build-appliance-image: Update to head revision

(From OE-Core rev: b2d96a966215d90bd2514e2bbe8deabe9eaabea1)

Signed-off-by: Richard Purdie <richard.purdie@linuxfoundation.org>

.gitignore

@@ -1,39 +1,23 @@
 *.pyc
 *.pyo
 /*.patch
-/.repo/
-/build*/
+build*/
 pyshtables.py
 pstage/
 scripts/oe-git-proxy-socks
 sources/
 meta-*/
-buildtools/
 !meta-skeleton
-!meta-selftest
+!meta-hob
 hob-image-*.bb
 *.swp
 *.orig
 *.rej
 *~
-!meta-poky
 !meta-yocto
 !meta-yocto-bsp
-!meta-yocto-imported
-/documentation/*/eclipse/
-/documentation/*/*.html
-/documentation/*/*.pdf
-/documentation/*/*.tgz
-/bitbake/doc/bitbake-user-manual/bitbake-user-manual.html
-/bitbake/doc/bitbake-user-manual/bitbake-user-manual.pdf
-/bitbake/doc/bitbake-user-manual/bitbake-user-manual.tgz
+bitbake/doc/manual/html/
+bitbake/doc/manual/pdf/
+bitbake/doc/manual/txt/
+bitbake/doc/manual/xhtml/
 pull-*/
-bitbake/lib/toaster/contrib/tts/backlog.txt
-bitbake/lib/toaster/contrib/tts/log/*
-bitbake/lib/toaster/contrib/tts/.cache/*
-bitbake/lib/bb/tests/runqueue-tests/bitbake-cookerdaemon.log
-_toaster_clones/
-downloads/
-sstate-cache/
-toaster.sqlite
-.vscode/

LICENSE

@@ -0,0 +1,14 @@
+Different components of Poky are under different licenses (a mix of 
+MIT and GPLv2). Please see:
+
+bitbake/COPYING (GPLv2)
+meta/COPYING.MIT (MIT)
+meta-extras/COPYING.MIT (MIT)
+
+which cover the components in those subdirectories. This means all 
+metadata is MIT licensed unless otherwise stated. Source code included 
+in tree for individual recipes is under the LICENSE stated in the .bb 
+file for those software projects unless otherwise stated.
+
+License information for any other files is either explicitly stated 
+or defaults to GPL version 2.

README

@@ -1,114 +1,49 @@
-The poky repository master branch is no longer being updated.
+Poky
+====
 
-You can either:
+Poky is an integration of various components to form a complete prepackaged
+build system and development environment. It features support for building
+customised embedded device style images. There are reference demo images
+featuring a X11/Matchbox/GTK themed UI called Sato. The system supports
+cross-architecture application development using QEMU emulation and a
+standalone toolchain and SDK with IDE integration.
 
-a) switch to individual clones of bitbake, openembedded-core, meta-yocto and yocto-docs
+Additional information on the specifics of hardware that Poky supports
+is available in README.hardware. Further hardware support can easily be added
+in the form of layers which extend the systems capabilities in a modular way.
 
-   https://docs.yoctoproject.org/dev/dev-manual/poky-manual-setup.html
+As an integration layer Poky consists of several upstream projects such as 
+BitBake, OpenEmbedded-Core, Yocto documentation and various sources of information 
+e.g. for the hardware support. Poky is in turn a component of the Yocto Project.
 
-b) use the new bitbake-setup
+The Yocto Project has extensive documentation about the system including a 
+reference manual which can be found at:
+    http://yoctoproject.org/documentation
 
-     https://docs.yoctoproject.org/bitbake/dev/bitbake-user-manual/bitbake-user-manual-environment-setup.html
+OpenEmbedded-Core is a layer containing the core metadata for current versions
+of OpenEmbedded. It is distro-less (can build a functional image with
+DISTRO = "") and contains only emulated machine support.
 
-You can find more information in our documentation: https://docs.yoctoproject.org/
+For information about OpenEmbedded, see the OpenEmbedded website:
+    http://www.openembedded.org/
 
-Note that "poky" the distro setting is still available in meta-yocto as
-before and we continue to use and maintain that.
+Where to Send Patches
+=====================
 
-Long live Poky!
+As Poky is an integration repository, patches against the various components
+should be sent to their respective upstreams.
 
+bitbake:
+    bitbake-devel@lists.openembedded.org
 
+meta-yocto:
+    poky@yoctoproject.org
 
+Most everything else should be sent to the OpenEmbedded Core mailing list.  If
+in doubt, check the oe-core git repository for the content you intend to modify.
+Before sending, be sure the patches apply cleanly to the current oe-core git
+repository.
+    openembedded-core@lists.openembedded.org
 
-Some further information on the background of this change follows. The 
-details are taken from:
-https://lists.openembedded.org/g/openembedded-architecture/message/2179
-
-TLDR: People have complained about the combo-layer built poky
-repository for years. It was meant to be a temporary thing, we now have
-an alternative and I'm therefore doing what I promised I'd do. Change
-is tough, things may break but this is the right point to at least try
-it.
-
-I'd like to note that:
-  * setting up builds with a separate oe-core and bitbake clone 
-    works as it always has done
-  * you can change your CI just to use those two repos instead of poky
-  * bitbake-setup isn't mandatory, it will just be what the yocto-
-    docs presents to users
-  * we don't have to stop maintaining the poky repository 
-    however nobody will test the new approach/code unless we do
-  * we are optionally exposing sstate mirrors in the new config
-  * we are also exposing config fragments to users
-  * poky as a DISTRO in meta-yocto remains
-
-A bit more about the history and background for those who are
-interested and then some FAQs:
-
-Back around 2010 when we split up openembedded-classic and started
-developing layers, we made the artificial "poky" repository construct
-as a way to let people easily and quickly get started with the project.
-without cloning and managing multiple repositories. Layers were a new
-idea with lots of rough edges. kas didn't exist, I think repo was only
-just created and it was a different world. For us, it meant hacking up
-a quick tool, "combo-layer" and it was really a temporary solution to
-fill a gap and it was at least as functional as repo of the era. It was
-assumed we'd work it out properly in the future.
-
-At developer meetings there are inevitable questions about why
-poky/combo-layer exist and few seem to actually like/support it. There
-are continual questions about why a tool doesn't exist or why we don't
-adopt one too.
-
-15 years later, a bit longer than we might have thought, we are finally
-in a position where there may be a viable way forward to change.
-
-It has taken us a bit of time to get to this point. I wrote the
-original description of something like bitbake-setup about 7-8 years
-ago. I shared it privately with a few people, the review feedback
-stopped me pushing it further as I simply did not have the bandwidth.
-We were fortunate to get funding from the Sovereign Tech Fund to start
-the work and whilst I'd probably prefer to avoid the issue, the time
-had come to start. Since then, Alexander Kanavin has put a lot of work
-into getting it to the point where it would be possible to switch. A
-huge thanks to him for getting this to the current point.
-
-Why not use kas/submodules/repo?
-
-This topic has been discussed in depth several times. Very roughly,
-these are either difficult to focus on our use cases or have specific
-designs and intent which we as a project would struggle to influence.
-We are taking significant influence from some of them but also trying
-to build something where we can benefit from tight direct integration
-with bitbake and the metadata. For example fragment support is generic
-and hopefully something other approaches can also benefit from. We want
-to provide something we can switch the projects docs and autobuilder to
-which we can control and develop as we need it to. We are not aiming to
-force anyone to switch, you can use whichever tool you want.
-
-Can we not keep poky [repository master branch] around?
-
-If we do that, nobody will use the new tooling and it will be a
-disaster as issues won't get resolved. We need our CI to use the same
-thing we promote to our new and experienced users. We need this new
-tooling to be usable by our experienced developers too. We have tried
-for months to get people to try it and they simply don't. Making a
-release with it won't change much either. It needs people using it and
-for that, poky has to stop being updated.
-
-What happens to poky [repository]?
-
-The LTS branches continue their lifetime as planned. For master, I'll
-probably put a final commit in changing to just a README which points
-people at the bitbake-setup changes and explains what happened.
-
-What are the timelines? Why now?
-
-If we're going to make a change, we really want this in the next LTS
-release, which is April 2026. We only have one release before that
-which is now, October 2025. We therefore need to switch now, and then
-give us time to update docs, fix issues that arise and so on and have
-it in a release cycle. Whilst it means delaying the Oct 2025 release
-slightly, that is the right thing to do in the context of the bigger
-picture.
-
+Note: The scripts directory should be treated with extra care as it is a mix
+      of oe-core and poky-specific files.

README.hardware

@@ -0,0 +1,476 @@
+                          Poky Hardware README
+                          ====================
+
+This file gives details about using Poky with the reference machines
+supported out of the box. A full list of supported reference target machines
+can be found by looking in the following directories:
+
+   meta/conf/machine/
+   meta-yocto-bsp/conf/machine/
+
+If you are in doubt about using Poky/OpenEmbedded with your hardware, consult
+the documentation for your board/device.
+
+Support for additional devices is normally added by creating BSP layers - for
+more information please see the Yocto Board Support Package (BSP) Developer's
+Guide - documentation source is in documentation/bspguide or download the PDF
+from:
+
+   http://yoctoproject.org/documentation
+
+Support for physical reference hardware has now been split out into a
+meta-yocto-bsp layer which can be removed separately from other layers if not
+needed.
+
+
+QEMU Emulation Targets
+======================
+
+To simplify development, the build system supports building images to
+work with the QEMU emulator in system emulation mode. Several architectures
+are currently supported:
+
+  * ARM (qemuarm)
+  * x86 (qemux86)
+  * x86-64 (qemux86-64)
+  * PowerPC (qemuppc)
+  * MIPS (qemumips)
+
+Use of the QEMU images is covered in the Yocto Project Reference Manual.
+The appropriate MACHINE variable value corresponding to the target is given
+in brackets.
+
+
+Hardware Reference Boards
+=========================
+
+The following boards are supported by the meta-yocto-bsp layer:
+
+  * Texas Instruments Beagleboard (beagleboard)
+  * Freescale MPC8315E-RDB (mpc8315e-rdb)
+  * Ubiquiti Networks RouterStation Pro (routerstationpro)
+
+For more information see the board's section below. The appropriate MACHINE
+variable value corresponding to the board is given in brackets.
+
+
+Consumer Devices
+================
+
+The following consumer devices are supported by the meta-yocto-bsp layer:
+
+  * Intel Atom based PCs and devices (atom-pc)
+
+For more information see the device's section below. The appropriate MACHINE
+variable value corresponding to the device is given in brackets.
+
+
+
+                      Specific Hardware Documentation
+                      ===============================
+
+
+Intel Atom based PCs and devices (atom-pc)
+==========================================
+
+The atom-pc MACHINE is tested on the following platforms:
+
+  o Asus EeePC 901
+  o Acer Aspire One
+  o Toshiba NB305
+  o Intel Embedded Development Board 1-N450 (Black Sand)
+
+and is likely to work on many unlisted Atom based devices. The MACHINE type
+supports ethernet, wifi, sound, and i915 graphics by default in addition to
+common PC input devices, busses, and so on.
+
+Depending on the device, it can boot from a traditional hard-disk, a USB device,
+or over the network. Writing generated images to physical media is
+straightforward with a caveat for USB devices. The following examples assume the
+target boot device is /dev/sdb, be sure to verify this and use the correct
+device as the following commands are run as root and are not reversable.
+
+USB Device:
+  1. Build a live image. This image type consists of a simple filesystem
+     without a partition table, which is suitable for USB keys, and with the
+     default setup for the atom-pc machine, this image type is built
+     automatically for any image you build. For example:
+
+     $ bitbake core-image-minimal
+
+  2. Use the "dd" utility to write the image to the raw block device. For
+     example:
+
+     # dd if=core-image-minimal-atom-pc.hddimg of=/dev/sdb
+
+  If the device fails to boot with "Boot error" displayed, or apparently
+  stops just after the SYSLINUX version banner, it is likely the BIOS cannot
+  understand the physical layout of the disk (or rather it expects a
+  particular layout and cannot handle anything else). There are two possible
+  solutions to this problem:
+
+  1. Change the BIOS USB Device setting to HDD mode. The label will vary by
+     device, but the idea is to force BIOS to read the Cylinder/Head/Sector
+     geometry from the device.
+
+  2. Without such an option, the BIOS generally boots the device in USB-ZIP
+     mode. To write an image to a USB device that will be bootable in
+     USB-ZIP mode, carry out the following actions:
+
+     a. Determine the geometry of your USB device using fdisk:
+
+     # fdisk /dev/sdb
+     Command (m for help): p
+
+     Disk /dev/sdb: 4011 MB, 4011491328 bytes
+     124 heads, 62 sectors/track, 1019 cylinders, total 7834944 sectors
+     ...
+
+     Command (m for help): q
+
+     b. Configure the USB device for USB-ZIP mode:
+     
+     # mkdiskimage -4 /dev/sdb 1019 124 62
+
+     Where 1019, 124 and 62 are the cylinder, head and sectors/track counts
+     as reported by fdisk (substitute the values reported for your device).
+     When the operation has finished and the access LED (if any) on the
+     device stops flashing, remove and reinsert the device to allow the
+     kernel to detect the new partition layout.
+
+     c. Copy the contents of the image to the USB-ZIP mode device:
+
+     # mkdir /tmp/image
+     # mkdir /tmp/usbkey
+     # mount -o loop core-image-minimal-atom-pc.hddimg  /tmp/image
+     # mount /dev/sdb4 /tmp/usbkey
+     # cp -rf /tmp/image/* /tmp/usbkey
+
+     d. Install the syslinux boot loader:
+
+     # syslinux /dev/sdb4
+
+     e. Unmount everything:
+
+     # umount /tmp/image
+     # umount /tmp/usbkey
+
+  Install the boot device in the target board and configure the BIOS to boot
+  from it.
+
+  For more details on the USB-ZIP scenario, see the syslinux documentation:
+  http://git.kernel.org/?p=boot/syslinux/syslinux.git;a=blob_plain;f=doc/usbkey.txt;hb=HEAD
+
+
+Texas Instruments Beagleboard (beagleboard)
+===========================================
+
+The Beagleboard is an ARM Cortex-A8 development board with USB, DVI-D, S-Video,
+2D/3D accelerated graphics, audio, serial, JTAG, and SD/MMC. The xM adds a
+faster CPU, more RAM, an ethernet port, more USB ports, microSD, and removes
+the NAND flash. The beagleboard MACHINE is tested on the following platforms:
+
+  o Beagleboard C4
+  o Beagleboard xM rev A & B
+
+The Beagleboard C4 has NAND, while the xM does not. For the sake of simplicity,
+these instructions assume you have erased the NAND on the C4 so its boot
+behavior matches that of the xM. To do this, issue the following commands from
+the u-boot prompt (note that the unlock may be unecessary depending on the
+version of u-boot installed on your board and only one of the erase commands
+will succeed):
+
+    # nand unlock
+    # nand erase
+    # nand erase.chip
+
+To further tailor these instructions for your board, please refer to the
+documentation at http://www.beagleboard.org.
+
+From a Linux system with access to the image files perform the following steps
+as root, replacing mmcblk0* with the SD card device on your machine (such as sdc
+if used via a usb card reader):
+
+  1. Partition and format an SD card:
+     # fdisk -lu /dev/mmcblk0
+     
+     Disk /dev/mmcblk0: 3951 MB, 3951034368 bytes
+     255 heads, 63 sectors/track, 480 cylinders, total 7716864 sectors
+     Units = sectors of 1 * 512 = 512 bytes
+     
+             Device Boot      Start         End      Blocks  Id System
+     /dev/mmcblk0p1   *          63      144584       72261   c Win95 FAT32 (LBA)
+     /dev/mmcblk0p2          144585      465884      160650  83 Linux
+
+     # mkfs.vfat -F 16 -n "boot" /dev/mmcblk0p1
+     # mke2fs -j -L "root" /dev/mmcblk0p2
+
+  The following assumes the SD card partition 1 and 2 are mounted at
+  /media/boot and /media/root respectively. Removing the card and reinserting
+  it will do just that on most modern Linux desktop environments.
+  
+  The files referenced below are made available after the build in
+  build/tmp/deploy/images.
+
+  2. Install the boot loaders
+     # cp MLO-beagleboard /media/boot/MLO
+     # cp u-boot-beagleboard.bin /media/boot/u-boot.bin
+
+  3. Install the root filesystem
+     # tar x -C /media/root -f core-image-$IMAGE_TYPE-beagleboard.tar.bz2
+     # tar x -C /media/root -f modules-$KERNEL_VERSION-beagleboard.tgz
+
+  4. Install the kernel uImage
+     # cp uImage-beagleboard.bin /media/boot/uImage
+
+  5. Prepare a u-boot script to simplify the boot process
+     The Beagleboard can be made to boot at this point from the u-boot command
+     shell. To automate this process, generate a user.scr script as follows.
+
+     Install uboot-mkimage (from uboot-mkimage on Ubuntu or uboot-tools on Fedora).
+
+     Prepare a script config:
+
+     # (cat << EOF
+     setenv bootcmd 'mmc init; fatload mmc 0:1 0x80300000 uImage; bootm 0x80300000'
+     setenv bootargs 'console=tty0 console=ttyO2,115200n8 root=/dev/mmcblk0p2 rootwait rootfstype=ext3 ro'
+     boot
+     EOF
+     ) > serial-boot.cmd
+     # mkimage -A arm -O linux -T script -C none -a 0 -e 0 -n "Core Minimal" -d ./serial-boot.cmd ./boot.scr
+     # cp boot.scr /media/boot
+
+   6. Unmount the SD partitions, insert the SD card into the Beagleboard, and
+      boot the Beagleboard
+
+Note: As of the 2.6.37 linux-yocto kernel recipe, the Beagleboard uses the
+      OMAP_SERIAL device (ttyO2). If you are using an older kernel, such as the
+      2.6.34 linux-yocto-stable, be sure to replace ttyO2 with ttyS2 above. You
+      should also override the machine SERIAL_CONSOLE in your local.conf in
+      order to setup the getty on the serial line:
+
+      SERIAL_CONSOLE_beagleboard = "115200 ttyS2"
+
+
+Freescale MPC8315E-RDB (mpc8315e-rdb)
+=====================================
+
+The MPC8315 PowerPC reference platform (MPC8315E-RDB) is aimed at hardware and
+software development of network attached storage (NAS) and digital media server
+applications. The MPC8315E-RDB features the PowerQUICC II Pro processor, which
+includes a built-in security accelerator.
+
+(Note: you may find it easier to order MPC8315E-RDBA; this appears to be the
+same board in an enclosure with accessories. In any case it is fully
+compatible with the instructions given here.)
+
+Setup instructions
+------------------
+
+You will need the following:
+* NFS root setup on your workstation
+* TFTP server installed on your workstation
+* Straight-thru 9-conductor serial cable (DB9, M/F) connected from your 
+  PC to UART1
+* Ethernet connected to the first ethernet port on the board
+
+--- Preparation ---
+
+Note: if you have altered your board's ethernet MAC address(es) from the
+defaults, or you need to do so because you want multiple boards on the same
+network, then you will need to change the values in the dts file (patch
+linux/arch/powerpc/boot/dts/mpc8315erdb.dts within the kernel source). If
+you have left them at the factory default then you shouldn't need to do
+anything here.
+
+--- Booting from NFS root ---
+
+Load the kernel and dtb (device tree blob), and boot the system as follows:
+
+ 1. Get the kernel (uImage-mpc8315e-rdb.bin) and dtb (uImage-mpc8315e-rdb.dtb)
+    files from the tmp/deploy directory, and make them available on your TFTP
+    server.
+
+ 2. Connect the board's first serial port to your workstation and then start up
+    your favourite serial terminal so that you will be able to interact with
+    the serial console. If you don't have a favourite, picocom is suggested:
+
+  $ picocom /dev/ttyUSB0 -b 115200
+
+ 3. Power up or reset the board and press a key on the terminal when prompted
+    to get to the U-Boot command line
+
+ 4. Set up the environment in U-Boot:
+
+ => setenv ipaddr <board ip>
+ => setenv serverip <tftp server ip>
+ => setenv bootargs root=/dev/nfs rw nfsroot=<nfsroot ip>:<rootfs path> ip=<board ip>:<server ip>:<gateway ip>:255.255.255.0:mpc8315e:eth0:off console=ttyS0,115200
+
+ 5. Download the kernel and dtb, and boot:
+
+ => tftp 1000000 uImage-mpc8315e-rdb.bin
+ => tftp 2000000 uImage-mpc8315e-rdb.dtb
+ => bootm 1000000 - 2000000
+
+
+Ubiquiti Networks RouterStation Pro (routerstationpro)
+======================================================
+
+The RouterStation Pro is an Atheros AR7161 MIPS-based board. Geared towards
+networking applications, it has all of the usual features as well as three
+type IIIA mini-PCI slots and an on-board 3-port 10/100/1000 Ethernet switch,
+in addition to the 10/100/1000 Ethernet WAN port which supports
+Power-over-Ethernet.
+
+Setup instructions
+------------------
+
+You will need the following:
+* A serial cable - female to female (or female to male + gender changer)
+  NOTE: cable must be straight through, *not* a null modem cable.
+* USB flash drive or hard disk that is able to be powered from the
+  board's USB port.
+* tftp server installed on your workstation
+
+NOTE: in the following instructions it is assumed that /dev/sdb corresponds
+to the USB disk when it is plugged into your workstation. If this is not the
+case in your setup then please be careful to substitute the correct device
+name in all commands where appropriate.
+
+--- Preparation ---
+
+1) Build an image (e.g. core-image-minimal) using "routerstationpro" as the
+MACHINE
+
+2) Partition the USB drive so that primary partition 1 is type Linux (83).
+Minimum size depends on your root image size - core-image-minimal probably
+only needs 8-16MB, other images will need more.
+
+  # fdisk /dev/sdb
+  Command (m for help): p
+
+  Disk /dev/sdb: 4011 MB, 4011491328 bytes
+  124 heads, 62 sectors/track, 1019 cylinders, total 7834944 sectors
+  Units = sectors of 1 * 512 = 512 bytes
+  Sector size (logical/physical): 512 bytes / 512 bytes
+  I/O size (minimum/optimal): 512 bytes / 512 bytes
+  Disk identifier: 0x0009e87d
+
+     Device Boot      Start         End      Blocks   Id  System
+  /dev/sdb1              62     1952751      976345   83  Linux
+
+3) Format partition 1 on the USB as ext3
+
+  # mke2fs -j /dev/sdb1
+
+4) Mount partition 1 and then extract the contents of
+tmp/deploy/images/core-image-XXXX.tar.bz2 into it (preserving permissions).
+
+  # mount /dev/sdb1 /media/sdb1
+  # cd /media/sdb1
+  # tar -xvjpf tmp/deploy/images/core-image-XXXX.tar.bz2
+
+5) Unmount the USB drive and then plug it into the board's USB port
+
+6) Connect the board's serial port to your workstation and then start up
+your favourite serial terminal so that you will be able to interact with
+the serial console. If you don't have a favourite, picocom is suggested:
+
+  $ picocom /dev/ttyUSB0 -b 115200
+
+7) Connect the network into eth0 (the one that is NOT the 3 port switch). If
+you are using power-over-ethernet then the board will power up at this point.
+
+8) Start up the board, watch the serial console. Hit Ctrl+C to abort the
+autostart if the board is configured that way (it is by default). The
+bootloader's fconfig command can be used to disable autostart and configure
+the IP settings if you need to change them (default IP is 192.168.1.20).
+
+9) Make the kernel (tmp/deploy/images/vmlinux-routerstationpro.bin) available
+on the tftp server.
+
+10) If you are going to write the kernel to flash (optional - see "Booting a
+kernel directly" below for the alternative), remove the current kernel and
+rootfs flash partitions. You can list the partitions using the following
+bootloader command:
+
+  RedBoot> fis list
+
+You can delete the existing kernel and rootfs with these commands:
+
+  RedBoot> fis delete kernel
+  RedBoot> fis delete rootfs
+
+--- Booting a kernel directly ---
+
+1) Load the kernel using the following bootloader command:
+
+  RedBoot> load -m tftp -h <ip of tftp server> vmlinux-routerstationpro.bin
+
+You should see a message on it being successfully loaded.
+
+2) Execute the kernel:
+
+  RedBoot> exec -c "console=ttyS0,115200 root=/dev/sda1 rw rootdelay=2 board=UBNT-RSPRO"
+
+Note that specifying the command line with -c is important as linux-yocto does
+not provide a default command line.
+
+--- Writing a kernel to flash ---
+
+1) Go to your tftp server and gzip the kernel you want in flash. It should
+halve the size.
+
+2) Load the kernel using the following bootloader command:
+
+  RedBoot> load -r -b 0x80600000 -m tftp -h <ip of tftp server> vmlinux-routerstationpro.bin.gz
+
+This should output something similar to the following:
+
+  Raw file loaded 0x80600000-0x8087c537, assumed entry at 0x80600000
+
+Calculate the length by subtracting the first number from the second number
+and then rounding the result up to the nearest 0x1000.
+
+3) Using the length calculated above, create a flash partition for the kernel:
+
+  RedBoot> fis create -b 0x80600000 -l 0x240000 kernel
+
+(change 0x240000 to your rounded length -- change "kernel" to whatever
+you want to name your kernel)
+
+--- Booting a kernel from flash ---
+
+To boot the flashed kernel perform the following steps.
+
+1) At the bootloader prompt, load the kernel:
+
+  RedBoot> fis load -d -e kernel
+
+(Change the name "kernel" above if you chose something different earlier)
+
+(-e means 'elf', -d 'decompress')
+
+2) Execute the kernel using the exec command as above.
+
+--- Automating the boot process ---
+
+After writing the kernel to flash and testing the load and exec commands
+manually, you can automate the boot process with a boot script.
+
+1) RedBoot> fconfig
+   (Answer the questions not specified here as they pertain to your environment)
+2) Run script at boot: true
+  Boot script: 
+  .. fis load -d -e kernel
+  .. exec
+  Enter script, terminate with empty line
+  >> fis load -d -e kernel
+  >> exec -c "console=ttyS0,115200 root=/dev/sda1 rw rootdelay=2 board=UBNT-RSPRO"
+  >> 
+3) Answer the remaining questions and write the changes to flash:
+  Update RedBoot non-volatile configuration - continue (y/n)? y
+  ... Erase from 0xbfff0000-0xc0000000: .
+  ... Program from 0x87ff0000-0x88000000 at 0xbfff0000: .
+4) Power cycle the board.
+

bitbake/AUTHORS

@@ -0,0 +1,10 @@
+Tim Ansell <mithro@mithis.net>
+Phil Blundell <pb@handhelds.org>
+Seb Frankengul <seb@frankengul.org>
+Holger Freyther <holger@moiji-mobile.com>
+Marcin Juszkiewicz <marcin@juszkiewicz.com.pl>
+Chris Larson <kergoth@handhelds.org>
+Ulrich Luckas <luckas@musoft.de>
+Mickey Lauer <mickey@Vanille.de>
+Richard Purdie <rpurdie@rpsys.net>
+Holger Schurig <holgerschurig@gmx.de>

bitbake/COPYING

@@ -0,0 +1,339 @@
+		    GNU GENERAL PUBLIC LICENSE
+		       Version 2, June 1991
+
+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.,
+ 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+			    Preamble
+
+  The licenses for most software are designed to take away your
+freedom to share and change it.  By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users.  This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it.  (Some other Free Software Foundation software is covered by
+the GNU Lesser General Public License instead.)  You can apply it to
+your programs, too.
+
+  When we speak of free software, we are referring to freedom, not
+price.  Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+
+  To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+  For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have.  You must make sure that they, too, receive or can get the
+source code.  And you must show them these terms so they know their
+rights.
+
+  We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+  Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software.  If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+  Finally, any free program is threatened constantly by software
+patents.  We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary.  To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.
+
+		    GNU GENERAL PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License.  The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language.  (Hereinafter, translation is included without limitation in
+the term "modification".)  Each licensee is addressed as "you".
+
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope.  The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
+  1. You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
+  2. You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+    a) You must cause the modified files to carry prominent notices
+    stating that you changed the files and the date of any change.
+
+    b) You must cause any work that you distribute or publish, that in
+    whole or in part contains or is derived from the Program or any
+    part thereof, to be licensed as a whole at no charge to all third
+    parties under the terms of this License.
+
+    c) If the modified program normally reads commands interactively
+    when run, you must cause it, when started running for such
+    interactive use in the most ordinary way, to print or display an
+    announcement including an appropriate copyright notice and a
+    notice that there is no warranty (or else, saying that you provide
+    a warranty) and that users may redistribute the program under
+    these conditions, and telling the user how to view a copy of this
+    License.  (Exception: if the Program itself is interactive but
+    does not normally print such an announcement, your work based on
+    the Program is not required to print an announcement.)
+
+These requirements apply to the modified work as a whole.  If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works.  But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+  3. You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
+    a) Accompany it with the complete corresponding machine-readable
+    source code, which must be distributed under the terms of Sections
+    1 and 2 above on a medium customarily used for software interchange; or,
+
+    b) Accompany it with a written offer, valid for at least three
+    years, to give any third party, for a charge no more than your
+    cost of physically performing source distribution, a complete
+    machine-readable copy of the corresponding source code, to be
+    distributed under the terms of Sections 1 and 2 above on a medium
+    customarily used for software interchange; or,
+
+    c) Accompany it with the information you received as to the offer
+    to distribute corresponding source code.  (This alternative is
+    allowed only for noncommercial distribution and only if you
+    received the program in object code or executable form with such
+    an offer, in accord with Subsection b above.)
+
+The source code for a work means the preferred form of the work for
+making modifications to it.  For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable.  However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+  4. You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License.  Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
+  5. You are not required to accept this License, since you have not
+signed it.  However, nothing else grants you permission to modify or
+distribute the Program or its derivative works.  These actions are
+prohibited by law if you do not accept this License.  Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
+  6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions.  You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
+  7. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all.  For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices.  Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+  8. If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded.  In such case, this License incorporates
+the limitation as if written in the body of this License.
+
+  9. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time.  Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number.  If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation.  If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
+  10. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission.  For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this.  Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+			    NO WARRANTY
+
+  11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+  12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
+
+		     END OF TERMS AND CONDITIONS
+
+	    How to Apply These Terms to Your New Programs
+
+  If you develop a new program, and you want it to be of the greatest
+possible use to the public, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these terms.
+
+  To do so, attach the following notices to the program.  It is safest
+to attach them to the start of each source file to most effectively
+convey the exclusion of warranty; and each file should have at least
+the "copyright" line and a pointer to where the full notice is found.
+
+    <one line to give the program's name and a brief idea of what it does.>
+    Copyright (C) <year>  <name of author>
+
+    This program is free software; you can redistribute it and/or modify
+    it under the terms of the GNU General Public License as published by
+    the Free Software Foundation; either version 2 of the License, or
+    (at your option) any later version.
+
+    This program is distributed in the hope that it will be useful,
+    but WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+    GNU General Public License for more details.
+
+    You should have received a copy of the GNU General Public License along
+    with this program; if not, write to the Free Software Foundation, Inc.,
+    51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+Also add information on how to contact you by electronic and paper mail.
+
+If the program is interactive, make it output a short notice like this
+when it starts in an interactive mode:
+
+    Gnomovision version 69, Copyright (C) year name of author
+    Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
+    This is free software, and you are welcome to redistribute it
+    under certain conditions; type `show c' for details.
+
+The hypothetical commands `show w' and `show c' should show the appropriate
+parts of the General Public License.  Of course, the commands you use may
+be called something other than `show w' and `show c'; they could even be
+mouse-clicks or menu items--whatever suits your program.
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the program, if
+necessary.  Here is a sample; alter the names:
+
+  Yoyodyne, Inc., hereby disclaims all copyright interest in the program
+  `Gnomovision' (which makes passes at compilers) written by James Hacker.
+
+  <signature of Ty Coon>, 1 April 1989
+  Ty Coon, President of Vice
+
+This General Public License does not permit incorporating your program into
+proprietary programs.  If your program is a subroutine library, you may
+consider it more useful to permit linking proprietary applications with the
+library.  If this is what you want to do, use the GNU Lesser General
+Public License instead of this License.

bitbake/ChangeLog

@@ -0,0 +1,317 @@
+Changes in Bitbake 1.9.x:
+	- Add PE (Package Epoch) support from Philipp Zabel (pH5)
+	- Treat python functions the same as shell functions for logging
+	- Use TMPDIR/anonfunc as a __anonfunc temp directory (T)
+	- Catch truncated cache file errors
+	- Allow operations other than assignment on flag variables
+	- Add code to handle inter-task dependencies
+	- Fix cache errors when generation dotGraphs
+	- Make sure __inherit_cache is updated before calling include() (from Michael Krelin)
+	- Fix bug when target was in ASSUME_PROVIDED (#2236)
+	- Raise ParseError for filenames with multiple underscores instead of infinitely looping (#2062)
+	- Fix invalid regexp in BBMASK error handling (missing import) (#1124)
+	- Promote certain warnings from debug to note 2 level
+	- Update manual
+	- Correctly redirect stdin when forking
+	- If parsing errors are found, exit, too many users miss the errors
+	- Remove supriours PREFERRED_PROVIDER warnings
+	- svn fetcher: Add _buildsvncommand function
+	- Improve certain error messages
+	- Rewrite svn fetcher to make adding extra operations easier 
+	  as part of future SRCDATE="now" fixes
+	  (requires new FETCHCMD_svn definition in bitbake.conf)
+	- Change SVNDIR layout to be more unique (fixes #2644 and #2624)
+	- Add ConfigParsed Event after configuration parsing is complete
+	- Add SRCREV support for svn fetcher
+	- data.emit_var() - only call getVar if we need the variable
+	- Stop generating the A variable (seems to be legacy code)
+	- Make sure intertask depends get processed correcting in recursive depends
+	- Add pn-PN to overrides when evaluating PREFERRED_VERSION
+	- Improve the progress indicator by skipping tasks that have 
+	  already run before starting the build rather than during it
+	- Add profiling option (-P)
+	- Add BB_SRCREV_POLICY variable (clear or cache) to control SRCREV cache
+	- Add SRCREV_FORMAT support
+	- Fix local fetcher's localpath return values
+	- Apply OVERRIDES before performing immediate expansions
+	- Allow the -b -e option combination to take regular expressions
+	- Fix handling of variables with expansion in the name using _append/_prepend
+	  e.g. RRECOMMENDS_${PN}_append_xyz = "abc"
+	- Add plain message function to bb.msg
+	- Sort the list of providers before processing so dependency problems are 
+	  reproducible rather than effectively random
+	- Fix/improve bitbake -s output
+	- Add locking for fetchers so only one tries to fetch a given file at a given time
+	- Fix int(0)/None confusion in runqueue.py which causes random gaps in dependency chains	  
+	- Expand data in addtasks
+	- Print the list of missing DEPENDS,RDEPENDS for the "No buildable providers available for required...."
+	  error message.
+	- Rework add_task to be more efficient (6% speedup, 7% number of function calls reduction)
+	- Sort digraph output to make builds more reproducible
+	- Split expandKeys into two for loops to benefit from the expand_cache (12% speedup)
+	- runqueue.py: Fix idepends handling to avoid dependency errors
+	- Clear the terminal TOSTOP flag if set (and warn the user)
+	- Fix regression from r653 and make SRCDATE/CVSDATE work for packages again
+	- Fix a bug in bb.decodeurl where http://some.where.com/somefile.tgz decoded to host="" (#1530)
+	- Warn about malformed PREFERRED_PROVIDERS (#1072)
+	- Add support for BB_NICE_LEVEL option (#1627)
+	- Psyco is used only on x86 as there is no support for other architectures.
+	- Sort initial providers list by default preference (#1145, #2024)
+	- Improve provider sorting so prefered versions have preference over latest versions (#768)
+	- Detect builds of tasks with overlapping providers and warn (will become a fatal error) (#1359)
+	- Add MULTI_PROVIDER_WHITELIST variable to allow known safe multiple providers to be listed
+	- Handle paths in svn fetcher module parameter
+	- Support the syntax "export VARIABLE"
+	- Add bzr fetcher
+	- Add support for cleaning directories before a task in the form:
+	  do_taskname[cleandirs] = "dir"
+	- bzr fetcher tweaks from Robert Schuster (#2913)
+	- Add mercurial (hg) fetcher from Robert Schuster (#2913)
+	- Don't add duplicates to BBPATH
+	- Fix preferred_version return values (providers.py)
+	- Fix 'depends' flag splitting
+	- Fix unexport handling (#3135)
+	- Add bb.copyfile function similar to bb.movefile (and improve movefile error reporting)
+	- Allow multiple options for deptask flag
+	- Use git-fetch instead of git-pull removing any need for merges when 
+	  fetching (we don't care about the index). Fixes fetch errors.
+	- Add BB_GENERATE_MIRROR_TARBALLS option, set to 0 to make git fetches 
+	  faster at the expense of not creating mirror tarballs.
+	- SRCREV handling updates, improvements and fixes from Poky
+	- Add bb.utils.lockfile() and bb.utils.unlockfile() from Poky
+	- Add support for task selfstamp and lockfiles flags
+	- Disable task number acceleration since it can allow the tasks to run 
+	  out of sequence
+	- Improve runqueue code comments
+	- Add task scheduler abstraction and some example schedulers
+	- Improve circular dependency chain debugging code and user feedback
+	- Don't give a stacktrace for invalid tasks, have a user friendly message (#3431)
+	- Add support for "-e target" (#3432)
+	- Fix shell showdata command (#3259)
+	- Fix shell data updating problems (#1880)
+	- Properly raise errors for invalid source URI protocols
+	- Change the wget fetcher failure handling to avoid lockfile problems
+	- Add support for branches in git fetcher (Otavio Salvador, Michael Lauer)
+	- Make taskdata and runqueue errors more user friendly
+	- Add norecurse and fullpath options to cvs fetcher
+	- Fix exit code for build failures in --continue mode
+	- Fix git branch tags fetching
+	- Change parseConfigurationFile so it works on real data, not a copy
+	- Handle 'base' inherit and all other INHERITs from parseConfigurationFile 
+	  instead of BBHandler
+	- Fix getVarFlags bug in data_smart
+	- Optmise cache handling by more quickly detecting an invalid cache, only 
+	  saving the cache when its changed, moving the cache validity check into
+	  the parsing loop and factoring some getVar calls outside a for loop
+	- Cooker: Remove a debug message from the parsing loop to lower overhead
+	- Convert build.py exec_task to use getVarFlags
+	- Update shell to use cooker.buildFile
+	- Add StampUpdate event
+	- Convert -b option to use taskdata/runqueue
+	- Remove digraph and switch to new stamp checking code. exec_task no longer
+	  honours dependencies
+	- Make fetcher timestamp updating non-fatal when permissions don't allow 
+	  updates
+	- Add BB_SCHEDULER variable/option ("completion" or "speed") controlling
+	  the way bitbake schedules tasks
+	- Add BB_STAMP_POLICY variable/option ("perfile" or "full") controlling
+	  how extensively stamps are looked at for validity
+	- When handling build target failures make sure idepends are checked and
+	  failed where needed. Fixes --continue mode crashes.
+	- Fix -f (force) in conjunction with -b
+	- Fix problems with recrdeptask handling where some idepends weren't handled
+	  correctly.
+	- Handle exit codes correctly (from pH5)
+	- Work around refs/HEAD issues with git over http (#3410)
+	- Add proxy support to the CVS fetcher (from Cyril Chemparathy)
+	- Improve runfetchcmd so errors are seen and various GIT variables are exported
+	- Add ability to fetchers to check URL validity without downloading
+	- Improve runtime PREFERRED_PROVIDERS warning message
+	- Add BB_STAMP_WHITELIST option which contains a list of stamps to ignore when
+	  checking stamp dependencies and using a BB_STAMP_POLICY of "whitelist"
+	- No longer weight providers on the basis of a package being "already staged". This
+	  leads to builds being non-deterministic.
+	- Flush stdout/stderr before forking to fix duplicate console output
+	- Make sure recrdeps tasks include all inter-task dependencies of a given fn
+	- Add bb.runqueue.check_stamp_fn() for use by packaged-staging
+	- Add PERSISTENT_DIR to store the PersistData in a persistent
+	  directory != the cache dir.
+	- Add md5 and sha256 checksum generation functions to utils.py
+	- Correctly handle '-' characters in class names (#2958)
+	- Make sure expandKeys has been called on the data dictionary before running tasks
+	- Correctly add a task override in the form task-TASKNAME.
+	- Revert the '-' character fix in class names since it breaks things
+	- When a regexp fails to compile for PACKAGES_DYNAMIC, print a more useful error (#4444)
+	- Allow to checkout CVS by Date and Time. Just add HHmm to the SRCDATE.
+	- Move prunedir function to utils.py and add explode_dep_versions function
+	- Raise an exception if SRCREV == 'INVALID'
+	- Fix hg fetcher username/password handling and fix crash
+	- Fix PACKAGES_DYNAMIC handling of packages with '++' in the name
+	- Rename __depends to __base_depends after configuration parsing so we don't
+	  recheck the validity of the config files time after time
+	- Add better environmental variable handling. By default it will now only pass certain 
+	  whitelisted variables into the data store. If BB_PRESERVE_ENV is set bitbake will use
+	  all variable from the environment. If BB_ENV_WHITELIST is set, that whitelist will be
+	  used instead of the internal bitbake one. Alternatively, BB_ENV_EXTRAWHITE can be used
+	  to extend the internal whitelist.
+	- Perforce fetcher fix to use commandline options instead of being overriden by the environment
+	- bb.utils.prunedir can cope with symlinks to directoriees without exceptions
+	- use @rev when doing a svn checkout
+	- Add osc fetcher (from Joshua Lock in Poky)
+	- When SRCREV autorevisioning for a recipe is in use, don't cache the recipe
+	- Add tryaltconfigs option to control whether bitbake trys using alternative providers
+	  to fulfil failed dependencies. It defaults to off, changing the default since this
+	  behaviour confuses many users and isn't often useful.
+	- Improve lock file function error handling
+	- Add username handling to the git fetcher (Robert Bragg)
+	- Add support for HTTP_PROXY and HTTP_PROXY_IGNORE variables to the wget fetcher
+	- Export more variables to the fetcher commands to allow ssh checkouts and checkouts through 
+	  proxies to work better. (from Poky)
+	- Also allow user and pswd options in SRC_URIs globally (from Poky)
+	- Improve proxy handling when using mirrors (from Poky)
+	- Add bb.utils.prune_suffix function
+	- Fix hg checkouts of specific revisions (from Poky)
+	- Fix wget fetching of urls with parameters specified (from Poky)
+	- Add username handling to git fetcher (from Poky)
+	- Set HOME environmental variable when running fetcher commands (from Poky)
+	- Make sure allowed variables inherited from the environment are exported again (from Poky)
+	- When running a stage task in bbshell, run populate_staging, not the stage task (from Poky)
+	- Fix + character escaping from PACKAGES_DYNAMIC (thanks Otavio Salvador)
+	- Addition of BBCLASSEXTEND support for allowing one recipe to provide multiple targets (from Poky)
+
+Changes in Bitbake 1.8.0:
+	- Release 1.7.x as a stable series
+
+Changes in BitBake 1.7.x:
+	- Major updates of the dependency handling and execution
+	  of tasks. Code from bin/bitbake replaced with runqueue.py
+	  and taskdata.py
+	- New task execution code supports multithreading with a simplistic
+	  threading algorithm controlled by BB_NUMBER_THREADS
+	- Change of the SVN Fetcher to keep the checkout around
+	  courtsey of Paul Sokolovsky (#1367)
+	- PATH fix to bbimage (#1108)
+	- Allow debug domains to be specified on the commandline (-l)
+	- Allow 'interactive' tasks
+	- Logging message improvements
+	- Drop now uneeded BUILD_ALL_DEPS variable
+	- Add support for wildcards to -b option
+	- Major overhaul of the fetchers making a large amount of code common
+	  including mirroring code
+	- Fetchers now touch md5 stamps upon access (to show activity)
+	- Fix -f force option when used without -b (long standing bug)
+	- Add expand_cache to data_cache.py, caching expanded data (speedup)
+	- Allow version field in DEPENDS (ignored for now)
+	- Add abort flag support to the shell
+	- Make inherit fail if the class doesn't exist (#1478)
+	- Fix data.emit_env() to expand keynames as well as values
+	- Add ssh fetcher
+	- Add perforce fetcher
+	- Make PREFERRED_PROVIDER_foobar defaults to foobar if available
+	- Share the parser's mtime_cache, reducing the number of stat syscalls
+	- Compile all anonfuncs at once! 
+	  *** Anonfuncs must now use common spacing format ***
+	- Memorise the list of handlers in __BBHANDLERS and tasks in __BBTASKS
+	  This removes 2 million function calls resulting in a 5-10% speedup
+	- Add manpage
+	- Update generateDotGraph to use taskData/runQueue improving accuracy
+	  and also adding a task dependency graph
+	- Fix/standardise on GPLv2 licence
+	- Move most functionality from bin/bitbake to cooker.py and split into
+	  separate funcitons
+	- CVS fetcher: Added support for non-default port
+	- Add BBINCLUDELOGS_LINES, the number of lines to read from any logfile
+	- Drop shebangs from lib/bb scripts
+
+Changes in Bitbake 1.6.0:
+	- Better msg handling
+	- COW dict implementation from Tim Ansell (mithro) leading
+	  to better performance
+	- Speed up of -s
+
+Changes in Bitbake 1.4.4:
+	- SRCDATE now handling courtsey Justin Patrin
+	- #1017 fix to work with rm_work
+
+Changes in BitBake 1.4.2:
+	- Send logs to oe.pastebin.com instead of pastebin.com
+	  fixes #856
+	- Copy the internal bitbake data before building the
+	  dependency graph. This fixes nano not having a
+	  virtual/libc dependency
+	- Allow multiple TARBALL_STASH entries
+	- Cache, check if the directory exists before changing
+	  into it
+	- git speedup cloning by not doing a checkout
+	- allow to have spaces in filenames (.conf, .bb, .bbclass)
+
+Changes in BitBake 1.4.0:
+	- Fix to check both RDEPENDS and RDEPENDS_${PN}
+	- Fix a RDEPENDS parsing bug in utils:explode_deps()
+	- Update git fetcher behaviour to match git changes
+	- ASSUME_PROVIDED allowed to include runtime packages
+	- git fetcher cleanup and efficency improvements
+	- Change the format of the cache
+	- Update usermanual to document the Fetchers
+	- Major changes to caching with a new strategy
+	  giving a major performance increase when reparsing
+	  with few data changes
+
+Changes in BitBake 1.3.3:
+	- Create a new Fetcher module to ease the
+	  development of new Fetchers.
+	  Issue #438 fixed by rpurdie@openedhand.com
+	- Make the Subversion fetcher honor the SRC Date
+	  (CVSDATE).
+	  Issue #555 fixed by chris@openedhand.com
+	- Expand PREFERRED_PROVIDER properly
+	  Issue #436 fixed by rprudie@openedhand.com
+	- Typo fix for Issue #531 by Philipp Zabel for the
+	  BitBake Shell
+	- Introduce a new special variable SRCDATE as
+	  a generic naming to replace CVSDATE.
+	- Introduce a new keyword 'required'. In contrast
+	  to 'include' parsing will fail if a to be included
+	  file can not be found.
+	- Remove hardcoding of the STAMP directory. Patch
+	  courtsey pHilipp Zabel
+	- Track the RDEPENDS of each package (rpurdie@openedhand.com)
+	- Introduce BUILD_ALL_DEPS to build all RDEPENDS. E.g
+	  this is used by the OpenEmbedded Meta Packages.
+	  (rpurdie@openedhand.com).
+
+Changes in BitBake 1.3.2:
+	- reintegration of make.py into BitBake
+	- bbread is gone, use bitbake -e
+	- lots of shell updates and bugfixes
+	- Introduction of the .= and =. operator
+	- Sort variables, keys and groups in bitdoc
+	- Fix regression in the handling of BBCOLLECTIONS
+	- Update the bitbake usermanual
+
+Changes in BitBake 1.3.0:
+	- add bitbake interactive shell (bitbake -i)
+	- refactor bitbake utility in OO style
+	- kill default arguments in methods in the bb.data module
+	- kill default arguments in methods in the bb.fetch module
+	- the http/https/ftp fetcher will fail if the to be 
+	  downloaded file was not found in DL_DIR (this is needed
+	  to avoid unpacking the sourceforge mirror page)
+	- Switch to a cow like data instance for persistent and non
+	  persisting mode (called data_smart.py)
+	- Changed the callback of bb.make.collect_bbfiles to carry
+	  additional parameters
+	- Drastically reduced the amount of needed RAM by not holding
+	  each data instance in memory when using a cache/persistent
+	  storage
+
+Changes in BitBake 1.2.1:
+	The 1.2.1 release is meant as a intermediate release to lay the
+	ground for more radical changes. The most notable changes are:
+
+	- Do not hardcode {}, use bb.data.init() instead if you want to
+	  get a instance of a data class
+	- bb.data.init() is a factory and the old bb.data methods are delegates
+	- Do not use deepcopy use bb.data.createCopy() instead.
+	- Removed default arguments in bb.fetch
+

bitbake/HEADER

@@ -0,0 +1,19 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# <one line to give the program's name and a brief idea of what it does.>
+# Copyright (C) <year>  <name of author>
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+

bitbake/bin/bitbake

@@ -0,0 +1,281 @@
+#!/usr/bin/env python
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2003, 2004  Phil Blundell
+# Copyright (C) 2003 - 2005 Michael 'Mickey' Lauer
+# Copyright (C) 2005        Holger Hans Peter Freyther
+# Copyright (C) 2005        ROAD GmbH
+# Copyright (C) 2006        Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os
+import sys, logging
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)),
+                                'lib'))
+
+import optparse
+import warnings
+from traceback import format_exception
+try:
+    import bb
+except RuntimeError as exc:
+    sys.exit(str(exc))
+from bb import event
+import bb.msg
+from bb import cooker
+from bb import ui
+from bb import server
+
+__version__ = "1.18.0"
+logger = logging.getLogger("BitBake")
+
+# Unbuffer stdout to avoid log truncation in the event
+# of an unorderly exit as well as to provide timely
+# updates to log files for use with tail
+try:
+    if sys.stdout.name == '<stdout>':
+        sys.stdout = os.fdopen(sys.stdout.fileno(), 'w', 0)
+except:
+    pass
+
+class BBConfiguration(object):
+    """
+    Manages build options and configurations for one run
+    """
+
+    def __init__(self, options):
+        for key, val in options.__dict__.items():
+            setattr(self, key, val)
+        self.pkgs_to_build = []
+
+
+def get_ui(config):
+    if not config.ui:
+        # modify 'ui' attribute because it is also read by cooker
+        config.ui = os.environ.get('BITBAKE_UI', 'knotty')
+
+    interface = config.ui
+
+    try:
+        # Dynamically load the UI based on the ui name. Although we
+        # suggest a fixed set this allows you to have flexibility in which
+        # ones are available.
+        module = __import__("bb.ui", fromlist = [interface])
+        return getattr(module, interface).main
+    except AttributeError:
+        sys.exit("FATAL: Invalid user interface '%s' specified.\n"
+                 "Valid interfaces: depexp, goggle, ncurses, hob, knotty [default]." % interface)
+
+
+# Display bitbake/OE warnings via the BitBake.Warnings logger, ignoring others"""
+warnlog = logging.getLogger("BitBake.Warnings")
+_warnings_showwarning = warnings.showwarning
+def _showwarning(message, category, filename, lineno, file=None, line=None):
+    if file is not None:
+        if _warnings_showwarning is not None:
+            _warnings_showwarning(message, category, filename, lineno, file, line)
+    else:
+        s = warnings.formatwarning(message, category, filename, lineno)
+        warnlog.warn(s)
+
+warnings.showwarning = _showwarning
+warnings.filterwarnings("ignore")
+warnings.filterwarnings("default", module="(<string>$|(oe|bb)\.)")
+warnings.filterwarnings("ignore", category=PendingDeprecationWarning)
+warnings.filterwarnings("ignore", category=ImportWarning)
+warnings.filterwarnings("ignore", category=DeprecationWarning, module="<string>$")
+warnings.filterwarnings("ignore", message="With-statements now directly support multiple context managers")
+
+
+def main():
+    parser = optparse.OptionParser(
+        version = "BitBake Build Tool Core version %s, %%prog version %s" % (bb.__version__, __version__),
+        usage = """%prog [options] [package ...]
+
+Executes the specified task (default is 'build') for a given set of BitBake files.
+It expects that BBFILES is defined, which is a space separated list of files to
+be executed.  BBFILES does support wildcards.
+Default BBFILES are the .bb files in the current directory.""")
+
+    parser.add_option("-b", "--buildfile", help = "execute the task against this .bb file, rather than a package from BBFILES. Does not handle any dependencies.",
+               action = "store", dest = "buildfile", default = None)
+
+    parser.add_option("-k", "--continue", help = "continue as much as possible after an error. While the target that failed, and those that depend on it, cannot be remade, the other dependencies of these targets can be processed all the same.",
+               action = "store_false", dest = "abort", default = True)
+
+    parser.add_option("-a", "--tryaltconfigs", help = "continue with builds by trying to use alternative providers where possible.",
+               action = "store_true", dest = "tryaltconfigs", default = False)
+
+    parser.add_option("-f", "--force", help = "force run of specified cmd, regardless of stamp status",
+               action = "store_true", dest = "force", default = False)
+
+    parser.add_option("-c", "--cmd", help = "Specify task to execute. Note that this only executes the specified task for the providee and the packages it depends on, i.e. 'compile' does not implicitly call stage for the dependencies (IOW: use only if you know what you are doing). Depending on the base.bbclass a listtasks tasks is defined and will show available tasks",
+               action = "store", dest = "cmd")
+
+    parser.add_option("-C", "--clear-stamp", help = "Invalidate the stamp for the specified cmd such as 'compile' and run the default task for the specified target(s)",
+                action = "store", dest = "invalidate_stamp")
+
+    parser.add_option("-r", "--read", help = "read the specified file before bitbake.conf",
+               action = "append", dest = "prefile", default = [])
+
+    parser.add_option("-R", "--postread", help = "read the specified file after bitbake.conf",
+                      action = "append", dest = "postfile", default = [])
+
+    parser.add_option("-v", "--verbose", help = "output more chit-chat to the terminal",
+               action = "store_true", dest = "verbose", default = False)
+
+    parser.add_option("-D", "--debug", help = "Increase the debug level. You can specify this more than once.",
+               action = "count", dest="debug", default = 0)
+
+    parser.add_option("-n", "--dry-run", help = "don't execute, just go through the motions",
+               action = "store_true", dest = "dry_run", default = False)
+
+    parser.add_option("-S", "--dump-signatures", help = "don't execute, just dump out the signature construction information",
+               action = "store_true", dest = "dump_signatures", default = False)
+
+    parser.add_option("-p", "--parse-only", help = "quit after parsing the BB files (developers only)",
+               action = "store_true", dest = "parse_only", default = False)
+
+    parser.add_option("-s", "--show-versions", help = "show current and preferred versions of all recipes",
+               action = "store_true", dest = "show_versions", default = False)
+
+    parser.add_option("-e", "--environment", help = "show the global or per-package environment (this is what used to be bbread)",
+               action = "store_true", dest = "show_environment", default = False)
+
+    parser.add_option("-g", "--graphviz", help = "emit the dependency trees of the specified packages in the dot syntax, and the pn-buildlist to show the build list",
+                action = "store_true", dest = "dot_graph", default = False)
+
+    parser.add_option("-I", "--ignore-deps", help = """Assume these dependencies don't exist and are already provided (equivalent to ASSUME_PROVIDED). Useful to make dependency graphs more appealing""",
+                action = "append", dest = "extra_assume_provided", default = [])
+
+    parser.add_option("-l", "--log-domains", help = """Show debug logging for the specified logging domains""",
+                action = "append", dest = "debug_domains", default = [])
+
+    parser.add_option("-P", "--profile", help = "profile the command and print a report",
+               action = "store_true", dest = "profile", default = False)
+
+    parser.add_option("-u", "--ui", help = "userinterface to use",
+               action = "store", dest = "ui")
+
+    parser.add_option("-t", "--servertype", help = "Choose which server to use, none, process or xmlrpc",
+               action = "store", dest = "servertype")
+
+    parser.add_option("", "--revisions-changed", help = "Set the exit code depending on whether upstream floating revisions have changed or not",
+               action = "store_true", dest = "revisions_changed", default = False)
+
+    parser.add_option("", "--server-only", help = "Run bitbake without UI,  the frontend can connect with bitbake server itself",
+               action = "store_true", dest = "server_only", default = False)
+
+    parser.add_option("-B", "--bind", help = "The name/address for the bitbake server to bind to",
+               action = "store", dest = "bind", default = False)
+    parser.add_option("", "--no-setscene", help = "Do not run any setscene tasks, forces builds",
+               action = "store_true", dest = "nosetscene", default = False)
+    options, args = parser.parse_args(sys.argv)
+
+    configuration = BBConfiguration(options)
+    configuration.pkgs_to_build.extend(args[1:])
+
+    ui_main = get_ui(configuration)
+
+    # Server type can be xmlrpc, process or none currently, if nothing is specified,
+    # the default server is process
+    if configuration.servertype:
+        server_type = configuration.servertype
+    else:
+        server_type = 'process'
+
+    try:
+        module = __import__("bb.server", fromlist = [server_type])
+        server = getattr(module, server_type)
+    except AttributeError:
+        sys.exit("FATAL: Invalid server type '%s' specified.\n"
+                 "Valid interfaces: xmlrpc, process [default], none." % servertype)
+
+    if configuration.server_only:
+        if configuration.servertype != "xmlrpc":
+            sys.exit("FATAL: If '--server-only' is defined, we must set the servertype as 'xmlrpc'.\n")
+        if not configuration.bind:
+            sys.exit("FATAL: The '--server-only' option requires a name/address to bind to with the -B option.\n")
+
+    if configuration.bind and configuration.servertype != "xmlrpc":
+        sys.exit("FATAL: If '-B' or '--bind' is defined, we must set the servertype as 'xmlrpc'.\n")
+
+    if "BBDEBUG" in os.environ:
+        level = int(os.environ["BBDEBUG"])
+        if level > configuration.debug:
+            configuration.debug = level
+
+    bb.msg.init_msgconfig(configuration.verbose, configuration.debug,
+                         configuration.debug_domains)
+
+    # Ensure logging messages get sent to the UI as events
+    handler = bb.event.LogHandler()
+    logger.addHandler(handler)
+
+    # Before we start modifying the environment we should take a pristine
+    # copy for possible later use
+    initialenv = os.environ.copy()
+    # Clear away any spurious environment variables while we stoke up the cooker
+    cleanedvars = bb.utils.clean_environment()
+
+    server = server.BitBakeServer()
+    if configuration.bind:
+        server.initServer((configuration.bind, 0))
+    else:
+        server.initServer()
+
+    idle = server.getServerIdleCB()
+
+    cooker = bb.cooker.BBCooker(configuration, idle, initialenv)
+    cooker.parseCommandLine()
+
+    server.addcooker(cooker)
+    server.saveConnectionDetails()
+    server.detach()
+
+    # Should no longer need to ever reference cooker
+    del cooker
+
+    logger.removeHandler(handler)
+
+    if not configuration.server_only:
+        # Setup a connection to the server (cooker)
+        server_connection = server.establishConnection()
+
+        # Restore the environment in case the UI needs it
+        for k in cleanedvars:
+            os.environ[k] = cleanedvars[k]
+
+        try:
+            return server.launchUI(ui_main, server_connection.connection, server_connection.events)
+        finally:
+            bb.event.ui_queue = []
+            server_connection.terminate()
+    else:
+        print("server address: %s, server port: %s" % (server.serverinfo.host, server.serverinfo.port))
+
+    return 1
+
+if __name__ == "__main__":
+    try:
+        ret = main()
+    except Exception:
+        ret = 1
+        import traceback
+        traceback.print_exc(5)
+    sys.exit(ret)
+

bitbake/bin/bitbake-diffsigs

@@ -0,0 +1,102 @@
+#!/usr/bin/env python
+
+# bitbake-diffsigs
+# BitBake task signature data comparison utility
+#
+# Copyright (C) 2012 Intel Corporation
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os
+import sys
+import warnings
+import fnmatch
+import optparse
+import logging
+
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
+
+import bb.tinfoil
+import bb.siggen
+
+logger = logging.getLogger('BitBake')
+
+def find_compare_task(bbhandler, pn, taskname):
+    """ Find the most recent signature files for the specified PN/task and compare them """
+
+    if not hasattr(bb.siggen, 'find_siginfo'):
+        logger.error('Metadata does not support finding signature data files')
+        sys.exit(1)
+
+    filedates = bb.siggen.find_siginfo(pn, taskname, None, bbhandler.config_data)
+    latestfiles = sorted(filedates.keys(), key=lambda f: filedates[f])[-2:]
+    if not latestfiles:
+        logger.error('No sigdata files found matching %s %s' % (pn, taskname))
+        sys.exit(1)
+    elif len(latestfiles) < 2:
+        logger.error('Only one matching sigdata file found for the specified task (%s %s)' % (pn, taskname))
+        sys.exit(1)
+    else:
+        # Define recursion callback
+        def recursecb(key, hash1, hash2):
+            hashes = [hash1, hash2]
+            hashfiles = bb.siggen.find_siginfo(key, None, hashes, bbhandler.config_data)
+
+            recout = []
+            if len(hashfiles) == 2:
+                out2 = bb.siggen.compare_sigfiles(hashfiles[hash1], hashfiles[hash2], recursecb)
+                recout.extend(list('  ' + l for l in out2))
+            else:
+                recout.append("Unable to find matching sigdata for %s with hashes %s or %s" % (key, hash1, hash2))
+
+            return recout
+
+        # Recurse into signature comparison
+        output = bb.siggen.compare_sigfiles(latestfiles[0], latestfiles[1], recursecb)
+        if output:
+            print '\n'.join(output)
+    sys.exit(0)
+
+
+
+parser = optparse.OptionParser(
+    usage = """
+  %prog -t recipename taskname
+  %prog sigdatafile1 sigdatafile2
+  %prog sigdatafile1""")
+
+parser.add_option("-t", "--task",
+        help = "find the signature data files for last two runs of the specified task and compare them",
+        action="store_true", dest="taskmode")
+
+options, args = parser.parse_args(sys.argv)
+
+if len(args) == 1:
+    parser.print_help()
+else:
+    if options.taskmode:
+        tinfoil = bb.tinfoil.Tinfoil()
+        if len(args) < 3:
+            logger.error("Please specify a recipe and task name")
+            sys.exit(1)
+        tinfoil.prepare(config_only = True)
+        find_compare_task(tinfoil, args[1], args[2])
+    else:
+        if len(args) == 2:
+            output = bb.siggen.dump_sigfile(sys.argv[1])
+        else:
+            output = bb.siggen.compare_sigfiles(sys.argv[1], sys.argv[2])
+
+        if output:
+            print '\n'.join(output)

bitbake/bin/bitbake-dumpsig

@@ -0,0 +1,11 @@
+#!/usr/bin/env python
+import os
+import sys
+import warnings
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
+
+import bb.siggen
+
+output = bb.siggen.dump_sigfile(sys.argv[1])
+if output:
+    print '\n'.join(output)

bitbake/bin/bitbake-layers

@@ -0,0 +1,720 @@
+#!/usr/bin/env python
+
+# This script has subcommands which operate against your bitbake layers, either
+# displaying useful information, or acting against them.
+# See the help output for details on available commands.
+
+# Copyright (C) 2011 Mentor Graphics Corporation
+# Copyright (C) 2012 Intel Corporation
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import cmd
+import logging
+import os
+import sys
+import fnmatch
+from collections import defaultdict
+import re
+
+bindir = os.path.dirname(__file__)
+topdir = os.path.dirname(bindir)
+sys.path[0:0] = [os.path.join(topdir, 'lib')]
+
+import bb.cache
+import bb.cooker
+import bb.providers
+import bb.utils
+import bb.tinfoil
+
+
+logger = logging.getLogger('BitBake')
+
+
+def main(args):
+    cmds = Commands()
+    if args:
+        # Allow user to specify e.g. show-layers instead of show_layers
+        args = [args[0].replace('-', '_')] + args[1:]
+        cmds.onecmd(' '.join(args))
+    else:
+        cmds.do_help('')
+    return cmds.returncode
+
+
+class Commands(cmd.Cmd):
+    def __init__(self):
+        cmd.Cmd.__init__(self)
+        self.bbhandler = bb.tinfoil.Tinfoil()
+        self.returncode = 0
+        self.bblayers = (self.bbhandler.config_data.getVar('BBLAYERS', True) or "").split()
+
+    def default(self, line):
+        """Handle unrecognised commands"""
+        sys.stderr.write("Unrecognised command or option\n")
+        self.do_help('')
+
+    def do_help(self, topic):
+        """display general help or help on a specified command"""
+        if topic:
+            sys.stdout.write('%s: ' % topic)
+            cmd.Cmd.do_help(self, topic.replace('-', '_'))
+        else:
+            sys.stdout.write("usage: bitbake-layers <command> [arguments]\n\n")
+            sys.stdout.write("Available commands:\n")
+            procnames = list(set(self.get_names()))
+            for procname in procnames:
+                if procname[:3] == 'do_':
+                    sys.stdout.write("  %s\n" % procname[3:].replace('_', '-'))
+                    doc = getattr(self, procname).__doc__
+                    if doc:
+                        sys.stdout.write("    %s\n" % doc.splitlines()[0])
+
+    def do_show_layers(self, args):
+        """show current configured layers"""
+        self.bbhandler.prepare(config_only = True)
+        logger.plain("%s  %s  %s" % ("layer".ljust(20), "path".ljust(40), "priority"))
+        logger.plain('=' * 74)
+        for layerdir in self.bblayers:
+            layername = self.get_layer_name(layerdir)
+            layerpri = 0
+            for layer, _, regex, pri in self.bbhandler.cooker.status.bbfile_config_priorities:
+                if regex.match(os.path.join(layerdir, 'test')):
+                    layerpri = pri
+                    break
+
+            logger.plain("%s  %s  %d" % (layername.ljust(20), layerdir.ljust(40), layerpri))
+
+
+    def version_str(self, pe, pv, pr = None):
+        verstr = "%s" % pv
+        if pr:
+            verstr = "%s-%s" % (verstr, pr)
+        if pe:
+            verstr = "%s:%s" % (pe, verstr)
+        return verstr
+
+
+    def do_show_overlayed(self, args):
+        """list overlayed recipes (where the same recipe exists in another layer)
+
+usage: show-overlayed [-f] [-s]
+
+Lists the names of overlayed recipes and the available versions in each
+layer, with the preferred version first. Note that skipped recipes that
+are overlayed will also be listed, with a " (skipped)" suffix.
+
+Options:
+  -f   instead of the default formatting, list filenames of higher priority
+       recipes with the ones they overlay indented underneath
+  -s   only list overlayed recipes where the version is the same
+"""
+        self.bbhandler.prepare()
+
+        show_filenames = False
+        show_same_ver_only = False
+        for arg in args.split():
+            if arg == '-f':
+                show_filenames = True
+            elif arg == '-s':
+                show_same_ver_only = True
+            else:
+                sys.stderr.write("show-overlayed: invalid option %s\n" % arg)
+                self.do_help('')
+                return
+
+        items_listed = self.list_recipes('Overlayed recipes', None, True, show_same_ver_only, show_filenames, True)
+
+        # Check for overlayed .bbclass files
+        classes = defaultdict(list)
+        for layerdir in self.bblayers:
+            classdir = os.path.join(layerdir, 'classes')
+            if os.path.exists(classdir):
+                for classfile in os.listdir(classdir):
+                    if os.path.splitext(classfile)[1] == '.bbclass':
+                        classes[classfile].append(classdir)
+
+        # Locating classes and other files is a bit more complicated than recipes -
+        # layer priority is not a factor; instead BitBake uses the first matching
+        # file in BBPATH, which is manipulated directly by each layer's
+        # conf/layer.conf in turn, thus the order of layers in bblayers.conf is a
+        # factor - however, each layer.conf is free to either prepend or append to
+        # BBPATH (or indeed do crazy stuff with it). Thus the order in BBPATH might
+        # not be exactly the order present in bblayers.conf either.
+        bbpath = str(self.bbhandler.config_data.getVar('BBPATH', True))
+        overlayed_class_found = False
+        for (classfile, classdirs) in classes.items():
+            if len(classdirs) > 1:
+                if not overlayed_class_found:
+                    logger.plain('=== Overlayed classes ===')
+                    overlayed_class_found = True
+
+                mainfile = bb.utils.which(bbpath, os.path.join('classes', classfile))
+                if show_filenames:
+                    logger.plain('%s' % mainfile)
+                else:
+                    # We effectively have to guess the layer here
+                    logger.plain('%s:' % classfile)
+                    mainlayername = '?'
+                    for layerdir in self.bblayers:
+                        classdir = os.path.join(layerdir, 'classes')
+                        if mainfile.startswith(classdir):
+                            mainlayername = self.get_layer_name(layerdir)
+                    logger.plain('  %s' % mainlayername)
+                for classdir in classdirs:
+                    fullpath = os.path.join(classdir, classfile)
+                    if fullpath != mainfile:
+                        if show_filenames:
+                            print('  %s' % fullpath)
+                        else:
+                            print('  %s' % self.get_layer_name(os.path.dirname(classdir)))
+
+        if overlayed_class_found:
+            items_listed = True;
+
+        if not items_listed:
+            logger.plain('No overlayed files found.')
+
+
+    def do_show_recipes(self, args):
+        """list available recipes, showing the layer they are provided by
+
+usage: show-recipes [-f] [-m] [pnspec]
+
+Lists the names of overlayed recipes and the available versions in each
+layer, with the preferred version first. Optionally you may specify
+pnspec to match a specified recipe name (supports wildcards). Note that
+skipped recipes will also be listed, with a " (skipped)" suffix.
+
+Options:
+  -f   instead of the default formatting, list filenames of higher priority
+       recipes with other available recipes indented underneath
+  -m   only list where multiple recipes (in the same layer or different
+       layers) exist for the same recipe name
+"""
+        self.bbhandler.prepare()
+
+        show_filenames = False
+        show_multi_provider_only = False
+        pnspec = None
+        title = 'Available recipes:'
+        for arg in args.split():
+            if arg == '-f':
+                show_filenames = True
+            elif arg == '-m':
+                show_multi_provider_only = True
+            elif not arg.startswith('-'):
+                pnspec = arg
+                title = 'Available recipes matching %s:' % pnspec
+            else:
+                sys.stderr.write("show-recipes: invalid option %s\n" % arg)
+                self.do_help('')
+                return
+        self.list_recipes(title, pnspec, False, False, show_filenames, show_multi_provider_only)
+
+
+    def list_recipes(self, title, pnspec, show_overlayed_only, show_same_ver_only, show_filenames, show_multi_provider_only):
+        pkg_pn = self.bbhandler.cooker.status.pkg_pn
+        (latest_versions, preferred_versions) = bb.providers.findProviders(self.bbhandler.cooker.configuration.data, self.bbhandler.cooker.status, pkg_pn)
+        allproviders = bb.providers.allProviders(self.bbhandler.cooker.status)
+
+        # Ensure we list skipped recipes
+        # We are largely guessing about PN, PV and the preferred version here,
+        # but we have no choice since skipped recipes are not fully parsed
+        skiplist = self.bbhandler.cooker.skiplist.keys()
+        skiplist.sort( key=lambda fileitem: self.bbhandler.cooker.calc_bbfile_priority(fileitem) )
+        skiplist.reverse()
+        for fn in skiplist:
+            recipe_parts = os.path.splitext(os.path.basename(fn))[0].split('_')
+            p = recipe_parts[0]
+            if len(recipe_parts) > 1:
+                ver = (None, recipe_parts[1], None)
+            else:
+                ver = (None, 'unknown', None)
+            allproviders[p].append((ver, fn))
+            if not p in pkg_pn:
+                pkg_pn[p] = 'dummy'
+                preferred_versions[p] = (ver, fn)
+
+        def print_item(f, pn, ver, layer, ispref):
+            if f in skiplist:
+                skipped = ' (skipped)'
+            else:
+                skipped = ''
+            if show_filenames:
+                if ispref:
+                    logger.plain("%s%s", f, skipped)
+                else:
+                    logger.plain("  %s%s", f, skipped)
+            else:
+                if ispref:
+                    logger.plain("%s:", pn)
+                logger.plain("  %s %s%s", layer.ljust(20), ver, skipped)
+
+        preffiles = []
+        items_listed = False
+        for p in sorted(pkg_pn):
+            if pnspec:
+                if not fnmatch.fnmatch(p, pnspec):
+                    continue
+
+            if len(allproviders[p]) > 1 or not show_multi_provider_only:
+                pref = preferred_versions[p]
+                preffile = bb.cache.Cache.virtualfn2realfn(pref[1])[0]
+                if preffile not in preffiles:
+                    preflayer = self.get_file_layer(preffile)
+                    multilayer = False
+                    same_ver = True
+                    provs = []
+                    for prov in allproviders[p]:
+                        provfile = bb.cache.Cache.virtualfn2realfn(prov[1])[0]
+                        provlayer = self.get_file_layer(provfile)
+                        provs.append((provfile, provlayer, prov[0]))
+                        if provlayer != preflayer:
+                            multilayer = True
+                        if prov[0] != pref[0]:
+                            same_ver = False
+
+                    if (multilayer or not show_overlayed_only) and (same_ver or not show_same_ver_only):
+                        if not items_listed:
+                            logger.plain('=== %s ===' % title)
+                            items_listed = True
+                        print_item(preffile, p, self.version_str(pref[0][0], pref[0][1]), preflayer, True)
+                        for (provfile, provlayer, provver) in provs:
+                            if provfile != preffile:
+                                print_item(provfile, p, self.version_str(provver[0], provver[1]), provlayer, False)
+                        # Ensure we don't show two entries for BBCLASSEXTENDed recipes
+                        preffiles.append(preffile)
+
+        return items_listed
+
+
+    def do_flatten(self, args):
+        """flattens layer configuration into a separate output directory.
+
+usage: flatten [layer1 layer2 [layer3]...] <outputdir>
+
+Takes the specified layers (or all layers in the current layer
+configuration if none are specified) and builds a "flattened" directory
+containing the contents of all layers, with any overlayed recipes removed
+and bbappends appended to the corresponding recipes. Note that some manual
+cleanup may still be necessary afterwards, in particular:
+
+* where non-recipe files (such as patches) are overwritten (the flatten
+  command will show a warning for these)
+* where anything beyond the normal layer setup has been added to
+  layer.conf (only the lowest priority number layer's layer.conf is used)
+* overridden/appended items from bbappends will need to be tidied up
+* when the flattened layers do not have the same directory structure (the
+  flatten command should show a warning when this will cause a problem)
+
+Warning: if you flatten several layers where another layer is intended to
+be used "inbetween" them (in layer priority order) such that recipes /
+bbappends in the layers interact, and then attempt to use the new output
+layer together with that other layer, you may no longer get the same
+build results (as the layer priority order has effectively changed).
+"""
+        arglist = args.split()
+        if len(arglist) < 1:
+            logger.error('Please specify an output directory')
+            self.do_help('flatten')
+            return
+
+        if len(arglist) == 2:
+            logger.error('If you specify layers to flatten you must specify at least two')
+            self.do_help('flatten')
+            return
+
+        outputdir = arglist[-1]
+        if os.path.exists(outputdir) and os.listdir(outputdir):
+            logger.error('Directory %s exists and is non-empty, please clear it out first' % outputdir)
+            return
+
+        self.bbhandler.prepare()
+        layers = self.bblayers
+        if len(arglist) > 2:
+            layernames = arglist[:-1]
+            found_layernames = []
+            found_layerdirs = []
+            for layerdir in layers:
+                layername = self.get_layer_name(layerdir)
+                if layername in layernames:
+                    found_layerdirs.append(layerdir)
+                    found_layernames.append(layername)
+
+            for layername in layernames:
+                if not layername in found_layernames:
+                    logger.error('Unable to find layer %s in current configuration, please run "%s show-layers" to list configured layers' % (layername, os.path.basename(sys.argv[0])))
+                    return
+            layers = found_layerdirs
+        else:
+            layernames = []
+
+        # Ensure a specified path matches our list of layers
+        def layer_path_match(path):
+            for layerdir in layers:
+                if path.startswith(os.path.join(layerdir, '')):
+                    return layerdir
+            return None
+
+        appended_recipes = []
+        for layer in layers:
+            overlayed = []
+            for f in self.bbhandler.cooker.overlayed.iterkeys():
+                for of in self.bbhandler.cooker.overlayed[f]:
+                    if of.startswith(layer):
+                        overlayed.append(of)
+
+            logger.plain('Copying files from %s...' % layer )
+            for root, dirs, files in os.walk(layer):
+                for f1 in files:
+                    f1full = os.sep.join([root, f1])
+                    if f1full in overlayed:
+                        logger.plain('  Skipping overlayed file %s' % f1full )
+                    else:
+                        ext = os.path.splitext(f1)[1]
+                        if ext != '.bbappend':
+                            fdest = f1full[len(layer):]
+                            fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
+                            bb.utils.mkdirhier(os.path.dirname(fdest))
+                            if os.path.exists(fdest):
+                                if f1 == 'layer.conf' and root.endswith('/conf'):
+                                    logger.plain('  Skipping layer config file %s' % f1full )
+                                    continue
+                                else:
+                                    logger.warn('Overwriting file %s', fdest)
+                            bb.utils.copyfile(f1full, fdest)
+                            if ext == '.bb':
+                                if f1 in self.bbhandler.cooker.appendlist:
+                                    appends = self.bbhandler.cooker.appendlist[f1]
+                                    if appends:
+                                        logger.plain('  Applying appends to %s' % fdest )
+                                        for appendname in appends:
+                                            if layer_path_match(appendname):
+                                                self.apply_append(appendname, fdest)
+                                    appended_recipes.append(f1)
+
+        # Take care of when some layers are excluded and yet we have included bbappends for those recipes
+        for recipename in self.bbhandler.cooker.appendlist.iterkeys():
+            if recipename not in appended_recipes:
+                appends = self.bbhandler.cooker.appendlist[recipename]
+                first_append = None
+                for appendname in appends:
+                    layer = layer_path_match(appendname)
+                    if layer:
+                        if first_append:
+                            self.apply_append(appendname, first_append)
+                        else:
+                            fdest = appendname[len(layer):]
+                            fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
+                            bb.utils.mkdirhier(os.path.dirname(fdest))
+                            bb.utils.copyfile(appendname, fdest)
+                            first_append = fdest
+
+        # Get the regex for the first layer in our list (which is where the conf/layer.conf file will
+        # have come from)
+        first_regex = None
+        layerdir = layers[0]
+        for layername, pattern, regex, _ in self.bbhandler.cooker.status.bbfile_config_priorities:
+            if regex.match(os.path.join(layerdir, 'test')):
+                first_regex = regex
+                break
+
+        if first_regex:
+            # Find the BBFILES entries that match (which will have come from this conf/layer.conf file)
+            bbfiles = str(self.bbhandler.config_data.getVar('BBFILES', True)).split()
+            bbfiles_layer = []
+            for item in bbfiles:
+                if first_regex.match(item):
+                    newpath = os.path.join(outputdir, item[len(layerdir)+1:])
+                    bbfiles_layer.append(newpath)
+
+            if bbfiles_layer:
+                # Check that all important layer files match BBFILES
+                for root, dirs, files in os.walk(outputdir):
+                    for f1 in files:
+                        ext = os.path.splitext(f1)[1]
+                        if ext in ['.bb', '.bbappend']:
+                            f1full = os.sep.join([root, f1])
+                            entry_found = False
+                            for item in bbfiles_layer:
+                                if fnmatch.fnmatch(f1full, item):
+                                    entry_found = True
+                                    break
+                            if not entry_found:
+                                logger.warning("File %s does not match the flattened layer's BBFILES setting, you may need to edit conf/layer.conf or move the file elsewhere" % f1full)
+
+    def get_file_layer(self, filename):
+        for layer, _, regex, _ in self.bbhandler.cooker.status.bbfile_config_priorities:
+            if regex.match(filename):
+                for layerdir in self.bblayers:
+                    if regex.match(os.path.join(layerdir, 'test')) and re.match(layerdir, filename):
+                        return self.get_layer_name(layerdir)
+        return "?"
+
+    def get_file_layerdir(self, filename):
+        for layer, _, regex, _ in self.bbhandler.cooker.status.bbfile_config_priorities:
+            if regex.match(filename):
+                for layerdir in self.bblayers:
+                    if regex.match(os.path.join(layerdir, 'test')) and re.match(layerdir, filename):
+                        return layerdir
+        return "?"
+
+    def remove_layer_prefix(self, f):
+        """Remove the layer_dir prefix, e.g., f = /path/to/layer_dir/foo/blah, the
+           return value will be: layer_dir/foo/blah"""
+        f_layerdir = self.get_file_layerdir(f)
+        prefix = os.path.join(os.path.dirname(f_layerdir), '')
+        return f[len(prefix):] if f.startswith(prefix) else f
+
+    def get_layer_name(self, layerdir):
+        return os.path.basename(layerdir.rstrip(os.sep))
+
+    def apply_append(self, appendname, recipename):
+        appendfile = open(appendname, 'r')
+        recipefile = open(recipename, 'a')
+        recipefile.write('\n')
+        recipefile.write('##### bbappended from %s #####\n' % self.get_file_layer(appendname))
+        recipefile.writelines(appendfile.readlines())
+        recipefile.close()
+        appendfile.close()
+
+    def do_show_appends(self, args):
+        """list bbappend files and recipe files they apply to
+
+usage: show-appends
+
+Recipes are listed with the bbappends that apply to them as subitems.
+"""
+        self.bbhandler.prepare()
+        if not self.bbhandler.cooker.appendlist:
+            logger.plain('No append files found')
+            return
+
+        logger.plain('=== Appended recipes ===')
+
+        pnlist = list(self.bbhandler.cooker_data.pkg_pn.keys())
+        pnlist.sort()
+        for pn in pnlist:
+            self.show_appends_for_pn(pn)
+
+        self.show_appends_for_skipped()
+
+    def show_appends_for_pn(self, pn):
+        filenames = self.bbhandler.cooker_data.pkg_pn[pn]
+
+        best = bb.providers.findBestProvider(pn,
+                                             self.bbhandler.cooker.configuration.data,
+                                             self.bbhandler.cooker_data,
+                                             self.bbhandler.cooker_data.pkg_pn)
+        best_filename = os.path.basename(best[3])
+
+        self.show_appends_output(filenames, best_filename)
+
+    def show_appends_for_skipped(self):
+        filenames = [os.path.basename(f)
+                    for f in self.bbhandler.cooker.skiplist.iterkeys()]
+        self.show_appends_output(filenames, None, " (skipped)")
+
+    def show_appends_output(self, filenames, best_filename, name_suffix = ''):
+        appended, missing = self.get_appends_for_files(filenames)
+        if appended:
+            for basename, appends in appended:
+                logger.plain('%s%s:', basename, name_suffix)
+                for append in appends:
+                    logger.plain('  %s', append)
+
+            if best_filename:
+                if best_filename in missing:
+                    logger.warn('%s: missing append for preferred version',
+                                best_filename)
+                    self.returncode |= 1
+
+
+    def get_appends_for_files(self, filenames):
+        appended, notappended = [], []
+        for filename in filenames:
+            _, cls = bb.cache.Cache.virtualfn2realfn(filename)
+            if cls:
+                continue
+
+            basename = os.path.basename(filename)
+            appends = self.bbhandler.cooker.appendlist.get(basename)
+            if appends:
+                appended.append((basename, list(appends)))
+            else:
+                notappended.append(basename)
+        return appended, notappended
+
+    def do_show_cross_depends(self, args):
+        """figure out the dependency between recipes that crosses a layer boundary.
+
+usage: show-cross-depends [-f]
+
+Figure out the dependency between recipes that crosses a layer boundary.
+
+Options:
+  -f   show full file path
+
+NOTE:
+The .bbappend file can impact the dependency.
+"""
+        self.bbhandler.prepare()
+
+        show_filenames = False
+        for arg in args.split():
+            if arg == '-f':
+                show_filenames = True
+            else:
+                sys.stderr.write("show-cross-depends: invalid option %s\n" % arg)
+                self.do_help('')
+                return
+
+        pkg_fn = self.bbhandler.cooker_data.pkg_fn
+        bbpath = str(self.bbhandler.config_data.getVar('BBPATH', True))
+        self.require_re = re.compile(r"require\s+(.+)")
+        self.include_re = re.compile(r"include\s+(.+)")
+        self.inherit_re = re.compile(r"inherit\s+(.+)")
+
+        # The bb's DEPENDS and RDEPENDS
+        for f in pkg_fn:
+            f = bb.cache.Cache.virtualfn2realfn(f)[0]
+            # Get the layername that the file is in
+            layername = self.get_file_layer(f)
+
+            # The DEPENDS
+            deps = self.bbhandler.cooker_data.deps[f]
+            for pn in deps:
+                if pn in self.bbhandler.cooker_data.pkg_pn:
+                    best = bb.providers.findBestProvider(pn,
+                            self.bbhandler.cooker.configuration.data,
+                            self.bbhandler.cooker_data,
+                            self.bbhandler.cooker_data.pkg_pn)
+                    self.check_cross_depends("DEPENDS", layername, f, best[3], show_filenames)
+
+            # The RDPENDS
+            all_rdeps = self.bbhandler.cooker_data.rundeps[f].values()
+            # Remove the duplicated or null one.
+            sorted_rdeps = {}
+            # The all_rdeps is the list in list, so we need two for loops
+            for k1 in all_rdeps:
+                for k2 in k1:
+                    sorted_rdeps[k2] = 1
+            all_rdeps = sorted_rdeps.keys()
+            for rdep in all_rdeps:
+                all_p = bb.providers.getRuntimeProviders(self.bbhandler.cooker_data, rdep)
+                if all_p:
+                    best = bb.providers.filterProvidersRunTime(all_p, rdep,
+                                    self.bbhandler.cooker.configuration.data,
+                                    self.bbhandler.cooker_data)[0][0]
+                    self.check_cross_depends("RDEPENDS", layername, f, best, show_filenames)
+
+            # The inherit class
+            cls_re = re.compile('classes/')
+            if f in self.bbhandler.cooker_data.inherits:
+                inherits = self.bbhandler.cooker_data.inherits[f]
+                for cls in inherits:
+                    # The inherits' format is [classes/cls, /path/to/classes/cls]
+                    # ignore the classes/cls.
+                    if not cls_re.match(cls):
+                        inherit_layername = self.get_file_layer(cls)
+                        if inherit_layername != layername:
+                            if not show_filenames:
+                                f_short = self.remove_layer_prefix(f)
+                                cls = self.remove_layer_prefix(cls)
+                            else:
+                                f_short = f
+                            logger.plain("%s inherits %s" % (f_short, cls))
+
+            # The 'require/include xxx' in the bb file
+            pv_re = re.compile(r"\${PV}")
+            fnfile = open(f, 'r')
+            line = fnfile.readline()
+            while line:
+                m, keyword = self.match_require_include(line)
+                # Found the 'require/include xxxx'
+                if m:
+                    needed_file = m.group(1)
+                    # Replace the ${PV} with the real PV
+                    if pv_re.search(needed_file) and f in self.bbhandler.cooker_data.pkg_pepvpr:
+                        pv = self.bbhandler.cooker_data.pkg_pepvpr[f][1]
+                        needed_file = re.sub(r"\${PV}", pv, needed_file)
+                    self.print_cross_files(bbpath, keyword, layername, f, needed_file, show_filenames)
+                line = fnfile.readline()
+            fnfile.close()
+
+        # The "require/include xxx" in conf/machine/*.conf, .inc and .bbclass
+        conf_re = re.compile(".*/conf/machine/[^\/]*\.conf$")
+        inc_re = re.compile(".*\.inc$")
+        # The "inherit xxx" in .bbclass
+        bbclass_re = re.compile(".*\.bbclass$")
+        for layerdir in self.bblayers:
+            layername = self.get_layer_name(layerdir)
+            for dirpath, dirnames, filenames in os.walk(layerdir):
+                for name in filenames:
+                    f = os.path.join(dirpath, name)
+                    s = conf_re.match(f) or inc_re.match(f) or bbclass_re.match(f)
+                    if s:
+                        ffile = open(f, 'r')
+                        line = ffile.readline()
+                        while line:
+                            m, keyword = self.match_require_include(line)
+                            # Only bbclass has the "inherit xxx" here.
+                            bbclass=""
+                            if not m and f.endswith(".bbclass"):
+                                m, keyword = self.match_inherit(line)
+                                bbclass=".bbclass"
+                            # Find a 'require/include xxxx'
+                            if m:
+                                self.print_cross_files(bbpath, keyword, layername, f, m.group(1) + bbclass, show_filenames)
+                            line = ffile.readline()
+                        ffile.close()
+
+    def print_cross_files(self, bbpath, keyword, layername, f, needed_filename, show_filenames):
+        """Print the depends that crosses a layer boundary"""
+        needed_file = bb.utils.which(bbpath, needed_filename)
+        if needed_file:
+            # Which layer is this file from
+            needed_layername = self.get_file_layer(needed_file)
+            if needed_layername != layername:
+                if not show_filenames:
+                    f = self.remove_layer_prefix(f)
+                    needed_file = self.remove_layer_prefix(needed_file)
+                logger.plain("%s %s %s" %(f, keyword, needed_file))
+    def match_inherit(self, line):
+        """Match the inherit xxx line"""
+        return (self.inherit_re.match(line), "inherits")
+
+    def match_require_include(self, line):
+        """Match the require/include xxx line"""
+        m = self.require_re.match(line)
+        keyword = "requires"
+        if not m:
+            m = self.include_re.match(line)
+            keyword = "includes"
+        return (m, keyword)
+
+    def check_cross_depends(self, keyword, layername, f, needed_file, show_filenames):
+        """Print the DEPENDS/RDEPENDS file that crosses a layer boundary"""
+        best_realfn = bb.cache.Cache.virtualfn2realfn(needed_file)[0]
+        needed_layername = self.get_file_layer(best_realfn)
+        if needed_layername != layername:
+            if not show_filenames:
+                f = self.remove_layer_prefix(f)
+                best_realfn = self.remove_layer_prefix(best_realfn)
+
+            logger.plain("%s %s %s" % (f, keyword, best_realfn))
+
+if __name__ == '__main__':
+    sys.exit(main(sys.argv[1:]) or 0)

bitbake/bin/bitbake-prserv

@@ -0,0 +1,55 @@
+#!/usr/bin/env python
+import os
+import sys,logging
+import optparse
+
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)),'lib'))
+
+import prserv
+import prserv.serv
+
+__version__="1.0.0"
+
+PRHOST_DEFAULT='0.0.0.0'
+PRPORT_DEFAULT=8585
+
+def main():
+    parser = optparse.OptionParser(
+        version="Bitbake PR Service Core version %s, %%prog version %s" % (prserv.__version__, __version__),
+        usage = "%prog < --start | --stop > [options]")
+
+    parser.add_option("-f", "--file", help="database filename(default: prserv.sqlite3)", action="store",
+                      dest="dbfile", type="string", default="prserv.sqlite3")
+    parser.add_option("-l", "--log", help="log filename(default: prserv.log)", action="store",
+                      dest="logfile", type="string", default="prserv.log")
+    parser.add_option("--loglevel", help="logging level, i.e. CRITICAL, ERROR, WARNING, INFO, DEBUG",
+                      action = "store", type="string", dest="loglevel", default = "INFO")
+    parser.add_option("--start", help="start daemon",
+                      action="store_true", dest="start")
+    parser.add_option("--stop", help="stop daemon",
+                      action="store_true", dest="stop")
+    parser.add_option("--host", help="ip address to bind", action="store",
+                      dest="host", type="string", default=PRHOST_DEFAULT)
+    parser.add_option("--port", help="port number(default: 8585)", action="store",
+                      dest="port", type="int", default=PRPORT_DEFAULT)
+
+    options, args = parser.parse_args(sys.argv)
+    prserv.init_logger(os.path.abspath(options.logfile),options.loglevel)
+
+    if options.start:
+        ret=prserv.serv.start_daemon(options.dbfile, options.host, options.port,os.path.abspath(options.logfile))
+    elif options.stop:
+        ret=prserv.serv.stop_daemon(options.host, options.port)
+    else:
+        ret=parser.print_help()
+    return ret
+
+if __name__ == "__main__":
+    try:
+        ret = main()
+    except Exception:
+        ret = 1
+        import traceback
+        traceback.print_exc(5)
+    sys.exit(ret)
+

