mirror of
https://git.yoctoproject.org/poky
synced 2026-03-22 07:09:41 +01:00
Compare commits
403 Commits
1.4_M1.rc1
...
bernard
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
c006044611 | ||
|
|
69cf476e36 | ||
|
|
0283822752 | ||
|
|
15c05fc10c | ||
|
|
cc6e20ea98 | ||
|
|
fc7f4b9711 | ||
|
|
4f1611cb8d | ||
|
|
5347bf352b | ||
|
|
d81e13a138 | ||
|
|
3d9db8b275 | ||
|
|
3faa84f835 | ||
|
|
10a8fb437e | ||
|
|
2c24e6b9b9 | ||
|
|
7f0a98f9ee | ||
|
|
47b2f03955 | ||
|
|
a02537187f | ||
|
|
78d092fe7a | ||
|
|
361eda901c | ||
|
|
373d73c7e7 | ||
|
|
b154d10232 | ||
|
|
00af854e96 | ||
|
|
4005aaf3f8 | ||
|
|
5c78a2b02d | ||
|
|
11355f3a7f | ||
|
|
a2283defe2 | ||
|
|
7ce789de38 | ||
|
|
4194c83a56 | ||
|
|
decb8953cd | ||
|
|
d6b531e6a1 | ||
|
|
d412b923ac | ||
|
|
cb69e75b7b | ||
|
|
9b33f20a73 | ||
|
|
00a8552b2b | ||
|
|
ec3aab7b04 | ||
|
|
5c51a88346 | ||
|
|
53bbe30ee7 | ||
|
|
1ca2d4316e | ||
|
|
87d0a3b594 | ||
|
|
c2c0b9f861 | ||
|
|
d1c356ad3d | ||
|
|
4f5622fb01 | ||
|
|
9ee10c93af | ||
|
|
490b71d15d | ||
|
|
60f42f2dc9 | ||
|
|
4dab699e96 | ||
|
|
1ca9ca2c7d | ||
|
|
5359255ce2 | ||
|
|
c9805a0c3c | ||
|
|
3545f453aa | ||
|
|
2319b2d2d7 | ||
|
|
da22a78bd4 | ||
|
|
0a69e60cfc | ||
|
|
2816cc0db8 | ||
|
|
c998000630 | ||
|
|
bf8d577f1d | ||
|
|
e3e50d2c69 | ||
|
|
e5cce8a57d | ||
|
|
bb855dab75 | ||
|
|
7779a1fedc | ||
|
|
1c5171b251 | ||
|
|
5eabb17202 | ||
|
|
b3cb28df9f | ||
|
|
14c9af0056 | ||
|
|
d106d15cad | ||
|
|
72f06800bc | ||
|
|
53b15f2732 | ||
|
|
1b159ff35d | ||
|
|
eabe47ed8c | ||
|
|
5299510bd3 | ||
|
|
679e3ae6de | ||
|
|
6619eff40b | ||
|
|
4e41793b5c | ||
|
|
5b1d38c0ed | ||
|
|
67ef061d39 | ||
|
|
5d3bfbbd18 | ||
|
|
36c9135215 | ||
|
|
437950723f | ||
|
|
5f92b6262f | ||
|
|
65d61e2d11 | ||
|
|
4825604977 | ||
|
|
00996de4eb | ||
|
|
5a9b3fecde | ||
|
|
2343f81fb4 | ||
|
|
d8f4a33500 | ||
|
|
a982aa5786 | ||
|
|
8404b657fa | ||
|
|
e4ab64389e | ||
|
|
9c43741ed6 | ||
|
|
586b7055b3 | ||
|
|
0401043d43 | ||
|
|
40a6a2612e | ||
|
|
2060a0d1f2 | ||
|
|
23a0019b1f | ||
|
|
aa37762223 | ||
|
|
5570e0ae78 | ||
|
|
310897df07 | ||
|
|
ca77772632 | ||
|
|
b8765d4efb | ||
|
|
c36361ed5a | ||
|
|
60ab27d71b | ||
|
|
d739fc53eb | ||
|
|
84d82c0685 | ||
|
|
9361df5ec2 | ||
|
|
5ec8233e2f | ||
|
|
c7301228c0 | ||
|
|
f77efdf544 | ||
|
|
f15a4a7677 | ||
|
|
0e55651fd0 | ||
|
|
8c888bf67a | ||
|
|
6f904b3550 | ||
|
|
5d01c9c296 | ||
|
|
55f72863b9 | ||
|
|
e086bc7c11 | ||
|
|
aa468ee163 | ||
|
|
94d2b2c563 | ||
|
|
f837ecebc6 | ||
|
|
dfb31f15b9 | ||
|
|
6bfb96bff3 | ||
|
|
88083714e3 | ||
|
|
2bd9b41760 | ||
|
|
e5f8d44d24 | ||
|
|
a3ed4e19e1 | ||
|
|
16c10b7a8d | ||
|
|
ce08910d62 | ||
|
|
d2492a6ee2 | ||
|
|
a05ffe7e61 | ||
|
|
05d95c7feb | ||
|
|
22a4bae306 | ||
|
|
dd99bbf1f3 | ||
|
|
6e902e0a31 | ||
|
|
1e10a0cf03 | ||
|
|
98820f5b74 | ||
|
|
e8486ec930 | ||
|
|
c0a58abed5 | ||
|
|
41d9bcdabe | ||
|
|
58e3304ea0 | ||
|
|
eb83549448 | ||
|
|
fdd4dc5db9 | ||
|
|
32d330889f | ||
|
|
a6620f2fcf | ||
|
|
8e4021a890 | ||
|
|
10a0dca45a | ||
|
|
347bbd1d4b | ||
|
|
da39a264ed | ||
|
|
292488656d | ||
|
|
6683544362 | ||
|
|
5ac1d6be71 | ||
|
|
97b223c6fc | ||
|
|
96bc30cf03 | ||
|
|
1d8535ccb7 | ||
|
|
6244cbc945 | ||
|
|
f76a807400 | ||
|
|
b1febbcb26 | ||
|
|
24b30e5285 | ||
|
|
47724b4320 | ||
|
|
058625b713 | ||
|
|
7d75d2cd94 | ||
|
|
4a17fc8a81 | ||
|
|
1327b6b06b | ||
|
|
8bc71db41f | ||
|
|
0137a98b28 | ||
|
|
326eb3f2cc | ||
|
|
5ed5ed5a0e | ||
|
|
e6668220f2 | ||
|
|
372e52ff6c | ||
|
|
3da8a8b9b9 | ||
|
|
841d084555 | ||
|
|
5a4d5b9c43 | ||
|
|
7959e40061 | ||
|
|
3d2c481ab0 | ||
|
|
232d7322b5 | ||
|
|
b116631418 | ||
|
|
9388aa62cf | ||
|
|
10ac9442f2 | ||
|
|
184a5c1c0a | ||
|
|
472a3b34d8 | ||
|
|
3c81ae17ea | ||
|
|
1528b88657 | ||
|
|
65a1eaf069 | ||
|
|
6d853bb196 | ||
|
|
74aeb0a2ec | ||
|
|
b02f8a482d | ||
|
|
0a11038665 | ||
|
|
01ab37c9ce | ||
|
|
db95181f8f | ||
|
|
8b6416db1e | ||
|
|
17600d23d8 | ||
|
|
e347cd769a | ||
|
|
25437936c4 | ||
|
|
063ede8698 | ||
|
|
82af8b9fb6 | ||
|
|
7b8b77444d | ||
|
|
2176606ff7 | ||
|
|
8c920456e4 | ||
|
|
a80791c568 | ||
|
|
ed8bcb28b2 | ||
|
|
a5d2854104 | ||
|
|
d3d7b1d679 | ||
|
|
4efe1437dd | ||
|
|
ee78d54023 | ||
|
|
bfdabe46df | ||
|
|
236357c05a | ||
|
|
06ba4f48dc | ||
|
|
d7635a9972 | ||
|
|
4a8dd99a9f | ||
|
|
bcc330c80e | ||
|
|
1743bba3ea | ||
|
|
74a635b919 | ||
|
|
1fc2d92bf6 | ||
|
|
df56b575cd | ||
|
|
8753278af8 | ||
|
|
6f139706ae | ||
|
|
b37e6a2234 | ||
|
|
f32ea8feff | ||
|
|
6f7f0810e0 | ||
|
|
8dee7adf47 | ||
|
|
bf4f7761b3 | ||
|
|
6f5703e473 | ||
|
|
c8bab9bca4 | ||
|
|
b209beb54b | ||
|
|
c1c7f61e80 | ||
|
|
48ea0ca37f | ||
|
|
60a7bca27e | ||
|
|
6e1e21942e | ||
|
|
8e70535583 | ||
|
|
5f5c9d133b | ||
|
|
6be2a5e54b | ||
|
|
334ff1fd4f | ||
|
|
b0df49cb10 | ||
|
|
a7b0c87a97 | ||
|
|
39734c77f7 | ||
|
|
3f689d6bfd | ||
|
|
dc08a1f933 | ||
|
|
8be338ed08 | ||
|
|
4c7131c26a | ||
|
|
3d732748b6 | ||
|
|
4d20c5ffd1 | ||
|
|
e6a8e53a8d | ||
|
|
fe6e54773e | ||
|
|
d659e6242b | ||
|
|
0cfdb4a029 | ||
|
|
37e29b5434 | ||
|
|
ed949c59cf | ||
|
|
185f2ac9ce | ||
|
|
387e05af6d | ||
|
|
806df0f8de | ||
|
|
47bbe6afe7 | ||
|
|
76f0cbaf1f | ||
|
|
51316230ba | ||
|
|
80c4ba0e03 | ||
|
|
97532bc759 | ||
|
|
a7d927af35 | ||
|
|
e9105d8b46 | ||
|
|
a4adf0d1ec | ||
|
|
0473eb2c22 | ||
|
|
d9d74a549d | ||
|
|
b5afabf41b | ||
|
|
b09e273fab | ||
|
|
6d990c8ca1 | ||
|
|
d065ae7311 | ||
|
|
f6185c6d85 | ||
|
|
0d4aa19918 | ||
|
|
4dfed39284 | ||
|
|
fc6863bea9 | ||
|
|
b4af02bcc4 | ||
|
|
811b28ae39 | ||
|
|
55b141c756 | ||
|
|
fbe5fdcd05 | ||
|
|
a2075d255b | ||
|
|
7ea36613da | ||
|
|
e4021e2d21 | ||
|
|
dfbc6b2d28 | ||
|
|
b14246e828 | ||
|
|
cc764902bc | ||
|
|
1156930bd7 | ||
|
|
a6f0062bd7 | ||
|
|
c86bd7f528 | ||
|
|
f971949135 | ||
|
|
93970e41e3 | ||
|
|
a250829cb6 | ||
|
|
aa3af99591 | ||
|
|
1800ff1c5f | ||
|
|
c7f5dcaf38 | ||
|
|
95fa18fd1b | ||
|
|
8797e389c6 | ||
|
|
8f0fc87a18 | ||
|
|
c455f4ccbd | ||
|
|
b8f4c95e21 | ||
|
|
498c628a1e | ||
|
|
5c0a84fd95 | ||
|
|
abcec8015c | ||
|
|
70febdf0ce | ||
|
|
a33a2cc024 | ||
|
|
d16085b67b | ||
|
|
5903a8fb4f | ||
|
|
e865b4f106 | ||
|
|
b507383230 | ||
|
|
ee0bd97330 | ||
|
|
cd7615343e | ||
|
|
3087be111c | ||
|
|
e415fd6d5b | ||
|
|
d6c639e64b | ||
|
|
6bb3da2236 | ||
|
|
f4b458f9e2 | ||
|
|
c966517392 | ||
|
|
1b774773ac | ||
|
|
095f420299 | ||
|
|
f6b945c739 | ||
|
|
4a7c467763 | ||
|
|
ff5680b8f1 | ||
|
|
111c268fbb | ||
|
|
20b41bd136 | ||
|
|
232dcb7241 | ||
|
|
09d166ebfd | ||
|
|
f432f1b010 | ||
|
|
d7fcae0778 | ||
|
|
223b4a9fb2 | ||
|
|
1af309aa19 | ||
|
|
13d14d0ddf | ||
|
|
66b30531ac | ||
|
|
66cf5423c6 | ||
|
|
3f0cec517b | ||
|
|
833b8160b5 | ||
|
|
a776cc376e | ||
|
|
83777bf1bc | ||
|
|
a15bc3ddd9 | ||
|
|
6dfddf5410 | ||
|
|
fb928dc8ea | ||
|
|
1bac3117fa | ||
|
|
07c55e9db4 | ||
|
|
5a8991913d | ||
|
|
fcce8449bc | ||
|
|
283d452ede | ||
|
|
52ba9b76e0 | ||
|
|
9d051f5808 | ||
|
|
b2ad1b9b42 | ||
|
|
a5d3c7c4f4 | ||
|
|
bef6f89563 | ||
|
|
4b77527f7a | ||
|
|
a080556e7e | ||
|
|
95fe31c60d | ||
|
|
8f1465aa9c | ||
|
|
1b11ff7752 | ||
|
|
101ce7109e | ||
|
|
7caf083ebe | ||
|
|
11f85405e0 | ||
|
|
be297836a1 | ||
|
|
91d72e822e | ||
|
|
8640414cca | ||
|
|
091ace83f8 | ||
|
|
e81957973d | ||
|
|
f3af7d55a8 | ||
|
|
e92f3a25ec | ||
|
|
ecbe894712 | ||
|
|
9a432a2328 | ||
|
|
976cb2d81d | ||
|
|
00d70680f9 | ||
|
|
3b8e7319f1 | ||
|
|
39c4f1f7c5 | ||
|
|
50a7f8483a | ||
|
|
52df73c3ff | ||
|
|
6adaf5a554 | ||
|
|
fc94ae7a77 | ||
|
|
ec8ab90763 | ||
|
|
5a0f713935 | ||
|
|
34921ffbba | ||
|
|
62ad9a8dc5 | ||
|
|
84752f34f9 | ||
|
|
3a39d96928 | ||
|
|
65d37c34b7 | ||
|
|
8e174d9437 | ||
|
|
4ec9b314c1 | ||
|
|
ba59c319b8 | ||
|
|
7708dde102 | ||
|
|
6c4c621475 | ||
|
|
9a8cc4eeb5 | ||
|
|
389ab65ab9 | ||
|
|
d3ae37234c | ||
|
|
f3c6ccd13c | ||
|
|
7305ee0962 | ||
|
|
38d6560c11 | ||
|
|
87ab152239 | ||
|
|
c387491661 | ||
|
|
7db4e07719 | ||
|
|
0073fae58e | ||
|
|
960c76bad2 | ||
|
|
93c36a6f68 | ||
|
|
781c12f2a9 | ||
|
|
55f3c2f438 | ||
|
|
60e922f180 | ||
|
|
a8a305a8ca | ||
|
|
87e8e1b31c | ||
|
|
f68e7a365f | ||
|
|
8abb5f60ca | ||
|
|
59aa9a23d8 | ||
|
|
6d79765420 | ||
|
|
49ca11e02d | ||
|
|
c004e18fb1 | ||
|
|
ee5918d9d7 | ||
|
|
9837e78bfc | ||
|
|
e08dc5aaae | ||
|
|
9ae2e2ef95 | ||
|
|
55b58a5d4c |
38
.gitignore
vendored
38
.gitignore
vendored
@@ -1,17 +1,37 @@
|
||||
*.pyc
|
||||
*.pyo
|
||||
/*.patch
|
||||
build*/
|
||||
pyshtables.py
|
||||
build/conf/local.conf
|
||||
build/conf/bblayers.conf
|
||||
build/downloads
|
||||
build/tmp/
|
||||
build/sstate-cache
|
||||
build/pyshtables.py
|
||||
pstage/
|
||||
scripts/oe-git-proxy-socks
|
||||
scripts/poky-git-proxy-socks
|
||||
sources/
|
||||
meta-*
|
||||
!meta-skeleton
|
||||
!meta-hob
|
||||
meta-darwin
|
||||
meta-maemo
|
||||
meta-extras
|
||||
meta-m2
|
||||
meta-prvt*
|
||||
poky-autobuilder*
|
||||
*.swp
|
||||
*.orig
|
||||
*.rej
|
||||
*~
|
||||
!meta-yocto
|
||||
!meta-yocto-bsp
|
||||
documentation/poky-ref-manual/poky-ref-manual.html
|
||||
documentation/poky-ref-manual/poky-ref-manual.pdf
|
||||
documentation/poky-ref-manual/poky-ref-manual.tgz
|
||||
documentation/poky-ref-manual/bsp-guide.html
|
||||
documentation/poky-ref-manual/bsp-guide.pdf
|
||||
documentation/bsp-guide/bsp-guide.html
|
||||
documentation/bsp-guide/bsp-guide.pdf
|
||||
documentation/bsp-guide/bsp-guide.tgz
|
||||
documentation/yocto-project-qs/yocto-project-qs.html
|
||||
documentation/yocto-project-qs/yocto-project-qs.tgz
|
||||
documentation/kernel-manual/kernel-manual.html
|
||||
documentation/kernel-manual/kernel-manual.tgz
|
||||
documentation/kernel-manual/kernel-manual.pdf
|
||||
|
||||
|
||||
|
||||
|
||||
54
README
54
README
@@ -1,49 +1,15 @@
|
||||
Poky
|
||||
====
|
||||
|
||||
Poky is an integration of various components to form a complete prepackaged
|
||||
build system and development environment. It features support for building
|
||||
customised embedded device style images. There are reference demo images
|
||||
featuring a X11/Matchbox/GTK themed UI called Sato. The system supports
|
||||
cross-architecture application development using QEMU emulation and a
|
||||
standalone toolchain and SDK with IDE integration.