bitbake/bin/bitbake-runtask

@@ -0,0 +1,119 @@
+#!/usr/bin/env python
+
+import os
+import sys
+import warnings
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
+from bb import fetch2
+import logging
+
+logger = logging.getLogger("BitBake")
+
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    bb.msg.note(1, bb.msg.domain.Cache, "Importing cPickle failed. Falling back to a very slow implementation.")
+
+class BBConfiguration(object):
+    """
+    Manages build options and configurations for one run
+    """
+
+    def __init__(self, **options):
+        self.data = {}
+        self.file = []
+        self.cmd = None
+        self.dump_signatures = True
+        self.prefile = []
+        self.postfile = []
+        self.parse_only = True
+
+    def __getattr__(self, attribute):
+        try:
+            return super(BBConfiguration, self).__getattribute__(attribute)
+        except AttributeError:
+            return None
+
+_warnings_showwarning = warnings.showwarning
+def _showwarning(message, category, filename, lineno, file=None, line=None):
+    """Display python warning messages using bb.msg"""
+    if file is not None:
+        if _warnings_showwarning is not None:
+            _warnings_showwarning(message, category, filename, lineno, file, line)
+    else:
+        s = warnings.formatwarning(message, category, filename, lineno)
+        s = s.split("\n")[0]
+        bb.msg.warn(None, s)
+
+warnings.showwarning = _showwarning
+warnings.simplefilter("ignore", DeprecationWarning)
+
+import bb.event
+import bb.cooker
+
+buildfile = sys.argv[1]
+taskname = sys.argv[2]
+if len(sys.argv) >= 4:
+    dryrun = sys.argv[3]    
+else:
+    dryrun = False
+if len(sys.argv) >= 5:
+    hashfile = sys.argv[4]
+    p = pickle.Unpickler(file(hashfile, "rb"))
+    hashdata = p.load()
+else:
+    hashdata = None
+
+handler = bb.event.LogHandler()
+logger.addHandler(handler)
+
+#An example to make debug log messages show up
+#bb.msg.init_msgconfig(True, 3, [])
+
+console = logging.StreamHandler(sys.stdout)
+format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
+bb.msg.addDefaultlogFilter(console)
+console.setFormatter(format)
+
+def worker_fire(event, d):
+    if isinstance(event, logging.LogRecord):
+        console.handle(event)
+bb.event.worker_fire = worker_fire
+bb.event.worker_pid = os.getpid()
+
+initialenv = os.environ.copy()
+config = BBConfiguration()
+
+def register_idle_function(self, function, data):
+    pass
+
+cooker = bb.cooker.BBCooker(config, register_idle_function, initialenv)
+config_data = cooker.configuration.data
+cooker.status = config_data
+cooker.handleCollections(config_data.getVar("BBFILE_COLLECTIONS", 1))
+
+fn, cls = bb.cache.Cache.virtualfn2realfn(buildfile)
+buildfile = cooker.matchFile(fn)
+fn = bb.cache.Cache.realfn2virtual(buildfile, cls)
+
+cooker.buildSetVars()
+
+# Load data into the cache for fn and parse the loaded cache data
+the_data = bb.cache.Cache.loadDataFull(fn, cooker.get_file_appends(fn), cooker.configuration.data)
+
+if taskname.endswith("_setscene"):
+    the_data.setVarFlag(taskname, "quieterrors", "1")
+
+if hashdata:
+    bb.parse.siggen.set_taskdata(hashdata["hashes"], hashdata["deps"])
+    for h in hashdata["hashes"]:
+        the_data.setVar("BBHASH_%s" % h, hashdata["hashes"][h])
+    for h in hashdata["deps"]:
+        the_data.setVar("BBHASHDEPS_%s" % h, hashdata["deps"][h])
+
+ret = 0
+if dryrun != "True":
+    ret = bb.build.exec_task(fn, taskname, the_data)
+sys.exit(ret)
+

bitbake/bin/bitbake-selftest

@@ -0,0 +1,38 @@
+#!/usr/bin/env python
+#
+# Copyright (C) 2012 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os
+import sys, logging
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)), 'lib'))
+
+import unittest
+try:
+    import bb
+except RuntimeError as exc:
+    sys.exit(str(exc))
+
+tests = ["bb.tests.codeparser", 
+         "bb.tests.cow",
+         "bb.tests.data",
+         "bb.tests.fetch",
+         "bb.tests.utils"]
+
+for t in tests:
+    __import__(t)
+
+unittest.main(argv=["bitbake-selftest"] + tests)
+

bitbake/bin/bitdoc

@@ -0,0 +1,531 @@
+#!/usr/bin/env python
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# Copyright (C) 2005 Holger Hans Peter Freyther
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import optparse, os, sys
+
+# bitbake
+sys.path.append(os.path.join(os.path.dirname(os.path.dirname(__file__), 'lib'))
+import bb
+import bb.parse
+from   string import split, join
+
+__version__ = "0.0.2"
+
+class HTMLFormatter:
+    """
+    Simple class to help to generate some sort of HTML files. It is
+    quite inferior solution compared to docbook, gtkdoc, doxygen but it
+    should work for now.
+    We've a global introduction site (index.html) and then one site for
+    the list of keys (alphabetical sorted) and one for the list of groups,
+    one site for each key with links to the relations and groups.
+
+        index.html
+        all_keys.html
+        all_groups.html
+        groupNAME.html
+        keyNAME.html
+    """
+
+    def replace(self, text, *pairs):
+        """
+        From pydoc... almost identical at least
+        """
+        while pairs:
+            (a, b) = pairs[0]
+            text = join(split(text, a), b)
+            pairs = pairs[1:]
+        return text
+    def escape(self, text):
+        """
+        Escape string to be conform HTML
+        """
+        return self.replace(text, 
+                            ('&', '&'), 
+                            ('<', '&lt;' ),
+                            ('>', '&gt;' ) )
+    def createNavigator(self):
+        """
+        Create the navgiator
+        """
+        return """<table class="navigation" width="100%" summary="Navigation header" cellpadding="2" cellspacing="2">
+<tr valign="middle">
+<td><a accesskey="g" href="index.html">Home</a></td>
+<td><a accesskey="n" href="all_groups.html">Groups</a></td>
+<td><a accesskey="u" href="all_keys.html">Keys</a></td>
+</tr></table>
+"""
+
+    def relatedKeys(self, item):
+        """
+        Create HTML to link to foreign keys
+        """
+
+        if len(item.related()) == 0:
+            return ""
+
+        txt = "<p><b>See also:</b><br>"
+        txts = []
+        for it in item.related():
+            txts.append("""<a href="key%(it)s.html">%(it)s</a>""" % vars() )
+
+        return txt + ",".join(txts)
+
+    def groups(self, item):
+        """
+        Create HTML to link to related groups
+        """
+
+        if len(item.groups()) == 0:
+            return ""
+
+
+        txt = "<p><b>See also:</b><br>"
+        txts = []
+        for group in item.groups():
+            txts.append( """<a href="group%s.html">%s</a> """ % (group, group) )
+
+        return txt + ",".join(txts)
+
+
+    def createKeySite(self, item):
+        """
+        Create a site for a key. It contains the header/navigator, a heading,
+        the description, links to related keys and to the groups.
+        """
+
+        return """<!doctype html PUBLIC "-//W3C//DTD HTML 4.0 Transitional//EN">
+<html><head><title>Key %s</title></head>
+<link rel="stylesheet" href="style.css" type="text/css">
+<body bgcolor="white" text="black" link="#0000FF" vlink="#840084" alink="#0000FF">
+%s
+<h2><span class="refentrytitle">%s</span></h2>
+
+<div class="refsynopsisdiv">
+<h2>Synopsis</h2>
+<p>
+%s
+</p>
+</div>
+
+<div class="refsynopsisdiv">
+<h2>Related Keys</h2>
+<p>
+%s
+</p>
+</div>
+
+<div class="refsynopsisdiv">
+<h2>Groups</h2>
+<p>
+%s
+</p>
+</div>
+
+
+</body>
+"""     % (item.name(), self.createNavigator(), item.name(), 
+           self.escape(item.description()), self.relatedKeys(item), self.groups(item))
+
+    def createGroupsSite(self, doc):
+        """
+        Create the Group Overview site
+        """
+
+        groups = ""
+        sorted_groups = sorted(doc.groups())
+        for group in sorted_groups:
+            groups += """<a href="group%s.html">%s</a><br>""" % (group, group)
+
+        return """<!doctype html PUBLIC "-//W3C//DTD HTML 4.0 Transitional//EN">
+<html><head><title>Group overview</title></head>
+<link rel="stylesheet" href="style.css" type="text/css">
+<body bgcolor="white" text="black" link="#0000FF" vlink="#840084" alink="#0000FF">
+%s
+<h2>Available Groups</h2>
+%s
+</body>
+""" % (self.createNavigator(), groups)
+
+    def createIndex(self):
+        """
+        Create the index file
+        """
+
+        return """<!doctype html PUBLIC "-//W3C//DTD HTML 4.0 Transitional//EN">
+<html><head><title>Bitbake Documentation</title></head>
+<link rel="stylesheet" href="style.css" type="text/css">
+<body bgcolor="white" text="black" link="#0000FF" vlink="#840084" alink="#0000FF">
+%s
+<h2>Documentation Entrance</h2>
+<a href="all_groups.html">All available groups</a><br>
+<a href="all_keys.html">All available keys</a><br>
+</body>
+""" % self.createNavigator()
+
+    def createKeysSite(self, doc):
+        """
+        Create Overview of all avilable keys
+        """
+        keys = ""
+        sorted_keys = sorted(doc.doc_keys())
+        for key in sorted_keys:
+            keys += """<a href="key%s.html">%s</a><br>""" % (key, key)
+
+        return """<!doctype html PUBLIC "-//W3C//DTD HTML 4.0 Transitional//EN">
+<html><head><title>Key overview</title></head>
+<link rel="stylesheet" href="style.css" type="text/css">
+<body bgcolor="white" text="black" link="#0000FF" vlink="#840084" alink="#0000FF">
+%s
+<h2>Available Keys</h2>
+%s
+</body>
+""" % (self.createNavigator(), keys)
+
+    def createGroupSite(self, gr, items, _description = None):
+        """
+        Create a site for a group:
+        Group the name of the group, items contain the name of the keys
+        inside this group
+        """
+        groups = ""
+        description = ""
+
+        # create a section with the group descriptions
+        if _description:
+            description  += "<h2 Description of Grozp %s</h2>" % gr
+            description  += _description
+
+        items.sort(lambda x, y:cmp(x.name(), y.name()))
+        for group in items:
+            groups += """<a href="key%s.html">%s</a><br>""" % (group.name(), group.name())
+
+        return """<!doctype html PUBLIC "-//W3C//DTD HTML 4.0 Transitional//EN">
+<html><head><title>Group %s</title></head>
+<link rel="stylesheet" href="style.css" type="text/css">
+<body bgcolor="white" text="black" link="#0000FF" vlink="#840084" alink="#0000FF">
+%s
+%s
+<div class="refsynopsisdiv">
+<h2>Keys in Group %s</h2>
+<pre class="synopsis">
+%s
+</pre>
+</div>
+</body>
+""" % (gr, self.createNavigator(), description, gr, groups)
+
+
+
+    def createCSS(self):
+        """
+        Create the CSS file
+        """
+        return """.synopsis, .classsynopsis
+{
+  background: #eeeeee;
+  border: solid 1px #aaaaaa;
+  padding: 0.5em;
+}
+.programlisting
+{
+  background: #eeeeff;
+  border: solid 1px #aaaaff;
+  padding: 0.5em;
+}
+.variablelist
+{
+  padding: 4px;
+  margin-left: 3em;
+}
+.variablelist td:first-child
+{
+  vertical-align: top;
+}
+table.navigation
+{
+  background: #ffeeee;
+  border: solid 1px #ffaaaa;
+  margin-top: 0.5em;
+  margin-bottom: 0.5em;
+}
+.navigation a
+{
+  color: #770000;
+}
+.navigation a:visited
+{
+  color: #550000;
+}
+.navigation .title
+{
+  font-size: 200%;
+}
+div.refnamediv
+{
+  margin-top: 2em;
+}
+div.gallery-float
+{
+  float: left;
+  padding: 10px;
+}
+div.gallery-float img
+{
+  border-style: none;
+}
+div.gallery-spacer
+{
+  clear: both;
+}
+a
+{
+  text-decoration: none;
+}
+a:hover
+{
+  text-decoration: underline;
+  color: #FF0000;
+}
+"""
+
+
+
+class DocumentationItem:
+    """
+    A class to hold information about a configuration
+    item. It contains the key name, description, a list of related names,
+    and the group this item is contained in.
+    """
+
+    def __init__(self):
+        self._groups  = []
+        self._related = []
+        self._name    = ""
+        self._desc    = ""
+
+    def groups(self):
+        return self._groups
+
+    def name(self):
+        return self._name
+
+    def description(self):
+        return self._desc
+
+    def related(self):
+        return self._related
+
+    def setName(self, name):
+        self._name = name
+
+    def setDescription(self, desc):
+        self._desc = desc
+
+    def addGroup(self, group):
+        self._groups.append(group)
+
+    def addRelation(self, relation):
+        self._related.append(relation)
+
+    def sort(self):
+        self._related.sort()
+        self._groups.sort()
+
+
+class Documentation:
+    """
+    Holds the documentation... with mappings from key to items...
+    """
+
+    def __init__(self):
+        self.__keys   = {}
+        self.__groups = {}
+
+    def insert_doc_item(self, item):
+        """
+        Insert the Doc Item into the internal list
+        of representation
+        """
+        item.sort()
+        self.__keys[item.name()] = item
+
+        for group in item.groups():
+            if not group in self.__groups:
+                self.__groups[group] = []
+            self.__groups[group].append(item)
+            self.__groups[group].sort()
+
+
+    def doc_item(self, key):
+        """
+        Return the DocumentationInstance describing the key
+        """
+        try:
+            return self.__keys[key]
+        except KeyError:
+            return None
+
+    def doc_keys(self):
+        """
+        Return the documented KEYS (names)
+        """
+        return self.__keys.keys()
+
+    def groups(self):
+        """
+        Return the names of available groups
+        """
+        return self.__groups.keys()
+
+    def group_content(self, group_name):
+        """
+        Return a list of keys/names that are in a specefic
+        group or the empty list
+        """
+        try:
+            return self.__groups[group_name]
+        except KeyError:
+            return []
+
+
+def parse_cmdline(args):
+    """
+    Parse the CMD line and return the result as a n-tuple
+    """
+
+    parser = optparse.OptionParser( version = "Bitbake Documentation Tool Core version %s, %%prog version %s" % (bb.__version__, __version__))
+    usage  = """%prog [options]
+
+Create a set of html pages (documentation) for a bitbake.conf....
+"""
+
+    # Add the needed options
+    parser.add_option( "-c", "--config", help = "Use the specified configuration file as source",
+                       action = "store", dest = "config", default = os.path.join("conf", "documentation.conf") )
+
+    parser.add_option( "-o", "--output", help = "Output directory for html files",
+                       action = "store", dest = "output", default = "html/" )
+
+    parser.add_option( "-D",  "--debug", help = "Increase the debug level",
+                       action = "count", dest = "debug", default = 0 )
+
+    parser.add_option( "-v", "--verbose", help = "output more chit-char to the terminal",
+                       action = "store_true", dest = "verbose", default = False )
+
+    options, args = parser.parse_args( sys.argv )
+ 
+    bb.msg.init_msgconfig(options.verbose, options.debug)
+
+    return options.config, options.output
+
+def main():
+    """
+    The main Method
+    """
+
+    (config_file, output_dir) = parse_cmdline( sys.argv )
+
+    # right to let us load the file now
+    try:
+        documentation = bb.parse.handle( config_file, bb.data.init() )
+    except IOError:
+        bb.fatal( "Unable to open %s" % config_file )
+    except bb.parse.ParseError:
+        bb.fatal( "Unable to parse %s" % config_file )
+
+    if isinstance(documentation, dict):
+        documentation = documentation[""]
+
+    # Assuming we've the file loaded now, we will initialize the 'tree'
+    doc = Documentation()
+
+    # defined states
+    state_begin = 0
+    state_see   = 1
+    state_group = 2
+
+    for key in bb.data.keys(documentation):
+        data   = documentation.getVarFlag(key, "doc")
+        if not data:
+            continue
+
+        # The Documentation now starts
+        doc_ins = DocumentationItem()
+        doc_ins.setName(key)
+
+
+        tokens = data.split(' ')
+        state = state_begin
+        string= ""
+        for token in tokens:
+            token = token.strip(',')
+
+            if not state == state_see and token == "@see":
+                state = state_see
+                continue
+            elif not state == state_group and token  == "@group":
+                state = state_group
+                continue
+
+            if state == state_begin:
+                string += " %s" % token
+            elif state == state_see:
+                doc_ins.addRelation(token)
+            elif state == state_group:
+                doc_ins.addGroup(token)
+
+        # set the description
+        doc_ins.setDescription(string)
+        doc.insert_doc_item(doc_ins)
+
+    # let us create the HTML now
+    bb.utils.mkdirhier(output_dir)
+    os.chdir(output_dir)
+
+    # Let us create the sites now. We do it in the following order
+    # Start with the index.html. It will point to sites explaining all
+    # keys and groups
+    html_slave = HTMLFormatter()
+
+    f = file('style.css', 'w')
+    print >> f, html_slave.createCSS()
+
+    f = file('index.html', 'w')
+    print >> f, html_slave.createIndex()
+
+    f = file('all_groups.html', 'w')
+    print >> f, html_slave.createGroupsSite(doc)
+
+    f = file('all_keys.html', 'w')
+    print >> f, html_slave.createKeysSite(doc)
+
+    # now for each group create the site
+    for group in doc.groups():
+        f = file('group%s.html' % group, 'w')
+        print >> f, html_slave.createGroupSite(group, doc.group_content(group))
+
+    # now for the keys
+    for key in doc.doc_keys():
+        f = file('key%s.html' % doc.doc_item(key).name(), 'w')
+        print >> f, html_slave.createKeySite(doc.doc_item(key))
+
+
+if __name__ == "__main__":
+    main()

bitbake/bin/image-writer

@@ -0,0 +1,122 @@
+#!/usr/bin/env python
+
+# Copyright (c) 2012 Wind River Systems, Inc.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
+# See the GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+
+import os
+import sys
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname( \
+                                    os.path.abspath(__file__))), 'lib'))
+try:
+    import bb
+except RuntimeError as exc:
+    sys.exit(str(exc))
+
+import gtk
+import optparse
+import pygtk
+
+from bb.ui.crumbs.hobwidget import HobAltButton, HobButton
+from bb.ui.crumbs.hig.crumbsmessagedialog import CrumbsMessageDialog
+from bb.ui.crumbs.hig.deployimagedialog import DeployImageDialog
+from bb.ui.crumbs.hig.imageselectiondialog import ImageSelectionDialog
+
+# I put all the fs bitbake supported here. Need more test.
+DEPLOYABLE_IMAGE_TYPES = ["jffs2", "cramfs", "ext2", "ext3", "btrfs", "squashfs", "ubi", "vmdk"]
+Title = "USB Image Writer"
+
+class DeployWindow(gtk.Window):
+    def __init__(self, image_path=''):
+        super(DeployWindow, self).__init__()
+
+        if len(image_path) > 0:
+            valid = True
+            if not os.path.exists(image_path):
+                valid = False
+                lbl = "<b>Invalid image file path: %s.</b>\nPress <b>Select Image</b> to select an image." % image_path
+            else:
+                image_path = os.path.abspath(image_path)
+                extend_name = os.path.splitext(image_path)[1][1:]
+                if extend_name not in DEPLOYABLE_IMAGE_TYPES:
+                    valid = False
+                    lbl = "<b>Undeployable imge type: %s</b>\nPress <b>Select Image</b> to select an image." % extend_name
+
+            if not valid:
+                image_path = ''
+                crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
+                button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
+                HobButton.style_button(button)
+                crumbs_dialog.run()
+                crumbs_dialog.destroy()
+
+        self.deploy_dialog = DeployImageDialog(Title, image_path, self,
+                                        gtk.DIALOG_MODAL | gtk.DIALOG_DESTROY_WITH_PARENT
+                                        | gtk.DIALOG_NO_SEPARATOR, None, standalone=True)
+        close_button = self.deploy_dialog.add_button("Close", gtk.RESPONSE_NO)
+        HobAltButton.style_button(close_button)
+        close_button.connect('clicked', gtk.main_quit)
+
+        write_button = self.deploy_dialog.add_button("Write USB image", gtk.RESPONSE_YES)
+        HobAltButton.style_button(write_button)
+
+        self.deploy_dialog.connect('select_image_clicked', self.select_image_clicked_cb)
+        self.deploy_dialog.connect('destroy', gtk.main_quit)
+        response = self.deploy_dialog.show()
+
+    def select_image_clicked_cb(self, dialog):
+        cwd = os.getcwd()
+        dialog = ImageSelectionDialog(cwd, DEPLOYABLE_IMAGE_TYPES, Title, self, gtk.FILE_CHOOSER_ACTION_SAVE )
+        button = dialog.add_button("Cancel", gtk.RESPONSE_NO)
+        HobAltButton.style_button(button)
+        button = dialog.add_button("Open", gtk.RESPONSE_YES)
+        HobAltButton.style_button(button)
+        response = dialog.run()
+
+        if response == gtk.RESPONSE_YES:
+            if not dialog.image_names:
+                lbl = "<b>No selections made</b>\nClicked the radio button to select a image."
+                crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
+                button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
+                HobButton.style_button(button)
+                crumbs_dialog.run()
+                crumbs_dialog.destroy()
+                dialog.destroy()
+                return
+
+            # get the full path of image
+            image_path = os.path.join(dialog.image_folder, dialog.image_names[0])
+            self.deploy_dialog.set_image_text_buffer(image_path)
+            self.deploy_dialog.set_image_path(image_path)
+
+        dialog.destroy()
+
+def main():
+    parser = optparse.OptionParser(
+                usage = """%prog [-h] [image_file]
+
+%prog writes bootable images to USB devices. You can
+provide the image file on the command line or select it using the GUI.""")
+
+    options, args = parser.parse_args(sys.argv)
+    image_file = args[1] if len(args) > 1 else ''
+    dw = DeployWindow(image_file)
+
+if __name__ == '__main__':
+    try:
+        main()
+        gtk.main()
+    except Exception:
+        import traceback
+        traceback.print_exc(3)

bitbake/contrib/README

@@ -0,0 +1 @@
+This directory is for additional contributed files which may be useful.

bitbake/contrib/bbdev.sh

@@ -0,0 +1,31 @@
+# This is a shell function to be sourced into your shell or placed in your .profile,
+# which makes setting things up for BitBake a bit easier.
+#
+# The author disclaims copyright to the contents of this file and places it in the
+# public domain.
+
+bbdev () {
+	local BBDIR PKGDIR BUILDDIR
+	if test x"$1" = "x--help"; then echo >&2 "syntax: bbdev [bbdir [pkgdir [builddir]]]"; return 1; fi
+	if test x"$1" = x; then BBDIR=`pwd`; else BBDIR=$1; fi
+	if test x"$2" = x; then PKGDIR=`pwd`; else PKGDIR=$2; fi
+	if test x"$3" = x; then BUILDDIR=`pwd`; else BUILDDIR=$3; fi
+
+	BBDIR=`readlink -f $BBDIR`
+	PKGDIR=`readlink -f $PKGDIR`
+	BUILDDIR=`readlink -f $BUILDDIR`
+	if ! (test -d $BBDIR && test -d $PKGDIR && test -d $BUILDDIR); then
+		echo >&2 "syntax: bbdev [bbdir [pkgdir [builddir]]]"
+		return 1
+	fi
+	
+	PATH=$BBDIR/bin:$PATH
+	BBPATH=$BBDIR
+	if test x"$BBDIR" != x"$PKGDIR"; then
+		BBPATH=$PKGDIR:$BBPATH
+	fi
+	if test x"$PKGDIR" != x"$BUILDDIR"; then
+		BBPATH=$BUILDDIR:$BBPATH
+	fi
+	export BBPATH
+}

bitbake/contrib/dump_cache.py

@@ -0,0 +1,68 @@
+#!/usr/bin/env python
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# Copyright (C) 2012 Wind River Systems, Inc.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+#
+# This is used for dumping the bb_cache.dat, the output format is:
+# recipe_path PN PV PACKAGES
+#
+import os
+import sys
+import warnings
+
+# For importing bb.cache
+sys.path.insert(0, os.path.join(os.path.abspath(os.path.dirname(sys.argv[0])), '../lib'))
+from bb.cache import CoreRecipeInfo
+
+import cPickle as pickle
+
+def main(argv=None):
+    """
+    Get the mapping for the target recipe.
+    """
+    if len(argv) != 1:
+        print >>sys.stderr, "Error, need one argument!"
+        return 2
+
+    cachefile = argv[0]
+
+    with open(cachefile, "rb") as cachefile:
+        pickled = pickle.Unpickler(cachefile)
+        while cachefile:
+            try:
+                key = pickled.load()
+                val = pickled.load()
+            except Exception:
+                break
+            if isinstance(val, CoreRecipeInfo) and (not val.skipped):
+                pn = val.pn
+                # Filter out the native recipes.
+                if key.startswith('virtual:native:') or pn.endswith("-native"):
+                    continue
+
+                # 1.0 is the default version for a no PV recipe.
+                if val.__dict__.has_key("pv"):
+                    pv = val.pv
+                else:
+                    pv = "1.0"
+
+                print("%s %s %s %s" % (key, pn, pv, ' '.join(val.packages)))
+
+if __name__ == "__main__":
+    sys.exit(main(sys.argv[1:]))
+

bitbake/contrib/vim/ftdetect/bitbake.vim

@@ -0,0 +1,24 @@
+" Vim filetype detection file
+" Language:     BitBake
+" Author:       Ricardo Salveti <rsalveti@rsalveti.net>
+" Copyright:    Copyright (C) 2008  Ricardo Salveti <rsalveti@rsalveti.net>
+" Licence:      You may redistribute this under the same terms as Vim itself
+"
+" This sets up the syntax highlighting for BitBake files, like .bb, .bbclass and .inc
+
+if &compatible || version < 600
+    finish
+endif
+
+" .bb, .bbappend and .bbclass
+au BufNewFile,BufRead *.{bb,bbappend,bbclass}	set filetype=bitbake
+
+" .inc
+au BufNewFile,BufRead *.inc 		set filetype=bitbake
+
+" .conf
+au BufNewFile,BufRead *.conf
+    \ if (match(expand("%:p:h"), "conf") > 0) |
+    \     set filetype=bitbake |
+    \ endif
+

bitbake/contrib/vim/ftplugin/bitbake.vim

@@ -0,0 +1 @@
+set sts=4 sw=4 et

bitbake/contrib/vim/plugin/newbb.vim

@@ -0,0 +1,85 @@
+" Vim plugin file
+" Purpose:	Create a template for new bb files
+" Author:	Ricardo Salveti <rsalveti@gmail.com>
+" Copyright:	Copyright (C) 2008 Ricardo Salveti <rsalveti@gmail.com>
+"
+" This file is licensed under the MIT license, see COPYING.MIT in
+" this source distribution for the terms.
+"
+" Based on the gentoo-syntax package
+"
+" Will try to use git to find the user name and email
+
+if &compatible || v:version < 600
+    finish
+endif
+
+fun! <SID>GetUserName()
+    let l:user_name = system("git-config --get user.name")
+    if v:shell_error
+        return "Unknow User"
+    else
+        return substitute(l:user_name, "\n", "", "")
+endfun
+
+fun! <SID>GetUserEmail()
+    let l:user_email = system("git-config --get user.email")
+    if v:shell_error
+        return "unknow@user.org"
+    else
+        return substitute(l:user_email, "\n", "", "")
+endfun
+
+fun! BBHeader()
+    let l:current_year = strftime("%Y")
+    let l:user_name = <SID>GetUserName()
+    let l:user_email = <SID>GetUserEmail()
+    0 put ='# Copyright (C) ' . l:current_year .
+                \ ' ' . l:user_name . ' <' . l:user_email . '>'
+    put ='# Released under the MIT license (see COPYING.MIT for the terms)'
+    $
+endfun
+
+fun! NewBBTemplate()
+    let l:paste = &paste
+    set nopaste
+    
+    " Get the header
+    call BBHeader()
+
+    " New the bb template
+    put ='DESCRIPTION = \"\"'
+    put ='HOMEPAGE = \"\"'
+    put ='LICENSE = \"\"' 
+    put ='SECTION = \"\"'
+    put ='DEPENDS = \"\"'
+    put ='PR = \"r0\"'
+    put =''
+    put ='SRC_URI = \"\"'
+
+    " Go to the first place to edit
+    0
+    /^DESCRIPTION =/
+    exec "normal 2f\""
+
+    if paste == 1
+        set paste
+    endif
+endfun
+
+if !exists("g:bb_create_on_empty")
+    let g:bb_create_on_empty = 1
+endif
+
+" disable in case of vimdiff
+if v:progname =~ "vimdiff"
+    let g:bb_create_on_empty = 0
+endif
+
+augroup NewBB
+    au BufNewFile *.bb
+                \ if g:bb_create_on_empty |
+                \    call NewBBTemplate() |
+                \ endif
+augroup END
+

bitbake/contrib/vim/syntax/bitbake.vim

@@ -0,0 +1,123 @@
+" Vim syntax file
+" Language:     BitBake bb/bbclasses/inc
+" Author:       Chris Larson <kergoth@handhelds.org>
+"               Ricardo Salveti <rsalveti@rsalveti.net>
+" Copyright:    Copyright (C) 2004  Chris Larson <kergoth@handhelds.org>
+"               Copyright (C) 2008  Ricardo Salveti <rsalveti@rsalveti.net>
+"
+" This file is licensed under the MIT license, see COPYING.MIT in
+" this source distribution for the terms.
+"
+" Syntax highlighting for bb, bbclasses and inc files.
+"
+" It's an entirely new type, just has specific syntax in shell and python code
+
+if &compatible || v:version < 600
+    finish
+endif
+if exists("b:current_syntax")
+    finish
+endif
+
+syn include @python syntax/python.vim
+if exists("b:current_syntax")
+  unlet b:current_syntax
+endif
+
+" BitBake syntax
+
+" Matching case
+syn case match
+
+" Indicates the error when nothing is matched
+syn match bbUnmatched           "."
+
+" Comments
+syn cluster bbCommentGroup      contains=bbTodo,@Spell
+syn keyword bbTodo              COMBAK FIXME TODO XXX contained
+syn match bbComment             "#.*$" contains=@bbCommentGroup
+
+" String helpers
+syn match bbQuote               +['"]+ contained 
+syn match bbDelimiter           "[(){}=]" contained
+syn match bbArrayBrackets       "[\[\]]" contained
+
+" BitBake strings
+syn match bbContinue            "\\$"
+syn region bbString             matchgroup=bbQuote start=+"+ skip=+\\$+ excludenl end=+"+ contained keepend contains=bbTodo,bbContinue,bbVarDeref,bbVarPyValue,@Spell
+syn region bbString             matchgroup=bbQuote start=+'+ skip=+\\$+ excludenl end=+'+ contained keepend contains=bbTodo,bbContinue,bbVarDeref,bbVarPyValue,@Spell
+
+" Vars definition
+syn match bbExport            "^export" nextgroup=bbIdentifier skipwhite
+syn keyword bbExportFlag        export contained nextgroup=bbIdentifier skipwhite
+syn match bbIdentifier          "[a-zA-Z0-9\-_\.\/\+]\+" display contained
+syn match bbVarDeref            "${[a-zA-Z0-9\-_\.\/\+]\+}" contained
+syn match bbVarEq               "\(:=\|+=\|=+\|\.=\|=\.\|?=\|??=\|=\)" contained nextgroup=bbVarValue
+syn match bbVarDef              "^\(export\s*\)\?\([a-zA-Z0-9\-_\.\/\+]\+\(_[${}a-zA-Z0-9\-_\.\/\+]\+\)\?\)\s*\(:=\|+=\|=+\|\.=\|=\.\|?=\|??=\|=\)\@=" contains=bbExportFlag,bbIdentifier,bbVarDeref nextgroup=bbVarEq
+syn match bbVarValue            ".*$" contained contains=bbString,bbVarDeref,bbVarPyValue
+syn region bbVarPyValue         start=+${@+ skip=+\\$+ excludenl end=+}+ contained contains=@python
+
+" Vars metadata flags
+syn match bbVarFlagDef          "^\([a-zA-Z0-9\-_\.]\+\)\(\[[a-zA-Z0-9\-_\.]\+\]\)\@=" contains=bbIdentifier nextgroup=bbVarFlagFlag
+syn region bbVarFlagFlag        matchgroup=bbArrayBrackets start="\[" end="\]\s*\(=\)\@=" keepend excludenl contained contains=bbIdentifier nextgroup=bbVarEq
+
+" Includes and requires
+syn keyword bbInclude           inherit include require contained 
+syn match bbIncludeRest         ".*$" contained contains=bbString,bbVarDeref
+syn match bbIncludeLine         "^\(inherit\|include\|require\)\s\+" contains=bbInclude nextgroup=bbIncludeRest
+
+" Add taks and similar
+syn keyword bbStatement         addtask addhandler after before EXPORT_FUNCTIONS contained
+syn match bbStatementRest       ".*$" skipwhite contained contains=bbStatement
+syn match bbStatementLine       "^\(addtask\|addhandler\|after\|before\|EXPORT_FUNCTIONS\)\s\+" contains=bbStatement nextgroup=bbStatementRest
+
+" OE Important Functions
+syn keyword bbOEFunctions       do_fetch do_unpack do_patch do_configure do_compile do_stage do_install do_package contained
+
+" Generic Functions
+syn match bbFunction            "\h[0-9A-Za-z_-]*" display contained contains=bbOEFunctions
+
+" BitBake shell metadata
+syn include @shell syntax/sh.vim
+if exists("b:current_syntax")
+  unlet b:current_syntax
+endif
+syn keyword bbShFakeRootFlag    fakeroot contained
+syn match bbShFuncDef           "^\(fakeroot\s*\)\?\([0-9A-Za-z_-]\+\)\(python\)\@<!\(\s*()\s*\)\({\)\@=" contains=bbShFakeRootFlag,bbFunction,bbDelimiter nextgroup=bbShFuncRegion skipwhite
+syn region bbShFuncRegion       matchgroup=bbDelimiter start="{\s*$" end="^}\s*$" keepend contained contains=@shell
+
+" BitBake python metadata
+syn keyword bbPyFlag            python contained
+syn match bbPyFuncDef           "^\(python\s\+\)\([0-9A-Za-z_-]\+\)\?\(\s*()\s*\)\({\)\@=" contains=bbPyFlag,bbFunction,bbDelimiter nextgroup=bbPyFuncRegion skipwhite 
+syn region bbPyFuncRegion       matchgroup=bbDelimiter start="{\s*$" end="^}\s*$" keepend contained contains=@python
+
+" BitBake 'def'd python functions
+syn keyword bbPyDef             def contained
+syn region bbPyDefRegion        start='^\(def\s\+\)\([0-9A-Za-z_-]\+\)\(\s*(.*)\s*\):\s*$' end='^\(\s\|$\)\@!' contains=@python
+
+" Highlighting Definitions
+hi def link bbUnmatched         Error
+hi def link bbInclude           Include
+hi def link bbTodo              Todo
+hi def link bbComment           Comment
+hi def link bbQuote             String
+hi def link bbString            String
+hi def link bbDelimiter         Keyword
+hi def link bbArrayBrackets     Statement
+hi def link bbContinue          Special
+hi def link bbExport            Type
+hi def link bbExportFlag        Type
+hi def link bbIdentifier	    Identifier
+hi def link bbVarDeref          PreProc
+hi def link bbVarDef            Identifier
+hi def link bbVarValue          String
+hi def link bbShFakeRootFlag    Type
+hi def link bbFunction          Function
+hi def link bbPyFlag            Type
+hi def link bbPyDef             Statement
+hi def link bbStatement         Statement
+hi def link bbStatementRest     Identifier
+hi def link bbOEFunctions       Special
+hi def link bbVarPyValue        PreProc
+
+let b:current_syntax = "bb"

bitbake/doc/COPYING.GPL

@@ -0,0 +1,339 @@
+		    GNU GENERAL PUBLIC LICENSE
+		       Version 2, June 1991
+
+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.,
+ 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+			    Preamble
+
+  The licenses for most software are designed to take away your
+freedom to share and change it.  By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users.  This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it.  (Some other Free Software Foundation software is covered by
+the GNU Lesser General Public License instead.)  You can apply it to
+your programs, too.
+
+  When we speak of free software, we are referring to freedom, not
+price.  Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+
+  To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+  For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have.  You must make sure that they, too, receive or can get the
+source code.  And you must show them these terms so they know their
+rights.
+
+  We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+  Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software.  If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+  Finally, any free program is threatened constantly by software
+patents.  We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary.  To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.
+
+		    GNU GENERAL PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License.  The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language.  (Hereinafter, translation is included without limitation in
+the term "modification".)  Each licensee is addressed as "you".
+
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope.  The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
+  1. You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
+  2. You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+    a) You must cause the modified files to carry prominent notices
+    stating that you changed the files and the date of any change.
+
+    b) You must cause any work that you distribute or publish, that in
+    whole or in part contains or is derived from the Program or any
+    part thereof, to be licensed as a whole at no charge to all third
+    parties under the terms of this License.
+
+    c) If the modified program normally reads commands interactively
+    when run, you must cause it, when started running for such
+    interactive use in the most ordinary way, to print or display an
+    announcement including an appropriate copyright notice and a
+    notice that there is no warranty (or else, saying that you provide
+    a warranty) and that users may redistribute the program under
+    these conditions, and telling the user how to view a copy of this
+    License.  (Exception: if the Program itself is interactive but
+    does not normally print such an announcement, your work based on
+    the Program is not required to print an announcement.)
+
+These requirements apply to the modified work as a whole.  If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works.  But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+  3. You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
+    a) Accompany it with the complete corresponding machine-readable
+    source code, which must be distributed under the terms of Sections
+    1 and 2 above on a medium customarily used for software interchange; or,
+
+    b) Accompany it with a written offer, valid for at least three
+    years, to give any third party, for a charge no more than your
+    cost of physically performing source distribution, a complete
+    machine-readable copy of the corresponding source code, to be
+    distributed under the terms of Sections 1 and 2 above on a medium
+    customarily used for software interchange; or,
+
+    c) Accompany it with the information you received as to the offer
+    to distribute corresponding source code.  (This alternative is
+    allowed only for noncommercial distribution and only if you
+    received the program in object code or executable form with such
+    an offer, in accord with Subsection b above.)
+
+The source code for a work means the preferred form of the work for
+making modifications to it.  For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable.  However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+  4. You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License.  Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
+  5. You are not required to accept this License, since you have not
+signed it.  However, nothing else grants you permission to modify or
+distribute the Program or its derivative works.  These actions are
+prohibited by law if you do not accept this License.  Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
+  6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions.  You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
+  7. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all.  For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices.  Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+  8. If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded.  In such case, this License incorporates
+the limitation as if written in the body of this License.
+
+  9. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time.  Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number.  If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation.  If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
+  10. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission.  For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this.  Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+			    NO WARRANTY
+
+  11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+  12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
+
+		     END OF TERMS AND CONDITIONS
+
+	    How to Apply These Terms to Your New Programs
+
+  If you develop a new program, and you want it to be of the greatest
+possible use to the public, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these terms.
+
+  To do so, attach the following notices to the program.  It is safest
+to attach them to the start of each source file to most effectively
+convey the exclusion of warranty; and each file should have at least
+the "copyright" line and a pointer to where the full notice is found.
+
+    <one line to give the program's name and a brief idea of what it does.>
+    Copyright (C) <year>  <name of author>
+
+    This program is free software; you can redistribute it and/or modify
+    it under the terms of the GNU General Public License as published by
+    the Free Software Foundation; either version 2 of the License, or
+    (at your option) any later version.
+
+    This program is distributed in the hope that it will be useful,
+    but WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+    GNU General Public License for more details.
+
+    You should have received a copy of the GNU General Public License along
+    with this program; if not, write to the Free Software Foundation, Inc.,
+    51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+Also add information on how to contact you by electronic and paper mail.
+
+If the program is interactive, make it output a short notice like this
+when it starts in an interactive mode:
+
+    Gnomovision version 69, Copyright (C) year name of author
+    Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
+    This is free software, and you are welcome to redistribute it
+    under certain conditions; type `show c' for details.
+
+The hypothetical commands `show w' and `show c' should show the appropriate
+parts of the General Public License.  Of course, the commands you use may
+be called something other than `show w' and `show c'; they could even be
+mouse-clicks or menu items--whatever suits your program.
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the program, if
+necessary.  Here is a sample; alter the names:
+
+  Yoyodyne, Inc., hereby disclaims all copyright interest in the program
+  `Gnomovision' (which makes passes at compilers) written by James Hacker.
+
+  <signature of Ty Coon>, 1 April 1989
+  Ty Coon, President of Vice
+
+This General Public License does not permit incorporating your program into
+proprietary programs.  If your program is a subroutine library, you may
+consider it more useful to permit linking proprietary applications with the
+library.  If this is what you want to do, use the GNU Lesser General
+Public License instead of this License.

bitbake/doc/COPYING.MIT

@@ -0,0 +1,17 @@
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT
+SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR
+THE USE OR OTHER DEALINGS IN THE SOFTWARE.

bitbake/doc/bitbake.1

@@ -0,0 +1,142 @@
+.\"                                      Hey, EMACS: -*- nroff -*-
+.\" First parameter, NAME, should be all caps
+.\" Second parameter, SECTION, should be 1-8, maybe w/ subsection
+.\" other parameters are allowed: see man(7), man(1)
+.TH BITBAKE 1 "November 19, 2006"
+.\" Please adjust this date whenever revising the manpage.
+.\"
+.\" Some roff macros, for reference:
+.\" .nh        disable hyphenation
+.\" .hy        enable hyphenation
+.\" .ad l      left justify
+.\" .ad b      justify to both left and right margins
+.\" .nf        disable filling
+.\" .fi        enable filling
+.\" .br        insert line break
+.\" .sp <n>    insert n+1 empty lines
+.\" for manpage-specific macros, see man(7)
+.SH NAME
+BitBake \- simple tool for the execution of tasks
+.SH SYNOPSIS
+.B bitbake
+.RI [ options ] " packagenames"
+.br
+.SH DESCRIPTION
+This manual page documents briefly the
+.B bitbake
+command.
+.PP
+.\" TeX users may be more comfortable with the \fB<whatever>\fP and
+.\" \fI<whatever>\fP escape sequences to invode bold face and italics, 
+.\" respectively.
+\fBbitbake\fP is a program that executes the specified task (default is 'build')
+for a given set of BitBake files.
+.br
+It expects that BBFILES is defined, which is a space separated list of files to
+be executed. BBFILES does support wildcards.
+.br
+Default BBFILES are the .bb files in the current directory.
+.SH OPTIONS
+This program follow the usual GNU command line syntax, with long
+options starting with two dashes (`-').
+.TP
+.B \-h, \-\-help
+Show summary of options.
+.TP
+.B \-\-version
+Show version of program.
+.TP
+.B \-bBUILDFILE, \-\-buildfile=BUILDFILE
+execute the task against this .bb file, rather than a package from BBFILES.
+.TP
+.B \-k, \-\-continue
+continue as much as possible after an error. While the target that failed, and
+those that depend on it, cannot be remade, the other dependencies of these
+targets can be processed all the same.
+.TP
+.B \-a, \-\-tryaltconfigs
+continue with builds by trying to use alternative providers where possible.
+.TP
+.B \-f, \-\-force
+force run of specified cmd, regardless of stamp status
+.TP
+.B \-i, \-\-interactive
+drop into the interactive mode also called the BitBake shell.
+.TP
+.B \-cCMD, \-\-cmd=CMD
+Specify task to execute. Note that this only executes the specified task for
+the providee and the packages it depends on, i.e. 'compile' does not implicitly
+call stage for the dependencies (IOW: use only if you know what you are doing).
+Depending on the base.bbclass a listtasks task is defined and will show
+available tasks.
+.TP
+.B \-rFILE, \-\-read=FILE 
+read the specified file before bitbake.conf
+.TP
+.B \-v, \-\-verbose
+output more chit-chat to the terminal
+.TP
+.B \-D, \-\-debug
+Increase the debug level. You can specify this more than once.
+.TP
+.B \-n, \-\-dry-run
+don't execute, just go through the motions
+.TP
+.B \-p, \-\-parse-only
+quit after parsing the BB files (developers only)
+.TP
+.B \-s, \-\-show-versions
+show current and preferred versions of all packages
+.TP
+.B \-e, \-\-environment
+show the global or per-package environment (this is what used to be bbread)
+.TP
+.B \-g, \-\-graphviz
+emit the dependency trees of the specified packages in the dot syntax
+.TP
+.B \-IIGNORED\_DOT\_DEPS, \-\-ignore-deps=IGNORED_DOT_DEPS
+Stop processing at the given list of dependencies when generating dependency
+graphs. This can help to make the graph more appealing
+.TP
+.B \-lDEBUG_DOMAINS, \-\-log-domains=DEBUG_DOMAINS
+Show debug logging for the specified logging domains
+.TP
+.B \-P, \-\-profile
+profile the command and print a report
+.TP
+.B \-uUI, \-\-ui=UI
+User interface to use. Currently, hob, depexp, goggle or ncurses can be specified as UI.
+.TP
+.B \-tSERVERTYPE, \-\-servertype=SERVERTYPE
+Choose which server to use, none, process or xmlrpc.
+.TP
+.B \-\-revisions-changed
+Set the exit code depending on whether upstream floating revisions have changed or not.
+.TP
+.B \-\-server-only
+Run bitbake without UI,  the frontend can connect with bitbake server itself.
+.TP
+.B \-BBIND, \-\-bind=BIND
+The name/address for the bitbake server to bind to.
+.TP
+.B \-\-no\-setscene
+Do not run any setscene tasks, forces builds.
+
+.SH ENVIRONMENT VARIABLES
+bitbake uses the following environment variables to control its
+operation:
+.TP
+.B BITBAKE_UI
+The bitbake user interface; overridden by the \fB-u\fP commandline option.
+
+.SH AUTHORS
+BitBake was written by 
+Phil Blundell,
+Holger Freyther,
+Chris Larson,
+Mickey Lauer,
+Richard Purdie,
+Holger Schurig
+.PP
+This manual page was written by Marcin Juszkiewicz <marcin@hrw.one.pl>
+for the Debian project (but may be used by others).

bitbake/doc/manual/Makefile

@@ -0,0 +1,56 @@
+topdir = .
+manual = $(topdir)/usermanual.xml
+# types = pdf txt rtf ps xhtml html man tex texi dvi
+# types = pdf txt
+types = $(xmltotypes) $(htmltypes)
+xmltotypes = pdf txt
+htmltypes = html xhtml
+htmlxsl = $(if $(filter $@,$(foreach type,$(htmltypes),$(type)-nochunks)),http://docbook.sourceforge.net/release/xsl/current/xhtml/docbook.xsl,http://docbook.sourceforge.net/release/xsl/current/$@/chunk.xsl)
+htmlcssfile = docbook.css
+htmlcss = $(topdir)/html.css
+# htmlcssfile =
+# htmlcss =
+cleanfiles = $(foreach i,$(types),$(topdir)/$(i))
+
+ifdef DEBUG
+define command
+	$(1)
+endef
+else
+define command
+	@echo $(2) $(3) $(4)
+	@$(1) >/dev/null
+endef
+endif
+
+all: $(types)
+
+lint: $(manual) FORCE
+	$(call command,xmllint --xinclude --postvalid --noout $(manual),XMLLINT $(manual))
+
+$(types) $(foreach type,$(htmltypes),$(type)-nochunks): lint FORCE
+
+$(foreach type,$(htmltypes),$(type)-nochunks): $(if $(htmlcss),$(htmlcss)) $(manual)
+	@mkdir -p $@
+ifdef htmlcss
+	$(call command,install -m 0644 $(htmlcss) $@/$(htmlcssfile),CP $(htmlcss) $@/$(htmlcssfile))
+endif
+	$(call command,xsltproc --stringparam base.dir $@/ $(if $(htmlcssfile),--stringparam html.stylesheet $(htmlcssfile)) $(htmlxsl) $(manual) > $@/index.$(patsubst %-nochunks,%,$@),XSLTPROC $@ $(manual))
+
+$(htmltypes): $(if $(htmlcss),$(htmlcss)) $(manual)
+	@mkdir -p $@
+ifdef htmlcss
+	$(call command,install -m 0644 $(htmlcss) $@/$(htmlcssfile),CP $(htmlcss) $@/$(htmlcssfile))
+endif
+	$(call command,xsltproc --stringparam base.dir $@/ $(if $(htmlcssfile),--stringparam html.stylesheet $(htmlcssfile)) $(htmlxsl) $(manual),XSLTPROC $@ $(manual))
+
+$(xmltotypes): $(manual)
+	$(call command,xmlto --with-dblatex --extensions -o $(topdir)/$@ $@ $(manual),XMLTO $@ $(manual))
+
+clean:
+	rm -rf $(cleanfiles)
+
+$(foreach i,$(types) $(foreach type,$(htmltypes),$(type)-nochunks),clean-$(i)):
+	rm -rf $(patsubst clean-%,%,$@)
+
+FORCE: 

bitbake/doc/manual/html.css

@@ -0,0 +1,281 @@
+/* Feuille de style DocBook du projet Traduc.org                */
+/* DocBook CSS stylesheet of the Traduc.org project             */
+
+/* (c) Jean-Philippe Gu<47>rard - 14 ao<61>t 2004                     */
+/* (c) Jean-Philippe Gu<47>rard - 14 August 2004                   */
+
+/* Cette feuille de style est libre, vous pouvez la             */
+/* redistribuer et la modifier selon les termes de la Licence   */
+/* Art Libre. Vous trouverez un exemplaire de cette Licence sur */
+/* http://tigreraye.org/Petit-guide-du-traducteur.html#licence-art-libre */
+
+/* This work of art is free, you can redistribute it and/or     */
+/* modify it according to terms of the Free Art license. You    */
+/* will find a specimen of this license on the Copyleft         */
+/* Attitude web site: http://artlibre.org as well as on other   */
+/* sites.                                                       */
+/* Please note that the French version of this licence as shown */
+/* on http://tigreraye.org/Petit-guide-du-traducteur.html#licence-art-libre */
+/* is only official licence of this document. The English       */
+/* is only provided to help you understand this licence.        */
+
+/* La derni<6E>re version de cette feuille de style est toujours   */
+/* disponible sur<75>: http://tigreraye.org/style.css              */
+/* Elle est <20>galement disponible sur<75>:                          */
+/* http://www.traduc.org/docs/HOWTO/lecture/style.css           */
+
+/* The latest version of this stylesheet is available from:     */
+/* http://tigreraye.org/style.css                               */
+/* It is also available on:                                     */
+/* http://www.traduc.org/docs/HOWTO/lecture/style.css           */
+
+/* N'h<>sitez pas <20> envoyer vos commentaires et corrections <20>    */
+/* Jean-Philippe Gu<47>rard <jean-philippe.guerard@tigreraye.org>  */
+
+/* Please send feedback and bug reports to                      */
+/* Jean-Philippe Gu<47>rard <jean-philippe.guerard@tigreraye.org>  */
+
+/* $Id: style.css,v 1.14 2004/09/10 20:12:09 fevrier Exp fevrier $ */
+
+/* Pr<50>sentation g<>n<EFBFBD>rale du document */
+/* Overall document presentation */
+
+body {
+    /*
+    font-family: Apolline, "URW Palladio L", Garamond, jGaramond,
+                 "Bitstream Cyberbit", "Palatino Linotype", serif;
+     */
+    margin: 7%;
+    background-color: white;
+}
+
+/* Taille du texte */
+/* Text size */
+
+* { font-size: 100%; }
+
+/* Gestion des textes mis en relief imbriqu<71>s */
+/* Embedded emphasis */
+
+em { font-style: italic; }
+em em { font-style: normal; }
+em em em { font-style: italic; }
+
+/* Titres */
+/* Titles */
+
+h1 { font-size: 200%; font-weight: 900; }
+h2 { font-size: 160%; font-weight: 900; }
+h3 { font-size: 130%; font-weight: bold; }
+h4 { font-size: 115%; font-weight: bold; }
+h5 { font-size: 108%; font-weight: bold; }
+h6 {                  font-weight: bold; }
+
+/* Nom de famille en petites majuscules (uniquement en fran<61>ais) */
+/* Last names in small caps (for French only) */
+
+*[class~="surname"]:lang(fr) { font-variant: small-caps; }
+
+/* Blocs de citation */
+/* Quotation blocs */
+
+div[class~="blockquote"] {
+  border: solid 2px #AAA;
+  padding: 5px;
+  margin: 5px;
+}
+
+div[class~="blockquote"] > table {
+  border: none;
+}
+
+/* Blocs lit<69>raux<75>: fond gris clair */
+/* Literal blocs: light gray background */
+
+*[class~="literallayout"] {
+  background: #f0f0f0;
+  padding: 5px;
+  margin: 5px;
+}
+
+/* Programmes et captures texte<74>: fond bleu clair */
+/* Listing and text screen snapshots: light blue background */
+
+*[class~="programlisting"], *[class~="screen"] {
+  background: #f0f0ff;
+  padding: 5px;
+  margin: 5px;
+}
+
+/* Les textes <20> remplacer sont surlign<67>s en vert p<>le */
+/* Replaceable text in highlighted in pale green */
+
+*[class~="replaceable"] { 
+    background-color: #98fb98;
+    font-style: normal; }
+
+/* Tables<65>: fonds gris clair & bords simples */
+/* Tables: light gray background and solid borders */
+
+*[class~="table"] *[class~="title"] { width:100%; border: 0px; }
+
+table {
+    border: 1px solid #aaa;
+    border-collapse: collapse;
+    padding: 2px;
+    margin: 5px;
+}
+
+/* Listes simples en style table */
+/* Simples lists in table presentation */
+
+table[class~="simplelist"] {
+    background-color: #F0F0F0;
+    margin: 5px;
+    border: solid 1px #AAA;
+}
+
+table[class~="simplelist"] td {
+    border: solid 1px #AAA;
+}
+
+/* Les tables */
+/* Tables */
+
+*[class~="table"] table {
+    background-color: #F0F0F0;
+    border: solid 1px #AAA;
+}
+*[class~="informaltable"] table { background-color: #F0F0F0; }
+
+th,td {
+    vertical-align: baseline;
+    text-align: left;
+    padding: 0.1em 0.3em;
+    empty-cells: show; 
+}
+
+/* Alignement des colonnes */
+/* Colunms alignment */
+
+td[align=center] ,  th[align=center]  { text-align: center; }
+td[align=right] ,   th[align=right]   { text-align: right; }
+td[align=left] ,    th[align=left]    { text-align: left; }
+td[align=justify] , th[align=justify] { text-align: justify; }
+
+/* Pas de marge autour des images */
+/* No inside margins for images */
+
+img { border: 0; }
+
+/* Les liens ne sont pas soulign<67>s */
+/* No underlines for links */
+
+:link , :visited , :active { text-decoration: none; }
+
+/* Prudence<63>: cadre jaune et fond jaune clair */
+/* Caution: yellow border and light yellow background */
+
+*[class~="caution"] {
+    border: solid 2px yellow;
+    background-color: #ffffe0;
+    padding: 1em 6px 1em ;
+    margin: 5px;
+}
+
+*[class~="caution"] th {
+    vertical-align: middle
+}
+
+*[class~="caution"] table {
+    background-color: #ffffe0;
+    border: none;
+}
+
+/* Note importante<74>: cadre jaune et fond jaune clair */
+/* Important: yellow border and light yellow background */
+
+*[class~="important"] {
+    border: solid 2px yellow;
+    background-color: #ffffe0;
+    padding: 1em 6px 1em;
+    margin: 5px;
+}
+
+*[class~="important"] th {
+    vertical-align: middle
+}
+
+*[class~="important"] table  {
+    background-color: #ffffe0;
+    border: none;
+}
+
+/* Mise en <20>vidence<63>: texte l<>g<EFBFBD>rement plus grand */
+/* Highlights: slightly larger texts */
+
+*[class~="highlights"] {
+    font-size:  110%;
+}
+
+/* Note<74>: cadre bleu et fond bleu clair */
+/* Notes: blue border and light blue background */
+
+*[class~="note"]   {
+    border: solid 2px #7099C5;
+    background-color: #f0f0ff;
+    padding: 1em 6px 1em ;
+    margin: 5px;
+}
+
+*[class~="note"] th {
+    vertical-align: middle
+}
+
+*[class~="note"] table {
+    background-color: #f0f0ff;
+    border: none;
+}
+
+/* Astuce<63>: cadre vert et fond vert clair */
+/* Tip: green border and light green background */
+
+*[class~="tip"] {
+    border: solid 2px #00ff00;
+    background-color: #f0ffff;
+    padding: 1em 6px 1em ;
+    margin: 5px;
+}
+
+*[class~="tip"] th {
+    vertical-align: middle;
+}
+
+*[class~="tip"] table {
+    background-color: #f0ffff;
+    border: none;
+}
+
+/* Avertissement<6E>: cadre rouge et fond rouge clair */
+/* Warning: red border and light red background */
+
+*[class~="warning"] {
+    border: solid 2px #ff0000;
+    background-color: #fff0f0; 
+    padding: 1em 6px 1em ;
+    margin: 5px;
+}
+
+*[class~="warning"] th {
+    vertical-align: middle;
+}
+                    
+
+*[class~="warning"] table {
+    background-color: #fff0f0;
+    border: none;
+}
+
+/* Fin */
+/* The End */
+

bitbake/doc/manual/usermanual.xml

@@ -0,0 +1,609 @@
+<?xml version="1.0"?>
+<!--
+  ex:ts=4:sw=4:sts=4:et
+  -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+-->
+<!DOCTYPE book PUBLIC "-//OASIS//DTD DocBook XML V4.2//EN"
+                      "http://www.oasis-open.org/docbook/xml/4.2/docbookx.dtd">
+<book>
+    <bookinfo>
+        <title>BitBake User Manual</title>
+        <authorgroup>
+            <corpauthor>BitBake Team</corpauthor>
+        </authorgroup>
+        <copyright>
+            <year>2004, 2005, 2006, 2011</year>
+            <holder>Chris Larson</holder>
+            <holder>Phil Blundell</holder>
+            <holder>Richard Purdie</holder>
+        </copyright>
+        <legalnotice>
+            <para>This work is licensed under the Creative Commons Attribution License. To view a copy of this license, visit <ulink url="http://creativecommons.org/licenses/by/2.5/">http://creativecommons.org/licenses/by/2.5/</ulink> or send a letter to Creative Commons, 559 Nathan Abbott Way, Stanford, California 94305, USA.</para>
+        </legalnotice>
+    </bookinfo>
+    <chapter>
+        <title>Introduction</title>
+        <section>
+            <title>Overview</title>
+            <para>BitBake is, at its simplest, a tool for executing
+tasks and managing metadata.  As such, its similarities to GNU make and other
+build tools are readily apparent.  It was inspired by Portage, the package management system used by the Gentoo Linux distribution.  BitBake is the basis of the <ulink url="http://www.openembedded.org/">OpenEmbedded</ulink> project, which is being used to build and maintain a number of embedded Linux distributions/projects such as Angstrom and the Yocto project.</para>
+        </section>
+        <section>
+            <title>Background and goals</title>
+            <para>Prior to BitBake, no other build tool adequately met
+the needs of an aspiring embedded Linux distribution.  All of the
+buildsystems used by traditional desktop Linux distributions lacked
+important functionality, and none of the ad-hoc
+<emphasis>buildroot</emphasis> systems, prevalent in the
+embedded space, were scalable or maintainable.</para>
+
+      <para>Some important original goals for BitBake were:
+            <itemizedlist>
+                <listitem><para>Handle crosscompilation.</para></listitem>
+                <listitem><para>Handle interpackage dependencies (build time on target architecture, build time on native architecture, and runtime).</para></listitem>
+                <listitem><para>Support running any number of tasks within a given package, including, but not limited to, fetching upstream sources, unpacking them, patching them, configuring them, et cetera.</para></listitem>
+                <listitem><para>Must be Linux distribution agnostic (both build and target).</para></listitem>
+                <listitem><para>Must be architecture agnostic</para></listitem>
+                <listitem><para>Must support multiple build and target operating systems (including Cygwin, the BSDs, etc).</para></listitem>
+                <listitem><para>Must be able to be self contained, rather than tightly integrated into the build machine's root filesystem.</para></listitem>
+                <listitem><para>There must be a way to handle conditional metadata (on target architecture, operating system, distribution, machine).</para></listitem>
+                <listitem><para>It must be easy for the person using the tools to supply their own local metadata and packages to operate against.</para></listitem>
+                <listitem><para>Must make it easy to collaborate
+between multiple projects using BitBake for their
+builds.</para></listitem>
+		<listitem><para>Should provide an inheritance mechanism to
+share common metadata between many packages.</para></listitem>
+            </itemizedlist>
+        </para>
+        <para>Over time it has become apparent that some further requirements were necessary:
+            <itemizedlist>
+                <listitem><para>Handle variants of a base recipe (native, sdk, multilib).</para></listitem>
+                <listitem><para>Able to split metadata into layers and allow layers to override each other.</para></listitem>
+                <listitem><para>Allow representation of a given set of input variables to a task as a checksum.</para></listitem>
+                <listitem><para>based on that checksum, allow acceleration of builds with prebuilt components.</para></listitem>
+            </itemizedlist>
+        </para>
+
+        <para>BitBake satisfies all the original requirements and many more with extensions being made to the basic functionality to reflect the additionl requirements.  Flexibility and power have always been the priorities.  It is highly extensible, supporting embedded Python code and execution of any arbitrary tasks.</para>
+        </section>
+    </chapter>
+    <chapter>
+        <title>Metadata</title>
+        <section>
+            <title>Description</title>
+            <itemizedlist>
+                <para>BitBake metadata can be classified into 3 major areas:</para>
+                <listitem>
+                    <para>Configuration Files</para>
+                </listitem>
+                <listitem>
+                    <para>.bb Files</para>
+                </listitem>
+                <listitem>
+                    <para>Classes</para>
+                </listitem>
+            </itemizedlist>
+            <para>What follows are a large number of examples of BitBake metadata.  Any syntax which isn't supported in any of the aforementioned areas will be documented as such.</para>
+            <section>
+                <title>Basic variable setting</title>
+                <para><screen><varname>VARIABLE</varname> = "value"</screen></para>
+                <para>In this example, <varname>VARIABLE</varname> is <literal>value</literal>.</para>
+            </section>
+            <section>
+                <title>Variable expansion</title>
+                <para>BitBake supports variables referencing one another's contents using a syntax which is similar to shell scripting</para>
+                <para><screen><varname>A</varname> = "aval"
+<varname>B</varname> = "pre${A}post"</screen></para>
+                <para>This results in <varname>A</varname> containing <literal>aval</literal> and <varname>B</varname> containing <literal>preavalpost</literal>.</para>
+            </section>
+            <section>
+                <title>Setting a default value (?=)</title>
+                <para><screen><varname>A</varname> ?= "aval"</screen></para>
+                <para>If <varname>A</varname> is set before the above is called, it will retain its previous value. If <varname>A</varname> is unset prior to the above call, <varname>A</varname> will be set to <literal>aval</literal>.  Note that this assignment is immediate, so if there are multiple ?= assignments to a single variable, the first of those will be used.</para>
+            </section>
+            <section>
+                <title>Setting a weak default value (??=)</title>
+                <para><screen><varname>A</varname> ??= "somevalue"
+<varname>A</varname> ??= "someothervalue"</screen></para>
+                <para>If <varname>A</varname> is set before the above, it will retain that value.  If <varname>A</varname> is unset prior to the above, <varname>A</varname> will be set to <literal>someothervalue</literal>.  This is a lazy/weak assignment in that the assignment does not occur until the end of the parsing process, so that the last, rather than the first, ??= assignment to a given variable will be used. Any other setting of A using = or ?= will however override the value set with ??=</para>
+            </section>
+            <section>
+                <title>Immediate variable expansion (:=)</title>
+                <para>:= results in a variable's contents being expanded immediately, rather than when the variable is actually used.</para>
+                <para><screen><varname>T</varname> = "123"
+<varname>A</varname> := "${B} ${A} test ${T}"
+<varname>T</varname> = "456"
+<varname>B</varname> = "${T} bval"
+
+<varname>C</varname> = "cval"
+<varname>C</varname> := "${C}append"</screen></para>
+                <para>In that example, <varname>A</varname> would contain <literal> test 123</literal>, <varname>B</varname> would contain <literal>456 bval</literal>, and <varname>C</varname> would be <literal>cvalappend</literal>.</para>
+            </section>
+            <section>
+                <title>Appending (+=) and prepending (=+)</title>
+                <para><screen><varname>B</varname> = "bval"
+<varname>B</varname> += "additionaldata"
+<varname>C</varname> = "cval"
+<varname>C</varname> =+ "test"</screen></para>
+                <para>In this example, <varname>B</varname> is now <literal>bval additionaldata</literal> and <varname>C</varname> is <literal>test cval</literal>.</para>
+            </section>
+            <section>
+                <title>Appending (.=) and prepending (=.) without spaces</title>
+                    <para><screen><varname>B</varname> = "bval"
+<varname>B</varname> .= "additionaldata"
+<varname>C</varname> = "cval"
+<varname>C</varname> =. "test"</screen></para>
+                <para>In this example, <varname>B</varname> is now <literal>bvaladditionaldata</literal> and <varname>C</varname> is <literal>testcval</literal>. In contrast to the above appending and prepending operators, no additional space
+will be introduced.</para>
+            </section>
+            <section>
+                <title>Conditional metadata set</title>
+                <para>OVERRIDES is a <quote>:</quote> separated variable containing each item you want to satisfy conditions.  So, if you have a variable which is conditional on <quote>arm</quote>, and <quote>arm</quote> is in OVERRIDES, then the <quote>arm</quote> specific version of the variable is used rather than the non-conditional version.  Example:</para>
+                <para><screen><varname>OVERRIDES</varname> = "architecture:os:machine"
+<varname>TEST</varname> = "defaultvalue"
+<varname>TEST_os</varname> = "osspecificvalue"
+<varname>TEST_condnotinoverrides</varname> = "othercondvalue"</screen></para>
+                <para>In this example, <varname>TEST</varname> would be <literal>osspecificvalue</literal>, due to the condition <quote>os</quote> being in <varname>OVERRIDES</varname>.</para>
+            </section>
+            <section>
+                <title>Conditional appending</title>
+                <para>BitBake also supports appending and prepending to variables based on whether something is in OVERRIDES.  Example:</para>
+                <para><screen><varname>DEPENDS</varname> = "glibc ncurses"
+<varname>OVERRIDES</varname> = "machine:local"
+<varname>DEPENDS_append_machine</varname> = " libmad"</screen></para>
+                <para>In this example, <varname>DEPENDS</varname> is set to <literal>glibc ncurses libmad</literal>.</para>
+            </section>
+            <section>
+                <title>Inclusion</title>
+                <para>Next, there is the <literal>include</literal> directive, which causes BitBake to parse whatever file you specify, and insert it at that location, which is not unlike <command>make</command>.  However, if the path specified on the <literal>include</literal> line is a relative path, BitBake will locate the first one it can find within <envar>BBPATH</envar>.</para>
+            </section>
+            <section>
+                <title>Requiring inclusion</title>
+                <para>In contrast to the <literal>include</literal> directive, <literal>require</literal> will
+raise an ParseError if the file to be included cannot be found. Otherwise it will behave just like the <literal>
+include</literal> directive.</para>
+            </section>
+            <section>
+                <title>Python variable expansion</title>
+                <para><screen><varname>DATE</varname> = "${@time.strftime('%Y%m%d',time.gmtime())}"</screen></para>
+                <para>This would result in the <varname>DATE</varname> variable containing today's date.</para>
+            </section>
+            <section>
+                <title>Defining executable metadata</title>
+                <para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
+                <para><screen>do_mytask () {
+    echo "Hello, world!"
+}</screen></para>
+                <para>This is essentially identical to setting a variable, except that this variable happens to be executable shell code.</para>
+                <para><screen>python do_printdate () {
+    import time
+    print time.strftime('%Y%m%d', time.gmtime())
+}</screen></para>
+                <para>This is the similar to the previous, but flags it as Python so that BitBake knows it is Python code.</para>
+            </section>
+            <section>
+                <title>Defining Python functions into the global Python namespace</title>
+                <para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
+                <para><screen>def get_depends(bb, d):
+    if d.getVar('SOMECONDITION', True):
+        return "dependencywithcond"
+    else:
+        return "dependency"
+
+<varname>SOMECONDITION</varname> = "1"
+<varname>DEPENDS</varname> = "${@get_depends(bb, d)}"</screen></para>
+                <para>This would result in <varname>DEPENDS</varname> containing <literal>dependencywithcond</literal>.</para>
+            </section>
+            <section>
+                <title>Variable flags</title>
+                <para>Variables can have associated flags which provide a way of tagging extra information onto a variable. Several flags are used internally by BitBake but they can be used externally too if needed. The standard operations mentioned above also work on flags.</para>
+                <para><screen><varname>VARIABLE</varname>[<varname>SOMEFLAG</varname>] = "value"</screen></para>
+                <para>In this example, <varname>VARIABLE</varname> has a flag, <varname>SOMEFLAG</varname> which is set to <literal>value</literal>.</para>
+            </section>
+            <section>
+                <title>Inheritance</title>
+                <para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
+                <para>The <literal>inherit</literal> directive is a means of specifying what classes of functionality your .bb requires.  It is a rudimentary form of inheritance.  For example, you can easily abstract out the tasks involved in building a package that uses autoconf and automake, and put that into a bbclass for your packages to make use of.  A given bbclass is located by searching for classes/filename.bbclass in <envar>BBPATH</envar>, where filename is what you inherited.</para>
+            </section>
+            <section>
+                <title>Tasks</title>
+                <para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
+                <para>In BitBake, each step that needs to be run for a given .bb is known as a task.  There is a command <literal>addtask</literal> to add new tasks (must be a defined Python executable metadata and must start with <quote>do_</quote>) and describe intertask dependencies.</para>
+                <para><screen>python do_printdate () {
+    import time
+    print time.strftime('%Y%m%d', time.gmtime())
+}
+
+addtask printdate before do_build</screen></para>
+                <para>This defines the necessary Python function and adds it as a task which is now a dependency of do_build, the default task.  If anyone executes the do_build task, that will result in do_printdate being run first.</para>
+            </section>
+
+            <section>
+                <title>Task Flags</title>
+                <para>Tasks support a number of flags which control various functionality of the task. These are as follows:</para>
+                <para>'dirs' - directories which should be created before the task runs</para>
+                <para>'cleandirs' - directories which should created before the task runs but should be empty</para>
+                <para>'noexec' - marks the tasks as being empty and no execution required. These are used as dependency placeholders or used when added tasks need to be subsequently disabled.</para>
+                <para>'nostamp' - don't generate a stamp file for a task. This means the task is always rexecuted.</para>
+                <para>'fakeroot' - this task needs to be run in a fakeroot environment, obtained by adding the variables in FAKEROOTENV to the environment.</para>
+                <para>'umask' - the umask to run the task under.</para>
+                <para> For the 'deptask', 'rdeptask', 'depends', 'rdepends' and 'recrdeptask' flags please see the dependencies section.</para>
+            </section>
+
+            <section>
+                <title>Events</title>
+                <para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
+                <para>BitBake allows installation of event handlers.  Events are triggered at certain points during operation, such as the beginning of operation against a given .bb, the start of a given task, task failure, task success, et cetera.  The intent is to make it easy to do things like email notification on build failure.</para>
+                <para><screen>addhandler myclass_eventhandler
+python myclass_eventhandler() {
+    from bb.event import getName
+    from bb import data
+
+    print("The name of the Event is %s" % getName(e))
+    print("The file we run for is %s" % data.getVar('FILE', e.data, True))
+}
+</screen></para><para>
+This event handler gets called every time an event is triggered. A global variable <varname>e</varname> is defined. <varname>e</varname>.data contains an instance of bb.data. With the getName(<varname>e</varname>)
+method one can get the name of the triggered event.</para><para>The above event handler prints the name
+of the event and the content of the <varname>FILE</varname> variable.</para>
+            </section>
+            <section>
+                <title>Variants</title>
+                <para>Two BitBake features exist to facilitate the creation of multiple buildable incarnations from a single recipe file.</para>
+                <para>The first is <varname>BBCLASSEXTEND</varname>.  This variable is a space separated list of classes used to "extend" the recipe for each variant.  As an example, setting <screen>BBCLASSEXTEND = "native"</screen> results in a second incarnation of the current recipe being available.  This second incarnation will have the "native" class inherited.</para>
+                <para>The second feature is <varname>BBVERSIONS</varname>.  This variable allows a single recipe to build multiple versions of a project from a single recipe file, and allows you to specify conditional metadata (using the <varname>OVERRIDES</varname> mechanism) for a single version, or an optionally named range of versions:</para>
+                <para><screen>BBVERSIONS = "1.0 2.0 git"
+SRC_URI_git = "git://someurl/somepath.git"</screen></para>
+                <para><screen>BBVERSIONS = "1.0.[0-6]:1.0.0+ \
+              1.0.[7-9]:1.0.7+"
+SRC_URI_append_1.0.7+ = "file://some_patch_which_the_new_versions_need.patch;patch=1"</screen></para>
+                <para>Note that the name of the range will default to the original version of the recipe, so given OE, a recipe file of foo_1.0.0+.bb will default the name of its versions to 1.0.0+.  This is useful, as the range name is not only placed into overrides; it's also made available for the metadata to use in the form of the <varname>BPV</varname> variable, for use in file:// search paths (<varname>FILESPATH</varname>).</para>
+            </section>
+        </section>
+
+        <section>
+            <title>Variable interaction: Worked Examples</title>
+            <para>Despite the documentation of the different forms of variable definition above, it can be hard to work out what happens when variable operators are combined. This section documents some common questions people have regarding the way variables interact.</para>
+
+            <section>
+                <title>Override and append ordering</title>
+
+                <para>There is often confusion about which order overrides and the various append operators take effect.</para>
+
+                <para><screen><varname>OVERRIDES</varname> = "foo"
+<varname>A_foo_append</varname> = "X"</screen></para>
+                <para>In this case, X is unconditionally appended to the variable <varname>A_foo</varname>. Since foo is an override, A_foo would then replace <varname>A</varname>.</para>
+
+                 <para><screen><varname>OVERRIDES</varname> = "foo"
+<varname>A</varname> = "X"
+<varname>A_append_foo</varname> = "Y"</screen></para>
+                <para>In this case, only when foo is in OVERRIDES, Y is appended to the variable <varname>A</varname> so the value of <varname>A</varname> would become XY (NB: no spaces are appended).</para>
+
+                <para><screen><varname>OVERRIDES</varname> = "foo"
+<varname>A_foo_append</varname> = "X"
+<varname>A_foo_append</varname> += "Y"</screen></para>
+                <para>This behaves as per the first case above, but the value of <varname>A</varname> would be "X Y" instead of just "X".</para>
+
+                <para><screen><varname>A</varname> = "1"
+<varname>A_append</varname> = "2"
+<varname>A_append</varname> = "3"
+<varname>A</varname> += "4"
+<varname>A</varname> .= "5"</screen></para>
+
+                <para>Would ultimately result in <varname>A</varname> taking the value "1 4523" since the _append operator executes at the same time as the expansion of other overrides.</para>
+
+            </section>
+            <section>
+                <title>Key Expansion</title>
+
+                <para>Key expansion happens at the data store finalisation time just before overrides are expanded.</para>
+
+                <para><screen><varname>A${B}</varname> = "X"
+<varname>B</varname> = "2"
+<varname>A2</varname> = "Y"</screen></para>
+                <para>So in this case <varname>A2</varname> would take the value of "X".</para>
+            </section>
+
+        </section>
+        <section>
+            <title>Dependency handling</title>
+            <para>BitBake handles dependencies at the task level since to allow for efficient operation with multiple processed executing in parallel. A robust method of specifying task dependencies is therefore needed. </para>
+            <section>
+                <title>Dependencies internal to the .bb file</title>
+                <para>Where the dependencies are internal to a given .bb file, the dependencies are handled by the previously detailed addtask directive.</para>
+            </section>
+
+            <section>
+                <title>Build Dependencies</title>
+                <para>DEPENDS lists build time dependencies. The 'deptask' flag for tasks is used to signify the task of each item listed in DEPENDS which must have completed before that task can be executed.</para>
+                <para><screen>do_configure[deptask] = "do_populate_staging"</screen></para>
+                <para>means the do_populate_staging task of each item in DEPENDS must have completed before do_configure can execute.</para>
+            </section>
+            <section>
+                <title>Runtime Dependencies</title>
+                <para>The PACKAGES variable lists runtime packages and each of these can have RDEPENDS and RRECOMMENDS runtime dependencies. The 'rdeptask' flag for tasks is used to signify the task of each item runtime dependency which must have completed before that task can be executed.</para>
+                <para><screen>do_package_write[rdeptask] = "do_package"</screen></para>
+                <para>means the do_package task of each item in RDEPENDS must have completed before do_package_write can execute.</para>
+            </section>
+            <section>
+                <title>Recursive Dependencies</title>
+                <para>These are specified with the 'recrdeptask' flag which is used signify the task(s) of dependencies which must have completed before that task can be executed. It works by looking though the build and runtime dependencies of the current recipe as well as any inter-task dependencies the task has, then adding a dependency on the listed task. It will then recurse through the dependencies of those tasks and so on.</para>
+                <para>It may be desireable to recurse not just through the dependencies of those tasks but through the build and runtime dependencies of dependent tasks too. If that is the case, the taskname itself should be referenced in the task list, e.g. do_a[recrdeptask] = "do_a do_b".</para>
+            </section>
+            <section>
+                <title>Inter task</title>
+                <para>The 'depends' flag for tasks is a more generic form of which allows an interdependency on specific tasks rather than specifying the data in DEPENDS.</para>
+                <para><screen>do_patch[depends] = "quilt-native:do_populate_staging"</screen></para>
+                <para>means the do_populate_staging task of the target quilt-native must have completed before the do_patch can execute.</para>
+                <para>The 'rdepends' flag works in a similar way but takes targets in the runtime namespace instead of the build time dependency namespace.</para>
+            </section>
+        </section>
+
+        <section>
+            <title>Parsing</title>
+            <section>
+                <title>Configuration files</title>
+                <para>The first kind of metadata in BitBake is configuration metadata.  This metadata is global, and therefore affects <emphasis>all</emphasis> packages and tasks which are executed.</para>
+                <para>BitBake will first search the current working directory for an optional "conf/bblayers.conf" configuration file. This file is expected to contain a BBLAYERS variable which is a space delimited list of 'layer' directories. For each directory in this list, a "conf/layer.conf" file will be searched for and parsed with the LAYERDIR variable being set to the directory where the layer was found. The idea is these files will setup BBPATH and other variables correctly for a given build directory automatically for the user.</para>
+                <para>BitBake will then expect to find 'conf/bitbake.conf' somewhere in the user specified <envar>BBPATH</envar>.  That configuration file generally has include directives to pull in any other metadata (generally files specific to architecture, machine, <emphasis>local</emphasis> and so on).</para>
+                <para>Only variable definitions and include directives are allowed in .conf files.</para>
+            </section>
+            <section>
+                <title>Classes</title>
+                <para>BitBake classes are our rudimentary inheritance mechanism.  As briefly mentioned in the metadata introduction, they're parsed when an <literal>inherit</literal> directive is encountered, and they are located in classes/ relative to the directories in <envar>BBPATH</envar>.</para>
+            </section>
+            <section>
+                <title>.bb files</title>
+                <para>A BitBake (.bb) file is a logical unit of tasks to be executed.  Normally this is a package to be built.  Inter-.bb dependencies are obeyed.  The files themselves are located via the <varname>BBFILES</varname> variable, which is set to a space separated list of .bb files, and does handle wildcards.</para>
+            </section>
+        </section>
+    </chapter>
+
+    <chapter>
+        <title>File download support</title>
+        <section>
+            <title>Overview</title>
+            <para>BitBake provides support to download files this procedure is called fetching and it handled by the fetch and fetch2 modules. At this point the original fetch code is considered to be replaced by fetch2 and this manual only related to the fetch2 codebase.</para>
+
+            <para>The SRC_URI is normally used to tell BitBake which files to fetch. The next sections will describe the available fetchers and their options. Each fetcher honors a set of variables and per URI parameters separated by a <quote>;</quote> consisting of a key and a value. The semantics of the variables and parameters are defined by the fetcher. BitBake tries to have consistent semantics between the different fetchers.
+            </para>
+
+            <para>The overall fetch process is that first, fetches are attempted from PREMIRRORS. If those don't work, the original SRC_URI is attempted and if that fails, BitBake will fall back to MIRRORS. Cross urls are supported, so its possible to mirror a git repository on an http server as a tarball for example. Some example commonly used mirror definitions are:</para>
+
+            <para><screen><varname>PREMIRRORS</varname> ?= "\
+bzr://.*/.*   http://somemirror.org/sources/ \n \
+cvs://.*/.*   http://somemirror.org/sources/ \n \
+git://.*/.*   http://somemirror.org/sources/ \n \
+hg://.*/.*    http://somemirror.org/sources/ \n \
+osc://.*/.*   http://somemirror.org/sources/ \n \
+p4://.*/.*    http://somemirror.org/sources/ \n \
+svk://.*/.*   http://somemirror.org/sources/ \n \
+svn://.*/.*   http://somemirror.org/sources/ \n"
+
+<varname>MIRRORS</varname> =+ "\
+ftp://.*/.*      http://somemirror.org/sources/ \n \
+http://.*/.*     http://somemirror.org/sources/ \n \
+https://.*/.*    http://somemirror.org/sources/ \n"</screen></para>
+
+            <para>Non-local downloaded output is placed into the directory specified by the <varname>DL_DIR</varname>. For non local archive downloads the code can verify sha256 and md5 checksums for the download to ensure the file has been downloaded correctly. These may be specified either in the form <varname>SRC_URI[md5sum]</varname> for the md5 checksum and <varname>SRC_URI[sha256sum]</varname> for the sha256 checksum or as parameters on the SRC_URI such as SRC_URI="http://example.com/foobar.tar.bz2;md5sum=4a8e0f237e961fd7785d19d07fdb994d". If <varname>BB_STRICT_CHECKSUM</varname> is set, any download without a checksum will trigger an error message. In cases where multiple files are listed in SRC_URI, the name parameter is used assign names to the urls and these are then specified in the checksums in the form SRC_URI[name.sha256sum].</para>
+
+        </section>
+
+        <section>
+            <title>Local file fetcher</title>
+            <para>The URN for the local file fetcher is <emphasis>file</emphasis>. The filename can be either absolute or relative. If the filename is relative, <varname>FILESPATH</varname> and failing that <varname>FILESDIR</varname> will be used to find the appropriate relative file. The metadata usually extend these variables to include variations of the values in <varname>OVERRIDES</varname>. Single files and complete directories can be specified.
+<screen><varname>SRC_URI</varname>= "file://relativefile.patch"
+<varname>SRC_URI</varname>= "file://relativefile.patch;this=ignored"
+<varname>SRC_URI</varname>= "file:///Users/ich/very_important_software"
+</screen>
+            </para>
+        </section>
+
+        <section>
+            <title>CVS fetcher</title>
+            <para>The URN for the CVS fetcher is <emphasis>cvs</emphasis>. This fetcher honors the variables <varname>CVSDIR</varname>, <varname>SRCDATE</varname>, <varname>FETCHCOMMAND_cvs</varname>, <varname>UPDATECOMMAND_cvs</varname>. <varname>DL_DIR</varname> specifies where a temporary checkout is saved. <varname>SRCDATE</varname> specifies which date to use when doing the fetching (the special value of "now" will cause the checkout to be updated on every build). <varname>FETCHCOMMAND</varname> and <varname>UPDATECOMMAND</varname> specify which executables to use for the CVS checkout or update.
+            </para>
+            <para>The supported parameters are <varname>module</varname>, <varname>tag</varname>, <varname>date</varname>, <varname>method</varname>, <varname>localdir</varname>, <varname>rsh</varname> and <varname>scmdata</varname>. The <varname>module</varname> specifies which module to check out, the <varname>tag</varname> describes which CVS TAG should be used for the checkout. By default the TAG is empty. A <varname>date</varname> can be specified to override the SRCDATE of the configuration to checkout a specific date.  The special value of "now" will cause the checkout to be updated on every build.<varname>method</varname> is by default <emphasis>pserver</emphasis>. If <emphasis>ext</emphasis> is used the <varname>rsh</varname> parameter will be evaluated and <varname>CVS_RSH</varname> will be set. Finally, <varname>localdir</varname> is used to checkout into a special directory relative to <varname>CVSDIR</varname>.
+
+<screen><varname>SRC_URI</varname> = "cvs://CVSROOT;module=mymodule;tag=some-version;method=ext"
+<varname>SRC_URI</varname> = "cvs://CVSROOT;module=mymodule;date=20060126;localdir=usethat"
+</screen>
+            </para>
+        </section>
+
+        <section>
+            <title>HTTP/FTP fetcher</title>
+            <para>The URNs for the HTTP/FTP fetcher are <emphasis>http</emphasis>, <emphasis>https</emphasis> and <emphasis>ftp</emphasis>. This fetcher honors the variables <varname>FETCHCOMMAND_wget</varname>. <varname>FETCHCOMMAND</varname> contains the command used for fetching. <quote>${URI}</quote> and <quote>${FILES}</quote> will be replaced by the URI and basename of the file to be fetched.
+            </para>
+            <para><screen><varname>SRC_URI</varname> = "http://oe.handhelds.org/not_there.aac"
+<varname>SRC_URI</varname> = "ftp://oe.handhelds.org/not_there_as_well.aac"
+<varname>SRC_URI</varname> = "ftp://you@oe.handheld.sorg/home/you/secret.plan"
+</screen></para>
+        </section>
+
+        <section>
+            <title>SVN fetcher</title>
+            <para>The URN for the SVN fetcher is <emphasis>svn</emphasis>.
+            </para>
+            <para>This fetcher honors the variables <varname>FETCHCOMMAND_svn</varname>, <varname>SVNDIR</varname>, <varname>SRCREV</varname>. <varname>FETCHCOMMAND</varname> contains the subversion command. <varname>SRCREV</varname> specifies which revision to use when doing the fetching.
+            </para>
+            <para>The supported parameters are <varname>proto</varname>, <varname>rev</varname> and <varname>scmdata</varname>. <varname>proto</varname> is the Subversion protocol, <varname>rev</varname> is the Subversion revision. If <varname>scmdata</varname> is set to <quote>keep</quote>, the <quote>.svn</quote> directories will be available during compile-time.
+            </para>
+            <para><screen><varname>SRC_URI</varname> = "svn://svn.oe.handhelds.org/svn;module=vip;proto=http;rev=667"
+<varname>SRC_URI</varname> = "svn://svn.oe.handhelds.org/svn/;module=opie;proto=svn+ssh;date=20060126"
+</screen></para>
+        </section>
+
+        <section>
+            <title>GIT fetcher</title>
+            <para>The URN for the GIT Fetcher is <emphasis>git</emphasis>.
+            </para>
+            <para>The variable <varname>GITDIR</varname> will be used as the base directory where the git tree is cloned to.
+            </para>
+            <para>The parameters are <emphasis>tag</emphasis>, <emphasis>protocol</emphasis> and <emphasis>scmdata</emphasis>. <emphasis>tag</emphasis> is a Git tag, the default is <quote>master</quote>. <emphasis>protocol</emphasis> is the Git protocol to use and defaults to <quote>git</quote> if a hostname is set, otherwise its <quote>file</quote>. If <emphasis>scmdata</emphasis> is set to <quote>keep</quote>, the <quote>.git</quote> directory will be available during compile-time.
+            </para>
+            <para><screen><varname>SRC_URI</varname> = "git://git.oe.handhelds.org/git/vip.git;tag=version-1"
+<varname>SRC_URI</varname> = "git://git.oe.handhelds.org/git/vip.git;protocol=http"
+            </screen></para>
+        </section>
+
+    </chapter>
+
+
+    <chapter>
+        <title>The BitBake command</title>
+            <section>
+                <title>Introduction</title>
+                <para>bitbake is the primary command in the system.  It facilitates executing tasks in a single .bb file, or executing a given task on a set of multiple .bb files, accounting for interdependencies amongst them.</para>
+            </section>
+            <section>
+                <title>Usage and syntax</title>
+                <para>
+                    <screen><prompt>$ </prompt>bitbake --help
+usage: bitbake [options] [package ...]
+
+Executes the specified task (default is 'build') for a given set of BitBake files.
+It expects that BBFILES is defined, which is a space separated list of files to
+be executed.  BBFILES does support wildcards.
+Default BBFILES are the .bb files in the current directory.
+
+options:
+  --version             show program's version number and exit
+  -h, --help            show this help message and exit
+  -b BUILDFILE, --buildfile=BUILDFILE
+                        execute the task against this .bb file, rather than a
+                        package from BBFILES.
+  -k, --continue        continue as much as possible after an error. While the
+                        target that failed, and those that depend on it,
+                        cannot be remade, the other dependencies of these
+                        targets can be processed all the same.
+  -f, --force           force run of specified cmd, regardless of stamp status
+  -i, --interactive     drop into the interactive mode also called the BitBake
+                        shell.
+  -c CMD, --cmd=CMD     Specify task to execute. Note that this only executes
+                        the specified task for the providee and the packages
+                        it depends on, i.e. 'compile' does not implicitly call
+                        stage for the dependencies (IOW: use only if you know
+                        what you are doing). Depending on the base.bbclass a
+                        listtasks task is defined and will show available
+                        tasks
+  -r FILE, --read=FILE  read the specified file before bitbake.conf
+  -v, --verbose         output more chit-chat to the terminal
+  -D, --debug           Increase the debug level. You can specify this more
+                        than once.
+  -n, --dry-run         don't execute, just go through the motions
+  -p, --parse-only      quit after parsing the BB files (developers only)
+  -s, --show-versions   show current and preferred versions of all packages
+  -e, --environment     show the global or per-package environment (this is
+                        what used to be bbread)
+  -g, --graphviz        emit the dependency trees of the specified packages in
+                        the dot syntax
+  -I IGNORED_DOT_DEPS, --ignore-deps=IGNORED_DOT_DEPS
+                        Stop processing at the given list of dependencies when
+                        generating dependency graphs. This can help to make
+                        the graph more appealing
+  -l DEBUG_DOMAINS, --log-domains=DEBUG_DOMAINS
+                        Show debug logging for the specified logging domains
+  -P, --profile         profile the command and print a report
+
+
+</screen>
+                </para>
+                <para>
+                <example>
+                    <title>Executing a task against a single .bb</title>
+                    <para>Executing tasks for a single file is relatively simple.  You specify the file in question, and BitBake parses it and executes the specified task (or <quote>build</quote> by default).  It obeys intertask dependencies when doing so.</para>
+                    <para><quote>clean</quote> task:</para>
+                    <para><screen><prompt>$ </prompt>bitbake -b blah_1.0.bb -c clean</screen></para>
+                    <para><quote>build</quote> task:</para>
+                    <para><screen><prompt>$ </prompt>bitbake -b blah_1.0.bb</screen></para>
+                </example>
+                </para>
+                <para>
+                <example>
+                    <title>Executing tasks against a set of .bb files</title>
+                    <para>There are a number of additional complexities introduced when one wants to manage multiple .bb files.  Clearly there needs to be a way to tell BitBake what files are available, and of those, which we want to execute at this time.  There also needs to be a way for each .bb to express its dependencies, both for build time and runtime.  There must be a way for the user to express their preferences when multiple .bb's provide the same functionality, or when there are multiple versions of a .bb.</para>
+                    <para>The next section, Metadata, outlines how to specify such things.</para>
+                    <para>Note that the bitbake command, when not using --buildfile, accepts a <varname>PROVIDER</varname>, not a filename or anything else.  By default, a .bb generally PROVIDES its packagename, packagename-version, and packagename-version-revision.</para>
+                    <screen><prompt>$ </prompt>bitbake blah</screen>
+                    <screen><prompt>$ </prompt>bitbake blah-1.0</screen>
+                    <screen><prompt>$ </prompt>bitbake blah-1.0-r0</screen>
+                    <screen><prompt>$ </prompt>bitbake -c clean blah</screen>
+                    <screen><prompt>$ </prompt>bitbake virtual/whatever</screen>
+                    <screen><prompt>$ </prompt>bitbake -c clean virtual/whatever</screen>
+                </example>
+                <example>
+                    <title>Generating dependency graphs</title>
+                    <para>BitBake is able to generate dependency graphs using the dot syntax. These graphs can be converted
+to images using the <application>dot</application> application from <ulink url="http://www.graphviz.org">Graphviz</ulink>. 
+Two files will be written into the current working directory, <emphasis>depends.dot</emphasis> containing dependency information at the package level and <emphasis>task-depends.dot</emphasis> containing a breakdown of the dependencies at the task level. To stop depending on common depends, one can use the <prompt>-I depend</prompt> to omit these from the graph. This can lead to more readable graphs.  This way, <varname>DEPENDS</varname> from inherited classes such as base.bbclass can be removed from the graph.</para>
+                    <screen><prompt>$ </prompt>bitbake -g blah</screen>
+                    <screen><prompt>$ </prompt>bitbake -g -I virtual/whatever -I bloom blah</screen>
+                </example>
+                </para>
+            </section>
+            <section>
+                <title>Special variables</title>
+                <para>Certain variables affect BitBake operation:</para>
+                <section>
+                    <title><varname>BB_NUMBER_THREADS</varname></title>
+                    <para> The number of threads BitBake should run at once (default: 1).</para>
+                </section>
+            </section>
+            <section>
+                <title>Metadata</title>
+                <para>As you may have seen in the usage information, or in the information about .bb files, the <varname>BBFILES</varname> variable is how the BitBake tool locates its files.  This variable is a space separated list of files that are available, and supports wildcards.
+                <example>
+                    <title>Setting BBFILES</title>
+                    <programlisting><varname>BBFILES</varname> = "/path/to/bbfiles/*.bb"</programlisting>
+                </example></para>
+                <para>With regard to dependencies, it expects the .bb to define a <varname>DEPENDS</varname> variable, which contains a space separated list of <quote>package names</quote>, which themselves are the <varname>PN</varname> variable.  The <varname>PN</varname> variable is, in general, set to a component of the .bb filename by default.</para>
+                <example>
+                    <title>Depending on another .bb</title>
+                    <para>a.bb:
+    <screen>PN = "package-a"
+DEPENDS += "package-b"</screen>
+                    </para>
+                    <para>b.bb:
+    <screen>PN = "package-b"</screen>
+                    </para>
+                </example>
+                <example>
+                    <title>Using PROVIDES</title>
+                    <para>This example shows the usage of the <varname>PROVIDES</varname> variable, which allows a given .bb to specify what functionality it provides.</para>
+                    <para>package1.bb:
+    <screen>PROVIDES += "virtual/package"</screen>
+                    </para>
+                    <para>package2.bb:
+    <screen>DEPENDS += "virtual/package"</screen>
+                    </para>
+                    <para>package3.bb:
+    <screen>PROVIDES += "virtual/package"</screen>
+                    </para>
+                    <para>As you can see, we have two different .bb's that provide the same functionality (virtual/package).  Clearly, there needs to be a way for the person running BitBake to control which of those providers gets used.  There is, indeed, such a way.</para>
+                    <para>The following would go into a .conf file, to select package1:
+    <screen>PREFERRED_PROVIDER_virtual/package = "package1"</screen>
+                    </para>
+                </example>
+                <example>
+                    <title>Specifying version preference</title>
+                    <para>When there are multiple <quote>versions</quote> of a given package, BitBake defaults to selecting the most recent version, unless otherwise specified.  If the .bb in question has a <varname>DEFAULT_PREFERENCE</varname> set lower than the other .bb's (default is 0), then it will not be selected.  This allows the person or persons maintaining the repository of .bb files to specify their preference for the default selected version.  In addition, the user can specify their preferred version.</para>
+                    <para>If the first .bb is named <filename>a_1.1.bb</filename>, then the <varname>PN</varname> variable will be set to <quote>a</quote>, and the <varname>PV</varname> variable will be set to 1.1.</para>
+                    <para>If we then have an <filename>a_1.2.bb</filename>, BitBake will choose 1.2 by default.  However, if we define the following variable in a .conf that BitBake parses, we can change that.
+    <screen>PREFERRED_VERSION_a = "1.1"</screen>
+                    </para>
+                </example>
+                <example>
+                    <title>Using <quote>bbfile collections</quote></title>
+                    <para>bbfile collections exist to allow the user to have multiple repositories of bbfiles that contain the same exact package.  For example, one could easily use them to make one's own local copy of an upstream repository, but with custom modifications that one does not want upstream.  Usage:</para>
+                    <screen>BBFILES = "/stuff/openembedded/*/*.bb /stuff/openembedded.modified/*/*.bb"
+BBFILE_COLLECTIONS = "upstream local"
+BBFILE_PATTERN_upstream = "^/stuff/openembedded/"
+BBFILE_PATTERN_local = "^/stuff/openembedded.modified/"
+BBFILE_PRIORITY_upstream = "5"
+BBFILE_PRIORITY_local = "10"</screen>
+                </example>
+            </section>
+    </chapter>
+</book>

bitbake/lib/bb/COW.py

@@ -0,0 +1,323 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# This is a copy on write dictionary and set which abuses classes to try and be nice and fast.
+#
+# Copyright (C) 2006 Tim Amsell
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+#Please Note:
+# Be careful when using mutable types (ie Dict and Lists) - operations involving these are SLOW.
+# Assign a file to __warn__ to get warnings about slow operations.
+#
+
+from __future__ import print_function
+import copy
+import types
+ImmutableTypes = (
+    types.NoneType,
+    bool,
+    complex,
+    float,
+    int,
+    long,
+    tuple,
+    frozenset,
+    basestring
+)
+
+MUTABLE = "__mutable__"
+
+class COWMeta(type):
+    pass
+
+class COWDictMeta(COWMeta):
+    __warn__ = False
+    __hasmutable__ = False
+    __marker__ = tuple()
+
+    def __str__(cls):
+        # FIXME: I have magic numbers!
+        return "<COWDict Level: %i Current Keys: %i>" % (cls.__count__, len(cls.__dict__) - 3)
+    __repr__ = __str__
+
+    def cow(cls):
+        class C(cls):
+            __count__ = cls.__count__ + 1
+        return C
+    copy = cow
+    __call__ = cow
+
+    def __setitem__(cls, key, value):
+        if not isinstance(value, ImmutableTypes):
+            if not isinstance(value, COWMeta):
+                cls.__hasmutable__ = True
+            key += MUTABLE
+        setattr(cls, key, value)
+
+    def __getmutable__(cls, key, readonly=False):
+        nkey = key + MUTABLE
+        try:
+            return cls.__dict__[nkey]
+        except KeyError:
+            pass
+
+        value = getattr(cls, nkey)
+        if readonly:
+            return value
+
+        if not cls.__warn__ is False and not isinstance(value, COWMeta):
+            print("Warning: Doing a copy because %s is a mutable type." % key, file=cls.__warn__)
+        try:
+            value = value.copy()
+        except AttributeError as e:
+            value = copy.copy(value)
+        setattr(cls, nkey, value)
+        return value
+
+    __getmarker__ = []
+    def __getreadonly__(cls, key, default=__getmarker__):
+        """\
+        Get a value (even if mutable) which you promise not to change.
+        """
+        return cls.__getitem__(key, default, True)
+
+    def __getitem__(cls, key, default=__getmarker__, readonly=False):
+        try:
+            try:
+                value = getattr(cls, key)
+            except AttributeError:
+                value = cls.__getmutable__(key, readonly)
+
+            # This is for values which have been deleted
+            if value is cls.__marker__:
+                raise AttributeError("key %s does not exist." % key)
+
+            return value
+        except AttributeError as e:
+            if not default is cls.__getmarker__:
+                return default
+
+            raise KeyError(str(e))
+
+    def __delitem__(cls, key):
+        cls.__setitem__(key, cls.__marker__)
+
+    def __revertitem__(cls, key):
+        if not cls.__dict__.has_key(key):
+            key += MUTABLE
+        delattr(cls, key)
+
+    def __contains__(cls, key):
+        return cls.has_key(key)
+
+    def has_key(cls, key):
+        value = cls.__getreadonly__(key, cls.__marker__)
+        if value is cls.__marker__:
+            return False
+        return True
+
+    def iter(cls, type, readonly=False):
+        for key in dir(cls):
+            if key.startswith("__"):
+                continue
+
+            if key.endswith(MUTABLE):
+                key = key[:-len(MUTABLE)]
+
+            if type == "keys":
+                yield key
+
+            try:
+                if readonly:
+                    value = cls.__getreadonly__(key)
+                else:
+                    value = cls[key]
+            except KeyError:
+                continue
+
+            if type == "values":
+                yield value
+            if type == "items":
+                yield (key, value)
+        raise StopIteration()
+
+    def iterkeys(cls):
+        return cls.iter("keys")
+    def itervalues(cls, readonly=False):
+        if not cls.__warn__ is False and cls.__hasmutable__ and readonly is False:
+            print("Warning: If you arn't going to change any of the values call with True.", file=cls.__warn__)
+        return cls.iter("values", readonly)
+    def iteritems(cls, readonly=False):
+        if not cls.__warn__ is False and cls.__hasmutable__ and readonly is False:
+            print("Warning: If you arn't going to change any of the values call with True.", file=cls.__warn__)
+        return cls.iter("items", readonly)
+
+class COWSetMeta(COWDictMeta):
+    def __str__(cls):
+        # FIXME: I have magic numbers!
+        return "<COWSet Level: %i Current Keys: %i>" % (cls.__count__, len(cls.__dict__) -3)
+    __repr__ = __str__
+
+    def cow(cls):
+        class C(cls):
+            __count__ = cls.__count__ + 1
+        return C
+
+    def add(cls, value):
+        COWDictMeta.__setitem__(cls, repr(hash(value)), value)
+
+    def remove(cls, value):
+        COWDictMeta.__delitem__(cls, repr(hash(value)))
+
+    def __in__(cls, value):
+        return COWDictMeta.has_key(repr(hash(value)))
+
+    def iterkeys(cls):
+        raise TypeError("sets don't have keys")
+
+    def iteritems(cls):
+        raise TypeError("sets don't have 'items'")
+
+# These are the actual classes you use!
+class COWDictBase(object):
+    __metaclass__ = COWDictMeta
+    __count__ = 0
+
+class COWSetBase(object):
+    __metaclass__ = COWSetMeta
+    __count__ = 0
+
+if __name__ == "__main__":
+    import sys
+    COWDictBase.__warn__ = sys.stderr
+    a = COWDictBase()
+    print("a", a)
+
+    a['a'] = 'a'
+    a['b'] = 'b'
+    a['dict'] = {}
+
+    b = a.copy()
+    print("b", b)
+    b['c'] = 'b'
+
+    print()
+
+    print("a", a)
+    for x in a.iteritems():
+        print(x)
+    print("--")
+    print("b", b)
+    for x in b.iteritems():
+        print(x)
+    print()
+
+    b['dict']['a'] = 'b'
+    b['a'] = 'c'
+
+    print("a", a)
+    for x in a.iteritems():
+        print(x)
+    print("--")
+    print("b", b)
+    for x in b.iteritems():
+        print(x)
+    print()
+
+    try:
+        b['dict2']
+    except KeyError as e:
+        print("Okay!")
+
+    a['set'] = COWSetBase()
+    a['set'].add("o1")
+    a['set'].add("o1")
+    a['set'].add("o2")
+
+    print("a", a)
+    for x in a['set'].itervalues():
+        print(x)
+    print("--")
+    print("b", b)
+    for x in b['set'].itervalues():
+        print(x)
+    print()
+
+    b['set'].add('o3')
+
+    print("a", a)
+    for x in a['set'].itervalues():
+        print(x)
+    print("--")
+    print("b", b)
+    for x in b['set'].itervalues():
+        print(x)
+    print()
+
+    a['set2'] = set()
+    a['set2'].add("o1")
+    a['set2'].add("o1")
+    a['set2'].add("o2")
+
+    print("a", a)
+    for x in a.iteritems():
+        print(x)
+    print("--")
+    print("b", b)
+    for x in b.iteritems(readonly=True):
+        print(x)
+    print()
+
+    del b['b']
+    try:
+        print(b['b'])
+    except KeyError:
+        print("Yay! deleted key raises error")
+
+    if b.has_key('b'):
+        print("Boo!")
+    else:
+        print("Yay - has_key with delete works!")
+
+    print("a", a)
+    for x in a.iteritems():
+        print(x)
+    print("--")
+    print("b", b)
+    for x in b.iteritems(readonly=True):
+        print(x)
+    print()
+
+    b.__revertitem__('b')
+
+    print("a", a)
+    for x in a.iteritems():
+        print(x)
+    print("--")
+    print("b", b)
+    for x in b.iteritems(readonly=True):
+        print(x)
+    print()
+
+    b.__revertitem__('dict')
+    print("a", a)
+    for x in a.iteritems():
+        print(x)
+    print("--")
+    print("b", b)
+    for x in b.iteritems(readonly=True):
+        print(x)
+    print()

bitbake/lib/bb/__init__.py

@@ -0,0 +1,146 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# BitBake Build System Python Library
+#
+# Copyright (C) 2003  Holger Schurig
+# Copyright (C) 2003, 2004  Chris Larson
+#
+# Based on Gentoo's portage.py.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+__version__ = "1.18.0"
+
+import sys
+if sys.version_info < (2, 6, 0):
+    raise RuntimeError("Sorry, python 2.6.0 or later is required for this version of bitbake")
+
+
+class BBHandledException(Exception):
+    """
+    The big dilemma for generic bitbake code is what information to give the user
+    when an exception occurs. Any exception inheriting this base exception class
+    has already provided information to the user via some 'fired' message type such as
+    an explicitly fired event using bb.fire, or a bb.error message. If bitbake 
+    encounters an exception derived from this class, no backtrace or other information 
+    will be given to the user, its assumed the earlier event provided the relevant information.
+    """
+    pass
+
+import os
+import logging
+
+
+class NullHandler(logging.Handler):
+    def emit(self, record):
+        pass
+
+Logger = logging.getLoggerClass()
+class BBLogger(Logger):
+    def __init__(self, name):
+        if name.split(".")[0] == "BitBake":
+            self.debug = self.bbdebug
+        Logger.__init__(self, name)
+
+    def bbdebug(self, level, msg, *args, **kwargs):
+        return self.log(logging.DEBUG - level + 1, msg, *args, **kwargs)
+
+    def plain(self, msg, *args, **kwargs):
+        return self.log(logging.INFO + 1, msg, *args, **kwargs)
+
+    def verbose(self, msg, *args, **kwargs):
+        return self.log(logging.INFO - 1, msg, *args, **kwargs)
+
+logging.raiseExceptions = False
+logging.setLoggerClass(BBLogger)
+
+logger = logging.getLogger("BitBake")
+logger.addHandler(NullHandler())
+logger.setLevel(logging.DEBUG - 2)
+
+# This has to be imported after the setLoggerClass, as the import of bb.msg
+# can result in construction of the various loggers.
+import bb.msg
+
+from bb import fetch2 as fetch
+sys.modules['bb.fetch'] = sys.modules['bb.fetch2']
+
+# Messaging convenience functions
+def plain(*args):
+    logger.plain(''.join(args))
+
+def debug(lvl, *args):
+    if isinstance(lvl, basestring):
+        logger.warn("Passed invalid debug level '%s' to bb.debug", lvl)
+        args = (lvl,) + args
+        lvl = 1
+    logger.debug(lvl, ''.join(args))
+
+def note(*args):
+    logger.info(''.join(args))
+
+def warn(*args):
+    logger.warn(''.join(args))
+
+def error(*args):
+    logger.error(''.join(args))
+
+def fatal(*args):
+    logger.critical(''.join(args))
+    sys.exit(1)
+
+
+def deprecated(func, name=None, advice=""):
+    """This is a decorator which can be used to mark functions
+    as deprecated. It will result in a warning being emmitted
+    when the function is used."""
+    import warnings
+
+    if advice:
+        advice = ": %s" % advice
+    if name is None:
+        name = func.__name__
+
+    def newFunc(*args, **kwargs):
+        warnings.warn("Call to deprecated function %s%s." % (name,
+                                                             advice),
+                      category=DeprecationWarning,
+                      stacklevel=2)
+        return func(*args, **kwargs)
+    newFunc.__name__ = func.__name__
+    newFunc.__doc__ = func.__doc__
+    newFunc.__dict__.update(func.__dict__)
+    return newFunc
+
+# For compatibility
+def deprecate_import(current, modulename, fromlist, renames = None):
+    """Import objects from one module into another, wrapping them with a DeprecationWarning"""
+    import sys
+
+    module = __import__(modulename, fromlist = fromlist)
+    for position, objname in enumerate(fromlist):
+        obj = getattr(module, objname)
+        newobj = deprecated(obj, "{0}.{1}".format(current, objname),
+                            "Please use {0}.{1} instead".format(modulename, objname))
+        if renames:
+            newname = renames[position]
+        else:
+            newname = objname
+
+        setattr(sys.modules[current], newname, newobj)
+
+deprecate_import(__name__, "bb.fetch", ("MalformedUrl", "encodeurl", "decodeurl"))
+deprecate_import(__name__, "bb.utils", ("mkdirhier", "movefile", "copyfile", "which"))
+deprecate_import(__name__, "bb.utils", ["vercmp_string"], ["vercmp"])

bitbake/lib/bb/build.py

@@ -0,0 +1,624 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# BitBake 'Build' implementation
+#
+# Core code for function execution and task handling in the
+# BitBake build tools.
+#
+# Copyright (C) 2003, 2004  Chris Larson
+#
+# Based on Gentoo's portage.py.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+#Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import os
+import sys
+import logging
+import shlex
+import glob
+import bb
+import bb.msg
+import bb.process
+from contextlib import nested
+from bb import data, event, utils
+
+bblogger = logging.getLogger('BitBake')
+logger = logging.getLogger('BitBake.Build')
+
+NULL = open(os.devnull, 'r+')
+
+
+# When we execute a python function we'd like certain things
+# in all namespaces, hence we add them to __builtins__
+# If we do not do this and use the exec globals, they will
+# not be available to subfunctions.
+__builtins__['bb'] = bb
+__builtins__['os'] = os
+
+class FuncFailed(Exception):
+    def __init__(self, name = None, logfile = None):
+        self.logfile = logfile
+        self.name = name
+        if name:
+            self.msg = 'Function failed: %s' % name
+        else:
+            self.msg = "Function failed"
+
+    def __str__(self):
+        if self.logfile and os.path.exists(self.logfile):
+            msg = ("%s (see %s for further information)" %
+                   (self.msg, self.logfile))
+        else:
+            msg = self.msg
+        return msg
+
+class TaskBase(event.Event):
+    """Base class for task events"""
+
+    def __init__(self, t, d ):
+        self._task = t
+        self._package = d.getVar("PF", True)
+        event.Event.__init__(self)
+        self._message = "recipe %s: task %s: %s" % (d.getVar("PF", True), t, self.getDisplayName())
+
+    def getTask(self):
+        return self._task
+
+    def setTask(self, task):
+        self._task = task
+
+    def getDisplayName(self):
+        return bb.event.getName(self)[4:]
+
+    task = property(getTask, setTask, None, "task property")
+
+class TaskStarted(TaskBase):
+    """Task execution started"""
+
+class TaskSucceeded(TaskBase):
+    """Task execution completed"""
+
+class TaskFailed(TaskBase):
+    """Task execution failed"""
+
+    def __init__(self, task, logfile, metadata, errprinted = False):
+        self.logfile = logfile
+        self.errprinted = errprinted
+        super(TaskFailed, self).__init__(task, metadata)
+
+class TaskFailedSilent(TaskBase):
+    """Task execution failed (silently)"""
+    def __init__(self, task, logfile, metadata):
+        self.logfile = logfile
+        super(TaskFailedSilent, self).__init__(task, metadata)
+
+    def getDisplayName(self):
+        # Don't need to tell the user it was silent
+        return "Failed"
+
+class TaskInvalid(TaskBase):
+
+    def __init__(self, task, metadata):
+        super(TaskInvalid, self).__init__(task, metadata)
+        self._message = "No such task '%s'" % task
+
+
+class LogTee(object):
+    def __init__(self, logger, outfile):
+        self.outfile = outfile
+        self.logger = logger
+        self.name = self.outfile.name
+
+    def write(self, string):
+        self.logger.plain(string)
+        self.outfile.write(string)
+
+    def __enter__(self):
+        self.outfile.__enter__()
+        return self
+
+    def __exit__(self, *excinfo):
+        self.outfile.__exit__(*excinfo)
+
+    def __repr__(self):
+        return '<LogTee {0}>'.format(self.name)
+    def flush(self):
+        self.outfile.flush()
+
+def exec_func(func, d, dirs = None):
+    """Execute an BB 'function'"""
+
+    body = data.getVar(func, d)
+    if not body:
+        if body is None:
+            logger.warn("Function %s doesn't exist", func)
+        return
+
+    flags = data.getVarFlags(func, d)
+    cleandirs = flags.get('cleandirs')
+    if cleandirs:
+        for cdir in data.expand(cleandirs, d).split():
+            bb.utils.remove(cdir, True)
+
+    if dirs is None:
+        dirs = flags.get('dirs')
+        if dirs:
+            dirs = data.expand(dirs, d).split()
+
+    if dirs:
+        for adir in dirs:
+            bb.utils.mkdirhier(adir)
+        adir = dirs[-1]
+    else:
+        adir = data.getVar('B', d, 1)
+        bb.utils.mkdirhier(adir)
+
+    ispython = flags.get('python')
+
+    lockflag = flags.get('lockfiles')
+    if lockflag:
+        lockfiles = [data.expand(f, d) for f in lockflag.split()]
+    else:
+        lockfiles = None
+
+    tempdir = data.getVar('T', d, 1)
+
+    # or func allows items to be executed outside of the normal
+    # task set, such as buildhistory
+    task = data.getVar('BB_RUNTASK', d, 1) or func
+    if task == func:
+        taskfunc = task
+    else:
+        taskfunc = "%s.%s" % (task, func)
+
+    runfmt = data.getVar('BB_RUNFMT', d, 1) or "run.{func}.{pid}"
+    runfn = runfmt.format(taskfunc=taskfunc, task=task, func=func, pid=os.getpid())
+    runfile = os.path.join(tempdir, runfn)
+    bb.utils.mkdirhier(os.path.dirname(runfile))
+
+    with bb.utils.fileslocked(lockfiles):
+        if ispython:
+            exec_func_python(func, d, runfile, cwd=adir)
+        else:
+            exec_func_shell(func, d, runfile, cwd=adir)
+
+_functionfmt = """
+def {function}(d):
+{body}
+
+{function}(d)
+"""
+logformatter = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
+def exec_func_python(func, d, runfile, cwd=None):
+    """Execute a python BB 'function'"""
+
+    bbfile = d.getVar('FILE', True)
+    code = _functionfmt.format(function=func, body=d.getVar(func, True))
+    bb.utils.mkdirhier(os.path.dirname(runfile))
+    with open(runfile, 'w') as script:
+        script.write(code)
+
+    if cwd:
+        try:
+            olddir = os.getcwd()
+        except OSError:
+            olddir = None
+        os.chdir(cwd)
+
+    bb.debug(2, "Executing python function %s" % func)
+
+    try:
+        comp = utils.better_compile(code, func, bbfile)
+        utils.better_exec(comp, {"d": d}, code, bbfile)
+    except:
+        if sys.exc_info()[0] in (bb.parse.SkipPackage, bb.build.FuncFailed):
+            raise
+
+        raise FuncFailed(func, None)
+    finally:
+        bb.debug(2, "Python function %s finished" % func)
+
+        if cwd and olddir:
+            try:
+                os.chdir(olddir)
+            except OSError:
+                pass
+
+def exec_func_shell(func, d, runfile, cwd=None):
+    """Execute a shell function from the metadata
+
+    Note on directory behavior.  The 'dirs' varflag should contain a list
+    of the directories you need created prior to execution.  The last
+    item in the list is where we will chdir/cd to.
+    """
+
+    # Don't let the emitted shell script override PWD
+    d.delVarFlag('PWD', 'export')
+
+    with open(runfile, 'w') as script:
+        script.write('#!/bin/sh -e\n')
+        data.emit_func(func, script, d)
+
+        if bb.msg.loggerVerboseLogs:
+            script.write("set -x\n")
+        if cwd:
+            script.write("cd %s\n" % cwd)
+        script.write("%s\n" % func)
+
+    os.chmod(runfile, 0775)
+
+    cmd = runfile
+    if d.getVarFlag(func, 'fakeroot'):
+        fakerootcmd = d.getVar('FAKEROOT', True)
+        if fakerootcmd:
+            cmd = [fakerootcmd, runfile]
+
+    if bb.msg.loggerDefaultVerbose:
+        logfile = LogTee(logger, sys.stdout)
+    else:
+        logfile = sys.stdout
+
+    bb.debug(2, "Executing shell function %s" % func)
+
+    try:
+        bb.process.run(cmd, shell=False, stdin=NULL, log=logfile)
+    except bb.process.CmdError:
+        logfn = d.getVar('BB_LOGFILE', True)
+        raise FuncFailed(func, logfn)
+
+    bb.debug(2, "Shell function %s finished" % func)
+
+def _task_data(fn, task, d):
+    localdata = data.createCopy(d)
+    localdata.setVar('BB_FILENAME', fn)
+    localdata.setVar('BB_CURRENTTASK', task[3:])
+    localdata.setVar('OVERRIDES', 'task-%s:%s' %
+                     (task[3:], d.getVar('OVERRIDES', False)))
+    localdata.finalize()
+    data.expandKeys(localdata)
+    return localdata
+
+def _exec_task(fn, task, d, quieterr):
+    """Execute a BB 'task'
+
+    Execution of a task involves a bit more setup than executing a function,
+    running it with its own local metadata, and with some useful variables set.
+    """
+    if not data.getVarFlag(task, 'task', d):
+        event.fire(TaskInvalid(task, d), d)
+        logger.error("No such task: %s" % task)
+        return 1
+
+    logger.debug(1, "Executing task %s", task)
+
+    localdata = _task_data(fn, task, d)
+    tempdir = localdata.getVar('T', True)
+    if not tempdir:
+        bb.fatal("T variable not set, unable to build")
+
+    bb.utils.mkdirhier(tempdir)
+
+    # Determine the logfile to generate
+    logfmt = localdata.getVar('BB_LOGFMT', True) or 'log.{task}.{pid}'
+    logbase = logfmt.format(task=task, pid=os.getpid())
+
+    # Document the order of the tasks...
+    logorder = os.path.join(tempdir, 'log.task_order')
+    try:
+        logorderfile = file(logorder, 'a')
+    except OSError:
+        logger.exception("Opening log file '%s'", logorder)
+        pass
+    logorderfile.write('{0} ({1}): {2}\n'.format(task, os.getpid(), logbase))
+    logorderfile.close()
+
+    # Setup the courtesy link to the logfn
+    loglink = os.path.join(tempdir, 'log.{0}'.format(task))
+    logfn = os.path.join(tempdir, logbase)
+    if loglink:
+        bb.utils.remove(loglink)
+
+        try:
+           os.symlink(logbase, loglink)
+        except OSError:
+           pass
+
+    prefuncs = localdata.getVarFlag(task, 'prefuncs', expand=True)
+    postfuncs = localdata.getVarFlag(task, 'postfuncs', expand=True)
+
+    class ErrorCheckHandler(logging.Handler):
+        def __init__(self):
+            self.triggered = False
+            logging.Handler.__init__(self, logging.ERROR)
+        def emit(self, record):
+            self.triggered = True
+
+    # Handle logfiles
+    si = file('/dev/null', 'r')
+    try:
+        bb.utils.mkdirhier(os.path.dirname(logfn))
+        logfile = file(logfn, 'w')
+    except OSError:
+        logger.exception("Opening log file '%s'", logfn)
+        pass
+
+    # Dup the existing fds so we dont lose them
+    osi = [os.dup(sys.stdin.fileno()), sys.stdin.fileno()]
+    oso = [os.dup(sys.stdout.fileno()), sys.stdout.fileno()]
+    ose = [os.dup(sys.stderr.fileno()), sys.stderr.fileno()]
+
+    # Replace those fds with our own
+    os.dup2(si.fileno(), osi[1])
+    os.dup2(logfile.fileno(), oso[1])
+    os.dup2(logfile.fileno(), ose[1])
+
+    # Ensure python logging goes to the logfile
+    handler = logging.StreamHandler(logfile)
+    handler.setFormatter(logformatter)
+    # Always enable full debug output into task logfiles
+    handler.setLevel(logging.DEBUG - 2)
+    bblogger.addHandler(handler)
+
+    errchk = ErrorCheckHandler()
+    bblogger.addHandler(errchk)
+
+    localdata.setVar('BB_LOGFILE', logfn)
+    localdata.setVar('BB_RUNTASK', task)
+
+    event.fire(TaskStarted(task, localdata), localdata)
+    try:
+        for func in (prefuncs or '').split():
+            exec_func(func, localdata)
+        exec_func(task, localdata)
+        for func in (postfuncs or '').split():
+            exec_func(func, localdata)
+    except FuncFailed as exc:
+        if quieterr:
+            event.fire(TaskFailedSilent(task, logfn, localdata), localdata)
+        else:
+            errprinted = errchk.triggered
+            logger.error(str(exc))
+            event.fire(TaskFailed(task, logfn, localdata, errprinted), localdata)
+        return 1
+    finally:
+        sys.stdout.flush()
+        sys.stderr.flush()
+
+        bblogger.removeHandler(handler)
+
+        # Restore the backup fds
+        os.dup2(osi[0], osi[1])
+        os.dup2(oso[0], oso[1])
+        os.dup2(ose[0], ose[1])
+
+        # Close the backup fds
+        os.close(osi[0])
+        os.close(oso[0])
+        os.close(ose[0])
+        si.close()
+
+        logfile.close()
+        if os.path.exists(logfn) and os.path.getsize(logfn) == 0:
+            logger.debug(2, "Zero size logfn %s, removing", logfn)
+            bb.utils.remove(logfn)
+            bb.utils.remove(loglink)
+    event.fire(TaskSucceeded(task, localdata), localdata)
+
+    if not localdata.getVarFlag(task, 'nostamp') and not localdata.getVarFlag(task, 'selfstamp'):
+        make_stamp(task, localdata)
+
+    return 0
+
+def exec_task(fn, task, d, profile = False):
+    try: 
+        quieterr = False
+        if d.getVarFlag(task, "quieterrors") is not None:
+            quieterr = True
+
+        if profile: 
+            profname = "profile-%s.log" % (os.path.basename(fn) + "-" + task)
+            try:
+                import cProfile as profile
+            except:
+                import profile
+            prof = profile.Profile()
+            ret = profile.Profile.runcall(prof, _exec_task, fn, task, d, quieterr)
+            prof.dump_stats(profname)
+            bb.utils.process_profilelog(profname)
+
+            return ret
+        else:
+            return _exec_task(fn, task, d, quieterr)
+
+    except Exception:
+        from traceback import format_exc
+        if not quieterr:
+            logger.error("Build of %s failed" % (task))
+            logger.error(format_exc())
+            failedevent = TaskFailed(task, None, d, True)
+            event.fire(failedevent, d)
+        return 1
+
+def stamp_internal(taskname, d, file_name):
+    """
+    Internal stamp helper function
+    Makes sure the stamp directory exists
+    Returns the stamp path+filename
+
+    In the bitbake core, d can be a CacheData and file_name will be set.
+    When called in task context, d will be a data store, file_name will not be set
+    """
+    taskflagname = taskname
+    if taskname.endswith("_setscene") and taskname != "do_setscene":
+        taskflagname = taskname.replace("_setscene", "")
+
+    if file_name:
+        stamp = d.stamp_base[file_name].get(taskflagname) or d.stamp[file_name]
+        extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
+    else:
+        stamp = d.getVarFlag(taskflagname, 'stamp-base', True) or d.getVar('STAMP', True)
+        file_name = d.getVar('BB_FILENAME', True)
+        extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
+
+    if not stamp:
+        return
+
+    stamp = bb.parse.siggen.stampfile(stamp, file_name, taskname, extrainfo)
+
+    stampdir = os.path.dirname(stamp)
+    if bb.parse.cached_mtime_noerror(stampdir) == 0:
+        bb.utils.mkdirhier(stampdir)
+
+    return stamp
+
+def stamp_cleanmask_internal(taskname, d, file_name):
+    """
+    Internal stamp helper function to generate stamp cleaning mask
+    Returns the stamp path+filename
+
+    In the bitbake core, d can be a CacheData and file_name will be set.
+    When called in task context, d will be a data store, file_name will not be set
+    """
+    taskflagname = taskname
+    if taskname.endswith("_setscene") and taskname != "do_setscene":
+        taskflagname = taskname.replace("_setscene", "")
+
+    if file_name:
+        stamp = d.stamp_base_clean[file_name].get(taskflagname) or d.stampclean[file_name]
+        extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
+    else:
+        stamp = d.getVarFlag(taskflagname, 'stamp-base-clean', True) or d.getVar('STAMPCLEAN', True)
+        file_name = d.getVar('BB_FILENAME', True)
+        extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
+
+    if not stamp:
+        return []
+
+    cleanmask = bb.parse.siggen.stampcleanmask(stamp, file_name, taskname, extrainfo)
+
+    return [cleanmask, cleanmask.replace(taskflagname, taskflagname + "_setscene")]
+
+def make_stamp(task, d, file_name = None):
+    """
+    Creates/updates a stamp for a given task
+    (d can be a data dict or dataCache)
+    """
+    cleanmask = stamp_cleanmask_internal(task, d, file_name)
+    for mask in cleanmask:
+        for name in glob.glob(mask):
+            # Preserve sigdata files in the stamps directory
+            if "sigdata" in name:
+                continue
+            # Preserve taint files in the stamps directory
+            if name.endswith('.taint'):
+                continue
+            os.unlink(name)
+    
+    stamp = stamp_internal(task, d, file_name)
+    # Remove the file and recreate to force timestamp
+    # change on broken NFS filesystems
+    if stamp:
+        bb.utils.remove(stamp)
+        f = open(stamp, "w")
+        f.close()
+
+    # If we're in task context, write out a signature file for each task
+    # as it completes
+    if not task.endswith("_setscene") and task != "do_setscene" and not file_name:
+        file_name = d.getVar('BB_FILENAME', True)
+        bb.parse.siggen.dump_sigtask(file_name, task, d.getVar('STAMP', True), True)
+
+def del_stamp(task, d, file_name = None):
+    """
+    Removes a stamp for a given task
+    (d can be a data dict or dataCache)
+    """
+    stamp = stamp_internal(task, d, file_name)
+    bb.utils.remove(stamp)
+
+def write_taint(task, d, file_name = None):
+    """
+    Creates a "taint" file which will force the specified task and its
+    dependents to be re-run the next time by influencing the value of its
+    taskhash.
+    (d can be a data dict or dataCache)
+    """
+    import uuid
+    if file_name:
+        taintfn = d.stamp[file_name] + '.' + task + '.taint'
+    else:
+        taintfn = d.getVar('STAMP', True) + '.' + task + '.taint'
+    bb.utils.mkdirhier(os.path.dirname(taintfn))
+    # The specific content of the taint file is not really important,
+    # we just need it to be random, so a random UUID is used
+    with open(taintfn, 'w') as taintf:
+        taintf.write(str(uuid.uuid4()))
+
+def stampfile(taskname, d, file_name = None):
+    """
+    Return the stamp for a given task
+    (d can be a data dict or dataCache)
+    """
+    return stamp_internal(taskname, d, file_name)
+
+def add_tasks(tasklist, d):
+    task_deps = data.getVar('_task_deps', d)
+    if not task_deps:
+        task_deps = {}
+    if not 'tasks' in task_deps:
+        task_deps['tasks'] = []
+    if not 'parents' in task_deps:
+        task_deps['parents'] = {}
+
+    for task in tasklist:
+        task = data.expand(task, d)
+        data.setVarFlag(task, 'task', 1, d)
+
+        if not task in task_deps['tasks']:
+            task_deps['tasks'].append(task)
+
+        flags = data.getVarFlags(task, d)
+        def getTask(name):
+            if not name in task_deps:
+                task_deps[name] = {}
+            if name in flags:
+                deptask = data.expand(flags[name], d)
+                task_deps[name][task] = deptask
+        getTask('depends')
+        getTask('rdepends')
+        getTask('deptask')
+        getTask('rdeptask')
+        getTask('recrdeptask')
+        getTask('nostamp')
+        getTask('fakeroot')
+        getTask('noexec')
+        getTask('umask')
+        task_deps['parents'][task] = []
+        if 'deps' in flags:
+            for dep in flags['deps']:
+                dep = data.expand(dep, d)
+                task_deps['parents'][task].append(dep)
+
+    # don't assume holding a reference
+    data.setVar('_task_deps', task_deps, d)
+
+def remove_task(task, kill, d):
+    """Remove an BB 'task'.
+
+       If kill is 1, also remove tasks that depend on this task."""
+
+    data.delVarFlag(task, 'task', d)

bitbake/lib/bb/cache.py

@@ -0,0 +1,829 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# BitBake Cache implementation
+#
+# Caching of bitbake variables before task execution
+
+# Copyright (C) 2006        Richard Purdie
+# Copyright (C) 2012        Intel Corporation
+
+# but small sections based on code from bin/bitbake:
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2003, 2004  Phil Blundell
+# Copyright (C) 2003 - 2005 Michael 'Mickey' Lauer
+# Copyright (C) 2005        Holger Hans Peter Freyther
+# Copyright (C) 2005        ROAD GmbH
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+
+import os
+import logging
+from collections import defaultdict
+import bb.utils
+
+logger = logging.getLogger("BitBake.Cache")
+
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    logger.info("Importing cPickle failed. "
+                "Falling back to a very slow implementation.")
+
+__cache_version__ = "145"
+
+def getCacheFile(path, filename, data_hash):
+    return os.path.join(path, filename + "." + data_hash)
+
+# RecipeInfoCommon defines common data retrieving methods
+# from meta data for caches. CoreRecipeInfo as well as other
+# Extra RecipeInfo needs to inherit this class
+class RecipeInfoCommon(object):
+
+    @classmethod
+    def listvar(cls, var, metadata):
+        return cls.getvar(var, metadata).split()
+
+    @classmethod
+    def intvar(cls, var, metadata):
+        return int(cls.getvar(var, metadata) or 0)
+
+    @classmethod
+    def depvar(cls, var, metadata):
+        return bb.utils.explode_deps(cls.getvar(var, metadata))
+
+    @classmethod
+    def pkgvar(cls, var, packages, metadata):
+        return dict((pkg, cls.depvar("%s_%s" % (var, pkg), metadata))
+                    for pkg in packages)
+
+    @classmethod
+    def taskvar(cls, var, tasks, metadata):
+        return dict((task, cls.getvar("%s_task-%s" % (var, task), metadata))
+                    for task in tasks)
+
+    @classmethod
+    def flaglist(cls, flag, varlist, metadata, squash=False):
+        out_dict = dict((var, metadata.getVarFlag(var, flag, True))
+                    for var in varlist)
+        if squash:
+            return dict((k,v) for (k,v) in out_dict.iteritems() if v)
+        else:
+            return out_dict
+
+    @classmethod
+    def getvar(cls, var, metadata):
+        return metadata.getVar(var, True) or ''
+
+
+class CoreRecipeInfo(RecipeInfoCommon):
+    __slots__ = ()
+
+    cachefile = "bb_cache.dat"   
+
+    def __init__(self, filename, metadata):      
+        self.file_depends = metadata.getVar('__depends', False)
+        self.timestamp = bb.parse.cached_mtime(filename)
+        self.variants = self.listvar('__VARIANTS', metadata) + ['']
+        self.appends = self.listvar('__BBAPPEND', metadata)
+        self.nocache = self.getvar('__BB_DONT_CACHE', metadata)
+
+        self.skipreason = self.getvar('__SKIPPED', metadata)
+        if self.skipreason:
+            self.pn = self.getvar('PN', metadata) or bb.parse.BBHandler.vars_from_file(filename,metadata)[0]
+            self.skipped = True
+            self.provides  = self.depvar('PROVIDES', metadata)
+            self.rprovides = self.depvar('RPROVIDES', metadata)
+            return
+
+        self.tasks = metadata.getVar('__BBTASKS', False)
+
+        self.pn = self.getvar('PN', metadata)
+        self.packages = self.listvar('PACKAGES', metadata)
+        if not self.pn in self.packages:
+            self.packages.append(self.pn)
+
+        self.basetaskhashes = self.taskvar('BB_BASEHASH', self.tasks, metadata)
+        self.hashfilename = self.getvar('BB_HASHFILENAME', metadata)
+
+        self.task_deps = metadata.getVar('_task_deps', False) or {'tasks': [], 'parents': {}}
+
+        self.skipped = False
+        self.pe = self.getvar('PE', metadata)
+        self.pv = self.getvar('PV', metadata)
+        self.pr = self.getvar('PR', metadata)
+        self.defaultpref = self.intvar('DEFAULT_PREFERENCE', metadata)
+        self.not_world = self.getvar('EXCLUDE_FROM_WORLD', metadata)
+        self.stamp = self.getvar('STAMP', metadata)
+        self.stampclean = self.getvar('STAMPCLEAN', metadata)        
+        self.stamp_base = self.flaglist('stamp-base', self.tasks, metadata)
+        self.stamp_base_clean = self.flaglist('stamp-base-clean', self.tasks, metadata)
+        self.stamp_extrainfo = self.flaglist('stamp-extra-info', self.tasks, metadata)
+        self.file_checksums = self.flaglist('file-checksums', self.tasks, metadata, True)
+        self.packages_dynamic = self.listvar('PACKAGES_DYNAMIC', metadata)
+        self.depends          = self.depvar('DEPENDS', metadata)
+        self.provides         = self.depvar('PROVIDES', metadata)
+        self.rdepends         = self.depvar('RDEPENDS', metadata)
+        self.rprovides        = self.depvar('RPROVIDES', metadata)
+        self.rrecommends      = self.depvar('RRECOMMENDS', metadata)
+        self.rprovides_pkg    = self.pkgvar('RPROVIDES', self.packages, metadata)
+        self.rdepends_pkg     = self.pkgvar('RDEPENDS', self.packages, metadata)
+        self.rrecommends_pkg  = self.pkgvar('RRECOMMENDS', self.packages, metadata)
+        self.inherits         = self.getvar('__inherit_cache', metadata)
+        self.fakerootenv      = self.getvar('FAKEROOTENV', metadata)
+        self.fakerootdirs     = self.getvar('FAKEROOTDIRS', metadata)
+        self.fakerootnoenv    = self.getvar('FAKEROOTNOENV', metadata)
+
+    @classmethod
+    def init_cacheData(cls, cachedata):
+        # CacheData in Core RecipeInfo Class
+        cachedata.task_deps = {}
+        cachedata.pkg_fn = {}
+        cachedata.pkg_pn = defaultdict(list)
+        cachedata.pkg_pepvpr = {}
+        cachedata.pkg_dp = {}
+
+        cachedata.stamp = {}
+        cachedata.stampclean = {}
+        cachedata.stamp_base = {}
+        cachedata.stamp_base_clean = {}
+        cachedata.stamp_extrainfo = {}
+        cachedata.file_checksums = {}
+        cachedata.fn_provides = {}
+        cachedata.pn_provides = defaultdict(list)
+        cachedata.all_depends = []
+
+        cachedata.deps = defaultdict(list)
+        cachedata.packages = defaultdict(list)
+        cachedata.providers = defaultdict(list)
+        cachedata.rproviders = defaultdict(list)
+        cachedata.packages_dynamic = defaultdict(list)
+
+        cachedata.rundeps = defaultdict(lambda: defaultdict(list))
+        cachedata.runrecs = defaultdict(lambda: defaultdict(list))
+        cachedata.possible_world = []
+        cachedata.universe_target = []
+        cachedata.hashfn = {}
+
+        cachedata.basetaskhash = {}
+        cachedata.inherits = {}
+        cachedata.fakerootenv = {}
+        cachedata.fakerootnoenv = {}
+        cachedata.fakerootdirs = {}
+
+    def add_cacheData(self, cachedata, fn):
+        cachedata.task_deps[fn] = self.task_deps
+        cachedata.pkg_fn[fn] = self.pn
+        cachedata.pkg_pn[self.pn].append(fn)
+        cachedata.pkg_pepvpr[fn] = (self.pe, self.pv, self.pr)
+        cachedata.pkg_dp[fn] = self.defaultpref
+        cachedata.stamp[fn] = self.stamp
+        cachedata.stampclean[fn] = self.stampclean
+        cachedata.stamp_base[fn] = self.stamp_base
+        cachedata.stamp_base_clean[fn] = self.stamp_base_clean
+        cachedata.stamp_extrainfo[fn] = self.stamp_extrainfo
+        cachedata.file_checksums[fn] = self.file_checksums
+
+        provides = [self.pn]
+        for provide in self.provides:
+            if provide not in provides:
+                provides.append(provide)
+        cachedata.fn_provides[fn] = provides
+
+        for provide in provides:
+            cachedata.providers[provide].append(fn)
+            if provide not in cachedata.pn_provides[self.pn]:
+                cachedata.pn_provides[self.pn].append(provide)
+
+        for dep in self.depends:
+            if dep not in cachedata.deps[fn]:
+                cachedata.deps[fn].append(dep)
+            if dep not in cachedata.all_depends:
+                cachedata.all_depends.append(dep)
+
+        rprovides = self.rprovides
+        for package in self.packages:
+            cachedata.packages[package].append(fn)
+            rprovides += self.rprovides_pkg[package]
+
+        for rprovide in rprovides:
+            cachedata.rproviders[rprovide].append(fn)
+
+        for package in self.packages_dynamic:
+            cachedata.packages_dynamic[package].append(fn)
+
+        # Build hash of runtime depends and rececommends
+        for package in self.packages + [self.pn]:
+            cachedata.rundeps[fn][package] = list(self.rdepends) + self.rdepends_pkg[package]
+            cachedata.runrecs[fn][package] = list(self.rrecommends) + self.rrecommends_pkg[package]
+
+        # Collect files we may need for possible world-dep
+        # calculations
+        if not self.not_world:
+            cachedata.possible_world.append(fn)
+
+        # create a collection of all targets for sanity checking
+        # tasks, such as upstream versions, license, and tools for
+        # task and image creation.
+        cachedata.universe_target.append(self.pn)
+
+        cachedata.hashfn[fn] = self.hashfilename
+        for task, taskhash in self.basetaskhashes.iteritems():
+            identifier = '%s.%s' % (fn, task)
+            cachedata.basetaskhash[identifier] = taskhash
+
+        cachedata.inherits[fn] = self.inherits
+        cachedata.fakerootenv[fn] = self.fakerootenv
+        cachedata.fakerootnoenv[fn] = self.fakerootnoenv
+        cachedata.fakerootdirs[fn] = self.fakerootdirs
+
+
+
+class Cache(object):
+    """
+    BitBake Cache implementation
+    """
+
+    def __init__(self, data, data_hash, caches_array):
+        # Pass caches_array information into Cache Constructor
+        # It will be used in later for deciding whether we 
+        # need extra cache file dump/load support 
+        self.caches_array = caches_array
+        self.cachedir = data.getVar("CACHE", True)
+        self.clean = set()
+        self.checked = set()
+        self.depends_cache = {}
+        self.data = None
+        self.data_fn = None
+        self.cacheclean = True
+        self.data_hash = data_hash
+
+        if self.cachedir in [None, '']:
+            self.has_cache = False
+            logger.info("Not using a cache. "
+                        "Set CACHE = <directory> to enable.")
+            return
+
+        self.has_cache = True
+        self.cachefile = getCacheFile(self.cachedir, "bb_cache.dat", self.data_hash)
+
+        logger.debug(1, "Using cache in '%s'", self.cachedir)
+        bb.utils.mkdirhier(self.cachedir)
+
+        cache_ok = True
+        if self.caches_array:
+            for cache_class in self.caches_array:
+                if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                    cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
+                    cache_ok = cache_ok and os.path.exists(cachefile)
+                    cache_class.init_cacheData(self)
+        if cache_ok:
+            self.load_cachefile()
+        elif os.path.isfile(self.cachefile):
+            logger.info("Out of date cache found, rebuilding...")
+
+    def load_cachefile(self):
+        # Firstly, using core cache file information for
+        # valid checking
+        with open(self.cachefile, "rb") as cachefile:
+            pickled = pickle.Unpickler(cachefile)
+            try:
+                cache_ver = pickled.load()
+                bitbake_ver = pickled.load()
+            except Exception:
+                logger.info('Invalid cache, rebuilding...')
+                return
+
+            if cache_ver != __cache_version__:
+                logger.info('Cache version mismatch, rebuilding...')
+                return
+            elif bitbake_ver != bb.__version__:
+                logger.info('Bitbake version mismatch, rebuilding...')
+                return
+
+
+        cachesize = 0
+        previous_progress = 0
+        previous_percent = 0
+
+        # Calculate the correct cachesize of all those cache files
+        for cache_class in self.caches_array:
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
+                with open(cachefile, "rb") as cachefile:
+                    cachesize += os.fstat(cachefile.fileno()).st_size
+
+        bb.event.fire(bb.event.CacheLoadStarted(cachesize), self.data)
+        
+        for cache_class in self.caches_array:
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
+                with open(cachefile, "rb") as cachefile:
+                    pickled = pickle.Unpickler(cachefile)                    
+                    while cachefile:
+                        try:
+                            key = pickled.load()
+                            value = pickled.load()
+                        except Exception:
+                            break
+                        if self.depends_cache.has_key(key):
+                            self.depends_cache[key].append(value)
+                        else:
+                            self.depends_cache[key] = [value]
+                        # only fire events on even percentage boundaries
+                        current_progress = cachefile.tell() + previous_progress
+                        current_percent = 100 * current_progress / cachesize
+                        if current_percent > previous_percent:
+                            previous_percent = current_percent
+                            bb.event.fire(bb.event.CacheLoadProgress(current_progress, cachesize),
+                                          self.data)
+
+                    previous_progress += current_progress
+
+        # Note: depends cache number is corresponding to the parsing file numbers.
+        # The same file has several caches, still regarded as one item in the cache
+        bb.event.fire(bb.event.CacheLoadCompleted(cachesize,
+                                                  len(self.depends_cache)),
+                      self.data)
+
+    
+    @staticmethod
+    def virtualfn2realfn(virtualfn):
+        """
+        Convert a virtual file name to a real one + the associated subclass keyword
+        """
+
+        fn = virtualfn
+        cls = ""
+        if virtualfn.startswith('virtual:'):
+            elems = virtualfn.split(':')
+            cls = ":".join(elems[1:-1])
+            fn = elems[-1]
+        return (fn, cls)
+
+    @staticmethod
+    def realfn2virtual(realfn, cls):
+        """
+        Convert a real filename + the associated subclass keyword to a virtual filename
+        """
+        if cls == "":
+            return realfn
+        return "virtual:" + cls + ":" + realfn
+
+    @classmethod
+    def loadDataFull(cls, virtualfn, appends, cfgData):
+        """
+        Return a complete set of data for fn.
+        To do this, we need to parse the file.
+        """
+
+        (fn, virtual) = cls.virtualfn2realfn(virtualfn)
+
+        logger.debug(1, "Parsing %s (full)", fn)
+
+        cfgData.setVar("__ONLYFINALISE", virtual or "default")
+        bb_data = cls.load_bbfile(fn, appends, cfgData)
+        return bb_data[virtual]
+
+    @classmethod
+    def parse(cls, filename, appends, configdata, caches_array):
+        """Parse the specified filename, returning the recipe information"""
+        infos = []
+        datastores = cls.load_bbfile(filename, appends, configdata)
+        depends = []
+        for variant, data in sorted(datastores.iteritems(),
+                                    key=lambda i: i[0],
+                                    reverse=True):
+            virtualfn = cls.realfn2virtual(filename, variant)
+            depends = depends + (data.getVar("__depends", False) or [])
+            if depends and not variant:
+                data.setVar("__depends", depends)
+
+            info_array = []
+            for cache_class in caches_array:
+                if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                    info = cache_class(filename, data)
+                    info_array.append(info)
+            infos.append((virtualfn, info_array))
+
+        return infos
+
+    def load(self, filename, appends, configdata):
+        """Obtain the recipe information for the specified filename,
+        using cached values if available, otherwise parsing.
+
+        Note that if it does parse to obtain the info, it will not
+        automatically add the information to the cache or to your
+        CacheData.  Use the add or add_info method to do so after
+        running this, or use loadData instead."""
+        cached = self.cacheValid(filename, appends)
+        if cached:
+            infos = []
+            # info_array item is a list of [CoreRecipeInfo, XXXRecipeInfo]
+            info_array = self.depends_cache[filename]
+            for variant in info_array[0].variants:
+                virtualfn = self.realfn2virtual(filename, variant)
+                infos.append((virtualfn, self.depends_cache[virtualfn]))
+        else:
+            logger.debug(1, "Parsing %s", filename)
+            return self.parse(filename, appends, configdata, self.caches_array)
+
+        return cached, infos
+
+    def loadData(self, fn, appends, cfgData, cacheData):
+        """Load the recipe info for the specified filename,
+        parsing and adding to the cache if necessary, and adding
+        the recipe information to the supplied CacheData instance."""
+        skipped, virtuals = 0, 0
+
+        cached, infos = self.load(fn, appends, cfgData)
+        for virtualfn, info_array in infos:
+            if info_array[0].skipped:
+                logger.debug(1, "Skipping %s: %s", virtualfn, info_array[0].skipreason)
+                skipped += 1
+            else:
+                self.add_info(virtualfn, info_array, cacheData, not cached)
+                virtuals += 1
+
+        return cached, skipped, virtuals
+
+    def cacheValid(self, fn, appends):
+        """
+        Is the cache valid for fn?
+        Fast version, no timestamps checked.
+        """
+        if fn not in self.checked:
+            self.cacheValidUpdate(fn, appends)
+
+        # Is cache enabled?
+        if not self.has_cache:
+            return False
+        if fn in self.clean:
+            return True
+        return False
+
+    def cacheValidUpdate(self, fn, appends):
+        """
+        Is the cache valid for fn?
+        Make thorough (slower) checks including timestamps.
+        """
+        # Is cache enabled?
+        if not self.has_cache:
+            return False
+
+        self.checked.add(fn)
+
+        # File isn't in depends_cache
+        if not fn in self.depends_cache:
+            logger.debug(2, "Cache: %s is not cached", fn)
+            return False
+
+        mtime = bb.parse.cached_mtime_noerror(fn)
+
+        # Check file still exists
+        if mtime == 0:
+            logger.debug(2, "Cache: %s no longer exists", fn)
+            self.remove(fn)
+            return False
+
+        info_array = self.depends_cache[fn]
+        # Check the file's timestamp
+        if mtime != info_array[0].timestamp:
+            logger.debug(2, "Cache: %s changed", fn)
+            self.remove(fn)
+            return False
+
+        # Check dependencies are still valid
+        depends = info_array[0].file_depends
+        if depends:
+            for f, old_mtime in depends:
+                fmtime = bb.parse.cached_mtime_noerror(f)
+                # Check if file still exists
+                if old_mtime != 0 and fmtime == 0:
+                    logger.debug(2, "Cache: %s's dependency %s was removed",
+                                    fn, f)
+                    self.remove(fn)
+                    return False
+
+                if (fmtime != old_mtime):
+                    logger.debug(2, "Cache: %s's dependency %s changed",
+                                    fn, f)
+                    self.remove(fn)
+                    return False
+
+        if appends != info_array[0].appends:
+            logger.debug(2, "Cache: appends for %s changed", fn)
+            logger.debug(2, "%s to %s" % (str(appends), str(info_array[0].appends)))
+            self.remove(fn)
+            return False
+
+        invalid = False
+        for cls in info_array[0].variants:
+            virtualfn = self.realfn2virtual(fn, cls)
+            self.clean.add(virtualfn)
+            if virtualfn not in self.depends_cache:
+                logger.debug(2, "Cache: %s is not cached", virtualfn)
+                invalid = True
+
+        # If any one of the variants is not present, mark as invalid for all
+        if invalid:
+            for cls in info_array[0].variants:
+                virtualfn = self.realfn2virtual(fn, cls)
+                if virtualfn in self.clean:
+                    logger.debug(2, "Cache: Removing %s from cache", virtualfn)
+                    self.clean.remove(virtualfn)
+            if fn in self.clean:
+                logger.debug(2, "Cache: Marking %s as not clean", fn)
+                self.clean.remove(fn)
+            return False
+
+        self.clean.add(fn)
+        return True
+
+    def remove(self, fn):
+        """
+        Remove a fn from the cache
+        Called from the parser in error cases
+        """
+        if fn in self.depends_cache:
+            logger.debug(1, "Removing %s from cache", fn)
+            del self.depends_cache[fn]
+        if fn in self.clean:
+            logger.debug(1, "Marking %s as unclean", fn)
+            self.clean.remove(fn)
+
+    def sync(self):
+        """
+        Save the cache
+        Called from the parser when complete (or exiting)
+        """
+
+        if not self.has_cache:
+            return
+
+        if self.cacheclean:
+            logger.debug(2, "Cache is clean, not saving.")
+            return
+
+        file_dict = {}
+        pickler_dict = {}
+        for cache_class in self.caches_array:
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                cache_class_name = cache_class.__name__
+                cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
+                file_dict[cache_class_name] = open(cachefile, "wb")
+                pickler_dict[cache_class_name] =  pickle.Pickler(file_dict[cache_class_name], pickle.HIGHEST_PROTOCOL)
+                   
+        pickler_dict['CoreRecipeInfo'].dump(__cache_version__)
+        pickler_dict['CoreRecipeInfo'].dump(bb.__version__)
+
+        try:
+            for key, info_array in self.depends_cache.iteritems():
+                for info in info_array:
+                    if isinstance(info, RecipeInfoCommon):
+                        cache_class_name = info.__class__.__name__
+                        pickler_dict[cache_class_name].dump(key)
+                        pickler_dict[cache_class_name].dump(info)
+        finally:
+            for cache_class in self.caches_array:
+                if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                    cache_class_name = cache_class.__name__
+                    file_dict[cache_class_name].close()
+
+        del self.depends_cache
+
+    @staticmethod
+    def mtime(cachefile):
+        return bb.parse.cached_mtime_noerror(cachefile)
+
+    def add_info(self, filename, info_array, cacheData, parsed=None):
+        if isinstance(info_array[0], CoreRecipeInfo) and (not info_array[0].skipped):
+            cacheData.add_from_recipeinfo(filename, info_array)
+
+        if not self.has_cache:
+            return
+
+        if (info_array[0].skipped or 'SRCREVINACTION' not in info_array[0].pv) and not info_array[0].nocache:
+            if parsed:
+                self.cacheclean = False
+            self.depends_cache[filename] = info_array
+
+    def add(self, file_name, data, cacheData, parsed=None):
+        """
+        Save data we need into the cache
+        """
+
+        realfn = self.virtualfn2realfn(file_name)[0]
+
+        info_array = []
+        for cache_class in self.caches_array:
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                info_array.append(cache_class(realfn, data))
+        self.add_info(file_name, info_array, cacheData, parsed)
+
+    @staticmethod
+    def load_bbfile(bbfile, appends, config):
+        """
+        Load and parse one .bb build file
+        Return the data and whether parsing resulted in the file being skipped
+        """
+        chdir_back = False
+
+        from bb import data, parse
+
+        # expand tmpdir to include this topdir
+        data.setVar('TMPDIR', data.getVar('TMPDIR', config, 1) or "", config)
+        bbfile_loc = os.path.abspath(os.path.dirname(bbfile))
+        oldpath = os.path.abspath(os.getcwd())
+        parse.cached_mtime_noerror(bbfile_loc)
+        bb_data = data.init_db(config)
+        # The ConfHandler first looks if there is a TOPDIR and if not
+        # then it would call getcwd().
+        # Previously, we chdir()ed to bbfile_loc, called the handler
+        # and finally chdir()ed back, a couple of thousand times. We now
+        # just fill in TOPDIR to point to bbfile_loc if there is no TOPDIR yet.
+        if not data.getVar('TOPDIR', bb_data):
+            chdir_back = True
+            data.setVar('TOPDIR', bbfile_loc, bb_data)
+        try:
+            if appends:
+                data.setVar('__BBAPPEND', " ".join(appends), bb_data)
+            bb_data = parse.handle(bbfile, bb_data)
+            if chdir_back:
+                os.chdir(oldpath)
+            return bb_data
+        except:
+            if chdir_back:
+                os.chdir(oldpath)
+            raise
+
+
+def init(cooker):
+    """
+    The Objective: Cache the minimum amount of data possible yet get to the
+    stage of building packages (i.e. tryBuild) without reparsing any .bb files.
+
+    To do this, we intercept getVar calls and only cache the variables we see
+    being accessed. We rely on the cache getVar calls being made for all
+    variables bitbake might need to use to reach this stage. For each cached
+    file we need to track:
+
+    * Its mtime
+    * The mtimes of all its dependencies
+    * Whether it caused a parse.SkipPackage exception
+
+    Files causing parsing errors are evicted from the cache.
+
+    """
+    return Cache(cooker.configuration.data, cooker.configuration.data_hash)
+
+
+class CacheData(object):
+    """
+    The data structures we compile from the cached data
+    """
+
+    def __init__(self, caches_array):
+        self.caches_array = caches_array
+        for cache_class in self.caches_array:
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                cache_class.init_cacheData(self)        
+
+        # Direct cache variables
+        self.task_queues = {}
+        self.preferred = {}
+        self.tasks = {}
+        # Indirect Cache variables (set elsewhere)
+        self.ignored_dependencies = []
+        self.world_target = set()
+        self.bbfile_priority = {}
+
+    def add_from_recipeinfo(self, fn, info_array):
+        for info in info_array:
+            info.add_cacheData(self, fn)
+
+
+class MultiProcessCache(object):
+    """
+    BitBake multi-process cache implementation
+
+    Used by the codeparser & file checksum caches
+    """
+
+    def __init__(self):
+        self.cachefile = None
+        self.cachedata = self.create_cachedata()
+        self.cachedata_extras = self.create_cachedata()
+
+    def init_cache(self, d):
+        cachedir = (d.getVar("PERSISTENT_DIR", True) or
+                    d.getVar("CACHE", True))
+        if cachedir in [None, '']:
+            return
+        bb.utils.mkdirhier(cachedir)
+        self.cachefile = os.path.join(cachedir, self.__class__.cache_file_name)
+        logger.debug(1, "Using cache in '%s'", self.cachefile)
+
+        try:
+            p = pickle.Unpickler(file(self.cachefile, "rb"))
+            data, version = p.load()
+        except:
+            return
+
+        if version != self.__class__.CACHE_VERSION:
+            return
+
+        self.cachedata = data
+
+    def internSet(self, items):
+        new = set()
+        for i in items:
+            new.add(intern(i))
+        return new
+
+    def compress_keys(self, data):
+        # Override in subclasses if desired
+        return
+
+    def create_cachedata(self):
+        data = [{}]
+        return data
+
+    def save_extras(self, d):
+        if not self.cachefile:
+            return
+
+        glf = bb.utils.lockfile(self.cachefile + ".lock", shared=True)
+
+        i = os.getpid()
+        lf = None
+        while not lf:
+            lf = bb.utils.lockfile(self.cachefile + ".lock." + str(i), retry=False)
+            if not lf or os.path.exists(self.cachefile + "-" + str(i)):
+                if lf:
+                    bb.utils.unlockfile(lf)
+                    lf = None
+                i = i + 1
+                continue
+
+            p = pickle.Pickler(file(self.cachefile + "-" + str(i), "wb"), -1)
+            p.dump([self.cachedata_extras, self.__class__.CACHE_VERSION])
+
+        bb.utils.unlockfile(lf)
+        bb.utils.unlockfile(glf)
+
+    def merge_data(self, source, dest):
+        for j in range(0,len(dest)):
+            for h in source[j]:
+                if h not in dest[j]:
+                    dest[j][h] = source[j][h]
+
+    def save_merge(self, d):
+        if not self.cachefile:
+            return
+
+        glf = bb.utils.lockfile(self.cachefile + ".lock")
+
+        try:
+            p = pickle.Unpickler(file(self.cachefile, "rb"))
+            data, version = p.load()
+        except (IOError, EOFError):
+            data, version = None, None
+
+        if version != self.__class__.CACHE_VERSION:
+            data = self.create_cachedata()
+
+        for f in [y for y in os.listdir(os.path.dirname(self.cachefile)) if y.startswith(os.path.basename(self.cachefile) + '-')]:
+            f = os.path.join(os.path.dirname(self.cachefile), f)
+            try:
+                p = pickle.Unpickler(file(f, "rb"))
+                extradata, version = p.load()
+            except (IOError, EOFError):
+                extradata, version = self.create_cachedata(), None
+
+            if version != self.__class__.CACHE_VERSION:
+                continue
+
+            self.merge_data(extradata, data)
+            os.unlink(f)
+
+        self.compress_keys(data)
+
+        p = pickle.Pickler(file(self.cachefile, "wb"), -1)
+        p.dump([data, self.__class__.CACHE_VERSION])
+
+        bb.utils.unlockfile(glf)
+

bitbake/lib/bb/cache_extra.py

@@ -0,0 +1,69 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# Extra RecipeInfo will be all defined in this file. Currently,
+# Only Hob (Image Creator) Requests some extra fields. So
+# HobRecipeInfo is defined. It's named HobRecipeInfo because it
+# is introduced by 'hob'. Users could also introduce other
+# RecipeInfo or simply use those already defined RecipeInfo.
+# In the following patch, this newly defined new extra RecipeInfo
+# will be dynamically loaded and used for loading/saving the extra
+# cache fields  
+
+# Copyright (C) 2011, Intel Corporation. All rights reserved.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+from bb.cache import RecipeInfoCommon
+
+class HobRecipeInfo(RecipeInfoCommon):
+    __slots__ = ()
+
+    classname = "HobRecipeInfo"
+    # please override this member with the correct data cache file
+    # such as (bb_cache.dat, bb_extracache_hob.dat) 
+    cachefile = "bb_extracache_" + classname +".dat"        
+
+    def __init__(self, filename, metadata):
+
+        self.summary = self.getvar('SUMMARY', metadata)
+        self.license = self.getvar('LICENSE', metadata)
+        self.section = self.getvar('SECTION', metadata)
+        self.description = self.getvar('DESCRIPTION', metadata)
+        self.homepage = self.getvar('HOMEPAGE', metadata)
+        self.bugtracker = self.getvar('BUGTRACKER', metadata)
+        self.prevision = self.getvar('PR', metadata)
+        self.files_info = self.getvar('FILES_INFO', metadata)
+
+    @classmethod
+    def init_cacheData(cls, cachedata):
+        # CacheData in Hob RecipeInfo Class
+        cachedata.summary = {}
+        cachedata.license = {}
+        cachedata.section = {}
+        cachedata.description = {}
+        cachedata.homepage = {}
+        cachedata.bugtracker = {}
+        cachedata.prevision = {}
+        cachedata.files_info = {}
+
+    def add_cacheData(self, cachedata, fn):
+        cachedata.summary[fn] = self.summary
+        cachedata.license[fn] = self.license
+        cachedata.section[fn] = self.section
+        cachedata.description[fn] = self.description
+        cachedata.homepage[fn] = self.homepage
+        cachedata.bugtracker[fn] = self.bugtracker
+        cachedata.prevision[fn] = self.prevision
+        cachedata.files_info[fn] = self.files_info

bitbake/lib/bb/checksum.py

@@ -0,0 +1,90 @@
+# Local file checksum cache implementation
+#
+# Copyright (C) 2012 Intel Corporation
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os
+import stat
+import bb.utils
+import logging
+from bb.cache import MultiProcessCache
+
+logger = logging.getLogger("BitBake.Cache")
+
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    logger.info("Importing cPickle failed. "
+                "Falling back to a very slow implementation.")
+
+
+# mtime cache (non-persistent)
+# based upon the assumption that files do not change during bitbake run
+class FileMtimeCache(object):
+    cache = {}
+
+    def cached_mtime(self, f):
+        if f not in self.cache:
+            self.cache[f] = os.stat(f)[stat.ST_MTIME]
+        return self.cache[f]
+
+    def cached_mtime_noerror(self, f):
+        if f not in self.cache:
+            try:
+                self.cache[f] = os.stat(f)[stat.ST_MTIME]
+            except OSError:
+                return 0
+        return self.cache[f]
+
+    def update_mtime(self, f):
+        self.cache[f] = os.stat(f)[stat.ST_MTIME]
+        return self.cache[f]
+
+    def clear(self):
+        self.cache.clear()
+
+# Checksum + mtime cache (persistent)
+class FileChecksumCache(MultiProcessCache):
+    cache_file_name = "local_file_checksum_cache.dat"
+    CACHE_VERSION = 1
+
+    def __init__(self):
+        self.mtime_cache = FileMtimeCache()
+        MultiProcessCache.__init__(self)
+
+    def get_checksum(self, f):
+        entry = self.cachedata[0].get(f)
+        cmtime = self.mtime_cache.cached_mtime(f)
+        if entry:
+            (mtime, hashval) = entry
+            if cmtime == mtime:
+                return hashval
+            else:
+                bb.debug(2, "file %s changed mtime, recompute checksum" % f)
+
+        hashval = bb.utils.md5_file(f)
+        self.cachedata_extras[0][f] = (cmtime, hashval)
+        return hashval
+
+    def merge_data(self, source, dest):
+        for h in source[0]:
+            if h in dest:
+                (smtime, _) = source[0][h]
+                (dmtime, _) = dest[0][h]
+                if smtime > dmtime:
+                    dest[0][h] = source[0][h]
+            else:
+                dest[0][h] = source[0][h]

bitbake/lib/bb/codeparser.py

@@ -0,0 +1,319 @@
+import ast
+import codegen
+import logging
+import os.path
+import bb.utils, bb.data
+from itertools import chain
+from pysh import pyshyacc, pyshlex, sherrors
+from bb.cache import MultiProcessCache
+
+
+logger = logging.getLogger('BitBake.CodeParser')
+
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    logger.info('Importing cPickle failed.  Falling back to a very slow implementation.')
+
+
+def check_indent(codestr):
+    """If the code is indented, add a top level piece of code to 'remove' the indentation"""
+
+    i = 0
+    while codestr[i] in ["\n", "\t", " "]:
+        i = i + 1
+
+    if i == 0:
+        return codestr
+
+    if codestr[i-1] == "\t" or codestr[i-1] == " ":
+        return "if 1:\n" + codestr
+
+    return codestr
+
+
+class CodeParserCache(MultiProcessCache):
+    cache_file_name = "bb_codeparser.dat"
+    CACHE_VERSION = 3
+
+    def __init__(self):
+        MultiProcessCache.__init__(self)
+        self.pythoncache = self.cachedata[0]
+        self.shellcache = self.cachedata[1]
+        self.pythoncacheextras = self.cachedata_extras[0]
+        self.shellcacheextras = self.cachedata_extras[1]
+
+    def init_cache(self, d):
+        MultiProcessCache.init_cache(self, d)
+
+        # cachedata gets re-assigned in the parent
+        self.pythoncache = self.cachedata[0]
+        self.shellcache = self.cachedata[1]
+
+    def compress_keys(self, data):
+        # When the dicts are originally created, python calls intern() on the set keys
+        # which significantly improves memory usage. Sadly the pickle/unpickle process
+        # doesn't call intern() on the keys and results in the same strings being duplicated
+        # in memory. This also means pickle will save the same string multiple times in
+        # the cache file. By interning the data here, the cache file shrinks dramatically
+        # meaning faster load times and the reloaded cache files also consume much less
+        # memory. This is worth any performance hit from this loops and the use of the
+        # intern() data storage.
+        # Python 3.x may behave better in this area
+        for h in data[0]:
+            data[0][h]["refs"] = self.internSet(data[0][h]["refs"])
+            data[0][h]["execs"] = self.internSet(data[0][h]["execs"])
+        for h in data[1]:
+            data[1][h]["execs"] = self.internSet(data[1][h]["execs"])
+        return
+
+    def create_cachedata(self):
+        data = [{}, {}]
+        return data
+
+codeparsercache = CodeParserCache()
+
+def parser_cache_init(d):
+    codeparsercache.init_cache(d)
+
+def parser_cache_save(d):
+    codeparsercache.save_extras(d)
+
+def parser_cache_savemerge(d):
+    codeparsercache.save_merge(d)
+
+Logger = logging.getLoggerClass()
+class BufferedLogger(Logger):
+    def __init__(self, name, level=0, target=None):
+        Logger.__init__(self, name)
+        self.setLevel(level)
+        self.buffer = []
+        self.target = target
+
+    def handle(self, record):
+        self.buffer.append(record)
+
+    def flush(self):
+        for record in self.buffer:
+            self.target.handle(record)
+        self.buffer = []
+
+class PythonParser():
+    getvars = ("d.getVar", "bb.data.getVar", "data.getVar", "d.appendVar", "d.prependVar")
+    containsfuncs = ("bb.utils.contains", "base_contains", "oe.utils.contains")
+    execfuncs = ("bb.build.exec_func", "bb.build.exec_task")
+
+    def warn(self, func, arg):
+        """Warn about calls of bitbake APIs which pass a non-literal
+        argument for the variable name, as we're not able to track such
+        a reference.
+        """
+
+        try:
+            funcstr = codegen.to_source(func)
+            argstr = codegen.to_source(arg)
+        except TypeError:
+            self.log.debug(2, 'Failed to convert function and argument to source form')
+        else:
+            self.log.debug(1, self.unhandled_message % (funcstr, argstr))
+
+    def visit_Call(self, node):
+        name = self.called_node_name(node.func)
+        if name in self.getvars or name in self.containsfuncs:
+            if isinstance(node.args[0], ast.Str):
+                self.var_references.add(node.args[0].s)
+            else:
+                self.warn(node.func, node.args[0])
+        elif name in self.execfuncs:
+            if isinstance(node.args[0], ast.Str):
+                self.var_execs.add(node.args[0].s)
+            else:
+                self.warn(node.func, node.args[0])
+        elif name and isinstance(node.func, (ast.Name, ast.Attribute)):
+            self.execs.add(name)
+
+    def called_node_name(self, node):
+        """Given a called node, return its original string form"""
+        components = []
+        while node:
+            if isinstance(node, ast.Attribute):
+                components.append(node.attr)
+                node = node.value
+            elif isinstance(node, ast.Name):
+                components.append(node.id)
+                return '.'.join(reversed(components))
+            else:
+                break
+
+    def __init__(self, name, log):
+        self.var_references = set()
+        self.var_execs = set()
+        self.execs = set()
+        self.references = set()
+        self.log = BufferedLogger('BitBake.Data.%s' % name, logging.DEBUG, log)
+
+        self.unhandled_message = "in call of %s, argument '%s' is not a string literal"
+        self.unhandled_message = "while parsing %s, %s" % (name, self.unhandled_message)
+
+    def parse_python(self, node):
+        h = hash(str(node))
+
+        if h in codeparsercache.pythoncache:
+            self.references = codeparsercache.pythoncache[h]["refs"]
+            self.execs = codeparsercache.pythoncache[h]["execs"]
+            return
+
+        if h in codeparsercache.pythoncacheextras:
+            self.references = codeparsercache.pythoncacheextras[h]["refs"]
+            self.execs = codeparsercache.pythoncacheextras[h]["execs"]
+            return
+
+
+        code = compile(check_indent(str(node)), "<string>", "exec",
+                       ast.PyCF_ONLY_AST)
+
+        for n in ast.walk(code):
+            if n.__class__.__name__ == "Call":
+                self.visit_Call(n)
+
+        self.references.update(self.var_references)
+        self.references.update(self.var_execs)
+
+        codeparsercache.pythoncacheextras[h] = {}
+        codeparsercache.pythoncacheextras[h]["refs"] = self.references
+        codeparsercache.pythoncacheextras[h]["execs"] = self.execs
+
+class ShellParser():
+    def __init__(self, name, log):
+        self.funcdefs = set()
+        self.allexecs = set()
+        self.execs = set()
+        self.log = BufferedLogger('BitBake.Data.%s' % name, logging.DEBUG, log)
+        self.unhandled_template = "unable to handle non-literal command '%s'"
+        self.unhandled_template = "while parsing %s, %s" % (name, self.unhandled_template)
+
+    def parse_shell(self, value):
+        """Parse the supplied shell code in a string, returning the external
+        commands it executes.
+        """
+
+        h = hash(str(value))
+
+        if h in codeparsercache.shellcache:
+            self.execs = codeparsercache.shellcache[h]["execs"]
+            return self.execs
+
+        if h in codeparsercache.shellcacheextras:
+            self.execs = codeparsercache.shellcacheextras[h]["execs"]
+            return self.execs
+
+        try:
+            tokens, _ = pyshyacc.parse(value, eof=True, debug=False)
+        except pyshlex.NeedMore:
+            raise sherrors.ShellSyntaxError("Unexpected EOF")
+
+        for token in tokens:
+            self.process_tokens(token)
+        self.execs = set(cmd for cmd in self.allexecs if cmd not in self.funcdefs)
+
+        codeparsercache.shellcacheextras[h] = {}
+        codeparsercache.shellcacheextras[h]["execs"] = self.execs
+
+        return self.execs
+
+    def process_tokens(self, tokens):
+        """Process a supplied portion of the syntax tree as returned by
+        pyshyacc.parse.
+        """
+
+        def function_definition(value):
+            self.funcdefs.add(value.name)
+            return [value.body], None
+
+        def case_clause(value):
+            # Element 0 of each item in the case is the list of patterns, and
+            # Element 1 of each item in the case is the list of commands to be
+            # executed when that pattern matches.
+            words = chain(*[item[0] for item in value.items])
+            cmds  = chain(*[item[1] for item in value.items])
+            return cmds, words
+
+        def if_clause(value):
+            main = chain(value.cond, value.if_cmds)
+            rest = value.else_cmds
+            if isinstance(rest, tuple) and rest[0] == "elif":
+                return chain(main, if_clause(rest[1]))
+            else:
+                return chain(main, rest)
+
+        def simple_command(value):
+            return None, chain(value.words, (assign[1] for assign in value.assigns))
+
+        token_handlers = {
+            "and_or": lambda x: ((x.left, x.right), None),
+            "async": lambda x: ([x], None),
+            "brace_group": lambda x: (x.cmds, None),
+            "for_clause": lambda x: (x.cmds, x.items),
+            "function_definition": function_definition,
+            "if_clause": lambda x: (if_clause(x), None),
+            "pipeline": lambda x: (x.commands, None),
+            "redirect_list": lambda x: ([x.cmd], None),
+            "subshell": lambda x: (x.cmds, None),
+            "while_clause": lambda x: (chain(x.condition, x.cmds), None),
+            "until_clause": lambda x: (chain(x.condition, x.cmds), None),
+            "simple_command": simple_command,
+            "case_clause": case_clause,
+        }
+
+        for token in tokens:
+            name, value = token
+            try:
+                more_tokens, words = token_handlers[name](value)
+            except KeyError:
+                raise NotImplementedError("Unsupported token type " + name)
+
+            if more_tokens:
+                self.process_tokens(more_tokens)
+
+            if words:
+                self.process_words(words)
+
+    def process_words(self, words):
+        """Process a set of 'words' in pyshyacc parlance, which includes
+        extraction of executed commands from $() blocks, as well as grabbing
+        the command name argument.
+        """
+
+        words = list(words)
+        for word in list(words):
+            wtree = pyshlex.make_wordtree(word[1])
+            for part in wtree:
+                if not isinstance(part, list):
+                    continue
+
+                if part[0] in ('`', '$('):
+                    command = pyshlex.wordtree_as_string(part[1:-1])
+                    self.parse_shell(command)
+
+                    if word[0] in ("cmd_name", "cmd_word"):
+                        if word in words:
+                            words.remove(word)
+
+        usetoken = False
+        for word in words:
+            if word[0] in ("cmd_name", "cmd_word") or \
+               (usetoken and word[0] == "TOKEN"):
+                if "=" in word[1]:
+                    usetoken = True
+                    continue
+
+                cmd = word[1]
+                if cmd.startswith("$"):
+                    self.log.debug(1, self.unhandled_template % cmd)
+                elif cmd == "eval":
+                    command = " ".join(word for _, word in words[1:])
+                    self.parse_shell(command)
+                else:
+                    self.allexecs.add(cmd)
+                break

bitbake/lib/bb/command.py

@@ -0,0 +1,406 @@
+"""
+BitBake 'Command' module
+
+Provide an interface to interact with the bitbake server through 'commands'
+"""
+
+# Copyright (C) 2006-2007  Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+"""
+The bitbake server takes 'commands' from its UI/commandline.
+Commands are either synchronous or asynchronous.
+Async commands return data to the client in the form of events.
+Sync commands must only return data through the function return value
+and must not trigger events, directly or indirectly.
+Commands are queued in a CommandQueue
+"""
+
+import bb.event
+import bb.cooker
+
+class CommandCompleted(bb.event.Event):
+    pass
+
+class CommandExit(bb.event.Event):
+    def  __init__(self, exitcode):
+        bb.event.Event.__init__(self)
+        self.exitcode = int(exitcode)
+
+class CommandFailed(CommandExit):
+    def __init__(self, message):
+        self.error = message
+        CommandExit.__init__(self, 1)
+
+class CommandError(Exception):
+    pass
+
+class Command:
+    """
+    A queue of asynchronous commands for bitbake
+    """
+    def __init__(self, cooker):
+        self.cooker = cooker
+        self.cmds_sync = CommandsSync()
+        self.cmds_async = CommandsAsync()
+
+        # FIXME Add lock for this
+        self.currentAsyncCommand = None
+
+    def runCommand(self, commandline):
+        command = commandline.pop(0)
+        if hasattr(CommandsSync, command):
+            # Can run synchronous commands straight away
+            command_method = getattr(self.cmds_sync, command)
+            try:
+                result = command_method(self, commandline)
+            except CommandError as exc:
+                return None, exc.args[0]
+            except Exception:
+                import traceback
+                return None, traceback.format_exc()
+            else:
+                return result, None
+        if self.currentAsyncCommand is not None:
+            return None, "Busy (%s in progress)" % self.currentAsyncCommand[0]
+        if command not in CommandsAsync.__dict__:
+            return None, "No such command"
+        self.currentAsyncCommand = (command, commandline)
+        self.cooker.server_registration_cb(self.cooker.runCommands, self.cooker)
+        return True, None
+
+    def runAsyncCommand(self):
+        try:
+            if self.currentAsyncCommand is not None:
+                (command, options) = self.currentAsyncCommand
+                commandmethod = getattr(CommandsAsync, command)
+                needcache = getattr( commandmethod, "needcache" )
+                if (needcache and self.cooker.state in
+                    (bb.cooker.state.initial, bb.cooker.state.parsing)):
+                    self.cooker.updateCache()
+                    return True
+                else:
+                    commandmethod(self.cmds_async, self, options)
+                    return False
+            else:
+                return False
+        except KeyboardInterrupt as exc:
+            self.finishAsyncCommand("Interrupted")
+            return False
+        except SystemExit as exc:
+            arg = exc.args[0]
+            if isinstance(arg, basestring):
+                self.finishAsyncCommand(arg)
+            else:
+                self.finishAsyncCommand("Exited with %s" % arg)
+            return False
+        except Exception as exc:
+            import traceback
+            if isinstance(exc, bb.BBHandledException):
+                self.finishAsyncCommand("")
+            else:
+                self.finishAsyncCommand(traceback.format_exc())
+            return False
+
+    def finishAsyncCommand(self, msg=None, code=None):
+        if msg:
+            bb.event.fire(CommandFailed(msg), self.cooker.configuration.event_data)
+        elif code:
+            bb.event.fire(CommandExit(code), self.cooker.configuration.event_data)
+        else:
+            bb.event.fire(CommandCompleted(), self.cooker.configuration.event_data)
+        self.currentAsyncCommand = None
+
+
+class CommandsSync:
+    """
+    A class of synchronous commands
+    These should run quickly so as not to hurt interactive performance.
+    These must not influence any running synchronous command.
+    """
+
+    def stateShutdown(self, command, params):
+        """
+        Trigger cooker 'shutdown' mode
+        """
+        command.cooker.shutdown()
+
+    def stateStop(self, command, params):
+        """
+        Stop the cooker
+        """
+        command.cooker.stop()
+
+    def getCmdLineAction(self, command, params):
+        """
+        Get any command parsed from the commandline
+        """
+        cmd_action = command.cooker.commandlineAction
+        if cmd_action is None:
+            return None
+        elif 'msg' in cmd_action and cmd_action['msg']:
+            raise CommandError(cmd_action['msg'])
+        else:
+            return cmd_action['action']
+
+    def getVariable(self, command, params):
+        """
+        Read the value of a variable from configuration.data
+        """
+        varname = params[0]
+        expand = True
+        if len(params) > 1:
+            expand = params[1]
+
+        return command.cooker.configuration.data.getVar(varname, expand)
+
+    def setVariable(self, command, params):
+        """
+        Set the value of variable in configuration.data
+        """
+        varname = params[0]
+        value = str(params[1])
+        command.cooker.configuration.data.setVar(varname, value)
+
+    def enableDataTracking(self, command, params):
+        """
+        Enable history tracking for variables
+        """
+        command.cooker.enableDataTracking()
+
+    def disableDataTracking(self, command, params):
+        """
+        Disable history tracking for variables
+        """
+        command.cooker.disableDataTracking()
+
+    def initCooker(self, command, params):
+        """
+        Init the cooker to initial state with nothing parsed
+        """
+        command.cooker.initialize()
+
+    def resetCooker(self, command, params):
+        """
+        Reset the cooker to its initial state, thus forcing a reparse for
+        any async command that has the needcache property set to True
+        """
+        command.cooker.reset()
+
+    def getCpuCount(self, command, params):
+        """
+        Get the CPU count on the bitbake server
+        """
+        return bb.utils.cpu_count()
+
+    def matchFile(self, command, params):
+        fMatch = params[0]
+        return command.cooker.matchFile(fMatch)
+
+    def generateNewImage(self, command, params):
+        image = params[0]
+        base_image = params[1]
+        package_queue = params[2]
+        return command.cooker.generateNewImage(image, base_image, package_queue)
+
+    def setVarFile(self, command, params):
+        var = params[0]
+        val = params[1]
+        default_file = params[2]
+        command.cooker.saveConfigurationVar(var, val, default_file)
+
+class CommandsAsync:
+    """
+    A class of asynchronous commands
+    These functions communicate via generated events.
+    Any function that requires metadata parsing should be here.
+    """
+
+    def buildFile(self, command, params):
+        """
+        Build a single specified .bb file
+        """
+        bfile = params[0]
+        task = params[1]
+
+        command.cooker.buildFile(bfile, task)
+    buildFile.needcache = False
+
+    def buildTargets(self, command, params):
+        """
+        Build a set of targets
+        """
+        pkgs_to_build = params[0]
+        task = params[1]
+
+        command.cooker.buildTargets(pkgs_to_build, task)
+    buildTargets.needcache = True
+
+    def generateDepTreeEvent(self, command, params):
+        """
+        Generate an event containing the dependency information
+        """
+        pkgs_to_build = params[0]
+        task = params[1]
+
+        command.cooker.generateDepTreeEvent(pkgs_to_build, task)
+        command.finishAsyncCommand()
+    generateDepTreeEvent.needcache = True
+
+    def generateDotGraph(self, command, params):
+        """
+        Dump dependency information to disk as .dot files
+        """
+        pkgs_to_build = params[0]
+        task = params[1]
+
+        command.cooker.generateDotGraphFiles(pkgs_to_build, task)
+        command.finishAsyncCommand()
+    generateDotGraph.needcache = True
+
+    def generateTargetsTree(self, command, params):
+        """
+        Generate a tree of buildable targets.
+        If klass is provided ensure all recipes that inherit the class are
+        included in the package list.
+        If pkg_list provided use that list (plus any extras brought in by
+        klass) rather than generating a tree for all packages.
+        """
+        klass = params[0]
+        pkg_list = params[1]
+
+        command.cooker.generateTargetsTree(klass, pkg_list)
+        command.finishAsyncCommand()
+    generateTargetsTree.needcache = True
+
+    def findCoreBaseFiles(self, command, params):
+        """
+        Find certain files in COREBASE directory. i.e. Layers
+        """
+        subdir = params[0]
+        filename = params[1]
+
+        command.cooker.findCoreBaseFiles(subdir, filename)
+        command.finishAsyncCommand()
+    findCoreBaseFiles.needcache = False
+
+    def findConfigFiles(self, command, params):
+        """
+        Find config files which provide appropriate values
+        for the passed configuration variable. i.e. MACHINE
+        """
+        varname = params[0]
+
+        command.cooker.findConfigFiles(varname)
+        command.finishAsyncCommand()
+    findConfigFiles.needcache = False
+
+    def findFilesMatchingInDir(self, command, params):
+        """
+        Find implementation files matching the specified pattern
+        in the requested subdirectory of a BBPATH
+        """
+        pattern = params[0]
+        directory = params[1]
+
+        command.cooker.findFilesMatchingInDir(pattern, directory)
+        command.finishAsyncCommand()
+    findFilesMatchingInDir.needcache = False
+
+    def findConfigFilePath(self, command, params):
+        """
+        Find the path of the requested configuration file
+        """
+        configfile = params[0]
+
+        command.cooker.findConfigFilePath(configfile)
+        command.finishAsyncCommand()
+    findConfigFilePath.needcache = False
+
+    def showVersions(self, command, params):
+        """
+        Show the currently selected versions
+        """
+        command.cooker.showVersions()
+        command.finishAsyncCommand()
+    showVersions.needcache = True
+
+    def showEnvironmentTarget(self, command, params):
+        """
+        Print the environment of a target recipe
+        (needs the cache to work out which recipe to use)
+        """
+        pkg = params[0]
+
+        command.cooker.showEnvironment(None, pkg)
+        command.finishAsyncCommand()
+    showEnvironmentTarget.needcache = True
+
+    def showEnvironment(self, command, params):
+        """
+        Print the standard environment
+        or if specified the environment for a specified recipe
+        """
+        bfile = params[0]
+
+        command.cooker.showEnvironment(bfile)
+        command.finishAsyncCommand()
+    showEnvironment.needcache = False
+
+    def parseFiles(self, command, params):
+        """
+        Parse the .bb files
+        """
+        command.cooker.updateCache()
+        command.finishAsyncCommand()
+    parseFiles.needcache = True
+
+    def reparseFiles(self, command, params):
+        """
+        Reparse .bb files
+        """
+        command.cooker.reparseFiles()
+        command.finishAsyncCommand()
+    reparseFiles.needcache = True
+
+    def compareRevisions(self, command, params):
+        """
+        Parse the .bb files
+        """
+        if bb.fetch.fetcher_compare_revisions(command.cooker.configuration.data):
+            command.finishAsyncCommand(code=1)
+        else:
+            command.finishAsyncCommand()
+    compareRevisions.needcache = True
+
+    def parseConfigurationFiles(self, command, params):
+        """
+        Parse the configuration files
+        """
+        prefiles = params[0]
+        postfiles = params[1]
+        command.cooker.parseConfigurationFiles(prefiles, postfiles)
+        command.finishAsyncCommand()
+    parseConfigurationFiles.needcache = False
+
+    def triggerEvent(self, command, params):
+        """
+        Trigger a certain event
+        """
+        event = params[0]
+        bb.event.fire(eval(event), command.cooker.configuration.data)
+        command.currentAsyncCommand = None
+    triggerEvent.needcache = False
+