|
||||
Poky platform builder is a combined cross build system and development
|
||||
environment. It features support for building X11/Matchbox/GTK based
|
||||
filesystem images for various embedded devices and boards. It also
|
||||
supports cross-architecture application development using QEMU emulation
|
||||
and a standalone toolchain and SDK with IDE integration.
|
||||
|
||||
Poky has an extensive handbook, the source of which is contained in
|
||||
the handbook directory. For compiled HTML or pdf versions of this,
|
||||
see the Poky website http://pokylinux.org.
|
||||
|
||||
Additional information on the specifics of hardware that Poky supports
|
||||
is available in README.hardware. Further hardware support can easily be added
|
||||
in the form of layers which extend the systems capabilities in a modular way.
|
||||
|
||||
As an integration layer Poky consists of several upstream projects such as
|
||||
BitBake, OpenEmbedded-Core, Yocto documentation and various sources of information
|
||||
e.g. for the hardware support. Poky is in turn a component of the Yocto Project.
|
||||
|
||||
The Yocto Project has extensive documentation about the system including a
|
||||
reference manual which can be found at:
|
||||
http://yoctoproject.org/documentation
|
||||
|
||||
OpenEmbedded-Core is a layer containing the core metadata for current versions
|
||||
of OpenEmbedded. It is distro-less (can build a functional image with
|
||||
DISTRO = "") and contains only emulated machine support.
|
||||
|
||||
For information about OpenEmbedded, see the OpenEmbedded website:
|
||||
http://www.openembedded.org/
|
||||
|
||||
Where to Send Patches
|
||||
=====================
|
||||
|
||||
As Poky is an integration repository, patches against the various components
|
||||
should be sent to their respective upstreams.
|
||||
|
||||
bitbake:
|
||||
bitbake-devel@lists.openembedded.org
|
||||
|
||||
meta-yocto:
|
||||
poky@yoctoproject.org
|
||||
|
||||
Most everything else should be sent to the OpenEmbedded Core mailing list. If
|
||||
in doubt, check the oe-core git repository for the content you intend to modify.
|
||||
Before sending, be sure the patches apply cleanly to the current oe-core git
|
||||
repository.
|
||||
openembedded-core@lists.openembedded.org
|
||||
|
||||
Note: The scripts directory should be treated with extra care as it is a mix
|
||||
of oe-core and poky-specific files.
|
||||
is available in README.hardware.
|
||||
|
||||
137
README.hardware
137
README.hardware
@@ -68,12 +68,12 @@ Intel Atom based PCs and devices (atom-pc)
|
||||
|
||||
The atom-pc MACHINE is tested on the following platforms:
|
||||
|
||||
o Asus EeePC 901
|
||||
o Asus eee901
|
||||
o Acer Aspire One
|
||||
o Toshiba NB305
|
||||
o Intel Embedded Development Board 1-N450 (Black Sand)
|
||||
|
||||
and is likely to work on many unlisted Atom based devices. The MACHINE type
|
||||
and is likely to work on many unlisted atom based devices. The MACHINE type
|
||||
supports ethernet, wifi, sound, and i915 graphics by default in addition to
|
||||
common PC input devices, busses, and so on.
|
||||
|
||||
@@ -83,22 +83,29 @@ straightforward with a caveat for USB devices. The following examples assume the
|
||||
target boot device is /dev/sdb, be sure to verify this and use the correct
|
||||
device as the following commands are run as root and are not reversable.
|
||||
|
||||
USB Device:
|
||||
1. Build a live image. This image type consists of a simple filesystem
|
||||
without a partition table, which is suitable for USB keys, and with the
|
||||
default setup for the atom-pc machine, this image type is built
|
||||
automatically for any image you build. For example:
|
||||
Hard Disk:
|
||||
1. Build a directdisk image format. This will generate proper partition tables
|
||||
that will in turn be written to the physical media. For example:
|
||||
|
||||
$ bitbake core-image-minimal
|
||||
$ bitbake poky-image-minimal-directdisk
|
||||
|
||||
2. Use the "dd" utility to write the image to the raw block device. For example:
|
||||
|
||||
# dd if=poky-image-minimal-directdisk-atom-pc.hdddirect of=/dev/sdb
|
||||
|
||||
USB Device:
|
||||
1. Build an hddimg image format. This is a simple filesystem without partition
|
||||
tables and is suitable for USB keys. For example:
|
||||
|
||||
$ bitbake poky-image-minimal-live
|
||||
|
||||
2. Use the "dd" utility to write the image to the raw block device. For
|
||||
example:
|
||||
|
||||
# dd if=core-image-minimal-atom-pc.hddimg of=/dev/sdb
|
||||
# dd if=poky-image-minimal-live-atom-pc.hddimg of=/dev/sdb
|
||||
|
||||
If the device fails to boot with "Boot error" displayed, or apparently
|
||||
stops just after the SYSLINUX version banner, it is likely the BIOS cannot
|
||||
understand the physical layout of the disk (or rather it expects a
|
||||
If the device fails to boot with "Boot error" displayed, it is likely the BIOS
|
||||
cannot understand the physical layout of the disk (or rather it expects a
|
||||
particular layout and cannot handle anything else). There are two possible
|
||||
solutions to this problem:
|
||||
|
||||
@@ -107,47 +114,26 @@ USB Device:
|
||||
geometry from the device.
|
||||
|
||||
2. Without such an option, the BIOS generally boots the device in USB-ZIP
|
||||
mode. To write an image to a USB device that will be bootable in
|
||||
USB-ZIP mode, carry out the following actions:
|
||||
mode.
|
||||
|
||||
a. Determine the geometry of your USB device using fdisk:
|
||||
|
||||
# fdisk /dev/sdb
|
||||
Command (m for help): p
|
||||
|
||||
Disk /dev/sdb: 4011 MB, 4011491328 bytes
|
||||
124 heads, 62 sectors/track, 1019 cylinders, total 7834944 sectors
|
||||
...
|
||||
|
||||
Command (m for help): q
|
||||
|
||||
b. Configure the USB device for USB-ZIP mode:
|
||||
a. Configure the USB device for USB-ZIP mode:
|
||||
|
||||
# mkdiskimage -4 /dev/sdb 1019 124 62
|
||||
# mkdiskimage -4 /dev/sdb 0 63 62
|
||||
|
||||
Where 1019, 124 and 62 are the cylinder, head and sectors/track counts
|
||||
as reported by fdisk (substitute the values reported for your device).
|
||||
When the operation has finished and the access LED (if any) on the
|
||||
device stops flashing, remove and reinsert the device to allow the
|
||||
kernel to detect the new partition layout.
|
||||
Where 63 and 62 are the head and sector count as reported by fdisk.
|
||||
Remove and reinsert the device to allow the kernel to detect the new
|
||||
partition layout.
|
||||
|
||||
c. Copy the contents of the poky image to the USB-ZIP mode device:
|
||||
b. Copy the contents of the poky image to the USB-ZIP mode device:
|
||||
|
||||
# mkdir /tmp/image
|
||||
# mkdir /tmp/usbkey
|
||||
# mount -o loop core-image-minimal-atom-pc.hddimg /tmp/image
|
||||
# mount -o loop poky-image-minimal-live-atom-pc.hddimg /tmp/image
|
||||
# mount /dev/sdb4 /tmp/usbkey
|
||||
# cp -rf /tmp/image/* /tmp/usbkey
|
||||
|
||||
d. Install the syslinux boot loader:
|
||||
c. Install the syslinux boot loader:
|
||||
|
||||
# syslinux /dev/sdb4
|
||||
|
||||
e. Unmount everything:
|
||||
|
||||
# umount /tmp/image
|
||||
# umount /tmp/usbkey
|
||||
|
||||
Install the boot device in the target board and configure the BIOS to boot
|
||||
from it.
|
||||
|
||||
@@ -164,7 +150,7 @@ faster CPU, more RAM, an ethernet port, more USB ports, microSD, and removes
|
||||
the NAND flash. The beagleboard MACHINE is tested on the following platforms:
|
||||
|
||||
o Beagleboard C4
|
||||
o Beagleboard xM rev A & B
|
||||
o Beagleboard xM Rev A
|
||||
|
||||
The Beagleboard C4 has NAND, while the xM does not. For the sake of simplicity,
|
||||
these instructions assume you have erased the NAND on the C4 so its boot
|
||||
@@ -210,7 +196,7 @@ if used via a usb card reader):
|
||||
# cp u-boot-beagleboard.bin /media/boot/u-boot.bin
|
||||
|
||||
3. Install the root filesystem
|
||||
# tar x -C /media/root -f core-image-$IMAGE_TYPE-beagleboard.tar.bz2
|
||||
# tar x -C /media/root -f poky-image-$IMAGE_TYPE-beagleboard.tar.bz2
|
||||
# tar x -C /media/root -f modules-$KERNEL_VERSION-beagleboard.tgz
|
||||
|
||||
4. Install the kernel uImage
|
||||
@@ -253,57 +239,30 @@ software development of network attached storage (NAS) and digital media server
|
||||
applications. The MPC8315E-RDB features the PowerQUICC II Pro processor, which
|
||||
includes a built-in security accelerator.
|
||||
|
||||
(Note: you may find it easier to order MPC8315E-RDBA; this appears to be the
|
||||
same board in an enclosure with accessories. In any case it is fully
|
||||
compatible with the instructions given here.)
|
||||
|
||||
Setup instructions
|
||||
------------------
|
||||
|
||||
You will need the following:
|
||||
* NFS root setup on your workstation
|
||||
* TFTP server installed on your workstation
|
||||
* Straight-thru 9-conductor serial cable (DB9, M/F) connected from your
|
||||
PC to UART1
|
||||
* Ethernet connected to the first ethernet port on the board
|
||||
* nfs root setup on your workstation
|
||||
* tftp server installed on your workstation
|
||||
|
||||
--- Preparation ---
|
||||
Load the kernel and boot it as follows:
|
||||
|
||||
Note: if you have altered your board's ethernet MAC address(es) from the
|
||||
defaults, or you need to do so because you want multiple boards on the same
|
||||
network, then you will need to change the values in the dts file (patch
|
||||
linux/arch/powerpc/boot/dts/mpc8315erdb.dts within the kernel source). If
|
||||
you have left them at the factory default then you shouldn't need to do
|
||||
anything here.
|
||||
1. Get the kernel (uImage.mpc8315erdb) and dtb (mpc8315erdb.dtb) files from
|
||||
the Poky build tmp/deploy directory, and make them available on your tftp
|
||||
server.
|
||||
|
||||
--- Booting from NFS root ---
|
||||
2. Set up the environment in U-Boot:
|
||||
|
||||
Load the kernel and dtb (device tree blob), and boot the system as follows:
|
||||
=>setenv ipaddr <board ip>
|
||||
=>setenv serverip <tftp server ip>
|
||||
=>setenv bootargs root=/dev/nfs rw nfsroot=<nfsroot ip>:<rootfs path> ip=<board ip>:<server ip>:<gateway ip>:255.255.255.0:mpc8315e:eth0:off console=ttyS0,115200
|
||||
|
||||
1. Get the kernel (uImage-mpc8315e-rdb.bin) and dtb (uImage-mpc8315e-rdb.dtb)
|
||||
files from the Poky build tmp/deploy directory, and make them available on
|
||||
your TFTP server.
|
||||
3. Download kernel and dtb to boot kernel.
|
||||
|
||||
2. Connect the board's first serial port to your workstation and then start up
|
||||
your favourite serial terminal so that you will be able to interact with
|
||||
the serial console. If you don't have a favourite, picocom is suggested:
|
||||
|
||||
$ picocom /dev/ttyUSB0 -b 115200
|
||||
|
||||
3. Power up or reset the board and press a key on the terminal when prompted
|
||||
to get to the U-Boot command line
|
||||
|
||||
4. Set up the environment in U-Boot:
|
||||
|
||||
=> setenv ipaddr <board ip>
|
||||
=> setenv serverip <tftp server ip>
|
||||
=> setenv bootargs root=/dev/nfs rw nfsroot=<nfsroot ip>:<rootfs path> ip=<board ip>:<server ip>:<gateway ip>:255.255.255.0:mpc8315e:eth0:off console=ttyS0,115200
|
||||
|
||||
5. Download the kernel and dtb, and boot:
|
||||
|
||||
=> tftp 800000 uImage-mpc8315e-rdb.bin
|
||||
=> tftp 780000 uImage-mpc8315e-rdb.dtb
|
||||
=> bootm 800000 - 780000
|
||||
=>tftp 800000 uImage.mpc8315erdb
|
||||
=>tftp 780000 mpc8315erdb.dtb
|
||||
=>bootm 800000 - 780000
|
||||
|
||||
|
||||
Ubiquiti Networks RouterStation Pro (routerstationpro)
|
||||
@@ -332,11 +291,11 @@ name in all commands where appropriate.
|
||||
|
||||
--- Preparation ---
|
||||
|
||||
1) Build an image (e.g. core-image-minimal) using "routerstationpro" as the
|
||||
1) Build an image (e.g. poky-image-minimal) using "routerstationpro" as the
|
||||
MACHINE
|
||||
|
||||
2) Partition the USB drive so that primary partition 1 is type Linux (83).
|
||||
Minimum size depends on your root image size - core-image-minimal probably
|
||||
Minimum size depends on your root image size - poky-image-minimal probably
|
||||
only needs 8-16MB, other images will need more.
|
||||
|
||||
# fdisk /dev/sdb
|
||||
@@ -357,11 +316,11 @@ only needs 8-16MB, other images will need more.
|
||||
# mke2fs -j /dev/sdb1
|
||||
|
||||
4) Mount partition 1 and then extract the contents of
|
||||
tmp/deploy/images/core-image-XXXX.tar.bz2 into it (preserving permissions).
|
||||
tmp/deploy/images/poky-image-XXXX.tar.bz2 into it (preserving permissions).
|
||||
|
||||
# mount /dev/sdb1 /media/sdb1
|
||||
# cd /media/sdb1
|
||||
# tar -xvjpf tmp/deploy/images/core-image-XXXX.tar.bz2
|
||||
# tar -xvjpf tmp/deploy/images/poky-image-XXXX.tar.bz2
|
||||
|
||||
5) Unmount the USB drive and then plug it into the board's USB port
|
||||
|
||||
|
||||
@@ -32,25 +32,19 @@ import warnings
|
||||
from traceback import format_exception
|
||||
try:
|
||||
import bb
|
||||
except RuntimeError as exc:
|
||||
except RuntimeError, exc:
|
||||
sys.exit(str(exc))
|
||||
from bb import event
|
||||
import bb.msg
|
||||
from bb import cooker
|
||||
from bb import ui
|
||||
from bb import server
|
||||
from bb.server import none
|
||||
#from bb.server import xmlrpc
|
||||
|
||||
__version__ = "1.17.0"
|
||||
__version__ = "1.11.0"
|
||||
logger = logging.getLogger("BitBake")
|
||||
|
||||
# Unbuffer stdout to avoid log truncation in the event
|
||||
# of an unorderly exit as well as to provide timely
|
||||
# updates to log files for use with tail
|
||||
try:
|
||||
if sys.stdout.name == '<stdout>':
|
||||
sys.stdout = os.fdopen(sys.stdout.fileno(), 'w', 0)
|
||||
except:
|
||||
pass
|
||||
|
||||
class BBConfiguration(object):
|
||||
"""
|
||||
@@ -64,11 +58,10 @@ class BBConfiguration(object):
|
||||
|
||||
|
||||
def get_ui(config):
|
||||
if not config.ui:
|
||||
# modify 'ui' attribute because it is also read by cooker
|
||||
config.ui = os.environ.get('BITBAKE_UI', 'knotty')
|
||||
|
||||
interface = config.ui
|
||||
if config.ui:
|
||||
interface = config.ui
|
||||
else:
|
||||
interface = 'knotty'
|
||||
|
||||
try:
|
||||
# Dynamically load the UI based on the ui name. Although we
|
||||
@@ -78,7 +71,7 @@ def get_ui(config):
|
||||
return getattr(module, interface).main
|
||||
except AttributeError:
|
||||
sys.exit("FATAL: Invalid user interface '%s' specified.\n"
|
||||
"Valid interfaces: depexp, goggle, ncurses, hob, knotty [default]." % interface)
|
||||
"Valid interfaces: depexp, goggle, ncurses, knotty [default]." % interface)
|
||||
|
||||
|
||||
# Display bitbake/OE warnings via the BitBake.Warnings logger, ignoring others"""
|
||||
@@ -111,7 +104,7 @@ It expects that BBFILES is defined, which is a space separated list of files to
|
||||
be executed. BBFILES does support wildcards.
|
||||
Default BBFILES are the .bb files in the current directory.""")
|
||||
|
||||
parser.add_option("-b", "--buildfile", help = "execute the task against this .bb file, rather than a package from BBFILES. Does not handle any dependencies.",
|
||||
parser.add_option("-b", "--buildfile", help = "execute the task against this .bb file, rather than a package from BBFILES.",
|
||||
action = "store", dest = "buildfile", default = None)
|
||||
|
||||
parser.add_option("-k", "--continue", help = "continue as much as possible after an error. While the target that failed, and those that depend on it, cannot be remade, the other dependencies of these targets can be processed all the same.",
|
||||
@@ -126,14 +119,8 @@ Default BBFILES are the .bb files in the current directory.""")
|
||||
parser.add_option("-c", "--cmd", help = "Specify task to execute. Note that this only executes the specified task for the providee and the packages it depends on, i.e. 'compile' does not implicitly call stage for the dependencies (IOW: use only if you know what you are doing). Depending on the base.bbclass a listtasks tasks is defined and will show available tasks",
|
||||
action = "store", dest = "cmd")
|
||||
|
||||
parser.add_option("-C", "--clear-stamp", help = "Invalidate the stamp for the specified cmd such as 'compile' and run the default task for the specified target(s)",
|
||||
action = "store", dest = "invalidate_stamp")
|
||||
|
||||
parser.add_option("-r", "--read", help = "read the specified file before bitbake.conf",
|
||||
action = "append", dest = "prefile", default = [])
|
||||
|
||||
parser.add_option("-R", "--postread", help = "read the specified file after bitbake.conf",
|
||||
action = "append", dest = "postfile", default = [])
|
||||
action = "append", dest = "file", default = [])
|
||||
|
||||
parser.add_option("-v", "--verbose", help = "output more chit-chat to the terminal",
|
||||
action = "store_true", dest = "verbose", default = False)
|
||||
@@ -150,13 +137,16 @@ Default BBFILES are the .bb files in the current directory.""")
|
||||
parser.add_option("-p", "--parse-only", help = "quit after parsing the BB files (developers only)",
|
||||
action = "store_true", dest = "parse_only", default = False)
|
||||
|
||||
parser.add_option("-s", "--show-versions", help = "show current and preferred versions of all recipes",
|
||||
parser.add_option("-d", "--disable-psyco", help = "disable using the psyco just-in-time compiler (not recommended)",
|
||||
action = "store_true", dest = "disable_psyco", default = False)
|
||||
|
||||
parser.add_option("-s", "--show-versions", help = "show current and preferred versions of all packages",
|
||||
action = "store_true", dest = "show_versions", default = False)
|
||||
|
||||
parser.add_option("-e", "--environment", help = "show the global or per-package environment (this is what used to be bbread)",
|
||||
action = "store_true", dest = "show_environment", default = False)
|
||||
|
||||
parser.add_option("-g", "--graphviz", help = "emit the dependency trees of the specified packages in the dot syntax, and the pn-buildlist to show the build list",
|
||||
parser.add_option("-g", "--graphviz", help = "emit the dependency trees of the specified packages in the dot syntax",
|
||||
action = "store_true", dest = "dot_graph", default = False)
|
||||
|
||||
parser.add_option("-I", "--ignore-deps", help = """Assume these dependencies don't exist and are already provided (equivalent to ASSUME_PROVIDED). Useful to make dependency graphs more appealing""",
|
||||
@@ -171,97 +161,58 @@ Default BBFILES are the .bb files in the current directory.""")
|
||||
parser.add_option("-u", "--ui", help = "userinterface to use",
|
||||
action = "store", dest = "ui")
|
||||
|
||||
parser.add_option("-t", "--servertype", help = "Choose which server to use, none, process or xmlrpc",
|
||||
action = "store", dest = "servertype")
|
||||
|
||||
parser.add_option("", "--revisions-changed", help = "Set the exit code depending on whether upstream floating revisions have changed or not",
|
||||
action = "store_true", dest = "revisions_changed", default = False)
|
||||
|
||||
parser.add_option("", "--server-only", help = "Run bitbake without UI, the frontend can connect with bitbake server itself",
|
||||
action = "store_true", dest = "server_only", default = False)
|
||||
|
||||
parser.add_option("-B", "--bind", help = "The name/address for the bitbake server to bind to",
|
||||
action = "store", dest = "bind", default = False)
|
||||
parser.add_option("", "--no-setscene", help = "Do not run any setscene tasks, forces builds",
|
||||
action = "store_true", dest = "nosetscene", default = False)
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
|
||||
configuration = BBConfiguration(options)
|
||||
configuration.pkgs_to_build.extend(args[1:])
|
||||
configuration.initial_path = os.environ['PATH']
|
||||
|
||||
ui_main = get_ui(configuration)
|
||||
|
||||
# Server type can be xmlrpc, process or none currently, if nothing is specified,
|
||||
# the default server is process
|
||||
if configuration.servertype:
|
||||
server_type = configuration.servertype
|
||||
else:
|
||||
server_type = 'process'
|
||||
loghandler = event.LogHandler()
|
||||
logger.addHandler(loghandler)
|
||||
|
||||
try:
|
||||
module = __import__("bb.server", fromlist = [server_type])
|
||||
server = getattr(module, server_type)
|
||||
except AttributeError:
|
||||
sys.exit("FATAL: Invalid server type '%s' specified.\n"
|
||||
"Valid interfaces: xmlrpc, process [default], none." % servertype)
|
||||
#server = bb.server.xmlrpc
|
||||
server = bb.server.none
|
||||
|
||||
if configuration.server_only:
|
||||
if configuration.servertype != "xmlrpc":
|
||||
sys.exit("FATAL: If '--server-only' is defined, we must set the servertype as 'xmlrpc'.\n")
|
||||
if not configuration.bind:
|
||||
sys.exit("FATAL: The '--server-only' option requires a name/address to bind to with the -B option.\n")
|
||||
# Save a logfile for cooker into the current working directory. When the
|
||||
# server is daemonized this logfile will be truncated.
|
||||
cooker_logfile = os.path.join(os.getcwd(), "cooker.log")
|
||||
|
||||
if configuration.bind and configuration.servertype != "xmlrpc":
|
||||
sys.exit("FATAL: If '-B' or '--bind' is defined, we must set the servertype as 'xmlrpc'.\n")
|
||||
|
||||
bb.msg.init_msgconfig(configuration.verbose, configuration.debug,
|
||||
bb.utils.init_logger(bb.msg, configuration.verbose, configuration.debug,
|
||||
configuration.debug_domains)
|
||||
|
||||
# Ensure logging messages get sent to the UI as events
|
||||
handler = bb.event.LogHandler()
|
||||
logger.addHandler(handler)
|
||||
|
||||
# Before we start modifying the environment we should take a pristine
|
||||
# copy for possible later use
|
||||
initialenv = os.environ.copy()