bitbake/lib/bb/compat.py

@@ -0,0 +1,928 @@
+"""Code pulled from future python versions, here for compatibility"""
+
+from collections import MutableMapping, KeysView, ValuesView, ItemsView
+try:
+    from thread import get_ident as _get_ident
+except ImportError:
+    from dummy_thread import get_ident as _get_ident
+
+def total_ordering(cls):
+    """Class decorator that fills in missing ordering methods"""
+    convert = {
+        '__lt__': [('__gt__', lambda self, other: other < self),
+                   ('__le__', lambda self, other: not other < self),
+                   ('__ge__', lambda self, other: not self < other)],
+        '__le__': [('__ge__', lambda self, other: other <= self),
+                   ('__lt__', lambda self, other: not other <= self),
+                   ('__gt__', lambda self, other: not self <= other)],
+        '__gt__': [('__lt__', lambda self, other: other > self),
+                   ('__ge__', lambda self, other: not other > self),
+                   ('__le__', lambda self, other: not self > other)],
+        '__ge__': [('__le__', lambda self, other: other >= self),
+                   ('__gt__', lambda self, other: not other >= self),
+                   ('__lt__', lambda self, other: not self >= other)]
+    }
+    roots = set(dir(cls)) & set(convert)
+    if not roots:
+        raise ValueError('must define at least one ordering operation: < > <= >=')
+    root = max(roots)       # prefer __lt__ to __le__ to __gt__ to __ge__
+    for opname, opfunc in convert[root]:
+        if opname not in roots:
+            opfunc.__name__ = opname
+            opfunc.__doc__ = getattr(int, opname).__doc__
+            setattr(cls, opname, opfunc)
+    return cls
+
+class OrderedDict(dict):
+    'Dictionary that remembers insertion order'
+    # An inherited dict maps keys to values.
+    # The inherited dict provides __getitem__, __len__, __contains__, and get.
+    # The remaining methods are order-aware.
+    # Big-O running times for all methods are the same as regular dictionaries.
+
+    # The internal self.__map dict maps keys to links in a doubly linked list.
+    # The circular doubly linked list starts and ends with a sentinel element.
+    # The sentinel element never gets deleted (this simplifies the algorithm).
+    # Each link is stored as a list of length three:  [PREV, NEXT, KEY].
+
+    def __init__(self, *args, **kwds):
+        '''Initialize an ordered dictionary.  The signature is the same as
+        regular dictionaries, but keyword arguments are not recommended because
+        their insertion order is arbitrary.
+
+        '''
+        if len(args) > 1:
+            raise TypeError('expected at most 1 arguments, got %d' % len(args))
+        try:
+            self.__root
+        except AttributeError:
+            self.__root = root = []                     # sentinel node
+            root[:] = [root, root, None]
+            self.__map = {}
+        self.__update(*args, **kwds)
+
+    def __setitem__(self, key, value, PREV=0, NEXT=1, dict_setitem=dict.__setitem__):
+        'od.__setitem__(i, y) <==> od[i]=y'
+        # Setting a new item creates a new link at the end of the linked list,
+        # and the inherited dictionary is updated with the new key/value pair.
+        if key not in self:
+            root = self.__root
+            last = root[PREV]
+            last[NEXT] = root[PREV] = self.__map[key] = [last, root, key]
+        dict_setitem(self, key, value)
+
+    def __delitem__(self, key, PREV=0, NEXT=1, dict_delitem=dict.__delitem__):
+        'od.__delitem__(y) <==> del od[y]'
+        # Deleting an existing item uses self.__map to find the link which gets
+        # removed by updating the links in the predecessor and successor nodes.
+        dict_delitem(self, key)
+        link_prev, link_next, key = self.__map.pop(key)
+        link_prev[NEXT] = link_next
+        link_next[PREV] = link_prev
+
+    def __iter__(self):
+        'od.__iter__() <==> iter(od)'
+        # Traverse the linked list in order.
+        NEXT, KEY = 1, 2
+        root = self.__root
+        curr = root[NEXT]
+        while curr is not root:
+            yield curr[KEY]
+            curr = curr[NEXT]
+
+    def __reversed__(self):
+        'od.__reversed__() <==> reversed(od)'
+        # Traverse the linked list in reverse order.
+        PREV, KEY = 0, 2
+        root = self.__root
+        curr = root[PREV]
+        while curr is not root:
+            yield curr[KEY]
+            curr = curr[PREV]
+
+    def clear(self):
+        'od.clear() -> None.  Remove all items from od.'
+        for node in self.__map.itervalues():
+            del node[:]
+        root = self.__root
+        root[:] = [root, root, None]
+        self.__map.clear()
+        dict.clear(self)
+
+    # -- the following methods do not depend on the internal structure --
+
+    def keys(self):
+        'od.keys() -> list of keys in od'
+        return list(self)
+
+    def values(self):
+        'od.values() -> list of values in od'
+        return [self[key] for key in self]
+
+    def items(self):
+        'od.items() -> list of (key, value) pairs in od'
+        return [(key, self[key]) for key in self]
+
+    def iterkeys(self):
+        'od.iterkeys() -> an iterator over the keys in od'
+        return iter(self)
+
+    def itervalues(self):
+        'od.itervalues -> an iterator over the values in od'
+        for k in self:
+            yield self[k]
+
+    def iteritems(self):
+        'od.iteritems -> an iterator over the (key, value) pairs in od'
+        for k in self:
+            yield (k, self[k])
+
+    update = MutableMapping.update
+
+    __update = update # let subclasses override update without breaking __init__
+
+    __marker = object()
+
+    def pop(self, key, default=__marker):
+        '''od.pop(k[,d]) -> v, remove specified key and return the corresponding
+        value.  If key is not found, d is returned if given, otherwise KeyError
+        is raised.
+
+        '''
+        if key in self:
+            result = self[key]
+            del self[key]
+            return result
+        if default is self.__marker:
+            raise KeyError(key)
+        return default
+
+    def setdefault(self, key, default=None):
+        'od.setdefault(k[,d]) -> od.get(k,d), also set od[k]=d if k not in od'
+        if key in self:
+            return self[key]
+        self[key] = default
+        return default
+
+    def popitem(self, last=True):
+        '''od.popitem() -> (k, v), return and remove a (key, value) pair.
+        Pairs are returned in LIFO order if last is true or FIFO order if false.
+
+        '''
+        if not self:
+            raise KeyError('dictionary is empty')
+        key = next(reversed(self) if last else iter(self))
+        value = self.pop(key)
+        return key, value
+
+    def __repr__(self, _repr_running={}):
+        'od.__repr__() <==> repr(od)'
+        call_key = id(self), _get_ident()
+        if call_key in _repr_running:
+            return '...'
+        _repr_running[call_key] = 1
+        try:
+            if not self:
+                return '%s()' % (self.__class__.__name__,)
+            return '%s(%r)' % (self.__class__.__name__, self.items())
+        finally:
+            del _repr_running[call_key]
+
+    def __reduce__(self):
+        'Return state information for pickling'
+        items = [[k, self[k]] for k in self]
+        inst_dict = vars(self).copy()
+        for k in vars(OrderedDict()):
+            inst_dict.pop(k, None)
+        if inst_dict:
+            return (self.__class__, (items,), inst_dict)
+        return self.__class__, (items,)
+
+    def copy(self):
+        'od.copy() -> a shallow copy of od'
+        return self.__class__(self)
+
+    @classmethod
+    def fromkeys(cls, iterable, value=None):
+        '''OD.fromkeys(S[, v]) -> New ordered dictionary with keys from S.
+        If not specified, the value defaults to None.
+
+        '''
+        self = cls()
+        for key in iterable:
+            self[key] = value
+        return self
+
+    def __eq__(self, other):
+        '''od.__eq__(y) <==> od==y.  Comparison to another OD is order-sensitive
+        while comparison to a regular mapping is order-insensitive.
+
+        '''
+        if isinstance(other, OrderedDict):
+            return len(self)==len(other) and self.items() == other.items()
+        return dict.__eq__(self, other)
+
+    def __ne__(self, other):
+        'od.__ne__(y) <==> od!=y'
+        return not self == other
+
+    # -- the following methods support python 3.x style dictionary views --
+
+    def viewkeys(self):
+        "od.viewkeys() -> a set-like object providing a view on od's keys"
+        return KeysView(self)
+
+    def viewvalues(self):
+        "od.viewvalues() -> an object providing a view on od's values"
+        return ValuesView(self)
+
+    def viewitems(self):
+        "od.viewitems() -> a set-like object providing a view on od's items"
+        return ItemsView(self)
+
+# Multiprocessing pool code imported from python 2.7.3. Previous versions of 
+# python have issues in this code which hang pool usage
+
+#
+# Module providing the `Pool` class for managing a process pool
+#
+# multiprocessing/pool.py
+#
+# Copyright (c) 2006-2008, R Oudkerk
+# All rights reserved.
+#
+# Redistribution and use in source and binary forms, with or without
+# modification, are permitted provided that the following conditions
+# are met:
+#
+# 1. Redistributions of source code must retain the above copyright
+#    notice, this list of conditions and the following disclaimer.
+# 2. Redistributions in binary form must reproduce the above copyright
+#    notice, this list of conditions and the following disclaimer in the
+#    documentation and/or other materials provided with the distribution.
+# 3. Neither the name of author nor the names of any contributors may be
+#    used to endorse or promote products derived from this software
+#    without specific prior written permission.
+#
+# THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS "AS IS" AND
+# ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+# ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE
+# FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+# DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS
+# OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION)
+# HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
+# LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY
+# OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF
+# SUCH DAMAGE.
+#
+import threading
+import Queue
+import itertools
+import collections
+import time
+
+import multiprocessing
+from multiprocessing import Process, cpu_count, TimeoutError, pool
+from multiprocessing.util import Finalize, debug
+
+#
+# Constants representing the state of a pool
+#
+
+RUN = 0
+CLOSE = 1
+TERMINATE = 2
+
+#
+# Miscellaneous
+#
+
+def mapstar(args):
+    return map(*args)
+
+class MaybeEncodingError(Exception):
+    """Wraps possible unpickleable errors, so they can be
+    safely sent through the socket."""
+
+    def __init__(self, exc, value):
+        self.exc = repr(exc)
+        self.value = repr(value)
+        super(MaybeEncodingError, self).__init__(self.exc, self.value)
+
+    def __str__(self):
+        return "Error sending result: '%s'. Reason: '%s'" % (self.value,
+                                                             self.exc)
+
+    def __repr__(self):
+        return "<MaybeEncodingError: %s>" % str(self)
+
+def worker(inqueue, outqueue, initializer=None, initargs=(), maxtasks=None):
+    assert maxtasks is None or (type(maxtasks) == int and maxtasks > 0)
+    put = outqueue.put
+    get = inqueue.get
+    if hasattr(inqueue, '_writer'):
+        inqueue._writer.close()
+        outqueue._reader.close()
+
+    if initializer is not None:
+        initializer(*initargs)
+
+    completed = 0
+    while maxtasks is None or (maxtasks and completed < maxtasks):
+        try:
+            task = get()
+        except (EOFError, IOError):
+            debug('worker got EOFError or IOError -- exiting')
+            break
+
+        if task is None:
+            debug('worker got sentinel -- exiting')
+            break
+
+        job, i, func, args, kwds = task
+        try:
+            result = (True, func(*args, **kwds))
+        except Exception, e:
+            result = (False, e)
+        try:
+            put((job, i, result))
+        except Exception as e:
+            wrapped = MaybeEncodingError(e, result[1])
+            debug("Possible encoding error while sending result: %s" % (
+                wrapped))
+            put((job, i, (False, wrapped)))
+        completed += 1
+    debug('worker exiting after %d tasks' % completed)
+
+
+class Pool(object):
+    '''
+    Class which supports an async version of the `apply()` builtin
+    '''
+    Process = Process
+
+    def __init__(self, processes=None, initializer=None, initargs=(),
+                 maxtasksperchild=None):
+        self._setup_queues()
+        self._taskqueue = Queue.Queue()
+        self._cache = {}
+        self._state = RUN
+        self._maxtasksperchild = maxtasksperchild
+        self._initializer = initializer
+        self._initargs = initargs
+
+        if processes is None:
+            try:
+                processes = cpu_count()
+            except NotImplementedError:
+                processes = 1
+        if processes < 1:
+            raise ValueError("Number of processes must be at least 1")
+
+        if initializer is not None and not hasattr(initializer, '__call__'):
+            raise TypeError('initializer must be a callable')
+
+        self._processes = processes
+        self._pool = []
+        self._repopulate_pool()
+
+        self._worker_handler = threading.Thread(
+            target=Pool._handle_workers,
+            args=(self, )
+            )
+        self._worker_handler.daemon = True
+        self._worker_handler._state = RUN
+        self._worker_handler.start()
+
+
+        self._task_handler = threading.Thread(
+            target=Pool._handle_tasks,
+            args=(self._taskqueue, self._quick_put, self._outqueue, self._pool)
+            )
+        self._task_handler.daemon = True
+        self._task_handler._state = RUN
+        self._task_handler.start()
+
+        self._result_handler = threading.Thread(
+            target=Pool._handle_results,
+            args=(self._outqueue, self._quick_get, self._cache)
+            )
+        self._result_handler.daemon = True
+        self._result_handler._state = RUN
+        self._result_handler.start()
+
+        self._terminate = Finalize(
+            self, self._terminate_pool,
+            args=(self._taskqueue, self._inqueue, self._outqueue, self._pool,
+                  self._worker_handler, self._task_handler,
+                  self._result_handler, self._cache),
+            exitpriority=15
+            )
+
+    def _join_exited_workers(self):
+        """Cleanup after any worker processes which have exited due to reaching
+        their specified lifetime.  Returns True if any workers were cleaned up.
+        """
+        cleaned = False
+        for i in reversed(range(len(self._pool))):
+            worker = self._pool[i]
+            if worker.exitcode is not None:
+                # worker exited
+                debug('cleaning up worker %d' % i)
+                worker.join()
+                cleaned = True
+                del self._pool[i]
+        return cleaned
+
+    def _repopulate_pool(self):
+        """Bring the number of pool processes up to the specified number,
+        for use after reaping workers which have exited.
+        """
+        for i in range(self._processes - len(self._pool)):
+            w = self.Process(target=worker,
+                             args=(self._inqueue, self._outqueue,
+                                   self._initializer,
+                                   self._initargs, self._maxtasksperchild)
+                            )
+            self._pool.append(w)
+            w.name = w.name.replace('Process', 'PoolWorker')
+            w.daemon = True
+            w.start()
+            debug('added worker')
+
+    def _maintain_pool(self):
+        """Clean up any exited workers and start replacements for them.
+        """
+        if self._join_exited_workers():
+            self._repopulate_pool()
+
+    def _setup_queues(self):
+        from multiprocessing.queues import SimpleQueue
+        self._inqueue = SimpleQueue()
+        self._outqueue = SimpleQueue()
+        self._quick_put = self._inqueue._writer.send
+        self._quick_get = self._outqueue._reader.recv
+
+    def apply(self, func, args=(), kwds={}):
+        '''
+        Equivalent of `apply()` builtin
+        '''
+        assert self._state == RUN
+        return self.apply_async(func, args, kwds).get()
+
+    def map(self, func, iterable, chunksize=None):
+        '''
+        Equivalent of `map()` builtin
+        '''
+        assert self._state == RUN
+        return self.map_async(func, iterable, chunksize).get()
+
+    def imap(self, func, iterable, chunksize=1):
+        '''
+        Equivalent of `itertools.imap()` -- can be MUCH slower than `Pool.map()`
+        '''
+        assert self._state == RUN
+        if chunksize == 1:
+            result = IMapIterator(self._cache)
+            self._taskqueue.put((((result._job, i, func, (x,), {})
+                         for i, x in enumerate(iterable)), result._set_length))
+            return result
+        else:
+            assert chunksize > 1
+            task_batches = Pool._get_tasks(func, iterable, chunksize)
+            result = IMapIterator(self._cache)
+            self._taskqueue.put((((result._job, i, mapstar, (x,), {})
+                     for i, x in enumerate(task_batches)), result._set_length))
+            return (item for chunk in result for item in chunk)
+
+    def imap_unordered(self, func, iterable, chunksize=1):
+        '''
+        Like `imap()` method but ordering of results is arbitrary
+        '''
+        assert self._state == RUN
+        if chunksize == 1:
+            result = IMapUnorderedIterator(self._cache)
+            self._taskqueue.put((((result._job, i, func, (x,), {})
+                         for i, x in enumerate(iterable)), result._set_length))
+            return result
+        else:
+            assert chunksize > 1
+            task_batches = Pool._get_tasks(func, iterable, chunksize)
+            result = IMapUnorderedIterator(self._cache)
+            self._taskqueue.put((((result._job, i, mapstar, (x,), {})
+                     for i, x in enumerate(task_batches)), result._set_length))
+            return (item for chunk in result for item in chunk)
+
+    def apply_async(self, func, args=(), kwds={}, callback=None):
+        '''
+        Asynchronous equivalent of `apply()` builtin
+        '''
+        assert self._state == RUN
+        result = ApplyResult(self._cache, callback)
+        self._taskqueue.put(([(result._job, None, func, args, kwds)], None))
+        return result
+
+    def map_async(self, func, iterable, chunksize=None, callback=None):
+        '''
+        Asynchronous equivalent of `map()` builtin
+        '''
+        assert self._state == RUN
+        if not hasattr(iterable, '__len__'):
+            iterable = list(iterable)
+
+        if chunksize is None:
+            chunksize, extra = divmod(len(iterable), len(self._pool) * 4)
+            if extra:
+                chunksize += 1
+        if len(iterable) == 0:
+            chunksize = 0
+
+        task_batches = Pool._get_tasks(func, iterable, chunksize)
+        result = MapResult(self._cache, chunksize, len(iterable), callback)
+        self._taskqueue.put((((result._job, i, mapstar, (x,), {})
+                              for i, x in enumerate(task_batches)), None))
+        return result
+
+    @staticmethod
+    def _handle_workers(pool):
+        thread = threading.current_thread()
+
+        # Keep maintaining workers until the cache gets drained, unless the pool
+        # is terminated.
+        while thread._state == RUN or (pool._cache and thread._state != TERMINATE):
+            pool._maintain_pool()
+            time.sleep(0.1)
+        # send sentinel to stop workers
+        pool._taskqueue.put(None)
+        debug('worker handler exiting')
+
+    @staticmethod
+    def _handle_tasks(taskqueue, put, outqueue, pool):
+        thread = threading.current_thread()
+
+        for taskseq, set_length in iter(taskqueue.get, None):
+            i = -1
+            for i, task in enumerate(taskseq):
+                if thread._state:
+                    debug('task handler found thread._state != RUN')
+                    break
+                try:
+                    put(task)
+                except IOError:
+                    debug('could not put task on queue')
+                    break
+            else:
+                if set_length:
+                    debug('doing set_length()')
+                    set_length(i+1)
+                continue
+            break
+        else:
+            debug('task handler got sentinel')
+
+
+        try:
+            # tell result handler to finish when cache is empty
+            debug('task handler sending sentinel to result handler')
+            outqueue.put(None)
+
+            # tell workers there is no more work
+            debug('task handler sending sentinel to workers')
+            for p in pool:
+                put(None)
+        except IOError:
+            debug('task handler got IOError when sending sentinels')
+
+        debug('task handler exiting')
+
+    @staticmethod
+    def _handle_results(outqueue, get, cache):
+        thread = threading.current_thread()
+
+        while 1:
+            try:
+                task = get()
+            except (IOError, EOFError):
+                debug('result handler got EOFError/IOError -- exiting')
+                return
+
+            if thread._state:
+                assert thread._state == TERMINATE
+                debug('result handler found thread._state=TERMINATE')
+                break
+
+            if task is None:
+                debug('result handler got sentinel')
+                break
+
+            job, i, obj = task
+            try:
+                cache[job]._set(i, obj)
+            except KeyError:
+                pass
+
+        while cache and thread._state != TERMINATE:
+            try:
+                task = get()
+            except (IOError, EOFError):
+                debug('result handler got EOFError/IOError -- exiting')
+                return
+
+            if task is None:
+                debug('result handler ignoring extra sentinel')
+                continue
+            job, i, obj = task
+            try:
+                cache[job]._set(i, obj)
+            except KeyError:
+                pass
+
+        if hasattr(outqueue, '_reader'):
+            debug('ensuring that outqueue is not full')
+            # If we don't make room available in outqueue then
+            # attempts to add the sentinel (None) to outqueue may
+            # block.  There is guaranteed to be no more than 2 sentinels.
+            try:
+                for i in range(10):
+                    if not outqueue._reader.poll():
+                        break
+                    get()
+            except (IOError, EOFError):
+                pass
+
+        debug('result handler exiting: len(cache)=%s, thread._state=%s',
+              len(cache), thread._state)
+
+    @staticmethod
+    def _get_tasks(func, it, size):
+        it = iter(it)
+        while 1:
+            x = tuple(itertools.islice(it, size))
+            if not x:
+                return
+            yield (func, x)
+
+    def __reduce__(self):
+        raise NotImplementedError(
+              'pool objects cannot be passed between processes or pickled'
+              )
+
+    def close(self):
+        debug('closing pool')
+        if self._state == RUN:
+            self._state = CLOSE
+            self._worker_handler._state = CLOSE
+
+    def terminate(self):
+        debug('terminating pool')
+        self._state = TERMINATE
+        self._worker_handler._state = TERMINATE
+        self._terminate()
+
+    def join(self):
+        debug('joining pool')
+        assert self._state in (CLOSE, TERMINATE)
+        self._worker_handler.join()
+        self._task_handler.join()
+        self._result_handler.join()
+        for p in self._pool:
+            p.join()
+
+    @staticmethod
+    def _help_stuff_finish(inqueue, task_handler, size):
+        # task_handler may be blocked trying to put items on inqueue
+        debug('removing tasks from inqueue until task handler finished')
+        inqueue._rlock.acquire()
+        while task_handler.is_alive() and inqueue._reader.poll():
+            inqueue._reader.recv()
+            time.sleep(0)
+
+    @classmethod
+    def _terminate_pool(cls, taskqueue, inqueue, outqueue, pool,
+                        worker_handler, task_handler, result_handler, cache):
+        # this is guaranteed to only be called once
+        debug('finalizing pool')
+
+        worker_handler._state = TERMINATE
+        task_handler._state = TERMINATE
+
+        debug('helping task handler/workers to finish')
+        cls._help_stuff_finish(inqueue, task_handler, len(pool))
+
+        assert result_handler.is_alive() or len(cache) == 0
+
+        result_handler._state = TERMINATE
+        outqueue.put(None)                  # sentinel
+
+        # We must wait for the worker handler to exit before terminating
+        # workers because we don't want workers to be restarted behind our back.
+        debug('joining worker handler')
+        if threading.current_thread() is not worker_handler:
+            worker_handler.join(1e100)
+
+        # Terminate workers which haven't already finished.
+        if pool and hasattr(pool[0], 'terminate'):
+            debug('terminating workers')
+            for p in pool:
+                if p.exitcode is None:
+                    p.terminate()
+
+        debug('joining task handler')
+        if threading.current_thread() is not task_handler:
+            task_handler.join(1e100)
+
+        debug('joining result handler')
+        if threading.current_thread() is not result_handler:
+            result_handler.join(1e100)
+
+        if pool and hasattr(pool[0], 'terminate'):
+            debug('joining pool workers')
+            for p in pool:
+                if p.is_alive():
+                    # worker has not yet exited
+                    debug('cleaning up worker %d' % p.pid)
+                    p.join()
+
+class ApplyResult(object):
+
+    def __init__(self, cache, callback):
+        self._cond = threading.Condition(threading.Lock())
+        self._job = multiprocessing.pool.job_counter.next()
+        self._cache = cache
+        self._ready = False
+        self._callback = callback
+        cache[self._job] = self
+
+    def ready(self):
+        return self._ready
+
+    def successful(self):
+        assert self._ready
+        return self._success
+
+    def wait(self, timeout=None):
+        self._cond.acquire()
+        try:
+            if not self._ready:
+                self._cond.wait(timeout)
+        finally:
+            self._cond.release()
+
+    def get(self, timeout=None):
+        self.wait(timeout)
+        if not self._ready:
+            raise TimeoutError
+        if self._success:
+            return self._value
+        else:
+            raise self._value
+
+    def _set(self, i, obj):
+        self._success, self._value = obj
+        if self._callback and self._success:
+            self._callback(self._value)
+        self._cond.acquire()
+        try:
+            self._ready = True
+            self._cond.notify()
+        finally:
+            self._cond.release()
+        del self._cache[self._job]
+
+#
+# Class whose instances are returned by `Pool.map_async()`
+#
+
+class MapResult(ApplyResult):
+
+    def __init__(self, cache, chunksize, length, callback):
+        ApplyResult.__init__(self, cache, callback)
+        self._success = True
+        self._value = [None] * length
+        self._chunksize = chunksize
+        if chunksize <= 0:
+            self._number_left = 0
+            self._ready = True
+            del cache[self._job]
+        else:
+            self._number_left = length//chunksize + bool(length % chunksize)
+
+    def _set(self, i, success_result):
+        success, result = success_result
+        if success:
+            self._value[i*self._chunksize:(i+1)*self._chunksize] = result
+            self._number_left -= 1
+            if self._number_left == 0:
+                if self._callback:
+                    self._callback(self._value)
+                del self._cache[self._job]
+                self._cond.acquire()
+                try:
+                    self._ready = True
+                    self._cond.notify()
+                finally:
+                    self._cond.release()
+
+        else:
+            self._success = False
+            self._value = result
+            del self._cache[self._job]
+            self._cond.acquire()
+            try:
+                self._ready = True
+                self._cond.notify()
+            finally:
+                self._cond.release()
+
+#
+# Class whose instances are returned by `Pool.imap()`
+#
+
+class IMapIterator(object):
+
+    def __init__(self, cache):
+        self._cond = threading.Condition(threading.Lock())
+        self._job = multiprocessing.pool.job_counter.next()
+        self._cache = cache
+        self._items = collections.deque()
+        self._index = 0
+        self._length = None
+        self._unsorted = {}
+        cache[self._job] = self
+
+    def __iter__(self):
+        return self
+
+    def next(self, timeout=None):
+        self._cond.acquire()
+        try:
+            try:
+                item = self._items.popleft()
+            except IndexError:
+                if self._index == self._length:
+                    raise StopIteration
+                self._cond.wait(timeout)
+                try:
+                    item = self._items.popleft()
+                except IndexError:
+                    if self._index == self._length:
+                        raise StopIteration
+                    raise TimeoutError
+        finally:
+            self._cond.release()
+
+        success, value = item
+        if success:
+            return value
+        raise value
+
+    __next__ = next                    # XXX
+
+    def _set(self, i, obj):
+        self._cond.acquire()
+        try:
+            if self._index == i:
+                self._items.append(obj)
+                self._index += 1
+                while self._index in self._unsorted:
+                    obj = self._unsorted.pop(self._index)
+                    self._items.append(obj)
+                    self._index += 1
+                self._cond.notify()
+            else:
+                self._unsorted[i] = obj
+
+            if self._index == self._length:
+                del self._cache[self._job]
+        finally:
+            self._cond.release()
+
+    def _set_length(self, length):
+        self._cond.acquire()
+        try:
+            self._length = length
+            if self._index == self._length:
+                self._cond.notify()
+                del self._cache[self._job]
+        finally:
+            self._cond.release()
+
+#
+# Class whose instances are returned by `Pool.imap_unordered()`
+#
+
+class IMapUnorderedIterator(IMapIterator):
+
+    def _set(self, i, obj):
+        self._cond.acquire()
+        try:
+            self._items.append(obj)
+            self._index += 1
+            self._cond.notify()
+            if self._index == self._length:
+                del self._cache[self._job]
+        finally:
+            self._cond.release()
+
+

bitbake/lib/bb/daemonize.py

@@ -0,0 +1,190 @@
+"""
+Python Deamonizing helper
+
+Configurable daemon behaviors:
+
+    1.) The current working directory set to the "/" directory.
+    2.) The current file creation mode mask set to 0.
+    3.) Close all open files (1024). 
+    4.) Redirect standard I/O streams to "/dev/null".
+
+A failed call to fork() now raises an exception.
+
+References:
+    1) Advanced Programming in the Unix Environment: W. Richard Stevens
+    2) Unix Programming Frequently Asked Questions:
+            http://www.erlenstar.demon.co.uk/unix/faq_toc.html
+
+Modified to allow a function to be daemonized and return for 
+bitbake use by Richard Purdie
+"""
+
+__author__ = "Chad J. Schroeder"
+__copyright__ = "Copyright (C) 2005 Chad J. Schroeder"
+__version__ = "0.2"
+
+# Standard Python modules.
+import os                    # Miscellaneous OS interfaces.
+import sys                  # System-specific parameters and functions.
+
+# Default daemon parameters.
+# File mode creation mask of the daemon.
+# For BitBake's children, we do want to inherit the parent umask.
+UMASK = None
+
+# Default maximum for the number of available file descriptors.
+MAXFD = 1024
+
+# The standard I/O file descriptors are redirected to /dev/null by default.
+if (hasattr(os, "devnull")):
+    REDIRECT_TO = os.devnull
+else:
+    REDIRECT_TO = "/dev/null"
+
+def createDaemon(function, logfile):
+    """
+    Detach a process from the controlling terminal and run it in the
+    background as a daemon, returning control to the caller.
+    """
+
+    try:
+        # Fork a child process so the parent can exit.  This returns control to
+        # the command-line or shell.  It also guarantees that the child will not
+        # be a process group leader, since the child receives a new process ID
+        # and inherits the parent's process group ID.  This step is required
+        # to insure that the next call to os.setsid is successful.
+        pid = os.fork()
+    except OSError as e:
+        raise Exception("%s [%d]" % (e.strerror, e.errno))
+
+    if (pid == 0):      # The first child.
+        # To become the session leader of this new session and the process group
+        # leader of the new process group, we call os.setsid().  The process is
+        # also guaranteed not to have a controlling terminal.
+        os.setsid()
+
+        # Is ignoring SIGHUP necessary?
+        #
+        # It's often suggested that the SIGHUP signal should be ignored before
+        # the second fork to avoid premature termination of the process.  The
+        # reason is that when the first child terminates, all processes, e.g.
+        # the second child, in the orphaned group will be sent a SIGHUP.
+        #
+        # "However, as part of the session management system, there are exactly
+        # two cases where SIGHUP is sent on the death of a process:
+        #
+        #    1) When the process that dies is the session leader of a session that
+        #        is attached to a terminal device, SIGHUP is sent to all processes
+        #        in the foreground process group of that terminal device.
+        #    2) When the death of a process causes a process group to become
+        #        orphaned, and one or more processes in the orphaned group are
+        #        stopped, then SIGHUP and SIGCONT are sent to all members of the
+        #        orphaned group." [2]
+        #
+        # The first case can be ignored since the child is guaranteed not to have
+        # a controlling terminal.  The second case isn't so easy to dismiss.
+        # The process group is orphaned when the first child terminates and
+        # POSIX.1 requires that every STOPPED process in an orphaned process
+        # group be sent a SIGHUP signal followed by a SIGCONT signal.  Since the
+        # second child is not STOPPED though, we can safely forego ignoring the
+        # SIGHUP signal.  In any case, there are no ill-effects if it is ignored.
+        #
+        # import signal              # Set handlers for asynchronous events.
+        # signal.signal(signal.SIGHUP, signal.SIG_IGN)
+
+        try:
+            # Fork a second child and exit immediately to prevent zombies.  This
+            # causes the second child process to be orphaned, making the init
+            # process responsible for its cleanup.  And, since the first child is
+            # a session leader without a controlling terminal, it's possible for
+            # it to acquire one by opening a terminal in the future (System V-
+            # based systems).  This second fork guarantees that the child is no
+            # longer a session leader, preventing the daemon from ever acquiring
+            # a controlling terminal.
+            pid = os.fork()     # Fork a second child.
+        except OSError as e:
+            raise Exception("%s [%d]" % (e.strerror, e.errno))
+
+        if (pid == 0):  # The second child.
+            # We probably don't want the file mode creation mask inherited from
+            # the parent, so we give the child complete control over permissions.
+            if UMASK is not None:
+                os.umask(UMASK)
+        else:
+            # Parent (the first child) of the second child.
+            os._exit(0)
+    else:
+        # exit() or _exit()?
+        # _exit is like exit(), but it doesn't call any functions registered
+        # with atexit (and on_exit) or any registered signal handlers.  It also
+        # closes any open file descriptors.  Using exit() may cause all stdio
+        # streams to be flushed twice and any temporary files may be unexpectedly
+        # removed.  It's therefore recommended that child branches of a fork()
+        # and the parent branch(es) of a daemon use _exit().
+        return
+
+    # Close all open file descriptors.  This prevents the child from keeping
+    # open any file descriptors inherited from the parent.  There is a variety
+    # of methods to accomplish this task.  Three are listed below.
+    #
+    # Try the system configuration variable, SC_OPEN_MAX, to obtain the maximum
+    # number of open file descriptors to close.  If it doesn't exists, use
+    # the default value (configurable).
+    #
+    # try:
+    #     maxfd = os.sysconf("SC_OPEN_MAX")
+    # except (AttributeError, ValueError):
+    #     maxfd = MAXFD
+    #
+    # OR
+    #
+    # if (os.sysconf_names.has_key("SC_OPEN_MAX")):
+    #     maxfd = os.sysconf("SC_OPEN_MAX")
+    # else:
+    #     maxfd = MAXFD
+    #
+    # OR
+    #
+    # Use the getrlimit method to retrieve the maximum file descriptor number
+    # that can be opened by this process.  If there is not limit on the
+    # resource, use the default value.
+    #
+    import resource             # Resource usage information.
+    maxfd = resource.getrlimit(resource.RLIMIT_NOFILE)[1]
+    if (maxfd == resource.RLIM_INFINITY):
+        maxfd = MAXFD
+  
+    # Iterate through and close all file descriptors.
+#    for fd in range(0, maxfd):
+#        try:
+#            os.close(fd)
+#        except OSError:        # ERROR, fd wasn't open to begin with (ignored)
+#            pass
+
+    # Redirect the standard I/O file descriptors to the specified file.  Since
+    # the daemon has no controlling terminal, most daemons redirect stdin,
+    # stdout, and stderr to /dev/null.  This is done to prevent side-effects
+    # from reads and writes to the standard I/O file descriptors.
+
+    # This call to open is guaranteed to return the lowest file descriptor,
+    # which will be 0 (stdin), since it was closed above.
+#    os.open(REDIRECT_TO, os.O_RDWR)    # standard input (0)
+
+    # Duplicate standard input to standard output and standard error.
+#    os.dup2(0, 1)                      # standard output (1)
+#    os.dup2(0, 2)                      # standard error (2)
+
+
+    si = file('/dev/null', 'r')
+    so = file(logfile, 'w')
+    se = so
+
+
+    # Replace those fds with our own
+    os.dup2(si.fileno(), sys.stdin.fileno())
+    os.dup2(so.fileno(), sys.stdout.fileno())
+    os.dup2(se.fileno(), sys.stderr.fileno())
+
+    function()
+
+    os._exit(0)

bitbake/lib/bb/data.py

@@ -0,0 +1,369 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Data' implementations
+
+Functions for interacting with the data structure used by the
+BitBake build tools.
+
+The expandData and update_data are the most expensive
+operations. At night the cookie monster came by and
+suggested 'give me cookies on setting the variables and
+things will work out'. Taking this suggestion into account
+applying the skills from the not yet passed 'Entwurf und
+Analyse von Algorithmen' lecture and the cookie
+monster seems to be right. We will track setVar more carefully
+to have faster update_data and expandKeys operations.
+
+This is a treade-off between speed and memory again but
+the speed is more critical here.
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2005        Holger Hans Peter Freyther
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+#Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import sys, os, re
+if sys.argv[0][-5:] == "pydoc":
+    path = os.path.dirname(os.path.dirname(sys.argv[1]))
+else:
+    path = os.path.dirname(os.path.dirname(sys.argv[0]))
+sys.path.insert(0, path)
+from itertools import groupby
+
+from bb import data_smart
+from bb import codeparser
+import bb
+
+logger = data_smart.logger
+_dict_type = data_smart.DataSmart
+
+def init():
+    """Return a new object representing the Bitbake data"""
+    return _dict_type()
+
+def init_db(parent = None):
+    """Return a new object representing the Bitbake data,
+    optionally based on an existing object"""
+    if parent:
+        return parent.createCopy()
+    else:
+        return _dict_type()
+
+def createCopy(source):
+    """Link the source set to the destination
+    If one does not find the value in the destination set,
+    search will go on to the source set to get the value.
+    Value from source are copy-on-write. i.e. any try to
+    modify one of them will end up putting the modified value
+    in the destination set.
+    """
+    return source.createCopy()
+
+def initVar(var, d):
+    """Non-destructive var init for data structure"""
+    d.initVar(var)
+
+
+def setVar(var, value, d):
+    """Set a variable to a given value"""
+    d.setVar(var, value)
+
+
+def getVar(var, d, exp = 0):
+    """Gets the value of a variable"""
+    return d.getVar(var, exp)
+
+
+def renameVar(key, newkey, d):
+    """Renames a variable from key to newkey"""
+    d.renameVar(key, newkey)
+
+def delVar(var, d):
+    """Removes a variable from the data set"""
+    d.delVar(var)
+
+def setVarFlag(var, flag, flagvalue, d):
+    """Set a flag for a given variable to a given value"""
+    d.setVarFlag(var, flag, flagvalue)
+
+def getVarFlag(var, flag, d):
+    """Gets given flag from given var"""
+    return d.getVarFlag(var, flag)
+
+def delVarFlag(var, flag, d):
+    """Removes a given flag from the variable's flags"""
+    d.delVarFlag(var, flag)
+
+def setVarFlags(var, flags, d):
+    """Set the flags for a given variable
+
+    Note:
+        setVarFlags will not clear previous
+        flags. Think of this method as
+        addVarFlags
+    """
+    d.setVarFlags(var, flags)
+
+def getVarFlags(var, d):
+    """Gets a variable's flags"""
+    return d.getVarFlags(var)
+
+def delVarFlags(var, d):
+    """Removes a variable's flags"""
+    d.delVarFlags(var)
+
+def keys(d):
+    """Return a list of keys in d"""
+    return d.keys()
+
+
+__expand_var_regexp__ = re.compile(r"\${[^{}]+}")
+__expand_python_regexp__ = re.compile(r"\${@.+?}")
+
+def expand(s, d, varname = None):
+    """Variable expansion using the data store"""
+    return d.expand(s, varname)
+
+def expandKeys(alterdata, readdata = None):
+    if readdata == None:
+        readdata = alterdata
+
+    todolist = {}
+    for key in keys(alterdata):
+        if not '${' in key:
+            continue
+
+        ekey = expand(key, readdata)
+        if key == ekey:
+            continue
+        todolist[key] = ekey
+
+    # These two for loops are split for performance to maximise the
+    # usefulness of the expand cache
+
+    for key in todolist:
+        ekey = todolist[key]
+        newval = alterdata.getVar(ekey, 0)
+        if newval:
+            val = alterdata.getVar(key, 0)
+            if val is not None and newval is not None:
+                bb.warn("Variable key %s (%s) replaces original key %s (%s)." % (key, val, ekey, newval))
+        alterdata.renameVar(key, ekey)
+
+def inheritFromOS(d, savedenv, permitted):
+    """Inherit variables from the initial environment."""
+    exportlist = bb.utils.preserved_envvars_exported()
+    for s in savedenv.keys():
+        if s in permitted:
+            try:
+                d.setVar(s, getVar(s, savedenv, True), op = 'from env')
+                if s in exportlist:
+                    d.setVarFlag(s, "export", True, op = 'auto env export')
+            except TypeError:
+                pass
+
+def emit_var(var, o=sys.__stdout__, d = init(), all=False):
+    """Emit a variable to be sourced by a shell."""
+    if getVarFlag(var, "python", d):
+        return 0
+
+    export = getVarFlag(var, "export", d)
+    unexport = getVarFlag(var, "unexport", d)
+    func = getVarFlag(var, "func", d)
+    if not all and not export and not unexport and not func:
+        return 0
+
+    try:
+        if all:
+            oval = getVar(var, d, 0)
+        val = getVar(var, d, 1)
+    except (KeyboardInterrupt, bb.build.FuncFailed):
+        raise
+    except Exception as exc:
+        o.write('# expansion of %s threw %s: %s\n' % (var, exc.__class__.__name__, str(exc)))
+        return 0
+
+    if all:
+        d.varhistory.emit(var, oval, val, o)
+
+    if (var.find("-") != -1 or var.find(".") != -1 or var.find('{') != -1 or var.find('}') != -1 or var.find('+') != -1) and not all:
+        return 0
+
+    varExpanded = expand(var, d)
+
+    if unexport:
+        o.write('unset %s\n' % varExpanded)
+        return 0
+
+    if not val:
+        return 0
+
+    val = str(val)
+
+    if func:
+        # NOTE: should probably check for unbalanced {} within the var
+        o.write("%s() {\n%s\n}\n" % (varExpanded, val))
+        return 1
+
+    if export:
+        o.write('export ')
+
+    # if we're going to output this within doublequotes,
+    # to a shell, we need to escape the quotes in the var
+    alter = re.sub('"', '\\"', val.strip())
+    alter = re.sub('\n', ' \\\n', alter)
+    o.write('%s="%s"\n' % (varExpanded, alter))
+    return 0
+
+def emit_env(o=sys.__stdout__, d = init(), all=False):
+    """Emits all items in the data store in a format such that it can be sourced by a shell."""
+
+    isfunc = lambda key: bool(d.getVarFlag(key, "func"))
+    keys = sorted((key for key in d.keys() if not key.startswith("__")), key=isfunc)
+    grouped = groupby(keys, isfunc)
+    for isfunc, keys in grouped:
+        for key in keys:
+            emit_var(key, o, d, all and not isfunc) and o.write('\n')
+
+def exported_keys(d):
+    return (key for key in d.keys() if not key.startswith('__') and
+                                      d.getVarFlag(key, 'export') and
+                                      not d.getVarFlag(key, 'unexport'))
+
+def exported_vars(d):
+    for key in exported_keys(d):
+        try:
+            value = d.getVar(key, True)
+        except Exception:
+            pass
+
+        if value is not None:
+            yield key, str(value)
+
+def emit_func(func, o=sys.__stdout__, d = init()):
+    """Emits all items in the data store in a format such that it can be sourced by a shell."""
+
+    keys = (key for key in d.keys() if not key.startswith("__") and not d.getVarFlag(key, "func"))
+    for key in keys:
+        emit_var(key, o, d, False) and o.write('\n')
+
+    emit_var(func, o, d, False) and o.write('\n')
+    newdeps = bb.codeparser.ShellParser(func, logger).parse_shell(d.getVar(func, True))
+    newdeps |= set((d.getVarFlag(func, "vardeps", True) or "").split())
+    seen = set()
+    while newdeps:
+        deps = newdeps
+        seen |= deps
+        newdeps = set()
+        for dep in deps:
+            if d.getVarFlag(dep, "func"):
+               emit_var(dep, o, d, False) and o.write('\n')
+               newdeps |=  bb.codeparser.ShellParser(dep, logger).parse_shell(d.getVar(dep, True))
+        newdeps -= seen
+
+def update_data(d):
+    """Performs final steps upon the datastore, including application of overrides"""
+    d.finalize(parent = True)
+
+def build_dependencies(key, keys, shelldeps, vardepvals, d):
+    deps = set()
+    vardeps = d.getVarFlag(key, "vardeps", True)
+    try:
+        if key[-1] == ']':
+            vf = key[:-1].split('[')
+            value = d.getVarFlag(vf[0], vf[1], False)
+        else:
+            value = d.getVar(key, False)
+
+        if key in vardepvals:
+           value =  d.getVarFlag(key, "vardepvalue", True)
+        elif d.getVarFlag(key, "func"):
+            if d.getVarFlag(key, "python"):
+                parsedvar = d.expandWithRefs(value, key)
+                parser = bb.codeparser.PythonParser(key, logger)
+                if parsedvar.value and "\t" in parsedvar.value:
+                    logger.warn("Variable %s contains tabs, please remove these (%s)" % (key, d.getVar("FILE", True)))
+                parser.parse_python(parsedvar.value)
+                deps = deps | parser.references
+            else:
+                parsedvar = d.expandWithRefs(value, key)
+                parser = bb.codeparser.ShellParser(key, logger)
+                parser.parse_shell(parsedvar.value)
+                deps = deps | shelldeps
+            if vardeps is None:
+                parser.log.flush()
+            deps = deps | parsedvar.references
+            deps = deps | (keys & parser.execs) | (keys & parsedvar.execs)
+        else:
+            parser = d.expandWithRefs(value, key)
+            deps |= parser.references
+            deps = deps | (keys & parser.execs)
+
+        # Add varflags, assuming an exclusion list is set
+        varflagsexcl = d.getVar('BB_SIGNATURE_EXCLUDE_FLAGS', True)
+        if varflagsexcl:
+            varfdeps = []
+            varflags = d.getVarFlags(key)
+            if varflags:
+                for f in varflags:
+                    if f not in varflagsexcl:
+                        varfdeps.append('%s[%s]' % (key, f))
+            if varfdeps:
+                deps |= set(varfdeps)
+
+        deps |= set((vardeps or "").split())
+        deps -= set((d.getVarFlag(key, "vardepsexclude", True) or "").split())
+    except Exception as e:
+        raise bb.data_smart.ExpansionError(key, None, e)
+    return deps, value
+    #bb.note("Variable %s references %s and calls %s" % (key, str(deps), str(execs)))
+    #d.setVarFlag(key, "vardeps", deps)
+
+def generate_dependencies(d):
+
+    keys = set(key for key in d.keys() if not key.startswith("__"))
+    shelldeps = set(key for key in keys if d.getVarFlag(key, "export") and not d.getVarFlag(key, "unexport"))
+    vardepvals = set(key for key in keys if d.getVarFlag(key, "vardepvalue"))
+
+    deps = {}
+    values = {}
+
+    tasklist = d.getVar('__BBTASKS') or []
+    for task in tasklist:
+        deps[task], values[task] = build_dependencies(task, keys, shelldeps, vardepvals, d)
+        newdeps = deps[task]
+        seen = set()
+        while newdeps:
+            nextdeps = newdeps
+            seen |= nextdeps
+            newdeps = set()
+            for dep in nextdeps:
+                if dep not in deps:
+                    deps[dep], values[dep] = build_dependencies(dep, keys, shelldeps, vardepvals, d)
+                newdeps |=  deps[dep]
+            newdeps -= seen
+        #print "For %s: %s" % (task, str(deps[task]))
+    return tasklist, deps, values
+
+def inherits_class(klass, d):
+    val = getVar('__inherit_cache', d) or []
+    needle = os.path.join('classes', '%s.bbclass' % klass)
+    for v in val:
+        if v.endswith(needle):
+            return True
+    return False

bitbake/lib/bb/data_smart.py

@@ -0,0 +1,758 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake Smart Dictionary Implementation
+
+Functions for interacting with the data structure used by the
+BitBake build tools.
+
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2004, 2005  Seb Frankengul
+# Copyright (C) 2005, 2006  Holger Hans Peter Freyther
+# Copyright (C) 2005        Uli Luckas
+# Copyright (C) 2005        ROAD GmbH
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import copy, re, sys, traceback
+from collections import MutableMapping
+import logging
+import hashlib
+import bb, bb.codeparser
+from bb   import utils
+from bb.COW  import COWDictBase
+
+logger = logging.getLogger("BitBake.Data")
+
+__setvar_keyword__ = ["_append", "_prepend"]
+__setvar_regexp__ = re.compile('(?P<base>.*?)(?P<keyword>_append|_prepend)(_(?P<add>.*))?$')
+__expand_var_regexp__ = re.compile(r"\${[^{}]+}")
+__expand_python_regexp__ = re.compile(r"\${@.+?}")
+
+def infer_caller_details(loginfo, parent = False, varval = True):
+    """Save the caller the trouble of specifying everything."""
+    # Save effort.
+    if 'ignore' in loginfo and loginfo['ignore']:
+        return
+    # If nothing was provided, mark this as possibly unneeded.
+    if not loginfo:
+        loginfo['ignore'] = True
+        return
+    # Infer caller's likely values for variable (var) and value (value), 
+    # to reduce clutter in the rest of the code.
+    if varval and ('variable' not in loginfo or 'detail' not in loginfo):
+        try:
+            raise Exception
+        except Exception:
+            tb = sys.exc_info()[2]
+            if parent:
+                above = tb.tb_frame.f_back.f_back
+            else:
+                above = tb.tb_frame.f_back
+            lcls = above.f_locals.items()
+        for k, v in lcls:
+            if k == 'value' and 'detail' not in loginfo:
+                loginfo['detail'] = v
+            if k == 'var' and 'variable' not in loginfo:
+                loginfo['variable'] = v
+    # Infer file/line/function from traceback
+    if 'file' not in loginfo:
+        depth = 3    
+        if parent:
+            depth = 4
+        file, line, func, text = traceback.extract_stack(limit = depth)[0]
+        loginfo['file'] = file
+        loginfo['line'] = line
+        if func not in loginfo:
+            loginfo['func'] = func
+
+class VariableParse:
+    def __init__(self, varname, d, val = None):
+        self.varname = varname
+        self.d = d
+        self.value = val
+
+        self.references = set()
+        self.execs = set()
+
+    def var_sub(self, match):
+            key = match.group()[2:-1]
+            if self.varname and key:
+                if self.varname == key:
+                    raise Exception("variable %s references itself!" % self.varname)
+            var = self.d.getVar(key, True)
+            if var is not None:
+                self.references.add(key)
+                return var
+            else:
+                return match.group()
+
+    def python_sub(self, match):
+            code = match.group()[3:-1]
+            codeobj = compile(code.strip(), self.varname or "<expansion>", "eval")
+
+            parser = bb.codeparser.PythonParser(self.varname, logger)
+            parser.parse_python(code)
+            if self.varname:
+                vardeps = self.d.getVarFlag(self.varname, "vardeps", True)
+                if vardeps is None:
+                    parser.log.flush()
+            else:
+                parser.log.flush()
+            self.references |= parser.references
+            self.execs |= parser.execs
+
+            value = utils.better_eval(codeobj, DataContext(self.d))
+            return str(value)
+
+
+class DataContext(dict):
+    def __init__(self, metadata, **kwargs):
+        self.metadata = metadata
+        dict.__init__(self, **kwargs)
+        self['d'] = metadata
+
+    def __missing__(self, key):
+        value = self.metadata.getVar(key, True)
+        if value is None or self.metadata.getVarFlag(key, 'func'):
+            raise KeyError(key)
+        else:
+            return value
+
+class ExpansionError(Exception):
+    def __init__(self, varname, expression, exception):
+        self.expression = expression
+        self.variablename = varname
+        self.exception = exception
+        if varname:
+            if expression:
+                self.msg = "Failure expanding variable %s, expression was %s which triggered exception %s: %s" % (varname, expression, type(exception).__name__, exception)
+            else:
+                self.msg = "Failure expanding variable %s: %s: %s" % (varname, type(exception).__name__, exception)
+        else:
+            self.msg = "Failure expanding expression %s which triggered exception %s: %s" % (expression, type(exception).__name__, exception)
+        Exception.__init__(self, self.msg)
+        self.args = (varname, expression, exception)
+    def __str__(self):
+        return self.msg
+
+class IncludeHistory(object):
+    def __init__(self, parent = None, filename = '[TOP LEVEL]'):
+        self.parent = parent
+        self.filename = filename
+        self.children = []
+        self.current = self
+
+    def copy(self):
+        new = IncludeHistory(self.parent, self.filename)
+        for c in self.children:
+            new.children.append(c)
+        return new
+
+    def include(self, filename):
+        newfile = IncludeHistory(self.current, filename)
+        self.current.children.append(newfile)
+        self.current = newfile
+        return self
+
+    def __enter__(self):
+        pass
+
+    def __exit__(self, a, b, c):
+        if self.current.parent:
+            self.current = self.current.parent
+        else:
+            bb.warn("Include log: Tried to finish '%s' at top level." % filename)
+        return False
+
+    def emit(self, o, level = 0):
+        """Emit an include history file, and its children."""
+        if level:
+            spaces = "  " * (level - 1)
+            o.write("# %s%s" % (spaces, self.filename))
+            if len(self.children) > 0:
+                o.write(" includes:")
+        else:
+            o.write("#\n# INCLUDE HISTORY:\n#")
+        level = level + 1
+        for child in self.children:
+            o.write("\n")
+            child.emit(o, level)
+
+class VariableHistory(object):
+    def __init__(self, dataroot):
+        self.dataroot = dataroot
+        self.variables = COWDictBase.copy()
+
+    def copy(self):
+        new = VariableHistory(self.dataroot)
+        new.variables = self.variables.copy()
+        return new
+
+    def record(self, *kwonly, **loginfo):
+        if not self.dataroot._tracking:
+            return
+        if len(kwonly) > 0:
+            raise TypeError
+        infer_caller_details(loginfo, parent = True)
+        if 'ignore' in loginfo and loginfo['ignore']:
+            return
+        if 'op' not in loginfo or not loginfo['op']:
+            loginfo['op'] = 'set'
+        if 'detail' in loginfo:
+            loginfo['detail'] = str(loginfo['detail'])
+        if 'variable' not in loginfo or 'file' not in loginfo:
+            raise ValueError("record() missing variable or file.")
+        var = loginfo['variable']
+
+        if var not in self.variables:
+            self.variables[var] = []
+        self.variables[var].append(loginfo.copy())
+
+    def variable(self, var):
+        if var in self.variables:
+            return self.variables[var]
+        else:
+            return []
+
+    def emit(self, var, oval, val, o):
+        history = self.variable(var)
+        commentVal = re.sub('\n', '\n#', str(oval))
+        if history:
+            if len(history) == 1:
+                o.write("#\n# $%s\n" % var)
+            else:
+                o.write("#\n# $%s [%d operations]\n" % (var, len(history)))
+            for event in history:
+                # o.write("# %s\n" % str(event))
+                if 'func' in event:
+                    # If we have a function listed, this is internal
+                    # code, not an operation in a config file, and the
+                    # full path is distracting.
+                    event['file'] = re.sub('.*/', '', event['file'])
+                    display_func = ' [%s]' % event['func']
+                else:
+                    display_func = ''
+                if 'flag' in event:
+                    flag = '[%s] ' % (event['flag'])
+                else:
+                    flag = ''
+                o.write("#   %s %s:%s%s\n#     %s\"%s\"\n" % (event['op'], event['file'], event['line'], display_func, flag, re.sub('\n', '\n#     ', event['detail'])))
+            if len(history) > 1:
+                o.write("# computed:\n")
+                o.write('#   "%s"\n' % (commentVal))
+        else:
+            o.write("#\n# $%s\n#   [no history recorded]\n#\n" % var)
+            o.write('#   "%s"\n' % (commentVal))
+
+    def get_variable_files(self, var):
+        """Get the files where operations are made on a variable"""
+        var_history = self.variable(var)
+        files = []
+        for event in var_history:
+            files.append(event['file'])
+        return files
+
+    def get_variable_lines(self, var, f):
+        """Get the line where a operation is made on a variable in file f"""
+        var_history = self.variable(var)
+        lines = []
+        for event in var_history:
+            if f== event['file']:
+                line = event['line']
+                lines.append(line)
+        return lines
+
+    def del_var_history(self, var):
+        if var in self.variables:
+            self.variables[var] = []
+
+class DataSmart(MutableMapping):
+    def __init__(self, special = COWDictBase.copy(), seen = COWDictBase.copy() ):
+        self.dict = {}
+
+        self.inchistory = IncludeHistory()
+        self.varhistory = VariableHistory(self)
+        self._tracking = False
+
+        # cookie monster tribute
+        self._special_values = special
+        self._seen_overrides = seen
+
+        self.expand_cache = {}
+
+    def enableTracking(self):
+        self._tracking = True
+
+    def disableTracking(self):
+        self._tracking = False
+
+    def expandWithRefs(self, s, varname):
+
+        if not isinstance(s, basestring): # sanity check
+            return VariableParse(varname, self, s)
+
+        if varname and varname in self.expand_cache:
+            return self.expand_cache[varname]
+
+        varparse = VariableParse(varname, self)
+
+        while s.find('${') != -1:
+            olds = s
+            try:
+                s = __expand_var_regexp__.sub(varparse.var_sub, s)
+                s = __expand_python_regexp__.sub(varparse.python_sub, s)
+                if s == olds:
+                    break
+            except ExpansionError:
+                raise
+            except bb.parse.SkipPackage:
+                raise
+            except Exception as exc:
+                raise ExpansionError(varname, s, exc)
+
+        varparse.value = s
+
+        if varname:
+            self.expand_cache[varname] = varparse
+
+        return varparse
+
+    def expand(self, s, varname = None):
+        return self.expandWithRefs(s, varname).value
+
+
+    def finalize(self, parent = False):
+        """Performs final steps upon the datastore, including application of overrides"""
+
+        overrides = (self.getVar("OVERRIDES", True) or "").split(":") or []
+        finalize_caller = {
+            'op': 'finalize',
+        }
+        infer_caller_details(finalize_caller, parent = parent, varval = False)
+
+        #
+        # Well let us see what breaks here. We used to iterate
+        # over each variable and apply the override and then
+        # do the line expanding.
+        # If we have bad luck - which we will have - the keys
+        # where in some order that is so important for this
+        # method which we don't have anymore.
+        # Anyway we will fix that and write test cases this
+        # time.
+
+        #
+        # First we apply all overrides
+        # Then  we will handle _append and _prepend
+        #
+
+        # We only want to report finalization once per variable overridden.
+        finalizes_reported = {}
+
+        for o in overrides:
+            # calculate '_'+override
+            l = len(o) + 1
+
+            # see if one should even try
+            if o not in self._seen_overrides:
+                continue
+
+            vars = self._seen_overrides[o].copy()
+            for var in vars:
+                name = var[:-l]
+                try:
+                    # Report only once, even if multiple changes.
+                    if name not in finalizes_reported:
+                        finalizes_reported[name] = True
+                        finalize_caller['variable'] = name
+                        finalize_caller['detail'] = 'was: ' + str(self.getVar(name, False))
+                        self.varhistory.record(**finalize_caller)
+                    # Copy history of the override over.
+                    for event in self.varhistory.variable(var):
+                        loginfo = event.copy()
+                        loginfo['variable'] = name
+                        loginfo['op'] = 'override[%s]:%s' % (o, loginfo['op'])
+                        self.varhistory.record(**loginfo)
+                    self.setVar(name, self.getVar(var, False), op = 'finalize', file = 'override[%s]' % o, line = '')
+                    self.delVar(var)
+                except Exception:
+                    logger.info("Untracked delVar")
+
+        # now on to the appends and prepends
+        for op in __setvar_keyword__:
+            if op in self._special_values:
+                appends = self._special_values[op] or []
+                for append in appends:
+                    keep = []
+                    for (a, o) in self.getVarFlag(append, op) or []:
+                        match = True
+                        if o:
+                            for o2 in o.split("_"):
+                                if not o2 in overrides:
+                                    match = False
+                        if not match:
+                            keep.append((a ,o))
+                            continue
+
+                        if op == "_append":
+                            sval = self.getVar(append, False) or ""
+                            sval += a
+                            self.setVar(append, sval)
+                        elif op == "_prepend":
+                            sval = a + (self.getVar(append, False) or "")
+                            self.setVar(append, sval)
+
+                    # We save overrides that may be applied at some later stage
+                    if keep:
+                        self.setVarFlag(append, op, keep, ignore=True)
+                    else:
+                        self.delVarFlag(append, op, ignore=True)
+
+    def initVar(self, var):
+        self.expand_cache = {}
+        if not var in self.dict:
+            self.dict[var] = {}
+
+    def _findVar(self, var):
+        dest = self.dict
+        while dest:
+            if var in dest:
+                return dest[var]
+
+            if "_data" not in dest:
+                break
+            dest = dest["_data"]
+
+    def _makeShadowCopy(self, var):
+        if var in self.dict:
+            return
+
+        local_var = self._findVar(var)
+
+        if local_var:
+            self.dict[var] = copy.copy(local_var)
+        else:
+            self.initVar(var)
+
+
+    def setVar(self, var, value, **loginfo):
+        #print("var=" + str(var) + "  val=" + str(value))
+        if 'op' not in loginfo:
+            loginfo['op'] = "set"
+        self.expand_cache = {}
+        match  = __setvar_regexp__.match(var)
+        if match and match.group("keyword") in __setvar_keyword__:
+            base = match.group('base')
+            keyword = match.group("keyword")
+            override = match.group('add')
+            l = self.getVarFlag(base, keyword) or []
+            l.append([value, override])
+            self.setVarFlag(base, keyword, l, ignore=True)
+            # And cause that to be recorded:
+            loginfo['detail'] = value
+            loginfo['variable'] = base
+            if override:
+                loginfo['op'] = '%s[%s]' % (keyword, override)
+            else:
+                loginfo['op'] = keyword
+            self.varhistory.record(**loginfo)
+            # todo make sure keyword is not __doc__ or __module__
+            # pay the cookie monster
+            try:
+                self._special_values[keyword].add(base)
+            except KeyError:
+                self._special_values[keyword] = set()
+                self._special_values[keyword].add(base)
+
+            return
+
+        if not var in self.dict:
+            self._makeShadowCopy(var)
+
+        # more cookies for the cookie monster
+        if '_' in var:
+            override = var[var.rfind('_')+1:]
+            if len(override) > 0:
+                if override not in self._seen_overrides:
+                    self._seen_overrides[override] = set()
+                self._seen_overrides[override].add( var )
+
+        # setting var
+        self.dict[var]["_content"] = value
+        self.varhistory.record(**loginfo)
+
+    def getVar(self, var, expand=False, noweakdefault=False):
+        value = self.getVarFlag(var, "_content", False, noweakdefault)
+
+        # Call expand() separately to make use of the expand cache
+        if expand and value:
+            return self.expand(value, var)
+        return value
+
+    def renameVar(self, key, newkey, **loginfo):
+        """
+        Rename the variable key to newkey
+        """
+        val = self.getVar(key, 0)
+        if val is not None:
+            loginfo['variable'] = newkey
+            loginfo['op'] = 'rename from %s' % key
+            loginfo['detail'] = val
+            self.varhistory.record(**loginfo)
+            self.setVar(newkey, val, ignore=True)
+
+        for i in ('_append', '_prepend'):
+            src = self.getVarFlag(key, i)
+            if src is None:
+                continue
+
+            dest = self.getVarFlag(newkey, i) or []
+            dest.extend(src)
+            self.setVarFlag(newkey, i, dest, ignore=True)
+
+            if i in self._special_values and key in self._special_values[i]:
+                self._special_values[i].remove(key)
+                self._special_values[i].add(newkey)
+
+        loginfo['variable'] = key
+        loginfo['op'] = 'rename (to)'
+        loginfo['detail'] = newkey
+        self.varhistory.record(**loginfo)
+        self.delVar(key, ignore=True)
+
+    def appendVar(self, var, value, **loginfo):
+        loginfo['op'] = 'append'
+        self.varhistory.record(**loginfo)
+        newvalue = (self.getVar(var, False) or "") + value
+        self.setVar(var, newvalue, ignore=True)
+
+    def prependVar(self, var, value, **loginfo):
+        loginfo['op'] = 'prepend'
+        self.varhistory.record(**loginfo)
+        newvalue = value + (self.getVar(var, False) or "")
+        self.setVar(var, newvalue, ignore=True)
+
+    def delVar(self, var, **loginfo):
+        loginfo['detail'] = ""
+        loginfo['op'] = 'del'
+        self.varhistory.record(**loginfo)
+        self.expand_cache = {}
+        self.dict[var] = {}
+        if '_' in var:
+            override = var[var.rfind('_')+1:]
+            if override and override in self._seen_overrides and var in self._seen_overrides[override]:
+                self._seen_overrides[override].remove(var)
+
+    def setVarFlag(self, var, flag, value, **loginfo):
+        if 'op' not in loginfo:
+            loginfo['op'] = "set"
+        loginfo['flag'] = flag
+        self.varhistory.record(**loginfo)
+        if not var in self.dict:
+            self._makeShadowCopy(var)
+        self.dict[var][flag] = value
+
+    def getVarFlag(self, var, flag, expand=False, noweakdefault=False):
+        local_var = self._findVar(var)
+        value = None
+        if local_var:
+            if flag in local_var:
+                value = copy.copy(local_var[flag])
+            elif flag == "_content" and "defaultval" in local_var and not noweakdefault:
+                value = copy.copy(local_var["defaultval"])
+        if expand and value:
+            value = self.expand(value, None)
+        return value
+
+    def delVarFlag(self, var, flag, **loginfo):
+        local_var = self._findVar(var)
+        if not local_var:
+            return
+        if not var in self.dict:
+            self._makeShadowCopy(var)
+
+        if var in self.dict and flag in self.dict[var]:
+            loginfo['detail'] = ""
+            loginfo['op'] = 'delFlag'
+            loginfo['flag'] = flag
+            self.varhistory.record(**loginfo)
+
+            del self.dict[var][flag]
+
+    def appendVarFlag(self, var, flag, value, **loginfo):
+        loginfo['op'] = 'append'
+        loginfo['flag'] = flag
+        self.varhistory.record(**loginfo)
+        newvalue = (self.getVarFlag(var, flag, False) or "") + value
+        self.setVarFlag(var, flag, newvalue, ignore=True)
+
+    def prependVarFlag(self, var, flag, value, **loginfo):
+        loginfo['op'] = 'prepend'
+        loginfo['flag'] = flag
+        self.varhistory.record(**loginfo)
+        newvalue = value + (self.getVarFlag(var, flag, False) or "")
+        self.setVarFlag(var, flag, newvalue, ignore=True)
+
+    def setVarFlags(self, var, flags, **loginfo):
+        infer_caller_details(loginfo)
+        if not var in self.dict:
+            self._makeShadowCopy(var)
+
+        for i in flags:
+            if i == "_content":
+                continue
+            loginfo['flag'] = i
+            loginfo['detail'] = flags[i]
+            self.varhistory.record(**loginfo)
+            self.dict[var][i] = flags[i]
+
+    def getVarFlags(self, var):
+        local_var = self._findVar(var)
+        flags = {}
+
+        if local_var:
+            for i in local_var:
+                if i.startswith("_"):
+                    continue
+                flags[i] = local_var[i]
+
+        if len(flags) == 0:
+            return None
+        return flags
+
+
+    def delVarFlags(self, var, **loginfo):
+        if not var in self.dict:
+            self._makeShadowCopy(var)
+
+        if var in self.dict:
+            content = None
+
+            loginfo['op'] = 'delete flags'
+            self.varhistory.record(**loginfo)
+
+            # try to save the content
+            if "_content" in self.dict[var]:
+                content  = self.dict[var]["_content"]
+                self.dict[var]            = {}
+                self.dict[var]["_content"] = content
+            else:
+                del self.dict[var]
+
+
+    def createCopy(self):
+        """
+        Create a copy of self by setting _data to self
+        """
+        # we really want this to be a DataSmart...
+        data = DataSmart(seen=self._seen_overrides.copy(), special=self._special_values.copy())
+        data.dict["_data"] = self.dict
+        data.varhistory = self.varhistory.copy()
+        data.varhistory.datasmart = data
+        data.inchistory = self.inchistory.copy()
+
+        data._tracking = self._tracking
+
+        return data
+
+    def expandVarref(self, variable, parents=False):
+        """Find all references to variable in the data and expand it
+           in place, optionally descending to parent datastores."""
+
+        if parents:
+            keys = iter(self)
+        else:
+            keys = self.localkeys()
+
+        ref = '${%s}' % variable
+        value = self.getVar(variable, False)
+        for key in keys:
+            referrervalue = self.getVar(key, False)
+            if referrervalue and ref in referrervalue:
+                self.setVar(key, referrervalue.replace(ref, value))
+
+    def localkeys(self):
+        for key in self.dict:
+            if key != '_data':
+                yield key
+
+    def __iter__(self):
+        def keylist(d):        
+            klist = set()
+            for key in d:
+                if key == "_data":
+                    continue
+                if not d[key]:
+                    continue
+                klist.add(key)
+
+            if "_data" in d:
+                klist |= keylist(d["_data"])
+
+            return klist
+
+        for k in keylist(self.dict):
+             yield k
+
+    def __len__(self):
+        return len(frozenset(self))
+
+    def __getitem__(self, item):
+        value = self.getVar(item, False)
+        if value is None:
+            raise KeyError(item)
+        else:
+            return value
+
+    def __setitem__(self, var, value):
+        self.setVar(var, value)
+
+    def __delitem__(self, var):
+        self.delVar(var)
+
+    def get_hash(self):
+        data = {}
+        d = self.createCopy()
+        bb.data.expandKeys(d)
+        bb.data.update_data(d)
+
+        config_whitelist = set((d.getVar("BB_HASHCONFIG_WHITELIST", True) or "").split())
+        keys = set(key for key in iter(d) if not key.startswith("__"))
+        for key in keys:
+            if key in config_whitelist:
+                continue
+            value = d.getVar(key, False) or ""
+            data.update({key:value})
+
+            varflags = d.getVarFlags(key)
+            if not varflags:
+                continue
+            for f in varflags:
+                data.update({'%s[%s]' % (key, f):varflags[f]})
+
+        for key in ["__BBTASKS", "__BBANONFUNCS", "__BBHANDLERS"]:
+            bb_list = d.getVar(key, False) or []
+            bb_list.sort()
+            data.update({key:str(bb_list)})
+
+            if key == "__BBANONFUNCS":
+                for i in bb_list:
+                    value = d.getVar(i, True) or ""
+                    data.update({i:value})
+
+        data_str = str([(k, data[k]) for k in sorted(data.keys())])
+        return hashlib.md5(data_str).hexdigest()

bitbake/lib/bb/event.py

@@ -0,0 +1,584 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Event' implementation
+
+Classes and functions for manipulating 'events' in the
+BitBake build tools.
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os, sys
+import warnings
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+import logging
+import atexit
+import traceback
+import bb.utils
+import bb.compat
+
+# This is the pid for which we should generate the event. This is set when
+# the runqueue forks off.
+worker_pid = 0
+worker_pipe = None
+
+logger = logging.getLogger('BitBake.Event')
+
+class Event(object):
+    """Base class for events"""
+
+    def __init__(self):
+        self.pid = worker_pid
+
+NotHandled = 0
+Handled    = 1
+
+Registered        = 10
+AlreadyRegistered = 14
+
+# Internal
+_handlers = bb.compat.OrderedDict()
+_ui_handlers = {}
+_ui_handler_seq = 0
+
+# For compatibility
+bb.utils._context["NotHandled"] = NotHandled
+bb.utils._context["Handled"] = Handled
+
+def execute_handler(name, handler, event, d):
+    event.data = d
+    try:
+        ret = handler(event)
+    except bb.parse.SkipPackage:
+        raise
+    except Exception:
+        etype, value, tb = sys.exc_info()
+        logger.error("Execution of event handler '%s' failed" % name,
+                        exc_info=(etype, value, tb.tb_next))
+        raise
+    except SystemExit as exc:
+        if exc.code != 0:
+            logger.error("Execution of event handler '%s' failed" % name)
+        raise
+    finally:
+        del event.data
+
+    if ret is not None:
+        warnings.warn("Using Handled/NotHandled in event handlers is deprecated",
+                        DeprecationWarning, stacklevel = 2)
+
+def fire_class_handlers(event, d):
+    if isinstance(event, logging.LogRecord):
+        return
+
+    for name, handler in _handlers.iteritems():
+        try:
+            execute_handler(name, handler, event, d)
+        except Exception:
+            continue
+
+ui_queue = []
+@atexit.register
+def print_ui_queue():
+    """If we're exiting before a UI has been spawned, display any queued
+    LogRecords to the console."""
+    logger = logging.getLogger("BitBake")
+    if not _ui_handlers:
+        from bb.msg import BBLogFormatter
+        console = logging.StreamHandler(sys.stdout)
+        console.setFormatter(BBLogFormatter("%(levelname)s: %(message)s"))
+        logger.handlers = [console]
+
+        # First check to see if we have any proper messages
+        msgprint = False
+        for event in ui_queue:
+            if isinstance(event, logging.LogRecord):
+                if event.levelno > logging.DEBUG:
+                    logger.handle(event)
+                    msgprint = True
+        if msgprint:
+            return
+
+        # Nope, so just print all of the messages we have (including debug messages)
+        for event in ui_queue:
+            if isinstance(event, logging.LogRecord):
+                logger.handle(event)
+
+def fire_ui_handlers(event, d):
+    if not _ui_handlers:
+        # No UI handlers registered yet, queue up the messages
+        ui_queue.append(event)
+        return
+
+    errors = []
+    for h in _ui_handlers:
+        #print "Sending event %s" % event
+        try:
+             # We use pickle here since it better handles object instances
+             # which xmlrpc's marshaller does not. Events *must* be serializable
+             # by pickle.
+             if hasattr(_ui_handlers[h].event, "sendpickle"):
+                _ui_handlers[h].event.sendpickle((pickle.dumps(event)))
+             else:
+                _ui_handlers[h].event.send(event)
+        except:
+            errors.append(h)
+    for h in errors:
+        del _ui_handlers[h]
+
+def fire(event, d):
+    """Fire off an Event"""
+
+    # We can fire class handlers in the worker process context and this is
+    # desired so they get the task based datastore.
+    # UI handlers need to be fired in the server context so we defer this. They
+    # don't have a datastore so the datastore context isn't a problem.
+
+    fire_class_handlers(event, d)
+    if worker_pid != 0:
+        worker_fire(event, d)
+    else:
+        fire_ui_handlers(event, d)
+
+def worker_fire(event, d):
+    data = "<event>" + pickle.dumps(event) + "</event>"
+    worker_pipe.write(data)
+
+def fire_from_worker(event, d):
+    if not event.startswith("<event>") or not event.endswith("</event>"):
+        print("Error, not an event %s" % event)
+        return
+    event = pickle.loads(event[7:-8])
+    fire_ui_handlers(event, d)
+
+noop = lambda _: None
+def register(name, handler):
+    """Register an Event handler"""
+
+    # already registered
+    if name in _handlers:
+        return AlreadyRegistered
+
+    if handler is not None:
+        # handle string containing python code
+        if isinstance(handler, basestring):
+            tmp = "def %s(e):\n%s" % (name, handler)
+            try:
+                code = compile(tmp, "%s(e)" % name, "exec")
+            except SyntaxError:
+                logger.error("Unable to register event handler '%s':\n%s", name,
+                             ''.join(traceback.format_exc(limit=0)))
+                _handlers[name] = noop
+                return
+            env = {}
+            bb.utils.better_exec(code, env)
+            func = bb.utils.better_eval(name, env)
+            _handlers[name] = func
+        else:
+            _handlers[name] = handler
+
+        return Registered
+
+def remove(name, handler):
+    """Remove an Event handler"""
+    _handlers.pop(name)
+
+def register_UIHhandler(handler):
+    bb.event._ui_handler_seq = bb.event._ui_handler_seq + 1
+    _ui_handlers[_ui_handler_seq] = handler
+    return _ui_handler_seq
+
+def unregister_UIHhandler(handlerNum):
+    if handlerNum in _ui_handlers:
+        del _ui_handlers[handlerNum]
+    return
+
+def getName(e):
+    """Returns the name of a class or class instance"""
+    if getattr(e, "__name__", None) == None:
+        return e.__class__.__name__
+    else:
+        return e.__name__
+
+class OperationStarted(Event):
+    """An operation has begun"""
+    def __init__(self, msg = "Operation Started"):
+        Event.__init__(self)
+        self.msg = msg
+
+class OperationCompleted(Event):
+    """An operation has completed"""
+    def __init__(self, total, msg = "Operation Completed"):
+        Event.__init__(self)
+        self.total = total
+        self.msg = msg
+
+class OperationProgress(Event):
+    """An operation is in progress"""
+    def __init__(self, current, total, msg = "Operation in Progress"):
+        Event.__init__(self)
+        self.current = current
+        self.total = total
+        self.msg = msg + ": %s/%s" % (current, total);
+
+class ConfigParsed(Event):
+    """Configuration Parsing Complete"""
+
+class RecipeEvent(Event):
+    def __init__(self, fn):
+        self.fn = fn
+        Event.__init__(self)
+
+class RecipePreFinalise(RecipeEvent):
+    """ Recipe Parsing Complete but not yet finialised"""
+
+class RecipeParsed(RecipeEvent):
+    """ Recipe Parsing Complete """
+
+class StampUpdate(Event):
+    """Trigger for any adjustment of the stamp files to happen"""
+
+    def __init__(self, targets, stampfns):
+        self._targets = targets
+        self._stampfns = stampfns
+        Event.__init__(self)
+
+    def getStampPrefix(self):
+        return self._stampfns
+
+    def getTargets(self):
+        return self._targets
+
+    stampPrefix = property(getStampPrefix)
+    targets = property(getTargets)
+
+class BuildBase(Event):
+    """Base class for bbmake run events"""
+
+    def __init__(self, n, p, failures = 0):
+        self._name = n
+        self._pkgs = p
+        Event.__init__(self)
+        self._failures = failures
+
+    def getPkgs(self):
+        return self._pkgs
+
+    def setPkgs(self, pkgs):
+        self._pkgs = pkgs
+
+    def getName(self):
+        return self._name
+
+    def setName(self, name):
+        self._name = name
+
+    def getCfg(self):
+        return self.data
+
+    def setCfg(self, cfg):
+        self.data = cfg
+
+    def getFailures(self):
+        """
+        Return the number of failed packages
+        """
+        return self._failures
+
+    pkgs = property(getPkgs, setPkgs, None, "pkgs property")
+    name = property(getName, setName, None, "name property")
+    cfg = property(getCfg, setCfg, None, "cfg property")
+
+
+
+
+
+class BuildStarted(BuildBase, OperationStarted):
+    """bbmake build run started"""
+    def __init__(self, n, p, failures = 0):
+        OperationStarted.__init__(self, "Building Started")
+        BuildBase.__init__(self, n, p, failures)
+
+class BuildCompleted(BuildBase, OperationCompleted):
+    """bbmake build run completed"""
+    def __init__(self, total, n, p, failures = 0):
+        if not failures:
+            OperationCompleted.__init__(self, total, "Building Succeeded")
+        else:
+            OperationCompleted.__init__(self, total, "Building Failed")
+        BuildBase.__init__(self, n, p, failures)
+
+class DiskFull(Event):
+    """Disk full case build aborted"""
+    def __init__(self, dev, type, freespace, mountpoint):
+        Event.__init__(self)
+        self._dev = dev
+        self._type = type
+        self._free = freespace
+        self._mountpoint = mountpoint
+
+class NoProvider(Event):
+    """No Provider for an Event"""
+
+    def __init__(self, item, runtime=False, dependees=None, reasons=[]):
+        Event.__init__(self)
+        self._item = item
+        self._runtime = runtime
+        self._dependees = dependees
+        self._reasons = reasons
+
+    def getItem(self):
+        return self._item
+
+    def isRuntime(self):
+        return self._runtime
+
+class MultipleProviders(Event):
+    """Multiple Providers"""
+
+    def  __init__(self, item, candidates, runtime = False):
+        Event.__init__(self)
+        self._item = item
+        self._candidates = candidates
+        self._is_runtime = runtime
+
+    def isRuntime(self):
+        """
+        Is this a runtime issue?
+        """
+        return self._is_runtime
+
+    def getItem(self):
+        """
+        The name for the to be build item
+        """
+        return self._item
+
+    def getCandidates(self):
+        """
+        Get the possible Candidates for a PROVIDER.
+        """
+        return self._candidates
+
+class ParseStarted(OperationStarted):
+    """Recipe parsing for the runqueue has begun"""
+    def __init__(self, total):
+        OperationStarted.__init__(self, "Recipe parsing Started")
+        self.total = total
+
+class ParseCompleted(OperationCompleted):
+    """Recipe parsing for the runqueue has completed"""
+    def __init__(self, cached, parsed, skipped, masked, virtuals, errors, total):
+        OperationCompleted.__init__(self, total, "Recipe parsing Completed")
+        self.cached = cached
+        self.parsed = parsed
+        self.skipped = skipped
+        self.virtuals = virtuals
+        self.masked = masked
+        self.errors = errors
+        self.sofar = cached + parsed
+
+class ParseProgress(OperationProgress):
+    """Recipe parsing progress"""
+    def __init__(self, current, total):
+        OperationProgress.__init__(self, current, total, "Recipe parsing")
+
+
+class CacheLoadStarted(OperationStarted):
+    """Loading of the dependency cache has begun"""
+    def __init__(self, total):
+        OperationStarted.__init__(self, "Loading cache Started")
+        self.total = total
+
+class CacheLoadProgress(OperationProgress):
+    """Cache loading progress"""
+    def __init__(self, current, total):
+        OperationProgress.__init__(self, current, total, "Loading cache")
+
+class CacheLoadCompleted(OperationCompleted):
+    """Cache loading is complete"""
+    def __init__(self, total, num_entries):
+        OperationCompleted.__init__(self, total, "Loading cache Completed")
+        self.num_entries = num_entries
+
+class TreeDataPreparationStarted(OperationStarted):
+    """Tree data preparation started"""
+    def __init__(self):
+        OperationStarted.__init__(self, "Preparing tree data Started")
+
+class TreeDataPreparationProgress(OperationProgress):
+    """Tree data preparation is in progress"""
+    def __init__(self, current, total):
+        OperationProgress.__init__(self, current, total, "Preparing tree data")
+
+class TreeDataPreparationCompleted(OperationCompleted):
+    """Tree data preparation completed"""
+    def __init__(self, total):
+        OperationCompleted.__init__(self, total, "Preparing tree data Completed")
+
+class DepTreeGenerated(Event):
+    """
+    Event when a dependency tree has been generated
+    """
+
+    def __init__(self, depgraph):
+        Event.__init__(self)
+        self._depgraph = depgraph
+
+class TargetsTreeGenerated(Event):
+    """
+    Event when a set of buildable targets has been generated
+    """
+    def __init__(self, model):
+        Event.__init__(self)
+        self._model = model
+
+class FilesMatchingFound(Event):
+    """
+    Event when a list of files matching the supplied pattern has
+    been generated
+    """
+    def __init__(self, pattern, matches):
+        Event.__init__(self)
+        self._pattern = pattern
+        self._matches = matches
+
+class CoreBaseFilesFound(Event):
+    """
+    Event when a list of appropriate config files has been generated
+    """
+    def __init__(self, paths):
+        Event.__init__(self)
+        self._paths = paths
+
+class ConfigFilesFound(Event):
+    """
+    Event when a list of appropriate config files has been generated
+    """
+    def __init__(self, variable, values):
+        Event.__init__(self)
+        self._variable = variable
+        self._values = values
+
+class ConfigFilePathFound(Event):
+    """
+    Event when a path for a config file has been found
+    """
+    def __init__(self, path):
+        Event.__init__(self)
+        self._path = path
+
+class MsgBase(Event):
+    """Base class for messages"""
+
+    def __init__(self, msg):
+        self._message = msg
+        Event.__init__(self)
+
+class MsgDebug(MsgBase):
+    """Debug Message"""
+
+class MsgNote(MsgBase):
+    """Note Message"""
+
+class MsgWarn(MsgBase):
+    """Warning Message"""
+
+class MsgError(MsgBase):
+    """Error Message"""
+
+class MsgFatal(MsgBase):
+    """Fatal Message"""
+
+class MsgPlain(MsgBase):
+    """General output"""
+
+class LogExecTTY(Event):
+    """Send event containing program to spawn on tty of the logger"""
+    def __init__(self, msg, prog, sleep_delay, retries):
+        Event.__init__(self)
+        self.msg = msg
+        self.prog = prog
+        self.sleep_delay = sleep_delay
+        self.retries = retries
+
+class LogHandler(logging.Handler):
+    """Dispatch logging messages as bitbake events"""
+
+    def emit(self, record):
+        if record.exc_info:
+            etype, value, tb = record.exc_info
+            if hasattr(tb, 'tb_next'):
+                tb = list(bb.exceptions.extract_traceback(tb, context=3))
+            record.bb_exc_info = (etype, value, tb)
+            record.exc_info = None
+        fire(record, None)
+
+    def filter(self, record):
+        record.taskpid = worker_pid
+        return True
+
+class RequestPackageInfo(Event):
+    """
+    Event to request package information
+    """
+
+class PackageInfo(Event):
+    """
+    Package information for GUI
+    """
+    def __init__(self, pkginfolist):
+        Event.__init__(self)
+        self._pkginfolist = pkginfolist
+
+class SanityCheck(Event):
+    """
+    Event to issue sanity check
+    """
+
+class SanityCheckPassed(Event):
+    """
+    Event to indicate sanity check is passed
+    """
+
+class SanityCheckFailed(Event):
+    """
+    Event to indicate sanity check has failed
+    """
+    def __init__(self, msg, network_error=False):
+        Event.__init__(self)
+        self._msg = msg
+        self._network_error = network_error
+
+class NetworkTest(Event):
+    """
+    Event to start network test
+    """
+
+class NetworkTestPassed(Event):
+    """
+    Event to indicate network test has passed
+    """
+
+class NetworkTestFailed(Event):
+    """
+    Event to indicate network test has failed
+    """
+

bitbake/lib/bb/exceptions.py

@@ -0,0 +1,91 @@
+from __future__ import absolute_import
+import inspect
+import traceback
+import bb.namedtuple_with_abc
+from collections import namedtuple
+
+
+class TracebackEntry(namedtuple.abc):
+    """Pickleable representation of a traceback entry"""
+    _fields = 'filename lineno function args code_context index'
+    _header = '  File "{0.filename}", line {0.lineno}, in {0.function}{0.args}'
+
+    def format(self, formatter=None):
+        if not self.code_context:
+            return self._header.format(self) + '\n'
+
+        formatted = [self._header.format(self) + ':\n']
+
+        for lineindex, line in enumerate(self.code_context):
+            if formatter:
+                line = formatter(line)
+
+            if lineindex == self.index:
+                formatted.append('    >%s' % line)
+            else:
+                formatted.append('     %s' % line)
+        return formatted
+
+    def __str__(self):
+        return ''.join(self.format())
+
+def _get_frame_args(frame):
+    """Get the formatted arguments and class (if available) for a frame"""
+    arginfo = inspect.getargvalues(frame)
+
+    try:
+        if not arginfo.args:
+            return '', None
+    # There have been reports from the field of python 2.6 which doesn't 
+    # return a namedtuple here but simply a tuple so fallback gracefully if
+    # args isn't present.
+    except AttributeError:
+        return '', None
+
+    firstarg = arginfo.args[0]
+    if firstarg == 'self':
+        self = arginfo.locals['self']
+        cls = self.__class__.__name__
+
+        arginfo.args.pop(0)
+        del arginfo.locals['self']
+    else:
+        cls = None
+
+    formatted = inspect.formatargvalues(*arginfo)
+    return formatted, cls
+
+def extract_traceback(tb, context=1):
+    frames = inspect.getinnerframes(tb, context)
+    for frame, filename, lineno, function, code_context, index in frames:
+        formatted_args, cls = _get_frame_args(frame)
+        if cls:
+            function = '%s.%s' % (cls, function)
+        yield TracebackEntry(filename, lineno, function, formatted_args,
+                             code_context, index)
+
+def format_extracted(extracted, formatter=None, limit=None):
+    if limit:
+        extracted = extracted[-limit:]
+
+    formatted = []
+    for tracebackinfo in extracted:
+        formatted.extend(tracebackinfo.format(formatter))
+    return formatted
+
+
+def format_exception(etype, value, tb, context=1, limit=None, formatter=None):
+    formatted = ['Traceback (most recent call last):\n']
+
+    if hasattr(tb, 'tb_next'):
+        tb = extract_traceback(tb, context)
+
+    formatted.extend(format_extracted(tb, formatter, limit))
+    formatted.extend(traceback.format_exception_only(etype, value))
+    return formatted
+
+def to_string(exc):
+    if isinstance(exc, SystemExit):
+        if not isinstance(exc.code, basestring):
+            return 'Exited with "%d"' % exc.code
+    return str(exc)

bitbake/lib/bb/fetch2/bzr.py

@@ -0,0 +1,143 @@
+"""
+BitBake 'Fetch' implementation for bzr.
+
+"""
+
+# Copyright (C) 2007 Ross Burton
+# Copyright (C) 2007 Richard Purdie
+#
+#   Classes for obtaining upstream sources for the
+#   BitBake build tools.
+#   Copyright (C) 2003, 2004  Chris Larson
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os
+import sys
+import logging
+import bb
+from bb import data
+from bb.fetch2 import FetchMethod
+from bb.fetch2 import FetchError
+from bb.fetch2 import runfetchcmd
+from bb.fetch2 import logger
+
+class Bzr(FetchMethod):
+    def supports(self, url, ud, d):
+        return ud.type in ['bzr']
+
+    def urldata_init(self, ud, d):
+        """
+        init bzr specific variable within url data
+        """
+        # Create paths to bzr checkouts
+        relpath = self._strip_leading_slashes(ud.path)
+        ud.pkgdir = os.path.join(data.expand('${BZRDIR}', d), ud.host, relpath)
+
+        ud.setup_revisons(d)
+
+        if not ud.revision:
+            ud.revision = self.latest_revision(ud.url, ud, d)
+
+        ud.localfile = data.expand('bzr_%s_%s_%s.tar.gz' % (ud.host, ud.path.replace('/', '.'), ud.revision), d)
+
+    def _buildbzrcommand(self, ud, d, command):
+        """
+        Build up an bzr commandline based on ud
+        command is "fetch", "update", "revno"
+        """
+
+        basecmd = data.expand('${FETCHCMD_bzr}', d)
+
+        proto =  ud.parm.get('protocol', 'http')
+
+        bzrroot = ud.host + ud.path
+
+        options = []
+
+        if command == "revno":
+            bzrcmd = "%s revno %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
+        else:
+            if ud.revision:
+                options.append("-r %s" % ud.revision)
+
+            if command == "fetch":
+                bzrcmd = "%s branch %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
+            elif command == "update":
+                bzrcmd = "%s pull %s --overwrite" % (basecmd, " ".join(options))
+            else:
+                raise FetchError("Invalid bzr command %s" % command, ud.url)
+
+        return bzrcmd
+
+    def download(self, loc, ud, d):
+        """Fetch url"""
+
+        if os.access(os.path.join(ud.pkgdir, os.path.basename(ud.pkgdir), '.bzr'), os.R_OK):
+            bzrcmd = self._buildbzrcommand(ud, d, "update")
+            logger.debug(1, "BZR Update %s", loc)
+            bb.fetch2.check_network_access(d, bzrcmd, ud.url)
+            os.chdir(os.path.join (ud.pkgdir, os.path.basename(ud.path)))
+            runfetchcmd(bzrcmd, d)
+        else:
+            bb.utils.remove(os.path.join(ud.pkgdir, os.path.basename(ud.pkgdir)), True)
+            bzrcmd = self._buildbzrcommand(ud, d, "fetch")
+            bb.fetch2.check_network_access(d, bzrcmd, ud.url)
+            logger.debug(1, "BZR Checkout %s", loc)
+            bb.utils.mkdirhier(ud.pkgdir)
+            os.chdir(ud.pkgdir)
+            logger.debug(1, "Running %s", bzrcmd)
+            runfetchcmd(bzrcmd, d)
+
+        os.chdir(ud.pkgdir)
+
+        scmdata = ud.parm.get("scmdata", "")
+        if scmdata == "keep":
+            tar_flags = ""
+        else:
+            tar_flags = "--exclude '.bzr' --exclude '.bzrtags'"
+
+        # tar them up to a defined filename
+        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(ud.pkgdir)), d, cleanup = [ud.localpath])
+
+    def supports_srcrev(self):
+        return True
+
+    def _revision_key(self, url, ud, d, name):
+        """
+        Return a unique key for the url
+        """
+        return "bzr:" + ud.pkgdir
+
+    def _latest_revision(self, url, ud, d, name):
+        """
+        Return the latest upstream revision number
+        """
+        logger.debug(2, "BZR fetcher hitting network for %s", url)
+
+        bb.fetch2.check_network_access(d, self._buildbzrcommand(ud, d, "revno"), ud.url)
+
+        output = runfetchcmd(self._buildbzrcommand(ud, d, "revno"), d, True)
+
+        return output.strip()
+
+    def _sortable_revision(self, url, ud, d):
+        """
+        Return a sortable revision number which in our case is the revision number
+        """
+
+        return self._build_revision(url, ud, d)
+
+    def _build_revision(self, url, ud, d):
+        return ud.revision

bitbake/lib/bb/fetch2/cvs.py

@@ -0,0 +1,171 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Fetch' implementations
+
+Classes for obtaining upstream sources for the
+BitBake build tools.
+
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+#Based on functions from the base bb module, Copyright 2003 Holger Schurig
+#
+
+import os
+import logging
+import bb
+from bb.fetch2 import FetchMethod, FetchError, MissingParameterError, logger
+from bb.fetch2 import runfetchcmd
+
+class Cvs(FetchMethod):
+    """
+    Class to fetch a module or modules from cvs repositories
+    """
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with cvs.
+        """
+        return ud.type in ['cvs']
+
+    def urldata_init(self, ud, d):
+        if not "module" in ud.parm:
+            raise MissingParameterError("module", ud.url)
+        ud.module = ud.parm["module"]
+
+        ud.tag = ud.parm.get('tag', "")
+
+        # Override the default date in certain cases
+        if 'date' in ud.parm:
+            ud.date = ud.parm['date']
+        elif ud.tag:
+            ud.date = ""
+
+        norecurse = ''
+        if 'norecurse' in ud.parm:
+            norecurse = '_norecurse'
+
+        fullpath = ''
+        if 'fullpath' in ud.parm:
+            fullpath = '_fullpath'
+
+        ud.localfile = bb.data.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath), d)
+
+    def need_update(self, url, ud, d):
+        if (ud.date == "now"):
+            return True
+        if not os.path.exists(ud.localpath):
+            return True
+        return False
+
+    def download(self, loc, ud, d):
+
+        method = ud.parm.get('method', 'pserver')
+        localdir = ud.parm.get('localdir', ud.module)
+        cvs_port = ud.parm.get('port', '')
+
+        cvs_rsh = None
+        if method == "ext":
+            if "rsh" in ud.parm:
+                cvs_rsh = ud.parm["rsh"]
+
+        if method == "dir":
+            cvsroot = ud.path
+        else:
+            cvsroot = ":" + method
+            cvsproxyhost = d.getVar('CVS_PROXY_HOST', True)
+            if cvsproxyhost:
+                cvsroot += ";proxy=" + cvsproxyhost
+            cvsproxyport = d.getVar('CVS_PROXY_PORT', True)
+            if cvsproxyport:
+                cvsroot += ";proxyport=" + cvsproxyport
+            cvsroot += ":" + ud.user
+            if ud.pswd:
+                cvsroot += ":" + ud.pswd
+            cvsroot += "@" + ud.host + ":" + cvs_port + ud.path
+
+        options = []
+        if 'norecurse' in ud.parm:
+            options.append("-l")
+        if ud.date:
+            # treat YYYYMMDDHHMM specially for CVS
+            if len(ud.date) == 12:
+                options.append("-D \"%s %s:%s UTC\"" % (ud.date[0:8], ud.date[8:10], ud.date[10:12]))
+            else:
+                options.append("-D \"%s UTC\"" % ud.date)
+        if ud.tag:
+            options.append("-r %s" % ud.tag)
+
+        cvsbasecmd = d.getVar("FETCHCMD_cvs", True)
+        cvscmd = cvsbasecmd + " '-d" + cvsroot + "' co " + " ".join(options) + " " + ud.module
+        cvsupdatecmd = cvsbasecmd + " '-d" + cvsroot + "' update -d -P " + " ".join(options)
+
+        if cvs_rsh:
+            cvscmd = "CVS_RSH=\"%s\" %s" % (cvs_rsh, cvscmd)
+            cvsupdatecmd = "CVS_RSH=\"%s\" %s" % (cvs_rsh, cvsupdatecmd)
+
+        # create module directory
+        logger.debug(2, "Fetch: checking for module directory")
+        pkg = d.getVar('PN', True)
+        pkgdir = os.path.join(d.getVar('CVSDIR', True), pkg)
+        moddir = os.path.join(pkgdir, localdir)
+        if os.access(os.path.join(moddir, 'CVS'), os.R_OK):
+            logger.info("Update " + loc)
+            bb.fetch2.check_network_access(d, cvsupdatecmd, ud.url)
+            # update sources there
+            os.chdir(moddir)
+            cmd = cvsupdatecmd
+        else:
+            logger.info("Fetch " + loc)
+            # check out sources there
+            bb.utils.mkdirhier(pkgdir)
+            os.chdir(pkgdir)
+            logger.debug(1, "Running %s", cvscmd)
+            bb.fetch2.check_network_access(d, cvscmd, ud.url)
+            cmd = cvscmd
+
+        runfetchcmd(cmd, d, cleanup = [moddir])
+
+        if not os.access(moddir, os.R_OK):
+            raise FetchError("Directory %s was not readable despite sucessful fetch?!" % moddir, ud.url)
+
+        scmdata = ud.parm.get("scmdata", "")
+        if scmdata == "keep":
+            tar_flags = ""
+        else:
+            tar_flags = "--exclude 'CVS'"
+
+        # tar them up to a defined filename
+        if 'fullpath' in ud.parm:
+            os.chdir(pkgdir)
+            cmd = "tar %s -czf %s %s" % (tar_flags, ud.localpath, localdir)
+        else:
+            os.chdir(moddir)
+            os.chdir('..')
+            cmd = "tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(moddir))
+
+        runfetchcmd(cmd, d, cleanup = [ud.localpath])
+
+    def clean(self, ud, d):
+        """ Clean CVS Files and tarballs """
+
+        pkg = d.getVar('PN', True)
+        pkgdir = os.path.join(d.getVar("CVSDIR", True), pkg)
+
+        bb.utils.remove(pkgdir, True)
+        bb.utils.remove(ud.localpath)
+

bitbake/lib/bb/fetch2/git.py

@@ -0,0 +1,326 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Fetch' git implementation
+
+git fetcher support the SRC_URI with format of:
+SRC_URI = "git://some.host/somepath;OptionA=xxx;OptionB=xxx;..."
+
+Supported SRC_URI options are:
+
+- branch
+   The git branch to retrieve from. The default is "master"
+
+   This option also supports multiple branch fetching, with branches
+   separated by commas.  In multiple branches case, the name option
+   must have the same number of names to match the branches, which is
+   used to specify the SRC_REV for the branch
+   e.g:
+   SRC_URI="git://some.host/somepath;branch=branchX,branchY;name=nameX,nameY"
+   SRCREV_nameX = "xxxxxxxxxxxxxxxxxxxx"
+   SRCREV_nameY = "YYYYYYYYYYYYYYYYYYYY"
+
+- tag
+    The git tag to retrieve. The default is "master"
+
+- protocol
+   The method to use to access the repository. Common options are "git",
+   "http", "https", "file", "ssh" and "rsync". The default is "git".
+
+- rebaseable
+   rebaseable indicates that the upstream git repo may rebase in the future,
+   and current revision may disappear from upstream repo. This option will
+   remind fetcher to preserve local cache carefully for future use.
+   The default value is "0", set rebaseable=1 for rebaseable git repo.
+
+- nocheckout
+   Don't checkout source code when unpacking. set this option for the recipe
+   who has its own routine to checkout code.
+   The default is "0", set nocheckout=1 if needed.
+
+- bareclone
+   Create a bare clone of the source code and don't checkout the source code
+   when unpacking. Set this option for the recipe who has its own routine to
+   checkout code and tracking branch requirements.
+   The default is "0", set bareclone=1 if needed.
+
+"""
+
+#Copyright (C) 2005 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os
+import bb
+from   bb    import data
+from   bb.fetch2 import FetchMethod
+from   bb.fetch2 import runfetchcmd
+from   bb.fetch2 import logger
+
+class Git(FetchMethod):
+    """Class to fetch a module or modules from git repositories"""
+    def init(self, d):
+        pass
+
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with git.
+        """
+        return ud.type in ['git']
+
+    def supports_checksum(self, urldata):
+        return False
+
+    def urldata_init(self, ud, d):
+        """
+        init git specific variable within url data
+        so that the git method like latest_revision() can work
+        """
+        if 'protocol' in ud.parm:
+            ud.proto = ud.parm['protocol']
+        elif not ud.host:
+            ud.proto = 'file'
+        else:
+            ud.proto = "git"
+
+        if not ud.proto in ('git', 'file', 'ssh', 'http', 'https', 'rsync'):
+            raise bb.fetch2.ParameterError("Invalid protocol type", ud.url)
+
+        ud.nocheckout = ud.parm.get("nocheckout","0") == "1"
+
+        ud.rebaseable = ud.parm.get("rebaseable","0") == "1"
+
+        # bareclone implies nocheckout
+        ud.bareclone = ud.parm.get("bareclone","0") == "1"
+        if ud.bareclone:
+            ud.nocheckout = 1
+  
+        branches = ud.parm.get("branch", "master").split(',')
+        if len(branches) != len(ud.names):
+            raise bb.fetch2.ParameterError("The number of name and branch parameters is not balanced", ud.url)
+        ud.branches = {}
+        for name in ud.names:
+            branch = branches[ud.names.index(name)]
+            ud.branches[name] = branch
+
+        ud.basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
+
+        ud.write_tarballs = ((data.getVar("BB_GENERATE_MIRROR_TARBALLS", d, True) or "0") != "0") or ud.rebaseable
+
+        ud.setup_revisons(d)
+
+        for name in ud.names:
+            # Ensure anything that doesn't look like a sha256 checksum/revision is translated into one
+            if not ud.revisions[name] or len(ud.revisions[name]) != 40  or (False in [c in "abcdef0123456789" for c in ud.revisions[name]]):
+                if ud.revisions[name]:
+                    ud.branches[name] = ud.revisions[name]
+                ud.revisions[name] = self.latest_revision(ud.url, ud, d, name)
+
+        gitsrcname = '%s%s' % (ud.host.replace(':','.'), ud.path.replace('/', '.').replace('*', '.'))
+        # for rebaseable git repo, it is necessary to keep mirror tar ball
+        # per revision, so that even the revision disappears from the
+        # upstream repo in the future, the mirror will remain intact and still
+        # contains the revision
+        if ud.rebaseable:
+            for name in ud.names:
+                gitsrcname = gitsrcname + '_' + ud.revisions[name]
+        ud.mirrortarball = 'git2_%s.tar.gz' % (gitsrcname)
+        ud.fullmirror = os.path.join(d.getVar("DL_DIR", True), ud.mirrortarball)
+        gitdir = d.getVar("GITDIR", True) or (d.getVar("DL_DIR", True) + "/git2/")
+        ud.clonedir = os.path.join(gitdir, gitsrcname)
+
+        ud.localfile = ud.clonedir
+
+    def localpath(self, url, ud, d):
+        return ud.clonedir
+
+    def need_update(self, u, ud, d):
+        if not os.path.exists(ud.clonedir):
+            return True
+        os.chdir(ud.clonedir)
+        for name in ud.names:
+            if not self._contains_ref(ud.revisions[name], d):
+                return True
+        if ud.write_tarballs and not os.path.exists(ud.fullmirror):
+            return True
+        return False
+
+    def try_premirror(self, u, ud, d):
+        # If we don't do this, updating an existing checkout with only premirrors
+        # is not possible
+        if d.getVar("BB_FETCH_PREMIRRORONLY", True) is not None:
+            return True
+        if os.path.exists(ud.clonedir):
+            return False
+        return True
+
+    def download(self, loc, ud, d):
+        """Fetch url"""
+
+        if ud.user:
+            username = ud.user + '@'
+        else:
+            username = ""
+
+        ud.repochanged = not os.path.exists(ud.fullmirror)
+
+        # If the checkout doesn't exist and the mirror tarball does, extract it
+        if not os.path.exists(ud.clonedir) and os.path.exists(ud.fullmirror):
+            bb.utils.mkdirhier(ud.clonedir)
+            os.chdir(ud.clonedir)
+            runfetchcmd("tar -xzf %s" % (ud.fullmirror), d)
+
+        repourl = "%s://%s%s%s" % (ud.proto, username, ud.host, ud.path)
+
+        # If the repo still doesn't exist, fallback to cloning it
+        if not os.path.exists(ud.clonedir):
+            # We do this since git will use a "-l" option automatically for local urls where possible
+            if repourl.startswith("file://"):
+                repourl = repourl[7:]
+            clone_cmd = "%s clone --bare --mirror %s %s" % (ud.basecmd, repourl, ud.clonedir)
+            if ud.proto.lower() != 'file':
+                bb.fetch2.check_network_access(d, clone_cmd)
+            runfetchcmd(clone_cmd, d)
+
+        os.chdir(ud.clonedir)
+        # Update the checkout if needed
+        needupdate = False
+        for name in ud.names:
+            if not self._contains_ref(ud.revisions[name], d):
+                needupdate = True
+        if needupdate:
+            try: 
+                runfetchcmd("%s remote rm origin" % ud.basecmd, d) 
+            except bb.fetch2.FetchError:
+                logger.debug(1, "No Origin")
+
+            runfetchcmd("%s remote add --mirror=fetch origin %s" % (ud.basecmd, repourl), d)
+            fetch_cmd = "%s fetch -f --prune %s refs/*:refs/*" % (ud.basecmd, repourl)
+            if ud.proto.lower() != 'file':
+                bb.fetch2.check_network_access(d, fetch_cmd, ud.url)
+            runfetchcmd(fetch_cmd, d)
+            runfetchcmd("%s prune-packed" % ud.basecmd, d)
+            runfetchcmd("%s pack-redundant --all | xargs -r rm" % ud.basecmd, d)
+            ud.repochanged = True
+
+    def build_mirror_data(self, url, ud, d):
+        # Generate a mirror tarball if needed
+        if ud.write_tarballs and (ud.repochanged or not os.path.exists(ud.fullmirror)):
+            # it's possible that this symlink points to read-only filesystem with PREMIRROR
+            if os.path.islink(ud.fullmirror):
+                os.unlink(ud.fullmirror)
+
+            os.chdir(ud.clonedir)
+            logger.info("Creating tarball of git repository")
+            runfetchcmd("tar -czf %s %s" % (ud.fullmirror, os.path.join(".") ), d)
+            runfetchcmd("touch %s.done" % (ud.fullmirror), d)
+
+    def unpack(self, ud, destdir, d):
+        """ unpack the downloaded src to destdir"""
+
+        subdir = ud.parm.get("subpath", "")
+        if subdir != "":
+            readpathspec = ":%s" % (subdir)
+            def_destsuffix = "%s/" % os.path.basename(subdir)
+        else:
+            readpathspec = ""
+            def_destsuffix = "git/"
+
+        destsuffix = ud.parm.get("destsuffix", def_destsuffix)
+        destdir = ud.destdir = os.path.join(destdir, destsuffix)
+        if os.path.exists(destdir):
+            bb.utils.prunedir(destdir)
+
+        cloneflags = "-s -n"
+        if ud.bareclone:
+            cloneflags += " --mirror"
+
+        # Versions of git prior to 1.7.9.2 have issues where foo.git and foo get confused
+        # and you end up with some horrible union of the two when you attempt to clone it
+        # The least invasive workaround seems to be a symlink to the real directory to
+        # fool git into ignoring any .git version that may also be present.
+        #
+        # The issue is fixed in more recent versions of git so we can drop this hack in future
+        # when that version becomes common enough.
+        clonedir = ud.clonedir
+        if not ud.path.endswith(".git"):
+            indirectiondir = destdir[:-1] + ".indirectionsymlink"
+            if os.path.exists(indirectiondir):
+                os.remove(indirectiondir)
+            bb.utils.mkdirhier(os.path.dirname(indirectiondir))
+            os.symlink(ud.clonedir, indirectiondir)
+            clonedir = indirectiondir
+
+        runfetchcmd("git clone %s %s/ %s" % (cloneflags, clonedir, destdir), d)
+        if not ud.nocheckout:
+            os.chdir(destdir)
+            if subdir != "":
+                runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.revisions[ud.names[0]], readpathspec), d)
+                runfetchcmd("%s checkout-index -q -f -a" % ud.basecmd, d)
+            else:
+                runfetchcmd("%s checkout %s" % (ud.basecmd, ud.revisions[ud.names[0]]), d)
+        return True
+
+    def clean(self, ud, d):
+        """ clean the git directory """
+
+        bb.utils.remove(ud.localpath, True)
+        bb.utils.remove(ud.fullmirror)
+
+    def supports_srcrev(self):
+        return True
+
+    def _contains_ref(self, tag, d):
+        basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
+        cmd = "%s log --pretty=oneline -n 1 %s -- 2> /dev/null | wc -l" % (basecmd, tag)
+        output = runfetchcmd(cmd, d, quiet=True)
+        if len(output.split()) > 1:
+            raise bb.fetch2.FetchError("The command '%s' gave output with more then 1 line unexpectedly, output: '%s'" % (cmd, output))
+        return output.split()[0] != "0"
+
+    def _revision_key(self, url, ud, d, name):
+        """
+        Return a unique key for the url
+        """
+        return "git:" + ud.host + ud.path.replace('/', '.') + ud.branches[name]
+
+    def _latest_revision(self, url, ud, d, name):
+        """
+        Compute the HEAD revision for the url
+        """
+        if ud.user:
+            username = ud.user + '@'
+        else:
+            username = ""
+
+        basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
+        cmd = "%s ls-remote %s://%s%s%s %s" % \
+              (basecmd, ud.proto, username, ud.host, ud.path, ud.branches[name])
+        if ud.proto.lower() != 'file':
+            bb.fetch2.check_network_access(d, cmd)
+        output = runfetchcmd(cmd, d, True)
+        if not output:
+            raise bb.fetch2.FetchError("The command %s gave empty output unexpectedly" % cmd, url)
+        return output.split()[0]
+
+    def _build_revision(self, url, ud, d, name):
+        return ud.revisions[name]
+
+    def checkstatus(self, uri, ud, d):
+        fetchcmd = "%s ls-remote %s" % (ud.basecmd, uri)
+        try:
+            runfetchcmd(fetchcmd, d, quiet=True)
+            return True
+        except FetchError:
+            return False

bitbake/lib/bb/fetch2/gitsm.py

@@ -0,0 +1,78 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Fetch' git submodules implementation
+"""
+
+# Copyright (C) 2013 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os
+import bb
+from   bb    import data
+from   bb.fetch2.git import Git
+from   bb.fetch2 import runfetchcmd
+from   bb.fetch2 import logger
+
+class GitSM(Git):
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with git.
+        """
+        return ud.type in ['gitsm']
+
+    def uses_submodules(self, ud, d):
+        for name in ud.names:
+            try:
+                runfetchcmd("%s show %s:.gitmodules" % (ud.basecmd, ud.revisions[name]), d, quiet=True)
+                return True
+            except bb.fetch.FetchError:
+                pass
+        return False
+
+    def update_submodules(self, u, ud, d):
+        # We have to convert bare -> full repo, do the submodule bit, then convert back
+        tmpclonedir = ud.clonedir + ".tmp"
+        gitdir = tmpclonedir + os.sep + ".git"
+        bb.utils.remove(tmpclonedir, True)
+        os.mkdir(tmpclonedir)
+        os.rename(ud.clonedir, gitdir)
+        runfetchcmd("sed " + gitdir + "/config -i -e 's/bare.*=.*true/bare = false/'", d)
+        os.chdir(tmpclonedir)
+        runfetchcmd("git reset --hard", d)
+        runfetchcmd("git submodule init", d)
+        runfetchcmd("git submodule update", d)
+        runfetchcmd("sed " + gitdir + "/config -i -e 's/bare.*=.*false/bare = true/'", d)
+        os.rename(gitdir, ud.clonedir,)
+        bb.utils.remove(tmpclonedir, True)
+
+    def download(self, loc, ud, d):
+        Git.download(self, loc, ud, d)
+
+        os.chdir(ud.clonedir)
+        submodules = self.uses_submodules(ud, d)
+        if submodules:
+            self.update_submodules(loc, ud, d)
+
+    def unpack(self, ud, destdir, d):
+        Git.unpack(self, ud, destdir, d)
+        
+        os.chdir(ud.destdir)
+        submodules = self.uses_submodules(ud, d)
+        if submodules:
+            runfetchcmd("cp -r " + ud.clonedir + "/modules " + ud.destdir + "/.git/", d)
+            runfetchcmd("git submodule init", d)
+            runfetchcmd("git submodule update", d)
+

bitbake/lib/bb/fetch2/hg.py

@@ -0,0 +1,187 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Fetch' implementation for mercurial DRCS (hg).
+
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2004        Marcin Juszkiewicz
+# Copyright (C) 2007        Robert Schuster
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import os
+import sys
+import logging
+import bb
+from bb import data
+from bb.fetch2 import FetchMethod
+from bb.fetch2 import FetchError
+from bb.fetch2 import MissingParameterError
+from bb.fetch2 import runfetchcmd
+from bb.fetch2 import logger
+
+class Hg(FetchMethod):
+    """Class to fetch from mercurial repositories"""
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with mercurial.
+        """
+        return ud.type in ['hg']
+
+    def urldata_init(self, ud, d):
+        """
+        init hg specific variable within url data
+        """
+        if not "module" in ud.parm:
+            raise MissingParameterError('module', ud.url)
+
+        ud.module = ud.parm["module"]
+
+        # Create paths to mercurial checkouts
+        relpath = self._strip_leading_slashes(ud.path)
+        ud.pkgdir = os.path.join(data.expand('${HGDIR}', d), ud.host, relpath)
+        ud.moddir = os.path.join(ud.pkgdir, ud.module)
+
+        ud.setup_revisons(d)
+
+        if 'rev' in ud.parm:
+            ud.revision = ud.parm['rev']
+        elif not ud.revision:
+            ud.revision = self.latest_revision(ud.url, ud, d)
+
+        ud.localfile = data.expand('%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision), d)
+
+    def need_update(self, url, ud, d):
+        revTag = ud.parm.get('rev', 'tip')
+        if revTag == "tip":
+            return True
+        if not os.path.exists(ud.localpath):
+            return True
+        return False
+
+    def _buildhgcommand(self, ud, d, command):
+        """
+        Build up an hg commandline based on ud
+        command is "fetch", "update", "info"
+        """
+
+        basecmd = data.expand('${FETCHCMD_hg}', d)
+
+        proto = ud.parm.get('protocol', 'http')
+
+        host = ud.host
+        if proto == "file":
+            host = "/"
+            ud.host = "localhost"
+
+        if not ud.user:
+            hgroot = host + ud.path
+        else:
+            if ud.pswd:
+                hgroot = ud.user + ":" + ud.pswd + "@" + host + ud.path
+            else:
+                hgroot = ud.user + "@" + host + ud.path
+
+        if command == "info":
+            return "%s identify -i %s://%s/%s" % (basecmd, proto, hgroot, ud.module)
+
+        options = [];
+
+        # Don't specify revision for the fetch; clone the entire repo.
+        # This avoids an issue if the specified revision is a tag, because
+        # the tag actually exists in the specified revision + 1, so it won't
+        # be available when used in any successive commands.
+        if ud.revision and command != "fetch":
+            options.append("-r %s" % ud.revision)
+
+        if command == "fetch":
+            cmd = "%s clone %s %s://%s/%s %s" % (basecmd, " ".join(options), proto, hgroot, ud.module, ud.module)
+        elif command == "pull":
+            # do not pass options list; limiting pull to rev causes the local
+            # repo not to contain it and immediately following "update" command
+            # will crash
+            if ud.user and ud.pswd:
+                cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" pull" % (basecmd, ud.user, ud.pswd, proto)
+            else:
+                cmd = "%s pull" % (basecmd)
+        elif command == "update":
+            cmd = "%s update -C %s" % (basecmd, " ".join(options))
+        else:
+            raise FetchError("Invalid hg command %s" % command, ud.url)
+
+        return cmd
+
+    def download(self, loc, ud, d):
+        """Fetch url"""
+
+        logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
+
+        if os.access(os.path.join(ud.moddir, '.hg'), os.R_OK):
+            updatecmd = self._buildhgcommand(ud, d, "pull")
+            logger.info("Update " + loc)
+            # update sources there
+            os.chdir(ud.moddir)
+            logger.debug(1, "Running %s", updatecmd)
+            bb.fetch2.check_network_access(d, updatecmd, ud.url)
+            runfetchcmd(updatecmd, d)
+
+        else:
+            fetchcmd = self._buildhgcommand(ud, d, "fetch")
+            logger.info("Fetch " + loc)
+            # check out sources there
+            bb.utils.mkdirhier(ud.pkgdir)
+            os.chdir(ud.pkgdir)
+            logger.debug(1, "Running %s", fetchcmd)
+            bb.fetch2.check_network_access(d, fetchcmd, ud.url)
+            runfetchcmd(fetchcmd, d)
+
+        # Even when we clone (fetch), we still need to update as hg's clone
+        # won't checkout the specified revision if its on a branch
+        updatecmd = self._buildhgcommand(ud, d, "update")
+        os.chdir(ud.moddir)
+        logger.debug(1, "Running %s", updatecmd)
+        runfetchcmd(updatecmd, d)
+
+        scmdata = ud.parm.get("scmdata", "")
+        if scmdata == "keep":
+            tar_flags = ""
+        else:
+            tar_flags = "--exclude '.hg' --exclude '.hgrags'"
+
+        os.chdir(ud.pkgdir)
+        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d, cleanup = [ud.localpath])
+
+    def supports_srcrev(self):
+        return True
+
+    def _latest_revision(self, url, ud, d, name):
+        """
+        Compute tip revision for the url
+        """
+        bb.fetch2.check_network_access(d, self._buildhgcommand(ud, d, "info"))
+        output = runfetchcmd(self._buildhgcommand(ud, d, "info"), d)
+        return output.strip()
+
+    def _build_revision(self, url, ud, d, name):
+        return ud.revision
+
+    def _revision_key(self, url, ud, d, name):
+        """
+        Return a unique key for the url
+        """
+        return "hg:" + ud.moddir

bitbake/lib/bb/fetch2/local.py

@@ -0,0 +1,116 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Fetch' implementations
+
+Classes for obtaining upstream sources for the
+BitBake build tools.
+
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import os
+import urllib
+import bb
+import bb.utils
+from   bb import data
+from   bb.fetch2 import FetchMethod, FetchError
+from   bb.fetch2 import logger
+
+class Local(FetchMethod):
+    def supports(self, url, urldata, d):
+        """
+        Check to see if a given url represents a local fetch.
+        """
+        return urldata.type in ['file']
+
+    def urldata_init(self, ud, d):
+        # We don't set localfile as for this fetcher the file is already local!
+        ud.decodedurl = urllib.unquote(ud.url.split("://")[1].split(";")[0])
+        ud.basename = os.path.basename(ud.decodedurl)
+        ud.basepath = ud.decodedurl
+        return
+
+    def localpath(self, url, urldata, d):
+        """
+        Return the local filename of a given url assuming a successful fetch.
+        """
+        path = urldata.decodedurl
+        newpath = path
+        if path[0] != "/":
+            filespath = data.getVar('FILESPATH', d, True)
+            if filespath:
+                logger.debug(2, "Searching for %s in paths:    \n%s" % (path, "\n    ".join(filespath.split(":"))))
+                newpath = bb.utils.which(filespath, path)
+            if not newpath:
+                filesdir = data.getVar('FILESDIR', d, True)
+                if filesdir:
+                    logger.debug(2, "Searching for %s in path: %s" % (path, filesdir))
+                    newpath = os.path.join(filesdir, path)
+            if (not newpath or not os.path.exists(newpath)) and path.find("*") != -1:
+                # For expressions using '*', best we can do is take the first directory in FILESPATH that exists
+                newpath = bb.utils.which(filespath, ".")
+                logger.debug(2, "Searching for %s in path: %s" % (path, newpath))
+                return newpath
+            if not os.path.exists(newpath):
+                dldirfile = os.path.join(d.getVar("DL_DIR", True), path)
+                logger.debug(2, "Defaulting to %s for %s" % (dldirfile, path))
+                bb.utils.mkdirhier(os.path.dirname(dldirfile))
+                return dldirfile
+        return newpath
+
+    def need_update(self, url, ud, d):
+        if url.find("*") != -1:
+            return False
+        if os.path.exists(ud.localpath):
+            return False
+        return True
+
+    def download(self, url, urldata, d):
+        """Fetch urls (no-op for Local method)"""
+        # no need to fetch local files, we'll deal with them in place.
+        if self.supports_checksum(urldata) and not os.path.exists(urldata.localpath):
+            locations = []
+            filespath = data.getVar('FILESPATH', d, True)
+            if filespath:
+                locations = filespath.split(":")
+            filesdir = data.getVar('FILESDIR', d, True)
+            if filesdir:
+                locations.append(filesdir)
+            locations.append(d.getVar("DL_DIR", True))
+
+            msg = "Unable to find file " + url + " anywhere. The paths that were searched were:\n    " + "\n    ".join(locations)
+            raise FetchError(msg)
+
+        return True
+
+    def checkstatus(self, url, urldata, d):
+        """
+        Check the status of the url
+        """
+        if urldata.localpath.find("*") != -1:
+            logger.info("URL %s looks like a glob and was therefore not checked.", url)
+            return True
+        if os.path.exists(urldata.localpath):
+            return True
+        return False
+
+    def clean(self, urldata, d):
+        return
+

bitbake/lib/bb/fetch2/osc.py

@@ -0,0 +1,135 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+Bitbake "Fetch" implementation for osc (Opensuse build service client).
+Based on the svn "Fetch" implementation.
+
+"""
+
+import  os
+import  sys
+import logging
+import  bb
+from    bb       import data
+from    bb.fetch2 import FetchMethod
+from    bb.fetch2 import FetchError
+from    bb.fetch2 import MissingParameterError
+from    bb.fetch2 import runfetchcmd
+
+class Osc(FetchMethod):
+    """Class to fetch a module or modules from Opensuse build server
+       repositories."""
+
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with osc.
+        """
+        return ud.type in ['osc']
+
+    def urldata_init(self, ud, d):
+        if not "module" in ud.parm:
+            raise MissingParameterError('module', ud.url)
+
+        ud.module = ud.parm["module"]
+
+        # Create paths to osc checkouts
+        relpath = self._strip_leading_slashes(ud.path)
+        ud.pkgdir = os.path.join(data.expand('${OSCDIR}', d), ud.host)
+        ud.moddir = os.path.join(ud.pkgdir, relpath, ud.module)
+
+        if 'rev' in ud.parm:
+            ud.revision = ud.parm['rev']
+        else:
+            pv = data.getVar("PV", d, 0)
+            rev = bb.fetch2.srcrev_internal_helper(ud, d)
+            if rev and rev != True:
+                ud.revision = rev
+            else:
+                ud.revision = ""
+
+        ud.localfile = data.expand('%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.path.replace('/', '.'), ud.revision), d)
+
+    def _buildosccommand(self, ud, d, command):
+        """
+        Build up an ocs commandline based on ud
+        command is "fetch", "update", "info"
+        """
+
+        basecmd = data.expand('${FETCHCMD_osc}', d)
+
+        proto = ud.parm.get('protocol', 'ocs')
+
+        options = []
+
+        config = "-c %s" % self.generate_config(ud, d)
+
+        if ud.revision:
+            options.append("-r %s" % ud.revision)
+
+        coroot = self._strip_leading_slashes(ud.path)
+
+        if command == "fetch":
+            osccmd = "%s %s co %s/%s %s" % (basecmd, config, coroot, ud.module, " ".join(options))
+        elif command == "update":
+            osccmd = "%s %s up %s" % (basecmd, config, " ".join(options))
+        else:
+            raise FetchError("Invalid osc command %s" % command, ud.url)
+
+        return osccmd
+
+    def download(self, loc, ud, d):
+        """
+        Fetch url
+        """
+
+        logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
+
+        if os.access(os.path.join(data.expand('${OSCDIR}', d), ud.path, ud.module), os.R_OK):
+            oscupdatecmd = self._buildosccommand(ud, d, "update")
+            logger.info("Update "+ loc)
+            # update sources there
+            os.chdir(ud.moddir)
+            logger.debug(1, "Running %s", oscupdatecmd)
+            bb.fetch2.check_network_access(d, oscupdatecmd, ud.url)
+            runfetchcmd(oscupdatecmd, d)
+        else:
+            oscfetchcmd = self._buildosccommand(ud, d, "fetch")
+            logger.info("Fetch " + loc)
+            # check out sources there
+            bb.utils.mkdirhier(ud.pkgdir)
+            os.chdir(ud.pkgdir)
+            logger.debug(1, "Running %s", oscfetchcmd)
+            bb.fetch2.check_network_access(d, oscfetchcmd, ud.url)
+            runfetchcmd(oscfetchcmd, d)
+
+        os.chdir(os.path.join(ud.pkgdir + ud.path))
+        # tar them up to a defined filename
+        runfetchcmd("tar -czf %s %s" % (ud.localpath, ud.module), d, cleanup = [ud.localpath])
+
+    def supports_srcrev(self):
+        return False
+
+    def generate_config(self, ud, d):
+        """
+        Generate a .oscrc to be used for this run.
+        """
+
+        config_path = os.path.join(data.expand('${OSCDIR}', d), "oscrc")
+        if (os.path.exists(config_path)):
+            os.remove(config_path)
+
+        f = open(config_path, 'w')
+        f.write("[general]\n")
+        f.write("apisrv = %s\n" % ud.host)
+        f.write("scheme = http\n")
+        f.write("su-wrapper = su -c\n")
+        f.write("build-root = %s\n" % data.expand('${WORKDIR}', d))
+        f.write("urllist = http://moblin-obs.jf.intel.com:8888/build/%(project)s/%(repository)s/%(buildarch)s/:full/%(name)s.rpm\n")
+        f.write("extra-pkgs = gzip\n")
+        f.write("\n")
+        f.write("[%s]\n" % ud.host)
+        f.write("user = %s\n" % ud.parm["user"])
+        f.write("pass = %s\n" % ud.parm["pswd"])
+        f.close()
+
+        return config_path

bitbake/lib/bb/fetch2/perforce.py

@@ -0,0 +1,198 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Fetch' implementations
+
+Classes for obtaining upstream sources for the
+BitBake build tools.
+
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+from future_builtins import zip
+import os
+import subprocess
+import logging
+import bb
+from   bb import data
+from   bb.fetch2 import FetchMethod
+from   bb.fetch2 import FetchError
+from   bb.fetch2 import logger
+from   bb.fetch2 import runfetchcmd
+
+class Perforce(FetchMethod):
+    def supports(self, url, ud, d):
+        return ud.type in ['p4']
+
+    def doparse(url, d):
+        parm = {}
+        path = url.split("://")[1]
+        delim = path.find("@");
+        if delim != -1:
+            (user, pswd, host, port) = path.split('@')[0].split(":")
+            path = path.split('@')[1]
+        else:
+            (host, port) = data.getVar('P4PORT', d).split(':')
+            user = ""
+            pswd = ""
+
+        if path.find(";") != -1:
+            keys=[]
+            values=[]
+            plist = path.split(';')
+            for item in plist:
+                if item.count('='):
+                    (key, value) = item.split('=')
+                    keys.append(key)
+                    values.append(value)
+
+            parm = dict(zip(keys, values))
+        path = "//" + path.split(';')[0]
+        host += ":%s" % (port)
+        parm["cset"] = Perforce.getcset(d, path, host, user, pswd, parm)
+
+        return host, path, user, pswd, parm
+    doparse = staticmethod(doparse)
+
+    def getcset(d, depot, host, user, pswd, parm):
+        p4opt = ""
+        if "cset" in parm:
+            return parm["cset"];
+        if user:
+            p4opt += " -u %s" % (user)
+        if pswd:
+            p4opt += " -P %s" % (pswd)
+        if host:
+            p4opt += " -p %s" % (host)
+
+        p4date = data.getVar("P4DATE", d, True)
+        if "revision" in parm:
+            depot += "#%s" % (parm["revision"])
+        elif "label" in parm:
+            depot += "@%s" % (parm["label"])
+        elif p4date:
+            depot += "@%s" % (p4date)
+
+        p4cmd = data.getVar('FETCHCOMMAND_p4', d, True)
+        logger.debug(1, "Running %s%s changes -m 1 %s", p4cmd, p4opt, depot)
+        p4file, errors = bb.process.run("%s%s changes -m 1 %s" % (p4cmd, p4opt, depot))
+        cset = p4file.strip()
+        logger.debug(1, "READ %s", cset)
+        if not cset:
+            return -1
+
+        return cset.split(' ')[1]
+    getcset = staticmethod(getcset)
+
+    def urldata_init(self, ud, d):
+        (host, path, user, pswd, parm) = Perforce.doparse(ud.url, d)
+
+        # If a label is specified, we use that as our filename
+
+        if "label" in parm:
+            ud.localfile = "%s.tar.gz" % (parm["label"])
+            return
+
+        base = path
+        which = path.find('/...')
+        if which != -1:
+            base = path[:which-1]
+
+        base = self._strip_leading_slashes(base)
+
+        cset = Perforce.getcset(d, path, host, user, pswd, parm)
+
+        ud.localfile = data.expand('%s+%s+%s.tar.gz' % (host, base.replace('/', '.'), cset), d)
+
+    def download(self, loc, ud, d):
+        """
+        Fetch urls
+        """
+
+        (host, depot, user, pswd, parm) = Perforce.doparse(loc, d)
+
+        if depot.find('/...') != -1:
+            path = depot[:depot.find('/...')]
+        else:
+            path = depot
+
+        module = parm.get('module', os.path.basename(path))
+
+        localdata = data.createCopy(d)
+        data.setVar('OVERRIDES', "p4:%s" % data.getVar('OVERRIDES', localdata), localdata)
+        data.update_data(localdata)
+
+        # Get the p4 command
+        p4opt = ""
+        if user:
+            p4opt += " -u %s" % (user)
+
+        if pswd:
+            p4opt += " -P %s" % (pswd)
+
+        if host:
+            p4opt += " -p %s" % (host)
+
+        p4cmd = data.getVar('FETCHCOMMAND', localdata, True)
+
+        # create temp directory
+        logger.debug(2, "Fetch: creating temporary directory")
+        bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
+        data.setVar('TMPBASE', data.expand('${WORKDIR}/oep4.XXXXXX', localdata), localdata)
+        tmpfile, errors = bb.process.run(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
+        tmpfile = tmpfile.strip()
+        if not tmpfile:
+            raise FetchError("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.", loc)
+
+        if "label" in parm:
+            depot = "%s@%s" % (depot, parm["label"])
+        else:
+            cset = Perforce.getcset(d, depot, host, user, pswd, parm)
+            depot = "%s@%s" % (depot, cset)
+
+        os.chdir(tmpfile)
+        logger.info("Fetch " + loc)
+        logger.info("%s%s files %s", p4cmd, p4opt, depot)
+        p4file, errors = bb.process.run("%s%s files %s" % (p4cmd, p4opt, depot))
+        p4file = [f.rstrip() for f in p4file.splitlines()]
+
+        if not p4file:
+            raise FetchError("Fetch: unable to get the P4 files from %s" % depot, loc)
+
+        count = 0
+
+        for file in p4file:
+            list = file.split()
+
+            if list[2] == "delete":
+                continue
+
+            dest = list[0][len(path)+1:]
+            where = dest.find("#")
+
+            subprocess.call("%s%s print -o %s/%s %s" % (p4cmd, p4opt, module, dest[:where], list[0]), shell=True)
+            count = count + 1
+
+        if count == 0:
+            logger.error()
+            raise FetchError("Fetch: No files gathered from the P4 fetch", loc)
+
+        runfetchcmd("tar -czf %s %s" % (ud.localpath, module), d, cleanup = [ud.localpath])
+        # cleanup
+        bb.utils.prunedir(tmpfile)

bitbake/lib/bb/fetch2/repo.py

@@ -0,0 +1,98 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake "Fetch" repo (git) implementation
+
+"""
+
+# Copyright (C) 2009 Tom Rini <trini@embeddedalley.com>
+#
+# Based on git.py which is:
+#Copyright (C) 2005 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os
+import bb
+from   bb    import data
+from   bb.fetch2 import FetchMethod
+from   bb.fetch2 import runfetchcmd
+
+class Repo(FetchMethod):
+    """Class to fetch a module or modules from repo (git) repositories"""
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with repo.
+        """
+        return ud.type in ["repo"]
+
+    def urldata_init(self, ud, d):
+        """
+        We don"t care about the git rev of the manifests repository, but
+        we do care about the manifest to use.  The default is "default".
+        We also care about the branch or tag to be used.  The default is
+        "master".
+        """
+
+        ud.proto = ud.parm.get('protocol', 'git')
+        ud.branch = ud.parm.get('branch', 'master')
+        ud.manifest = ud.parm.get('manifest', 'default.xml')
+        if not ud.manifest.endswith('.xml'):
+            ud.manifest += '.xml'
+
+        ud.localfile = data.expand("repo_%s%s_%s_%s.tar.gz" % (ud.host, ud.path.replace("/", "."), ud.manifest, ud.branch), d)
+
+    def download(self, loc, ud, d):
+        """Fetch url"""
+
+        if os.access(os.path.join(data.getVar("DL_DIR", d, True), ud.localfile), os.R_OK):
+            logger.debug(1, "%s already exists (or was stashed). Skipping repo init / sync.", ud.localpath)
+            return
+
+        gitsrcname = "%s%s" % (ud.host, ud.path.replace("/", "."))
+        repodir = data.getVar("REPODIR", d, True) or os.path.join(data.getVar("DL_DIR", d, True), "repo")
+        codir = os.path.join(repodir, gitsrcname, ud.manifest)
+
+        if ud.user:
+            username = ud.user + "@"
+        else:
+            username = ""
+
+        bb.utils.mkdirhier(os.path.join(codir, "repo"))
+        os.chdir(os.path.join(codir, "repo"))
+        if not os.path.exists(os.path.join(codir, "repo", ".repo")):
+            bb.fetch2.check_network_access(d, "repo init -m %s -b %s -u %s://%s%s%s" % (ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), ud.url)
+            runfetchcmd("repo init -m %s -b %s -u %s://%s%s%s" % (ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), d)
+
+        bb.fetch2.check_network_access(d, "repo sync %s" % ud.url, ud.url)
+        runfetchcmd("repo sync", d)
+        os.chdir(codir)
+
+        scmdata = ud.parm.get("scmdata", "")
+        if scmdata == "keep":
+            tar_flags = ""
+        else:
+            tar_flags = "--exclude '.repo' --exclude '.git'"
+
+        # Create a cache
+        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.join(".", "*") ), d)
+
+    def supports_srcrev(self):
+        return False
+
+    def _build_revision(self, url, ud, d):
+        return ud.manifest
+
+    def _want_sortable_revision(self, url, ud, d):
+        return False

bitbake/lib/bb/fetch2/sftp.py

@@ -0,0 +1,129 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake SFTP Fetch implementation
+
+Class for fetching files via SFTP. It tries to adhere to the (now
+expired) IETF Internet Draft for "Uniform Resource Identifier (URI)
+Scheme for Secure File Transfer Protocol (SFTP) and Secure Shell
+(SSH)" (SECSH URI).
+
+It uses SFTP (as to adhere to the SECSH URI specification). It only
+supports key based authentication, not password. This class, unlike
+the SSH fetcher, does not support fetching a directory tree from the
+remote.
+
+  http://tools.ietf.org/html/draft-ietf-secsh-scp-sftp-ssh-uri-04
+  https://www.iana.org/assignments/uri-schemes/prov/sftp
+  https://tools.ietf.org/html/draft-ietf-secsh-filexfer-13
+
+Please note that '/' is used as host path seperator, and not ":"
+as you may be used to from the scp/sftp commands. You can use a
+~ (tilde) to specify a path relative to your home directory.
+(The /~user/ syntax, for specyfing a path relative to another
+user's home directory is not supported.) Note that the tilde must
+still follow the host path seperator ("/"). See exampels below.
+
+Example SRC_URIs:
+
+SRC_URI = "sftp://host.example.com/dir/path.file.txt"
+
+A path relative to your home directory.
+
+SRC_URI = "sftp://host.example.com/~/dir/path.file.txt"
+
+You can also specify a username (specyfing password in the
+URI is not supported, use SSH keys to authenticate):
+
+SRC_URI = "sftp://user@host.example.com/dir/path.file.txt"
+
+"""
+
+# Copyright (C) 2013, Olof Johansson <olof.johansson@axis.com>
+#
+# Based in part on bb.fetch2.wget:
+#    Copyright (C) 2003, 2004  Chris Larson
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import os
+import bb
+import urllib
+import commands
+from bb import data
+from bb.fetch2 import URI
+from bb.fetch2 import FetchMethod
+from bb.fetch2 import runfetchcmd
+
+
+class SFTP(FetchMethod):
+    """Class to fetch urls via 'sftp'"""
+
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with sftp.
+        """
+        return ud.type in ['sftp']
+
+    def recommends_checksum(self, urldata):
+        return True
+
+    def urldata_init(self, ud, d):
+        if 'protocol' in ud.parm and ud.parm['protocol'] == 'git':
+            raise bb.fetch2.ParameterError(
+                "Invalid protocol - if you wish to fetch from a " +
+                "git repository using ssh, you need to use the " +
+                "git:// prefix with protocol=ssh", ud.url)
+
+        if 'downloadfilename' in ud.parm:
+            ud.basename = ud.parm['downloadfilename']
+        else:
+            ud.basename = os.path.basename(ud.path)
+
+        ud.localfile = data.expand(urllib.unquote(ud.basename), d)
+
+    def download(self, uri, ud, d):
+        """Fetch urls"""
+
+        urlo = URI(uri)
+        basecmd = 'sftp -oPasswordAuthentication=no'
+        port = ''
+        if urlo.port:
+            port = '-P %d' % urlo.port
+            urlo.port = None
+
+        dldir = data.getVar('DL_DIR', d, True)
+        lpath = os.path.join(dldir, ud.localfile)
+
+        user = ''
+        if urlo.userinfo:
+            user = urlo.userinfo + '@'
+
+        path = urlo.path
+
+        # Supoprt URIs relative to the user's home directory, with
+        # the tilde syntax. (E.g. <sftp://example.com/~/foo.diff>).
+        if path[:3] == '/~/':
+            path = path[3:]
+
+        remote = '%s%s:%s' % (user, urlo.hostname, path)
+
+        cmd = '%s %s %s %s' % (basecmd, port, commands.mkarg(remote),
+                               commands.mkarg(lpath))
+
+        bb.fetch2.check_network_access(d, cmd, uri)
+        runfetchcmd(cmd, d)
+        return True

bitbake/lib/bb/fetch2/ssh.py

@@ -0,0 +1,127 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+'''
+BitBake 'Fetch' implementations
+
+This implementation is for Secure Shell (SSH), and attempts to comply with the
+IETF secsh internet draft:
+    http://tools.ietf.org/wg/secsh/draft-ietf-secsh-scp-sftp-ssh-uri/
+
+    Currently does not support the sftp parameters, as this uses scp
+    Also does not support the 'fingerprint' connection parameter.
+
+    Please note that '/' is used as host, path separator not ':' as you may 
+    be used to, also '~' can be used to specify user HOME, but again after '/'
+    
+    Example SRC_URI:
+    SRC_URI = "ssh://user@host.example.com/dir/path/file.txt"
+    SRC_URI = "ssh://user@host.example.com/~/file.txt"
+'''
+
+# Copyright (C) 2006  OpenedHand Ltd.
+#
+#
+# Based in part on svk.py:
+#    Copyright (C) 2006 Holger Hans Peter Freyther
+#    Based on svn.py:
+#        Copyright (C) 2003, 2004  Chris Larson
+#        Based on functions from the base bb module:
+#            Copyright 2003 Holger Schurig
+#
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import re, os
+from   bb import data
+from   bb.fetch2 import FetchMethod
+from   bb.fetch2 import FetchError
+from   bb.fetch2 import logger
+from   bb.fetch2 import runfetchcmd
+
+
+__pattern__ = re.compile(r'''
+ \s*                 # Skip leading whitespace
+ ssh://              # scheme
+ (                   # Optional username/password block
+  (?P<user>\S+)      # username
+  (:(?P<pass>\S+))?  # colon followed by the password (optional)
+ )?
+ (?P<cparam>(;[^;]+)*)?  # connection parameters block (optional)
+ @
+ (?P<host>\S+?)          # non-greedy match of the host
+ (:(?P<port>[0-9]+))?    # colon followed by the port (optional)
+ /
+ (?P<path>[^;]+)         # path on the remote system, may be absolute or relative,
+                         # and may include the use of '~' to reference the remote home
+                         # directory
+ (?P<sparam>(;[^;]+)*)?  # parameters block (optional)
+ $
+''', re.VERBOSE)
+
+class SSH(FetchMethod):
+    '''Class to fetch a module or modules via Secure Shell'''
+
+    def supports(self, url, urldata, d):
+        return __pattern__.match(url) != None
+
+    def supports_checksum(self, urldata):
+        return False
+
+    def urldata_init(self, urldata, d):
+        if 'protocol' in urldata.parm and urldata.parm['protocol'] == 'git':
+            raise bb.fetch2.ParameterError(
+                "Invalid protocol - if you wish to fetch from a git " +
+                "repository using ssh, you need to use " +
+                "git:// prefix with protocol=ssh", urldata.url)
+        m = __pattern__.match(urldata.url)
+        path = m.group('path')
+        host = m.group('host')
+        urldata.localpath = os.path.join(d.getVar('DL_DIR', True), os.path.basename(path))
+
+    def download(self, url, urldata, d):
+        dldir = d.getVar('DL_DIR', True)
+
+        m = __pattern__.match(url)
+        path = m.group('path')
+        host = m.group('host')
+        port = m.group('port')
+        user = m.group('user')
+        password = m.group('pass')
+
+        if port:
+            portarg = '-P %s' % port
+        else:
+            portarg = ''
+
+        if user:
+            fr = user
+            if password:
+                fr += ':%s' % password
+            fr += '@%s' % host
+        else:
+            fr = host
+        fr += ':%s' % path
+
+
+        import commands
+        cmd = 'scp -B -r %s %s %s/' % (
+            portarg,
+            commands.mkarg(fr),
+            commands.mkarg(dldir)
+        )
+
+        bb.fetch2.check_network_access(d, cmd, urldata.url)
+
+        runfetchcmd(cmd, d)
+

bitbake/lib/bb/fetch2/svk.py

@@ -0,0 +1,97 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Fetch' implementations
+
+This implementation is for svk. It is based on the svn implementation
+
+"""
+
+# Copyright (C) 2006 Holger Hans Peter Freyther
+# Copyright (C) 2003, 2004  Chris Larson
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import os
+import logging
+import bb
+from   bb import data
+from   bb.fetch2 import FetchMethod
+from   bb.fetch2 import FetchError
+from   bb.fetch2 import MissingParameterError
+from   bb.fetch2 import logger
+from   bb.fetch2 import runfetchcmd
+
+class Svk(FetchMethod):
+    """Class to fetch a module or modules from svk repositories"""
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with svk.
+        """
+        return ud.type in ['svk']
+
+    def urldata_init(self, ud, d):
+
+        if not "module" in ud.parm:
+            raise MissingParameterError('module', ud.url)
+        else:
+            ud.module = ud.parm["module"]
+
+        ud.revision = ud.parm.get('rev', "")
+
+        ud.localfile = data.expand('%s_%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision, ud.date), d)
+
+    def need_update(self, url, ud, d):
+        if ud.date == "now":
+            return True
+        if not os.path.exists(ud.localpath):
+            return True
+        return False
+
+    def download(self, loc, ud, d):
+        """Fetch urls"""
+
+        svkroot = ud.host + ud.path
+
+        svkcmd = "svk co -r {%s} %s/%s" % (ud.date, svkroot, ud.module)
+
+        if ud.revision:
+            svkcmd = "svk co -r %s %s/%s" % (ud.revision, svkroot, ud.module)
+
+        # create temp directory
+        localdata = data.createCopy(d)
+        data.update_data(localdata)
+        logger.debug(2, "Fetch: creating temporary directory")
+        bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
+        data.setVar('TMPBASE', data.expand('${WORKDIR}/oesvk.XXXXXX', localdata), localdata)
+        tmpfile, errors = bb.process.run(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
+        tmpfile = tmpfile.strip()
+        if not tmpfile:
+            logger.error()
+            raise FetchError("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.", loc)
+
+        # check out sources there
+        os.chdir(tmpfile)
+        logger.info("Fetch " + loc)
+        logger.debug(1, "Running %s", svkcmd)
+        runfetchcmd(svkcmd, d, cleanup = [tmpfile])
+
+        os.chdir(os.path.join(tmpfile, os.path.dirname(ud.module)))
+        # tar them up to a defined filename
+        runfetchcmd("tar -czf %s %s" % (ud.localpath, os.path.basename(ud.module)), d, cleanup = [ud.localpath])
+
+        # cleanup
+        bb.utils.prunedir(tmpfile)

bitbake/lib/bb/fetch2/svn.py

@@ -0,0 +1,189 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Fetch' implementation for svn.
+
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2004        Marcin Juszkiewicz
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import os
+import sys
+import logging
+import bb
+import re
+from   bb import data
+from   bb.fetch2 import FetchMethod
+from   bb.fetch2 import FetchError
+from   bb.fetch2 import MissingParameterError
+from   bb.fetch2 import runfetchcmd
+from   bb.fetch2 import logger
+
+class Svn(FetchMethod):
+    """Class to fetch a module or modules from svn repositories"""
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with svn.
+        """
+        return ud.type in ['svn']
+
+    def urldata_init(self, ud, d):
+        """
+        init svn specific variable within url data
+        """
+        if not "module" in ud.parm:
+            raise MissingParameterError('module', ud.url)
+
+        ud.basecmd = d.getVar('FETCHCMD_svn', True)
+
+        ud.module = ud.parm["module"]
+
+        # Create paths to svn checkouts
+        relpath = self._strip_leading_slashes(ud.path)
+        ud.pkgdir = os.path.join(data.expand('${SVNDIR}', d), ud.host, relpath)
+        ud.moddir = os.path.join(ud.pkgdir, ud.module)
+
+        ud.setup_revisons(d)
+
+        if 'rev' in ud.parm:
+            ud.revision = ud.parm['rev']
+
+        ud.localfile = data.expand('%s_%s_%s_%s_.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision), d)
+
+    def _buildsvncommand(self, ud, d, command):
+        """
+        Build up an svn commandline based on ud
+        command is "fetch", "update", "info"
+        """
+
+        proto = ud.parm.get('protocol', 'svn')
+
+        svn_rsh = None
+        if proto == "svn+ssh" and "rsh" in ud.parm:
+            svn_rsh = ud.parm["rsh"]
+
+        svnroot = ud.host + ud.path
+
+        options = []
+
+        if ud.user:
+            options.append("--username %s" % ud.user)
+
+        if ud.pswd:
+            options.append("--password %s" % ud.pswd)
+
+        if command == "info":
+            svncmd = "%s info %s %s://%s/%s/" % (ud.basecmd, " ".join(options), proto, svnroot, ud.module)
+        elif command == "log1":
+            svncmd = "%s log --limit 1 %s %s://%s/%s/" % (ud.basecmd, " ".join(options), proto, svnroot, ud.module)
+        else:
+            suffix = ""
+            if ud.revision:
+                options.append("-r %s" % ud.revision)
+                suffix = "@%s" % (ud.revision)
+
+            if command == "fetch":
+                svncmd = "%s co %s %s://%s/%s%s %s" % (ud.basecmd, " ".join(options), proto, svnroot, ud.module, suffix, ud.module)
+            elif command == "update":
+                svncmd = "%s update %s" % (ud.basecmd, " ".join(options))
+            else:
+                raise FetchError("Invalid svn command %s" % command, ud.url)
+
+        if svn_rsh:
+            svncmd = "svn_RSH=\"%s\" %s" % (svn_rsh, svncmd)
+
+        return svncmd
+
+    def download(self, loc, ud, d):
+        """Fetch url"""
+
+        logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
+
+        if os.access(os.path.join(ud.moddir, '.svn'), os.R_OK):
+            svnupdatecmd = self._buildsvncommand(ud, d, "update")
+            logger.info("Update " + loc)
+            # update sources there
+            os.chdir(ud.moddir)
+            # We need to attempt to run svn upgrade first in case its an older working format
+            try:
+                runfetchcmd(ud.basecmd + " upgrade", d)
+            except FetchError:
+                pass
+            logger.debug(1, "Running %s", svnupdatecmd)
+            bb.fetch2.check_network_access(d, svnupdatecmd, ud.url)
+            runfetchcmd(svnupdatecmd, d)
+        else:
+            svnfetchcmd = self._buildsvncommand(ud, d, "fetch")
+            logger.info("Fetch " + loc)
+            # check out sources there
+            bb.utils.mkdirhier(ud.pkgdir)
+            os.chdir(ud.pkgdir)
+            logger.debug(1, "Running %s", svnfetchcmd)
+            bb.fetch2.check_network_access(d, svnfetchcmd, ud.url)
+            runfetchcmd(svnfetchcmd, d)
+
+        scmdata = ud.parm.get("scmdata", "")
+        if scmdata == "keep":
+            tar_flags = ""
+        else:
+            tar_flags = "--exclude '.svn'"
+
+        os.chdir(ud.pkgdir)
+        # tar them up to a defined filename
+        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d, cleanup = [ud.localpath])
+
+    def clean(self, ud, d):
+        """ Clean SVN specific files and dirs """
+
+        bb.utils.remove(ud.localpath)
+        bb.utils.remove(ud.moddir, True)
+        
+
+    def supports_srcrev(self):
+        return True
+
+    def _revision_key(self, url, ud, d, name):
+        """
+        Return a unique key for the url
+        """
+        return "svn:" + ud.moddir
+
+    def _latest_revision(self, url, ud, d, name):
+        """
+        Return the latest upstream revision number
+        """
+        bb.fetch2.check_network_access(d, self._buildsvncommand(ud, d, "log1"))
+
+        output = runfetchcmd("LANG=C LC_ALL=C " + self._buildsvncommand(ud, d, "log1"), d, True)
+
+        # skip the first line, as per output of svn log
+        # then we expect the revision on the 2nd line
+        revision = re.search('^r([0-9]*)', output.splitlines()[1]).group(1)
+
+        return revision
+
+    def _sortable_revision(self, url, ud, d):
+        """
+        Return a sortable revision number which in our case is the revision number
+        """
+
+        return self._build_revision(url, ud, d)
+
+    def _build_revision(self, url, ud, d):
+        return ud.revision

bitbake/lib/bb/fetch2/wget.py

@@ -0,0 +1,97 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'Fetch' implementations
+
+Classes for obtaining upstream sources for the
+BitBake build tools.
+
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import os
+import logging
+import bb
+import urllib
+from   bb import data
+from   bb.fetch2 import FetchMethod
+from   bb.fetch2 import FetchError
+from   bb.fetch2 import logger
+from   bb.fetch2 import runfetchcmd
+
+class Wget(FetchMethod):
+    """Class to fetch urls via 'wget'"""
+    def supports(self, url, ud, d):
+        """
+        Check to see if a given url can be fetched with wget.
+        """
+        return ud.type in ['http', 'https', 'ftp']
+
+    def recommends_checksum(self, urldata):
+        return True
+
+    def urldata_init(self, ud, d):
+        if 'protocol' in ud.parm:
+            if ud.parm['protocol'] == 'git':
+                raise bb.fetch2.ParameterError("Invalid protocol - if you wish to fetch from a git repository using http, you need to instead use the git:// prefix with protocol=http", ud.url)
+
+        if 'downloadfilename' in ud.parm:
+            ud.basename = ud.parm['downloadfilename']
+        else:
+            ud.basename = os.path.basename(ud.path)
+
+        ud.localfile = data.expand(urllib.unquote(ud.basename), d)
+
+    def download(self, uri, ud, d, checkonly = False):
+        """Fetch urls"""
+
+        basecmd = d.getVar("FETCHCMD_wget", True) or "/usr/bin/env wget -t 2 -T 30 -nv --passive-ftp --no-check-certificate"
+
+        if not checkonly and 'downloadfilename' in ud.parm:
+            dldir = d.getVar("DL_DIR", True)
+            bb.utils.mkdirhier(os.path.dirname(dldir + os.sep + ud.localfile))
+            basecmd += " -O " + dldir + os.sep + ud.localfile
+
+        if checkonly:
+            fetchcmd = d.getVar("CHECKCOMMAND_wget", True) or d.expand(basecmd + " --spider '${URI}'")
+        elif os.path.exists(ud.localpath):
+            # file exists, but we didnt complete it.. trying again..
+            fetchcmd = d.getVar("RESUMECOMMAND_wget", True) or d.expand(basecmd + " -c -P ${DL_DIR} '${URI}'")
+        else:
+            fetchcmd = d.getVar("FETCHCOMMAND_wget", True) or d.expand(basecmd + " -P ${DL_DIR} '${URI}'")
+
+        uri = uri.split(";")[0]
+
+        fetchcmd = fetchcmd.replace("${URI}", uri.split(";")[0])
+        fetchcmd = fetchcmd.replace("${FILE}", ud.basename)
+        if not checkonly:
+            logger.info("fetch " + uri)
+            logger.debug(2, "executing " + fetchcmd)
+        bb.fetch2.check_network_access(d, fetchcmd)
+        runfetchcmd(fetchcmd, d, quiet=checkonly)
+
+        # Sanity check since wget can pretend it succeed when it didn't
+        # Also, this used to happen if sourceforge sent us to the mirror page
+        if not os.path.exists(ud.localpath) and not checkonly:
+            raise FetchError("The fetch command returned success for url %s but %s doesn't exist?!" % (uri, ud.localpath), uri)
+
+        return True
+
+    def checkstatus(self, uri, ud, d):
+        return self.download(uri, ud, d, True)

bitbake/lib/bb/methodpool.py

@@ -0,0 +1,28 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+#
+# Copyright (C)       2006 Holger Hans Peter Freyther
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+from bb.utils import better_compile, better_exec
+
+def insert_method(modulename, code, fn):
+    """
+    Add code of a module should be added. The methods
+    will be simply added, no checking will be done
+    """
+    comp = better_compile(code, modulename, fn )
+    better_exec(comp, None, code, fn)

bitbake/lib/bb/monitordisk.py

@@ -0,0 +1,265 @@
+#!/usr/bin/env python
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# Copyright (C) 2012 Robert Yang
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os, logging, re, sys
+import bb
+logger = logging.getLogger("BitBake.Monitor")
+
+def printErr(info):
+    logger.error("%s\n       Disk space monitor will NOT be enabled" % info)
+
+def convertGMK(unit):
+
+    """ Convert the space unit G, M, K, the unit is case-insensitive """
+
+    unitG = re.match('([1-9][0-9]*)[gG]\s?$', unit)
+    if unitG:
+        return int(unitG.group(1)) * (1024 ** 3)
+    unitM = re.match('([1-9][0-9]*)[mM]\s?$', unit)
+    if unitM:
+        return int(unitM.group(1)) * (1024 ** 2)
+    unitK = re.match('([1-9][0-9]*)[kK]\s?$', unit)
+    if unitK:
+        return int(unitK.group(1)) * 1024
+    unitN = re.match('([1-9][0-9]*)\s?$', unit)
+    if unitN:
+        return int(unitN.group(1))
+    else:
+        return None
+
+def getMountedDev(path):
+
+    """ Get the device mounted at the path, uses /proc/mounts """
+
+    # Get the mount point of the filesystem containing path
+    # st_dev is the ID of device containing file
+    parentDev = os.stat(path).st_dev
+    currentDev = parentDev
+    # When the current directory's device is different from the
+    # parrent's, then the current directory is a mount point
+    while parentDev == currentDev:
+        mountPoint = path
+        # Use dirname to get the parrent's directory
+        path = os.path.dirname(path)
+        # Reach the "/"
+        if path == mountPoint:
+            break
+        parentDev= os.stat(path).st_dev
+
+    try:
+        with open("/proc/mounts", "r") as ifp:
+            for line in ifp:
+                procLines = line.rstrip('\n').split()
+                if procLines[1] == mountPoint:
+                    return procLines[0]
+    except EnvironmentError:
+        pass
+    return None
+
+def getDiskData(BBDirs, configuration):
+
+    """Prepare disk data for disk space monitor"""
+
+    # Save the device IDs, need the ID to be unique (the dictionary's key is
+    # unique), so that when more than one directories are located in the same
+    # device, we just monitor it once
+    devDict = {}
+    for pathSpaceInode in BBDirs.split():
+        # The input format is: "dir,space,inode", dir is a must, space
+        # and inode are optional
+        pathSpaceInodeRe = re.match('([^,]*),([^,]*),([^,]*),?(.*)', pathSpaceInode)
+        if not pathSpaceInodeRe:
+            printErr("Invalid value in BB_DISKMON_DIRS: %s" % pathSpaceInode)
+            return None
+
+        action = pathSpaceInodeRe.group(1)
+        if action not in ("ABORT", "STOPTASKS", "WARN"):
+            printErr("Unknown disk space monitor action: %s" % action)
+            return None
+
+        path = os.path.realpath(pathSpaceInodeRe.group(2))
+        if not path:
+            printErr("Invalid path value in BB_DISKMON_DIRS: %s" % pathSpaceInode)
+            return None
+
+        # The disk space or inode is optional, but it should have a correct
+        # value once it is specified
+        minSpace = pathSpaceInodeRe.group(3)
+        if minSpace:
+            minSpace = convertGMK(minSpace)
+            if not minSpace:
+                printErr("Invalid disk space value in BB_DISKMON_DIRS: %s" % pathSpaceInodeRe.group(3))
+                return None
+        else:
+            # None means that it is not specified
+            minSpace = None
+
+        minInode = pathSpaceInodeRe.group(4)
+        if minInode:
+            minInode = convertGMK(minInode)
+            if not minInode:
+                printErr("Invalid inode value in BB_DISKMON_DIRS: %s" % pathSpaceInodeRe.group(4))
+                return None
+        else:
+            # None means that it is not specified
+            minInode = None
+
+        if minSpace is None and minInode is None:
+            printErr("No disk space or inode value in found BB_DISKMON_DIRS: %s" % pathSpaceInode)
+            return None
+        # mkdir for the directory since it may not exist, for example the
+        # DL_DIR may not exist at the very beginning
+        if not os.path.exists(path):
+            bb.utils.mkdirhier(path)
+        dev = getMountedDev(path)
+        # Use path/action as the key
+        devDict[os.path.join(path, action)] = [dev, minSpace, minInode]
+
+    return devDict
+
+def getInterval(configuration):
+
+    """ Get the disk space interval """
+
+    # The default value is 50M and 5K.
+    spaceDefault = 50 * 1024 * 1024
+    inodeDefault = 5 * 1024
+
+    interval = configuration.getVar("BB_DISKMON_WARNINTERVAL", True)
+    if not interval:
+        return spaceDefault, inodeDefault
+    else:
+        # The disk space or inode interval is optional, but it should
+        # have a correct value once it is specified
+        intervalRe = re.match('([^,]*),?\s*(.*)', interval)
+        if intervalRe:
+            intervalSpace = intervalRe.group(1)
+            if intervalSpace:
+                intervalSpace = convertGMK(intervalSpace)
+                if not intervalSpace:
+                    printErr("Invalid disk space interval value in BB_DISKMON_WARNINTERVAL: %s" % intervalRe.group(1))
+                    return None, None
+            else:
+                intervalSpace = spaceDefault
+            intervalInode = intervalRe.group(2)
+            if intervalInode:
+                intervalInode = convertGMK(intervalInode)
+                if not intervalInode:
+                    printErr("Invalid disk inode interval value in BB_DISKMON_WARNINTERVAL: %s" % intervalRe.group(2))
+                    return None, None
+            else:
+                intervalInode = inodeDefault
+            return intervalSpace, intervalInode
+        else:
+            printErr("Invalid interval value in BB_DISKMON_WARNINTERVAL: %s" % interval)
+            return None, None
+
+class diskMonitor:
+
+    """Prepare the disk space monitor data"""
+
+    def __init__(self, configuration):
+
+        self.enableMonitor = False
+        self.configuration = configuration
+
+        BBDirs = configuration.getVar("BB_DISKMON_DIRS", True) or None
+        if BBDirs:
+            self.devDict = getDiskData(BBDirs, configuration)
+            if self.devDict:
+                self.spaceInterval, self.inodeInterval = getInterval(configuration)
+                if self.spaceInterval and self.inodeInterval:
+                    self.enableMonitor = True
+                    # These are for saving the previous disk free space and inode, we
+                    # use them to avoid print too many warning messages
+                    self.preFreeS = {}
+                    self.preFreeI = {}
+                    # This is for STOPTASKS and ABORT, to avoid print the message repeatly
+                    # during waiting the tasks to finish
+                    self.checked = {}
+                    for k in self.devDict:
+                        self.preFreeS[k] = 0
+                        self.preFreeI[k] = 0
+                        self.checked[k] = False
+                    if self.spaceInterval is None and self.inodeInterval is None:
+                        self.enableMonitor = False
+
+    def check(self, rq):
+
+        """ Take action for the monitor """
+
+        if self.enableMonitor:
+            for k in self.devDict:
+                path = os.path.dirname(k)
+                action = os.path.basename(k)
+                dev = self.devDict[k][0]
+                minSpace = self.devDict[k][1]
+                minInode = self.devDict[k][2]
+
+                st = os.statvfs(path)
+
+                # The free space, float point number
+                freeSpace = st.f_bavail * st.f_frsize
+
+                if minSpace and freeSpace < minSpace:
+                    # Always show warning, the self.checked would always be False if the action is WARN
+                    if self.preFreeS[k] == 0 or self.preFreeS[k] - freeSpace > self.spaceInterval and not self.checked[k]:
+                        logger.warn("The free space of %s (%s) is running low (%.3fGB left)" % \
+                                (path, dev, freeSpace / 1024 / 1024 / 1024.0))
+                        self.preFreeS[k] = freeSpace
+
+                    if action == "STOPTASKS" and not self.checked[k]:
+                        logger.error("No new tasks can be excuted since the disk space monitor action is \"STOPTASKS\"!")
+                        self.checked[k] = True
+                        rq.finish_runqueue(False)
+                        bb.event.fire(bb.event.DiskFull(dev, 'disk', freeSpace, path), self.configuration)
+                    elif action == "ABORT" and not self.checked[k]:
+                        logger.error("Immediately abort since the disk space monitor action is \"ABORT\"!")
+                        self.checked[k] = True
+                        rq.finish_runqueue(True)
+                        bb.event.fire(bb.event.DiskFull(dev, 'disk', freeSpace, path), self.configuration)
+
+                # The free inodes, float point number
+                freeInode = st.f_favail
+
+                if minInode and freeInode < minInode:
+                    # Some fs formats' (e.g., btrfs) statvfs.f_files (inodes) is
+                    # zero, this is a feature of the fs, we disable the inode
+                    # checking for such a fs.
+                    if st.f_files == 0:
+                        logger.warn("Inode check for %s is unavaliable, will remove it from disk monitor" % path)
+                        self.devDict[k][2] = None
+                        continue
+                    # Always show warning, the self.checked would always be False if the action is WARN
+                    if self.preFreeI[k] == 0 or self.preFreeI[k] - freeInode > self.inodeInterval and not self.checked[k]:
+                        logger.warn("The free inode of %s (%s) is running low (%.3fK left)" % \
+                                (path, dev, freeInode / 1024.0))
+                        self.preFreeI[k] = freeInode
+
+                    if action  == "STOPTASKS" and not self.checked[k]:
+                        logger.error("No new tasks can be excuted since the disk space monitor action is \"STOPTASKS\"!")
+                        self.checked[k] = True
+                        rq.finish_runqueue(False)
+                        bb.event.fire(bb.event.DiskFull(dev, 'inode', freeInode, path), self.configuration)
+                    elif action  == "ABORT" and not self.checked[k]:
+                        logger.error("Immediately abort since the disk space monitor action is \"ABORT\"!")
+                        self.checked[k] = True
+                        rq.finish_runqueue(True)
+                        bb.event.fire(bb.event.DiskFull(dev, 'inode', freeInode, path), self.configuration)
+        return

bitbake/lib/bb/msg.py

@@ -0,0 +1,179 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'msg' implementation
+
+Message handling infrastructure for bitbake
+
+"""
+
+# Copyright (C) 2006        Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import sys
+import copy
+import logging
+import collections
+from itertools import groupby
+import warnings
+import bb
+import bb.event
+
+class BBLogFormatter(logging.Formatter):
+    """Formatter which ensures that our 'plain' messages (logging.INFO + 1) are used as is"""
+
+    DEBUG3 = logging.DEBUG - 2
+    DEBUG2 = logging.DEBUG - 1
+    DEBUG = logging.DEBUG
+    VERBOSE = logging.INFO - 1
+    NOTE = logging.INFO
+    PLAIN = logging.INFO + 1
+    ERROR = logging.ERROR
+    WARNING = logging.WARNING
+    CRITICAL = logging.CRITICAL
+
+    levelnames = {
+        DEBUG3   : 'DEBUG',
+        DEBUG2   : 'DEBUG',
+        DEBUG   : 'DEBUG',
+        VERBOSE: 'NOTE',
+        NOTE    : 'NOTE',
+        PLAIN  : '',
+        WARNING : 'WARNING',
+        ERROR   : 'ERROR',
+        CRITICAL: 'ERROR',
+    }
+
+    color_enabled = False
+    BASECOLOR, BLACK, RED, GREEN, YELLOW, BLUE, MAGENTA, CYAN, WHITE = range(29,38)
+
+    COLORS = {
+        DEBUG3  : CYAN,
+        DEBUG2  : CYAN,
+        DEBUG   : CYAN,
+        VERBOSE : BASECOLOR,
+        NOTE    : BASECOLOR,
+        PLAIN   : BASECOLOR,
+        WARNING : YELLOW,
+        ERROR   : RED,
+        CRITICAL: RED,
+    }
+
+    BLD = '\033[1;%dm'
+    STD = '\033[%dm'
+    RST = '\033[0m'
+
+    def getLevelName(self, levelno):
+        try:
+            return self.levelnames[levelno]
+        except KeyError:
+            self.levelnames[levelno] = value = 'Level %d' % levelno
+            return value
+
+    def format(self, record):
+        record.levelname = self.getLevelName(record.levelno)
+        if record.levelno == self.PLAIN:
+            msg = record.getMessage()
+        else:
+            if self.color_enabled:
+                record = self.colorize(record)
+            msg = logging.Formatter.format(self, record)
+
+        if hasattr(record, 'bb_exc_info'):
+            etype, value, tb = record.bb_exc_info
+            formatted = bb.exceptions.format_exception(etype, value, tb, limit=5)
+            msg += '\n' + ''.join(formatted)
+        return msg
+
+    def colorize(self, record):
+        color = self.COLORS[record.levelno]
+        if self.color_enabled and color is not None:
+            record = copy.copy(record)
+            record.levelname = "".join([self.BLD % color, record.levelname, self.RST])
+            record.msg = "".join([self.STD % color, record.msg, self.RST])
+        return record
+
+    def enable_color(self):
+        self.color_enabled = True
+
+class BBLogFilter(object):
+    def __init__(self, handler, level, debug_domains):
+        self.stdlevel = level
+        self.debug_domains = debug_domains
+        loglevel = level
+        for domain in debug_domains:
+            if debug_domains[domain] < loglevel:
+                loglevel = debug_domains[domain]
+        handler.setLevel(loglevel)
+        handler.addFilter(self)
+
+    def filter(self, record):
+        if record.levelno >= self.stdlevel:
+            return True
+        if record.name in self.debug_domains and record.levelno >= self.debug_domains[record.name]:
+            return True
+        return False
+
+
+
+# Message control functions
+#
+
+loggerDefaultDebugLevel = 0
+loggerDefaultVerbose = False
+loggerVerboseLogs = False
+loggerDefaultDomains = []
+
+def init_msgconfig(verbose, debug, debug_domains = []):
+    """
+    Set default verbosity and debug levels config the logger
+    """
+    bb.msg.loggerDefaultDebugLevel = debug
+    bb.msg.loggerDefaultVerbose = verbose
+    if verbose:
+        bb.msg.loggerVerboseLogs = True
+    bb.msg.loggerDefaultDomains = debug_domains
+
+def addDefaultlogFilter(handler):
+
+    debug = loggerDefaultDebugLevel
+    verbose = loggerDefaultVerbose
+    domains = loggerDefaultDomains
+
+    if debug:
+        level = BBLogFormatter.DEBUG - debug + 1
+    elif verbose:
+        level = BBLogFormatter.VERBOSE
+    else:
+        level = BBLogFormatter.NOTE
+
+    debug_domains = {}
+    for (domainarg, iterator) in groupby(domains):
+        dlevel = len(tuple(iterator))
+        debug_domains["BitBake.%s" % domainarg] = logging.DEBUG - dlevel + 1
+
+    BBLogFilter(handler, level, debug_domains)
+
+#
+# Message handling functions
+#
+
+def fatal(msgdomain, msg):
+    if msgdomain:
+        logger = logging.getLogger("BitBake.%s" % msgdomain)
+    else:
+        logger = logging.getLogger("BitBake")
+    logger.critical(msg)
+    sys.exit(1)

bitbake/lib/bb/namedtuple_with_abc.py

@@ -0,0 +1,255 @@
+# http://code.activestate.com/recipes/577629-namedtupleabc-abstract-base-class-mix-in-for-named/
+#!/usr/bin/env python
+# Copyright (c) 2011 Jan Kaliszewski (zuo). Available under the MIT License.
+
+"""
+namedtuple_with_abc.py:
+* named tuple mix-in + ABC (abstract base class) recipe,
+* works under Python 2.6, 2.7 as well as 3.x.
+
+Import this module to patch collections.namedtuple() factory function
+-- enriching it with the 'abc' attribute (an abstract base class + mix-in
+for named tuples) and decorating it with a wrapper that registers each
+newly created named tuple as a subclass of namedtuple.abc.
+
+How to import:
+    import collections, namedtuple_with_abc
+or:
+    import namedtuple_with_abc
+    from collections import namedtuple
+    # ^ in this variant you must import namedtuple function
+    #   *after* importing namedtuple_with_abc module
+or simply:
+    from namedtuple_with_abc import namedtuple
+
+Simple usage example:
+    class Credentials(namedtuple.abc):
+        _fields = 'username password'
+        def __str__(self):
+            return ('{0.__class__.__name__}'
+                    '(username={0.username}, password=...)'.format(self))
+    print(Credentials("alice", "Alice's password"))
+
+For more advanced examples -- see below the "if __name__ == '__main__':".
+"""
+
+import collections
+from abc import ABCMeta, abstractproperty
+from functools import wraps
+from sys import version_info
+
+__all__ = ('namedtuple',)
+_namedtuple = collections.namedtuple
+
+
+class _NamedTupleABCMeta(ABCMeta):
+    '''The metaclass for the abstract base class + mix-in for named tuples.'''
+    def __new__(mcls, name, bases, namespace):
+        fields = namespace.get('_fields')
+        for base in bases:
+            if fields is not None:
+                break
+            fields = getattr(base, '_fields', None)
+        if not isinstance(fields, abstractproperty):
+            basetuple = _namedtuple(name, fields)
+            bases = (basetuple,) + bases
+            namespace.pop('_fields', None)
+            namespace.setdefault('__doc__', basetuple.__doc__)
+            namespace.setdefault('__slots__', ())
+        return ABCMeta.__new__(mcls, name, bases, namespace)
+
+
+exec(
+    # Python 2.x metaclass declaration syntax
+    """class _NamedTupleABC(object):
+        '''The abstract base class + mix-in for named tuples.'''
+        __metaclass__ = _NamedTupleABCMeta
+        _fields = abstractproperty()""" if version_info[0] < 3 else
+    # Python 3.x metaclass declaration syntax
+    """class _NamedTupleABC(metaclass=_NamedTupleABCMeta):
+        '''The abstract base class + mix-in for named tuples.'''
+        _fields = abstractproperty()"""
+)
+
+
+_namedtuple.abc = _NamedTupleABC
+#_NamedTupleABC.register(type(version_info))  # (and similar, in the future...)
+
+@wraps(_namedtuple)
+def namedtuple(*args, **kwargs):
+    '''Named tuple factory with namedtuple.abc subclass registration.'''
+    cls = _namedtuple(*args, **kwargs)
+    _NamedTupleABC.register(cls)
+    return cls
+
+collections.namedtuple = namedtuple
+
+
+
+
+if __name__ == '__main__':
+
+    '''Examples and explanations'''
+
+    # Simple usage
+
+    class MyRecord(namedtuple.abc):
+        _fields = 'x y z'  # such form will be transformed into ('x', 'y', 'z')
+        def _my_custom_method(self):
+            return list(self._asdict().items())
+    # (the '_fields' attribute belongs to the named tuple public API anyway)
+
+    rec = MyRecord(1, 2, 3)
+    print(rec)
+    print(rec._my_custom_method())
+    print(rec._replace(y=222))
+    print(rec._replace(y=222)._my_custom_method())
+
+    # Custom abstract classes...
+
+    class MyAbstractRecord(namedtuple.abc):
+        def _my_custom_method(self):
+            return list(self._asdict().items())
+
+    try:
+        MyAbstractRecord()  # (abstract classes cannot be instantiated)
+    except TypeError as exc:
+        print(exc)
+
+    class AnotherAbstractRecord(MyAbstractRecord):
+        def __str__(self):
+            return '<<<{0}>>>'.format(super(AnotherAbstractRecord,
+                                            self).__str__())
+
+    # ...and their non-abstract subclasses
+
+    class MyRecord2(MyAbstractRecord):
+        _fields = 'a, b'
+
+    class MyRecord3(AnotherAbstractRecord):
+        _fields = 'p', 'q', 'r'
+
+    rec2 = MyRecord2('foo', 'bar')
+    print(rec2)
+    print(rec2._my_custom_method())
+    print(rec2._replace(b=222))
+    print(rec2._replace(b=222)._my_custom_method())
+
+    rec3 = MyRecord3('foo', 'bar', 'baz')
+    print(rec3)
+    print(rec3._my_custom_method())
+    print(rec3._replace(q=222))
+    print(rec3._replace(q=222)._my_custom_method())
+
+   # You can also subclass non-abstract ones...
+
+    class MyRecord33(MyRecord3):
+        def __str__(self):
+            return '< {0!r}, ..., {0!r} >'.format(self.p, self.r)
+
+    rec33 = MyRecord33('foo', 'bar', 'baz')
+    print(rec33)
+    print(rec33._my_custom_method())
+    print(rec33._replace(q=222))
+    print(rec33._replace(q=222)._my_custom_method())
+
+    # ...and even override the magic '_fields' attribute again
+
+    class MyRecord345(MyRecord3):
+        _fields = 'e f g h i j k'
+
+    rec345 = MyRecord345(1, 2, 3, 4, 3, 2, 1)
+    print(rec345)
+    print(rec345._my_custom_method())
+    print(rec345._replace(f=222))
+    print(rec345._replace(f=222)._my_custom_method())
+
+    # Mixing-in some other classes is also possible:
+
+    class MyMixIn(object):
+        def method(self):
+            return "MyMixIn.method() called"
+        def _my_custom_method(self):
+            return "MyMixIn._my_custom_method() called"
+        def count(self, item):
+            return "MyMixIn.count({0}) called".format(item)
+        def _asdict(self):  # (cannot override a namedtuple method, see below)
+            return "MyMixIn._asdict() called"
+
+    class MyRecord4(MyRecord33, MyMixIn):  # mix-in on the right
+        _fields = 'j k l x'
+
+    class MyRecord5(MyMixIn, MyRecord33):  # mix-in on the left
+        _fields = 'j k l x y'
+
+    rec4 = MyRecord4(1, 2, 3, 2)
+    print(rec4)
+    print(rec4.method())
+    print(rec4._my_custom_method())  # MyRecord33's
+    print(rec4.count(2))  # tuple's
+    print(rec4._replace(k=222))
+    print(rec4._replace(k=222).method())
+    print(rec4._replace(k=222)._my_custom_method())  # MyRecord33's
+    print(rec4._replace(k=222).count(8))  # tuple's
+
+    rec5 = MyRecord5(1, 2, 3, 2, 1)
+    print(rec5)
+    print(rec5.method())
+    print(rec5._my_custom_method())  # MyMixIn's
+    print(rec5.count(2))  # MyMixIn's
+    print(rec5._replace(k=222))
+    print(rec5._replace(k=222).method())
+    print(rec5._replace(k=222)._my_custom_method())  # MyMixIn's
+    print(rec5._replace(k=222).count(2))  # MyMixIn's
+
+    # None that behavior: the standard namedtuple methods cannot be
+    # overriden by a foreign mix-in -- even if the mix-in is declared
+    # as the leftmost base class (but, obviously, you can override them
+    # in the defined class or its subclasses):
+
+    print(rec4._asdict())  # (returns a dict, not "MyMixIn._asdict() called")
+    print(rec5._asdict())  # (returns a dict, not "MyMixIn._asdict() called")
+
+    class MyRecord6(MyRecord33):
+        _fields = 'j k l x y z'
+        def _asdict(self):
+            return "MyRecord6._asdict() called"
+    rec6 = MyRecord6(1, 2, 3, 1, 2, 3)
+    print(rec6._asdict())  # (this returns "MyRecord6._asdict() called")
+
+    # All that record classes are real subclasses of namedtuple.abc:
+
+    assert issubclass(MyRecord, namedtuple.abc)
+    assert issubclass(MyAbstractRecord, namedtuple.abc)
+    assert issubclass(AnotherAbstractRecord, namedtuple.abc)
+    assert issubclass(MyRecord2, namedtuple.abc)
+    assert issubclass(MyRecord3, namedtuple.abc)
+    assert issubclass(MyRecord33, namedtuple.abc)
+    assert issubclass(MyRecord345, namedtuple.abc)
+    assert issubclass(MyRecord4, namedtuple.abc)
+    assert issubclass(MyRecord5, namedtuple.abc)
+    assert issubclass(MyRecord6, namedtuple.abc)
+
+    # ...but abstract ones are not subclasses of tuple
+    # (and this is what you probably want):
+
+    assert not issubclass(MyAbstractRecord, tuple)
+    assert not issubclass(AnotherAbstractRecord, tuple)
+
+    assert issubclass(MyRecord, tuple)
+    assert issubclass(MyRecord2, tuple)
+    assert issubclass(MyRecord3, tuple)
+    assert issubclass(MyRecord33, tuple)
+    assert issubclass(MyRecord345, tuple)
+    assert issubclass(MyRecord4, tuple)
+    assert issubclass(MyRecord5, tuple)
+    assert issubclass(MyRecord6, tuple)
+
+    # Named tuple classes created with namedtuple() factory function
+    # (in the "traditional" way) are registered as "virtual" subclasses
+    # of namedtuple.abc:
+
+    MyTuple = namedtuple('MyTuple', 'a b c')
+    mt = MyTuple(1, 2, 3)
+    assert issubclass(MyTuple, namedtuple.abc)
+    assert isinstance(mt, namedtuple.abc)

bitbake/lib/bb/parse/__init__.py

@@ -0,0 +1,143 @@
+"""
+BitBake Parsers
+
+File parsers for the BitBake build tools.
+
+"""
+
+
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2003, 2004  Phil Blundell
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+handlers = []
+
+import os
+import stat
+import logging
+import bb
+import bb.utils
+import bb.siggen
+
+logger = logging.getLogger("BitBake.Parsing")
+
+class ParseError(Exception):
+    """Exception raised when parsing fails"""
+    def __init__(self, msg, filename, lineno=0):
+        self.msg = msg
+        self.filename = filename
+        self.lineno = lineno
+        Exception.__init__(self, msg, filename, lineno)
+
+    def __str__(self):
+        if self.lineno:
+            return "ParseError at %s:%d: %s" % (self.filename, self.lineno, self.msg)
+        else:
+            return "ParseError in %s: %s" % (self.filename, self.msg)
+
+class SkipPackage(Exception):
+    """Exception raised to skip this package"""
+
+__mtime_cache = {}
+def cached_mtime(f):
+    if f not in __mtime_cache:
+        __mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
+    return __mtime_cache[f]
+
+def cached_mtime_noerror(f):
+    if f not in __mtime_cache:
+        try:
+            __mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
+        except OSError:
+            return 0
+    return __mtime_cache[f]
+
+def update_mtime(f):
+    __mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
+    return __mtime_cache[f]
+
+def mark_dependency(d, f):
+    if f.startswith('./'):
+        f = "%s/%s" % (os.getcwd(), f[2:])
+    deps = (d.getVar('__depends') or []) + [(f, cached_mtime(f))]
+    d.setVar('__depends', deps)
+
+def supports(fn, data):
+    """Returns true if we have a handler for this file, false otherwise"""
+    for h in handlers:
+        if h['supports'](fn, data):
+            return 1
+    return 0
+
+def handle(fn, data, include = 0):
+    """Call the handler that is appropriate for this file"""
+    for h in handlers:
+        if h['supports'](fn, data):
+            with data.inchistory.include(fn):
+                return h['handle'](fn, data, include)
+    raise ParseError("not a BitBake file", fn)
+
+def init(fn, data):
+    for h in handlers:
+        if h['supports'](fn):
+            return h['init'](data)
+
+def init_parser(d):
+    bb.parse.siggen = bb.siggen.init(d)
+
+def resolve_file(fn, d):
+    if not os.path.isabs(fn):
+        bbpath = d.getVar("BBPATH", True)
+        newfn = bb.utils.which(bbpath, fn)
+        if not newfn:
+            raise IOError("file %s not found in %s" % (fn, bbpath))
+        fn = newfn
+
+    logger.debug(2, "LOAD %s", fn)
+    return fn
+
+# Used by OpenEmbedded metadata
+__pkgsplit_cache__={}
+def vars_from_file(mypkg, d):
+    if not mypkg:
+        return (None, None, None)
+    if mypkg in __pkgsplit_cache__:
+        return __pkgsplit_cache__[mypkg]
+
+    myfile = os.path.splitext(os.path.basename(mypkg))
+    parts = myfile[0].split('_')
+    __pkgsplit_cache__[mypkg] = parts
+    if len(parts) > 3:
+        raise ParseError("Unable to generate default variables from filename (too many underscores)", mypkg)
+    exp = 3 - len(parts)
+    tmplist = []
+    while exp != 0:
+        exp -= 1
+        tmplist.append(None)
+    parts.extend(tmplist)
+    return parts
+
+def get_file_depends(d):
+    '''Return the dependent files'''
+    dep_files = []
+    depends = d.getVar('__base_depends', True) or []
+    depends = depends + (d.getVar('__depends', True) or [])
+    for (fn, _) in depends:
+        dep_files.append(os.path.abspath(fn))
+    return " ".join(dep_files)
+
+from bb.parse.parse_py import __version__, ConfHandler, BBHandler