|
||||
# Clear away any spurious environment variables. But don't wipe the
|
||||
# environment totally. This is necessary to ensure the correct operation
|
||||
# of the UIs (e.g. for DISPLAY, etc.)
|
||||
bb.utils.clean_environment()
|
||||
|
||||
server = server.BitBakeServer()
|
||||
if configuration.bind:
|
||||
server.initServer((configuration.bind, 0))
|
||||
else:
|
||||
server.initServer()
|
||||
|
||||
idle = server.getServerIdleCB()
|
||||
|
||||
cooker = bb.cooker.BBCooker(configuration, idle, initialenv)
|
||||
cooker = bb.cooker.BBCooker(configuration, server)
|
||||
cooker.parseCommandLine()
|
||||
|
||||
server.addcooker(cooker)
|
||||
server.saveConnectionDetails()
|
||||
server.detach()
|
||||
serverinfo = server.BitbakeServerInfo(cooker.server)
|
||||
|
||||
# Should no longer need to ever reference cooker
|
||||
server.BitBakeServerFork(cooker, cooker.server, serverinfo, cooker_logfile)
|
||||
del cooker
|
||||
|
||||
logger.removeHandler(handler)
|
||||
logger.removeHandler(loghandler)
|
||||
|
||||
if not configuration.server_only:
|
||||
# Setup a connection to the server (cooker)
|
||||
server_connection = server.establishConnection()
|
||||
# Setup a connection to the server (cooker)
|
||||
server_connection = server.BitBakeServerConnection(serverinfo)
|
||||
|
||||
try:
|
||||
return server.launchUI(ui_main, server_connection.connection, server_connection.events)
|
||||
finally:
|
||||
bb.event.ui_queue = []
|
||||
server_connection.terminate()
|
||||
# Launch the UI
|
||||
if configuration.ui:
|
||||
ui = configuration.ui
|
||||
else:
|
||||
print("server address: %s, server port: %s" % (server.serverinfo.host, server.serverinfo.port))
|
||||
ui = "knotty"
|
||||
|
||||
return 1
|
||||
try:
|
||||
return server.BitbakeUILauch().launch(serverinfo, ui_main, server_connection.connection, server_connection.events)
|
||||
finally:
|
||||
server_connection.terminate()
|
||||
|
||||
if __name__ == "__main__":
|
||||
try:
|
||||
@@ -271,4 +222,3 @@ if __name__ == "__main__":
|
||||
import traceback
|
||||
traceback.print_exc(5)
|
||||
sys.exit(ret)
|
||||
|
||||
|
||||
@@ -1,102 +1,12 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# bitbake-diffsigs
|
||||
# BitBake task signature data comparison utility
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
import fnmatch
|
||||
import optparse
|
||||
import logging
|
||||
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
|
||||
|
||||
import bb.tinfoil
|
||||
import bb.siggen
|
||||
|
||||
logger = logging.getLogger('BitBake')
|
||||
|
||||
def find_compare_task(bbhandler, pn, taskname):
|
||||
""" Find the most recent signature files for the specified PN/task and compare them """
|
||||
|
||||
if not hasattr(bb.siggen, 'find_siginfo'):
|
||||
logger.error('Metadata does not support finding signature data files')
|
||||
sys.exit(1)
|
||||
|
||||
filedates = bb.siggen.find_siginfo(pn, taskname, None, bbhandler.config_data)
|
||||
latestfiles = sorted(filedates.keys(), key=lambda f: filedates[f])[-2:]
|
||||
if not latestfiles:
|
||||
logger.error('No sigdata files found matching %s %s' % (pn, taskname))
|
||||
sys.exit(1)
|
||||
elif len(latestfiles) < 2:
|
||||
logger.error('Only one matching sigdata file found for the specified task (%s %s)' % (pn, taskname))
|
||||
sys.exit(1)
|
||||
else:
|
||||
# Define recursion callback
|
||||
def recursecb(key, hash1, hash2):
|
||||
hashes = [hash1, hash2]
|
||||
hashfiles = bb.siggen.find_siginfo(key, None, hashes, bbhandler.config_data)
|
||||
|
||||
recout = []
|
||||
if len(hashfiles) == 2:
|
||||
out2 = bb.siggen.compare_sigfiles(hashfiles[hash1], hashfiles[hash2], recursecb)
|
||||
recout.extend(list(' ' + l for l in out2))
|
||||
else:
|
||||
recout.append("Unable to find matching sigdata for %s with hashes %s or %s" % (key, hash1, hash2))
|
||||
|
||||
return recout
|
||||
|
||||
# Recurse into signature comparison
|
||||
output = bb.siggen.compare_sigfiles(latestfiles[0], latestfiles[1], recursecb)
|
||||
if output:
|
||||
print '\n'.join(output)
|
||||
sys.exit(0)
|
||||
|
||||
|
||||
|
||||
parser = optparse.OptionParser(
|
||||
usage = """
|
||||
%prog -t recipename taskname
|
||||
%prog sigdatafile1 sigdatafile2
|
||||
%prog sigdatafile1""")
|
||||
|
||||
parser.add_option("-t", "--task",
|
||||
help = "find the signature data files for last two runs of the specified task and compare them",
|
||||
action="store_true", dest="taskmode")
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
|
||||
if len(args) == 1:
|
||||
parser.print_help()
|
||||
if len(sys.argv) > 2:
|
||||
bb.siggen.compare_sigfiles(sys.argv[1], sys.argv[2])
|
||||
else:
|
||||
tinfoil = bb.tinfoil.Tinfoil()
|
||||
if options.taskmode:
|
||||
if len(args) < 3:
|
||||
logger.error("Please specify a recipe and task name")
|
||||
sys.exit(1)
|
||||
tinfoil.prepare(config_only = True)
|
||||
find_compare_task(tinfoil, args[1], args[2])
|
||||
else:
|
||||
if len(args) == 2:
|
||||
output = bb.siggen.dump_sigfile(sys.argv[1])
|
||||
else:
|
||||
output = bb.siggen.compare_sigfiles(sys.argv[1], sys.argv[2])
|
||||
|
||||
if output:
|
||||
print '\n'.join(output)
|
||||
bb.siggen.dump_sigfile(sys.argv[1])
|
||||
|
||||
@@ -1,11 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
|
||||
|
||||
import bb.siggen
|
||||
|
||||
output = bb.siggen.dump_sigfile(sys.argv[1])
|
||||
if output:
|
||||
print '\n'.join(output)
|
||||
@@ -2,30 +2,14 @@
|
||||
|
||||
# This script has subcommands which operate against your bitbake layers, either
|
||||
# displaying useful information, or acting against them.
|
||||
# See the help output for details on available commands.
|
||||
|
||||
# Copyright (C) 2011 Mentor Graphics Corporation
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
# Currently, it only provides a show_appends command, which shows you what
|
||||
# bbappends are in effect, and warns you if you have appends which are not being
|
||||
# utilized.
|
||||
|
||||
import cmd
|
||||
import logging
|
||||
import os
|
||||
import os.path
|
||||
import sys
|
||||
import fnmatch
|
||||
from collections import defaultdict
|
||||
|
||||
bindir = os.path.dirname(__file__)
|
||||
topdir = os.path.dirname(bindir)
|
||||
@@ -34,513 +18,141 @@ sys.path[0:0] = [os.path.join(topdir, 'lib')]
|
||||
import bb.cache
|
||||
import bb.cooker
|
||||
import bb.providers
|
||||
import bb.utils
|
||||
import bb.tinfoil
|
||||
from bb.cooker import state
|
||||
from bb.server import none
|
||||
|
||||
|
||||
logger = logging.getLogger('BitBake')
|
||||
default_cmd = 'show_appends'
|
||||
|
||||
|
||||
def main(args):
|
||||
logging.basicConfig(format='%(levelname)s: %(message)s')
|
||||
bb.utils.clean_environment()
|
||||
|
||||
cmds = Commands()
|
||||
if args:
|
||||
# Allow user to specify e.g. show-layers instead of show_layers
|
||||
args = [args[0].replace('-', '_')] + args[1:]
|
||||
cmds.onecmd(' '.join(args))
|
||||
else:
|
||||
cmds.do_help('')
|
||||
cmds.onecmd(default_cmd)
|
||||
return cmds.returncode
|
||||
|
||||
|
||||
class Commands(cmd.Cmd):
|
||||
def __init__(self):
|
||||
cmd.Cmd.__init__(self)
|
||||
self.bbhandler = bb.tinfoil.Tinfoil()
|
||||
|
||||
self.returncode = 0
|
||||
self.bblayers = (self.bbhandler.config_data.getVar('BBLAYERS', True) or "").split()
|
||||
self.config = Config(parse_only=True)
|
||||
self.cooker = bb.cooker.BBCooker(self.config,
|
||||
bb.server.none)
|
||||
self.config_data = self.cooker.configuration.data
|
||||
bb.providers.logger.setLevel(logging.ERROR)
|
||||
self.prepare_cooker()
|
||||
|
||||
def default(self, line):
|
||||
"""Handle unrecognised commands"""
|
||||
sys.stderr.write("Unrecognised command or option\n")
|
||||
self.do_help('')
|
||||
def prepare_cooker(self):
|
||||
sys.stderr.write("Parsing recipes..")
|
||||
logger.setLevel(logging.ERROR)
|
||||
|
||||
def do_help(self, topic):
|
||||
"""display general help or help on a specified command"""
|
||||
if topic:
|
||||
sys.stdout.write('%s: ' % topic)
|
||||
cmd.Cmd.do_help(self, topic.replace('-', '_'))
|
||||
else:
|
||||
sys.stdout.write("usage: bitbake-layers <command> [arguments]\n\n")
|
||||
sys.stdout.write("Available commands:\n")
|
||||
procnames = self.get_names()
|
||||
for procname in procnames:
|
||||
if procname[:3] == 'do_':
|
||||
sys.stdout.write(" %s\n" % procname[3:].replace('_', '-'))
|
||||
doc = getattr(self, procname).__doc__
|
||||
if doc:
|
||||
sys.stdout.write(" %s\n" % doc.splitlines()[0])
|
||||
try:
|
||||
while self.cooker.state in (state.initial, state.parsing):
|
||||
self.cooker.updateCache()
|
||||
except KeyboardInterrupt:
|
||||
self.cooker.shutdown()
|
||||
self.cooker.updateCache()
|
||||
sys.exit(2)
|
||||
|
||||
logger.setLevel(logging.INFO)
|
||||
sys.stderr.write("done.\n")
|
||||
|
||||
self.cooker_data = self.cooker.status
|
||||
self.cooker_data.appends = self.cooker.appendlist
|
||||
|
||||
def do_show_layers(self, args):
|
||||
"""show current configured layers"""
|
||||
self.bbhandler.prepare(config_only = True)
|
||||
logger.plain("%s %s %s" % ("layer".ljust(20), "path".ljust(40), "priority"))
|
||||
logger.plain('=' * 74)
|
||||
for layerdir in self.bblayers:
|
||||
layername = self.get_layer_name(layerdir)
|
||||
layerpri = 0
|
||||
for layer, _, regex, pri in self.bbhandler.cooker.status.bbfile_config_priorities:
|
||||
if regex.match(os.path.join(layerdir, 'test')):
|
||||
layerpri = pri
|
||||
break
|
||||
|
||||
logger.plain("%s %s %d" % (layername.ljust(20), layerdir.ljust(40), layerpri))
|
||||
|
||||
|
||||
def version_str(self, pe, pv, pr = None):
|
||||
verstr = "%s" % pv
|
||||
if pr:
|
||||
verstr = "%s-%s" % (verstr, pr)
|
||||
if pe:
|
||||
verstr = "%s:%s" % (pe, verstr)
|
||||
return verstr
|
||||
|
||||
|
||||
def do_show_overlayed(self, args):
|
||||
"""list overlayed recipes (where the same recipe exists in another layer)
|
||||
|
||||
usage: show-overlayed [-f] [-s]
|
||||
|
||||
Lists the names of overlayed recipes and the available versions in each
|
||||
layer, with the preferred version first. Note that skipped recipes that
|
||||
are overlayed will also be listed, with a " (skipped)" suffix.
|
||||
|
||||
Options:
|
||||
-f instead of the default formatting, list filenames of higher priority
|
||||
recipes with the ones they overlay indented underneath
|
||||
-s only list overlayed recipes where the version is the same
|
||||
"""
|
||||
self.bbhandler.prepare()
|
||||
|
||||
show_filenames = False
|
||||
show_same_ver_only = False
|
||||
for arg in args.split():
|
||||
if arg == '-f':
|
||||
show_filenames = True
|
||||
elif arg == '-s':
|
||||
show_same_ver_only = True
|
||||
else:
|
||||
sys.stderr.write("show-overlayed: invalid option %s\n" % arg)
|
||||
self.do_help('')
|
||||
return
|
||||
|
||||
items_listed = self.list_recipes('Overlayed recipes', None, True, show_same_ver_only, show_filenames, True)
|
||||
|
||||
# Check for overlayed .bbclass files
|
||||
classes = defaultdict(list)
|
||||
for layerdir in self.bblayers:
|
||||
classdir = os.path.join(layerdir, 'classes')
|
||||
if os.path.exists(classdir):
|
||||
for classfile in os.listdir(classdir):
|
||||
if os.path.splitext(classfile)[1] == '.bbclass':
|
||||
classes[classfile].append(classdir)
|
||||
|
||||
# Locating classes and other files is a bit more complicated than recipes -
|
||||
# layer priority is not a factor; instead BitBake uses the first matching
|
||||
# file in BBPATH, which is manipulated directly by each layer's
|
||||
# conf/layer.conf in turn, thus the order of layers in bblayers.conf is a
|
||||
# factor - however, each layer.conf is free to either prepend or append to
|
||||
# BBPATH (or indeed do crazy stuff with it). Thus the order in BBPATH might
|
||||
# not be exactly the order present in bblayers.conf either.
|
||||
bbpath = str(self.bbhandler.config_data.getVar('BBPATH', True))
|
||||
overlayed_class_found = False
|
||||
for (classfile, classdirs) in classes.items():
|
||||
if len(classdirs) > 1:
|
||||
if not overlayed_class_found:
|
||||
logger.plain('=== Overlayed classes ===')
|
||||
overlayed_class_found = True
|
||||
|
||||
mainfile = bb.utils.which(bbpath, os.path.join('classes', classfile))
|
||||
if show_filenames:
|
||||
logger.plain('%s' % mainfile)
|
||||
else:
|
||||
# We effectively have to guess the layer here
|
||||
logger.plain('%s:' % classfile)
|
||||
mainlayername = '?'