bitbake/lib/bb/parse/ast.py

@@ -0,0 +1,483 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+ AbstractSyntaxTree classes for the Bitbake language
+"""
+
+# Copyright (C) 2003, 2004 Chris Larson
+# Copyright (C) 2003, 2004 Phil Blundell
+# Copyright (C) 2009 Holger Hans Peter Freyther
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+from __future__ import absolute_import
+from future_builtins import filter
+import re
+import string
+import logging
+import bb
+import itertools
+from bb import methodpool
+from bb.parse import logger
+
+_bbversions_re = re.compile(r"\[(?P<from>[0-9]+)-(?P<to>[0-9]+)\]")
+
+class StatementGroup(list):
+    def eval(self, data):
+        for statement in self:
+            statement.eval(data)
+
+class AstNode(object):
+    def __init__(self, filename, lineno):
+        self.filename = filename
+        self.lineno = lineno
+
+class IncludeNode(AstNode):
+    def __init__(self, filename, lineno, what_file, force):
+        AstNode.__init__(self, filename, lineno)
+        self.what_file = what_file
+        self.force = force
+
+    def eval(self, data):
+        """
+        Include the file and evaluate the statements
+        """
+        s = data.expand(self.what_file)
+        logger.debug(2, "CONF %s:%s: including %s", self.filename, self.lineno, s)
+
+        # TODO: Cache those includes... maybe not here though
+        if self.force:
+            bb.parse.ConfHandler.include(self.filename, s, self.lineno, data, "include required")
+        else:
+            bb.parse.ConfHandler.include(self.filename, s, self.lineno, data, False)
+
+class ExportNode(AstNode):
+    def __init__(self, filename, lineno, var):
+        AstNode.__init__(self, filename, lineno)
+        self.var = var
+
+    def eval(self, data):
+        data.setVarFlag(self.var, "export", 1, op = 'exported')
+
+class DataNode(AstNode):
+    """
+    Various data related updates. For the sake of sanity
+    we have one class doing all this. This means that all
+    this need to be re-evaluated... we might be able to do
+    that faster with multiple classes.
+    """
+    def __init__(self, filename, lineno, groupd):
+        AstNode.__init__(self, filename, lineno)
+        self.groupd = groupd
+
+    def getFunc(self, key, data):
+        if 'flag' in self.groupd and self.groupd['flag'] != None:
+            return data.getVarFlag(key, self.groupd['flag'], noweakdefault=True)
+        else:
+            return data.getVar(key, noweakdefault=True)
+
+    def eval(self, data):
+        groupd = self.groupd
+        key = groupd["var"]
+        loginfo = {
+            'variable': key,
+            'file': self.filename,
+            'line': self.lineno,
+        }
+        if "exp" in groupd and groupd["exp"] != None:
+            data.setVarFlag(key, "export", 1, op = 'exported', **loginfo)
+
+        op = "set"
+        if "ques" in groupd and groupd["ques"] != None:
+            val = self.getFunc(key, data)
+            op = "set?"
+            if val == None:
+                val = groupd["value"]
+        elif "colon" in groupd and groupd["colon"] != None:
+            e = data.createCopy()
+            bb.data.update_data(e)
+            op = "immediate"
+            val = e.expand(groupd["value"], key + "[:=]")
+        elif "append" in groupd and groupd["append"] != None:
+            op = "append"
+            val = "%s %s" % ((self.getFunc(key, data) or ""), groupd["value"])
+        elif "prepend" in groupd and groupd["prepend"] != None:
+            op = "prepend"
+            val = "%s %s" % (groupd["value"], (self.getFunc(key, data) or ""))
+        elif "postdot" in groupd and groupd["postdot"] != None:
+            op = "postdot"
+            val = "%s%s" % ((self.getFunc(key, data) or ""), groupd["value"])
+        elif "predot" in groupd and groupd["predot"] != None:
+            op = "predot"
+            val = "%s%s" % (groupd["value"], (self.getFunc(key, data) or ""))
+        else:
+            val = groupd["value"]
+
+        flag = None
+        if 'flag' in groupd and groupd['flag'] != None:
+            flag = groupd['flag']
+        elif groupd["lazyques"]:
+            flag = "defaultval"
+
+        loginfo['op'] = op
+        loginfo['detail'] = groupd["value"]
+
+        if flag:
+            data.setVarFlag(key, flag, val, **loginfo)
+        else:
+            data.setVar(key, val, **loginfo)
+
+class MethodNode(AstNode):
+    def __init__(self, filename, lineno, func_name, body):
+        AstNode.__init__(self, filename, lineno)
+        self.func_name = func_name
+        self.body = body
+
+    def eval(self, data):
+        text = '\n'.join(self.body)
+        if self.func_name == "__anonymous":
+            funcname = ("__anon_%s_%s" % (self.lineno, self.filename.translate(string.maketrans('/.+-', '____'))))
+            text = "def %s(d):\n" % (funcname) + text
+            bb.methodpool.insert_method(funcname, text, self.filename)
+            anonfuncs = data.getVar('__BBANONFUNCS') or []
+            anonfuncs.append(funcname)
+            data.setVar('__BBANONFUNCS', anonfuncs)
+            data.setVar(funcname, text)
+        else:
+            data.setVarFlag(self.func_name, "func", 1)
+            data.setVar(self.func_name, text)
+
+class PythonMethodNode(AstNode):
+    def __init__(self, filename, lineno, function, modulename, body):
+        AstNode.__init__(self, filename, lineno)
+        self.function = function
+        self.modulename = modulename
+        self.body = body
+
+    def eval(self, data):
+        # Note we will add root to parsedmethods after having parse
+        # 'this' file. This means we will not parse methods from
+        # bb classes twice
+        text = '\n'.join(self.body)
+        bb.methodpool.insert_method(self.modulename, text, self.filename)
+        data.setVarFlag(self.function, "func", 1)
+        data.setVarFlag(self.function, "python", 1)
+        data.setVar(self.function, text)
+
+class MethodFlagsNode(AstNode):
+    def __init__(self, filename, lineno, key, m):
+        AstNode.__init__(self, filename, lineno)
+        self.key = key
+        self.m = m
+
+    def eval(self, data):
+        if data.getVar(self.key):
+            # clean up old version of this piece of metadata, as its
+            # flags could cause problems
+            data.setVarFlag(self.key, 'python', None)
+            data.setVarFlag(self.key, 'fakeroot', None)
+        if self.m.group("py") is not None:
+            data.setVarFlag(self.key, "python", "1")
+        else:
+            data.delVarFlag(self.key, "python")
+        if self.m.group("fr") is not None:
+            data.setVarFlag(self.key, "fakeroot", "1")
+        else:
+            data.delVarFlag(self.key, "fakeroot")
+
+class ExportFuncsNode(AstNode):
+    def __init__(self, filename, lineno, fns, classname):
+        AstNode.__init__(self, filename, lineno)
+        self.n = fns.split()
+        self.classname = classname
+
+    def eval(self, data):
+
+        for func in self.n:
+            calledfunc = self.classname + "_" + func
+
+            if data.getVar(func) and not data.getVarFlag(func, 'export_func'):
+                continue
+
+            if data.getVar(func):
+                data.setVarFlag(func, 'python', None)
+                data.setVarFlag(func, 'func', None)
+
+            for flag in [ "func", "python" ]:
+                if data.getVarFlag(calledfunc, flag):
+                    data.setVarFlag(func, flag, data.getVarFlag(calledfunc, flag))
+            for flag in [ "dirs" ]:
+                if data.getVarFlag(func, flag):
+                    data.setVarFlag(calledfunc, flag, data.getVarFlag(func, flag))
+
+            if data.getVarFlag(calledfunc, "python"):
+                data.setVar(func, "    bb.build.exec_func('" + calledfunc + "', d)\n")
+            else:
+                data.setVar(func, "    " + calledfunc + "\n")
+            data.setVarFlag(func, 'export_func', '1')
+
+class AddTaskNode(AstNode):
+    def __init__(self, filename, lineno, func, before, after):
+        AstNode.__init__(self, filename, lineno)
+        self.func = func
+        self.before = before
+        self.after = after
+
+    def eval(self, data):
+        var = self.func
+        if self.func[:3] != "do_":
+            var = "do_" + self.func
+
+        data.setVarFlag(var, "task", 1)
+        bbtasks = data.getVar('__BBTASKS') or []
+        if not var in bbtasks:
+            bbtasks.append(var)
+        data.setVar('__BBTASKS', bbtasks)
+
+        existing = data.getVarFlag(var, "deps") or []
+        if self.after is not None:
+            # set up deps for function
+            for entry in self.after.split():
+                if entry not in existing:
+                    existing.append(entry)
+        data.setVarFlag(var, "deps", existing)
+        if self.before is not None:
+            # set up things that depend on this func
+            for entry in self.before.split():
+                existing = data.getVarFlag(entry, "deps") or []
+                if var not in existing:
+                    data.setVarFlag(entry, "deps", [var] + existing)
+
+class BBHandlerNode(AstNode):
+    def __init__(self, filename, lineno, fns):
+        AstNode.__init__(self, filename, lineno)
+        self.hs = fns.split()
+
+    def eval(self, data):
+        bbhands = data.getVar('__BBHANDLERS') or []
+        for h in self.hs:
+            bbhands.append(h)
+            data.setVarFlag(h, "handler", 1)
+        data.setVar('__BBHANDLERS', bbhands)
+
+class InheritNode(AstNode):
+    def __init__(self, filename, lineno, classes):
+        AstNode.__init__(self, filename, lineno)
+        self.classes = classes
+
+    def eval(self, data):
+        bb.parse.BBHandler.inherit(self.classes, self.filename, self.lineno, data)
+
+def handleInclude(statements, filename, lineno, m, force):
+    statements.append(IncludeNode(filename, lineno, m.group(1), force))
+
+def handleExport(statements, filename, lineno, m):
+    statements.append(ExportNode(filename, lineno, m.group(1)))
+
+def handleData(statements, filename, lineno, groupd):
+    statements.append(DataNode(filename, lineno, groupd))
+
+def handleMethod(statements, filename, lineno, func_name, body):
+    statements.append(MethodNode(filename, lineno, func_name, body))
+
+def handlePythonMethod(statements, filename, lineno, funcname, modulename, body):
+    statements.append(PythonMethodNode(filename, lineno, funcname, modulename, body))
+
+def handleMethodFlags(statements, filename, lineno, key, m):
+    statements.append(MethodFlagsNode(filename, lineno, key, m))
+
+def handleExportFuncs(statements, filename, lineno, m, classname):
+    statements.append(ExportFuncsNode(filename, lineno, m.group(1), classname))
+
+def handleAddTask(statements, filename, lineno, m):
+    func = m.group("func")
+    before = m.group("before")
+    after = m.group("after")
+    if func is None:
+        return
+
+    statements.append(AddTaskNode(filename, lineno, func, before, after))
+
+def handleBBHandlers(statements, filename, lineno, m):
+    statements.append(BBHandlerNode(filename, lineno, m.group(1)))
+
+def handleInherit(statements, filename, lineno, m):
+    classes = m.group(1)
+    statements.append(InheritNode(filename, lineno, classes))
+
+def finalize(fn, d, variant = None):
+    all_handlers = {}
+    for var in d.getVar('__BBHANDLERS') or []:
+        # try to add the handler
+        handler = d.getVar(var)
+        bb.event.register(var, handler)
+
+    bb.event.fire(bb.event.RecipePreFinalise(fn), d)
+
+    bb.data.expandKeys(d)
+    bb.data.update_data(d)
+    code = []
+    for funcname in d.getVar("__BBANONFUNCS") or []:
+        code.append("%s(d)" % funcname)
+    bb.utils.better_exec("\n".join(code), {"d": d})
+    bb.data.update_data(d)
+
+    tasklist = d.getVar('__BBTASKS') or []
+    bb.build.add_tasks(tasklist, d)
+
+    bb.parse.siggen.finalise(fn, d, variant)
+
+    d.setVar('BBINCLUDED', bb.parse.get_file_depends(d))
+
+    bb.event.fire(bb.event.RecipeParsed(fn), d)
+
+def _create_variants(datastores, names, function):
+    def create_variant(name, orig_d, arg = None):
+        new_d = bb.data.createCopy(orig_d)
+        function(arg or name, new_d)
+        datastores[name] = new_d
+
+    for variant, variant_d in datastores.items():
+        for name in names:
+            if not variant:
+                # Based on main recipe
+                create_variant(name, variant_d)
+            else:
+                create_variant("%s-%s" % (variant, name), variant_d, name)
+
+def _expand_versions(versions):
+    def expand_one(version, start, end):
+        for i in xrange(start, end + 1):
+            ver = _bbversions_re.sub(str(i), version, 1)
+            yield ver
+
+    versions = iter(versions)
+    while True:
+        try:
+            version = next(versions)
+        except StopIteration:
+            break
+
+        range_ver = _bbversions_re.search(version)
+        if not range_ver:
+            yield version
+        else:
+            newversions = expand_one(version, int(range_ver.group("from")),
+                                     int(range_ver.group("to")))
+            versions = itertools.chain(newversions, versions)
+
+def multi_finalize(fn, d):
+    appends = (d.getVar("__BBAPPEND", True) or "").split()
+    for append in appends:
+        logger.debug(2, "Appending .bbappend file %s to %s", append, fn)
+        bb.parse.BBHandler.handle(append, d, True)
+
+    onlyfinalise = d.getVar("__ONLYFINALISE", False)
+
+    safe_d = d
+    d = bb.data.createCopy(safe_d)
+    try:
+        finalize(fn, d)
+    except bb.parse.SkipPackage as e:
+        d.setVar("__SKIPPED", e.args[0])
+    datastores = {"": safe_d}
+
+    versions = (d.getVar("BBVERSIONS", True) or "").split()
+    if versions:
+        pv = orig_pv = d.getVar("PV", True)
+        baseversions = {}
+
+        def verfunc(ver, d, pv_d = None):
+            if pv_d is None:
+                pv_d = d
+
+            overrides = d.getVar("OVERRIDES", True).split(":")
+            pv_d.setVar("PV", ver)
+            overrides.append(ver)
+            bpv = baseversions.get(ver) or orig_pv
+            pv_d.setVar("BPV", bpv)
+            overrides.append(bpv)
+            d.setVar("OVERRIDES", ":".join(overrides))
+
+        versions = list(_expand_versions(versions))
+        for pos, version in enumerate(list(versions)):
+            try:
+                pv, bpv = version.split(":", 2)
+            except ValueError:
+                pass
+            else:
+                versions[pos] = pv
+                baseversions[pv] = bpv
+
+        if pv in versions and not baseversions.get(pv):
+            versions.remove(pv)
+        else:
+            pv = versions.pop()
+
+            # This is necessary because our existing main datastore
+            # has already been finalized with the old PV, we need one
+            # that's been finalized with the new PV.
+            d = bb.data.createCopy(safe_d)
+            verfunc(pv, d, safe_d)
+            try:
+                finalize(fn, d)
+            except bb.parse.SkipPackage as e:
+                d.setVar("__SKIPPED", e.args[0])
+
+        _create_variants(datastores, versions, verfunc)
+
+    extended = d.getVar("BBCLASSEXTEND", True) or ""
+    if extended:
+        # the following is to support bbextends with arguments, for e.g. multilib
+        # an example is as follows:
+        #   BBCLASSEXTEND = "multilib:lib32"
+        # it will create foo-lib32, inheriting multilib.bbclass and set
+        # BBEXTENDCURR to "multilib" and BBEXTENDVARIANT to "lib32"
+        extendedmap = {}
+        variantmap = {}
+
+        for ext in extended.split():
+            eext = ext.split(':', 2)
+            if len(eext) > 1:
+                extendedmap[ext] = eext[0]
+                variantmap[ext] = eext[1]
+            else:
+                extendedmap[ext] = ext
+
+        pn = d.getVar("PN", True)
+        def extendfunc(name, d):
+            if name != extendedmap[name]:
+                d.setVar("BBEXTENDCURR", extendedmap[name])
+                d.setVar("BBEXTENDVARIANT", variantmap[name])
+            else:
+                d.setVar("PN", "%s-%s" % (pn, name))
+            bb.parse.BBHandler.inherit(extendedmap[name], fn, 0, d)
+
+        safe_d.setVar("BBCLASSEXTEND", extended)
+        _create_variants(datastores, extendedmap.keys(), extendfunc)
+
+    for variant, variant_d in datastores.iteritems():
+        if variant:
+            try:
+                if not onlyfinalise or variant in onlyfinalise:
+                    finalize(fn, variant_d, variant)
+            except bb.parse.SkipPackage as e:
+                variant_d.setVar("__SKIPPED", e.args[0])
+
+    if len(datastores) > 1:
+        variants = filter(None, datastores.iterkeys())
+        safe_d.setVar("__VARIANTS", " ".join(variants))
+
+    datastores[""] = d
+    return datastores

bitbake/lib/bb/parse/parse_py/BBHandler.py

@@ -0,0 +1,257 @@
+#!/usr/bin/env python
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+   class for handling .bb files
+
+   Reads a .bb file and obtains its metadata
+
+"""
+
+
+#  Copyright (C) 2003, 2004  Chris Larson
+#  Copyright (C) 2003, 2004  Phil Blundell
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+from __future__ import absolute_import
+import re, bb, os
+import logging
+import bb.build, bb.utils
+from bb import data
+
+from . import ConfHandler
+from .. import resolve_file, ast, logger
+from .ConfHandler import include, init
+
+# For compatibility
+bb.deprecate_import(__name__, "bb.parse", ["vars_from_file"])
+
+__func_start_regexp__    = re.compile( r"(((?P<py>python)|(?P<fr>fakeroot))\s*)*(?P<func>[\w\.\-\+\{\}\$]+)?\s*\(\s*\)\s*{$" )
+__inherit_regexp__       = re.compile( r"inherit\s+(.+)" )
+__export_func_regexp__   = re.compile( r"EXPORT_FUNCTIONS\s+(.+)" )
+__addtask_regexp__       = re.compile("addtask\s+(?P<func>\w+)\s*((before\s*(?P<before>((.*(?=after))|(.*))))|(after\s*(?P<after>((.*(?=before))|(.*)))))*")
+__addhandler_regexp__    = re.compile( r"addhandler\s+(.+)" )
+__def_regexp__           = re.compile( r"def\s+(\w+).*:" )
+__python_func_regexp__   = re.compile( r"(\s+.*)|(^$)" )
+
+
+__infunc__ = ""
+__inpython__ = False
+__body__   = []
+__classname__ = ""
+
+cached_statements = {}
+
+# We need to indicate EOF to the feeder. This code is so messy that
+# factoring it out to a close_parse_file method is out of question.
+# We will use the IN_PYTHON_EOF as an indicator to just close the method
+#
+# The two parts using it are tightly integrated anyway
+IN_PYTHON_EOF = -9999999999999
+
+
+
+def supports(fn, d):
+    """Return True if fn has a supported extension"""
+    return os.path.splitext(fn)[-1] in [".bb", ".bbclass", ".inc"]
+
+def inherit(files, fn, lineno, d):
+    __inherit_cache = d.getVar('__inherit_cache') or []
+    files = d.expand(files).split()
+    for file in files:
+        if not os.path.isabs(file) and not file.endswith(".bbclass"):
+            file = os.path.join('classes', '%s.bbclass' % file)
+
+        if not os.path.isabs(file):
+            dname = os.path.dirname(fn)
+            bbpath = "%s:%s" % (dname, d.getVar("BBPATH", True))
+            abs_fn = bb.utils.which(bbpath, file)
+            if abs_fn:
+                file = abs_fn
+
+        if not file in __inherit_cache:
+            logger.log(logging.DEBUG -1, "BB %s:%d: inheriting %s", fn, lineno, file)
+            __inherit_cache.append( file )
+            d.setVar('__inherit_cache', __inherit_cache)
+            include(fn, file, lineno, d, "inherit")
+            __inherit_cache = d.getVar('__inherit_cache') or []
+
+def get_statements(filename, absolute_filename, base_name):
+    global cached_statements
+
+    try:
+        return cached_statements[absolute_filename]
+    except KeyError:
+        file = open(absolute_filename, 'r')
+        statements = ast.StatementGroup()
+
+        lineno = 0
+        while True:
+            lineno = lineno + 1
+            s = file.readline()
+            if not s: break
+            s = s.rstrip()
+            feeder(lineno, s, filename, base_name, statements)
+        if __inpython__:
+            # add a blank line to close out any python definition
+            feeder(IN_PYTHON_EOF, "", filename, base_name, statements)
+
+        if filename.endswith(".bbclass") or filename.endswith(".inc"):
+            cached_statements[absolute_filename] = statements
+        return statements
+
+def handle(fn, d, include):
+    global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __infunc__, __body__, __residue__, __classname__
+    __body__ = []
+    __infunc__ = ""
+    __classname__ = ""
+    __residue__ = []
+
+
+    if include == 0:
+        logger.debug(2, "BB %s: handle(data)", fn)
+    else:
+        logger.debug(2, "BB %s: handle(data, include)", fn)
+
+    base_name = os.path.basename(fn)
+    (root, ext) = os.path.splitext(base_name)
+    init(d)
+
+    if ext == ".bbclass":
+        __classname__ = root
+        __inherit_cache = d.getVar('__inherit_cache') or []
+        if not fn in __inherit_cache:
+            __inherit_cache.append(fn)
+            d.setVar('__inherit_cache', __inherit_cache)
+
+    if include != 0:
+        oldfile = d.getVar('FILE')
+    else:
+        oldfile = None
+
+    abs_fn = resolve_file(fn, d)
+
+    if include:
+        bb.parse.mark_dependency(d, abs_fn)
+
+    # actual loading
+    statements = get_statements(fn, abs_fn, base_name)
+
+    # DONE WITH PARSING... time to evaluate
+    if ext != ".bbclass":
+        d.setVar('FILE', abs_fn)
+
+    try:
+        statements.eval(d)
+    except bb.parse.SkipPackage:
+        bb.data.setVar("__SKIPPED", True, d)
+        if include == 0:
+            return { "" : d }
+
+    if ext != ".bbclass" and include == 0:
+        return ast.multi_finalize(fn, d)
+
+    if oldfile:
+        d.setVar("FILE", oldfile)
+
+    return d
+
+def feeder(lineno, s, fn, root, statements):
+    global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __def_regexp__, __python_func_regexp__, __inpython__, __infunc__, __body__, bb, __residue__, __classname__
+    if __infunc__:
+        if s == '}':
+            __body__.append('')
+            ast.handleMethod(statements, fn, lineno, __infunc__, __body__)
+            __infunc__ = ""
+            __body__ = []
+        else:
+            __body__.append(s)
+        return
+
+    if __inpython__:
+        m = __python_func_regexp__.match(s)
+        if m and lineno != IN_PYTHON_EOF:
+            __body__.append(s)
+            return
+        else:
+            ast.handlePythonMethod(statements, fn, lineno, __inpython__,
+                                   root, __body__)
+            __body__ = []
+            __inpython__ = False
+
+            if lineno == IN_PYTHON_EOF:
+                return
+
+    if s and s[0] == '#':
+        if len(__residue__) != 0 and __residue__[0][0] != "#":
+            bb.fatal("There is a comment on line %s of file %s (%s) which is in the middle of a multiline expression.\nBitbake used to ignore these but no longer does so, please fix your metadata as errors are likely as a result of this change." % (lineno, fn, s))
+
+    if len(__residue__) != 0 and __residue__[0][0] == "#" and (not s or s[0] != "#"):
+        bb.fatal("There is a confusing multiline, partially commented expression on line %s of file %s (%s).\nPlease clarify whether this is all a comment or should be parsed." % (lineno, fn, s))
+
+    if s and s[-1] == '\\':
+        __residue__.append(s[:-1])
+        return
+
+    s = "".join(__residue__) + s
+    __residue__ = []
+
+    # Skip empty lines
+    if s == '':
+        return   
+
+    # Skip comments
+    if s[0] == '#':
+        return
+
+    m = __func_start_regexp__.match(s)
+    if m:
+        __infunc__ = m.group("func") or "__anonymous"
+        ast.handleMethodFlags(statements, fn, lineno, __infunc__, m)
+        return
+
+    m = __def_regexp__.match(s)
+    if m:
+        __body__.append(s)
+        __inpython__ = m.group(1)
+
+        return
+
+    m = __export_func_regexp__.match(s)
+    if m:
+        ast.handleExportFuncs(statements, fn, lineno, m, __classname__)
+        return
+
+    m = __addtask_regexp__.match(s)
+    if m:
+        ast.handleAddTask(statements, fn, lineno, m)
+        return
+
+    m = __addhandler_regexp__.match(s)
+    if m:
+        ast.handleBBHandlers(statements, fn, lineno, m)
+        return
+
+    m = __inherit_regexp__.match(s)
+    if m:
+        ast.handleInherit(statements, fn, lineno, m)
+        return
+
+    return ConfHandler.feeder(lineno, s, fn, statements)
+
+# Add us to the handlers list
+from .. import handlers
+handlers.append({'supports': supports, 'handle': handle, 'init': init})
+del handlers

bitbake/lib/bb/parse/parse_py/ConfHandler.py

@@ -0,0 +1,180 @@
+#!/usr/bin/env python
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+   class for handling configuration data files
+
+   Reads a .conf file and obtains its metadata
+
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2003, 2004  Phil Blundell
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import re, os
+import logging
+import bb.utils
+from bb.parse import ParseError, resolve_file, ast, logger
+
+__config_regexp__  = re.compile( r"""
+    ^
+    (?P<exp>export\s*)?
+    (?P<var>[a-zA-Z0-9\-~_+.${}/]+?)
+    (\[(?P<flag>[a-zA-Z0-9\-_+.]+)\])?
+
+    \s* (
+        (?P<colon>:=) |
+        (?P<lazyques>\?\?=) |
+        (?P<ques>\?=) |
+        (?P<append>\+=) |
+        (?P<prepend>=\+) |
+        (?P<predot>=\.) |
+        (?P<postdot>\.=) |
+        =
+    ) \s*
+
+    (?!'[^']*'[^']*'$)
+    (?!\"[^\"]*\"[^\"]*\"$)
+    (?P<apo>['\"])
+    (?P<value>.*)
+    (?P=apo)
+    $
+    """, re.X)
+__include_regexp__ = re.compile( r"include\s+(.+)" )
+__require_regexp__ = re.compile( r"require\s+(.+)" )
+__export_regexp__ = re.compile( r"export\s+([a-zA-Z0-9\-_+.${}/]+)$" )
+
+def init(data):
+    topdir = data.getVar('TOPDIR')
+    if not topdir:
+        data.setVar('TOPDIR', os.getcwd())
+
+
+def supports(fn, d):
+    return fn[-5:] == ".conf"
+
+def include(oldfn, fn, lineno, data, error_out):
+    """
+    error_out: A string indicating the verb (e.g. "include", "inherit") to be
+    used in a ParseError that will be raised if the file to be included could
+    not be included. Specify False to avoid raising an error in this case.
+    """
+    if oldfn == fn: # prevent infinite recursion
+        return None
+
+    import bb
+    fn = data.expand(fn)
+    oldfn = data.expand(oldfn)
+
+    if not os.path.isabs(fn):
+        dname = os.path.dirname(oldfn)
+        bbpath = "%s:%s" % (dname, data.getVar("BBPATH", True))
+        abs_fn = bb.utils.which(bbpath, fn)
+        if abs_fn:
+            fn = abs_fn
+
+    from bb.parse import handle
+    try:
+        ret = handle(fn, data, True)
+    except IOError:
+        if error_out:
+            raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
+        logger.debug(2, "CONF file '%s' not found", fn)
+
+# We have an issue where a UI might want to enforce particular settings such as
+# an empty DISTRO variable. If configuration files do something like assigning
+# a weak default, it turns out to be very difficult to filter out these changes,
+# particularly when the weak default might appear half way though parsing a chain 
+# of configuration files. We therefore let the UIs hook into configuration file
+# parsing. This turns out to be a hard problem to solve any other way.
+confFilters = []
+
+def handle(fn, data, include):
+    init(data)
+
+    if include == 0:
+        oldfile = None
+    else:
+        oldfile = data.getVar('FILE')
+
+    abs_fn = resolve_file(fn, data)
+    f = open(abs_fn, 'r')
+
+    if include:
+        bb.parse.mark_dependency(data, abs_fn)
+
+    statements = ast.StatementGroup()
+    lineno = 0
+    while True:
+        lineno = lineno + 1
+        s = f.readline()
+        if not s:
+            break
+        w = s.strip()
+        # skip empty lines
+        if not w:
+            continue
+        s = s.rstrip()
+        while s[-1] == '\\':
+            s2 = f.readline().strip()
+            lineno = lineno + 1
+            if (not s2 or s2 and s2[0] != "#") and s[0] == "#" :
+                bb.fatal("There is a confusing multiline, partially commented expression on line %s of file %s (%s).\nPlease clarify whether this is all a comment or should be parsed." % (lineno, fn, s))
+            s = s[:-1] + s2
+        # skip comments
+        if s[0] == '#':
+            continue
+        feeder(lineno, s, fn, statements)
+
+    # DONE WITH PARSING... time to evaluate
+    data.setVar('FILE', abs_fn)
+    statements.eval(data)
+    if oldfile:
+        data.setVar('FILE', oldfile)
+
+    for f in confFilters:
+        f(fn, data)
+
+    return data
+
+def feeder(lineno, s, fn, statements):
+    m = __config_regexp__.match(s)
+    if m:
+        groupd = m.groupdict()
+        ast.handleData(statements, fn, lineno, groupd)
+        return
+
+    m = __include_regexp__.match(s)
+    if m:
+        ast.handleInclude(statements, fn, lineno, m, False)
+        return
+
+    m = __require_regexp__.match(s)
+    if m:
+        ast.handleInclude(statements, fn, lineno, m, True)
+        return
+
+    m = __export_regexp__.match(s)
+    if m:
+        ast.handleExport(statements, fn, lineno, m)
+        return
+
+    raise ParseError("unparsed line: '%s'" % s, fn, lineno);
+
+# Add us to the handlers list
+from bb.parse import handlers
+handlers.append({'supports': supports, 'handle': handle, 'init': init})
+del handlers

bitbake/lib/bb/parse/parse_py/__init__.py

@@ -0,0 +1,33 @@
+#!/usr/bin/env python
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake Parsers
+
+File parsers for the BitBake build tools.
+
+"""
+
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2003, 2004  Phil Blundell
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+from __future__ import absolute_import
+from . import ConfHandler
+from . import BBHandler
+
+__version__ = '1.0'

bitbake/lib/bb/persist_data.py

@@ -0,0 +1,215 @@
+"""BitBake Persistent Data Store
+
+Used to store data in a central location such that other threads/tasks can
+access them at some future date.  Acts as a convenience wrapper around sqlite,
+currently, providing a key/value store accessed by 'domain'.
+"""
+
+# Copyright (C) 2007        Richard Purdie
+# Copyright (C) 2010        Chris Larson <chris_larson@mentor.com>
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import collections
+import logging
+import os.path
+import sys
+import warnings
+from bb.compat import total_ordering
+from collections import Mapping
+
+try:
+    import sqlite3
+except ImportError:
+    from pysqlite2 import dbapi2 as sqlite3
+
+sqlversion = sqlite3.sqlite_version_info
+if sqlversion[0] < 3 or (sqlversion[0] == 3 and sqlversion[1] < 3):
+    raise Exception("sqlite3 version 3.3.0 or later is required.")
+
+
+logger = logging.getLogger("BitBake.PersistData")
+if hasattr(sqlite3, 'enable_shared_cache'):
+    try:
+        sqlite3.enable_shared_cache(True)
+    except sqlite3.OperationalError:
+        pass
+
+
+@total_ordering
+class SQLTable(collections.MutableMapping):
+    """Object representing a table/domain in the database"""
+    def __init__(self, cachefile, table):
+        self.cachefile = cachefile
+        self.table = table
+        self.cursor = connect(self.cachefile)
+
+        self._execute("CREATE TABLE IF NOT EXISTS %s(key TEXT, value TEXT);"
+                      % table)
+
+    def _execute(self, *query):
+        """Execute a query, waiting to acquire a lock if necessary"""
+        count = 0
+        while True:
+            try:
+                return self.cursor.execute(*query)
+            except sqlite3.OperationalError as exc:
+                if 'database is locked' in str(exc) and count < 500:
+                    count = count + 1
+                    self.cursor.close()
+                    self.cursor = connect(self.cachefile)
+                    continue
+                raise
+
+    def __enter__(self):
+        self.cursor.__enter__()
+        return self
+
+    def __exit__(self, *excinfo):
+        self.cursor.__exit__(*excinfo)
+
+    def __getitem__(self, key):
+        data = self._execute("SELECT * from %s where key=?;" %
+                             self.table, [key])
+        for row in data:
+            return row[1]
+        raise KeyError(key)
+
+    def __delitem__(self, key):
+        if key not in self:
+            raise KeyError(key)
+        self._execute("DELETE from %s where key=?;" % self.table, [key])
+
+    def __setitem__(self, key, value):
+        if not isinstance(key, basestring):
+            raise TypeError('Only string keys are supported')
+        elif not isinstance(value, basestring):
+            raise TypeError('Only string values are supported')
+
+        data = self._execute("SELECT * from %s where key=?;" %
+                                   self.table, [key])
+        exists = len(list(data))
+        if exists:
+            self._execute("UPDATE %s SET value=? WHERE key=?;" % self.table,
+                          [value, key])
+        else:
+            self._execute("INSERT into %s(key, value) values (?, ?);" %
+                          self.table, [key, value])
+
+    def __contains__(self, key):
+        return key in set(self)
+
+    def __len__(self):
+        data = self._execute("SELECT COUNT(key) FROM %s;" % self.table)
+        for row in data:
+            return row[0]
+
+    def __iter__(self):
+        data = self._execute("SELECT key FROM %s;" % self.table)
+        return (row[0] for row in data)
+
+    def __lt__(self, other):
+        if not isinstance(other, Mapping):
+            raise NotImplemented
+
+        return len(self) < len(other)
+
+    def get_by_pattern(self, pattern):
+        data = self._execute("SELECT * FROM %s WHERE key LIKE ?;" %
+                             self.table, [pattern])
+        return [row[1] for row in data]
+
+    def values(self):
+        return list(self.itervalues())
+
+    def itervalues(self):
+        data = self._execute("SELECT value FROM %s;" % self.table)
+        return (row[0] for row in data)
+
+    def items(self):
+        return list(self.iteritems())
+
+    def iteritems(self):
+        return self._execute("SELECT * FROM %s;" % self.table)
+
+    def clear(self):
+        self._execute("DELETE FROM %s;" % self.table)
+
+    def has_key(self, key):
+        return key in self
+
+
+class PersistData(object):
+    """Deprecated representation of the bitbake persistent data store"""
+    def __init__(self, d):
+        warnings.warn("Use of PersistData is deprecated.  Please use "
+                      "persist(domain, d) instead.",
+                      category=DeprecationWarning,
+                      stacklevel=2)
+
+        self.data = persist(d)
+        logger.debug(1, "Using '%s' as the persistent data cache",
+                     self.data.filename)
+
+    def addDomain(self, domain):
+        """
+        Add a domain (pending deprecation)
+        """
+        return self.data[domain]
+
+    def delDomain(self, domain):
+        """
+        Removes a domain and all the data it contains
+        """
+        del self.data[domain]
+
+    def getKeyValues(self, domain):
+        """
+        Return a list of key + value pairs for a domain
+        """
+        return self.data[domain].items()
+
+    def getValue(self, domain, key):
+        """
+        Return the value of a key for a domain
+        """
+        return self.data[domain][key]
+
+    def setValue(self, domain, key, value):
+        """
+        Sets the value of a key for a domain
+        """
+        self.data[domain][key] = value
+
+    def delValue(self, domain, key):
+        """
+        Deletes a key/value pair
+        """
+        del self.data[domain][key]
+
+def connect(database):
+    return sqlite3.connect(database, timeout=5, isolation_level=None)
+
+def persist(domain, d):
+    """Convenience factory for SQLTable objects based upon metadata"""
+    import bb.utils
+    cachedir = (d.getVar("PERSISTENT_DIR", True) or
+                d.getVar("CACHE", True))
+    if not cachedir:
+        logger.critical("Please set the 'PERSISTENT_DIR' or 'CACHE' variable")
+        sys.exit(1)
+
+    bb.utils.mkdirhier(cachedir)
+    cachefile = os.path.join(cachedir, "bb_persist_data.sqlite3")
+    return SQLTable(cachefile, domain)

bitbake/lib/bb/process.py

@@ -0,0 +1,129 @@
+import logging
+import signal
+import subprocess
+import errno
+import select
+
+logger = logging.getLogger('BitBake.Process')
+
+def subprocess_setup():
+    # Python installs a SIGPIPE handler by default. This is usually not what
+    # non-Python subprocesses expect.
+    signal.signal(signal.SIGPIPE, signal.SIG_DFL)
+
+class CmdError(RuntimeError):
+    def __init__(self, command, msg=None):
+        self.command = command
+        self.msg = msg
+
+    def __str__(self):
+        if not isinstance(self.command, basestring):
+            cmd = subprocess.list2cmdline(self.command)
+        else:
+            cmd = self.command
+
+        msg = "Execution of '%s' failed" % cmd
+        if self.msg:
+            msg += ': %s' % self.msg
+        return msg
+
+class NotFoundError(CmdError):
+    def __str__(self):
+        return CmdError.__str__(self) + ": command not found"
+
+class ExecutionError(CmdError):
+    def __init__(self, command, exitcode, stdout = None, stderr = None):
+        CmdError.__init__(self, command)
+        self.exitcode = exitcode
+        self.stdout = stdout
+        self.stderr = stderr
+
+    def __str__(self):
+        message = ""
+        if self.stderr:
+            message += self.stderr
+        if self.stdout:
+            message += self.stdout
+        if message:
+            message = ":\n" + message
+        return (CmdError.__str__(self) +
+                " with exit code %s" % self.exitcode + message)
+
+class Popen(subprocess.Popen):
+    defaults = {
+        "close_fds": True,
+        "preexec_fn": subprocess_setup,
+        "stdout": subprocess.PIPE,
+        "stderr": subprocess.STDOUT,
+        "stdin": subprocess.PIPE,
+        "shell": False,
+    }
+
+    def __init__(self, *args, **kwargs):
+        options = dict(self.defaults)
+        options.update(kwargs)
+        subprocess.Popen.__init__(self, *args, **options)
+
+def _logged_communicate(pipe, log, input):
+    if pipe.stdin:
+        if input is not None:
+            pipe.stdin.write(input)
+        pipe.stdin.close()
+
+    outdata, errdata = [], []
+    rin = []
+
+    if pipe.stdout is not None:
+        bb.utils.nonblockingfd(pipe.stdout.fileno())
+        rin.append(pipe.stdout)
+    if pipe.stderr is not None:
+        bb.utils.nonblockingfd(pipe.stderr.fileno())
+        rin.append(pipe.stderr)
+
+    try:
+        while pipe.poll() is None:
+            rlist = rin
+            try:
+                r,w,e = select.select (rlist, [], [])
+            except OSError, e:
+                if e.errno != errno.EINTR:
+                    raise
+
+            if pipe.stdout in r:
+                data = pipe.stdout.read()
+                if data is not None:
+                    outdata.append(data)
+                    log.write(data)
+
+            if pipe.stderr in r:
+                data = pipe.stderr.read()
+                if data is not None:
+                    errdata.append(data)
+                    log.write(data)
+    finally:    
+        log.flush()
+    return ''.join(outdata), ''.join(errdata)
+
+def run(cmd, input=None, log=None, **options):
+    """Convenience function to run a command and return its output, raising an
+    exception when the command fails"""
+
+    if isinstance(cmd, basestring) and not "shell" in options:
+        options["shell"] = True
+
+    try:
+        pipe = Popen(cmd, **options)
+    except OSError as exc:
+        if exc.errno == 2:
+            raise NotFoundError(cmd)
+        else:
+            raise CmdError(cmd, exc)
+
+    if log:
+        stdout, stderr = _logged_communicate(pipe, log, input)
+    else:
+        stdout, stderr = pipe.communicate(input)
+
+    if pipe.returncode != 0:
+        raise ExecutionError(cmd, pipe.returncode, stdout, stderr)
+    return stdout, stderr

bitbake/lib/bb/providers.py

@@ -0,0 +1,380 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# Copyright (C) 2003, 2004  Chris Larson
+# Copyright (C) 2003, 2004  Phil Blundell
+# Copyright (C) 2003 - 2005 Michael 'Mickey' Lauer
+# Copyright (C) 2005        Holger Hans Peter Freyther
+# Copyright (C) 2005        ROAD GmbH
+# Copyright (C) 2006        Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import re
+import logging
+from bb import data, utils
+from collections import defaultdict
+import bb
+
+logger = logging.getLogger("BitBake.Provider")
+
+class NoProvider(bb.BBHandledException):
+    """Exception raised when no provider of a build dependency can be found"""
+
+class NoRProvider(bb.BBHandledException):
+    """Exception raised when no provider of a runtime dependency can be found"""
+
+class MultipleRProvider(bb.BBHandledException):
+    """Exception raised when multiple providers of a runtime dependency can be found"""
+
+def findProviders(cfgData, dataCache, pkg_pn = None):
+    """
+    Convenience function to get latest and preferred providers in pkg_pn
+    """
+
+    if not pkg_pn:
+        pkg_pn = dataCache.pkg_pn
+
+    # Need to ensure data store is expanded
+    localdata = data.createCopy(cfgData)
+    bb.data.update_data(localdata)
+    bb.data.expandKeys(localdata)
+
+    preferred_versions = {}
+    latest_versions = {}
+
+    for pn in pkg_pn:
+        (last_ver, last_file, pref_ver, pref_file) = findBestProvider(pn, localdata, dataCache, pkg_pn)
+        preferred_versions[pn] = (pref_ver, pref_file)
+        latest_versions[pn] = (last_ver, last_file)
+
+    return (latest_versions, preferred_versions)
+
+
+def allProviders(dataCache):
+    """
+    Find all providers for each pn
+    """
+    all_providers = defaultdict(list)
+    for (fn, pn) in dataCache.pkg_fn.items():
+        ver = dataCache.pkg_pepvpr[fn]
+        all_providers[pn].append((ver, fn))
+    return all_providers
+
+
+def sortPriorities(pn, dataCache, pkg_pn = None):
+    """
+    Reorder pkg_pn by file priority and default preference
+    """
+
+    if not pkg_pn:
+        pkg_pn = dataCache.pkg_pn
+
+    files = pkg_pn[pn]
+    priorities = {}
+    for f in files:
+        priority = dataCache.bbfile_priority[f]
+        preference = dataCache.pkg_dp[f]
+        if priority not in priorities:
+            priorities[priority] = {}
+        if preference not in priorities[priority]:
+            priorities[priority][preference] = []
+        priorities[priority][preference].append(f)
+    tmp_pn = []
+    for pri in sorted(priorities, lambda a, b: a - b):
+        tmp_pref = []
+        for pref in sorted(priorities[pri], lambda a, b: b - a):
+            tmp_pref.extend(priorities[pri][pref])
+        tmp_pn = [tmp_pref] + tmp_pn
+
+    return tmp_pn
+
+def preferredVersionMatch(pe, pv, pr, preferred_e, preferred_v, preferred_r):
+    """
+    Check if the version pe,pv,pr is the preferred one.
+    If there is preferred version defined and ends with '%', then pv has to start with that version after removing the '%'
+    """
+    if (pr == preferred_r or preferred_r == None):
+        if (pe == preferred_e or preferred_e == None):
+            if preferred_v == pv:
+                return True
+            if preferred_v != None and preferred_v.endswith('%') and pv.startswith(preferred_v[:len(preferred_v)-1]):
+                return True
+    return False
+
+def findPreferredProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
+    """
+    Find the first provider in pkg_pn with a PREFERRED_VERSION set.
+    """
+
+    preferred_file = None
+    preferred_ver = None
+
+    localdata = data.createCopy(cfgData)
+    localdata.setVar('OVERRIDES', "%s:pn-%s:%s" % (data.getVar('OVERRIDES', localdata), pn, pn))
+    bb.data.update_data(localdata)
+
+    preferred_v = localdata.getVar('PREFERRED_VERSION', True)
+    if preferred_v:
+        m = re.match('(\d+:)*(.*)(_.*)*', preferred_v)
+        if m:
+            if m.group(1):
+                preferred_e = m.group(1)[:-1]
+            else:
+                preferred_e = None
+            preferred_v = m.group(2)
+            if m.group(3):
+                preferred_r = m.group(3)[1:]
+            else:
+                preferred_r = None
+        else:
+            preferred_e = None
+            preferred_r = None
+
+        for file_set in pkg_pn:
+            for f in file_set:
+                pe, pv, pr = dataCache.pkg_pepvpr[f]
+                if preferredVersionMatch(pe, pv, pr, preferred_e, preferred_v, preferred_r):
+                    preferred_file = f
+                    preferred_ver = (pe, pv, pr)
+                    break
+            if preferred_file:
+                break;
+        if preferred_r:
+            pv_str = '%s-%s' % (preferred_v, preferred_r)
+        else:
+            pv_str = preferred_v
+        if not (preferred_e is None):
+            pv_str = '%s:%s' % (preferred_e, pv_str)
+        itemstr = ""
+        if item:
+            itemstr = " (for item %s)" % item
+        if preferred_file is None:
+            logger.info("preferred version %s of %s not available%s", pv_str, pn, itemstr)
+            available_vers = []
+            for file_set in pkg_pn:
+                for f in file_set:
+                    pe, pv, pr = dataCache.pkg_pepvpr[f]
+                    ver_str = pv
+                    if pe:
+                        ver_str = "%s:%s" % (pe, ver_str)
+                    if not ver_str in available_vers:
+                        available_vers.append(ver_str)
+            if available_vers:
+                available_vers.sort()
+                logger.info("versions of %s available: %s", pn, ' '.join(available_vers))
+        else:
+            logger.debug(1, "selecting %s as PREFERRED_VERSION %s of package %s%s", preferred_file, pv_str, pn, itemstr)
+
+    return (preferred_ver, preferred_file)
+
+
+def findLatestProvider(pn, cfgData, dataCache, file_set):
+    """
+    Return the highest version of the providers in file_set.
+    Take default preferences into account.
+    """
+    latest = None
+    latest_p = 0
+    latest_f = None
+    for file_name in file_set:
+        pe, pv, pr = dataCache.pkg_pepvpr[file_name]
+        dp = dataCache.pkg_dp[file_name]
+
+        if (latest is None) or ((latest_p == dp) and (utils.vercmp(latest, (pe, pv, pr)) < 0)) or (dp > latest_p):
+            latest = (pe, pv, pr)
+            latest_f = file_name
+            latest_p = dp
+
+    return (latest, latest_f)
+
+
+def findBestProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
+    """
+    If there is a PREFERRED_VERSION, find the highest-priority bbfile
+    providing that version.  If not, find the latest version provided by
+    an bbfile in the highest-priority set.
+    """
+
+    sortpkg_pn = sortPriorities(pn, dataCache, pkg_pn)
+    # Find the highest priority provider with a PREFERRED_VERSION set
+    (preferred_ver, preferred_file) = findPreferredProvider(pn, cfgData, dataCache, sortpkg_pn, item)
+    # Find the latest version of the highest priority provider
+    (latest, latest_f) = findLatestProvider(pn, cfgData, dataCache, sortpkg_pn[0])
+
+    if preferred_file is None:
+        preferred_file = latest_f
+        preferred_ver = latest
+
+    return (latest, latest_f, preferred_ver, preferred_file)
+
+
+def _filterProviders(providers, item, cfgData, dataCache):
+    """
+    Take a list of providers and filter/reorder according to the
+    environment variables and previous build results
+    """
+    eligible = []
+    preferred_versions = {}
+    sortpkg_pn = {}
+
+    # The order of providers depends on the order of the files on the disk
+    # up to here. Sort pkg_pn to make dependency issues reproducible rather
+    # than effectively random.
+    providers.sort()
+
+    # Collate providers by PN
+    pkg_pn = {}
+    for p in providers:
+        pn = dataCache.pkg_fn[p]
+        if pn not in pkg_pn:
+            pkg_pn[pn] = []
+        pkg_pn[pn].append(p)
+
+    logger.debug(1, "providers for %s are: %s", item, pkg_pn.keys())
+
+    # First add PREFERRED_VERSIONS
+    for pn in pkg_pn:
+        sortpkg_pn[pn] = sortPriorities(pn, dataCache, pkg_pn)
+        preferred_versions[pn] = findPreferredProvider(pn, cfgData, dataCache, sortpkg_pn[pn], item)
+        if preferred_versions[pn][1]:
+            eligible.append(preferred_versions[pn][1])
+
+    # Now add latest versions
+    for pn in sortpkg_pn:
+        if pn in preferred_versions and preferred_versions[pn][1]:
+            continue
+        preferred_versions[pn] = findLatestProvider(pn, cfgData, dataCache, sortpkg_pn[pn][0])
+        eligible.append(preferred_versions[pn][1])
+
+    if len(eligible) == 0:
+        logger.error("no eligible providers for %s", item)
+        return 0
+
+    # If pn == item, give it a slight default preference
+    # This means PREFERRED_PROVIDER_foobar defaults to foobar if available
+    for p in providers:
+        pn = dataCache.pkg_fn[p]
+        if pn != item:
+            continue
+        (newvers, fn) = preferred_versions[pn]
+        if not fn in eligible:
+            continue
+        eligible.remove(fn)
+        eligible = [fn] + eligible
+
+    return eligible
+
+
+def filterProviders(providers, item, cfgData, dataCache):
+    """
+    Take a list of providers and filter/reorder according to the
+    environment variables and previous build results
+    Takes a "normal" target item
+    """
+
+    eligible = _filterProviders(providers, item, cfgData, dataCache)
+
+    prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % item, True)
+    if prefervar:
+        dataCache.preferred[item] = prefervar
+
+    foundUnique = False
+    if item in dataCache.preferred:
+        for p in eligible:
+            pn = dataCache.pkg_fn[p]
+            if dataCache.preferred[item] == pn:
+                logger.verbose("selecting %s to satisfy %s due to PREFERRED_PROVIDERS", pn, item)
+                eligible.remove(p)
+                eligible = [p] + eligible
+                foundUnique = True
+                break
+
+    logger.debug(1, "sorted providers for %s are: %s", item, eligible)
+
+    return eligible, foundUnique
+
+def filterProvidersRunTime(providers, item, cfgData, dataCache):
+    """
+    Take a list of providers and filter/reorder according to the
+    environment variables and previous build results
+    Takes a "runtime" target item
+    """
+
+    eligible = _filterProviders(providers, item, cfgData, dataCache)
+
+    # Should use dataCache.preferred here?
+    preferred = []
+    preferred_vars = []
+    pns = {}
+    for p in eligible:
+        pns[dataCache.pkg_fn[p]] = p
+    for p in eligible:
+        pn = dataCache.pkg_fn[p]
+        provides = dataCache.pn_provides[pn]
+        for provide in provides:
+            prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % provide, True)
+            logger.debug(1, "checking PREFERRED_PROVIDER_%s (value %s) against %s", provide, prefervar, pns.keys())
+            if prefervar in pns and pns[prefervar] not in preferred:
+                var = "PREFERRED_PROVIDER_%s = %s" % (provide, prefervar)
+                logger.verbose("selecting %s to satisfy runtime %s due to %s", prefervar, item, var)
+                preferred_vars.append(var)
+                pref = pns[prefervar]
+                eligible.remove(pref)
+                eligible = [pref] + eligible
+                preferred.append(pref)
+                break
+
+    numberPreferred = len(preferred)
+
+    if numberPreferred > 1:
+        logger.error("Trying to resolve runtime dependency %s resulted in conflicting PREFERRED_PROVIDER entries being found.\nThe providers found were: %s\nThe PREFERRED_PROVIDER entries resulting in this conflict were: %s", item, preferred, preferred_vars)
+
+    logger.debug(1, "sorted providers for %s are: %s", item, eligible)
+
+    return eligible, numberPreferred
+
+regexp_cache = {}
+
+def getRuntimeProviders(dataCache, rdepend):
+    """
+    Return any providers of runtime dependency
+    """
+    rproviders = []
+
+    if rdepend in dataCache.rproviders:
+        rproviders += dataCache.rproviders[rdepend]
+
+    if rdepend in dataCache.packages:
+        rproviders += dataCache.packages[rdepend]
+
+    if rproviders:
+        return rproviders
+
+    # Only search dynamic packages if we can't find anything in other variables
+    for pattern in dataCache.packages_dynamic:
+        pattern = pattern.replace('+', "\+")
+        if pattern in regexp_cache:
+            regexp = regexp_cache[pattern]
+        else:
+            try:
+                regexp = re.compile(pattern)
+            except:
+                logger.error("Error parsing regular expression '%s'", pattern)
+                raise
+            regexp_cache[pattern] = regexp
+        if regexp.match(rdepend):
+            rproviders += dataCache.packages_dynamic[pattern]
+
+    return rproviders

bitbake/lib/bb/pysh/builtin.py

@@ -0,0 +1,710 @@
+# builtin.py - builtins and utilities definitions for pysh.
+#
+# Copyright 2007 Patrick Mezard
+#
+# This software may be used and distributed according to the terms
+# of the GNU General Public License, incorporated herein by reference.
+
+"""Builtin and internal utilities implementations.
+
+- Beware not to use python interpreter environment as if it were the shell
+environment. For instance, commands working directory must be explicitely handled
+through env['PWD'] instead of relying on python working directory.
+"""
+import errno
+import optparse
+import os
+import re
+import subprocess
+import sys
+import time
+
+def has_subprocess_bug():
+    return getattr(subprocess, 'list2cmdline') and \
+       (    subprocess.list2cmdline(['']) == '' or \
+            subprocess.list2cmdline(['foo|bar']) == 'foo|bar')
+            
+# Detect python bug 1634343: "subprocess swallows empty arguments under win32"
+# <http://sourceforge.net/tracker/index.php?func=detail&aid=1634343&group_id=5470&atid=105470>
+# Also detect: "[ 1710802 ] subprocess must escape redirection characters under win32"
+# <http://sourceforge.net/tracker/index.php?func=detail&aid=1710802&group_id=5470&atid=105470>
+if has_subprocess_bug():
+    import subprocess_fix
+    subprocess.list2cmdline = subprocess_fix.list2cmdline
+
+from sherrors import *
+
+class NonExitingParser(optparse.OptionParser):
+    """OptionParser default behaviour upon error is to print the error message and
+    exit. Raise a utility error instead.
+    """
+    def error(self, msg):
+        raise UtilityError(msg)
+
+#-------------------------------------------------------------------------------  
+# set special builtin
+#-------------------------------------------------------------------------------  
+OPT_SET = NonExitingParser(usage="set - set or unset options and positional parameters")
+OPT_SET.add_option( '-f', action='store_true', dest='has_f', default=False,
+    help='The shell shall disable pathname expansion.')
+OPT_SET.add_option('-e', action='store_true', dest='has_e', default=False,
+    help="""When this option is on, if a simple command fails for any of the \
+    reasons listed in Consequences of Shell Errors or returns an exit status \
+    value >0, and is not part of the compound list following a while, until, \
+    or if keyword, and is not a part of an AND or OR list, and is not a \
+    pipeline preceded by the ! reserved word, then the shell shall immediately \
+    exit.""")
+OPT_SET.add_option('-x', action='store_true', dest='has_x', default=False,
+    help="""The shell shall write to standard error a trace for each command \
+    after it expands the command and before it executes it. It is unspecified \
+    whether the command that turns tracing off is traced.""")
+
+def builtin_set(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    option, args = OPT_SET.parse_args(args)
+    env = interp.get_env()
+    
+    if option.has_f:
+        env.set_opt('-f')
+    if option.has_e:
+        env.set_opt('-e')
+    if option.has_x:
+        env.set_opt('-x')
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# shift special builtin
+#-------------------------------------------------------------------------------  
+def builtin_shift(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    params = interp.get_env().get_positional_args()
+    if args:
+        try:
+            n = int(args[0])
+            if n > len(params):
+                raise ValueError()
+        except ValueError:
+            return 1
+    else:
+        n = 1
+        
+    params[:n] = []
+    interp.get_env().set_positional_args(params)
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# export special builtin
+#-------------------------------------------------------------------------------  
+OPT_EXPORT = NonExitingParser(usage="set - set or unset options and positional parameters")
+OPT_EXPORT.add_option('-p', action='store_true', dest='has_p', default=False)
+
+def builtin_export(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    option, args = OPT_EXPORT.parse_args(args)
+    if option.has_p:
+        raise NotImplementedError()
+    
+    for arg in args:
+        try:
+            name, value = arg.split('=', 1)
+        except ValueError:
+            name, value = arg, None
+        env = interp.get_env().export(name, value)
+    
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# return special builtin
+#-------------------------------------------------------------------------------  
+def builtin_return(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    res = 0
+    if args:
+        try:
+            res = int(args[0])
+        except ValueError:
+            res = 0
+        if not 0<=res<=255:
+            res = 0
+            
+    # BUG: should be last executed command exit code        
+    raise ReturnSignal(res)
+
+#-------------------------------------------------------------------------------  
+# trap special builtin
+#-------------------------------------------------------------------------------  
+def builtin_trap(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    if len(args) < 2:
+        stderr.write('trap: usage: trap [[arg] signal_spec ...]\n')
+        return 2
+
+    action = args[0]
+    for sig in args[1:]:
+        try:
+            env.traps[sig] = action
+        except Exception as e:
+            stderr.write('trap: %s\n' % str(e))
+    return 0
+
+#-------------------------------------------------------------------------------  
+# unset special builtin
+#-------------------------------------------------------------------------------
+OPT_UNSET = NonExitingParser("unset - unset values and attributes of variables and functions")
+OPT_UNSET.add_option( '-f', action='store_true', dest='has_f', default=False)
+OPT_UNSET.add_option( '-v', action='store_true', dest='has_v', default=False)
+
+def builtin_unset(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    option, args = OPT_UNSET.parse_args(args)
+    
+    status = 0
+    env = interp.get_env()
+    for arg in args:    
+        try:
+            if option.has_f:
+                env.remove_function(arg)
+            else:
+                del env[arg]
+        except KeyError:
+            pass
+        except VarAssignmentError:
+            status = 1
+            
+    return status
+
+#-------------------------------------------------------------------------------  
+# wait special builtin
+#-------------------------------------------------------------------------------  
+def builtin_wait(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    return interp.wait([int(arg) for arg in args])
+
+#-------------------------------------------------------------------------------  
+# cat utility
+#-------------------------------------------------------------------------------
+def utility_cat(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    if not args:
+        args = ['-']
+
+    status = 0
+    for arg in args:
+        if arg == '-':
+            data = stdin.read()
+        else:
+            path = os.path.join(env['PWD'], arg)
+            try:
+                f = file(path, 'rb')
+                try:
+                    data = f.read()
+                finally:
+                    f.close()
+            except IOError as e:
+                if e.errno != errno.ENOENT:
+                    raise
+                status = 1
+                continue
+        stdout.write(data)
+        stdout.flush()
+    return status
+    
+#-------------------------------------------------------------------------------  
+# cd utility
+#-------------------------------------------------------------------------------  
+OPT_CD = NonExitingParser("cd - change the working directory")
+
+def utility_cd(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    option, args = OPT_CD.parse_args(args)
+    env = interp.get_env()
+    
+    directory = None
+    printdir = False
+    if not args:
+        home = env.get('HOME')
+        if home:
+            # Unspecified, do nothing
+            return 0
+        else:
+            directory = home
+    elif len(args)==1:
+        directory = args[0]
+        if directory=='-':
+            if 'OLDPWD' not in env:
+                raise UtilityError("OLDPWD not set")
+            printdir = True
+            directory = env['OLDPWD']
+    else:
+        raise UtilityError("too many arguments")
+            
+    curpath = None
+    # Absolute directories will be handled correctly by the os.path.join call.
+    if not directory.startswith('.') and not directory.startswith('..'):
+        cdpaths = env.get('CDPATH', '.').split(';')
+        for cdpath in cdpaths:
+            p = os.path.join(cdpath, directory)
+            if os.path.isdir(p):
+                curpath = p
+                break
+    
+    if curpath is None:
+        curpath = directory
+    curpath = os.path.join(env['PWD'], directory)
+
+    env['OLDPWD'] = env['PWD']
+    env['PWD'] = curpath
+    if printdir:
+        stdout.write('%s\n' % curpath)
+    return 0
+
+#-------------------------------------------------------------------------------  
+# colon utility
+#-------------------------------------------------------------------------------  
+def utility_colon(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# echo utility
+#-------------------------------------------------------------------------------  
+def utility_echo(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    # Echo only takes arguments, no options. Use printf if you need fancy stuff.
+    output = ' '.join(args) + '\n'
+    stdout.write(output)
+    stdout.flush()
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# egrep utility
+#-------------------------------------------------------------------------------
+# egrep is usually a shell script.
+# Unfortunately, pysh does not support shell scripts *with arguments* right now,
+# so the redirection is implemented here, assuming grep is available.
+def utility_egrep(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    return run_command('grep', ['-E'] + args, interp, env, stdin, stdout, 
+        stderr, debugflags)
+    
+#-------------------------------------------------------------------------------  
+# env utility
+#-------------------------------------------------------------------------------  
+def utility_env(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    
+    if args and args[0]=='-i':
+        raise NotImplementedError('env: -i option is not implemented')
+    
+    i = 0
+    for arg in args:
+        if '=' not in arg:
+            break
+        # Update the current environment
+        name, value = arg.split('=', 1)
+        env[name] = value
+        i += 1
+        
+    if args[i:]:
+        # Find then execute the specified interpreter
+        utility = env.find_in_path(args[i])
+        if not utility:
+            return 127
+        args[i:i+1] = utility
+        name = args[i]
+        args = args[i+1:]
+        try:
+            return run_command(name, args, interp, env, stdin, stdout, stderr, 
+                debugflags)
+        except UtilityError:
+            stderr.write('env: failed to execute %s' % ' '.join([name]+args))
+            return 126            
+    else:
+        for pair in env.get_variables().iteritems():
+            stdout.write('%s=%s\n' % pair)
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# exit utility
+#-------------------------------------------------------------------------------
+def utility_exit(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    res = None
+    if args:
+        try:
+            res = int(args[0])
+        except ValueError:
+            res = None
+        if not 0<=res<=255:
+            res = None
+            
+    if res is None:
+        # BUG: should be last executed command exit code
+        res = 0
+        
+    raise ExitSignal(res)
+
+#-------------------------------------------------------------------------------  
+# fgrep utility
+#-------------------------------------------------------------------------------
+# see egrep
+def utility_fgrep(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    return run_command('grep', ['-F'] + args, interp, env, stdin, stdout, 
+        stderr, debugflags)
+
+#-------------------------------------------------------------------------------  
+# gunzip utility
+#-------------------------------------------------------------------------------
+# see egrep
+def utility_gunzip(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    return run_command('gzip', ['-d'] + args, interp, env, stdin, stdout, 
+        stderr, debugflags)
+    
+#-------------------------------------------------------------------------------  
+# kill utility
+#-------------------------------------------------------------------------------
+def utility_kill(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    for arg in args:
+        pid = int(arg)
+        status = subprocess.call(['pskill', '/T', str(pid)],
+                                shell=True,
+                                stdout=subprocess.PIPE,
+                                stderr=subprocess.PIPE)
+        # pskill is asynchronous, hence the stupid polling loop
+        while 1:
+            p = subprocess.Popen(['pslist', str(pid)],
+                                shell=True,
+                                stdout=subprocess.PIPE,
+                                stderr=subprocess.STDOUT)
+            output = p.communicate()[0]
+            if ('process %d was not' % pid) in output:
+                break
+            time.sleep(1)
+    return status
+    
+#-------------------------------------------------------------------------------  
+# mkdir utility
+#-------------------------------------------------------------------------------
+OPT_MKDIR = NonExitingParser("mkdir - make directories.")
+OPT_MKDIR.add_option('-p', action='store_true', dest='has_p', default=False)
+
+def utility_mkdir(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    # TODO: implement umask
+    # TODO: implement proper utility error report
+    option, args = OPT_MKDIR.parse_args(args)
+    for arg in args:
+        path = os.path.join(env['PWD'], arg)
+        if option.has_p:
+            try:
+                os.makedirs(path)
+            except IOError as e:
+                if e.errno != errno.EEXIST:
+                    raise
+        else:               
+            os.mkdir(path)
+    return 0
+
+#-------------------------------------------------------------------------------  
+# netstat utility
+#-------------------------------------------------------------------------------
+def utility_netstat(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    # Do you really expect me to implement netstat ?
+    # This empty form is enough for Mercurial tests since it's
+    # supposed to generate nothing upon success. Faking this test
+    # is not a big deal either.
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# pwd utility
+#-------------------------------------------------------------------------------  
+OPT_PWD = NonExitingParser("pwd - return working directory name")
+OPT_PWD.add_option('-L', action='store_true', dest='has_L', default=True,
+    help="""If the PWD environment variable contains an absolute pathname of \
+    the current directory that does not contain the filenames dot or dot-dot, \
+    pwd shall write this pathname to standard output. Otherwise, the -L option \
+    shall behave as the -P option.""")
+OPT_PWD.add_option('-P', action='store_true', dest='has_L', default=False,
+    help="""The absolute pathname written shall not contain filenames that, in \
+    the context of the pathname, refer to files of type symbolic link.""")
+
+def utility_pwd(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    option, args = OPT_PWD.parse_args(args)        
+    stdout.write('%s\n' % env['PWD'])
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# printf utility
+#-------------------------------------------------------------------------------
+RE_UNESCAPE = re.compile(r'(\\x[a-zA-Z0-9]{2}|\\[0-7]{1,3}|\\.)')
+
+def utility_printf(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    def replace(m):
+        assert m.group()
+        g = m.group()[1:]
+        if g.startswith('x'):
+            return chr(int(g[1:], 16))
+        if len(g) <= 3 and len([c for c in g if c in '01234567']) == len(g):
+            # Yay, an octal number
+            return chr(int(g, 8))
+        return {
+            'a': '\a',
+            'b': '\b',
+            'f': '\f',
+            'n': '\n',
+            'r': '\r',
+            't': '\t',
+            'v': '\v',
+            '\\': '\\',
+        }.get(g)
+        
+    # Convert escape sequences
+    format = re.sub(RE_UNESCAPE, replace, args[0])
+    stdout.write(format % tuple(args[1:]))
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# true utility
+#-------------------------------------------------------------------------------
+def utility_true(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    return 0
+
+#-------------------------------------------------------------------------------  
+# sed utility
+#-------------------------------------------------------------------------------
+RE_SED = re.compile(r'^s(.).*\1[a-zA-Z]*$')
+
+# cygwin sed fails with some expressions when they do not end with a single space.
+# see unit tests for details. Interestingly, the same expressions works perfectly
+# in cygwin shell.
+def utility_sed(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    # Scan pattern arguments and append a space if necessary
+    for i in xrange(len(args)):
+        if not RE_SED.search(args[i]):
+            continue
+        args[i] = args[i] + ' '
+
+    return run_command(name, args, interp, env, stdin, stdout, 
+        stderr, debugflags)
+
+#-------------------------------------------------------------------------------  
+# sleep utility
+#-------------------------------------------------------------------------------
+def utility_sleep(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    time.sleep(int(args[0]))
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# sort utility
+#-------------------------------------------------------------------------------
+OPT_SORT = NonExitingParser("sort - sort, merge, or sequence check text files")
+
+def utility_sort(name, args, interp, env, stdin, stdout, stderr, debugflags):
+
+    def sort(path):
+        if path == '-':
+            lines = stdin.readlines()
+        else:
+            try:
+                f = file(path)
+                try:
+                    lines = f.readlines()
+                finally:
+                    f.close()
+            except IOError as e:
+                stderr.write(str(e) + '\n')
+                return 1
+        
+        if lines and lines[-1][-1]!='\n':
+            lines[-1] = lines[-1] + '\n'
+        return lines
+    
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    option, args = OPT_SORT.parse_args(args)
+    alllines = []
+    
+    if len(args)<=0:
+        args += ['-']
+        
+    # Load all files lines
+    curdir = os.getcwd()
+    try:
+        os.chdir(env['PWD'])
+        for path in args:
+            alllines += sort(path)
+    finally:
+        os.chdir(curdir)
+            
+    alllines.sort()
+    for line in alllines:
+        stdout.write(line)
+    return 0
+    
+#-------------------------------------------------------------------------------
+# hg utility
+#-------------------------------------------------------------------------------
+
+hgcommands = [
+    'add',
+    'addremove',
+    'commit', 'ci',
+    'debugrename',
+    'debugwalk',
+    'falabala', # Dummy command used in a mercurial test
+    'incoming',
+    'locate',
+    'pull',
+    'push',
+    'qinit',
+    'remove', 'rm',
+    'rename', 'mv',
+    'revert',    
+    'showconfig',
+    'status', 'st',
+    'strip',
+    ]
+
+def rewriteslashes(name, args):
+    # Several hg commands output file paths, rewrite the separators
+    if len(args) > 1 and name.lower().endswith('python') \
+       and args[0].endswith('hg'):
+        for cmd in hgcommands:
+            if cmd in args[1:]:
+                return True
+            
+    # svn output contains many paths with OS specific separators.
+    # Normalize these to unix paths.
+    base = os.path.basename(name)
+    if base.startswith('svn'):
+        return True
+    
+    return False
+
+def rewritehg(output):
+    if not output:
+        return output
+    # Rewrite os specific messages
+    output = output.replace(': The system cannot find the file specified',
+                            ': No such file or directory')
+    output = re.sub(': Access is denied.*$', ': Permission denied', output)
+    output = output.replace(': No connection could be made because the target machine actively refused it',
+                            ': Connection refused')
+    return output
+                            
+
+def run_command(name, args, interp, env, stdin, stdout,
+                stderr, debugflags):
+    # Execute the command
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    hgbin = interp.options().hgbinary
+    ishg = hgbin and ('hg' in name or args and 'hg' in args[0])
+    unixoutput = 'cygwin' in name or ishg
+    
+    exec_env = env.get_variables()        
+    try:
+        # BUG: comparing file descriptor is clearly not a reliable way to tell
+        # whether they point on the same underlying object. But in pysh limited
+        # scope this is usually right, we do not expect complicated redirections
+        # besides usual 2>&1.
+        # Still there is one case we have but cannot deal with is when stdout
+        # and stderr are redirected *by pysh caller*. This the reason for the
+        # --redirect pysh() option.
+        # Now, we want to know they are the same because we sometimes need to 
+        # transform the command output, mostly remove CR-LF to ensure that
+        # command output is unix-like. Cygwin utilies are a special case because
+        # they explicitely set their output streams to binary mode, so we have
+        # nothing to do. For all others commands, we have to guess whether they
+        # are sending text data, in which case the transformation must be done.
+        # Again, the NUL character test is unreliable but should be enough for
+        # hg tests.
+        redirected = stdout.fileno()==stderr.fileno()
+        if not redirected:
+            p = subprocess.Popen([name] + args, cwd=env['PWD'], env=exec_env, 
+                    stdin=stdin, stdout=subprocess.PIPE, stderr=subprocess.PIPE)
+        else:
+            p = subprocess.Popen([name] + args, cwd=env['PWD'], env=exec_env, 
+                    stdin=stdin, stdout=subprocess.PIPE, stderr=subprocess.STDOUT)
+        out, err = p.communicate()
+    except WindowsError as e:
+        raise UtilityError(str(e))
+
+    if not unixoutput:
+        def encode(s):
+            if '\0' in s:
+                return s
+            return s.replace('\r\n', '\n')
+    else:
+        encode = lambda s: s
+
+    if rewriteslashes(name, args):
+        encode1_ = encode
+        def encode(s):
+            s = encode1_(s)
+            s = s.replace('\\\\', '\\')
+            s = s.replace('\\', '/')
+            return s
+
+    if ishg:
+        encode2_ = encode
+        def encode(s):
+            return rewritehg(encode2_(s))
+    
+    stdout.write(encode(out))
+    if not redirected:
+        stderr.write(encode(err))
+    return p.returncode
+            

bitbake/lib/bb/pysh/lsprof.py

@@ -0,0 +1,116 @@
+#! /usr/bin/env python
+
+import sys
+from _lsprof import Profiler, profiler_entry
+
+__all__ = ['profile', 'Stats']
+
+def profile(f, *args, **kwds):
+    """XXX docstring"""
+    p = Profiler()
+    p.enable(subcalls=True, builtins=True)
+    try:
+        f(*args, **kwds)
+    finally:
+        p.disable()
+    return Stats(p.getstats())
+
+
+class Stats(object):
+    """XXX docstring"""
+
+    def __init__(self, data):
+        self.data = data
+
+    def sort(self, crit="inlinetime"):
+        """XXX docstring"""
+        if crit not in profiler_entry.__dict__:
+            raise ValueError("Can't sort by %s" % crit)
+        self.data.sort(lambda b, a: cmp(getattr(a, crit),
+                                        getattr(b, crit)))
+        for e in self.data:
+            if e.calls:
+                e.calls.sort(lambda b, a: cmp(getattr(a, crit),
+                                              getattr(b, crit)))
+
+    def pprint(self, top=None, file=None, limit=None, climit=None):
+        """XXX docstring"""
+        if file is None:
+            file = sys.stdout
+        d = self.data
+        if top is not None:
+            d = d[:top]
+        cols = "% 12s %12s %11.4f %11.4f   %s\n"
+        hcols = "% 12s %12s %12s %12s %s\n"
+        cols2 = "+%12s %12s %11.4f %11.4f +  %s\n"
+        file.write(hcols % ("CallCount", "Recursive", "Total(ms)",
+                            "Inline(ms)", "module:lineno(function)"))
+        count = 0
+        for e in d:
+            file.write(cols % (e.callcount, e.reccallcount, e.totaltime,
+                               e.inlinetime, label(e.code)))
+            count += 1
+            if limit is not None and count == limit:
+                return
+            ccount = 0
+            if e.calls:
+                for se in e.calls:
+                    file.write(cols % ("+%s" % se.callcount, se.reccallcount,
+                                       se.totaltime, se.inlinetime,
+                                       "+%s" % label(se.code)))
+                    count += 1
+                    ccount += 1
+                    if limit is not None and count == limit:
+                        return
+                    if climit is not None and ccount == climit:
+                        break
+
+    def freeze(self):
+        """Replace all references to code objects with string
+        descriptions; this makes it possible to pickle the instance."""
+
+        # this code is probably rather ickier than it needs to be!
+        for i in range(len(self.data)):
+            e = self.data[i]
+            if not isinstance(e.code, str):
+                self.data[i] = type(e)((label(e.code),) + e[1:])
+            if e.calls:
+                for j in range(len(e.calls)):
+                    se = e.calls[j]
+                    if not isinstance(se.code, str):
+                        e.calls[j] = type(se)((label(se.code),) + se[1:])
+
+_fn2mod = {}
+
+def label(code):
+    if isinstance(code, str):
+        return code
+    try:
+        mname = _fn2mod[code.co_filename]
+    except KeyError:
+        for k, v in sys.modules.items():
+            if v is None:
+                continue
+            if not hasattr(v, '__file__'):
+                continue
+            if not isinstance(v.__file__, str):
+                continue
+            if v.__file__.startswith(code.co_filename):
+                mname = _fn2mod[code.co_filename] = k
+                break
+        else:
+            mname = _fn2mod[code.co_filename] = '<%s>'%code.co_filename
+
+    return '%s:%d(%s)' % (mname, code.co_firstlineno, code.co_name)
+
+
+if __name__ == '__main__':
+    import os
+    sys.argv = sys.argv[1:]
+    if not sys.argv:
+        print >> sys.stderr, "usage: lsprof.py <script> <arguments...>"
+        sys.exit(2)
+    sys.path.insert(0, os.path.abspath(os.path.dirname(sys.argv[0])))
+    stats = profile(execfile, sys.argv[0], globals(), locals())
+    stats.sort()
+    stats.pprint()

bitbake/lib/bb/pysh/pysh.py

@@ -0,0 +1,167 @@
+# pysh.py - command processing for pysh.
+#
+# Copyright 2007 Patrick Mezard
+#
+# This software may be used and distributed according to the terms
+# of the GNU General Public License, incorporated herein by reference.
+
+import optparse
+import os
+import sys
+
+import interp
+
+SH_OPT = optparse.OptionParser(prog='pysh', usage="%prog [OPTIONS]", version='0.1')
+SH_OPT.add_option('-c', action='store_true', dest='command_string', default=None, 
+    help='A string that shall be interpreted by the shell as one or more commands')
+SH_OPT.add_option('--redirect-to', dest='redirect_to', default=None, 
+    help='Redirect script commands stdout and stderr to the specified file')
+# See utility_command in builtin.py about the reason for this flag.
+SH_OPT.add_option('--redirected', dest='redirected', action='store_true', default=False, 
+    help='Tell the interpreter that stdout and stderr are actually the same objects, which is really stdout')
+SH_OPT.add_option('--debug-parsing', action='store_true', dest='debug_parsing', default=False, 
+    help='Trace PLY execution')
+SH_OPT.add_option('--debug-tree', action='store_true', dest='debug_tree', default=False, 
+    help='Display the generated syntax tree.')
+SH_OPT.add_option('--debug-cmd', action='store_true', dest='debug_cmd', default=False, 
+    help='Trace command execution before parameters expansion and exit status.')
+SH_OPT.add_option('--debug-utility', action='store_true', dest='debug_utility', default=False, 
+    help='Trace utility calls, after parameters expansions')
+SH_OPT.add_option('--ast', action='store_true', dest='ast', default=False,
+    help='Encoded commands to execute in a subprocess')
+SH_OPT.add_option('--profile', action='store_true', default=False,
+    help='Profile pysh run')
+    
+    
+def split_args(args):
+    # Separate shell arguments from command ones
+    # Just stop at the first argument not starting with a dash. I know, this is completely broken,
+    # it ignores files starting with a dash or may take option values for command file. This is not
+    # supposed to happen for now
+    command_index = len(args)
+    for i,arg in enumerate(args):
+        if not arg.startswith('-'):
+            command_index = i
+            break
+            
+    return args[:command_index], args[command_index:]
+
+
+def fixenv(env):
+    path = env.get('PATH')
+    if path is not None:
+        parts = path.split(os.pathsep)
+        # Remove Windows utilities from PATH, they are useless at best and
+        # some of them (find) may be confused with other utilities.
+        parts = [p for p in parts if 'system32' not in p.lower()]
+        env['PATH'] = os.pathsep.join(parts)
+    if env.get('HOME') is None:
+        # Several utilities, including cvsps, cannot work without
+        # a defined HOME directory.
+        env['HOME'] = os.path.expanduser('~')
+    return env
+
+def _sh(cwd, shargs, cmdargs, options, debugflags=None, env=None):
+    if os.environ.get('PYSH_TEXT') != '1':
+        import msvcrt
+        for fp in (sys.stdin, sys.stdout, sys.stderr):
+            msvcrt.setmode(fp.fileno(), os.O_BINARY)
+
+    hgbin = os.environ.get('PYSH_HGTEXT') != '1'
+    
+    if debugflags is None:
+        debugflags = []
+        if options.debug_parsing:    debugflags.append('debug-parsing')
+        if options.debug_utility:    debugflags.append('debug-utility')
+        if options.debug_cmd:        debugflags.append('debug-cmd')
+        if options.debug_tree:       debugflags.append('debug-tree')
+    
+    if env is None:
+        env = fixenv(dict(os.environ))
+    if cwd is None:
+        cwd = os.getcwd()
+
+    if not cmdargs:
+        # Nothing to do
+        return 0
+
+    ast = None
+    command_file = None
+    if options.command_string:
+        input = cmdargs[0]
+        if not options.ast:
+            input += '\n'
+        else:
+            args, input = interp.decodeargs(input), None
+            env, ast = args
+            cwd = env.get('PWD', cwd)
+    else:
+        command_file = cmdargs[0]
+        arguments = cmdargs[1:]
+
+        prefix = interp.resolve_shebang(command_file, ignoreshell=True)
+        if prefix:
+            input = ' '.join(prefix + [command_file] + arguments)
+        else:
+            # Read commands from file
+            f = file(command_file)
+            try:
+                # Trailing newline to help the parser
+                input = f.read() + '\n'
+            finally:
+                f.close()
+    
+    redirect = None
+    try:
+        if options.redirected:
+            stdout = sys.stdout
+            stderr = stdout
+        elif options.redirect_to:
+            redirect = open(options.redirect_to, 'wb')
+            stdout = redirect
+            stderr = redirect
+        else:
+            stdout = sys.stdout
+            stderr = sys.stderr
+            
+        # TODO: set arguments to environment variables
+        opts = interp.Options()
+        opts.hgbinary = hgbin
+        ip = interp.Interpreter(cwd, debugflags, stdout=stdout, stderr=stderr,
+                                opts=opts)
+        try:
+            # Export given environment in shell object
+            for k,v in env.iteritems():
+                ip.get_env().export(k,v)
+            return ip.execute_script(input, ast, scriptpath=command_file)
+        finally:
+            ip.close()
+    finally:
+        if redirect is not None:
+            redirect.close()
+
+def sh(cwd=None, args=None, debugflags=None, env=None):
+    if args is None:
+        args = sys.argv[1:]
+    shargs, cmdargs = split_args(args)
+    options, shargs = SH_OPT.parse_args(shargs)
+
+    if options.profile:
+        import lsprof
+        p = lsprof.Profiler()
+        p.enable(subcalls=True)
+        try:
+            return _sh(cwd, shargs, cmdargs, options, debugflags, env)
+        finally:
+            p.disable()
+            stats = lsprof.Stats(p.getstats())
+            stats.sort()
+            stats.pprint(top=10, file=sys.stderr, climit=5)
+    else:
+        return _sh(cwd, shargs, cmdargs, options, debugflags, env)
+            
+def main():
+    sys.exit(sh())
+
+if __name__=='__main__':
+    main()

bitbake/lib/bb/pysh/pyshlex.py

@@ -0,0 +1,888 @@
+# pyshlex.py - PLY compatible lexer for pysh.
+#
+# Copyright 2007 Patrick Mezard
+#
+# This software may be used and distributed according to the terms
+# of the GNU General Public License, incorporated herein by reference.
+
+# TODO:
+# - review all "char in 'abc'" snippets: the empty string can be matched
+# - test line continuations within quoted/expansion strings
+# - eof is buggy wrt sublexers
+# - the lexer cannot really work in pull mode as it would be required to run
+# PLY in pull mode. It was designed to work incrementally and it would not be
+# that hard to enable pull mode.
+import re
+try:
+    s = set()
+    del s
+except NameError:
+    from Set import Set as set
+
+from ply import lex
+from sherrors import *
+
+class NeedMore(Exception):
+    pass
+
+def is_blank(c):
+    return c in (' ', '\t')
+    
+_RE_DIGITS = re.compile(r'^\d+$')
+
+def are_digits(s):
+    return _RE_DIGITS.search(s) is not None
+
+_OPERATORS = dict([
+    ('&&', 'AND_IF'),
+    ('||', 'OR_IF'),
+    (';;', 'DSEMI'),
+    ('<<', 'DLESS'),
+    ('>>', 'DGREAT'),
+    ('<&', 'LESSAND'),
+    ('>&', 'GREATAND'),
+    ('<>', 'LESSGREAT'),
+    ('<<-', 'DLESSDASH'),
+    ('>|', 'CLOBBER'),
+    ('&', 'AMP'),
+    (';', 'COMMA'),
+    ('<', 'LESS'),
+    ('>', 'GREATER'),
+    ('(', 'LPARENS'),
+    (')', 'RPARENS'),
+])
+
+#Make a function to silence pychecker "Local variable shadows global"
+def make_partial_ops():
+    partials = {}
+    for k in _OPERATORS:
+        for i in range(1, len(k)+1):
+            partials[k[:i]] = None
+    return partials  
+
+_PARTIAL_OPERATORS = make_partial_ops()    
+        
+def is_partial_op(s):
+    """Return True if s matches a non-empty subpart of an operator starting
+    at its first character.
+    """
+    return s in _PARTIAL_OPERATORS
+    
+def is_op(s):
+    """If s matches an operator, returns the operator identifier. Return None
+    otherwise.
+    """
+    return _OPERATORS.get(s)
+
+_RESERVEDS = dict([
+    ('if', 'If'),
+    ('then', 'Then'),
+    ('else', 'Else'),
+    ('elif', 'Elif'),
+    ('fi', 'Fi'),
+    ('do', 'Do'),
+    ('done', 'Done'),
+    ('case', 'Case'),
+    ('esac', 'Esac'),
+    ('while', 'While'),
+    ('until', 'Until'),
+    ('for', 'For'),
+    ('{', 'Lbrace'),
+    ('}', 'Rbrace'),
+    ('!', 'Bang'),
+    ('in', 'In'),
+    ('|', 'PIPE'),
+])
+    
+def get_reserved(s):
+    return _RESERVEDS.get(s)
+    
+_RE_NAME = re.compile(r'^[0-9a-zA-Z_]+$')
+
+def is_name(s):
+    return _RE_NAME.search(s) is not None
+
+def find_chars(seq, chars):
+    for i,v in enumerate(seq):
+        if v in chars:
+            return i,v
+    return -1, None
+
+class WordLexer:
+    """WordLexer parse quoted or expansion expressions and return an expression
+    tree. The input string can be any well formed sequence beginning with quoting
+    or expansion character. Embedded expressions are handled recursively. The
+    resulting tree is made of lists and strings. Lists represent quoted or
+    expansion expressions. Each list first element is the opening separator,
+    the last one the closing separator. In-between can be any number of strings
+    or lists for sub-expressions. Non quoted/expansion expression can written as
+    strings or as lists with empty strings as starting and ending delimiters.
+    """
+
+    NAME_CHARSET = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789_'
+    NAME_CHARSET = dict(zip(NAME_CHARSET, NAME_CHARSET))
+    
+    SPECIAL_CHARSET = '@*#?-$!0'
+    
+    #Characters which can be escaped depends on the current delimiters
+    ESCAPABLE = {
+        '`': set(['$', '\\', '`']),
+        '"': set(['$', '\\', '`', '"']),
+        "'": set(),
+    }
+        
+    def __init__(self, heredoc = False):
+        # _buffer is the unprocessed input characters buffer
+        self._buffer = []
+        # _stack is empty or contains a quoted list being processed
+        # (this is the DFS path to the quoted expression being evaluated).
+        self._stack = []
+        self._escapable = None
+        # True when parsing unquoted here documents
+        self._heredoc = heredoc
+        
+    def add(self, data, eof=False):
+        """Feed the lexer with more data. If the quoted expression can be
+        delimited, return a tuple (expr, remaining) containing the expression
+        tree and the unconsumed data.
+        Otherwise, raise NeedMore.
+        """
+        self._buffer += list(data)
+        self._parse(eof)
+        
+        result = self._stack[0]
+        remaining = ''.join(self._buffer)
+        self._stack = []
+        self._buffer = []
+        return result, remaining
+        
+    def _is_escapable(self, c, delim=None):
+        if delim is None:
+            if self._heredoc:
+                # Backslashes works as if they were double quoted in unquoted
+                # here-documents
+                delim = '"'
+            else:
+                if len(self._stack)<=1:
+                    return True
+                delim = self._stack[-2][0]
+            
+        escapables = self.ESCAPABLE.get(delim, None)
+        return escapables is None or c in escapables
+        
+    def _parse_squote(self, buf, result, eof):
+        if not buf:
+            raise NeedMore()
+        try:
+            pos = buf.index("'")
+        except ValueError:
+            raise NeedMore()
+        result[-1] += ''.join(buf[:pos])
+        result += ["'"]
+        return pos+1, True
+        
+    def _parse_bquote(self, buf, result, eof):
+        if not buf:
+            raise NeedMore()
+            
+        if buf[0]=='\n':
+            #Remove line continuations
+            result[:] = ['', '', '']
+        elif self._is_escapable(buf[0]):
+            result[-1] += buf[0]
+            result += ['']
+        else:
+            #Keep as such
+            result[:] = ['', '\\'+buf[0], '']
+        
+        return 1, True
+        
+    def _parse_dquote(self, buf, result, eof):
+        if not buf:
+            raise NeedMore()
+        pos, sep = find_chars(buf, '$\\`"')
+        if pos==-1:
+            raise NeedMore()
+            
+        result[-1] += ''.join(buf[:pos])
+        if sep=='"':
+            result += ['"']
+            return pos+1, True
+        else:
+            #Keep everything until the separator and defer processing
+            return pos, False
+            
+    def _parse_command(self, buf, result, eof):
+        if not buf:
+            raise NeedMore()
+
+        chars = '$\\`"\''
+        if result[0] == '$(':
+            chars += ')'
+        pos, sep = find_chars(buf, chars)
+        if pos == -1:
+            raise NeedMore()
+            
+        result[-1] += ''.join(buf[:pos])
+        if (result[0]=='$(' and sep==')') or (result[0]=='`' and sep=='`'):
+            result += [sep]
+            return pos+1, True
+        else:
+            return pos, False
+            
+    def _parse_parameter(self, buf, result, eof):
+        if not buf:
+            raise NeedMore()
+            
+        pos, sep = find_chars(buf, '$\\`"\'}')
+        if pos==-1:
+            raise NeedMore()
+            
+        result[-1] += ''.join(buf[:pos])
+        if sep=='}':
+            result += [sep]
+            return pos+1, True
+        else:
+            return pos, False
+            
+    def _parse_dollar(self, buf, result, eof):
+        sep = result[0]
+        if sep=='$':            
+            if not buf:
+                #TODO: handle empty $
+                raise NeedMore()
+            if buf[0]=='(':
+                if len(buf)==1:
+                    raise NeedMore()
+                    
+                if buf[1]=='(':
+                    result[0] = '$(('
+                    buf[:2] = []
+                else:
+                    result[0] = '$('
+                    buf[:1] = []
+                
+            elif buf[0]=='{':
+                result[0] = '${'
+                buf[:1] = []
+            else:
+                if buf[0] in self.SPECIAL_CHARSET:
+                    result[-1] = buf[0]
+                    read = 1
+                else:
+                    for read,c in enumerate(buf):
+                        if c not in self.NAME_CHARSET:
+                            break
+                    else:
+                        if not eof:
+                            raise NeedMore()
+                        read += 1
+                        
+                    result[-1] += ''.join(buf[0:read])
+                    
+                if not result[-1]:
+                    result[:] = ['', result[0], '']
+                else:
+                    result += [''] 
+                return read,True
+        
+        sep = result[0]    
+        if sep=='$(':
+            parsefunc = self._parse_command
+        elif sep=='${':
+            parsefunc = self._parse_parameter
+        else:
+            raise NotImplementedError()
+            
+        pos, closed = parsefunc(buf, result, eof)
+        return pos, closed
+
+    def _parse(self, eof):
+        buf = self._buffer
+        stack = self._stack
+        recurse = False
+    
+        while 1:
+            if not stack or recurse:
+                if not buf:
+                    raise NeedMore()
+                if buf[0] not in ('"\\`$\''):
+                    raise ShellSyntaxError('Invalid quoted string sequence')
+                stack.append([buf[0], ''])
+                buf[:1] = []
+                recurse = False
+                
+            result = stack[-1]
+            if result[0]=="'":
+                parsefunc = self._parse_squote
+            elif result[0]=='\\':
+                parsefunc = self._parse_bquote
+            elif result[0]=='"':
+                parsefunc = self._parse_dquote
+            elif result[0]=='`':
+                parsefunc = self._parse_command
+            elif result[0][0]=='$':
+                parsefunc = self._parse_dollar
+            else:
+                raise NotImplementedError()
+                
+            read, closed = parsefunc(buf, result, eof)
+                
+            buf[:read] = []
+            if closed:
+                if len(stack)>1:
+                    #Merge in parent expression
+                    parsed = stack.pop()
+                    stack[-1] += [parsed]
+                    stack[-1] += ['']
+                else:
+                    break
+            else:
+                recurse = True
+
+def normalize_wordtree(wtree):
+    """Fold back every literal sequence (delimited with empty strings) into
+    parent sequence.
+    """
+    def normalize(wtree):
+        result = []
+        for part in wtree[1:-1]:
+            if isinstance(part, list):
+                part = normalize(part)
+                if part[0]=='':
+                    #Move the part content back at current level
+                    result += part[1:-1]
+                    continue
+            elif not part:
+                #Remove empty strings
+                continue
+            result.append(part)
+        if not result:
+            result = ['']    
+        return [wtree[0]] + result + [wtree[-1]]
+                
+    return normalize(wtree)
+    
+                
+def make_wordtree(token, here_document=False):
+    """Parse a delimited token and return a tree similar to the ones returned by
+    WordLexer. token may contain any combinations of expansion/quoted fields and
+    non-ones.
+    """    
+    tree = ['']
+    remaining = token
+    delimiters = '\\$`'
+    if not here_document:
+        delimiters += '\'"'
+    
+    while 1:
+        pos, sep = find_chars(remaining, delimiters)
+        if pos==-1:
+            tree += [remaining, '']
+            return normalize_wordtree(tree)
+        tree.append(remaining[:pos])
+        remaining = remaining[pos:]
+        
+        try:
+            result, remaining = WordLexer(heredoc = here_document).add(remaining, True)
+        except NeedMore:
+            raise ShellSyntaxError('Invalid token "%s"')
+        tree.append(result)
+        
+                
+def wordtree_as_string(wtree):
+    """Rewrite an expression tree generated by make_wordtree as string."""
+    def visit(node, output):
+        for child in node:
+            if isinstance(child, list):
+                visit(child, output)
+            else:
+                output.append(child)
+    
+    output = []
+    visit(wtree, output)
+    return ''.join(output)
+    
+    
+def unquote_wordtree(wtree):
+    """Fold the word tree while removing quotes everywhere. Other expansion
+    sequences are joined as such.
+    """
+    def unquote(wtree):
+        unquoted = []
+        if wtree[0] in ('', "'", '"', '\\'):
+            wtree = wtree[1:-1]
+            
+        for part in wtree:
+            if isinstance(part, list):
+                part = unquote(part)
+            unquoted.append(part)
+        return ''.join(unquoted)
+            
+    return unquote(wtree)
+    
+    
+class HereDocLexer:
+    """HereDocLexer delimits whatever comes from the here-document starting newline
+    not included to the closing delimiter line included.
+    """
+    def __init__(self, op, delim):
+        assert op in ('<<', '<<-')
+        if not delim:
+            raise ShellSyntaxError('invalid here document delimiter %s' % str(delim))
+            
+        self._op = op
+        self._delim = delim
+        self._buffer = []
+        self._token = []
+        
+    def add(self, data, eof):
+        """If the here-document was delimited, return a tuple (content, remaining).
+        Raise NeedMore() otherwise.
+        """
+        self._buffer += list(data)
+        self._parse(eof)
+        token = ''.join(self._token)
+        remaining = ''.join(self._buffer)
+        self._token, self._remaining = [], []
+        return token, remaining
+    
+    def _parse(self, eof):
+        while 1:
+            #Look for first unescaped newline. Quotes may be ignored
+            escaped = False
+            for i,c in enumerate(self._buffer):
+                if escaped:
+                    escaped = False
+                elif c=='\\':
+                    escaped = True
+                elif c=='\n':
+                    break
+            else:
+                i = -1
+                    
+            if i==-1 or self._buffer[i]!='\n':
+                if not eof:
+                    raise NeedMore()
+                #No more data, maybe the last line is closing delimiter
+                line = ''.join(self._buffer)
+                eol = ''
+                self._buffer[:] = []
+            else:
+                line = ''.join(self._buffer[:i])
+                eol = self._buffer[i]
+                self._buffer[:i+1] = []
+            
+            if self._op=='<<-':
+                line = line.lstrip('\t')
+                
+            if line==self._delim:
+                break
+                
+            self._token += [line, eol]
+            if i==-1:
+                break
+    
+class Token:
+    #TODO: check this is still in use
+    OPERATOR = 'OPERATOR'
+    WORD = 'WORD'
+    
+    def __init__(self):
+        self.value = ''
+        self.type = None
+        
+    def __getitem__(self, key):
+        #Behave like a two elements tuple
+        if key==0:
+            return self.type
+        if key==1:
+            return self.value
+        raise IndexError(key)
+               
+               
+class HereDoc:
+    def __init__(self, op, name=None):
+        self.op = op
+        self.name = name
+        self.pendings = []
+               
+TK_COMMA        = 'COMMA'
+TK_AMPERSAND    = 'AMP'
+TK_OP           = 'OP'
+TK_TOKEN        = 'TOKEN'
+TK_COMMENT      = 'COMMENT'
+TK_NEWLINE      = 'NEWLINE' 
+TK_IONUMBER     = 'IO_NUMBER'
+TK_ASSIGNMENT   = 'ASSIGNMENT_WORD'
+TK_HERENAME     = 'HERENAME'
+
+class Lexer:
+    """Main lexer.
+    
+    Call add() until the script AST is returned.
+    """
+    # Here-document handling makes the whole thing more complex because they basically
+    # force tokens to be reordered: here-content must come right after the operator
+    # and the here-document name, while some other tokens might be following the
+    # here-document expression on the same line.
+    #
+    # So, here-doc states are basically:
+    #   *self._state==ST_NORMAL
+    #       - self._heredoc.op is None: no here-document
+    #       - self._heredoc.op is not None but name is: here-document operator matched,
+    #           waiting for the document name/delimiter
+    #       - self._heredoc.op and name are not None: here-document is ready, following
+    #           tokens are being stored and will be pushed again when the document is
+    #           completely parsed.
+    #   *self._state==ST_HEREDOC
+    #       - The here-document is being delimited by self._herelexer. Once it is done
+    #           the content is pushed in front of the pending token list then all these
+    #           tokens are pushed once again.
+    ST_NORMAL       = 'ST_NORMAL'
+    ST_OP           = 'ST_OP'
+    ST_BACKSLASH    = 'ST_BACKSLASH'
+    ST_QUOTED       = 'ST_QUOTED'
+    ST_COMMENT      = 'ST_COMMENT'
+    ST_HEREDOC      = 'ST_HEREDOC'
+    
+    #Match end of backquote strings
+    RE_BACKQUOTE_END = re.compile(r'(?<!\\)(`)')
+
+    def __init__(self, parent_state = None):
+        self._input = []
+        self._pos = 0
+        
+        self._token = ''
+        self._type = TK_TOKEN
+        
+        self._state = self.ST_NORMAL
+        self._parent_state = parent_state
+        self._wordlexer = None
+        
+        self._heredoc = HereDoc(None)
+        self._herelexer = None
+        
+        ### Following attributes are not used for delimiting token and can safely
+        ### be changed after here-document detection (see _push_toke)
+        
+        # Count the number of tokens following a 'For' reserved word. Needed to
+        # return an 'In' reserved word if it comes in third place.
+        self._for_count = None
+        
+    def add(self, data, eof=False):
+        """Feed the lexer with data.
+        
+        When eof is set to True, returns unconsumed data or raise if the lexer
+        is in the middle of a delimiting operation.
+        Raise NeedMore otherwise.
+        """
+        self._input += list(data)
+        self._parse(eof)
+        self._input[:self._pos] = []
+        return ''.join(self._input)
+        
+    def _parse(self, eof):            
+        while self._state:
+            if self._pos>=len(self._input):
+                if not eof:
+                    raise NeedMore()
+                elif self._state not in (self.ST_OP, self.ST_QUOTED, self.ST_HEREDOC):
+                    #Delimit the current token and leave cleanly
+                    self._push_token('')
+                    break
+                else:
+                    #Let the sublexer handle the eof themselves
+                    pass
+                
+            if self._state==self.ST_NORMAL:
+                self._parse_normal()
+            elif self._state==self.ST_COMMENT:
+                self._parse_comment()
+            elif self._state==self.ST_OP:
+                self._parse_op(eof)
+            elif self._state==self.ST_QUOTED:
+                self._parse_quoted(eof)
+            elif self._state==self.ST_HEREDOC:
+                self._parse_heredoc(eof)
+            else:
+                assert False, "Unknown state " + str(self._state)
+                
+        if self._heredoc.op is not None:
+            raise ShellSyntaxError('missing here-document delimiter')
+                
+    def _parse_normal(self):
+        c = self._input[self._pos]
+        if c=='\n':
+            self._push_token(c)
+            self._token = c
+            self._type = TK_NEWLINE
+            self._push_token('')
+            self._pos += 1
+        elif c in ('\\', '\'', '"', '`', '$'):
+            self._state = self.ST_QUOTED
+        elif is_partial_op(c):
+            self._push_token(c)
+            
+            self._type = TK_OP
+            self._token += c
+            self._pos += 1
+            self._state = self.ST_OP
+        elif is_blank(c):
+            self._push_token(c)
+            
+            #Discard blanks
+            self._pos += 1
+        elif self._token:
+            self._token += c
+            self._pos += 1
+        elif c=='#':
+            self._state = self.ST_COMMENT
+            self._type = TK_COMMENT
+            self._pos += 1
+        else:
+            self._pos += 1
+            self._token += c          
+                
+    def _parse_op(self, eof):
+        assert self._token
+        
+        while 1:
+            if self._pos>=len(self._input):
+                if not eof:
+                    raise NeedMore()
+                c = ''
+            else:                
+                c = self._input[self._pos]
+                
+            op = self._token + c
+            if c and is_partial_op(op):
+                #Still parsing an operator
+                self._token = op
+                self._pos += 1
+            else:            
+                #End of operator
+                self._push_token(c)                    
+                self._state = self.ST_NORMAL
+                break
+                
+    def _parse_comment(self):
+        while 1:
+            if self._pos>=len(self._input):
+                raise NeedMore()
+                
+            c = self._input[self._pos]
+            if c=='\n':
+                #End of comment, do not consume the end of line
+                self._state = self.ST_NORMAL
+                break
+            else:
+                self._token += c
+                self._pos += 1
+                
+    def _parse_quoted(self, eof):
+        """Precondition: the starting backquote/dollar is still in the input queue."""
+        if not self._wordlexer:
+            self._wordlexer = WordLexer()
+        
+        if self._pos<len(self._input):
+             #Transfer input queue character into the subparser
+            input = self._input[self._pos:]
+            self._pos += len(input)
+            
+        wtree, remaining = self._wordlexer.add(input, eof)
+        self._wordlexer = None
+        self._token += wordtree_as_string(wtree)
+        
+        #Put unparsed character back in the input queue
+        if remaining:
+            self._input[self._pos:self._pos] = list(remaining)          
+        self._state = self.ST_NORMAL
+        
+    def _parse_heredoc(self, eof):
+        assert not self._token
+        
+        if self._herelexer is None:
+            self._herelexer = HereDocLexer(self._heredoc.op, self._heredoc.name)
+        
+        if self._pos<len(self._input):
+             #Transfer input queue character into the subparser
+            input = self._input[self._pos:]
+            self._pos += len(input)
+        
+        self._token, remaining = self._herelexer.add(input, eof)
+        
+        #Reset here-document state
+        self._herelexer = None
+        heredoc, self._heredoc = self._heredoc, HereDoc(None)
+        if remaining:
+            self._input[self._pos:self._pos] = list(remaining)
+        self._state = self.ST_NORMAL
+        
+        #Push pending tokens
+        heredoc.pendings[:0] = [(self._token, self._type, heredoc.name)]
+        for token, type, delim in heredoc.pendings:
+            self._token = token
+            self._type = type
+            self._push_token(delim)
+                     
+    def _push_token(self, delim):
+        if not self._token:
+            return 0
+            
+        if self._heredoc.op is not None:
+            if self._heredoc.name is None:
+                #Here-document name
+                if self._type!=TK_TOKEN:
+                    raise ShellSyntaxError("expecting here-document name, got '%s'" % self._token)
+                self._heredoc.name = unquote_wordtree(make_wordtree(self._token))
+                self._type = TK_HERENAME
+            else:
+                #Capture all tokens until the newline starting the here-document
+                if self._type==TK_NEWLINE:
+                    assert self._state==self.ST_NORMAL
+                    self._state = self.ST_HEREDOC    
+                
+                self._heredoc.pendings.append((self._token, self._type, delim))    
+                self._token = ''
+                self._type = TK_TOKEN
+                return 1
+                
+        # BEWARE: do not change parser state from here to the end of the function:
+        # when parsing between an here-document operator to the end of the line
+        # tokens are stored in self._heredoc.pendings. Therefore, they will not
+        # reach the section below.
+                    
+        #Check operators
+        if self._type==TK_OP:
+            #False positive because of partial op matching
+            op = is_op(self._token)
+            if not op:
+                self._type = TK_TOKEN
+            else:
+                #Map to the specific operator
+                self._type = op
+                if self._token in ('<<', '<<-'):
+                    #Done here rather than in _parse_op because there is no need
+                    #to change the parser state since we are still waiting for
+                    #the here-document name
+                    if self._heredoc.op is not None:
+                        raise ShellSyntaxError("syntax error near token '%s'" % self._token)
+                    assert self._heredoc.op is None
+                    self._heredoc.op = self._token
+                
+        if self._type==TK_TOKEN:            
+            if '=' in self._token and not delim:
+                if self._token.startswith('='):
+                    #Token is a WORD... a TOKEN that is.
+                    pass
+                else:
+                    prev = self._token[:self._token.find('=')]
+                    if is_name(prev):
+                        self._type = TK_ASSIGNMENT
+                    else:
+                        #Just a token (unspecified)
+                        pass
+            else:
+                reserved = get_reserved(self._token)
+                if reserved is not None:
+                    if reserved=='In' and self._for_count!=2:
+                        #Sorry, not a reserved word after all
+                        pass
+                    else:
+                        self._type = reserved
+                        if reserved in ('For', 'Case'):
+                            self._for_count = 0                    
+                elif are_digits(self._token) and delim in ('<', '>'):
+                    #Detect IO_NUMBER
+                    self._type = TK_IONUMBER
+                elif self._token==';':
+                    self._type = TK_COMMA
+                elif self._token=='&':
+                    self._type = TK_AMPERSAND
+        elif self._type==TK_COMMENT:
+            #Comments are not part of sh grammar, ignore them
+            self._token = ''
+            self._type = TK_TOKEN
+            return 0
+        
+        if self._for_count is not None:
+            #Track token count in 'For' expression to detect 'In' reserved words.
+            #Can only be in third position, no need to go beyond
+            self._for_count += 1
+            if self._for_count==3:
+                self._for_count = None
+                
+        self.on_token((self._token, self._type))
+        self._token = ''
+        self._type = TK_TOKEN
+        return 1
+                        
+    def on_token(self, token):
+        raise NotImplementedError
+                 
+
+tokens = [
+    TK_TOKEN,
+# To silence yacc unused token warnings
+#    TK_COMMENT,
+    TK_NEWLINE,
+    TK_IONUMBER,
+    TK_ASSIGNMENT,
+    TK_HERENAME,
+]            
+
+#Add specific operators
+tokens += _OPERATORS.values()
+#Add reserved words
+tokens += _RESERVEDS.values()
+            
+class PLYLexer(Lexer):
+    """Bridge Lexer and PLY lexer interface."""
+    def __init__(self):
+        Lexer.__init__(self)
+        self._tokens = []
+        self._current = 0
+        self.lineno = 0
+
+    def on_token(self, token):
+        value, type = token
+
+        self.lineno = 0
+        t = lex.LexToken()
+        t.value = value
+        t.type = type
+        t.lexer = self
+        t.lexpos = 0
+        t.lineno = 0
+        
+        self._tokens.append(t)
+        
+    def is_empty(self):
+        return not bool(self._tokens)
+        
+    #PLY compliant interface
+    def token(self):
+        if self._current>=len(self._tokens):
+            return None
+        t = self._tokens[self._current]
+        self._current += 1
+        return t      
+        
+        
+def get_tokens(s):
+    """Parse the input string and return a tuple (tokens, unprocessed) where
+    tokens is a list of parsed tokens and unprocessed is the part of the input
+    string left untouched by the lexer.
+    """
+    lexer = PLYLexer()
+    untouched = lexer.add(s, True) 
+    tokens = []
+    while 1:
+        token = lexer.token()
+        if token is None:
+            break
+        tokens.append(token)
+        
+    tokens = [(t.value, t.type) for t in tokens]
+    return tokens, untouched        