|
||||
for layerdir in self.bblayers:
|
||||
classdir = os.path.join(layerdir, 'classes')
|
||||
if mainfile.startswith(classdir):
|
||||
mainlayername = self.get_layer_name(layerdir)
|
||||
logger.plain(' %s' % mainlayername)
|
||||
for classdir in classdirs:
|
||||
fullpath = os.path.join(classdir, classfile)
|
||||
if fullpath != mainfile:
|
||||
if show_filenames:
|
||||
print(' %s' % fullpath)
|
||||
else:
|
||||
print(' %s' % self.get_layer_name(os.path.dirname(classdir)))
|
||||
|
||||
if overlayed_class_found:
|
||||
items_listed = True;
|
||||
|
||||
if not items_listed:
|
||||
logger.plain('No overlayed files found.')
|
||||
|
||||
|
||||
def do_show_recipes(self, args):
|
||||
"""list available recipes, showing the layer they are provided by
|
||||
|
||||
usage: show-recipes [-f] [-m] [pnspec]
|
||||
|
||||
Lists the names of overlayed recipes and the available versions in each
|
||||
layer, with the preferred version first. Optionally you may specify
|
||||
pnspec to match a specified recipe name (supports wildcards). Note that
|
||||
skipped recipes will also be listed, with a " (skipped)" suffix.
|
||||
|
||||
Options:
|
||||
-f instead of the default formatting, list filenames of higher priority
|
||||
recipes with other available recipes indented underneath
|
||||
-m only list where multiple recipes (in the same layer or different
|
||||
layers) exist for the same recipe name
|
||||
"""
|
||||
self.bbhandler.prepare()
|
||||
|
||||
show_filenames = False
|
||||
show_multi_provider_only = False
|
||||
pnspec = None
|
||||
title = 'Available recipes:'
|
||||
for arg in args.split():
|
||||
if arg == '-f':
|
||||
show_filenames = True
|
||||
elif arg == '-m':
|
||||
show_multi_provider_only = True
|
||||
elif not arg.startswith('-'):
|
||||
pnspec = arg
|
||||
title = 'Available recipes matching %s:' % pnspec
|
||||
else:
|
||||
sys.stderr.write("show-recipes: invalid option %s\n" % arg)
|
||||
self.do_help('')
|
||||
return
|
||||
self.list_recipes(title, pnspec, False, False, show_filenames, show_multi_provider_only)
|
||||
|
||||
|
||||
def list_recipes(self, title, pnspec, show_overlayed_only, show_same_ver_only, show_filenames, show_multi_provider_only):
|
||||
pkg_pn = self.bbhandler.cooker.status.pkg_pn
|
||||
(latest_versions, preferred_versions) = bb.providers.findProviders(self.bbhandler.cooker.configuration.data, self.bbhandler.cooker.status, pkg_pn)
|
||||
allproviders = bb.providers.allProviders(self.bbhandler.cooker.status)
|
||||
|
||||
# Ensure we list skipped recipes
|
||||
# We are largely guessing about PN, PV and the preferred version here,
|
||||
# but we have no choice since skipped recipes are not fully parsed
|
||||
skiplist = self.bbhandler.cooker.skiplist.keys()
|
||||
skiplist.sort( key=lambda fileitem: self.bbhandler.cooker.calc_bbfile_priority(fileitem) )
|
||||
skiplist.reverse()
|
||||
for fn in skiplist:
|
||||
recipe_parts = os.path.splitext(os.path.basename(fn))[0].split('_')
|
||||
p = recipe_parts[0]
|
||||
if len(recipe_parts) > 1:
|
||||
ver = (None, recipe_parts[1], None)
|
||||
else:
|
||||
ver = (None, 'unknown', None)
|
||||
allproviders[p].append((ver, fn))
|
||||
if not p in pkg_pn:
|
||||
pkg_pn[p] = 'dummy'
|
||||
preferred_versions[p] = (ver, fn)
|
||||
|
||||
def print_item(f, pn, ver, layer, ispref):
|
||||
if f in skiplist:
|
||||
skipped = ' (skipped)'
|
||||
else:
|
||||
skipped = ''
|
||||
if show_filenames:
|
||||
if ispref:
|
||||
logger.plain("%s%s", f, skipped)
|
||||
else:
|
||||
logger.plain(" %s%s", f, skipped)
|
||||
else:
|
||||
if ispref:
|
||||
logger.plain("%s:", pn)
|
||||
logger.plain(" %s %s%s", layer.ljust(20), ver, skipped)
|
||||
|
||||
preffiles = []
|
||||
items_listed = False
|
||||
for p in sorted(pkg_pn):
|
||||
if pnspec:
|
||||
if not fnmatch.fnmatch(p, pnspec):
|
||||
continue
|
||||
|
||||
if len(allproviders[p]) > 1 or not show_multi_provider_only:
|
||||
pref = preferred_versions[p]
|
||||
preffile = bb.cache.Cache.virtualfn2realfn(pref[1])[0]
|
||||
if preffile not in preffiles:
|
||||
preflayer = self.get_file_layer(preffile)
|
||||
multilayer = False
|
||||
same_ver = True
|
||||
provs = []
|
||||
for prov in allproviders[p]:
|
||||
provfile = bb.cache.Cache.virtualfn2realfn(prov[1])[0]
|
||||
provlayer = self.get_file_layer(provfile)
|
||||
provs.append((provfile, provlayer, prov[0]))
|
||||
if provlayer != preflayer:
|
||||
multilayer = True
|
||||
if prov[0] != pref[0]:
|
||||
same_ver = False
|
||||
|
||||
if (multilayer or not show_overlayed_only) and (same_ver or not show_same_ver_only):
|
||||
if not items_listed:
|
||||
logger.plain('=== %s ===' % title)
|
||||
items_listed = True
|
||||
print_item(preffile, p, self.version_str(pref[0][0], pref[0][1]), preflayer, True)
|
||||
for (provfile, provlayer, provver) in provs:
|
||||
if provfile != preffile:
|
||||
print_item(provfile, p, self.version_str(provver[0], provver[1]), provlayer, False)
|
||||
# Ensure we don't show two entries for BBCLASSEXTENDed recipes
|
||||
preffiles.append(preffile)
|
||||
|
||||
return items_listed
|
||||
|
||||
|
||||
def do_flatten(self, args):
|
||||
"""flattens layer configuration into a separate output directory.
|
||||
|
||||
usage: flatten [layer1 layer2 [layer3]...] <outputdir>
|
||||
|
||||
Takes the specified layers (or all layers in the current layer
|
||||
configuration if none are specified) and builds a "flattened" directory
|
||||
containing the contents of all layers, with any overlayed recipes removed
|
||||
and bbappends appended to the corresponding recipes. Note that some manual
|
||||
cleanup may still be necessary afterwards, in particular:
|
||||
|
||||
* where non-recipe files (such as patches) are overwritten (the flatten
|
||||
command will show a warning for these)
|
||||
* where anything beyond the normal layer setup has been added to
|
||||
layer.conf (only the lowest priority number layer's layer.conf is used)
|
||||
* overridden/appended items from bbappends will need to be tidied up
|
||||
* when the flattened layers do not have the same directory structure (the
|
||||
flatten command should show a warning when this will cause a problem)
|
||||
|
||||
Warning: if you flatten several layers where another layer is intended to
|
||||
be used "inbetween" them (in layer priority order) such that recipes /
|
||||
bbappends in the layers interact, and then attempt to use the new output
|
||||
layer together with that other layer, you may no longer get the same
|
||||
build results (as the layer priority order has effectively changed).
|
||||
"""
|
||||
arglist = args.split()
|
||||
if len(arglist) < 1:
|
||||
logger.error('Please specify an output directory')
|
||||
self.do_help('flatten')
|
||||
return
|
||||
|
||||
if len(arglist) == 2:
|
||||
logger.error('If you specify layers to flatten you must specify at least two')
|
||||
self.do_help('flatten')
|
||||
return
|
||||
|
||||
outputdir = arglist[-1]
|
||||
if os.path.exists(outputdir) and os.listdir(outputdir):
|
||||
logger.error('Directory %s exists and is non-empty, please clear it out first' % outputdir)
|
||||
return
|
||||
|
||||
self.bbhandler.prepare()
|
||||
layers = self.bblayers
|
||||
if len(arglist) > 2:
|
||||
layernames = arglist[:-1]
|
||||
found_layernames = []
|
||||
found_layerdirs = []
|
||||
for layerdir in layers:
|
||||
layername = self.get_layer_name(layerdir)
|
||||
if layername in layernames:
|
||||
found_layerdirs.append(layerdir)
|
||||
found_layernames.append(layername)
|
||||
|
||||
for layername in layernames:
|
||||
if not layername in found_layernames:
|
||||
logger.error('Unable to find layer %s in current configuration, please run "%s show-layers" to list configured layers' % (layername, os.path.basename(sys.argv[0])))
|
||||
return
|
||||
layers = found_layerdirs
|
||||
else:
|
||||
layernames = []
|
||||
|
||||
# Ensure a specified path matches our list of layers
|
||||
def layer_path_match(path):
|
||||
for layerdir in layers:
|
||||
if path.startswith(os.path.join(layerdir, '')):
|
||||
return layerdir
|
||||
return None
|
||||
|
||||
appended_recipes = []
|
||||
for layer in layers:
|
||||
overlayed = []
|
||||
for f in self.bbhandler.cooker.overlayed.iterkeys():
|
||||
for of in self.bbhandler.cooker.overlayed[f]:
|
||||
if of.startswith(layer):
|
||||
overlayed.append(of)
|
||||
|
||||
logger.plain('Copying files from %s...' % layer )
|
||||
for root, dirs, files in os.walk(layer):
|
||||
for f1 in files:
|
||||
f1full = os.sep.join([root, f1])
|
||||
if f1full in overlayed:
|
||||
logger.plain(' Skipping overlayed file %s' % f1full )
|
||||
else:
|
||||
ext = os.path.splitext(f1)[1]
|
||||
if ext != '.bbappend':
|
||||
fdest = f1full[len(layer):]
|
||||
fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
|
||||
bb.utils.mkdirhier(os.path.dirname(fdest))
|
||||
if os.path.exists(fdest):
|
||||
if f1 == 'layer.conf' and root.endswith('/conf'):
|
||||
logger.plain(' Skipping layer config file %s' % f1full )
|
||||
continue
|
||||
else:
|
||||
logger.warn('Overwriting file %s', fdest)
|
||||
bb.utils.copyfile(f1full, fdest)
|
||||
if ext == '.bb':
|
||||
if f1 in self.bbhandler.cooker.appendlist:
|
||||
appends = self.bbhandler.cooker.appendlist[f1]
|
||||
if appends:
|
||||
logger.plain(' Applying appends to %s' % fdest )
|
||||
for appendname in appends:
|
||||
if layer_path_match(appendname):
|
||||
self.apply_append(appendname, fdest)
|
||||
appended_recipes.append(f1)
|
||||
|
||||
# Take care of when some layers are excluded and yet we have included bbappends for those recipes
|
||||
for recipename in self.bbhandler.cooker.appendlist.iterkeys():
|
||||
if recipename not in appended_recipes:
|
||||
appends = self.bbhandler.cooker.appendlist[recipename]
|
||||
first_append = None
|
||||
for appendname in appends:
|
||||
layer = layer_path_match(appendname)
|
||||
if layer:
|
||||
if first_append:
|
||||
self.apply_append(appendname, first_append)
|
||||
else:
|
||||
fdest = appendname[len(layer):]
|
||||
fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
|
||||
bb.utils.mkdirhier(os.path.dirname(fdest))
|
||||
bb.utils.copyfile(appendname, fdest)
|
||||
first_append = fdest
|
||||
|
||||
# Get the regex for the first layer in our list (which is where the conf/layer.conf file will
|
||||
# have come from)
|
||||
first_regex = None
|
||||
layerdir = layers[0]
|
||||
for layername, pattern, regex, _ in self.bbhandler.cooker.status.bbfile_config_priorities:
|
||||
if regex.match(os.path.join(layerdir, 'test')):
|
||||
first_regex = regex
|
||||
break
|
||||
|
||||
if first_regex:
|
||||
# Find the BBFILES entries that match (which will have come from this conf/layer.conf file)
|
||||
bbfiles = str(self.bbhandler.config_data.getVar('BBFILES', True)).split()
|
||||
bbfiles_layer = []
|
||||
for item in bbfiles:
|
||||
if first_regex.match(item):
|
||||
newpath = os.path.join(outputdir, item[len(layerdir)+1:])
|
||||
bbfiles_layer.append(newpath)
|
||||
|
||||
if bbfiles_layer:
|
||||
# Check that all important layer files match BBFILES
|
||||
for root, dirs, files in os.walk(outputdir):
|
||||
for f1 in files:
|
||||
ext = os.path.splitext(f1)[1]
|
||||
if ext in ['.bb', '.bbappend']:
|
||||
f1full = os.sep.join([root, f1])
|
||||
entry_found = False
|
||||
for item in bbfiles_layer:
|
||||
if fnmatch.fnmatch(f1full, item):
|
||||
entry_found = True
|
||||
break
|
||||
if not entry_found:
|
||||
logger.warning("File %s does not match the flattened layer's BBFILES setting, you may need to edit conf/layer.conf or move the file elsewhere" % f1full)
|
||||
|
||||
def get_file_layer(self, filename):
|
||||
for layer, _, regex, _ in self.bbhandler.cooker.status.bbfile_config_priorities:
|
||||
if regex.match(filename):
|
||||
for layerdir in self.bblayers:
|
||||
if regex.match(os.path.join(layerdir, 'test')):
|
||||
return self.get_layer_name(layerdir)
|
||||
return "?"
|
||||
|
||||
def get_layer_name(self, layerdir):
|
||||
return os.path.basename(layerdir.rstrip(os.sep))
|
||||
|
||||
def apply_append(self, appendname, recipename):
|
||||
appendfile = open(appendname, 'r')
|
||||
recipefile = open(recipename, 'a')
|
||||
recipefile.write('\n')
|
||||
recipefile.write('##### bbappended from %s #####\n' % self.get_file_layer(appendname))
|
||||
recipefile.writelines(appendfile.readlines())
|
||||
recipefile.close()
|
||||
appendfile.close()
|
||||
logger.info(str(self.config_data.getVar('BBLAYERS', True)))
|
||||
|
||||
def do_show_appends(self, args):
|
||||
"""list bbappend files and recipe files they apply to
|
||||
|
||||
usage: show-appends
|
||||
|
||||
Recipes are listed with the bbappends that apply to them as subitems.
|
||||
"""
|
||||
self.bbhandler.prepare()
|
||||
if not self.bbhandler.cooker.appendlist:
|
||||
logger.plain('No append files found')
|
||||
if not self.cooker_data.appends:
|
||||
logger.info('No append files found')
|
||||
return
|
||||
|
||||
logger.plain('=== Appended recipes ===')
|
||||
logger.info('State of append files:')
|
||||
|
||||
pnlist = list(self.bbhandler.cooker_data.pkg_pn.keys())
|
||||
pnlist.sort()
|
||||
for pn in pnlist:
|
||||
for pn in self.cooker_data.pkg_pn:
|
||||
self.show_appends_for_pn(pn)
|
||||
|
||||
self.show_appends_for_skipped()
|
||||
self.show_appends_with_no_recipes()
|
||||
|
||||
def show_appends_for_pn(self, pn):
|
||||
filenames = self.bbhandler.cooker_data.pkg_pn[pn]
|
||||
filenames = self.cooker_data.pkg_pn[pn]
|
||||
|
||||
best = bb.providers.findBestProvider(pn,
|
||||
self.bbhandler.cooker.configuration.data,
|
||||
self.bbhandler.cooker_data,
|
||||
self.bbhandler.cooker_data.pkg_pn)
|
||||
self.cooker.configuration.data,
|
||||
self.cooker_data,
|
||||
self.cooker_data.pkg_pn)
|
||||
best_filename = os.path.basename(best[3])
|
||||
|
||||
self.show_appends_output(filenames, best_filename)
|
||||
|
||||
def show_appends_for_skipped(self):
|
||||
filenames = [os.path.basename(f)
|
||||
for f in self.bbhandler.cooker.skiplist.iterkeys()]
|
||||
self.show_appends_output(filenames, None, " (skipped)")
|
||||
|
||||
def show_appends_output(self, filenames, best_filename, name_suffix = ''):
|
||||
appended, missing = self.get_appends_for_files(filenames)
|
||||
if appended:
|
||||
for basename, appends in appended:
|
||||
logger.plain('%s%s:', basename, name_suffix)
|
||||
logger.info('%s:', basename)
|
||||
for append in appends:
|
||||
logger.plain(' %s', append)
|
||||
|
||||
if best_filename:
|
||||
if best_filename in missing:
|
||||
logger.warn('%s: missing append for preferred version',
|
||||
best_filename)
|
||||
self.returncode |= 1
|
||||
logger.info(' %s', append)
|
||||
|
||||
if best_filename in missing:
|
||||
logger.warn('%s: missing append for preferred version',
|
||||
best_filename)
|
||||
self.returncode |= 1
|
||||
|
||||
def get_appends_for_files(self, filenames):
|
||||
appended, notappended = [], []
|
||||
appended, notappended = set(), set()
|
||||
for filename in filenames:
|
||||
_, cls = bb.cache.Cache.virtualfn2realfn(filename)
|
||||
if cls:
|
||||
continue
|
||||
|
||||
basename = os.path.basename(filename)
|
||||
appends = self.bbhandler.cooker.appendlist.get(basename)
|
||||
appends = self.cooker_data.appends.get(basename)
|
||||
if appends:
|
||||
appended.append((basename, list(appends)))
|
||||
appended.add((basename, frozenset(appends)))
|
||||
else:
|
||||
notappended.append(basename)
|
||||
notappended.add(basename)
|
||||
return appended, notappended
|
||||
|
||||
def show_appends_with_no_recipes(self):
|
||||
recipes = set(os.path.basename(f)
|
||||
for f in self.cooker_data.pkg_fn.iterkeys())
|
||||
appended_recipes = self.cooker_data.appends.iterkeys()
|
||||
appends_without_recipes = [self.cooker_data.appends[recipe]
|
||||
for recipe in appended_recipes
|
||||
if recipe not in recipes]
|
||||
if appends_without_recipes:
|
||||
appendlines = (' %s' % append
|
||||
for appends in appends_without_recipes
|
||||
for append in appends)
|
||||
logger.warn('No recipes available for:\n%s',
|
||||
'\n'.join(appendlines))
|
||||
self.returncode |= 4
|
||||
|
||||
def do_EOF(self, line):
|
||||
return True
|
||||
|
||||
|
||||
class Config(object):
|
||||
def __init__(self, **options):
|
||||
self.pkgs_to_build = []
|
||||
self.debug_domains = []
|
||||
self.extra_assume_provided = []
|
||||
self.file = []
|
||||
self.debug = 0
|
||||
self.__dict__.update(options)
|
||||
|
||||
def __getattr__(self, attribute):
|
||||
try:
|
||||
return super(Config, self).__getattribute__(attribute)
|
||||
except AttributeError:
|
||||
return None
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
sys.exit(main(sys.argv[1:]) or 0)
|
||||
|
||||
@@ -1,55 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
import os
|
||||
import sys,logging
|
||||
import optparse
|
||||
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)),'lib'))
|
||||
|
||||
import prserv
|
||||
import prserv.serv
|
||||
|
||||
__version__="1.0.0"
|
||||
|
||||
PRHOST_DEFAULT='0.0.0.0'
|
||||
PRPORT_DEFAULT=8585
|
||||
|
||||
def main():
|
||||
parser = optparse.OptionParser(
|
||||
version="Bitbake PR Service Core version %s, %%prog version %s" % (prserv.__version__, __version__),
|
||||
usage = "%prog < --start | --stop > [options]")
|
||||
|
||||
parser.add_option("-f", "--file", help="database filename(default: prserv.sqlite3)", action="store",
|
||||
dest="dbfile", type="string", default="prserv.sqlite3")
|
||||
parser.add_option("-l", "--log", help="log filename(default: prserv.log)", action="store",
|
||||
dest="logfile", type="string", default="prserv.log")
|
||||
parser.add_option("--loglevel", help="logging level, i.e. CRITICAL, ERROR, WARNING, INFO, DEBUG",
|
||||
action = "store", type="string", dest="loglevel", default = "INFO")
|
||||
parser.add_option("--start", help="start daemon",
|
||||
action="store_true", dest="start")
|
||||
parser.add_option("--stop", help="stop daemon",
|
||||
action="store_true", dest="stop")
|
||||
parser.add_option("--host", help="ip address to bind", action="store",
|
||||
dest="host", type="string", default=PRHOST_DEFAULT)
|
||||
parser.add_option("--port", help="port number(default: 8585)", action="store",
|
||||
dest="port", type="int", default=PRPORT_DEFAULT)
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
prserv.init_logger(os.path.abspath(options.logfile),options.loglevel)
|
||||
|
||||
if options.start:
|
||||
ret=prserv.serv.start_daemon(options.dbfile, options.host, options.port,os.path.abspath(options.logfile))
|
||||
elif options.stop:
|
||||
ret=prserv.serv.stop_daemon(options.host, options.port)
|
||||
else:
|
||||
ret=parser.print_help()
|
||||
return ret
|
||||
|
||||
if __name__ == "__main__":
|
||||
try:
|
||||
ret = main()
|
||||
except Exception:
|
||||
ret = 1
|
||||
import traceback
|
||||
traceback.print_exc(5)
|
||||
sys.exit(ret)
|
||||
|
||||
@@ -4,10 +4,6 @@ import os
|
||||
import sys
|
||||
import warnings
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
|
||||
from bb import fetch2
|
||||
import logging
|
||||
|
||||
logger = logging.getLogger("BitBake")
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
@@ -20,20 +16,13 @@ class BBConfiguration(object):
|
||||
Manages build options and configurations for one run
|
||||
"""
|
||||
|
||||
def __init__(self, **options):
|
||||
self.data = {}
|
||||
self.file = []
|
||||
self.cmd = None
|
||||
self.dump_signatures = True
|
||||
self.prefile = []
|
||||
self.postfile = []
|
||||
self.parse_only = True
|
||||
|
||||
def __getattr__(self, attribute):
|
||||
try:
|
||||
return super(BBConfiguration, self).__getattribute__(attribute)
|
||||
except AttributeError:
|
||||
return None
|
||||
def __init__(self, debug, debug_domains):
|
||||
setattr(self, "data", {})
|
||||
setattr(self, "file", [])
|
||||
setattr(self, "cmd", None)
|
||||
setattr(self, "dump_signatures", True)
|
||||
setattr(self, "debug", debug)
|
||||
setattr(self, "debug_domains", debug_domains)
|
||||
|
||||
_warnings_showwarning = warnings.showwarning
|
||||
def _showwarning(message, category, filename, lineno, file=None, line=None):
|
||||
@@ -50,70 +39,82 @@ warnings.showwarning = _showwarning
|
||||
warnings.simplefilter("ignore", DeprecationWarning)