bitbake/lib/bb/pysh/pyshyacc.py

@@ -0,0 +1,779 @@
+# pyshyacc.py - PLY grammar definition for pysh
+#
+# Copyright 2007 Patrick Mezard
+#
+# This software may be used and distributed according to the terms
+# of the GNU General Public License, incorporated herein by reference.
+
+"""PLY grammar file.
+"""
+import os.path
+import sys
+
+import pyshlex
+tokens = pyshlex.tokens
+
+from ply import yacc
+import sherrors
+    
+class IORedirect:
+    def __init__(self, op, filename, io_number=None):
+        self.op = op
+        self.filename = filename
+        self.io_number = io_number
+        
+class HereDocument:
+    def __init__(self, op, name, content, io_number=None):
+        self.op = op
+        self.name = name
+        self.content = content
+        self.io_number = io_number
+
+def make_io_redirect(p):
+    """Make an IORedirect instance from the input 'io_redirect' production."""
+    name, io_number, io_target = p
+    assert name=='io_redirect'
+    
+    if io_target[0]=='io_file':
+        io_type, io_op, io_file = io_target
+        return IORedirect(io_op, io_file, io_number)
+    elif io_target[0]=='io_here':
+        io_type, io_op, io_name, io_content = io_target
+        return HereDocument(io_op, io_name, io_content, io_number)
+    else:
+        assert False, "Invalid IO redirection token %s" % repr(io_type)
+        
+class SimpleCommand:
+    """
+    assigns contains (name, value) pairs.
+    """
+    def __init__(self, words, redirs, assigns):
+        self.words = list(words)
+        self.redirs = list(redirs)
+        self.assigns = list(assigns)
+
+class Pipeline:
+    def __init__(self, commands, reverse_status=False):
+        self.commands = list(commands)
+        assert self.commands    #Grammar forbids this
+        self.reverse_status = reverse_status
+        
+class AndOr:
+    def __init__(self, op, left, right):
+        self.op = str(op)
+        self.left = left
+        self.right = right
+        
+class ForLoop:
+    def __init__(self, name, items, cmds):
+        self.name = str(name)
+        self.items = list(items)
+        self.cmds = list(cmds)
+        
+class WhileLoop:
+    def __init__(self, condition, cmds):
+        self.condition = list(condition)
+        self.cmds = list(cmds)
+        
+class UntilLoop:
+    def __init__(self, condition, cmds):
+        self.condition = list(condition)
+        self.cmds = list(cmds)
+
+class FunDef:
+    def __init__(self, name, body):
+        self.name = str(name)
+        self.body = body
+        
+class BraceGroup:
+    def __init__(self, cmds):
+        self.cmds = list(cmds)
+        
+class IfCond:
+    def __init__(self, cond, if_cmds, else_cmds):
+        self.cond = list(cond)
+        self.if_cmds = if_cmds
+        self.else_cmds = else_cmds
+
+class Case:
+    def __init__(self, name, items):
+        self.name = name
+        self.items = items
+        
+class SubShell:
+    def __init__(self, cmds):
+        self.cmds = cmds
+
+class RedirectList:
+    def __init__(self, cmd, redirs):
+        self.cmd = cmd
+        self.redirs = list(redirs)
+        
+def get_production(productions, ptype):
+    """productions must be a list of production tuples like (name, obj) where
+    name is the production string identifier.
+    Return the first production named 'ptype'. Raise KeyError if None can be
+    found.
+    """
+    for production in productions:
+        if production is not None and production[0]==ptype:
+            return production
+    raise KeyError(ptype)
+    
+#-------------------------------------------------------------------------------
+# PLY grammar definition
+#-------------------------------------------------------------------------------
+
+def p_multiple_commands(p):
+    """multiple_commands : newline_sequence
+                         | complete_command
+                         | multiple_commands complete_command"""
+    if len(p)==2:
+        if p[1] is not None:
+            p[0] = [p[1]]
+        else:
+            p[0] = []
+    else:
+        p[0] = p[1] + [p[2]]
+
+def p_complete_command(p):
+    """complete_command : list separator
+                        | list"""
+    if len(p)==3 and p[2] and p[2][1] == '&':
+        p[0] = ('async', p[1])
+    else:
+        p[0] = p[1]
+                 
+def p_list(p):
+    """list : list separator_op and_or
+            |                   and_or"""
+    if len(p)==2:
+        p[0] = [p[1]]
+    else:
+        #if p[2]!=';':
+        #    raise NotImplementedError('AND-OR list asynchronous execution is not implemented')
+        p[0] = p[1] + [p[3]]
+       
+def p_and_or(p):
+    """and_or : pipeline
+              | and_or AND_IF linebreak pipeline
+              | and_or OR_IF  linebreak pipeline"""
+    if len(p)==2:
+        p[0] = p[1]
+    else:
+        p[0] = ('and_or', AndOr(p[2], p[1], p[4]))
+        
+def p_maybe_bang_word(p):
+    """maybe_bang_word : Bang"""
+    p[0] = ('maybe_bang_word', p[1])
+            
+def p_pipeline(p):
+    """pipeline : pipe_sequence
+                | bang_word pipe_sequence"""
+    if len(p)==3:
+        p[0] = ('pipeline', Pipeline(p[2][1:], True))
+    else:
+        p[0] = ('pipeline', Pipeline(p[1][1:]))
+
+def p_pipe_sequence(p):
+    """pipe_sequence : command
+                     | pipe_sequence PIPE linebreak command"""
+    if len(p)==2:
+        p[0] = ['pipe_sequence', p[1]]
+    else:
+        p[0] = p[1] + [p[4]]
+
+def p_command(p):
+    """command : simple_command
+               | compound_command
+               | compound_command redirect_list
+               | function_definition"""
+        
+    if p[1][0] in ( 'simple_command', 
+                    'for_clause',
+                    'while_clause',
+                    'until_clause',
+                    'case_clause',
+                    'if_clause',
+                    'function_definition',
+                    'subshell',
+                    'brace_group',):
+        if len(p) == 2:
+            p[0] = p[1]
+        else:
+            p[0] = ('redirect_list', RedirectList(p[1], p[2][1:]))
+    else:
+        raise NotImplementedError('%s command is not implemented' % repr(p[1][0]))
+
+def p_compound_command(p):
+    """compound_command : brace_group
+                        | subshell
+                        | for_clause
+                        | case_clause
+                        | if_clause
+                        | while_clause
+                        | until_clause"""
+    p[0] = p[1]
+
+def p_subshell(p):
+    """subshell : LPARENS compound_list RPARENS"""
+    p[0] = ('subshell', SubShell(p[2][1:]))
+
+def p_compound_list(p):
+    """compound_list : term
+                     | newline_list term
+                     |              term separator
+                     | newline_list term separator"""
+    productions = p[1:]           
+    try:
+        sep = get_production(productions, 'separator')
+        if sep[1]!=';':
+            raise NotImplementedError()
+    except KeyError:
+        pass
+    term = get_production(productions, 'term')
+    p[0] = ['compound_list'] + term[1:]
+
+def p_term(p):
+    """term : term separator and_or
+            |                and_or"""
+    if len(p)==2:
+        p[0] = ['term', p[1]]
+    else:
+        if p[2] is not None and p[2][1] == '&':
+            p[0] = ['term', ('async', p[1][1:])] + [p[3]]
+        else:
+            p[0] = p[1] + [p[3]]
+            
+def p_maybe_for_word(p):
+    # Rearrange 'For' priority wrt TOKEN. See p_for_word
+    """maybe_for_word : For"""
+    p[0] = ('maybe_for_word', p[1])
+
+def p_for_clause(p):
+    """for_clause : for_word name linebreak                            do_group
+                  | for_word name linebreak in          sequential_sep do_group
+                  | for_word name linebreak in wordlist sequential_sep do_group"""
+    productions = p[1:]
+    do_group = get_production(productions, 'do_group')
+    try:
+        items = get_production(productions, 'in')[1:]
+    except KeyError:
+        raise NotImplementedError('"in" omission is not implemented')
+        
+    try:
+        items = get_production(productions, 'wordlist')[1:]
+    except KeyError:
+        items = []
+        
+    name = p[2]
+    p[0] = ('for_clause', ForLoop(name, items, do_group[1:]))
+
+def p_name(p):
+    """name : token""" #Was NAME instead of token
+    p[0] = p[1]
+
+def p_in(p):
+    """in : In"""
+    p[0] = ('in', p[1])
+
+def p_wordlist(p):
+    """wordlist : wordlist token
+                |          token"""
+    if len(p)==2:
+        p[0] = ['wordlist', ('TOKEN', p[1])]
+    else:
+        p[0] = p[1] + [('TOKEN', p[2])]
+
+def p_case_clause(p):
+    """case_clause : Case token linebreak in linebreak case_list    Esac
+                   | Case token linebreak in linebreak case_list_ns Esac
+                   | Case token linebreak in linebreak              Esac"""
+    if len(p) < 8:
+        items = []
+    else:
+        items = p[6][1:]
+    name = p[2]
+    p[0] = ('case_clause', Case(name, [c[1] for c in items]))
+       
+def p_case_list_ns(p):
+    """case_list_ns : case_list case_item_ns
+                    |           case_item_ns"""
+    p_case_list(p)
+      
+def p_case_list(p):
+    """case_list : case_list case_item
+                 |           case_item"""
+    if len(p)==2:
+        p[0] = ['case_list', p[1]]
+    else:
+        p[0] = p[1] + [p[2]]
+        
+def p_case_item_ns(p):
+    """case_item_ns :         pattern RPARENS               linebreak
+                    |         pattern RPARENS compound_list linebreak
+                    | LPARENS pattern RPARENS               linebreak
+                    | LPARENS pattern RPARENS compound_list linebreak"""
+    p_case_item(p)
+                 
+def p_case_item(p):
+    """case_item :         pattern RPARENS linebreak     DSEMI linebreak
+                 |         pattern RPARENS compound_list DSEMI linebreak
+                 | LPARENS pattern RPARENS linebreak     DSEMI linebreak
+                 | LPARENS pattern RPARENS compound_list DSEMI linebreak"""
+    if len(p) < 7:
+        name = p[1][1:]
+    else:
+        name = p[2][1:]
+
+    try:
+        cmds = get_production(p[1:], "compound_list")[1:]
+    except KeyError:
+        cmds = []
+
+    p[0] = ('case_item', (name, cmds))
+                 
+def p_pattern(p):
+    """pattern :              token
+               | pattern PIPE token"""
+    if len(p)==2:
+        p[0] = ['pattern', ('TOKEN', p[1])]
+    else:
+        p[0] = p[1] + [('TOKEN', p[2])]
+
+def p_maybe_if_word(p):
+    # Rearrange 'If' priority wrt TOKEN. See p_if_word
+    """maybe_if_word : If"""
+    p[0] = ('maybe_if_word', p[1])
+
+def p_maybe_then_word(p):
+    # Rearrange 'Then' priority wrt TOKEN. See p_then_word
+    """maybe_then_word : Then"""
+    p[0] = ('maybe_then_word', p[1])
+                 
+def p_if_clause(p):
+    """if_clause : if_word compound_list then_word compound_list else_part Fi
+                 | if_word compound_list then_word compound_list           Fi"""
+    else_part = []
+    if len(p)==7:
+        else_part = p[5]
+    p[0] = ('if_clause', IfCond(p[2][1:], p[4][1:], else_part))
+                 
+def p_else_part(p):
+    """else_part : Elif compound_list then_word compound_list else_part
+                 | Elif compound_list then_word compound_list
+                 | Else compound_list"""
+    if len(p)==3:
+        p[0] = p[2][1:]
+    else:
+        else_part = []
+        if len(p)==6:
+            else_part = p[5]
+        p[0] = ('elif', IfCond(p[2][1:], p[4][1:], else_part))
+                 
+def p_while_clause(p):
+    """while_clause : While compound_list do_group"""
+    p[0] = ('while_clause', WhileLoop(p[2][1:], p[3][1:]))
+    
+def p_maybe_until_word(p):
+    # Rearrange 'Until' priority wrt TOKEN. See p_until_word
+    """maybe_until_word : Until"""
+    p[0] = ('maybe_until_word', p[1])
+           
+def p_until_clause(p):
+    """until_clause : until_word compound_list do_group"""
+    p[0] = ('until_clause', UntilLoop(p[2][1:], p[3][1:]))
+                 
+def p_function_definition(p):
+    """function_definition : fname LPARENS RPARENS linebreak function_body"""
+    p[0] = ('function_definition', FunDef(p[1], p[5]))
+                 
+def p_function_body(p):
+    """function_body : compound_command
+                     | compound_command redirect_list"""
+    if len(p)!=2:
+        raise NotImplementedError('functions redirections lists are not implemented')    
+    p[0] = p[1]    
+
+def p_fname(p):
+    """fname : TOKEN""" #Was NAME instead of token
+    p[0] = p[1]
+
+def p_brace_group(p):
+    """brace_group : Lbrace compound_list Rbrace"""
+    p[0] = ('brace_group', BraceGroup(p[2][1:]))
+
+def p_maybe_done_word(p):
+    #See p_assignment_word for details.
+    """maybe_done_word : Done"""
+    p[0] = ('maybe_done_word', p[1])
+
+def p_maybe_do_word(p):
+    """maybe_do_word : Do"""
+    p[0] = ('maybe_do_word', p[1])
+
+def p_do_group(p):
+    """do_group : do_word compound_list done_word"""
+    #Do group contains a list of AndOr
+    p[0] = ['do_group'] + p[2][1:]
+
+def p_simple_command(p):
+    """simple_command : cmd_prefix cmd_word cmd_suffix
+                      | cmd_prefix cmd_word
+                      | cmd_prefix
+                      | cmd_name cmd_suffix
+                      | cmd_name"""
+    words, redirs, assigns = [], [], []
+    for e in p[1:]:
+        name = e[0]
+        if name in ('cmd_prefix', 'cmd_suffix'):
+            for sube in e[1:]:
+                subname = sube[0]
+                if subname=='io_redirect':
+                    redirs.append(make_io_redirect(sube))
+                elif subname=='ASSIGNMENT_WORD':
+                    assigns.append(sube)
+                else:
+                    words.append(sube)
+        elif name in ('cmd_word', 'cmd_name'):
+            words.append(e)
+            
+    cmd = SimpleCommand(words, redirs, assigns)
+    p[0] = ('simple_command', cmd)
+
+def p_cmd_name(p):
+    """cmd_name : TOKEN"""
+    p[0] = ('cmd_name', p[1])
+    
+def p_cmd_word(p):
+    """cmd_word : token"""
+    p[0] = ('cmd_word', p[1])
+
+def p_maybe_assignment_word(p):
+    #See p_assignment_word for details.
+    """maybe_assignment_word : ASSIGNMENT_WORD"""
+    p[0] = ('maybe_assignment_word', p[1])
+    
+def p_cmd_prefix(p):
+    """cmd_prefix :            io_redirect
+                  | cmd_prefix io_redirect
+                  |            assignment_word
+                  | cmd_prefix assignment_word"""
+    try:
+        prefix = get_production(p[1:], 'cmd_prefix')
+    except KeyError:
+        prefix = ['cmd_prefix']
+        
+    try:
+        value = get_production(p[1:], 'assignment_word')[1]
+        value = ('ASSIGNMENT_WORD', value.split('=', 1))
+    except KeyError:        
+        value = get_production(p[1:], 'io_redirect')
+    p[0] = prefix + [value]
+                                  
+def p_cmd_suffix(p):
+    """cmd_suffix   :            io_redirect
+                    | cmd_suffix io_redirect
+                    |            token
+                    | cmd_suffix token
+                    |            maybe_for_word
+                    | cmd_suffix maybe_for_word
+                    |            maybe_done_word
+                    | cmd_suffix maybe_done_word
+                    |            maybe_do_word
+                    | cmd_suffix maybe_do_word
+                    |            maybe_until_word
+                    | cmd_suffix maybe_until_word
+                    |            maybe_assignment_word
+                    | cmd_suffix maybe_assignment_word
+                    |            maybe_if_word
+                    | cmd_suffix maybe_if_word
+                    |            maybe_then_word
+                    | cmd_suffix maybe_then_word
+                    |            maybe_bang_word
+                    | cmd_suffix maybe_bang_word"""
+    try:
+        suffix = get_production(p[1:], 'cmd_suffix')
+        token = p[2]
+    except KeyError:
+        suffix = ['cmd_suffix']
+        token = p[1]
+        
+    if isinstance(token, tuple):
+        if token[0]=='io_redirect':
+            p[0] = suffix + [token]
+        else:
+            #Convert maybe_*  to TOKEN if necessary
+            p[0] = suffix + [('TOKEN', token[1])]
+    else:
+        p[0] = suffix + [('TOKEN', token)]
+                 
+def p_redirect_list(p):
+    """redirect_list : io_redirect
+                     | redirect_list io_redirect"""
+    if len(p) == 2:
+        p[0] = ['redirect_list', make_io_redirect(p[1])]
+    else:
+        p[0] = p[1] + [make_io_redirect(p[2])]
+    
+def p_io_redirect(p):
+    """io_redirect :           io_file
+                   | IO_NUMBER io_file
+                   |           io_here
+                   | IO_NUMBER io_here"""
+    if len(p)==3:
+        p[0] = ('io_redirect', p[1], p[2])
+    else:
+        p[0] = ('io_redirect', None, p[1])
+    
+def p_io_file(p):
+    #Return the tuple (operator, filename)
+    """io_file : LESS      filename
+               | LESSAND   filename
+               | GREATER   filename
+               | GREATAND  filename
+               | DGREAT    filename
+               | LESSGREAT filename
+               | CLOBBER   filename"""
+    #Extract the filename from the file
+    p[0] = ('io_file', p[1], p[2][1])
+
+def p_filename(p):
+    #Return the filename
+    """filename : TOKEN"""
+    p[0] = ('filename', p[1])
+        
+def p_io_here(p):
+    """io_here : DLESS here_end
+               | DLESSDASH here_end"""
+    p[0] = ('io_here', p[1], p[2][1], p[2][2])
+
+def p_here_end(p):
+    """here_end : HERENAME TOKEN"""
+    p[0] = ('here_document', p[1], p[2])
+    
+def p_newline_sequence(p):
+    # Nothing in the grammar can handle leading NEWLINE productions, so add
+    # this one with the lowest possible priority relatively to newline_list.
+    """newline_sequence : newline_list"""
+    p[0] = None
+    
+def p_newline_list(p):
+    """newline_list : NEWLINE
+                    | newline_list NEWLINE"""
+    p[0] = None
+                    
+def p_linebreak(p):
+    """linebreak : newline_list
+                 | empty"""
+    p[0] = None
+
+def p_separator_op(p):                 
+    """separator_op : COMMA
+                    | AMP"""
+    p[0] = p[1]
+
+def p_separator(p):
+    """separator : separator_op linebreak
+                 | newline_list"""
+    if len(p)==2:
+        #Ignore newlines
+        p[0] = None
+    else:
+        #Keep the separator operator
+        p[0] = ('separator', p[1])
+                 
+def p_sequential_sep(p):
+    """sequential_sep : COMMA linebreak
+                      | newline_list"""
+    p[0] = None
+
+# Low priority TOKEN => for_word conversion.
+# Let maybe_for_word be used as a token when necessary in higher priority
+# rules. 
+def p_for_word(p):
+    """for_word : maybe_for_word"""
+    p[0] = p[1]
+
+def p_if_word(p):
+    """if_word : maybe_if_word"""
+    p[0] = p[1]
+
+def p_then_word(p):
+    """then_word : maybe_then_word"""
+    p[0] = p[1]
+
+def p_done_word(p):
+    """done_word : maybe_done_word"""
+    p[0] = p[1]
+
+def p_do_word(p):
+    """do_word : maybe_do_word"""
+    p[0] = p[1]
+    
+def p_until_word(p):
+    """until_word : maybe_until_word"""
+    p[0] = p[1]
+    
+def p_assignment_word(p):
+    """assignment_word : maybe_assignment_word"""
+    p[0] = ('assignment_word', p[1][1])
+    
+def p_bang_word(p):
+    """bang_word : maybe_bang_word"""
+    p[0] = ('bang_word', p[1][1])
+
+def p_token(p):
+    """token : TOKEN
+             | Fi"""
+    p[0] = p[1]
+
+def p_empty(p):
+    'empty :'
+    p[0] = None
+    
+# Error rule for syntax errors
+def p_error(p):
+    msg = []
+    w = msg.append
+    w('%r\n' % p)
+    w('followed by:\n')
+    for i in range(5):
+        n = yacc.token()
+        if not n:
+            break
+        w('  %r\n' % n)
+    raise sherrors.ShellSyntaxError(''.join(msg))
+
+# Build the parser
+try:
+    import pyshtables
+except ImportError:
+    outputdir = os.path.dirname(__file__)
+    if not os.access(outputdir, os.W_OK):
+        outputdir = ''
+    yacc.yacc(tabmodule = 'pyshtables', outputdir = outputdir, debug = 0)
+else:
+    yacc.yacc(tabmodule = 'pysh.pyshtables', write_tables = 0, debug = 0)
+
+
+def parse(input, eof=False, debug=False):
+    """Parse a whole script at once and return the generated AST and unconsumed
+    data in a tuple.
+    
+    NOTE: eof is probably meaningless for now, the parser being unable to work
+    in pull mode. It should be set to True.
+    """
+    lexer = pyshlex.PLYLexer()
+    remaining = lexer.add(input, eof)
+    if lexer.is_empty():
+        return [], remaining
+    if debug:
+        debug = 2
+    return yacc.parse(lexer=lexer, debug=debug), remaining
+
+#-------------------------------------------------------------------------------
+# AST rendering helpers
+#-------------------------------------------------------------------------------    
+
+def format_commands(v):
+    """Return a tree made of strings and lists. Make command trees easier to
+    display.
+    """
+    if isinstance(v, list):
+        return [format_commands(c) for c in v]
+    if isinstance(v, tuple):
+        if len(v)==2 and isinstance(v[0], str) and not isinstance(v[1], str):
+            if v[0] == 'async':
+                return ['AsyncList', map(format_commands, v[1])]
+            else:
+                #Avoid decomposing tuples like ('pipeline', Pipeline(...))
+                return format_commands(v[1])
+        return format_commands(list(v))
+    elif isinstance(v, IfCond):
+        name = ['IfCond']
+        name += ['if', map(format_commands, v.cond)]
+        name += ['then', map(format_commands, v.if_cmds)]
+        name += ['else', map(format_commands, v.else_cmds)]
+        return name
+    elif isinstance(v, ForLoop):
+        name = ['ForLoop']
+        name += [repr(v.name)+' in ', map(str, v.items)]
+        name += ['commands', map(format_commands, v.cmds)]
+        return name
+    elif isinstance(v, AndOr):
+        return [v.op, format_commands(v.left), format_commands(v.right)]
+    elif isinstance(v, Pipeline):
+        name = 'Pipeline'
+        if v.reverse_status:
+            name = '!' + name
+        return [name, format_commands(v.commands)]
+    elif isinstance(v, Case):
+        name = ['Case']
+        name += [v.name, format_commands(v.items)]
+    elif isinstance(v, SimpleCommand):
+        name = ['SimpleCommand']
+        if v.words:                
+            name += ['words', map(str, v.words)]
+        if v.assigns:
+            assigns = [tuple(a[1]) for a in v.assigns]
+            name += ['assigns', map(str, assigns)]
+        if v.redirs:
+            name += ['redirs', map(format_commands, v.redirs)]
+        return name
+    elif isinstance(v, RedirectList):
+        name = ['RedirectList']
+        if v.redirs:
+            name += ['redirs', map(format_commands, v.redirs)]
+        name += ['command', format_commands(v.cmd)]
+        return name
+    elif isinstance(v, IORedirect):
+        return ' '.join(map(str, (v.io_number, v.op, v.filename)))
+    elif isinstance(v, HereDocument):
+        return ' '.join(map(str, (v.io_number, v.op, repr(v.name), repr(v.content))))
+    elif isinstance(v, SubShell):
+        return ['SubShell', map(format_commands, v.cmds)]
+    else:
+        return repr(v)
+             
+def print_commands(cmds, output=sys.stdout):
+    """Pretty print a command tree."""
+    def print_tree(cmd, spaces, output):
+        if isinstance(cmd, list):
+            for c in cmd:
+                print_tree(c, spaces + 3, output)              
+        else:
+            print >>output, ' '*spaces + str(cmd)
+    
+    formatted = format_commands(cmds)
+    print_tree(formatted, 0, output)
+    
+    
+def stringify_commands(cmds): 
+    """Serialize a command tree as a string.
+    
+    Returned string is not pretty and is currently used for unit tests only.
+    """   
+    def stringify(value):
+        output = []
+        if isinstance(value, list):
+            formatted = []
+            for v in value:
+                formatted.append(stringify(v))
+            formatted = ' '.join(formatted)
+            output.append(''.join(['<', formatted, '>']))
+        else:
+            output.append(value)
+        return ' '.join(output)
+            
+    return stringify(format_commands(cmds))
+    
+        
+def visit_commands(cmds, callable):
+    """Visit the command tree and execute callable on every Pipeline and 
+    SimpleCommand instances.
+    """
+    if isinstance(cmds, (tuple, list)):
+        map(lambda c: visit_commands(c,callable), cmds)
+    elif isinstance(cmds, (Pipeline, SimpleCommand)):
+        callable(cmds)

bitbake/lib/bb/pysh/sherrors.py

@@ -0,0 +1,41 @@
+# sherrors.py - shell errors and signals
+#
+# Copyright 2007 Patrick Mezard
+#
+# This software may be used and distributed according to the terms
+# of the GNU General Public License, incorporated herein by reference.
+
+"""Define shell exceptions and error codes.
+"""
+
+class ShellError(Exception):
+    pass
+
+class ShellSyntaxError(ShellError):
+    pass
+    
+class UtilityError(ShellError):
+    """Raised upon utility syntax error (option or operand error)."""
+    pass
+   
+class ExpansionError(ShellError):
+    pass
+     
+class CommandNotFound(ShellError):
+    """Specified command was not found."""
+    pass
+    
+class RedirectionError(ShellError):
+    pass
+    
+class VarAssignmentError(ShellError):
+    """Variable assignment error."""
+    pass
+    
+class ExitSignal(ShellError):
+    """Exit signal."""
+    pass
+    
+class ReturnSignal(ShellError):
+    """Exit signal."""
+    pass

bitbake/lib/bb/pysh/subprocess_fix.py

@@ -0,0 +1,77 @@
+# subprocess - Subprocesses with accessible I/O streams
+#
+# For more information about this module, see PEP 324.
+#
+# This module should remain compatible with Python 2.2, see PEP 291.
+#
+# Copyright (c) 2003-2005 by Peter Astrand <astrand@lysator.liu.se>
+#
+# Licensed to PSF under a Contributor Agreement.
+# See http://www.python.org/2.4/license for licensing details.
+
+def list2cmdline(seq):
+    """
+    Translate a sequence of arguments into a command line
+    string, using the same rules as the MS C runtime:
+
+    1) Arguments are delimited by white space, which is either a
+       space or a tab.
+
+    2) A string surrounded by double quotation marks is
+       interpreted as a single argument, regardless of white space
+       contained within.  A quoted string can be embedded in an
+       argument.
+
+    3) A double quotation mark preceded by a backslash is
+       interpreted as a literal double quotation mark.
+
+    4) Backslashes are interpreted literally, unless they
+       immediately precede a double quotation mark.
+
+    5) If backslashes immediately precede a double quotation mark,
+       every pair of backslashes is interpreted as a literal
+       backslash.  If the number of backslashes is odd, the last
+       backslash escapes the next double quotation mark as
+       described in rule 3.
+    """
+
+    # See
+    # http://msdn.microsoft.com/library/en-us/vccelng/htm/progs_12.asp
+    result = []
+    needquote = False
+    for arg in seq:
+        bs_buf = []
+
+        # Add a space to separate this argument from the others
+        if result:
+            result.append(' ')
+
+        needquote = (" " in arg) or ("\t" in arg) or ("|" in arg) or arg == ""
+        if needquote:
+            result.append('"')
+
+        for c in arg:
+            if c == '\\':
+                # Don't know if we need to double yet.
+                bs_buf.append(c)
+            elif c == '"':
+                # Double backspaces.
+                result.append('\\' * len(bs_buf)*2)
+                bs_buf = []
+                result.append('\\"')
+            else:
+                # Normal char
+                if bs_buf:
+                    result.extend(bs_buf)
+                    bs_buf = []
+                result.append(c)
+
+        # Add remaining backspaces, if any.
+        if bs_buf:
+            result.extend(bs_buf)
+
+        if needquote:
+            result.extend(bs_buf)
+            result.append('"')
+            
+    return ''.join(result)

bitbake/lib/bb/server/none.py

@@ -0,0 +1,203 @@
+#
+# BitBake 'dummy' Passthrough Server
+#
+# Copyright (C) 2006 - 2007  Michael 'Mickey' Lauer
+# Copyright (C) 2006 - 2008  Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+"""
+    This module implements a passthrough server for BitBake.
+
+    Use register_idle_function() to add a function which the server
+    calls from within idle_commands when no requests are pending. Make sure
+    that those functions are non-blocking or else you will introduce latency
+    in the server's main loop.
+"""
+
+import time
+import bb
+import signal
+
+DEBUG = False
+
+import inspect, select
+
+class BitBakeServerCommands():
+    def __init__(self, server):
+        self.server = server
+
+    def runCommand(self, command):
+        """
+        Run a cooker command on the server
+        """
+        #print "Running Command %s" % command
+        return self.cooker.command.runCommand(command)
+
+    def terminateServer(self):
+        """
+        Trigger the server to quit
+        """
+        self.server.server_exit()
+        #print "Server (cooker) exitting"
+        return
+
+    def ping(self):
+        """
+        Dummy method which can be used to check the server is still alive
+        """
+        return True
+
+eventQueue = []
+
+class BBUIEventQueue:
+    class event:
+        def __init__(self, parent):
+            self.parent = parent
+        @staticmethod
+        def send(event):
+            bb.server.none.eventQueue.append(event)
+        @staticmethod
+        def quit():
+            return
+
+    def __init__(self, BBServer):
+        self.eventQueue = bb.server.none.eventQueue
+        self.BBServer = BBServer
+        self.EventHandle = bb.event.register_UIHhandler(self)
+
+    def __popEvent(self):
+        if len(self.eventQueue) == 0:
+            return None
+        return self.eventQueue.pop(0)
+
+    def getEvent(self):
+        if len(self.eventQueue) == 0:
+          self.BBServer.idle_commands(0)
+        return self.__popEvent()
+
+    def waitEvent(self, delay):
+        event = self.__popEvent()
+        if event:
+            return event
+        self.BBServer.idle_commands(delay)
+        return self.__popEvent()
+
+    def queue_event(self, event):
+        self.eventQueue.append(event)
+
+    def system_quit( self ):
+        bb.event.unregister_UIHhandler(self.EventHandle)
+
+# Dummy signal handler to ensure we break out of sleep upon SIGCHLD
+def chldhandler(signum, stackframe):
+    pass
+
+class BitBakeNoneServer():
+    # remove this when you're done with debugging
+    # allow_reuse_address = True
+
+    def __init__(self):
+        self._idlefuns = {}
+        self.commands = BitBakeServerCommands(self)
+
+    def addcooker(self, cooker):
+        self.cooker = cooker
+        self.commands.cooker = cooker
+
+    def register_idle_function(self, function, data):
+        """Register a function to be called while the server is idle"""
+        assert hasattr(function, '__call__')
+        self._idlefuns[function] = data
+
+    def idle_commands(self, delay):
+        #print "Idle queue length %s" % len(self._idlefuns)
+        #print "Idle timeout, running idle functions"
+        #if len(self._idlefuns) == 0:
+        nextsleep = delay
+        for function, data in self._idlefuns.items():
+            try:
+                retval = function(self, data, False)
+                #print "Idle function returned %s" % (retval)
+                if retval is False:
+                    del self._idlefuns[function]
+                elif retval is True:
+                    nextsleep = None
+                elif nextsleep is None:
+                    continue
+                elif retval < nextsleep:
+                    nextsleep = retval
+            except SystemExit:
+                raise
+            except:
+                import traceback
+                traceback.print_exc()
+                self.commands.runCommand(["stateShutdown"])
+                pass
+        if nextsleep is not None:
+            #print "Sleeping for %s (%s)" % (nextsleep, delay)
+            signal.signal(signal.SIGCHLD, chldhandler)
+            time.sleep(nextsleep)
+            signal.signal(signal.SIGCHLD, signal.SIG_DFL)
+
+    def server_exit(self):
+        # Tell idle functions we're exiting
+        for function, data in self._idlefuns.items():
+            try:
+                retval = function(self, data, True)
+            except:
+                pass
+
+class BitBakeServerConnection():
+    def __init__(self, server):
+        self.server = server.server
+        self.connection = self.server.commands
+        self.events = bb.server.none.BBUIEventQueue(self.server)
+        for event in bb.event.ui_queue:
+            self.events.queue_event(event)
+
+    def terminate(self):
+        try:
+            self.events.system_quit()
+        except:
+            pass
+        try:
+            self.connection.terminateServer()
+        except:
+            pass
+
+class BitBakeServer(object):
+    def initServer(self):
+        self.server = BitBakeNoneServer()
+
+    def addcooker(self, cooker):
+        self.cooker = cooker
+        self.server.addcooker(cooker)
+
+    def getServerIdleCB(self):
+        return self.server.register_idle_function
+
+    def saveConnectionDetails(self):
+        return
+
+    def detach(self):
+        return
+
+    def establishConnection(self):
+        self.connection = BitBakeServerConnection(self)
+        return self.connection
+
+    def launchUI(self, uifunc, *args):
+        return bb.cooker.server_main(self.cooker, uifunc, *args)
+

bitbake/lib/bb/server/process.py

@@ -0,0 +1,270 @@
+#
+# BitBake Process based server.
+#
+# Copyright (C) 2010 Bob Foerster <robert@erafx.com>
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+"""
+    This module implements a multiprocessing.Process based server for bitbake.
+"""
+
+import bb
+import bb.event
+import itertools
+import logging
+import multiprocessing
+import os
+import signal
+import sys
+import time
+from Queue import Empty
+from multiprocessing import Event, Process, util, Queue, Pipe, queues
+
+logger = logging.getLogger('BitBake')
+
+class ServerCommunicator():
+    def __init__(self, connection):
+        self.connection = connection
+
+    def runCommand(self, command):
+        # @todo try/except
+        self.connection.send(command)
+
+        while True:
+            # don't let the user ctrl-c while we're waiting for a response
+            try:
+                if self.connection.poll(20):
+                    return self.connection.recv()
+                else:
+                    bb.fatal("Timeout while attempting to communicate with bitbake server")
+            except KeyboardInterrupt:
+                pass
+
+
+class EventAdapter():
+    """
+    Adapter to wrap our event queue since the caller (bb.event) expects to
+    call a send() method, but our actual queue only has put()
+    """
+    def __init__(self, queue):
+        self.queue = queue
+
+    def send(self, event):
+        try:
+            self.queue.put(event)
+        except Exception as err:
+            print("EventAdapter puked: %s" % str(err))
+
+
+class ProcessServer(Process):
+    profile_filename = "profile.log"
+    profile_processed_filename = "profile.log.processed"
+
+    def __init__(self, command_channel, event_queue):
+        Process.__init__(self)
+        self.command_channel = command_channel
+        self.event_queue = event_queue
+        self.event = EventAdapter(event_queue)
+        self._idlefunctions = {}
+        self.quit = False
+
+        self.keep_running = Event()
+        self.keep_running.set()
+
+    def register_idle_function(self, function, data):
+        """Register a function to be called while the server is idle"""
+        assert hasattr(function, '__call__')
+        self._idlefunctions[function] = data
+
+    def run(self):
+        for event in bb.event.ui_queue:
+            self.event_queue.put(event)
+        self.event_handle = bb.event.register_UIHhandler(self)
+        bb.cooker.server_main(self.cooker, self.main)
+
+    def main(self):
+        # Ignore SIGINT within the server, as all SIGINT handling is done by
+        # the UI and communicated to us
+        signal.signal(signal.SIGINT, signal.SIG_IGN)
+        while self.keep_running.is_set():
+            try:
+                if self.command_channel.poll():
+                    command = self.command_channel.recv()
+                    self.runCommand(command)
+
+                self.idle_commands(.1)
+            except Exception:
+                logger.exception('Running command %s', command)
+
+        self.event_queue.cancel_join_thread()
+        bb.event.unregister_UIHhandler(self.event_handle)
+        self.command_channel.close()
+        self.cooker.stop()
+        self.idle_commands(.1)
+
+    def idle_commands(self, delay):
+        nextsleep = delay
+
+        for function, data in self._idlefunctions.items():
+            try:
+                retval = function(self, data, False)
+                if retval is False:
+                    del self._idlefunctions[function]
+                elif retval is True:
+                    nextsleep = None
+                elif nextsleep is None:
+                    continue
+                elif retval < nextsleep:
+                    nextsleep = retval
+            except SystemExit:
+                raise
+            except Exception:
+                logger.exception('Running idle function')
+
+        if nextsleep is not None:
+            time.sleep(nextsleep)
+
+    def runCommand(self, command):
+        """
+        Run a cooker command on the server
+        """
+        self.command_channel.send(self.cooker.command.runCommand(command))
+
+    def stop(self):
+        self.keep_running.clear()
+
+    def bootstrap_2_6_6(self):
+        """Pulled from python 2.6.6. Needed to ensure we have the fix from
+        http://bugs.python.org/issue5313 when running on python version 2.6.2
+        or lower."""
+
+        try:
+            self._children = set()
+            self._counter = itertools.count(1)
+            try:
+                sys.stdin.close()
+                sys.stdin = open(os.devnull)
+            except (OSError, ValueError):
+                pass
+            multiprocessing._current_process = self
+            util._finalizer_registry.clear()
+            util._run_after_forkers()
+            util.info('child process calling self.run()')
+            try:
+                self.run()
+                exitcode = 0
+            finally:
+                util._exit_function()
+        except SystemExit as e:
+            if not e.args:
+                exitcode = 1
+            elif type(e.args[0]) is int:
+                exitcode = e.args[0]
+            else:
+                sys.stderr.write(e.args[0] + '\n')
+                sys.stderr.flush()
+                exitcode = 1
+        except:
+            exitcode = 1
+            import traceback
+            sys.stderr.write('Process %s:\n' % self.name)
+            sys.stderr.flush()
+            traceback.print_exc()
+
+        util.info('process exiting with exitcode %d' % exitcode)
+        return exitcode
+
+    # Python versions 2.6.0 through 2.6.2 suffer from a multiprocessing bug
+    # which can result in a bitbake server hang during the parsing process
+    if (2, 6, 0) <= sys.version_info < (2, 6, 3):
+        _bootstrap = bootstrap_2_6_6
+
+class BitBakeServerConnection():
+    def __init__(self, server):
+        self.server = server
+        self.procserver = server.server
+        self.connection = ServerCommunicator(server.ui_channel)
+        self.events = server.event_queue
+
+    def terminate(self, force = False):
+        signal.signal(signal.SIGINT, signal.SIG_IGN)
+        self.procserver.stop()
+        if force:
+            self.procserver.join(0.5)
+            if self.procserver.is_alive():
+                self.procserver.terminate()
+                self.procserver.join()
+        else:
+            self.procserver.join()
+        while True:
+            try:
+                event = self.server.event_queue.get(block=False)
+            except (Empty, IOError):
+                break
+            if isinstance(event, logging.LogRecord):
+                logger.handle(event)
+        self.server.ui_channel.close()
+        self.server.event_queue.close()
+        if force:
+            sys.exit(1)
+
+# Wrap Queue to provide API which isn't server implementation specific
+class ProcessEventQueue(multiprocessing.queues.Queue):
+    def waitEvent(self, timeout):
+        try:
+            return self.get(True, timeout)
+        except Empty:
+            return None
+
+    def getEvent(self):
+        try:
+            return self.get(False)
+        except Empty:
+            return None
+
+
+class BitBakeServer(object):
+    def initServer(self):
+        # establish communication channels.  We use bidirectional pipes for
+        # ui <--> server command/response pairs
+        # and a queue for server -> ui event notifications
+        #
+        self.ui_channel, self.server_channel = Pipe()
+        self.event_queue = ProcessEventQueue(0)
+
+        self.server = ProcessServer(self.server_channel, self.event_queue)
+
+    def addcooker(self, cooker):
+        self.cooker = cooker
+        self.server.cooker = cooker
+
+    def getServerIdleCB(self):
+        return self.server.register_idle_function
+
+    def saveConnectionDetails(self):
+        return
+
+    def detach(self):
+        self.server.start() 
+        return
+
+    def establishConnection(self):
+        self.connection = BitBakeServerConnection(self)
+        signal.signal(signal.SIGTERM, lambda i, s: self.connection.terminate(force=True))
+        return self.connection
+
+    def launchUI(self, uifunc, *args):
+        return uifunc(*args)
+

bitbake/lib/bb/server/xmlrpc.py

@@ -0,0 +1,295 @@
+#
+# BitBake XMLRPC Server
+#
+# Copyright (C) 2006 - 2007  Michael 'Mickey' Lauer
+# Copyright (C) 2006 - 2008  Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+"""
+    This module implements an xmlrpc server for BitBake.
+
+    Use this by deriving a class from BitBakeXMLRPCServer and then adding
+    methods which you want to "export" via XMLRPC. If the methods have the
+    prefix xmlrpc_, then registering those function will happen automatically,
+    if not, you need to call register_function.
+
+    Use register_idle_function() to add a function which the xmlrpc server
+    calls from within server_forever when no requests are pending. Make sure
+    that those functions are non-blocking or else you will introduce latency
+    in the server's main loop.
+"""
+
+import bb
+import xmlrpclib, sys
+from bb import daemonize
+from bb.ui import uievent
+
+DEBUG = False
+
+from SimpleXMLRPCServer import SimpleXMLRPCServer, SimpleXMLRPCRequestHandler
+import inspect, select
+
+if sys.hexversion < 0x020600F0:
+    print("Sorry, python 2.6 or later is required for bitbake's XMLRPC mode")
+    sys.exit(1)
+
+##
+# The xmlrpclib.Transport class has undergone various changes in Python 2.7
+# which break BitBake's XMLRPC implementation.
+# To work around this we subclass Transport and have a copy/paste of method
+# implementations from Python 2.6.6's xmlrpclib.
+#
+# Upstream Python bug is #8194 (http://bugs.python.org/issue8194)
+# This bug is relevant for Python 2.7.0 and 2.7.1 but was fixed for
+# Python > 2.7.2
+##
+
+class BBTransport(xmlrpclib.Transport):
+    def request(self, host, handler, request_body, verbose=0):
+        h = self.make_connection(host)
+        if verbose:
+            h.set_debuglevel(1)
+
+        self.send_request(h, handler, request_body)
+        self.send_host(h, host)
+        self.send_user_agent(h)
+        self.send_content(h, request_body)
+
+        errcode, errmsg, headers = h.getreply()
+
+        if errcode != 200:
+            raise ProtocolError(
+                host + handler,
+                errcode, errmsg,
+                headers
+                )
+
+        self.verbose = verbose
+
+        try:
+            sock = h._conn.sock
+        except AttributeError:
+            sock = None
+
+        return self._parse_response(h.getfile(), sock)
+
+    def make_connection(self, host):
+        import httplib
+        host, extra_headers, x509 = self.get_host_info(host)
+        return httplib.HTTP(host)
+
+    def _parse_response(self, file, sock):
+        p, u = self.getparser()
+
+        while 1:
+            if sock:
+                response = sock.recv(1024)
+            else:
+                response = file.read(1024)
+            if not response:
+                break
+            if self.verbose:
+                print "body:", repr(response)
+            p.feed(response)
+
+        file.close()
+        p.close()
+
+        return u.close()
+
+def _create_server(host, port):
+    # Python 2.7.0 and 2.7.1 have a buggy Transport implementation
+    # For those versions of Python, and only those versions, use our
+    # own copy/paste BBTransport class.
+    if (2, 7, 0) <= sys.version_info < (2, 7, 2):
+        t = BBTransport()
+        s = xmlrpclib.Server("http://%s:%d/" % (host, port), transport=t, allow_none=True)
+    else:
+        s = xmlrpclib.Server("http://%s:%d/" % (host, port), allow_none=True)
+
+    return s
+
+class BitBakeServerCommands():
+    def __init__(self, server):
+        self.server = server
+
+    def registerEventHandler(self, host, port):
+        """
+        Register a remote UI Event Handler
+        """
+        s = _create_server(host, port)
+
+        return bb.event.register_UIHhandler(s)
+
+    def unregisterEventHandler(self, handlerNum):
+        """
+        Unregister a remote UI Event Handler
+        """
+        return bb.event.unregister_UIHhandler(handlerNum)
+
+    def runCommand(self, command):
+        """
+        Run a cooker command on the server
+        """
+        return self.cooker.command.runCommand(command)
+
+    def terminateServer(self):
+        """
+        Trigger the server to quit
+        """
+        self.server.quit = True
+        print("Server (cooker) exiting")
+        return
+
+    def ping(self):
+        """
+        Dummy method which can be used to check the server is still alive
+        """
+        return True
+
+class BitBakeXMLRPCServer(SimpleXMLRPCServer):
+    # remove this when you're done with debugging
+    # allow_reuse_address = True
+
+    def __init__(self, interface):
+        """
+        Constructor
+        """
+        SimpleXMLRPCServer.__init__(self, interface,
+                                    requestHandler=SimpleXMLRPCRequestHandler,
+                                    logRequests=False, allow_none=True)
+        self._idlefuns = {}
+        self.host, self.port = self.socket.getsockname()
+        #self.register_introspection_functions()
+        self.commands = BitBakeServerCommands(self)
+        self.autoregister_all_functions(self.commands, "")
+
+    def addcooker(self, cooker):
+        self.cooker = cooker
+        self.commands.cooker = cooker
+
+    def autoregister_all_functions(self, context, prefix):
+        """
+        Convenience method for registering all functions in the scope
+        of this class that start with a common prefix
+        """
+        methodlist = inspect.getmembers(context, inspect.ismethod)
+        for name, method in methodlist:
+            if name.startswith(prefix):
+                self.register_function(method, name[len(prefix):])
+
+    def register_idle_function(self, function, data):
+        """Register a function to be called while the server is idle"""
+        assert hasattr(function, '__call__')
+        self._idlefuns[function] = data
+
+    def serve_forever(self):
+        bb.cooker.server_main(self.cooker, self._serve_forever)
+
+    def _serve_forever(self):
+        """
+        Serve Requests. Overloaded to honor a quit command
+        """
+        self.quit = False
+        self.timeout = 0 # Run Idle calls for our first callback
+        while not self.quit:
+            #print "Idle queue length %s" % len(self._idlefuns)
+            self.handle_request()
+            #print "Idle timeout, running idle functions"
+            nextsleep = None
+            for function, data in self._idlefuns.items():
+                try:
+                    retval = function(self, data, False)
+                    if retval is False:
+                        del self._idlefuns[function]
+                    elif retval is True:
+                        nextsleep = 0
+                    elif nextsleep is 0:
+                        continue
+                    elif nextsleep is None:
+                        nextsleep = retval
+                    elif retval < nextsleep:
+                        nextsleep = retval
+                except SystemExit:
+                    raise
+                except:
+                    import traceback
+                    traceback.print_exc()
+                    pass
+            if nextsleep is None and len(self._idlefuns) > 0:
+                nextsleep = 0
+            self.timeout = nextsleep
+        # Tell idle functions we're exiting
+        for function, data in self._idlefuns.items():
+            try:
+                retval = function(self, data, True)
+            except:
+                pass
+
+        self.server_close()
+        return
+
+class BitbakeServerInfo():
+    def __init__(self, host, port):
+        self.host = host
+        self.port = port
+
+class BitBakeServerConnection():
+    def __init__(self, serverinfo, clientinfo=("localhost", 0)):
+        self.connection = _create_server(serverinfo.host, serverinfo.port)
+        self.events = uievent.BBUIEventQueue(self.connection, clientinfo)
+        for event in bb.event.ui_queue:
+            self.events.queue_event(event)
+
+    def terminate(self):
+        # Don't wait for server indefinitely
+        import socket
+        socket.setdefaulttimeout(2)
+        try:
+            self.events.system_quit()
+        except:
+            pass
+        try:
+            self.connection.terminateServer()
+        except:
+            pass
+
+class BitBakeServer(object):
+    def initServer(self, interface = ("localhost", 0)):
+        self.server = BitBakeXMLRPCServer(interface)
+
+    def addcooker(self, cooker):
+        self.cooker = cooker
+        self.server.addcooker(cooker)
+
+    def getServerIdleCB(self):
+        return self.server.register_idle_function
+
+    def saveConnectionDetails(self): 
+        self.serverinfo = BitbakeServerInfo(self.server.host, self.server.port)
+
+    def detach(self):
+        daemonize.createDaemon(self.server.serve_forever, "bitbake-cookerdaemon.log")
+        del self.cooker
+        del self.server
+
+    def establishConnection(self):
+        self.connection = BitBakeServerConnection(self.serverinfo)
+        return self.connection
+
+    def launchUI(self, uifunc, *args):
+        return uifunc(*args)
+
+

bitbake/lib/bb/shell.py

@@ -0,0 +1,820 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+##########################################################################
+#
+# Copyright (C) 2005-2006 Michael 'Mickey' Lauer <mickey@Vanille.de>
+# Copyright (C) 2005-2006 Vanille Media
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+##########################################################################
+#
+# Thanks to:
+# * Holger Freyther <zecke@handhelds.org>
+# * Justin Patrin <papercrane@reversefold.com>
+#
+##########################################################################
+
+"""
+BitBake Shell
+
+IDEAS:
+    * list defined tasks per package
+    * list classes
+    * toggle force
+    * command to reparse just one (or more) bbfile(s)
+    * automatic check if reparsing is necessary (inotify?)
+    * frontend for bb file manipulation
+    * more shell-like features:
+        - output control, i.e. pipe output into grep, sort, etc.
+        - job control, i.e. bring running commands into background and foreground
+    * start parsing in background right after startup
+    * ncurses interface
+
+PROBLEMS:
+    * force doesn't always work
+    * readline completion for commands with more than one parameters
+
+"""
+
+##########################################################################
+# Import and setup global variables
+##########################################################################
+
+from __future__ import print_function
+from functools import reduce
+try:
+    set
+except NameError:
+    from sets import Set as set
+import sys, os, readline, socket, httplib, urllib, commands, popen2, shlex, Queue, fnmatch
+from bb import data, parse, build, cache, taskdata, runqueue, providers as Providers
+
+__version__ = "0.5.3.1"
+__credits__ = """BitBake Shell Version %s (C) 2005 Michael 'Mickey' Lauer <mickey@Vanille.de>
+Type 'help' for more information, press CTRL-D to exit.""" % __version__
+
+cmds = {}
+leave_mainloop = False
+last_exception = None
+cooker = None
+parsed = False
+debug = os.environ.get( "BBSHELL_DEBUG", "" )
+
+##########################################################################
+# Class BitBakeShellCommands
+##########################################################################
+
+class BitBakeShellCommands:
+    """This class contains the valid commands for the shell"""
+
+    def __init__( self, shell ):
+        """Register all the commands"""
+        self._shell = shell
+        for attr in BitBakeShellCommands.__dict__:
+            if not attr.startswith( "_" ):
+                if attr.endswith( "_" ):
+                    command = attr[:-1].lower()
+                else:
+                    command = attr[:].lower()
+                method = getattr( BitBakeShellCommands, attr )
+                debugOut( "registering command '%s'" % command )
+                # scan number of arguments
+                usage = getattr( method, "usage", "" )
+                if usage != "<...>":
+                    numArgs = len( usage.split() )
+                else:
+                    numArgs = -1
+                shell.registerCommand( command, method, numArgs, "%s %s" % ( command, usage ), method.__doc__ )
+
+    def _checkParsed( self ):
+        if not parsed:
+            print("SHELL: This command needs to parse bbfiles...")
+            self.parse( None )
+
+    def _findProvider( self, item ):
+        self._checkParsed()
+        # Need to use taskData for this information
+        preferred = data.getVar( "PREFERRED_PROVIDER_%s" % item, cooker.configuration.data, 1 )
+        if not preferred: preferred = item
+        try:
+            lv, lf, pv, pf = Providers.findBestProvider(preferred, cooker.configuration.data, cooker.status)
+        except KeyError:
+            if item in cooker.status.providers:
+                pf = cooker.status.providers[item][0]
+            else:
+                pf = None
+        return pf
+
+    def alias( self, params ):
+        """Register a new name for a command"""
+        new, old = params
+        if not old in cmds:
+            print("ERROR: Command '%s' not known" % old)
+        else:
+            cmds[new] = cmds[old]
+            print("OK")
+    alias.usage = "<alias> <command>"
+
+    def buffer( self, params ):
+        """Dump specified output buffer"""
+        index = params[0]
+        print(self._shell.myout.buffer( int( index ) ))
+    buffer.usage = "<index>"
+
+    def buffers( self, params ):
+        """Show the available output buffers"""
+        commands = self._shell.myout.bufferedCommands()
+        if not commands:
+            print("SHELL: No buffered commands available yet. Start doing something.")
+        else:
+            print("="*35, "Available Output Buffers", "="*27)
+            for index, cmd in enumerate( commands ):
+                print("| %s %s" % ( str( index ).ljust( 3 ), cmd ))
+            print("="*88)
+
+    def build( self, params, cmd = "build" ):
+        """Build a providee"""
+        global last_exception
+        globexpr = params[0]
+        self._checkParsed()
+        names = globfilter( cooker.status.pkg_pn, globexpr )
+        if len( names ) == 0: names = [ globexpr ]
+        print("SHELL: Building %s" % ' '.join( names ))
+
+        td = taskdata.TaskData(cooker.configuration.abort)
+        localdata = data.createCopy(cooker.configuration.data)
+        data.update_data(localdata)
+        data.expandKeys(localdata)
+
+        try:
+            tasks = []
+            for name in names:
+                td.add_provider(localdata, cooker.status, name)
+                providers = td.get_provider(name)
+
+                if len(providers) == 0:
+                    raise Providers.NoProvider
+
+                tasks.append([name, "do_%s" % cmd])
+
+            td.add_unresolved(localdata, cooker.status)
+
+            rq = runqueue.RunQueue(cooker, localdata, cooker.status, td, tasks)
+            rq.prepare_runqueue()
+            rq.execute_runqueue()
+
+        except Providers.NoProvider:
+            print("ERROR: No Provider")
+            last_exception = Providers.NoProvider
+
+        except runqueue.TaskFailure as fnids:
+            last_exception = runqueue.TaskFailure
+
+        except build.FuncFailed as e:
+            print("ERROR: Couldn't build '%s'" % names)
+            last_exception = e
+
+
+    build.usage = "<providee>"
+
+    def clean( self, params ):
+        """Clean a providee"""
+        self.build( params, "clean" )
+    clean.usage = "<providee>"
+
+    def compile( self, params ):
+        """Execute 'compile' on a providee"""
+        self.build( params, "compile" )
+    compile.usage = "<providee>"
+
+    def configure( self, params ):
+        """Execute 'configure' on a providee"""
+        self.build( params, "configure" )
+    configure.usage = "<providee>"
+
+    def install( self, params ):
+        """Execute 'install' on a providee"""
+        self.build( params, "install" )
+    install.usage = "<providee>"
+
+    def edit( self, params ):
+        """Call $EDITOR on a providee"""
+        name = params[0]
+        bbfile = self._findProvider( name )
+        if bbfile is not None:
+            os.system( "%s %s" % ( os.environ.get( "EDITOR", "vi" ), bbfile ) )
+        else:
+            print("ERROR: Nothing provides '%s'" % name)
+    edit.usage = "<providee>"
+
+    def environment( self, params ):
+        """Dump out the outer BitBake environment"""
+        cooker.showEnvironment()
+
+    def exit_( self, params ):
+        """Leave the BitBake Shell"""
+        debugOut( "setting leave_mainloop to true" )
+        global leave_mainloop
+        leave_mainloop = True
+
+    def fetch( self, params ):
+        """Fetch a providee"""
+        self.build( params, "fetch" )
+    fetch.usage = "<providee>"
+
+    def fileBuild( self, params, cmd = "build" ):
+        """Parse and build a .bb file"""
+        global last_exception
+        name = params[0]
+        bf = completeFilePath( name )
+        print("SHELL: Calling '%s' on '%s'" % ( cmd, bf ))
+
+        try:
+            cooker.buildFile(bf, cmd)
+        except parse.ParseError:
+            print("ERROR: Unable to open or parse '%s'" % bf)
+        except build.FuncFailed as e:
+            print("ERROR: Couldn't build '%s'" % name)
+            last_exception = e
+
+    fileBuild.usage = "<bbfile>"
+
+    def fileClean( self, params ):
+        """Clean a .bb file"""
+        self.fileBuild( params, "clean" )
+    fileClean.usage = "<bbfile>"
+
+    def fileEdit( self, params ):
+        """Call $EDITOR on a .bb file"""
+        name = params[0]
+        os.system( "%s %s" % ( os.environ.get( "EDITOR", "vi" ), completeFilePath( name ) ) )
+    fileEdit.usage = "<bbfile>"
+
+    def fileRebuild( self, params ):
+        """Rebuild (clean & build) a .bb file"""
+        self.fileBuild( params, "rebuild" )
+    fileRebuild.usage = "<bbfile>"
+
+    def fileReparse( self, params ):
+        """(re)Parse a bb file"""
+        bbfile = params[0]
+        print("SHELL: Parsing '%s'" % bbfile)
+        parse.update_mtime( bbfile )
+        cooker.parser.reparse(bbfile)
+        if False: #fromCache:
+            print("SHELL: File has not been updated, not reparsing")
+        else:
+            print("SHELL: Parsed")
+    fileReparse.usage = "<bbfile>"
+
+    def abort( self, params ):
+        """Toggle abort task execution flag (see bitbake -k)"""
+        cooker.configuration.abort = not cooker.configuration.abort
+        print("SHELL: Abort Flag is now '%s'" % repr( cooker.configuration.abort ))
+
+    def force( self, params ):
+        """Toggle force task execution flag (see bitbake -f)"""
+        cooker.configuration.force = not cooker.configuration.force
+        print("SHELL: Force Flag is now '%s'" % repr( cooker.configuration.force ))
+
+    def help( self, params ):
+        """Show a comprehensive list of commands and their purpose"""
+        print("="*30, "Available Commands", "="*30)
+        for cmd in sorted(cmds):
+            function, numparams, usage, helptext = cmds[cmd]
+            print("| %s | %s" % (usage.ljust(30), helptext))
+        print("="*78)
+
+    def lastError( self, params ):
+        """Show the reason or log that was produced by the last BitBake event exception"""
+        if last_exception is None:
+            print("SHELL: No Errors yet (Phew)...")
+        else:
+            reason, event = last_exception.args
+            print("SHELL: Reason for the last error: '%s'" % reason)
+            if ':' in reason:
+                msg, filename = reason.split( ':' )
+                filename = filename.strip()
+                print("SHELL: Dumping log file for last error:")
+                try:
+                    print(open( filename ).read())
+                except IOError:
+                    print("ERROR: Couldn't open '%s'" % filename)
+
+    def match( self, params ):
+        """Dump all files or providers matching a glob expression"""
+        what, globexpr = params
+        if what == "files":
+            self._checkParsed()
+            for key in globfilter( cooker.status.pkg_fn, globexpr ): print(key)
+        elif what == "providers":
+            self._checkParsed()
+            for key in globfilter( cooker.status.pkg_pn, globexpr ): print(key)
+        else:
+            print("Usage: match %s" % self.print_.usage)
+    match.usage = "<files|providers> <glob>"
+
+    def new( self, params ):
+        """Create a new .bb file and open the editor"""
+        dirname, filename = params
+        packages = '/'.join( data.getVar( "BBFILES", cooker.configuration.data, 1 ).split('/')[:-2] )
+        fulldirname = "%s/%s" % ( packages, dirname )
+
+        if not os.path.exists( fulldirname ):
+            print("SHELL: Creating '%s'" % fulldirname)
+            os.mkdir( fulldirname )
+        if os.path.exists( fulldirname ) and os.path.isdir( fulldirname ):
+            if os.path.exists( "%s/%s" % ( fulldirname, filename ) ):
+                print("SHELL: ERROR: %s/%s already exists" % ( fulldirname, filename ))
+                return False
+            print("SHELL: Creating '%s/%s'" % ( fulldirname, filename ))
+            newpackage = open( "%s/%s" % ( fulldirname, filename ), "w" )
+            print("""DESCRIPTION = ""
+SECTION = ""
+AUTHOR = ""
+HOMEPAGE = ""
+MAINTAINER = ""
+LICENSE = "GPL"
+PR = "r0"
+
+SRC_URI = ""
+
+#inherit base
+
+#do_configure() {
+#
+#}
+
+#do_compile() {
+#
+#}
+
+#do_stage() {
+#
+#}
+
+#do_install() {
+#
+#}
+""", file=newpackage)
+            newpackage.close()
+            os.system( "%s %s/%s" % ( os.environ.get( "EDITOR" ), fulldirname, filename ) )
+    new.usage = "<directory> <filename>"
+
+    def package( self, params ):
+        """Execute 'package' on a providee"""
+        self.build( params, "package" )
+    package.usage = "<providee>"
+
+    def pasteBin( self, params ):
+        """Send a command + output buffer to the pastebin at http://rafb.net/paste"""
+        index = params[0]
+        contents = self._shell.myout.buffer( int( index ) )
+        sendToPastebin( "output of " + params[0], contents )
+    pasteBin.usage = "<index>"
+
+    def pasteLog( self, params ):
+        """Send the last event exception error log (if there is one) to http://rafb.net/paste"""
+        if last_exception is None:
+            print("SHELL: No Errors yet (Phew)...")
+        else:
+            reason, event = last_exception.args
+            print("SHELL: Reason for the last error: '%s'" % reason)
+            if ':' in reason:
+                msg, filename = reason.split( ':' )
+                filename = filename.strip()
+                print("SHELL: Pasting log file to pastebin...")
+
+                file = open( filename ).read()
+                sendToPastebin( "contents of " + filename, file )
+
+    def patch( self, params ):
+        """Execute 'patch' command on a providee"""
+        self.build( params, "patch" )
+    patch.usage = "<providee>"
+
+    def parse( self, params ):
+        """(Re-)parse .bb files and calculate the dependency graph"""
+        cooker.status = cache.CacheData(cooker.caches_array)
+        ignore = data.getVar("ASSUME_PROVIDED", cooker.configuration.data, 1) or ""
+        cooker.status.ignored_dependencies = set( ignore.split() )
+        cooker.handleCollections( data.getVar("BBFILE_COLLECTIONS", cooker.configuration.data, 1) )
+
+        (filelist, masked) = cooker.collect_bbfiles()
+        cooker.parse_bbfiles(filelist, masked, cooker.myProgressCallback)
+        cooker.buildDepgraph()
+        global parsed
+        parsed = True
+        print()
+
+    def reparse( self, params ):
+        """(re)Parse a providee's bb file"""
+        bbfile = self._findProvider( params[0] )
+        if bbfile is not None:
+            print("SHELL: Found bbfile '%s' for '%s'" % ( bbfile, params[0] ))
+            self.fileReparse( [ bbfile ] )
+        else:
+            print("ERROR: Nothing provides '%s'" % params[0])
+    reparse.usage = "<providee>"
+
+    def getvar( self, params ):
+        """Dump the contents of an outer BitBake environment variable"""
+        var = params[0]
+        value = data.getVar( var, cooker.configuration.data, 1 )
+        print(value)
+    getvar.usage = "<variable>"
+
+    def peek( self, params ):
+        """Dump contents of variable defined in providee's metadata"""
+        name, var = params
+        bbfile = self._findProvider( name )
+        if bbfile is not None:
+            the_data = cache.Cache.loadDataFull(bbfile, cooker.configuration.data)
+            value = the_data.getVar( var, 1 )
+            print(value)
+        else:
+            print("ERROR: Nothing provides '%s'" % name)
+    peek.usage = "<providee> <variable>"
+
+    def poke( self, params ):
+        """Set contents of variable defined in providee's metadata"""
+        name, var, value = params
+        bbfile = self._findProvider( name )
+        if bbfile is not None:
+            print("ERROR: Sorry, this functionality is currently broken")
+            #d = cooker.pkgdata[bbfile]
+            #data.setVar( var, value, d )
+
+            # mark the change semi persistant
+            #cooker.pkgdata.setDirty(bbfile, d)
+            #print "OK"
+        else:
+            print("ERROR: Nothing provides '%s'" % name)
+    poke.usage = "<providee> <variable> <value>"
+
+    def print_( self, params ):
+        """Dump all files or providers"""
+        what = params[0]
+        if what == "files":
+            self._checkParsed()
+            for key in cooker.status.pkg_fn: print(key)
+        elif what == "providers":
+            self._checkParsed()
+            for key in cooker.status.providers: print(key)
+        else:
+            print("Usage: print %s" % self.print_.usage)
+    print_.usage = "<files|providers>"
+
+    def python( self, params ):
+        """Enter the expert mode - an interactive BitBake Python Interpreter"""
+        sys.ps1 = "EXPERT BB>>> "
+        sys.ps2 = "EXPERT BB... "
+        import code
+        interpreter = code.InteractiveConsole( dict( globals() ) )
+        interpreter.interact( "SHELL: Expert Mode - BitBake Python %s\nType 'help' for more information, press CTRL-D to switch back to BBSHELL." % sys.version )
+
+    def showdata( self, params ):
+        """Execute 'showdata' on a providee"""
+        cooker.showEnvironment(None, params)
+    showdata.usage = "<providee>"
+
+    def setVar( self, params ):
+        """Set an outer BitBake environment variable"""
+        var, value = params
+        data.setVar( var, value, cooker.configuration.data )
+        print("OK")
+    setVar.usage = "<variable> <value>"
+
+    def rebuild( self, params ):
+        """Clean and rebuild a .bb file or a providee"""
+        self.build( params, "clean" )
+        self.build( params, "build" )
+    rebuild.usage = "<providee>"
+
+    def shell( self, params ):
+        """Execute a shell command and dump the output"""
+        if params != "":
+            print(commands.getoutput( " ".join( params ) ))
+    shell.usage = "<...>"
+
+    def stage( self, params ):
+        """Execute 'stage' on a providee"""
+        self.build( params, "populate_staging" )
+    stage.usage = "<providee>"
+
+    def status( self, params ):
+        """<just for testing>"""
+        print("-" * 78)
+        print("building list = '%s'" % cooker.building_list)
+        print("build path = '%s'" % cooker.build_path)
+        print("consider_msgs_cache = '%s'" % cooker.consider_msgs_cache)
+        print("build stats = '%s'" % cooker.stats)
+        if last_exception is not None: print("last_exception = '%s'" % repr( last_exception.args ))
+        print("memory output contents = '%s'" % self._shell.myout._buffer)
+
+    def test( self, params ):
+        """<just for testing>"""
+        print("testCommand called with '%s'" % params)
+
+    def unpack( self, params ):
+        """Execute 'unpack' on a providee"""
+        self.build( params, "unpack" )
+    unpack.usage = "<providee>"
+
+    def which( self, params ):
+        """Computes the providers for a given providee"""
+        # Need to use taskData for this information
+        item = params[0]
+
+        self._checkParsed()
+
+        preferred = data.getVar( "PREFERRED_PROVIDER_%s" % item, cooker.configuration.data, 1 )
+        if not preferred: preferred = item
+
+        try:
+            lv, lf, pv, pf = Providers.findBestProvider(preferred, cooker.configuration.data, cooker.status)
+        except KeyError:
+            lv, lf, pv, pf = (None,)*4
+
+        try:
+            providers = cooker.status.providers[item]
+        except KeyError:
+            print("SHELL: ERROR: Nothing provides", preferred)
+        else:
+            for provider in providers:
+                if provider == pf: provider = " (***) %s" % provider
+                else:              provider = "       %s" % provider
+                print(provider)
+    which.usage = "<providee>"
+
+##########################################################################
+# Common helper functions
+##########################################################################
+
+def completeFilePath( bbfile ):
+    """Get the complete bbfile path"""
+    if not cooker.status: return bbfile
+    if not cooker.status.pkg_fn: return bbfile
+    for key in cooker.status.pkg_fn:
+        if key.endswith( bbfile ):
+            return key
+    return bbfile
+
+def sendToPastebin( desc, content ):
+    """Send content to http://oe.pastebin.com"""
+    mydata = {}
+    mydata["lang"] = "Plain Text"
+    mydata["desc"] = desc
+    mydata["cvt_tabs"] = "No"
+    mydata["nick"] = "%s@%s" % ( os.environ.get( "USER", "unknown" ), socket.gethostname() or "unknown" )
+    mydata["text"] = content
+    params = urllib.urlencode( mydata )
+    headers = {"Content-type": "application/x-www-form-urlencoded", "Accept": "text/plain"}
+
+    host = "rafb.net"
+    conn = httplib.HTTPConnection( "%s:80" % host )
+    conn.request("POST", "/paste/paste.php", params, headers )
+
+    response = conn.getresponse()
+    conn.close()
+
+    if response.status == 302:
+        location = response.getheader( "location" ) or "unknown"
+        print("SHELL: Pasted to http://%s%s" % ( host, location ))
+    else:
+        print("ERROR: %s %s" % ( response.status, response.reason ))
+
+def completer( text, state ):
+    """Return a possible readline completion"""
+    debugOut( "completer called with text='%s', state='%d'" % ( text, state ) )
+
+    if state == 0:
+        line = readline.get_line_buffer()
+        if " " in line:
+            line = line.split()
+            # we are in second (or more) argument
+            if line[0] in cmds and hasattr( cmds[line[0]][0], "usage" ): # known command and usage
+                u = getattr( cmds[line[0]][0], "usage" ).split()[0]
+                if u == "<variable>":
+                    allmatches = cooker.configuration.data.keys()
+                elif u == "<bbfile>":
+                    if cooker.status.pkg_fn is None: allmatches = [ "(No Matches Available. Parsed yet?)" ]
+                    else: allmatches = [ x.split("/")[-1] for x in cooker.status.pkg_fn ]
+                elif u == "<providee>":
+                    if cooker.status.pkg_fn is None: allmatches = [ "(No Matches Available. Parsed yet?)" ]
+                    else: allmatches = cooker.status.providers.iterkeys()
+                else: allmatches = [ "(No tab completion available for this command)" ]
+            else: allmatches = [ "(No tab completion available for this command)" ]
+        else:
+            # we are in first argument
+            allmatches = cmds.iterkeys()
+
+        completer.matches = [ x for x in allmatches if x[:len(text)] == text ]
+        #print "completer.matches = '%s'" % completer.matches
+    if len( completer.matches ) > state:
+        return completer.matches[state]
+    else:
+        return None
+
+def debugOut( text ):
+    if debug:
+        sys.stderr.write( "( %s )\n" % text )
+
+def columnize( alist, width = 80 ):
+    """
+    A word-wrap function that preserves existing line breaks
+    and most spaces in the text. Expects that existing line
+    breaks are posix newlines (\n).
+    """
+    return reduce(lambda line, word, width=width: '%s%s%s' %
+                  (line,
+                   ' \n'[(len(line[line.rfind('\n')+1:])
+                         + len(word.split('\n', 1)[0]
+                              ) >= width)],
+                   word),
+                  alist
+                 )
+
+def globfilter( names, pattern ):
+    return fnmatch.filter( names, pattern )
+
+##########################################################################
+# Class MemoryOutput
+##########################################################################
+
+class MemoryOutput:
+    """File-like output class buffering the output of the last 10 commands"""
+    def __init__( self, delegate ):
+        self.delegate = delegate
+        self._buffer = []
+        self.text = []
+        self._command = None
+
+    def startCommand( self, command ):
+        self._command = command
+        self.text = []
+    def endCommand( self ):
+        if self._command is not None:
+            if len( self._buffer ) == 10: del self._buffer[0]
+            self._buffer.append( ( self._command, self.text ) )
+    def removeLast( self ):
+        if self._buffer:
+            del self._buffer[ len( self._buffer ) - 1 ]
+        self.text = []
+        self._command = None
+    def lastBuffer( self ):
+        if self._buffer:
+            return self._buffer[ len( self._buffer ) -1 ][1]
+    def bufferedCommands( self ):
+        return [ cmd for cmd, output in self._buffer ]
+    def buffer( self, i ):
+        if i < len( self._buffer ):
+            return "BB>> %s\n%s" % ( self._buffer[i][0], "".join( self._buffer[i][1] ) )
+        else: return "ERROR: Invalid buffer number. Buffer needs to be in (0, %d)" % ( len( self._buffer ) - 1 )
+    def write( self, text ):
+        if self._command is not None and text != "BB>> ": self.text.append( text )
+        if self.delegate is not None: self.delegate.write( text )
+    def flush( self ):
+        return self.delegate.flush()
+    def fileno( self ):
+        return self.delegate.fileno()
+    def isatty( self ):
+        return self.delegate.isatty()
+
+##########################################################################
+# Class BitBakeShell
+##########################################################################
+
+class BitBakeShell:
+
+    def __init__( self ):
+        """Register commands and set up readline"""
+        self.commandQ = Queue.Queue()
+        self.commands = BitBakeShellCommands( self )
+        self.myout = MemoryOutput( sys.stdout )
+        self.historyfilename = os.path.expanduser( "~/.bbsh_history" )
+        self.startupfilename = os.path.expanduser( "~/.bbsh_startup" )
+
+        readline.set_completer( completer )
+        readline.set_completer_delims( " " )
+        readline.parse_and_bind("tab: complete")
+
+        try:
+            readline.read_history_file( self.historyfilename )
+        except IOError:
+            pass  # It doesn't exist yet.
+
+        print(__credits__)
+
+    def cleanup( self ):
+        """Write readline history and clean up resources"""
+        debugOut( "writing command history" )
+        try:
+            readline.write_history_file( self.historyfilename )
+        except:
+            print("SHELL: Unable to save command history")
+
+    def registerCommand( self, command, function, numparams = 0, usage = "", helptext = "" ):
+        """Register a command"""
+        if usage == "": usage = command
+        if helptext == "": helptext = function.__doc__ or "<not yet documented>"
+        cmds[command] = ( function, numparams, usage, helptext )
+
+    def processCommand( self, command, params ):
+        """Process a command. Check number of params and print a usage string, if appropriate"""
+        debugOut( "processing command '%s'..." % command )
+        try:
+            function, numparams, usage, helptext = cmds[command]
+        except KeyError:
+            print("SHELL: ERROR: '%s' command is not a valid command." % command)
+            self.myout.removeLast()
+        else:
+            if (numparams != -1) and (not len( params ) == numparams):
+                print("Usage: '%s'" % usage)
+                return
+
+            result = function( self.commands, params )
+            debugOut( "result was '%s'" % result )
+
+    def processStartupFile( self ):
+        """Read and execute all commands found in $HOME/.bbsh_startup"""
+        if os.path.exists( self.startupfilename ):
+            startupfile = open( self.startupfilename, "r" )
+            for cmdline in startupfile:
+                debugOut( "processing startup line '%s'" % cmdline )
+                if not cmdline:
+                    continue
+                if "|" in cmdline:
+                    print("ERROR: '|' in startup file is not allowed. Ignoring line")
+                    continue
+                self.commandQ.put( cmdline.strip() )
+
+    def main( self ):
+        """The main command loop"""
+        while not leave_mainloop:
+            try:
+                if self.commandQ.empty():
+                    sys.stdout = self.myout.delegate
+                    cmdline = raw_input( "BB>> " )
+                    sys.stdout = self.myout
+                else:
+                    cmdline = self.commandQ.get()
+                if cmdline:
+                    allCommands = cmdline.split( ';' )
+                    for command in allCommands:
+                        pipecmd = None
+                        #
+                        # special case for expert mode
+                        if command == 'python':
+                            sys.stdout = self.myout.delegate
+                            self.processCommand( command, "" )
+                            sys.stdout = self.myout
+                        else:
+                            self.myout.startCommand( command )
+                            if '|' in command: # disable output
+                                command, pipecmd = command.split( '|' )
+                                delegate = self.myout.delegate
+                                self.myout.delegate = None
+                            tokens = shlex.split( command, True )
+                            self.processCommand( tokens[0], tokens[1:] or "" )
+                            self.myout.endCommand()
+                            if pipecmd is not None: # restore output
+                                self.myout.delegate = delegate
+
+                                pipe = popen2.Popen4( pipecmd )
+                                pipe.tochild.write( "\n".join( self.myout.lastBuffer() ) )
+                                pipe.tochild.close()
+                                sys.stdout.write( pipe.fromchild.read() )
+                        #
+            except EOFError:
+                print()
+                return
+            except KeyboardInterrupt:
+                print()
+
+##########################################################################
+# Start function - called from the BitBake command line utility
+##########################################################################
+
+def start( aCooker ):
+    global cooker
+    cooker = aCooker
+    bbshell = BitBakeShell()
+    bbshell.processStartupFile()
+    bbshell.main()
+    bbshell.cleanup()
+
+if __name__ == "__main__":
+    print("SHELL: Sorry, this program should only be called by BitBake.")

bitbake/lib/bb/siggen.py

@@ -0,0 +1,453 @@
+import hashlib
+import logging
+import os
+import re
+import tempfile
+import bb.data
+
+logger = logging.getLogger('BitBake.SigGen')
+
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    logger.info('Importing cPickle failed.  Falling back to a very slow implementation.')
+
+def init(d):
+    siggens = [obj for obj in globals().itervalues()
+                      if type(obj) is type and issubclass(obj, SignatureGenerator)]
+
+    desired = d.getVar("BB_SIGNATURE_HANDLER", True) or "noop"
+    for sg in siggens:
+        if desired == sg.name:
+            return sg(d)
+            break
+    else:
+        logger.error("Invalid signature generator '%s', using default 'noop'\n"
+                     "Available generators: %s",
+                     ', '.join(obj.name for obj in siggens))
+        return SignatureGenerator(d)
+
+class SignatureGenerator(object):
+    """
+    """
+    name = "noop"
+
+    def __init__(self, data):
+        return
+
+    def finalise(self, fn, d, varient):
+        return
+
+    def get_taskhash(self, fn, task, deps, dataCache):
+        return "0"
+
+    def set_taskdata(self, hashes, deps):
+        return
+
+    def stampfile(self, stampbase, file_name, taskname, extrainfo):
+        return ("%s.%s.%s" % (stampbase, taskname, extrainfo)).rstrip('.')
+
+    def stampcleanmask(self, stampbase, file_name, taskname, extrainfo):
+        return ("%s.%s.%s" % (stampbase, taskname, extrainfo)).rstrip('.')
+
+    def dump_sigtask(self, fn, task, stampbase, runtime):
+        return
+
+    def invalidate_task(self, task, d, fn):
+        bb.build.del_stamp(task, d, fn)
+
+
+class SignatureGeneratorBasic(SignatureGenerator):
+    """
+    """
+    name = "basic"
+
+    def __init__(self, data):
+        self.basehash = {}
+        self.taskhash = {}
+        self.taskdeps = {}
+        self.runtaskdeps = {}
+        self.file_checksum_values = {}
+        self.gendeps = {}
+        self.lookupcache = {}
+        self.pkgnameextract = re.compile("(?P<fn>.*)\..*")
+        self.basewhitelist = set((data.getVar("BB_HASHBASE_WHITELIST", True) or "").split())
+        self.taskwhitelist = None
+        self.init_rundepcheck(data)
+
+    def init_rundepcheck(self, data):
+        self.taskwhitelist = data.getVar("BB_HASHTASK_WHITELIST", True) or None
+        if self.taskwhitelist:
+            self.twl = re.compile(self.taskwhitelist)
+        else:
+            self.twl = None
+
+    def _build_data(self, fn, d):
+
+        tasklist, gendeps, lookupcache = bb.data.generate_dependencies(d)
+
+        taskdeps = {}
+        basehash = {}
+
+        for task in tasklist:
+            data = d.getVar(task, False)
+            lookupcache[task] = data
+
+            if data is None:
+                bb.error("Task %s from %s seems to be empty?!" % (task, fn))
+                data = ''
+
+            gendeps[task] -= self.basewhitelist
+            newdeps = gendeps[task]
+            seen = set()
+            while newdeps:
+                nextdeps = newdeps
+                seen |= nextdeps
+                newdeps = set()
+                for dep in nextdeps:
+                    if dep in self.basewhitelist:
+                        continue
+                    gendeps[dep] -= self.basewhitelist
+                    newdeps |= gendeps[dep]
+                newdeps -= seen
+
+            alldeps = sorted(seen)
+            for dep in alldeps:
+                data = data + dep
+                if dep in lookupcache:
+                    var = lookupcache[dep]
+                elif dep[-1] == ']':
+                    vf = dep[:-1].split('[')
+                    var = d.getVarFlag(vf[0], vf[1], False)
+                    lookupcache[dep] = var
+                else:
+                    var = d.getVar(dep, False)
+                    lookupcache[dep] = var
+                if var:
+                    data = data + str(var)
+            self.basehash[fn + "." + task] = hashlib.md5(data).hexdigest()
+            taskdeps[task] = alldeps
+
+        self.taskdeps[fn] = taskdeps
+        self.gendeps[fn] = gendeps
+        self.lookupcache[fn] = lookupcache
+
+        return taskdeps
+
+    def finalise(self, fn, d, variant):
+
+        if variant:
+            fn = "virtual:" + variant + ":" + fn
+
+        try:
+            taskdeps = self._build_data(fn, d)
+        except:
+            bb.note("Error during finalise of %s" % fn)
+            raise
+
+        #Slow but can be useful for debugging mismatched basehashes
+        #for task in self.taskdeps[fn]:
+        #    self.dump_sigtask(fn, task, d.getVar("STAMP", True), False)
+
+        for task in taskdeps:
+            d.setVar("BB_BASEHASH_task-%s" % task, self.basehash[fn + "." + task])
+
+    def rundep_check(self, fn, recipename, task, dep, depname, dataCache):
+        # Return True if we should keep the dependency, False to drop it
+        # We only manipulate the dependencies for packages not in the whitelist
+        if self.twl and not self.twl.search(recipename):
+            # then process the actual dependencies
+            if self.twl.search(depname):
+                return False
+        return True
+
+    def read_taint(self, fn, task, stampbase):
+        taint = None
+        try:
+            with open(stampbase + '.' + task + '.taint', 'r') as taintf:
+                taint = taintf.read()
+        except IOError:
+            pass
+        return taint
+
+    def get_taskhash(self, fn, task, deps, dataCache):
+        k = fn + "." + task
+        data = dataCache.basetaskhash[k]
+        self.runtaskdeps[k] = []
+        self.file_checksum_values[k] = {}
+        recipename = dataCache.pkg_fn[fn]
+        for dep in sorted(deps, key=clean_basepath):
+            depname = dataCache.pkg_fn[self.pkgnameextract.search(dep).group('fn')]
+            if not self.rundep_check(fn, recipename, task, dep, depname, dataCache):
+                continue
+            if dep not in self.taskhash:
+                bb.fatal("%s is not in taskhash, caller isn't calling in dependency order?", dep)
+            data = data + self.taskhash[dep]
+            self.runtaskdeps[k].append(dep)
+
+        if task in dataCache.file_checksums[fn]:
+            checksums = bb.fetch2.get_file_checksums(dataCache.file_checksums[fn][task], recipename)
+            for (f,cs) in checksums:
+                self.file_checksum_values[k][f] = cs
+                data = data + cs
+
+        taint = self.read_taint(fn, task, dataCache.stamp[fn])
+        if taint:
+            data = data + taint
+
+        h = hashlib.md5(data).hexdigest()
+        self.taskhash[k] = h
+        #d.setVar("BB_TASKHASH_task-%s" % task, taskhash[task])
+        return h
+
+    def set_taskdata(self, hashes, deps):
+        self.runtaskdeps = deps
+        self.taskhash = hashes
+
+    def dump_sigtask(self, fn, task, stampbase, runtime):
+        k = fn + "." + task
+        if runtime == "customfile":
+            sigfile = stampbase
+        elif runtime and k in self.taskhash:
+            sigfile = stampbase + "." + task + ".sigdata" + "." + self.taskhash[k]
+        else:
+            sigfile = stampbase + "." + task + ".sigbasedata" + "." + self.basehash[k]
+
+        bb.utils.mkdirhier(os.path.dirname(sigfile))
+
+        data = {}
+        data['basewhitelist'] = self.basewhitelist
+        data['taskwhitelist'] = self.taskwhitelist
+        data['taskdeps'] = self.taskdeps[fn][task]
+        data['basehash'] = self.basehash[k]
+        data['gendeps'] = {}
+        data['varvals'] = {}
+        data['varvals'][task] = self.lookupcache[fn][task]
+        for dep in self.taskdeps[fn][task]:
+            if dep in self.basewhitelist:
+                continue
+            data['gendeps'][dep] = self.gendeps[fn][dep]
+            data['varvals'][dep] = self.lookupcache[fn][dep]
+
+        if runtime and k in self.taskhash:
+            data['runtaskdeps'] = self.runtaskdeps[k]
+            data['file_checksum_values'] = self.file_checksum_values[k]
+            data['runtaskhashes'] = {}
+            for dep in data['runtaskdeps']:
+                data['runtaskhashes'][dep] = self.taskhash[dep]
+
+        taint = self.read_taint(fn, task, stampbase)
+        if taint:
+            data['taint'] = taint
+
+        fd, tmpfile = tempfile.mkstemp(dir=os.path.dirname(sigfile), prefix="sigtask.")
+        try:
+            with os.fdopen(fd, "wb") as stream:
+                p = pickle.dump(data, stream, -1)
+                stream.flush()
+                os.fsync(fd)
+            os.chmod(tmpfile, 0664)
+            os.rename(tmpfile, sigfile)
+        except (OSError, IOError), err:
+            try:
+                os.unlink(tmpfile)
+            except OSError:
+                pass
+            raise err
+
+    def dump_sigs(self, dataCache):
+        for fn in self.taskdeps:
+            for task in self.taskdeps[fn]:
+                k = fn + "." + task
+                if k not in self.taskhash:
+                    continue
+                if dataCache.basetaskhash[k] != self.basehash[k]:
+                    bb.error("Bitbake's cached basehash does not match the one we just generated (%s)!" % k)
+                    bb.error("The mismatched hashes were %s and %s" % (dataCache.basetaskhash[k], self.basehash[k]))
+                self.dump_sigtask(fn, task, dataCache.stamp[fn], True)
+
+class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
+    name = "basichash"
+
+    def stampfile(self, stampbase, fn, taskname, extrainfo, clean=False):
+        if taskname != "do_setscene" and taskname.endswith("_setscene"):
+            k = fn + "." + taskname[:-9]
+        else:
+            k = fn + "." + taskname
+        if clean:
+            h = "*"
+        elif k in self.taskhash:
+            h = self.taskhash[k]
+        else:
+            # If k is not in basehash, then error
+            h = self.basehash[k]
+        return ("%s.%s.%s.%s" % (stampbase, taskname, h, extrainfo)).rstrip('.')
+
+    def stampcleanmask(self, stampbase, fn, taskname, extrainfo):
+        return self.stampfile(stampbase, fn, taskname, extrainfo, clean=True)
+        
+    def invalidate_task(self, task, d, fn):
+        bb.note("Tainting hash to force rebuild of task %s, %s" % (fn, task))
+        bb.build.write_taint(task, d, fn)
+
+def dump_this_task(outfile, d):
+    import bb.parse
+    fn = d.getVar("BB_FILENAME", True)
+    task = "do_" + d.getVar("BB_CURRENTTASK", True)
+    bb.parse.siggen.dump_sigtask(fn, task, outfile, "customfile")
+
+def clean_basepath(a):
+    if a.startswith("virtual:"):
+        b = a.rsplit(":", 1)[0] + ":" + a.rsplit("/", 1)[1]
+    else:
+        b = a.rsplit("/", 1)[1]
+    return b
+
+def clean_basepaths(a):
+    b = {}
+    for x in a:
+        b[clean_basepath(x)] = a[x]
+    return b
+
+def compare_sigfiles(a, b, recursecb = None):
+    output = []
+
+    p1 = pickle.Unpickler(open(a, "rb"))
+    a_data = p1.load()
+    p2 = pickle.Unpickler(open(b, "rb"))
+    b_data = p2.load()
+
+    def dict_diff(a, b, whitelist=set()):
+        sa = set(a.keys())
+        sb = set(b.keys())
+        common = sa & sb
+        changed = set()
+        for i in common:
+            if a[i] != b[i] and i not in whitelist:
+                changed.add(i)
+        added = sa - sb
+        removed = sb - sa
+        return changed, added, removed
+
+    if 'basewhitelist' in a_data and a_data['basewhitelist'] != b_data['basewhitelist']:
+        output.append("basewhitelist changed from '%s' to '%s'" % (a_data['basewhitelist'], b_data['basewhitelist']))
+        if a_data['basewhitelist'] and b_data['basewhitelist']:
+            output.append("changed items: %s" % a_data['basewhitelist'].symmetric_difference(b_data['basewhitelist']))
+
+    if 'taskwhitelist' in a_data and a_data['taskwhitelist'] != b_data['taskwhitelist']:
+        output.append("taskwhitelist changed from '%s' to '%s'" % (a_data['taskwhitelist'], b_data['taskwhitelist']))
+        if a_data['taskwhitelist'] and b_data['taskwhitelist']:
+            output.append("changed items: %s" % a_data['taskwhitelist'].symmetric_difference(b_data['taskwhitelist']))
+
+    if a_data['taskdeps'] != b_data['taskdeps']:
+        output.append("Task dependencies changed from:\n%s\nto:\n%s" % (sorted(a_data['taskdeps']), sorted(b_data['taskdeps'])))
+
+    if a_data['basehash'] != b_data['basehash']:
+        output.append("basehash changed from %s to %s" % (a_data['basehash'], b_data['basehash']))
+
+    changed, added, removed = dict_diff(a_data['gendeps'], b_data['gendeps'], a_data['basewhitelist'] & b_data['basewhitelist'])
+    if changed:
+        for dep in changed:
+            output.append("List of dependencies for variable %s changed from '%s' to '%s'" % (dep, a_data['gendeps'][dep], b_data['gendeps'][dep]))
+            if a_data['gendeps'][dep] and b_data['gendeps'][dep]:
+                output.append("changed items: %s" % a_data['gendeps'][dep].symmetric_difference(b_data['gendeps'][dep]))
+    if added:
+        for dep in added:
+            output.append("Dependency on variable %s was added" % (dep))
+    if removed:
+        for dep in removed:
+            output.append("Dependency on Variable %s was removed" % (dep))
+
+
+    changed, added, removed = dict_diff(a_data['varvals'], b_data['varvals'])
+    if changed:
+        for dep in changed:
+            output.append("Variable %s value changed from '%s' to '%s'" % (dep, a_data['varvals'][dep], b_data['varvals'][dep]))
+
+    changed, added, removed = dict_diff(a_data['file_checksum_values'], b_data['file_checksum_values'])
+    if changed:
+        for f in changed:
+            output.append("Checksum for file %s changed from %s to %s" % (f, a_data['file_checksum_values'][f], b_data['file_checksum_values'][f]))
+    if added:
+        for f in added:
+            output.append("Dependency on checksum of file %s was added" % (f))
+    if removed:
+        for f in removed:
+            output.append("Dependency on checksum of file %s was removed" % (f))
+
+
+    if 'runtaskhashes' in a_data and 'runtaskhashes' in b_data:
+        a = a_data['runtaskhashes']
+        b = b_data['runtaskhashes']
+        changed, added, removed = dict_diff(a, b)
+        if added:
+            for dep in added:
+                bdep_found = False
+                if removed:
+                    for bdep in removed:
+                        if a[dep] == b[bdep]:
+                            #output.append("Dependency on task %s was replaced by %s with same hash" % (dep, bdep))
+                            bdep_found = True
+                if not bdep_found:
+                    output.append("Dependency on task %s was added with hash %s" % (clean_basepath(dep), a[dep]))
+        if removed:
+            for dep in removed:
+                adep_found = False
+                if added:
+                    for adep in added:
+                        if a[adep] == b[dep]:
+                            #output.append("Dependency on task %s was replaced by %s with same hash" % (adep, dep))
+                            adep_found = True
+                if not adep_found:
+                    output.append("Dependency on task %s was removed with hash %s" % (clean_basepath(dep), b[dep]))
+        if changed:
+            for dep in changed:
+                output.append("Hash for dependent task %s changed from %s to %s" % (clean_basepath(dep), a[dep], b[dep]))
+                if callable(recursecb):
+                    recout = recursecb(dep, a[dep], b[dep])
+                    if recout:
+                        output.extend(recout)
+
+    a_taint = a_data.get('taint', None)
+    b_taint = b_data.get('taint', None)
+    if a_taint != b_taint:
+        output.append("Taint (by forced/invalidated task) changed from %s to %s" % (a_taint, b_taint))
+
+    return output
+
+
+def dump_sigfile(a):
+    output = []
+
+    p1 = pickle.Unpickler(open(a, "rb"))
+    a_data = p1.load()
+
+    output.append("basewhitelist: %s" % (a_data['basewhitelist']))
+
+    output.append("taskwhitelist: %s" % (a_data['taskwhitelist']))
+
+    output.append("Task dependencies: %s" % (sorted(a_data['taskdeps'])))
+
+    output.append("basehash: %s" % (a_data['basehash']))
+
+    for dep in a_data['gendeps']:
+        output.append("List of dependencies for variable %s is %s" % (dep, a_data['gendeps'][dep]))
+
+    for dep in a_data['varvals']:
+        output.append("Variable %s value is %s" % (dep, a_data['varvals'][dep]))
+
+    if 'runtaskdeps' in a_data:
+        output.append("Tasks this task depends on: %s" % (a_data['runtaskdeps']))
+
+    if 'file_checksum_values' in a_data:
+        output.append("This task depends on the checksums of files: %s" % (a_data['file_checksum_values']))
+
+    if 'runtaskhashes' in a_data:
+        for dep in a_data['runtaskhashes']:
+            output.append("Hash for dependent task %s is %s" % (dep, a_data['runtaskhashes'][dep]))
+
+    if 'taint' in a_data:
+        output.append("Tainted (by forced/invalidated task): %s" % a_data['taint'])
+
+    return output

bitbake/lib/bb/taskdata.py

@@ -0,0 +1,634 @@
+#!/usr/bin/env python
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+"""
+BitBake 'TaskData' implementation
+
+Task data collection and handling
+
+"""
+
+# Copyright (C) 2006  Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import logging
+import re
+import bb
+
+logger = logging.getLogger("BitBake.TaskData")
+
+def re_match_strings(target, strings):
+    """
+    Whether or not the string 'target' matches
+    any one string of the strings which can be regular expression string
+    """
+    return any(name == target or re.match(name, target)
+               for name in strings)
+
+class TaskData:
+    """
+    BitBake Task Data implementation
+    """
+    def __init__(self, abort = True, tryaltconfigs = False, skiplist = None):
+        self.build_names_index = []
+        self.run_names_index = []
+        self.fn_index = []
+
+        self.build_targets = {}
+        self.run_targets = {}
+
+        self.external_targets = []
+
+        self.tasks_fnid = []
+        self.tasks_name = []
+        self.tasks_tdepends = []
+        self.tasks_idepends = []
+        self.tasks_irdepends = []
+        # Cache to speed up task ID lookups
+        self.tasks_lookup = {}
+
+        self.depids = {}
+        self.rdepids = {}
+
+        self.consider_msgs_cache = []
+
+        self.failed_deps = []
+        self.failed_rdeps = []
+        self.failed_fnids = []
+
+        self.abort = abort
+        self.tryaltconfigs = tryaltconfigs
+
+        self.skiplist = skiplist
+
+    def getbuild_id(self, name):
+        """
+        Return an ID number for the build target name.
+        If it doesn't exist, create one.
+        """
+        if not name in self.build_names_index:
+            self.build_names_index.append(name)
+            return len(self.build_names_index) - 1
+
+        return self.build_names_index.index(name)
+
+    def getrun_id(self, name):
+        """
+        Return an ID number for the run target name.
+        If it doesn't exist, create one.
+        """
+        if not name in self.run_names_index:
+            self.run_names_index.append(name)
+            return len(self.run_names_index) - 1
+
+        return self.run_names_index.index(name)
+
+    def getfn_id(self, name):
+        """
+        Return an ID number for the filename.
+        If it doesn't exist, create one.
+        """
+        if not name in self.fn_index:
+            self.fn_index.append(name)
+            return len(self.fn_index) - 1
+
+        return self.fn_index.index(name)
+
+    def gettask_ids(self, fnid):
+        """
+        Return an array of the ID numbers matching a given fnid.
+        """
+        ids = []
+        if fnid in self.tasks_lookup:
+            for task in self.tasks_lookup[fnid]:
+                ids.append(self.tasks_lookup[fnid][task])
+        return ids
+
+    def gettask_id_fromfnid(self, fnid, task):
+        """
+        Return an ID number for the task matching fnid and task.
+        """
+        if fnid in self.tasks_lookup:
+            if task in self.tasks_lookup[fnid]:
+                return self.tasks_lookup[fnid][task]
+
+        return None
+
+    def gettask_id(self, fn, task, create = True):
+        """
+        Return an ID number for the task matching fn and task.
+        If it doesn't exist, create one by default.
+        Optionally return None instead.
+        """
+        fnid = self.getfn_id(fn)
+
+        if fnid in self.tasks_lookup:
+            if task in self.tasks_lookup[fnid]:
+                return self.tasks_lookup[fnid][task]
+
+        if not create:
+            return None
+
+        self.tasks_name.append(task)
+        self.tasks_fnid.append(fnid)
+        self.tasks_tdepends.append([])
+        self.tasks_idepends.append([])
+        self.tasks_irdepends.append([])
+
+        listid = len(self.tasks_name) - 1
+
+        if fnid not in self.tasks_lookup:
+            self.tasks_lookup[fnid] = {}
+        self.tasks_lookup[fnid][task] = listid
+
+        return listid
+
+    def add_tasks(self, fn, dataCache):
+        """
+        Add tasks for a given fn to the database
+        """
+
+        task_deps = dataCache.task_deps[fn]
+
+        fnid = self.getfn_id(fn)
+
+        if fnid in self.failed_fnids:
+            bb.msg.fatal("TaskData", "Trying to re-add a failed file? Something is broken...")
+
+        # Check if we've already seen this fn
+        if fnid in self.tasks_fnid:
+            return
+
+        for task in task_deps['tasks']:
+
+            # Work out task dependencies
+            parentids = []
+            for dep in task_deps['parents'][task]:
+                if dep not in task_deps['tasks']:
+                    bb.debug(2, "Not adding dependeny of %s on %s since %s does not exist" % (task, dep, dep))
+                    continue
+                parentid = self.gettask_id(fn, dep)
+                parentids.append(parentid)
+            taskid = self.gettask_id(fn, task)
+            self.tasks_tdepends[taskid].extend(parentids)
+
+            # Touch all intertask dependencies
+            if 'depends' in task_deps and task in task_deps['depends']:
+                ids = []
+                for dep in task_deps['depends'][task].split():
+                    if dep:
+                        if ":" not in dep:
+                            bb.msg.fatal("TaskData", "Error for %s, dependency %s does not contain ':' character\n. Task 'depends' should be specified in the form 'packagename:task'" % (fn, dep))
+                        ids.append(((self.getbuild_id(dep.split(":")[0])), dep.split(":")[1]))
+                self.tasks_idepends[taskid].extend(ids)
+            if 'rdepends' in task_deps and task in task_deps['rdepends']:
+                ids = []
+                for dep in task_deps['rdepends'][task].split():
+                    if dep:
+                        if ":" not in dep:
+                            bb.msg.fatal("TaskData", "Error for %s, dependency %s does not contain ':' character\n. Task 'rdepends' should be specified in the form 'packagename:task'" % (fn, dep))
+                        ids.append(((self.getrun_id(dep.split(":")[0])), dep.split(":")[1]))
+                self.tasks_irdepends[taskid].extend(ids)
+
+
+        # Work out build dependencies
+        if not fnid in self.depids:
+            dependids = {}
+            for depend in dataCache.deps[fn]:
+                logger.debug(2, "Added dependency %s for %s", depend, fn)
+                dependids[self.getbuild_id(depend)] = None
+            self.depids[fnid] = dependids.keys()
+
+        # Work out runtime dependencies
+        if not fnid in self.rdepids:
+            rdependids = {}
+            rdepends = dataCache.rundeps[fn]
+            rrecs = dataCache.runrecs[fn]
+            for package in rdepends:
+                for rdepend in rdepends[package]:
+                    logger.debug(2, "Added runtime dependency %s for %s", rdepend, fn)
+                    rdependids[self.getrun_id(rdepend)] = None
+            for package in rrecs:
+                for rdepend in rrecs[package]:
+                    logger.debug(2, "Added runtime recommendation %s for %s", rdepend, fn)
+                    rdependids[self.getrun_id(rdepend)] = None
+            self.rdepids[fnid] = rdependids.keys()
+
+        for dep in self.depids[fnid]:
+            if dep in self.failed_deps:
+                self.fail_fnid(fnid)
+                return
+        for dep in self.rdepids[fnid]:
+            if dep in self.failed_rdeps:
+                self.fail_fnid(fnid)
+                return
+
+    def have_build_target(self, target):
+        """
+        Have we a build target matching this name?
+        """
+        targetid = self.getbuild_id(target)
+
+        if targetid in self.build_targets:
+            return True
+        return False
+
+    def have_runtime_target(self, target):
+        """
+        Have we a runtime target matching this name?
+        """
+        targetid = self.getrun_id(target)
+
+        if targetid in self.run_targets:
+            return True
+        return False
+
+    def add_build_target(self, fn, item):
+        """
+        Add a build target.
+        If already present, append the provider fn to the list
+        """
+        targetid = self.getbuild_id(item)
+        fnid = self.getfn_id(fn)
+
+        if targetid in self.build_targets:
+            if fnid in self.build_targets[targetid]:
+                return
+            self.build_targets[targetid].append(fnid)
+            return
+        self.build_targets[targetid] = [fnid]
+
+    def add_runtime_target(self, fn, item):
+        """
+        Add a runtime target.
+        If already present, append the provider fn to the list
+        """
+        targetid = self.getrun_id(item)
+        fnid = self.getfn_id(fn)
+
+        if targetid in self.run_targets:
+            if fnid in self.run_targets[targetid]:
+                return
+            self.run_targets[targetid].append(fnid)
+            return
+        self.run_targets[targetid] = [fnid]
+
+    def mark_external_target(self, item):
+        """
+        Mark a build target as being externally requested
+        """
+        targetid = self.getbuild_id(item)
+
+        if targetid not in self.external_targets:
+            self.external_targets.append(targetid)
+
+    def get_unresolved_build_targets(self, dataCache):
+        """
+        Return a list of build targets who's providers
+        are unknown.
+        """
+        unresolved = []
+        for target in self.build_names_index:
+            if re_match_strings(target, dataCache.ignored_dependencies):
+                continue
+            if self.build_names_index.index(target) in self.failed_deps:
+                continue
+            if not self.have_build_target(target):
+                unresolved.append(target)
+        return unresolved
+
+    def get_unresolved_run_targets(self, dataCache):
+        """
+        Return a list of runtime targets who's providers
+        are unknown.
+        """
+        unresolved = []
+        for target in self.run_names_index:
+            if re_match_strings(target, dataCache.ignored_dependencies):
+                continue
+            if self.run_names_index.index(target) in self.failed_rdeps:
+                continue
+            if not self.have_runtime_target(target):
+                unresolved.append(target)
+        return unresolved
+
+    def get_provider(self, item):
+        """
+        Return a list of providers of item
+        """
+        targetid = self.getbuild_id(item)
+
+        return self.build_targets[targetid]
+
+    def get_dependees(self, itemid):
+        """
+        Return a list of targets which depend on item
+        """
+        dependees = []
+        for fnid in self.depids:
+            if itemid in self.depids[fnid]:
+                dependees.append(fnid)
+        return dependees
+
+    def get_dependees_str(self, item):
+        """
+        Return a list of targets which depend on item as a user readable string
+        """
+        itemid = self.getbuild_id(item)
+        dependees = []
+        for fnid in self.depids:
+            if itemid in self.depids[fnid]:
+                dependees.append(self.fn_index[fnid])
+        return dependees
+
+    def get_rdependees(self, itemid):
+        """
+        Return a list of targets which depend on runtime item
+        """
+        dependees = []
+        for fnid in self.rdepids:
+            if itemid in self.rdepids[fnid]:
+                dependees.append(fnid)
+        return dependees
+
+    def get_rdependees_str(self, item):
+        """
+        Return a list of targets which depend on runtime item as a user readable string
+        """
+        itemid = self.getrun_id(item)
+        dependees = []
+        for fnid in self.rdepids:
+            if itemid in self.rdepids[fnid]:
+                dependees.append(self.fn_index[fnid])
+        return dependees
+
+    def get_reasons(self, item, runtime=False):
+        """
+        Get the reason(s) for an item not being provided, if any
+        """
+        reasons = []
+        if self.skiplist:
+            for fn in self.skiplist:
+                skipitem = self.skiplist[fn]
+                if skipitem.pn == item:
+                    reasons.append("%s was skipped: %s" % (skipitem.pn, skipitem.skipreason))
+                elif runtime and item in skipitem.rprovides:
+                    reasons.append("%s RPROVIDES %s but was skipped: %s" % (skipitem.pn, item, skipitem.skipreason))
+                elif not runtime and item in skipitem.provides:
+                    reasons.append("%s PROVIDES %s but was skipped: %s" % (skipitem.pn, item, skipitem.skipreason))
+        return reasons
+
+    def add_provider(self, cfgData, dataCache, item):
+        try:
+            self.add_provider_internal(cfgData, dataCache, item)
+        except bb.providers.NoProvider:
+            if self.abort:
+                raise
+            self.remove_buildtarget(self.getbuild_id(item))
+
+        self.mark_external_target(item)
+
+    def add_provider_internal(self, cfgData, dataCache, item):
+        """
+        Add the providers of item to the task data
+        Mark entries were specifically added externally as against dependencies
+        added internally during dependency resolution
+        """
+
+        if re_match_strings(item, dataCache.ignored_dependencies):
+            return
+
+        if not item in dataCache.providers:
+            bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item), reasons=self.get_reasons(item)), cfgData)
+            raise bb.providers.NoProvider(item)
+
+        if self.have_build_target(item):
+            return
+
+        all_p = dataCache.providers[item]
+
+        eligible, foundUnique = bb.providers.filterProviders(all_p, item, cfgData, dataCache)
+        eligible = [p for p in eligible if not self.getfn_id(p) in self.failed_fnids]
+
+        if not eligible:
+            bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item), reasons=["No eligible PROVIDERs exist for '%s'" % item]), cfgData)
+            raise bb.providers.NoProvider(item)
+
+        if len(eligible) > 1 and foundUnique == False:
+            if item not in self.consider_msgs_cache:
+                providers_list = []
+                for fn in eligible:
+                    providers_list.append(dataCache.pkg_fn[fn])
+                bb.event.fire(bb.event.MultipleProviders(item, providers_list), cfgData)
+            self.consider_msgs_cache.append(item)
+
+        for fn in eligible:
+            fnid = self.getfn_id(fn)
+            if fnid in self.failed_fnids:
+                continue
+            logger.debug(2, "adding %s to satisfy %s", fn, item)
+            self.add_build_target(fn, item)
+            self.add_tasks(fn, dataCache)
+
+
+            #item = dataCache.pkg_fn[fn]
+
+    def add_rprovider(self, cfgData, dataCache, item):
+        """
+        Add the runtime providers of item to the task data
+        (takes item names from RDEPENDS/PACKAGES namespace)
+        """
+
+        if re_match_strings(item, dataCache.ignored_dependencies):
+            return
+
+        if self.have_runtime_target(item):
+            return
+
+        all_p = bb.providers.getRuntimeProviders(dataCache, item)
+
+        if not all_p:
+            bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item), reasons=self.get_reasons(item, True)), cfgData)
+            raise bb.providers.NoRProvider(item)
+
+        eligible, numberPreferred = bb.providers.filterProvidersRunTime(all_p, item, cfgData, dataCache)
+        eligible = [p for p in eligible if not self.getfn_id(p) in self.failed_fnids]
+
+        if not eligible:
+            bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item), reasons=["No eligible RPROVIDERs exist for '%s'" % item]), cfgData)
+            raise bb.providers.NoRProvider(item)
+
+        if len(eligible) > 1 and numberPreferred == 0:
+            if item not in self.consider_msgs_cache:
+                providers_list = []
+                for fn in eligible:
+                    providers_list.append(dataCache.pkg_fn[fn])
+                bb.event.fire(bb.event.MultipleProviders(item, providers_list, runtime=True), cfgData)
+            self.consider_msgs_cache.append(item)
+
+        if numberPreferred > 1:
+            if item not in self.consider_msgs_cache:
+                providers_list = []
+                for fn in eligible:
+                    providers_list.append(dataCache.pkg_fn[fn])
+                bb.event.fire(bb.event.MultipleProviders(item, providers_list, runtime=True), cfgData)
+            self.consider_msgs_cache.append(item)
+            raise bb.providers.MultipleRProvider(item)
+
+        # run through the list until we find one that we can build
+        for fn in eligible:
+            fnid = self.getfn_id(fn)
+            if fnid in self.failed_fnids:
+                continue
+            logger.debug(2, "adding '%s' to satisfy runtime '%s'", fn, item)
+            self.add_runtime_target(fn, item)
+            self.add_tasks(fn, dataCache)
+
+    def fail_fnid(self, fnid, missing_list = []):
+        """
+        Mark a file as failed (unbuildable)
+        Remove any references from build and runtime provider lists
+
+        missing_list, A list of missing requirements for this target
+        """
+        if fnid in self.failed_fnids:
+            return
+        logger.debug(1, "File '%s' is unbuildable, removing...", self.fn_index[fnid])
+        self.failed_fnids.append(fnid)
+        for target in self.build_targets:
+            if fnid in self.build_targets[target]:
+                self.build_targets[target].remove(fnid)
+                if len(self.build_targets[target]) == 0:
+                    self.remove_buildtarget(target, missing_list)
+        for target in self.run_targets:
+            if fnid in self.run_targets[target]:
+                self.run_targets[target].remove(fnid)
+                if len(self.run_targets[target]) == 0:
+                    self.remove_runtarget(target, missing_list)
+
+    def remove_buildtarget(self, targetid, missing_list = []):
+        """
+        Mark a build target as failed (unbuildable)
+        Trigger removal of any files that have this as a dependency
+        """
+        if not missing_list:
+            missing_list = [self.build_names_index[targetid]]
+        else:
+            missing_list = [self.build_names_index[targetid]] + missing_list
+        logger.verbose("Target '%s' is unbuildable, removing...\nMissing or unbuildable dependency chain was: %s", self.build_names_index[targetid], missing_list)
+        self.failed_deps.append(targetid)
+        dependees = self.get_dependees(targetid)
+        for fnid in dependees:
+            self.fail_fnid(fnid, missing_list)
+        for taskid in xrange(len(self.tasks_idepends)):
+            idepends = self.tasks_idepends[taskid]
+            for (idependid, idependtask) in idepends:
+                if idependid == targetid:
+                    self.fail_fnid(self.tasks_fnid[taskid], missing_list)
+
+        if self.abort and targetid in self.external_targets:
+            target = self.build_names_index[targetid]
+            logger.error("Required build target '%s' has no buildable providers.\nMissing or unbuildable dependency chain was: %s", target, missing_list)
+            raise bb.providers.NoProvider(target)
+
+    def remove_runtarget(self, targetid, missing_list = []):
+        """
+        Mark a run target as failed (unbuildable)
+        Trigger removal of any files that have this as a dependency
+        """
+        if not missing_list:
+            missing_list = [self.run_names_index[targetid]]
+        else:
+            missing_list = [self.run_names_index[targetid]] + missing_list
+
+        logger.info("Runtime target '%s' is unbuildable, removing...\nMissing or unbuildable dependency chain was: %s", self.run_names_index[targetid], missing_list)
+        self.failed_rdeps.append(targetid)
+        dependees = self.get_rdependees(targetid)
+        for fnid in dependees:
+            self.fail_fnid(fnid, missing_list)
+        for taskid in xrange(len(self.tasks_irdepends)):
+            irdepends = self.tasks_irdepends[taskid]
+            for (idependid, idependtask) in irdepends:
+                if idependid == targetid:
+                    self.fail_fnid(self.tasks_fnid[taskid], missing_list)
+
+    def add_unresolved(self, cfgData, dataCache):
+        """
+        Resolve all unresolved build and runtime targets
+        """
+        logger.info("Resolving any missing task queue dependencies")
+        while True:
+            added = 0
+            for target in self.get_unresolved_build_targets(dataCache):
+                try:
+                    self.add_provider_internal(cfgData, dataCache, target)
+                    added = added + 1
+                except bb.providers.NoProvider:
+                    targetid = self.getbuild_id(target)
+                    if self.abort and targetid in self.external_targets:
+                        raise
+                    self.remove_buildtarget(targetid)
+            for target in self.get_unresolved_run_targets(dataCache):
+                try:
+                    self.add_rprovider(cfgData, dataCache, target)
+                    added = added + 1
+                except (bb.providers.NoRProvider, bb.providers.MultipleRProvider):
+                    self.remove_runtarget(self.getrun_id(target))
+            logger.debug(1, "Resolved " + str(added) + " extra dependencies")
+            if added == 0:
+                break
+        # self.dump_data()
+
+    def dump_data(self):
+        """
+        Dump some debug information on the internal data structures
+        """
+        logger.debug(3, "build_names:")
+        logger.debug(3, ", ".join(self.build_names_index))
+
+        logger.debug(3, "run_names:")
+        logger.debug(3, ", ".join(self.run_names_index))
+
+        logger.debug(3, "build_targets:")
+        for buildid in xrange(len(self.build_names_index)):
+            target = self.build_names_index[buildid]
+            targets = "None"
+            if buildid in self.build_targets:
+                targets = self.build_targets[buildid]
+            logger.debug(3, " (%s)%s: %s", buildid, target, targets)
+
+        logger.debug(3, "run_targets:")
+        for runid in xrange(len(self.run_names_index)):
+            target = self.run_names_index[runid]
+            targets = "None"
+            if runid in self.run_targets:
+                targets = self.run_targets[runid]
+            logger.debug(3, " (%s)%s: %s", runid, target, targets)
+
+        logger.debug(3, "tasks:")
+        for task in xrange(len(self.tasks_name)):
+            logger.debug(3, " (%s)%s - %s: %s",
+                       task,
+                       self.fn_index[self.tasks_fnid[task]],
+                       self.tasks_name[task],
+                       self.tasks_tdepends[task])
+
+        logger.debug(3, "dependency ids (per fn):")
+        for fnid in self.depids:
+            logger.debug(3, " %s %s: %s", fnid, self.fn_index[fnid], self.depids[fnid])
+
+        logger.debug(3, "runtime dependency ids (per fn):")
+        for fnid in self.rdepids:
+            logger.debug(3, " %s %s: %s", fnid, self.fn_index[fnid], self.rdepids[fnid])

bitbake/lib/bb/tests/codeparser.py

@@ -0,0 +1,374 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# BitBake Test for codeparser.py
+#
+# Copyright (C) 2010 Chris Larson
+# Copyright (C) 2012 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+
+import unittest
+import logging
+import bb
+
+logger = logging.getLogger('BitBake.TestCodeParser')
+
+# bb.data references bb.parse but can't directly import due to circular dependencies.
+# Hack around it for now :( 
+import bb.parse
+import bb.data
+
+class ReferenceTest(unittest.TestCase):
+    def setUp(self):
+        self.d = bb.data.init()
+
+    def setEmptyVars(self, varlist):
+        for k in varlist:
+            self.d.setVar(k, "")
+
+    def setValues(self, values):
+        for k, v in values.items():
+            self.d.setVar(k, v)
+
+    def assertReferences(self, refs):
+        self.assertEqual(self.references, refs)
+
+    def assertExecs(self, execs):
+        self.assertEqual(self.execs, execs)
+
+class VariableReferenceTest(ReferenceTest):
+
+    def parseExpression(self, exp):
+        parsedvar = self.d.expandWithRefs(exp, None)
+        self.references = parsedvar.references
+
+    def test_simple_reference(self):
+        self.setEmptyVars(["FOO"])
+        self.parseExpression("${FOO}")
+        self.assertReferences(set(["FOO"]))
+
+    def test_nested_reference(self):
+        self.setEmptyVars(["BAR"])
+        self.d.setVar("FOO", "BAR")
+        self.parseExpression("${${FOO}}")
+        self.assertReferences(set(["FOO", "BAR"]))
+
+    def test_python_reference(self):
+        self.setEmptyVars(["BAR"])
+        self.parseExpression("${@bb.data.getVar('BAR', d, True) + 'foo'}")
+        self.assertReferences(set(["BAR"]))
+
+class ShellReferenceTest(ReferenceTest):
+
+    def parseExpression(self, exp):
+        parsedvar = self.d.expandWithRefs(exp, None)
+        parser = bb.codeparser.ShellParser("ParserTest", logger)
+        parser.parse_shell(parsedvar.value)
+
+        self.references = parsedvar.references
+        self.execs = parser.execs
+
+    def test_quotes_inside_assign(self):
+        self.parseExpression('foo=foo"bar"baz')
+        self.assertReferences(set([]))
+
+    def test_quotes_inside_arg(self):
+        self.parseExpression('sed s#"bar baz"#"alpha beta"#g')
+        self.assertExecs(set(["sed"]))
+
+    def test_arg_continuation(self):
+        self.parseExpression("sed -i -e s,foo,bar,g \\\n *.pc")
+        self.assertExecs(set(["sed"]))
+
+    def test_dollar_in_quoted(self):
+        self.parseExpression('sed -i -e "foo$" *.pc')
+        self.assertExecs(set(["sed"]))
+
+    def test_quotes_inside_arg_continuation(self):
+        self.setEmptyVars(["bindir", "D", "libdir"])
+        self.parseExpression("""
+sed -i -e s#"moc_location=.*$"#"moc_location=${bindir}/moc4"# \\
+-e s#"uic_location=.*$"#"uic_location=${bindir}/uic4"# \\
+${D}${libdir}/pkgconfig/*.pc
+""")
+        self.assertReferences(set(["bindir", "D", "libdir"]))
+
+    def test_assign_subshell_expansion(self):
+        self.parseExpression("foo=$(echo bar)")
+        self.assertExecs(set(["echo"]))
+
+    def test_shell_unexpanded(self):
+        self.setEmptyVars(["QT_BASE_NAME"])
+        self.parseExpression('echo "${QT_BASE_NAME}"')
+        self.assertExecs(set(["echo"]))
+        self.assertReferences(set(["QT_BASE_NAME"]))
+
+    def test_incomplete_varexp_single_quotes(self):
+        self.parseExpression("sed -i -e 's:IP{:I${:g' $pc")
+        self.assertExecs(set(["sed"]))
+
+
+    def test_until(self):
+        self.parseExpression("until false; do echo true; done")
+        self.assertExecs(set(["false", "echo"]))
+        self.assertReferences(set())
+
+    def test_case(self):
+        self.parseExpression("""
+case $foo in
+*)
+bar
+;;
+esac
+""")
+        self.assertExecs(set(["bar"]))
+        self.assertReferences(set())
+
+    def test_assign_exec(self):
+        self.parseExpression("a=b c='foo bar' alpha 1 2 3")
+        self.assertExecs(set(["alpha"]))
+
+    def test_redirect_to_file(self):
+        self.setEmptyVars(["foo"])
+        self.parseExpression("echo foo >${foo}/bar")
+        self.assertExecs(set(["echo"]))
+        self.assertReferences(set(["foo"]))
+
+    def test_heredoc(self):
+        self.setEmptyVars(["theta"])
+        self.parseExpression("""
+cat <<END
+alpha
+beta
+${theta}
+END
+""")
+        self.assertReferences(set(["theta"]))
+
+    def test_redirect_from_heredoc(self):
+        v = ["B", "SHADOW_MAILDIR", "SHADOW_MAILFILE", "SHADOW_UTMPDIR", "SHADOW_LOGDIR", "bindir"]
+        self.setEmptyVars(v)
+        self.parseExpression("""
+cat <<END >${B}/cachedpaths
+shadow_cv_maildir=${SHADOW_MAILDIR}
+shadow_cv_mailfile=${SHADOW_MAILFILE}
+shadow_cv_utmpdir=${SHADOW_UTMPDIR}
+shadow_cv_logdir=${SHADOW_LOGDIR}
+shadow_cv_passwd_dir=${bindir}
+END
+""")
+        self.assertReferences(set(v))
+        self.assertExecs(set(["cat"]))
+
+#    def test_incomplete_command_expansion(self):
+#        self.assertRaises(reftracker.ShellSyntaxError, reftracker.execs,
+#                          bbvalue.shparse("cp foo`", self.d), self.d)
+
+#    def test_rogue_dollarsign(self):
+#        self.setValues({"D" : "/tmp"})
+#        self.parseExpression("install -d ${D}$")
+#        self.assertReferences(set(["D"]))
+#        self.assertExecs(set(["install"]))
+
+
+class PythonReferenceTest(ReferenceTest):
+
+    def setUp(self):
+        self.d = bb.data.init()
+        if hasattr(bb.utils, "_context"):
+            self.context = bb.utils._context
+        else:
+            import __builtin__
+            self.context = __builtin__.__dict__
+
+    def parseExpression(self, exp):
+        parsedvar = self.d.expandWithRefs(exp, None)
+        parser = bb.codeparser.PythonParser("ParserTest", logger)
+        parser.parse_python(parsedvar.value)
+
+        self.references = parsedvar.references | parser.references
+        self.execs = parser.execs
+
+    @staticmethod
+    def indent(value):
+        """Python Snippets have to be indented, python values don't have to
+be. These unit tests are testing snippets."""
+        return " " + value
+
+    def test_getvar_reference(self):
+        self.parseExpression("bb.data.getVar('foo', d, True)")
+        self.assertReferences(set(["foo"]))
+        self.assertExecs(set())
+
+    def test_getvar_computed_reference(self):
+        self.parseExpression("bb.data.getVar('f' + 'o' + 'o', d, True)")
+        self.assertReferences(set())
+        self.assertExecs(set())
+
+    def test_getvar_exec_reference(self):
+        self.parseExpression("eval('bb.data.getVar(\"foo\", d, True)')")
+        self.assertReferences(set())
+        self.assertExecs(set(["eval"]))
+
+    def test_var_reference(self):
+        self.context["foo"] = lambda x: x
+        self.setEmptyVars(["FOO"])
+        self.parseExpression("foo('${FOO}')")
+        self.assertReferences(set(["FOO"]))
+        self.assertExecs(set(["foo"]))
+        del self.context["foo"]
+
+    def test_var_exec(self):
+        for etype in ("func", "task"):
+            self.d.setVar("do_something", "echo 'hi mom! ${FOO}'")
+            self.d.setVarFlag("do_something", etype, True)
+            self.parseExpression("bb.build.exec_func('do_something', d)")
+            self.assertReferences(set(["do_something"]))
+
+    def test_function_reference(self):
+        self.context["testfunc"] = lambda msg: bb.msg.note(1, None, msg)
+        self.d.setVar("FOO", "Hello, World!")
+        self.parseExpression("testfunc('${FOO}')")
+        self.assertReferences(set(["FOO"]))
+        self.assertExecs(set(["testfunc"]))
+        del self.context["testfunc"]
+
+    def test_qualified_function_reference(self):
+        self.parseExpression("time.time()")
+        self.assertExecs(set(["time.time"]))
+
+    def test_qualified_function_reference_2(self):
+        self.parseExpression("os.path.dirname('/foo/bar')")
+        self.assertExecs(set(["os.path.dirname"]))
+
+    def test_qualified_function_reference_nested(self):
+        self.parseExpression("time.strftime('%Y%m%d',time.gmtime())")
+        self.assertExecs(set(["time.strftime", "time.gmtime"]))
+
+    def test_function_reference_chained(self):
+        self.context["testget"] = lambda: "\tstrip me "
+        self.parseExpression("testget().strip()")
+        self.assertExecs(set(["testget"]))
+        del self.context["testget"]
+
+
+class DependencyReferenceTest(ReferenceTest):
+
+    pydata = """
+bb.data.getVar('somevar', d, True)
+def test(d):
+    foo = 'bar %s' % 'foo'
+def test2(d):
+    d.getVar(foo, True)
+    d.getVar('bar', False)
+    test2(d)
+
+def a():
+    \"\"\"some
+    stuff
+    \"\"\"
+    return "heh"
+
+test(d)
+
+bb.data.expand(bb.data.getVar("something", False, d), d)
+bb.data.expand("${inexpand} somethingelse", d)
+bb.data.getVar(a(), d, False)
+"""
+
+    def test_python(self):
+        self.d.setVar("FOO", self.pydata)
+        self.setEmptyVars(["inexpand", "a", "test2", "test"])
+        self.d.setVarFlags("FOO", {"func": True, "python": True})
+
+        deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
+
+        self.assertEquals(deps, set(["somevar", "bar", "something", "inexpand", "test", "test2", "a"]))
+
+
+    shelldata = """
+foo () {
+bar
+}
+{
+echo baz
+$(heh)
+eval `moo`
+}
+a=b
+c=d
+(
+true && false
+test -f foo
+testval=something
+$testval
+) || aiee
+! inverted
+echo ${somevar}
+
+case foo in
+bar)
+echo bar
+;;
+baz)
+echo baz
+;;
+foo*)
+echo foo
+;;
+esac
+"""
+
+    def test_shell(self):
+        execs = ["bar", "echo", "heh", "moo", "true", "aiee"]
+        self.d.setVar("somevar", "heh")
+        self.d.setVar("inverted", "echo inverted...")
+        self.d.setVarFlag("inverted", "func", True)
+        self.d.setVar("FOO", self.shelldata)
+        self.d.setVarFlags("FOO", {"func": True})
+        self.setEmptyVars(execs)
+
+        deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
+
+        self.assertEquals(deps, set(["somevar", "inverted"] + execs))
+
+
+    def test_vardeps(self):
+        self.d.setVar("oe_libinstall", "echo test")
+        self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
+        self.d.setVarFlag("FOO", "vardeps", "oe_libinstall")
+
+        deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
+
+        self.assertEquals(deps, set(["oe_libinstall"]))
+
+    def test_vardeps_expand(self):
+        self.d.setVar("oe_libinstall", "echo test")
+        self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
+        self.d.setVarFlag("FOO", "vardeps", "${@'oe_libinstall'}")
+
+        deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
+
+        self.assertEquals(deps, set(["oe_libinstall"]))
+
+    #Currently no wildcard support
+    #def test_vardeps_wildcards(self):
+    #    self.d.setVar("oe_libinstall", "echo test")
+    #    self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
+    #    self.d.setVarFlag("FOO", "vardeps", "oe_*")
+    #    self.assertEquals(deps, set(["oe_libinstall"]))
+
+

bitbake/lib/bb/tests/cow.py

@@ -0,0 +1,136 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# BitBake Tests for Copy-on-Write (cow.py)
+#
+# Copyright 2006 Holger Freyther <freyther@handhelds.org>
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+
+import unittest
+import os
+
+class COWTestCase(unittest.TestCase):
+    """
+    Test case for the COW module from mithro
+    """
+
+    def testGetSet(self):
+        """
+        Test and set
+        """
+        from bb.COW import COWDictBase
+        a = COWDictBase.copy()
+
+        self.assertEquals(False, a.has_key('a'))
+
+        a['a'] = 'a'
+        a['b'] = 'b'
+        self.assertEquals(True, a.has_key('a'))
+        self.assertEquals(True, a.has_key('b'))
+        self.assertEquals('a', a['a'] )
+        self.assertEquals('b', a['b'] )
+
+    def testCopyCopy(self):
+        """
+        Test the copy of copies
+        """
+
+        from bb.COW import COWDictBase
+
+        # create two COW dict 'instances'
+        b = COWDictBase.copy()
+        c = COWDictBase.copy()
+
+        # assign some keys to one instance, some keys to another
+        b['a'] = 10
+        b['c'] = 20
+        c['a'] = 30
+
+        # test separation of the two instances
+        self.assertEquals(False, c.has_key('c'))
+        self.assertEquals(30, c['a'])
+        self.assertEquals(10, b['a'])
+
+        # test copy
+        b_2 = b.copy()
+        c_2 = c.copy()
+
+        self.assertEquals(False, c_2.has_key('c'))
+        self.assertEquals(10, b_2['a'])
+
+        b_2['d'] = 40
+        self.assertEquals(False, c_2.has_key('d'))
+        self.assertEquals(True, b_2.has_key('d'))
+        self.assertEquals(40, b_2['d'])
+        self.assertEquals(False, b.has_key('d'))
+        self.assertEquals(False, c.has_key('d'))
+
+        c_2['d'] = 30
+        self.assertEquals(True, c_2.has_key('d'))
+        self.assertEquals(True, b_2.has_key('d'))
+        self.assertEquals(30, c_2['d'])
+        self.assertEquals(40, b_2['d'])
+        self.assertEquals(False, b.has_key('d'))
+        self.assertEquals(False, c.has_key('d'))
+
+        # test copy of the copy
+        c_3 = c_2.copy()
+        b_3 = b_2.copy()
+        b_3_2 = b_2.copy()
+
+        c_3['e'] = 4711
+        self.assertEquals(4711, c_3['e'])
+        self.assertEquals(False, c_2.has_key('e'))
+        self.assertEquals(False, b_3.has_key('e'))
+        self.assertEquals(False, b_3_2.has_key('e'))
+        self.assertEquals(False, b_2.has_key('e'))
+
+        b_3['e'] = 'viel'
+        self.assertEquals('viel', b_3['e'])
+        self.assertEquals(4711, c_3['e'])
+        self.assertEquals(False, c_2.has_key('e'))
+        self.assertEquals(True, b_3.has_key('e'))
+        self.assertEquals(False, b_3_2.has_key('e'))
+        self.assertEquals(False, b_2.has_key('e'))
+
+    def testCow(self):
+        from bb.COW import COWDictBase
+        c = COWDictBase.copy()
+        c['123'] = 1027
+        c['other'] = 4711
+        c['d'] = { 'abc' : 10, 'bcd' : 20 }
+
+        copy = c.copy()
+
+        self.assertEquals(1027, c['123'])
+        self.assertEquals(4711, c['other'])
+        self.assertEquals({'abc':10, 'bcd':20}, c['d'])
+        self.assertEquals(1027, copy['123'])
+        self.assertEquals(4711, copy['other'])
+        self.assertEquals({'abc':10, 'bcd':20}, copy['d'])
+
+        # cow it now
+        copy['123'] = 1028
+        copy['other'] = 4712
+        copy['d']['abc'] = 20
+
+
+        self.assertEquals(1027, c['123'])
+        self.assertEquals(4711, c['other'])
+        self.assertEquals({'abc':10, 'bcd':20}, c['d'])
+        self.assertEquals(1028, copy['123'])
+        self.assertEquals(4712, copy['other'])
+        self.assertEquals({'abc':20, 'bcd':20}, copy['d'])

bitbake/lib/bb/tests/data.py

@@ -0,0 +1,254 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# BitBake Tests for the Data Store (data.py/data_smart.py)
+#
+# Copyright (C) 2010 Chris Larson
+# Copyright (C) 2012 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+
+import unittest
+import bb
+import bb.data
+
+class DataExpansions(unittest.TestCase):
+    def setUp(self):
+        self.d = bb.data.init()
+        self.d["foo"] = "value of foo"
+        self.d["bar"] = "value of bar"
+        self.d["value of foo"] = "value of 'value of foo'"
+
+    def test_one_var(self):
+        val = self.d.expand("${foo}")
+        self.assertEqual(str(val), "value of foo")
+
+    def test_indirect_one_var(self):
+        val = self.d.expand("${${foo}}")
+        self.assertEqual(str(val), "value of 'value of foo'")
+
+    def test_indirect_and_another(self):
+        val = self.d.expand("${${foo}} ${bar}")
+        self.assertEqual(str(val), "value of 'value of foo' value of bar")
+
+    def test_python_snippet(self):
+        val = self.d.expand("${@5*12}")
+        self.assertEqual(str(val), "60")
+
+    def test_expand_in_python_snippet(self):
+        val = self.d.expand("${@'boo ' + '${foo}'}")
+        self.assertEqual(str(val), "boo value of foo")
+
+    def test_python_snippet_getvar(self):
+        val = self.d.expand("${@d.getVar('foo', True) + ' ${bar}'}")
+        self.assertEqual(str(val), "value of foo value of bar")
+
+    def test_python_snippet_syntax_error(self):
+        self.d.setVar("FOO", "${@foo = 5}")
+        self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
+
+    def test_python_snippet_runtime_error(self):
+        self.d.setVar("FOO", "${@int('test')}")
+        self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
+
+    def test_python_snippet_error_path(self):
+        self.d.setVar("FOO", "foo value ${BAR}")
+        self.d.setVar("BAR", "bar value ${@int('test')}")
+        self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
+
+    def test_value_containing_value(self):
+        val = self.d.expand("${@d.getVar('foo', True) + ' ${bar}'}")
+        self.assertEqual(str(val), "value of foo value of bar")
+
+    def test_reference_undefined_var(self):
+        val = self.d.expand("${undefinedvar} meh")
+        self.assertEqual(str(val), "${undefinedvar} meh")
+
+    def test_double_reference(self):
+        self.d.setVar("BAR", "bar value")
+        self.d.setVar("FOO", "${BAR} foo ${BAR}")
+        val = self.d.getVar("FOO", True)
+        self.assertEqual(str(val), "bar value foo bar value")
+
+    def test_direct_recursion(self):
+        self.d.setVar("FOO", "${FOO}")
+        self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
+
+    def test_indirect_recursion(self):
+        self.d.setVar("FOO", "${BAR}")
+        self.d.setVar("BAR", "${BAZ}")
+        self.d.setVar("BAZ", "${FOO}")
+        self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
+
+    def test_recursion_exception(self):
+        self.d.setVar("FOO", "${BAR}")
+        self.d.setVar("BAR", "${${@'FOO'}}")
+        self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
+
+    def test_incomplete_varexp_single_quotes(self):
+        self.d.setVar("FOO", "sed -i -e 's:IP{:I${:g' $pc")
+        val = self.d.getVar("FOO", True)
+        self.assertEqual(str(val), "sed -i -e 's:IP{:I${:g' $pc")
+
+    def test_nonstring(self):
+        self.d.setVar("TEST", 5)
+        val = self.d.getVar("TEST", True)
+        self.assertEqual(str(val), "5")
+
+    def test_rename(self):
+        self.d.renameVar("foo", "newfoo")
+        self.assertEqual(self.d.getVar("newfoo"), "value of foo")
+        self.assertEqual(self.d.getVar("foo"), None)
+
+    def test_deletion(self):
+        self.d.delVar("foo")
+        self.assertEqual(self.d.getVar("foo"), None)
+
+    def test_keys(self):
+        keys = self.d.keys()
+        self.assertEqual(keys, ['value of foo', 'foo', 'bar'])
+
+class TestNestedExpansions(unittest.TestCase):
+    def setUp(self):
+        self.d = bb.data.init()
+        self.d["foo"] = "foo"
+        self.d["bar"] = "bar"
+        self.d["value of foobar"] = "187"
+
+    def test_refs(self):
+        val = self.d.expand("${value of ${foo}${bar}}")
+        self.assertEqual(str(val), "187")
+
+    #def test_python_refs(self):
+    #    val = self.d.expand("${@${@3}**2 + ${@4}**2}")
+    #    self.assertEqual(str(val), "25")
+
+    def test_ref_in_python_ref(self):
+        val = self.d.expand("${@'${foo}' + 'bar'}")
+        self.assertEqual(str(val), "foobar")
+
+    def test_python_ref_in_ref(self):
+        val = self.d.expand("${${@'f'+'o'+'o'}}")
+        self.assertEqual(str(val), "foo")
+
+    def test_deep_nesting(self):
+        depth = 100
+        val = self.d.expand("${" * depth + "foo" + "}" * depth)
+        self.assertEqual(str(val), "foo")
+
+    #def test_deep_python_nesting(self):
+    #    depth = 50
+    #    val = self.d.expand("${@" * depth + "1" + "+1}" * depth)
+    #    self.assertEqual(str(val), str(depth + 1))
+
+    def test_mixed(self):
+        val = self.d.expand("${value of ${@('${foo}'+'bar')[0:3]}${${@'BAR'.lower()}}}")
+        self.assertEqual(str(val), "187")
+
+    def test_runtime(self):
+        val = self.d.expand("${${@'value of' + ' f'+'o'+'o'+'b'+'a'+'r'}}")
+        self.assertEqual(str(val), "187")
+
+class TestMemoize(unittest.TestCase):
+    def test_memoized(self):
+        d = bb.data.init()
+        d.setVar("FOO", "bar")
+        self.assertTrue(d.getVar("FOO") is d.getVar("FOO"))
+
+    def test_not_memoized(self):
+        d1 = bb.data.init()
+        d2 = bb.data.init()
+        d1.setVar("FOO", "bar")
+        d2.setVar("FOO", "bar2")
+        self.assertTrue(d1.getVar("FOO") is not d2.getVar("FOO"))
+
+    def test_changed_after_memoized(self):
+        d = bb.data.init()
+        d.setVar("foo", "value of foo")
+        self.assertEqual(str(d.getVar("foo")), "value of foo")
+        d.setVar("foo", "second value of foo")
+        self.assertEqual(str(d.getVar("foo")), "second value of foo")
+
+    def test_same_value(self):
+        d = bb.data.init()
+        d.setVar("foo", "value of")
+        d.setVar("bar", "value of")
+        self.assertEqual(d.getVar("foo"),
+                         d.getVar("bar"))
+
+class TestConcat(unittest.TestCase):
+    def setUp(self):
+        self.d = bb.data.init()
+        self.d.setVar("FOO", "foo")
+        self.d.setVar("VAL", "val")
+        self.d.setVar("BAR", "bar")
+
+    def test_prepend(self):
+        self.d.setVar("TEST", "${VAL}")
+        self.d.prependVar("TEST", "${FOO}:")
+        self.assertEqual(self.d.getVar("TEST", True), "foo:val")
+
+    def test_append(self):
+        self.d.setVar("TEST", "${VAL}")
+        self.d.appendVar("TEST", ":${BAR}")
+        self.assertEqual(self.d.getVar("TEST", True), "val:bar")
+
+    def test_multiple_append(self):
+        self.d.setVar("TEST", "${VAL}")
+        self.d.prependVar("TEST", "${FOO}:")
+        self.d.appendVar("TEST", ":val2")
+        self.d.appendVar("TEST", ":${BAR}")
+        self.assertEqual(self.d.getVar("TEST", True), "foo:val:val2:bar")
+
+class TestOverrides(unittest.TestCase):
+    def setUp(self):
+        self.d = bb.data.init()
+        self.d.setVar("OVERRIDES", "foo:bar:local")
+        self.d.setVar("TEST", "testvalue")
+
+    def test_no_override(self):
+        bb.data.update_data(self.d)
+        self.assertEqual(self.d.getVar("TEST", True), "testvalue")
+
+    def test_one_override(self):
+        self.d.setVar("TEST_bar", "testvalue2")
+        bb.data.update_data(self.d)
+        self.assertEqual(self.d.getVar("TEST", True), "testvalue2")
+
+    def test_multiple_override(self):
+        self.d.setVar("TEST_bar", "testvalue2")
+        self.d.setVar("TEST_local", "testvalue3")
+        self.d.setVar("TEST_foo", "testvalue4")
+        bb.data.update_data(self.d)
+        self.assertEqual(self.d.getVar("TEST", True), "testvalue3")
+
+
+class TestFlags(unittest.TestCase):
+    def setUp(self):
+        self.d = bb.data.init()
+        self.d.setVar("foo", "value of foo")
+        self.d.setVarFlag("foo", "flag1", "value of flag1")
+        self.d.setVarFlag("foo", "flag2", "value of flag2")
+
+    def test_setflag(self):
+        self.assertEqual(self.d.getVarFlag("foo", "flag1"), "value of flag1")
+        self.assertEqual(self.d.getVarFlag("foo", "flag2"), "value of flag2")
+
+    def test_delflag(self):
+        self.d.delVarFlag("foo", "flag2")
+        self.assertEqual(self.d.getVarFlag("foo", "flag1"), "value of flag1")
+        self.assertEqual(self.d.getVarFlag("foo", "flag2"), None)
+
+

bitbake/lib/bb/tests/fetch.py

@@ -0,0 +1,425 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# BitBake Tests for the Fetcher (fetch2/)
+#
+# Copyright (C) 2012 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+
+import unittest
+import tempfile
+import subprocess
+import os
+from bb.fetch2 import URI
+import bb
+
+class URITest(unittest.TestCase):
+    test_uris = {
+        "http://www.google.com/index.html" : {
+            'uri': 'http://www.google.com/index.html',
+            'scheme': 'http',
+            'hostname': 'www.google.com',
+            'port': None,
+            'hostport': 'www.google.com',
+            'path': '/index.html',
+            'userinfo': '',
+            'username': '',
+            'password': '',
+            'params': {},
+            'relative': False
+        },
+        "http://www.google.com/index.html;param1=value1" : {
+            'uri': 'http://www.google.com/index.html;param1=value1',
+            'scheme': 'http',
+            'hostname': 'www.google.com',
+            'port': None,
+            'hostport': 'www.google.com',
+            'path': '/index.html',
+            'userinfo': '',
+            'username': '',
+            'password': '',
+            'params': {
+                'param1': 'value1'
+            },
+            'relative': False
+        },
+        "http://www.example.com:8080/index.html" : {
+            'uri': 'http://www.example.com:8080/index.html',
+            'scheme': 'http',
+            'hostname': 'www.example.com',
+            'port': 8080,
+            'hostport': 'www.example.com:8080',
+            'path': '/index.html',
+            'userinfo': '',
+            'username': '',
+            'password': '',
+            'params': {},
+            'relative': False
+        },
+        "cvs://anoncvs@cvs.handhelds.org/cvs;module=familiar/dist/ipkg" : {
+            'uri': 'cvs://anoncvs@cvs.handhelds.org/cvs;module=familiar/dist/ipkg',
+            'scheme': 'cvs',
+            'hostname': 'cvs.handhelds.org',
+            'port': None,
+            'hostport': 'cvs.handhelds.org',
+            'path': '/cvs',
+            'userinfo': 'anoncvs',
+            'username': 'anoncvs',
+            'password': '',
+            'params': {
+                'module': 'familiar/dist/ipkg'
+            },
+            'relative': False
+        },
+        "cvs://anoncvs:anonymous@cvs.handhelds.org/cvs;tag=V0-99-81;module=familiar/dist/ipkg": {
+            'uri': 'cvs://anoncvs:anonymous@cvs.handhelds.org/cvs;tag=V0-99-81;module=familiar/dist/ipkg',
+            'scheme': 'cvs',
+            'hostname': 'cvs.handhelds.org',
+            'port': None,
+            'hostport': 'cvs.handhelds.org',
+            'path': '/cvs',
+            'userinfo': 'anoncvs:anonymous',
+            'username': 'anoncvs',
+            'password': 'anonymous',
+            'params': {
+                'tag': 'V0-99-81',
+                'module': 'familiar/dist/ipkg'
+            },
+            'relative': False
+        },
+        "file://example.diff": { # NOTE: Not RFC compliant!
+            'uri': 'file:example.diff',
+            'scheme': 'file',
+            'hostname': '',
+            'port': None,
+            'hostport': '',
+            'path': 'example.diff',
+            'userinfo': '',
+            'username': '',
+            'password': '',
+            'params': {},
+            'relative': True
+        },
+        "file:example.diff": { # NOTE: RFC compliant version of the former
+            'uri': 'file:example.diff',
+            'scheme': 'file',
+            'hostname': '',
+            'port': None,
+            'hostport': '',
+            'path': 'example.diff',
+            'userinfo': '',
+            'userinfo': '',
+            'username': '',
+            'password': '',
+            'params': {},
+            'relative': True
+        },
+        "file:///tmp/example.diff": {
+            'uri': 'file:///tmp/example.diff',
+            'scheme': 'file',
+            'hostname': '',
+            'port': None,
+            'hostport': '',
+            'path': '/tmp/example.diff',
+            'userinfo': '',
+            'userinfo': '',
+            'username': '',
+            'password': '',
+            'params': {},
+            'relative': False
+        },
+        "git:///path/example.git": {
+            'uri': 'git:///path/example.git',
+            'scheme': 'git',
+            'hostname': '',
+            'port': None,
+            'hostport': '',
+            'path': '/path/example.git',
+            'userinfo': '',
+            'userinfo': '',
+            'username': '',
+            'password': '',
+            'params': {},
+            'relative': False
+        },
+        "git:path/example.git": {
+            'uri': 'git:path/example.git',
+            'scheme': 'git',
+            'hostname': '',
+            'port': None,
+            'hostport': '',
+            'path': 'path/example.git',
+            'userinfo': '',
+            'userinfo': '',
+            'username': '',
+            'password': '',
+            'params': {},
+            'relative': True
+        },
+        "git://example.net/path/example.git": {
+            'uri': 'git://example.net/path/example.git',
+            'scheme': 'git',
+            'hostname': 'example.net',
+            'port': None,
+            'hostport': 'example.net',
+            'path': '/path/example.git',
+            'userinfo': '',
+            'userinfo': '',
+            'username': '',
+            'password': '',
+            'params': {},
+            'relative': False
+        }
+    }
+
+    def test_uri(self):
+        for test_uri, ref in self.test_uris.items():
+            uri = URI(test_uri)
+
+            self.assertEqual(str(uri), ref['uri'])
+
+            # expected attributes
+            self.assertEqual(uri.scheme, ref['scheme'])
+
+            self.assertEqual(uri.userinfo, ref['userinfo'])
+            self.assertEqual(uri.username, ref['username'])
+            self.assertEqual(uri.password, ref['password'])
+
+            self.assertEqual(uri.hostname, ref['hostname'])
+            self.assertEqual(uri.port, ref['port'])
+            self.assertEqual(uri.hostport, ref['hostport'])
+
+            self.assertEqual(uri.path, ref['path'])
+            self.assertEqual(uri.params, ref['params'])
+
+            self.assertEqual(uri.relative, ref['relative'])
+
+    def test_dict(self):
+        for test in self.test_uris.values():
+            uri = URI()
+
+            self.assertEqual(uri.scheme, '')
+            self.assertEqual(uri.userinfo, '')
+            self.assertEqual(uri.username, '')
+            self.assertEqual(uri.password, '')
+            self.assertEqual(uri.hostname, '')
+            self.assertEqual(uri.port, None)
+            self.assertEqual(uri.path, '')
+            self.assertEqual(uri.params, {})
+
+
+            uri.scheme = test['scheme']
+            self.assertEqual(uri.scheme, test['scheme'])
+
+            uri.userinfo = test['userinfo']
+            self.assertEqual(uri.userinfo, test['userinfo'])
+            self.assertEqual(uri.username, test['username'])
+            self.assertEqual(uri.password, test['password'])
+
+            uri.hostname = test['hostname']
+            self.assertEqual(uri.hostname, test['hostname'])
+            self.assertEqual(uri.hostport, test['hostname'])
+
+            uri.port = test['port']
+            self.assertEqual(uri.port, test['port'])
+            self.assertEqual(uri.hostport, test['hostport'])
+
+            uri.path = test['path']
+            self.assertEqual(uri.path, test['path'])
+
+            uri.params = test['params']
+            self.assertEqual(uri.params, test['params'])
+
+            self.assertEqual(str(uri)+str(uri.relative), str(test['uri'])+str(test['relative']))
+
+            self.assertEqual(str(uri), test['uri'])
+
+            uri.params = {}
+            self.assertEqual(uri.params, {})
+            self.assertEqual(str(uri), (str(uri).split(";"))[0])
+
+class FetcherTest(unittest.TestCase):
+
+    def setUp(self):
+        self.d = bb.data.init()
+        self.tempdir = tempfile.mkdtemp()
+        self.dldir = os.path.join(self.tempdir, "download")
+        os.mkdir(self.dldir)
+        self.d.setVar("DL_DIR", self.dldir)
+        self.unpackdir = os.path.join(self.tempdir, "unpacked")
+        os.mkdir(self.unpackdir)
+        persistdir = os.path.join(self.tempdir, "persistdata")
+        self.d.setVar("PERSISTENT_DIR", persistdir)
+
+    def tearDown(self):
+        bb.utils.prunedir(self.tempdir)
+
+class MirrorUriTest(FetcherTest):
+
+    replaceuris = {
+        ("git://git.invalid.infradead.org/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "http://somewhere.org/somedir/") 
+            : "http://somewhere.org/somedir/git2_git.invalid.infradead.org.mtd-utils.git.tar.gz",
+        ("git://git.invalid.infradead.org/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/([^/]+/)*([^/]*)", "git://somewhere.org/somedir/\\2;protocol=http") 
+            : "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http", 
+        ("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/([^/]+/)*([^/]*)", "git://somewhere.org/somedir/\\2;protocol=http") 
+            : "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http", 
+        ("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/([^/]+/)*([^/]*)", "git://somewhere.org/\\2;protocol=http") 
+            : "git://somewhere.org/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http", 
+        ("git://someserver.org/bitbake;tag=1234567890123456789012345678901234567890", "git://someserver.org/bitbake", "git://git.openembedded.org/bitbake")
+            : "git://git.openembedded.org/bitbake;tag=1234567890123456789012345678901234567890",
+        ("file://sstate-xyz.tgz", "file://.*", "file:///somewhere/1234/sstate-cache") 
+            : "file:///somewhere/1234/sstate-cache/sstate-xyz.tgz",
+        ("file://sstate-xyz.tgz", "file://.*", "file:///somewhere/1234/sstate-cache/") 
+            : "file:///somewhere/1234/sstate-cache/sstate-xyz.tgz",
+        ("http://somewhere.org/somedir1/somedir2/somefile_1.2.3.tar.gz", "http://.*/.*", "http://somewhere2.org/somedir3") 
+            : "http://somewhere2.org/somedir3/somefile_1.2.3.tar.gz",
+        ("http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere2.org/somedir3/somefile_1.2.3.tar.gz") 
+            : "http://somewhere2.org/somedir3/somefile_1.2.3.tar.gz",
+        ("http://www.apache.org/dist/subversion/subversion-1.7.1.tar.bz2", "http://www.apache.org/dist", "http://archive.apache.org/dist")
+            : "http://archive.apache.org/dist/subversion/subversion-1.7.1.tar.bz2",
+        ("http://www.apache.org/dist/subversion/subversion-1.7.1.tar.bz2", "http://.*/.*", "file:///somepath/downloads/")
+            : "file:///somepath/downloads/subversion-1.7.1.tar.bz2",
+        ("git://git.invalid.infradead.org/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "git://somewhere.org/somedir/BASENAME;protocol=http") 
+            : "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http", 
+        ("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "git://somewhere.org/somedir/BASENAME;protocol=http") 
+            : "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http", 
+        ("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "git://somewhere.org/somedir/MIRRORNAME;protocol=http") 
+            : "git://somewhere.org/somedir/git.invalid.infradead.org.foo.mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http", 
+
+        #Renaming files doesn't work
+        #("http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere2.org/somedir3/somefile_2.3.4.tar.gz") : "http://somewhere2.org/somedir3/somefile_2.3.4.tar.gz"
+        #("file://sstate-xyz.tgz", "file://.*/.*", "file:///somewhere/1234/sstate-cache") : "file:///somewhere/1234/sstate-cache/sstate-xyz.tgz",
+    }
+
+    mirrorvar = "http://.*/.* file:///somepath/downloads/ \n" \
+                "git://someserver.org/bitbake git://git.openembedded.org/bitbake \n" \
+                "https://.*/.* file:///someotherpath/downloads/ \n" \
+                "http://.*/.* file:///someotherpath/downloads/ \n"
+
+    def test_urireplace(self):
+        for k, v in self.replaceuris.items():
+            ud = bb.fetch.FetchData(k[0], self.d)
+            ud.setup_localpath(self.d)
+            mirrors = bb.fetch2.mirror_from_string("%s %s" % (k[1], k[2]))
+            newuris, uds = bb.fetch2.build_mirroruris(ud, mirrors, self.d)
+            self.assertEqual([v], newuris)
+
+    def test_urilist1(self):
+        fetcher = bb.fetch.FetchData("http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", self.d)
+        mirrors = bb.fetch2.mirror_from_string(self.mirrorvar)
+        uris, uds = bb.fetch2.build_mirroruris(fetcher, mirrors, self.d)
+        self.assertEqual(uris, ['file:///somepath/downloads/bitbake-1.0.tar.gz', 'file:///someotherpath/downloads/bitbake-1.0.tar.gz'])
+
+    def test_urilist2(self):
+        # Catch https:// -> files:// bug
+        fetcher = bb.fetch.FetchData("https://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", self.d)
+        mirrors = bb.fetch2.mirror_from_string(self.mirrorvar)
+        uris, uds = bb.fetch2.build_mirroruris(fetcher, mirrors, self.d)
+        self.assertEqual(uris, ['file:///someotherpath/downloads/bitbake-1.0.tar.gz'])
+
+class FetcherNetworkTest(FetcherTest):
+
+    if os.environ.get("BB_SKIP_NETTESTS") == "yes":
+        print("Unset BB_SKIP_NETTESTS to run network tests")
+    else:
+        def test_fetch(self):
+            fetcher = bb.fetch.Fetch(["http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", "http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.1.tar.gz"], self.d)
+            fetcher.download()
+            self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.0.tar.gz"), 57749)
+            self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.1.tar.gz"), 57892)
+            self.d.setVar("BB_NO_NETWORK", "1")
+            fetcher = bb.fetch.Fetch(["http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", "http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.1.tar.gz"], self.d)
+            fetcher.download()
+            fetcher.unpack(self.unpackdir)
+            self.assertEqual(len(os.listdir(self.unpackdir + "/bitbake-1.0/")), 9)
+            self.assertEqual(len(os.listdir(self.unpackdir + "/bitbake-1.1/")), 9)
+
+        def test_fetch_mirror(self):
+            self.d.setVar("MIRRORS", "http://.*/.* http://downloads.yoctoproject.org/releases/bitbake")
+            fetcher = bb.fetch.Fetch(["http://invalid.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz"], self.d)
+            fetcher.download()
+            self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.0.tar.gz"), 57749)
+
+        def test_fetch_premirror(self):
+            self.d.setVar("PREMIRRORS", "http://.*/.* http://downloads.yoctoproject.org/releases/bitbake")
+            fetcher = bb.fetch.Fetch(["http://invalid.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz"], self.d)
+            fetcher.download()
+            self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.0.tar.gz"), 57749)
+
+        def gitfetcher(self, url1, url2):
+            def checkrevision(self, fetcher):
+                fetcher.unpack(self.unpackdir)
+                revision = bb.process.run("git rev-parse HEAD", shell=True, cwd=self.unpackdir + "/git")[0].strip()
+                self.assertEqual(revision, "270a05b0b4ba0959fe0624d2a4885d7b70426da5")
+
+            self.d.setVar("BB_GENERATE_MIRROR_TARBALLS", "1")
+            self.d.setVar("SRCREV", "270a05b0b4ba0959fe0624d2a4885d7b70426da5")
+            fetcher = bb.fetch.Fetch([url1], self.d)
+            fetcher.download()
+            checkrevision(self, fetcher)
+            # Wipe out the dldir clone and the unpacked source, turn off the network and check mirror tarball works
+            bb.utils.prunedir(self.dldir + "/git2/")
+            bb.utils.prunedir(self.unpackdir)
+            self.d.setVar("BB_NO_NETWORK", "1")
+            fetcher = bb.fetch.Fetch([url2], self.d)
+            fetcher.download()
+            checkrevision(self, fetcher)
+
+        def test_gitfetch(self):
+            url1 = url2 = "git://git.openembedded.org/bitbake"
+            self.gitfetcher(url1, url2)
+
+        def test_gitfetch_premirror(self):
+            url1 = "git://git.openembedded.org/bitbake"
+            url2 = "git://someserver.org/bitbake"
+            self.d.setVar("PREMIRRORS", "git://someserver.org/bitbake git://git.openembedded.org/bitbake \n")
+            self.gitfetcher(url1, url2)
+
+        def test_gitfetch_premirror2(self):
+            url1 = url2 = "git://someserver.org/bitbake"
+            self.d.setVar("PREMIRRORS", "git://someserver.org/bitbake git://git.openembedded.org/bitbake \n")
+            self.gitfetcher(url1, url2)
+
+        def test_gitfetch_premirror3(self):
+            realurl = "git://git.openembedded.org/bitbake"
+            dummyurl = "git://someserver.org/bitbake"
+            self.sourcedir = self.unpackdir.replace("unpacked", "sourcemirror.git")
+            os.chdir(self.tempdir)
+            bb.process.run("git clone %s %s 2> /dev/null" % (realurl, self.sourcedir), shell=True)
+            self.d.setVar("PREMIRRORS", "%s git://%s;protocol=file \n" % (dummyurl, self.sourcedir))
+            self.gitfetcher(dummyurl, dummyurl)
+
+class URLHandle(unittest.TestCase):
+
+    datatable = {
+       "http://www.google.com/index.html" : ('http', 'www.google.com', '/index.html', '', '', {}),
+       "cvs://anoncvs@cvs.handhelds.org/cvs;module=familiar/dist/ipkg" : ('cvs', 'cvs.handhelds.org', '/cvs', 'anoncvs', '', {'module': 'familiar/dist/ipkg'}),
+       "cvs://anoncvs:anonymous@cvs.handhelds.org/cvs;tag=V0-99-81;module=familiar/dist/ipkg" : ('cvs', 'cvs.handhelds.org', '/cvs', 'anoncvs', 'anonymous', {'tag': 'V0-99-81', 'module': 'familiar/dist/ipkg'}),
+       "git://git.openembedded.org/bitbake;branch=@foo" : ('git', 'git.openembedded.org', '/bitbake', '', '', {'branch': '@foo'})
+    }
+
+    def test_decodeurl(self):
+        for k, v in self.datatable.items():
+            result = bb.fetch.decodeurl(k)
+            self.assertEqual(result, v)
+
+    def test_encodeurl(self):
+        for k, v in self.datatable.items():
+            result = bb.fetch.encodeurl(v)
+            self.assertEqual(result, k)
+
+
+

bitbake/lib/bb/tests/utils.py

@@ -0,0 +1,53 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+#
+# BitBake Tests for utils.py
+#
+# Copyright (C) 2012 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+
+import unittest
+import bb
+
+class VerCmpString(unittest.TestCase):
+
+    def test_vercmpstring(self):
+        result = bb.utils.vercmp_string('1', '2')
+        self.assertTrue(result < 0)
+        result = bb.utils.vercmp_string('2', '1')
+        self.assertTrue(result > 0)
+        result = bb.utils.vercmp_string('1', '1.0')
+        self.assertTrue(result < 0)
+        result = bb.utils.vercmp_string('1', '1.1')
+        self.assertTrue(result < 0)
+        result = bb.utils.vercmp_string('1.1', '1_p2')
+        self.assertTrue(result < 0)
+
+    def test_explode_dep_versions(self):
+        correctresult = {"foo" : ["= 1.10"]}
+        result = bb.utils.explode_dep_versions2("foo (= 1.10)")
+        self.assertEqual(result, correctresult)
+        result = bb.utils.explode_dep_versions2("foo (=1.10)")
+        self.assertEqual(result, correctresult)
+        result = bb.utils.explode_dep_versions2("foo ( = 1.10)")
+        self.assertEqual(result, correctresult)
+        result = bb.utils.explode_dep_versions2("foo ( =1.10)")
+        self.assertEqual(result, correctresult)
+        result = bb.utils.explode_dep_versions2("foo ( = 1.10 )")
+        self.assertEqual(result, correctresult)
+        result = bb.utils.explode_dep_versions2("foo ( =1.10 )")
+        self.assertEqual(result, correctresult)
+

bitbake/lib/bb/tinfoil.py

@@ -0,0 +1,100 @@
+# tinfoil: a simple wrapper around cooker for bitbake-based command-line utilities
+#
+# Copyright (C) 2012 Intel Corporation
+# Copyright (C) 2011 Mentor Graphics Corporation
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import logging
+import warnings
+import os
+import sys
+
+import bb.cache
+import bb.cooker
+import bb.providers
+import bb.utils
+from bb.cooker import state
+import bb.fetch2
+
+class Tinfoil:
+    def __init__(self, output=sys.stdout):
+        # Needed to avoid deprecation warnings with python 2.6
+        warnings.filterwarnings("ignore", category=DeprecationWarning)
+
+        # Set up logging
+        self.logger = logging.getLogger('BitBake')
+        console = logging.StreamHandler(output)
+        bb.msg.addDefaultlogFilter(console)
+        format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
+        if output.isatty():
+            format.enable_color()
+        console.setFormatter(format)
+        self.logger.addHandler(console)
+
+        initialenv = os.environ.copy()
+        bb.utils.clean_environment()
+        self.config = TinfoilConfig(parse_only=True)
+        self.cooker = bb.cooker.BBCooker(self.config,
+                                            self.register_idle_function,
+                                            initialenv)
+        self.config_data = self.cooker.configuration.data
+        bb.providers.logger.setLevel(logging.ERROR)
+        self.cooker_data = None
+
+    def register_idle_function(self, function, data):
+        pass
+
+    def parseRecipes(self):
+        sys.stderr.write("Parsing recipes..")
+        self.logger.setLevel(logging.WARNING)
+
+        try:
+            while self.cooker.state in (state.initial, state.parsing):
+                self.cooker.updateCache()
+        except KeyboardInterrupt:
+            self.cooker.shutdown()
+            self.cooker.updateCache()
+            sys.exit(2)
+
+        self.logger.setLevel(logging.INFO)
+        sys.stderr.write("done.\n")
+
+        self.cooker_data = self.cooker.status
+
+    def prepare(self, config_only = False):
+        if not self.cooker_data:
+            if config_only:
+                self.cooker.parseConfiguration()
+                self.cooker_data = self.cooker.status
+            else:
+                self.parseRecipes()
+
+
+class TinfoilConfig(object):
+    def __init__(self, **options):
+        self.pkgs_to_build = []
+        self.debug_domains = []
+        self.extra_assume_provided = []
+        self.prefile = []
+        self.postfile = []
+        self.debug = 0
+        self.__dict__.update(options)
+
+    def __getattr__(self, attribute):
+        try:
+            return super(TinfoilConfig, self).__getattribute__(attribute)
+        except AttributeError:
+            return None
+

bitbake/lib/bb/ui/__init__.py

@@ -0,0 +1,17 @@
+#
+# BitBake UI Implementation
+#
+# Copyright (C) 2006-2007 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.

bitbake/lib/bb/ui/crumbs/__init__.py

@@ -0,0 +1,17 @@
+#
+# Gtk+ UI pieces for BitBake
+#
+# Copyright (C) 2006-2007 Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.

bitbake/lib/bb/ui/crumbs/builddetailspage.py

@@ -0,0 +1,436 @@
+#!/usr/bin/env python
+#
+# BitBake Graphical GTK User Interface
+#
+# Copyright (C) 2012        Intel Corporation
+#
+# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
+# Authored by Shane Wang <shane.wang@intel.com>
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import gtk
+import pango
+import gobject
+import bb.process
+from bb.ui.crumbs.progressbar import HobProgressBar
+from bb.ui.crumbs.hobwidget import hic, HobNotebook, HobAltButton, HobWarpCellRendererText, HobButton, HobInfoButton
+from bb.ui.crumbs.runningbuild import RunningBuildTreeView
+from bb.ui.crumbs.runningbuild import BuildFailureTreeView
+from bb.ui.crumbs.hobpages import HobPage
+from bb.ui.crumbs.hobcolor import HobColors
+
+class BuildConfigurationTreeView(gtk.TreeView):
+    def __init__ (self):
+        gtk.TreeView.__init__(self)
+        self.set_rules_hint(False)
+        self.set_headers_visible(False)
+        self.set_property("hover-expand", True)
+        self.get_selection().set_mode(gtk.SELECTION_SINGLE)
+
+        # The icon that indicates whether we're building or failed.
+        renderer0 = gtk.CellRendererText()
+        renderer0.set_property('font-desc', pango.FontDescription('courier bold 12'))
+        col0 = gtk.TreeViewColumn ("Name", renderer0, text=0)
+        self.append_column (col0)
+
+        # The message of configuration.
+        renderer1 = HobWarpCellRendererText(col_number=1)
+        col1 = gtk.TreeViewColumn ("Values", renderer1, text=1)
+        self.append_column (col1)
+
+    def set_vars(self, key="", var=[""]):
+        d = {}
+        if type(var) == str:
+            d = {key: [var]}
+        elif type(var) == list and len(var) > 1:
+            #create the sub item line
+            l = []
+            text = ""
+            for item in var:
+                text = " - " + item
+                l.append(text)
+            d = {key: var}
+
+        return d
+
+    def set_config_model(self, show_vars):
+        listmodel = gtk.TreeStore(gobject.TYPE_STRING, gobject.TYPE_STRING)
+        parent = None
+        for var in show_vars:
+            for subitem in var.items():
+                name = subitem[0]
+                is_parent = True
+                for value in subitem[1]:
+                    if is_parent:
+                        parent = listmodel.append(parent, (name, value))
+                        is_parent = False
+                    else:
+                        listmodel.append(parent, (None, value))
+                    name = "     - "
+                parent = None
+        # renew the tree model after get the configuration messages
+        self.set_model(listmodel)
+
+    def show(self, src_config_info, src_params):
+        vars = []
+        vars.append(self.set_vars("BB version:", src_params.bb_version))
+        vars.append(self.set_vars("Target arch:", src_params.target_arch))
+        vars.append(self.set_vars("Target OS:", src_params.target_os))
+        vars.append(self.set_vars("Machine:", src_config_info.curr_mach))
+        vars.append(self.set_vars("Distro:", src_config_info.curr_distro))
+        vars.append(self.set_vars("Distro version:", src_params.distro_version))
+        vars.append(self.set_vars("SDK machine:", src_config_info.curr_sdk_machine))
+        vars.append(self.set_vars("Tune features:", src_params.tune_pkgarch))
+        vars.append(self.set_vars("Layers:", src_config_info.layers))
+
+        for path in src_config_info.layers:
+            import os, os.path
+            if os.path.exists(path):
+                branch = bb.process.run('cd %s; git branch | grep "^* " | tr -d "* "' % path)[0]
+                if branch.startswith("fatal:"):
+                    branch = "(unknown)"
+                if branch:
+                    branch = branch.strip('\n')
+                    vars.append(self.set_vars("Branch:", branch))
+                break
+
+        self.set_config_model(vars)
+
+    def reset(self):
+        self.set_model(None)
+
+#
+# BuildDetailsPage
+#
+
+class BuildDetailsPage (HobPage):
+
+    def __init__(self, builder):
+        super(BuildDetailsPage, self).__init__(builder, "Building ...")
+
+        self.num_of_issues = 0
+        self.endpath = (0,)
+        # create visual elements
+        self.create_visual_elements()
+
+    def create_visual_elements(self):
+        # create visual elements
+        self.vbox = gtk.VBox(False, 12)
+
+        self.progress_box = gtk.VBox(False, 12)
+        self.task_status = gtk.Label("\n") # to ensure layout is correct
+        self.task_status.set_alignment(0.0, 0.5)
+        self.progress_box.pack_start(self.task_status, expand=False, fill=False)
+        self.progress_hbox = gtk.HBox(False, 6)
+        self.progress_box.pack_end(self.progress_hbox, expand=True, fill=True)
+        self.progress_bar = HobProgressBar()
+        self.progress_hbox.pack_start(self.progress_bar, expand=True, fill=True)
+        self.stop_button = HobAltButton("Stop")
+        self.stop_button.connect("clicked", self.stop_button_clicked_cb)
+        self.stop_button.set_sensitive(False)
+        self.progress_hbox.pack_end(self.stop_button, expand=False, fill=False)
+
+        self.notebook = HobNotebook()
+        self.config_tv = BuildConfigurationTreeView()
+        self.scrolled_view_config = gtk.ScrolledWindow ()
+        self.scrolled_view_config.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
+        self.scrolled_view_config.add(self.config_tv)
+        self.notebook.append_page(self.scrolled_view_config, "Build configuration")
+
+        self.failure_tv = BuildFailureTreeView()
+        self.failure_model = self.builder.handler.build.model.failure_model()
+        self.failure_tv.set_model(self.failure_model)
+        self.scrolled_view_failure = gtk.ScrolledWindow ()
+        self.scrolled_view_failure.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
+        self.scrolled_view_failure.add(self.failure_tv)
+        self.notebook.append_page(self.scrolled_view_failure, "Issues")
+
+        self.build_tv = RunningBuildTreeView(readonly=True, hob=True)
+        self.build_tv.set_model(self.builder.handler.build.model)
+        self.scrolled_view_build = gtk.ScrolledWindow ()
+        self.scrolled_view_build.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
+        self.scrolled_view_build.add(self.build_tv)
+        self.notebook.append_page(self.scrolled_view_build, "Log")
+
+        self.builder.handler.build.model.connect_after("row-changed", self.scroll_to_present_row, self.scrolled_view_build.get_vadjustment(), self.build_tv)
+
+        self.button_box = gtk.HBox(False, 6)
+        self.back_button = HobAltButton('&lt;&lt; Back')
+        self.back_button.connect("clicked", self.back_button_clicked_cb)
+        self.button_box.pack_start(self.back_button, expand=False, fill=False)
+
+    def update_build_status(self, current, total, task):
+        recipe_path, recipe_task = task.split(", ")
+        recipe = os.path.basename(recipe_path).rstrip(".bb")
+        tsk_msg = "<b>Running task %s of %s:</b> %s\n<b>Recipe:</b> %s" % (current, total, recipe_task, recipe)
+        self.task_status.set_markup(tsk_msg)
+        self.stop_button.set_sensitive(True)
+
+    def reset_build_status(self):
+        self.task_status.set_markup("\n") # to ensure layout is correct
+        self.endpath = (0,)
+
+    def show_issues(self):
+        self.num_of_issues += 1
+        self.notebook.show_indicator_icon("Issues", self.num_of_issues)
+
+    def reset_issues(self):
+        self.num_of_issues = 0
+        self.notebook.hide_indicator_icon("Issues")
+
+    def _remove_all_widget(self):
+        children = self.vbox.get_children() or []
+        for child in children:
+            self.vbox.remove(child)
+        children = self.box_group_area.get_children() or []
+        for child in children:
+            self.box_group_area.remove(child)
+        children = self.get_children() or []
+        for child in children:
+            self.remove(child)
+
+    def add_build_fail_top_bar(self, actions, log_file=None):
+        primary_action = "Edit %s" % actions
+
+        color = HobColors.ERROR
+        build_fail_top = gtk.EventBox()
+        #build_fail_top.set_size_request(-1, 200)
+        build_fail_top.modify_bg(gtk.STATE_NORMAL, gtk.gdk.color_parse(color))
+
+        build_fail_tab = gtk.Table(14, 46, True)
+        build_fail_top.add(build_fail_tab)
+
+        icon = gtk.Image()
+        icon_pix_buffer = gtk.gdk.pixbuf_new_from_file(hic.ICON_INDI_ERROR_FILE)
+        icon.set_from_pixbuf(icon_pix_buffer)
+        build_fail_tab.attach(icon, 1, 4, 0, 6)
+
+        label = gtk.Label()
+        label.set_alignment(0.0, 0.5)
+        label.set_markup("<span size='x-large'><b>%s</b></span>" % self.title)
+        build_fail_tab.attach(label, 4, 26, 0, 6)
+
+        label = gtk.Label()
+        label.set_alignment(0.0, 0.5)
+        # Ensure variable disk_full is defined
+        if not hasattr(self.builder, 'disk_full'):
+            self.builder.disk_full = False
+
+        if self.builder.disk_full:
+            markup = "<span size='medium'>There is no disk space left, so Hob cannot finish building your image. Free up some disk space\n"
+            markup += "and restart the build. Check the \"Issues\" tab for more details</span>"
+            label.set_markup(markup)
+        else:
+            label.set_markup("<span size='medium'>Check the \"Issues\" information for more details</span>")
+        build_fail_tab.attach(label, 4, 40, 4, 9)
+
+        # create button 'Edit packages'
+        action_button = HobButton(primary_action)
+        #action_button.set_size_request(-1, 40)
+        action_button.set_tooltip_text("Edit the %s parameters" % actions)
+        action_button.connect('clicked', self.failure_primary_action_button_clicked_cb, primary_action)
+
+        if log_file:
+            open_log_button = HobAltButton("Open log")
+            open_log_button.set_relief(gtk.RELIEF_HALF)
+            open_log_button.set_tooltip_text("Open the build's log file")
+            open_log_button.connect('clicked', self.open_log_button_clicked_cb, log_file)
+
+        attach_pos = (24 if log_file else 14)
+        file_bug_button = HobAltButton('File a bug')
+        file_bug_button.set_relief(gtk.RELIEF_HALF)
+        file_bug_button.set_tooltip_text("Open the Yocto Project bug tracking website")
+        file_bug_button.connect('clicked', self.failure_activate_file_bug_link_cb)
+
+        if not self.builder.disk_full:
+            build_fail_tab.attach(action_button, 4, 13, 9, 12)
+            if log_file:
+                build_fail_tab.attach(open_log_button, 14, 23, 9, 12)
+            build_fail_tab.attach(file_bug_button, attach_pos, attach_pos + 9, 9, 12)
+
+        else:
+            restart_build = HobButton("Restart the build")
+            restart_build.set_tooltip_text("Restart the build")
+            restart_build.connect('clicked', self.restart_build_button_clicked_cb)
+
+            build_fail_tab.attach(restart_build, 4, 13, 9, 12)
+            build_fail_tab.attach(action_button, 14, 23, 9, 12)
+            if log_file:
+                build_fail_tab.attach(open_log_button, attach_pos, attach_pos + 9, 9, 12)
+
+        self.builder.disk_full = False
+        return build_fail_top
+
+    def show_fail_page(self, title):
+        self._remove_all_widget()
+        self.title = "Hob cannot build your %s" % title
+
+        self.build_fail_bar = self.add_build_fail_top_bar(title, self.builder.current_logfile)
+
+        self.pack_start(self.group_align, expand=True, fill=True)
+        self.box_group_area.pack_start(self.build_fail_bar, expand=False, fill=False)
+        self.box_group_area.pack_start(self.vbox, expand=True, fill=True)
+
+        self.vbox.pack_start(self.notebook, expand=True, fill=True)
+        self.show_all()
+        self.notebook.set_page("Issues")
+        self.back_button.hide()
+
+    def add_build_stop_top_bar(self, action, log_file=None):
+        color = HobColors.LIGHT_GRAY
+        build_stop_top = gtk.EventBox()
+        #build_stop_top.set_size_request(-1, 200)
+        build_stop_top.modify_bg(gtk.STATE_NORMAL, gtk.gdk.color_parse(color))
+        build_stop_top.set_flags(gtk.CAN_DEFAULT)
+        build_stop_top.grab_default()
+
+        build_stop_tab = gtk.Table(11, 46, True)
+        build_stop_top.add(build_stop_tab)
+
+        icon = gtk.Image()
+        icon_pix_buffer = gtk.gdk.pixbuf_new_from_file(hic.ICON_INFO_HOVER_FILE)
+        icon.set_from_pixbuf(icon_pix_buffer)
+        build_stop_tab.attach(icon, 1, 4, 0, 6)
+
+        label = gtk.Label()
+        label.set_alignment(0.0, 0.5)
+        label.set_markup("<span size='x-large'><b>%s</b></span>" % self.title)
+        build_stop_tab.attach(label, 4, 26, 0, 6)
+
+        action_button = HobButton("Edit %s" % action)
+        action_button.set_size_request(-1, 40)
+        if action == "image":
+            action_button.set_tooltip_text("Edit the image parameters")
+        elif action == "recipes":
+            action_button.set_tooltip_text("Edit the included recipes")
+        elif action == "packages":
+            action_button.set_tooltip_text("Edit the included packages")
+        action_button.connect('clicked', self.stop_primary_action_button_clicked_cb, action)
+        build_stop_tab.attach(action_button, 4, 13, 6, 9)
+
+        if log_file:
+            open_log_button = HobAltButton("Open log")
+            open_log_button.set_relief(gtk.RELIEF_HALF)
+            open_log_button.set_tooltip_text("Open the build's log file")
+            open_log_button.connect('clicked', self.open_log_button_clicked_cb, log_file)
+            build_stop_tab.attach(open_log_button, 14, 23, 6, 9)
+
+        attach_pos = (24 if log_file else 14)
+        build_button = HobAltButton("Build new image")
+        #build_button.set_size_request(-1, 40)
+        build_button.set_tooltip_text("Create a new image from scratch")
+        build_button.connect('clicked', self.new_image_button_clicked_cb)
+        build_stop_tab.attach(build_button, attach_pos, attach_pos + 9, 6, 9)
+
+        return build_stop_top, action_button
+
+    def show_stop_page(self, action):
+        self._remove_all_widget()
+        self.title = "Build stopped"
+        self.build_stop_bar, action_button = self.add_build_stop_top_bar(action, self.builder.current_logfile)
+
+        self.pack_start(self.group_align, expand=True, fill=True)
+        self.box_group_area.pack_start(self.build_stop_bar, expand=False, fill=False)
+        self.box_group_area.pack_start(self.vbox, expand=True, fill=True)
+
+        self.vbox.pack_start(self.notebook, expand=True, fill=True)
+        self.show_all()
+        self.back_button.hide()
+        return action_button
+
+    def show_page(self, step):
+        self._remove_all_widget()
+        if step == self.builder.PACKAGE_GENERATING or step == self.builder.FAST_IMAGE_GENERATING:
+            self.title = "Building packages ..."
+        else:
+            self.title = "Building image ..."
+        self.build_details_top = self.add_onto_top_bar(None)
+        self.pack_start(self.build_details_top, expand=False, fill=False)
+        self.pack_start(self.group_align, expand=True, fill=True)
+
+        self.box_group_area.pack_start(self.vbox, expand=True, fill=True)
+
+        self.progress_bar.reset()
+        self.config_tv.reset()
+        self.vbox.pack_start(self.progress_box, expand=False, fill=False)
+
+        self.vbox.pack_start(self.notebook, expand=True, fill=True)
+
+        self.box_group_area.pack_end(self.button_box, expand=False, fill=False)
+        self.show_all()
+        self.notebook.set_page("Log")
+        self.back_button.hide()
+
+        self.reset_build_status()
+        self.reset_issues()
+
+    def update_progress_bar(self, title, fraction, status=None):
+        self.progress_bar.update(fraction)
+        self.progress_bar.set_title(title)
+        self.progress_bar.set_rcstyle(status)
+
+    def back_button_clicked_cb(self, button):
+        self.builder.show_configuration()
+
+    def new_image_button_clicked_cb(self, button):
+        self.builder.reset()
+
+    def show_back_button(self):
+        self.back_button.show()
+
+    def stop_button_clicked_cb(self, button):
+        self.builder.stop_build()
+
+    def hide_stop_button(self):
+        self.stop_button.set_sensitive(False)
+        self.stop_button.hide()
+
+    def scroll_to_present_row(self, model, path, iter, v_adj, treeview):
+        if treeview and v_adj:
+            if path[0] > self.endpath[0]: # check the event is a new row append or not
+                self.endpath = path
+                # check the gtk.adjustment position is at end boundary or not
+                if (v_adj.upper <= v_adj.page_size) or (v_adj.value == v_adj.upper - v_adj.page_size):
+                    treeview.scroll_to_cell(path)
+
+    def show_configurations(self, configurations, params):
+        self.config_tv.show(configurations, params)
+
+    def failure_primary_action_button_clicked_cb(self, button, action):
+        if "Edit recipes" in action:
+            self.builder.show_recipes()
+        elif "Edit packages" in action:
+            self.builder.show_packages()
+        elif "Edit image" in action:
+            self.builder.show_configuration()
+
+    def restart_build_button_clicked_cb(self, button):
+        self.builder.just_bake()
+
+    def stop_primary_action_button_clicked_cb(self, button, action):
+        if "recipes" in action:
+            self.builder.show_recipes()
+        elif "packages" in action:
+            self.builder.show_packages(ask=False)
+        elif "image" in action:
+            self.builder.show_configuration()
+
+    def open_log_button_clicked_cb(self, button, log_file):
+        if log_file:
+            log_file = "file:///" + log_file
+            gtk.show_uri(screen=button.get_screen(), uri=log_file, timestamp=0)
+
+    def failure_activate_file_bug_link_cb(self, button):
+        button.child.emit('activate-link', "http://bugzilla.yoctoproject.org")