|
||||
|
||||
import bb.event
|
||||
|
||||
# Need to map our I/O correctly. stdout is a pipe to the server expecting
|
||||
# events. We save this and then map stdout to stderr.
|
||||
|
||||
eventfd = os.dup(sys.stdout.fileno())
|
||||
bb.event.worker_pipe = os.fdopen(eventfd, 'w', 0)
|
||||
|
||||
# map stdout to stderr
|
||||
os.dup2(sys.stderr.fileno(), sys.stdout.fileno())
|
||||
|
||||
# Replace those fds with our own
|
||||
#logout = data.expand("${TMPDIR}/log/stdout.%s" % os.getpid(), self.cfgData, True)
|
||||
#mkdirhier(os.path.dirname(logout))
|
||||
#newso = open("/tmp/stdout.%s" % os.getpid(), 'w')
|
||||
#os.dup2(newso.fileno(), sys.stdout.fileno())
|
||||
#os.dup2(newso.fileno(), sys.stderr.fileno())
|
||||
|
||||
# Don't read from stdin from the parent
|
||||
si = file("/dev/null", 'r')
|
||||
os.dup2(si.fileno( ), sys.stdin.fileno( ))
|
||||
|
||||
# We don't want to see signals to our parent, e.g. Ctrl+C
|
||||
os.setpgrp()
|
||||
|
||||
# Save out the PID so that the event can include it the
|
||||
# events
|
||||
bb.event.worker_pid = os.getpid()
|
||||
bb.event.useStdout = False
|
||||
|
||||
hashfile = sys.argv[1]
|
||||
buildfile = sys.argv[2]
|
||||
taskname = sys.argv[3]
|
||||
|
||||
import bb.cooker
|
||||
|
||||
buildfile = sys.argv[1]
|
||||
taskname = sys.argv[2]
|
||||
if len(sys.argv) >= 4:
|
||||
dryrun = sys.argv[3]
|
||||
else:
|
||||
dryrun = False
|
||||
if len(sys.argv) >= 5:
|
||||
hashfile = sys.argv[4]
|
||||
p = pickle.Unpickler(file(hashfile, "rb"))
|
||||
hashdata = p.load()
|
||||
else:
|
||||
hashdata = None
|
||||
p = pickle.Unpickler(file(hashfile, "rb"))
|
||||
hashdata = p.load()
|
||||
|
||||
handler = bb.event.LogHandler()
|
||||
logger.addHandler(handler)
|
||||
debug = hashdata["msg-debug"]
|
||||
debug_domains = hashdata["msg-debug-domains"]
|
||||
verbose = hashdata["verbose"]
|
||||
|
||||
#An example to make debug log messages show up
|
||||
#bb.msg.init_msgconfig(True, 3, [])
|
||||
bb.utils.init_logger(bb.msg, verbose, debug, debug_domains)
|
||||
|
||||
console = logging.StreamHandler(sys.stdout)
|
||||
format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
|
||||
bb.msg.addDefaultlogFilter(console)
|
||||
console.setFormatter(format)
|
||||
cooker = bb.cooker.BBCooker(BBConfiguration(debug, debug_domains), None)
|
||||
cooker.parseConfiguration()
|
||||
|
||||
def worker_fire(event, d):
|
||||
if isinstance(event, logging.LogRecord):
|
||||
console.handle(event)
|
||||
bb.event.worker_fire = worker_fire
|
||||
bb.event.worker_pid = os.getpid()
|
||||
cooker.bb_cache = bb.cache.init(cooker)
|
||||
cooker.status = bb.cache.CacheData()
|
||||
|
||||
initialenv = os.environ.copy()
|
||||
config = BBConfiguration()
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
pass
|
||||
|
||||
cooker = bb.cooker.BBCooker(config, register_idle_function, initialenv)
|
||||
config_data = cooker.configuration.data
|
||||
cooker.status = config_data
|
||||
cooker.handleCollections(config_data.getVar("BBFILE_COLLECTIONS", 1))
|
||||
|
||||
fn, cls = bb.cache.Cache.virtualfn2realfn(buildfile)
|
||||
(fn, cls) = cooker.bb_cache.virtualfn2realfn(buildfile)
|
||||
buildfile = cooker.matchFile(fn)
|
||||
fn = bb.cache.Cache.realfn2virtual(buildfile, cls)
|
||||
fn = cooker.bb_cache.realfn2virtual(buildfile, cls)
|
||||
|
||||
cooker.buildSetVars()
|
||||
|
||||
# Load data into the cache for fn and parse the loaded cache data
|
||||
the_data = bb.cache.Cache.loadDataFull(fn, cooker.get_file_appends(fn), cooker.configuration.data)
|
||||
the_data = cooker.bb_cache.loadDataFull(fn, cooker.get_file_appends(fn), cooker.configuration.data)
|
||||
cooker.bb_cache.setData(fn, buildfile, the_data)
|
||||
cooker.bb_cache.handle_data(fn, cooker.status)
|
||||
|
||||
#exportlist = bb.utils.preserved_envvars_export_list()
|
||||
#bb.utils.filter_environment(exportlist)
|
||||
|
||||
if taskname.endswith("_setscene"):
|
||||
the_data.setVarFlag(taskname, "quieterrors", "1")
|
||||
|
||||
if hashdata:
|
||||
bb.parse.siggen.set_taskdata(hashdata["hashes"], hashdata["deps"])
|
||||
for h in hashdata["hashes"]:
|
||||
the_data.setVar("BBHASH_%s" % h, hashdata["hashes"][h])
|
||||
for h in hashdata["deps"]:
|
||||
the_data.setVar("BBHASHDEPS_%s" % h, hashdata["deps"][h])
|
||||
bb.parse.siggen.set_taskdata(hashdata["hashes"], hashdata["deps"])
|
||||
|
||||
for h in hashdata["hashes"]:
|
||||
bb.data.setVar("BBHASH_%s" % h, hashdata["hashes"][h], the_data)
|
||||
for h in hashdata["deps"]:
|
||||
bb.data.setVar("BBHASHDEPS_%s" % h, hashdata["deps"][h], the_data)
|
||||
|
||||
ret = 0
|
||||
if dryrun != "True":
|
||||
if sys.argv[4] != "True":
|
||||
ret = bb.build.exec_task(fn, taskname, the_data)
|
||||
sys.exit(ret)
|
||||
|
||||
|
||||
@@ -1,38 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys, logging
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)), 'lib'))
|
||||
|
||||
import unittest
|
||||
try:
|
||||
import bb
|
||||
except RuntimeError as exc:
|
||||
sys.exit(str(exc))
|
||||
|
||||
tests = ["bb.tests.codeparser",
|
||||
"bb.tests.cow",
|
||||
"bb.tests.data",
|
||||
"bb.tests.fetch",
|
||||
"bb.tests.utils"]
|
||||
|
||||
for t in tests:
|
||||
__import__(t)
|
||||
|
||||
unittest.main(argv=["bitbake-selftest"] + tests)
|
||||
|
||||
@@ -430,8 +430,9 @@ Create a set of html pages (documentation) for a bitbake.conf....
|
||||
action = "store_true", dest = "verbose", default = False )
|
||||
|
||||
options, args = parser.parse_args( sys.argv )
|
||||
|
||||
bb.msg.init_msgconfig(options.verbose, options.debug)
|
||||
|
||||
if options.debug:
|
||||
bb.msg.set_debug_level(options.debug)
|
||||
|
||||
return options.config, options.output
|
||||
|
||||
@@ -462,7 +463,7 @@ def main():
|
||||
state_group = 2
|
||||
|
||||
for key in bb.data.keys(documentation):
|
||||
data = documentation.getVarFlag(key, "doc")
|
||||
data = bb.data.getVarFlag(key, "doc", documentation)
|
||||
if not data:
|
||||
continue
|
||||
|
||||
|
||||
@@ -1,120 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright (c) 2012 Wind River Systems, Inc.
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
|
||||
# See the GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License
|
||||
# along with this program; if not, write to the Free Software
|
||||
# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
||||
|
||||
import os
|
||||
import sys
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname( \
|
||||
os.path.abspath(__file__))), 'lib'))
|
||||
try:
|
||||
import bb
|
||||
except RuntimeError as exc:
|
||||
sys.exit(str(exc))
|
||||
|
||||
import gtk
|
||||
import optparse
|
||||
import pygtk
|
||||
|
||||
from bb.ui.crumbs.hig import DeployImageDialog, ImageSelectionDialog, CrumbsMessageDialog
|
||||
from bb.ui.crumbs.hobwidget import HobAltButton, HobButton
|
||||
|
||||
# I put all the fs bitbake supported here. Need more test.
|
||||
DEPLOYABLE_IMAGE_TYPES = ["jffs2", "cramfs", "ext2", "ext3", "btrfs", "squashfs", "ubi", "vmdk"]
|
||||
Title = "USB Image Writer"
|
||||
|
||||
class DeployWindow(gtk.Window):
|
||||
def __init__(self, image_path=''):
|
||||
super(DeployWindow, self).__init__()
|
||||
|
||||
if len(image_path) > 0:
|
||||
valid = True
|
||||
if not os.path.exists(image_path):
|
||||
valid = False
|
||||
lbl = "<b>Invalid image file path: %s.</b>\nPress <b>Select Image</b> to select an image." % image_path
|
||||
else:
|
||||
image_path = os.path.abspath(image_path)
|
||||
extend_name = os.path.splitext(image_path)[1][1:]
|
||||
if extend_name not in DEPLOYABLE_IMAGE_TYPES:
|
||||
valid = False
|
||||
lbl = "<b>Undeployable imge type: %s</b>\nPress <b>Select Image</b> to select an image." % extend_name
|
||||
|
||||
if not valid:
|
||||
image_path = ''
|
||||
crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
|
||||
button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
|
||||
HobButton.style_button(button)
|
||||
crumbs_dialog.run()
|
||||
crumbs_dialog.destroy()
|
||||
|
||||
self.deploy_dialog = DeployImageDialog(Title, image_path, self,
|
||||
gtk.DIALOG_MODAL | gtk.DIALOG_DESTROY_WITH_PARENT
|
||||
| gtk.DIALOG_NO_SEPARATOR, None, standalone=True)
|
||||
close_button = self.deploy_dialog.add_button("Close", gtk.RESPONSE_NO)
|
||||
HobAltButton.style_button(close_button)
|
||||
close_button.connect('clicked', gtk.main_quit)
|
||||
|
||||
write_button = self.deploy_dialog.add_button("Write USB image", gtk.RESPONSE_YES)
|
||||
HobAltButton.style_button(write_button)
|
||||
|
||||
self.deploy_dialog.connect('select_image_clicked', self.select_image_clicked_cb)
|
||||
self.deploy_dialog.connect('destroy', gtk.main_quit)
|
||||
response = self.deploy_dialog.show()
|
||||
|
||||
def select_image_clicked_cb(self, dialog):
|
||||
cwd = os.getcwd()
|
||||
dialog = ImageSelectionDialog(cwd, DEPLOYABLE_IMAGE_TYPES, Title, self, gtk.FILE_CHOOSER_ACTION_SAVE )
|
||||
button = dialog.add_button("Cancel", gtk.RESPONSE_NO)
|
||||
HobAltButton.style_button(button)
|
||||
button = dialog.add_button("Open", gtk.RESPONSE_YES)
|
||||
HobAltButton.style_button(button)
|
||||
response = dialog.run()
|
||||
|
||||
if response == gtk.RESPONSE_YES:
|
||||
if not dialog.image_names:
|
||||
lbl = "<b>No selections made</b>\nClicked the radio button to select a image."
|
||||
crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
|
||||
button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
|
||||
HobButton.style_button(button)
|
||||
crumbs_dialog.run()
|
||||
crumbs_dialog.destroy()
|
||||
dialog.destroy()
|
||||
return
|
||||
|
||||
# get the full path of image
|
||||
image_path = os.path.join(dialog.image_folder, dialog.image_names[0])
|
||||
self.deploy_dialog.set_image_text_buffer(image_path)
|
||||
self.deploy_dialog.set_image_path(image_path)
|
||||
|
||||
dialog.destroy()
|
||||
|
||||
def main():
|
||||
parser = optparse.OptionParser(
|
||||
usage = """%prog [-h] [image_file]
|
||||
|
||||
%prog writes bootable images to USB devices. You can
|
||||
provide the image file on the command line or select it using the GUI.""")
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
image_file = args[1] if len(args) > 1 else ''
|
||||
dw = DeployWindow(image_file)
|
||||
|
||||
if __name__ == '__main__':
|
||||
try:
|
||||
main()
|
||||
gtk.main()
|
||||
except Exception:
|
||||
import traceback
|
||||
traceback.print_exc(3)
|
||||
@@ -1,68 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Copyright (C) 2012 Wind River Systems, Inc.
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
#
|
||||
# This is used for dumping the bb_cache.dat, the output format is:
|
||||
# recipe_path PN PV PACKAGES
|
||||
#
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
|
||||
# For importing bb.cache
|
||||
sys.path.insert(0, os.path.join(os.path.abspath(os.path.dirname(sys.argv[0])), '../lib'))
|
||||
from bb.cache import CoreRecipeInfo
|
||||
|
||||
import cPickle as pickle
|
||||
|
||||
def main(argv=None):
|
||||
"""
|
||||
Get the mapping for the target recipe.
|
||||
"""
|
||||
if len(argv) != 1:
|
||||
print >>sys.stderr, "Error, need one argument!"
|
||||
return 2
|
||||
|
||||
cachefile = argv[0]
|
||||
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
while cachefile:
|
||||
try:
|
||||
key = pickled.load()
|
||||
val = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
if isinstance(val, CoreRecipeInfo) and (not val.skipped):
|
||||
pn = val.pn
|
||||
# Filter out the native recipes.
|
||||
if key.startswith('virtual:native:') or pn.endswith("-native"):
|
||||
continue
|
||||
|
||||
# 1.0 is the default version for a no PV recipe.
|
||||
if val.__dict__.has_key("pv"):
|
||||
pv = val.pv
|
||||
else:
|
||||
pv = "1.0"
|
||||
|
||||
print("%s %s %s %s" % (key, pn, pv, ' '.join(val.packages)))
|
||||
|
||||
if __name__ == "__main__":
|
||||
sys.exit(main(sys.argv[1:]))
|
||||
|
||||
@@ -52,8 +52,8 @@ syn match bbExport "^export" nextgroup=bbIdentifier skipwhite
|
||||
syn keyword bbExportFlag export contained nextgroup=bbIdentifier skipwhite
|
||||
syn match bbIdentifier "[a-zA-Z0-9\-_\.\/\+]\+" display contained
|
||||
syn match bbVarDeref "${[a-zA-Z0-9\-_\.\/\+]\+}" contained
|
||||
syn match bbVarEq "\(:=\|+=\|=+\|\.=\|=\.\|?=\|??=\|=\)" contained nextgroup=bbVarValue
|
||||
syn match bbVarDef "^\(export\s*\)\?\([a-zA-Z0-9\-_\.\/\+]\+\(_[${}a-zA-Z0-9\-_\.\/\+]\+\)\?\)\s*\(:=\|+=\|=+\|\.=\|=\.\|?=\|??=\|=\)\@=" contains=bbExportFlag,bbIdentifier,bbVarDeref nextgroup=bbVarEq
|
||||
syn match bbVarEq "\(:=\|+=\|=+\|\.=\|=\.\|?=\|=\)" contained nextgroup=bbVarValue
|
||||
syn match bbVarDef "^\(export\s*\)\?\([a-zA-Z0-9\-_\.\/\+]\+\(_[${}a-zA-Z0-9\-_\.\/\+]\+\)\?\)\s*\(:=\|+=\|=+\|\.=\|=\.\|?=\|=\)\@=" contains=bbExportFlag,bbIdentifier,bbVarDeref nextgroup=bbVarEq
|
||||
syn match bbVarValue ".*$" contained contains=bbString,bbVarDeref,bbVarPyValue
|
||||
syn region bbVarPyValue start=+${@+ skip=+\\$+ excludenl end=+}+ contained contains=@python
|
||||
|
||||
|
||||
@@ -85,6 +85,9 @@ don't execute, just go through the motions
|
||||
.B \-p, \-\-parse-only
|
||||
quit after parsing the BB files (developers only)
|
||||
.TP
|
||||
.B \-d, \-\-disable-psyco
|
||||
disable using the psyco just-in-time compiler (not recommended)
|
||||
.TP
|
||||
.B \-s, \-\-show-versions
|
||||
show current and preferred versions of all packages
|
||||
.TP
|
||||
@@ -103,13 +106,7 @@ Show debug logging for the specified logging domains
|
||||
.TP
|
||||
.B \-P, \-\-profile
|
||||
profile the command and print a report
|
||||
|
||||
.SH ENVIRONMENT VARIABLES
|
||||
bitbake uses the following environment variables to control its
|
||||
operation:
|
||||
.TP
|
||||
.B BITBAKE_UI
|
||||
The bitbake user interface; overridden by the \fB-u\fP commandline option.
|
||||
|
||||
.SH AUTHORS
|
||||
BitBake was written by
|
||||
|
||||
@@ -12,10 +12,9 @@
|
||||
<corpauthor>BitBake Team</corpauthor>
|
||||
</authorgroup>
|
||||
<copyright>
|
||||
<year>2004, 2005, 2006, 2011</year>
|
||||
<year>2004, 2005, 2006</year>
|
||||
<holder>Chris Larson</holder>
|
||||
<holder>Phil Blundell</holder>
|
||||
<holder>Richard Purdie</holder>
|
||||
</copyright>
|
||||
<legalnotice>
|
||||
<para>This work is licensed under the Creative Commons Attribution License. To view a copy of this license, visit <ulink url="http://creativecommons.org/licenses/by/2.5/">http://creativecommons.org/licenses/by/2.5/</ulink> or send a letter to Creative Commons, 559 Nathan Abbott Way, Stanford, California 94305, USA.</para>
|
||||
@@ -27,10 +26,10 @@
|
||||
<title>Overview</title>
|
||||
<para>BitBake is, at its simplest, a tool for executing
|
||||
tasks and managing metadata. As such, its similarities to GNU make and other
|
||||
build tools are readily apparent. It was inspired by Portage, the package management system used by the Gentoo Linux distribution. BitBake is the basis of the <ulink url="http://www.openembedded.org/">OpenEmbedded</ulink> project, which is being used to build and maintain a number of embedded Linux distributions/projects such as Angstrom and the Yocto project.</para>
|
||||
build tools are readily apparent. It was inspired by Portage, the package management system used by the Gentoo Linux distribution. BitBake is the basis of the <ulink url="http://www.openembedded.org/">OpenEmbedded</ulink> project, which is being used to build and maintain a number of embedded Linux distributions, including OpenZaurus and Familiar.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Background and goals</title>
|
||||
<title>Background and Goals</title>
|
||||
<para>Prior to BitBake, no other build tool adequately met
|
||||
the needs of an aspiring embedded Linux distribution. All of the
|
||||
buildsystems used by traditional desktop Linux distributions lacked
|
||||
@@ -38,14 +37,14 @@ important functionality, and none of the ad-hoc
|
||||
<emphasis>buildroot</emphasis> systems, prevalent in the
|
||||
embedded space, were scalable or maintainable.</para>
|
||||
|
||||
<para>Some important original goals for BitBake were:
|
||||
<para>Some important goals for BitBake were:
|
||||
<itemizedlist>
|
||||
<listitem><para>Handle crosscompilation.</para></listitem>
|
||||
<listitem><para>Handle interpackage dependencies (build time on target architecture, build time on native architecture, and runtime).</para></listitem>
|
||||
<listitem><para>Support running any number of tasks within a given package, including, but not limited to, fetching upstream sources, unpacking them, patching them, configuring them, et cetera.</para></listitem>
|
||||
<listitem><para>Must be Linux distribution agnostic (both build and target).</para></listitem>
|
||||
<listitem><para>Must be linux distribution agnostic (both build and target).</para></listitem>
|
||||
<listitem><para>Must be architecture agnostic</para></listitem>
|
||||
<listitem><para>Must support multiple build and target operating systems (including Cygwin, the BSDs, etc).</para></listitem>
|
||||
<listitem><para>Must support multiple build and target operating systems (including cygwin, the BSDs, etc).</para></listitem>
|
||||
<listitem><para>Must be able to be self contained, rather than tightly integrated into the build machine's root filesystem.</para></listitem>
|
||||
<listitem><para>There must be a way to handle conditional metadata (on target architecture, operating system, distribution, machine).</para></listitem>
|
||||
<listitem><para>It must be easy for the person using the tools to supply their own local metadata and packages to operate against.</para></listitem>
|
||||
@@ -54,18 +53,10 @@ between multiple projects using BitBake for their
|
||||
builds.</para></listitem>
|
||||
<listitem><para>Should provide an inheritance mechanism to
|
||||
share common metadata between many packages.</para></listitem>
|
||||
<listitem><para>Et cetera...</para></listitem>
|
||||
</itemizedlist>
|
||||
</para>
|
||||
<para>Over time it has become apparent that some further requirements were necessary:
|
||||
<itemizedlist>
|
||||
<listitem><para>Handle variants of a base recipe (native, sdk, multilib).</para></listitem>
|
||||
<listitem><para>Able to split metadata into layers and allow layers to override each other.</para></listitem>
|
||||
<listitem><para>Allow representation of a given set of input variables to a task as a checksum.</para></listitem>
|
||||
<listitem><para>based on that checksum, allow acceleration of builds with prebuilt components.</para></listitem>
|
||||
</itemizedlist>
|
||||
</para>
|
||||
|
||||
<para>BitBake satisfies all the original requirements and many more with extensions being made to the basic functionality to reflect the additionl requirements. Flexibility and power have always been the priorities. It is highly extensible, supporting embedded Python code and execution of any arbitrary tasks.</para>
|
||||
<para>BitBake satisfies all these and many more. Flexibility and power have always been the priorities. It is highly extensible, supporting embedded Python code and execution of any arbitrary tasks.</para>
|
||||
</section>
|
||||
</chapter>
|
||||
<chapter>
|
||||
@@ -100,13 +91,13 @@ share common metadata between many packages.</para></listitem>
|
||||
<section>
|
||||
<title>Setting a default value (?=)</title>
|
||||
<para><screen><varname>A</varname> ?= "aval"</screen></para>
|
||||
<para>If <varname>A</varname> is set before the above is called, it will retain its previous value. If <varname>A</varname> is unset prior to the above call, <varname>A</varname> will be set to <literal>aval</literal>. Note that this assignment is immediate, so if there are multiple ?= assignments to a single variable, the first of those will be used.</para>
|
||||
<para>If <varname>A</varname> is set before the above is called, it will retain it's previous value. If <varname>A</varname> is unset prior to the above call, <varname>A</varname> will be set to <literal>aval</literal>. Note that this assignment is immediate, so if there are multiple ?= assignments to a single variable, the first of those will be used.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Setting a weak default value (??=)</title>
|
||||
<para><screen><varname>A</varname> ??= "somevalue"
|
||||
<varname>A</varname> ??= "someothervalue"</screen></para>
|
||||
<para>If <varname>A</varname> is set before the above, it will retain that value. If <varname>A</varname> is unset prior to the above, <varname>A</varname> will be set to <literal>someothervalue</literal>. This is a lazy/weak assignment in that the assignment does not occur until the end of the parsing process, so that the last, rather than the first, ??= assignment to a given variable will be used. Any other setting of A using = or ?= will however override the value set with ??=</para>
|
||||
<title>Setting a default value (??=)</title>
|
||||
<para><screen><varname>A</varname> ??= "somevalue"</screen></para>
|
||||
<para><screen><varname>A</varname> ??= "someothervalue"</screen></para>
|
||||
<para>If <varname>A</varname> is set before the above, it will retain that value. If <varname>A</varname> is unset prior to the above, <varname>A</varname> will be set to <literal>someothervalue</literal>. This is a lazy version of ?=, in that the assignment does not occur until the end of the parsing process, so that the last, rather than the first, ??= assignment to a given variable will be used.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Immediate variable expansion (:=)</title>
|
||||
@@ -134,7 +125,7 @@ share common metadata between many packages.</para></listitem>
|
||||
<varname>B</varname> .= "additionaldata"
|
||||
<varname>C</varname> = "cval"
|
||||
<varname>C</varname> =. "test"</screen></para>
|
||||
<para>In this example, <varname>B</varname> is now <literal>bvaladditionaldata</literal> and <varname>C</varname> is <literal>testcval</literal>. In contrast to the above appending and prepending operators, no additional space
|
||||
<para>In this example, <varname>B</varname> is now <literal>bvaladditionaldata</literal> and <varname>C</varname> is <literal>testcval</literal>. In contrast to the above Appending and Prepending operators no additional space
|
||||
will be introduced.</para>
|
||||
</section>
|
||||
<section>
|
||||
@@ -156,12 +147,12 @@ will be introduced.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Inclusion</title>
|
||||
<para>Next, there is the <literal>include</literal> directive, which causes BitBake to parse whatever file you specify, and insert it at that location, which is not unlike <command>make</command>. However, if the path specified on the <literal>include</literal> line is a relative path, BitBake will locate the first one it can find within <envar>BBPATH</envar>.</para>
|
||||
<para>Next, there is the <literal>include</literal> directive, which causes BitBake to parse in whatever file you specify, and insert it at that location, which is not unlike <command>make</command>. However, if the path specified on the <literal>include</literal> line is a relative path, BitBake will locate the first one it can find within <envar>BBPATH</envar>.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Requiring inclusion</title>
|
||||
<title>Requiring Inclusion</title>
|
||||
<para>In contrast to the <literal>include</literal> directive, <literal>require</literal> will
|
||||
raise an ParseError if the file to be included cannot be found. Otherwise it will behave just like the <literal>
|
||||
raise an ParseError if the to be included file can not be found. Otherwise it will behave just like the <literal>
|
||||
include</literal> directive.</para>
|
||||
</section>
|
||||
<section>
|
||||
@@ -180,13 +171,13 @@ include</literal> directive.</para>
|
||||
import time
|
||||
print time.strftime('%Y%m%d', time.gmtime())
|
||||
}</screen></para>
|
||||
<para>This is the similar to the previous, but flags it as Python so that BitBake knows it is Python code.</para>
|
||||
<para>This is the similar to the previous, but flags it as python so that BitBake knows it is python code.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Defining Python functions into the global Python namespace</title>
|
||||
<title>Defining python functions into the global python namespace</title>
|
||||
<para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
|
||||
<para><screen>def get_depends(bb, d):
|
||||
if d.getVar('SOMECONDITION', True):
|
||||
if bb.data.getVar('SOMECONDITION', d, True):
|
||||
return "dependencywithcond"
|
||||
else:
|
||||
return "dependency"
|
||||
@@ -196,45 +187,32 @@ include</literal> directive.</para>
|
||||
<para>This would result in <varname>DEPENDS</varname> containing <literal>dependencywithcond</literal>.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Variable flags</title>
|
||||
<para>Variables can have associated flags which provide a way of tagging extra information onto a variable. Several flags are used internally by BitBake but they can be used externally too if needed. The standard operations mentioned above also work on flags.</para>
|
||||
<title>Variable Flags</title>
|
||||
<para>Variables can have associated flags which provide a way of tagging extra information onto a variable. Several flags are used internally by bitbake but they can be used externally too if needed. The standard operations mentioned above also work on flags.</para>
|
||||
<para><screen><varname>VARIABLE</varname>[<varname>SOMEFLAG</varname>] = "value"</screen></para>
|
||||
<para>In this example, <varname>VARIABLE</varname> has a flag, <varname>SOMEFLAG</varname> which is set to <literal>value</literal>.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Inheritance</title>
|
||||
<para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
|
||||
<para>The <literal>inherit</literal> directive is a means of specifying what classes of functionality your .bb requires. It is a rudimentary form of inheritance. For example, you can easily abstract out the tasks involved in building a package that uses autoconf and automake, and put that into a bbclass for your packages to make use of. A given bbclass is located by searching for classes/filename.bbclass in <envar>BBPATH</envar>, where filename is what you inherited.</para>
|
||||
<para>The <literal>inherit</literal> directive is a means of specifying what classes of functionality your .bb requires. It is a rudimentary form of inheritance. For example, you can easily abstract out the tasks involved in building a package that uses autoconf and automake, and put that into a bbclass for your packages to make use of. A given bbclass is located by searching for classes/filename.oeclass in <envar>BBPATH</envar>, where filename is what you inherited.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Tasks</title>
|
||||
<para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
|
||||
<para>In BitBake, each step that needs to be run for a given .bb is known as a task. There is a command <literal>addtask</literal> to add new tasks (must be a defined Python executable metadata and must start with <quote>do_</quote>) and describe intertask dependencies.</para>
|
||||
<para>In BitBake, each step that needs to be run for a given .bb is known as a task. There is a command <literal>addtask</literal> to add new tasks (must be a defined python executable metadata and must start with <quote>do_</quote>) and describe intertask dependencies.</para>
|
||||
<para><screen>python do_printdate () {
|
||||
import time
|
||||
print time.strftime('%Y%m%d', time.gmtime())
|
||||
}
|
||||
|
||||
addtask printdate before do_build</screen></para>
|
||||
<para>This defines the necessary Python function and adds it as a task which is now a dependency of do_build, the default task. If anyone executes the do_build task, that will result in do_printdate being run first.</para>
|
||||
<para>This defines the necessary python function and adds it as a task which is now a dependency of do_build (the default task). If anyone executes the do_build task, that will result in do_printdate being run first.</para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Task Flags</title>
|
||||
<para>Tasks support a number of flags which control various functionality of the task. These are as follows:</para>
|
||||
<para>'dirs' - directories which should be created before the task runs</para>
|
||||
<para>'cleandirs' - directories which should created before the task runs but should be empty</para>
|
||||
<para>'noexec' - marks the tasks as being empty and no execution required. These are used as dependency placeholders or used when added tasks need to be subsequently disabled.</para>
|
||||
<para>'nostamp' - don't generate a stamp file for a task. This means the task is always rexecuted.</para>
|
||||
<para>'fakeroot' - this task needs to be run in a fakeroot environment, obtained by adding the variables in FAKEROOTENV to the environment.</para>
|
||||
<para>'umask' - the umask to run the task under.</para>
|
||||
<para> For the 'deptask', 'rdeptask', 'depends', 'rdepends' and 'recrdeptask' flags please see the dependencies section.</para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Events</title>
|
||||
<para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
|
||||
<para>BitBake allows installation of event handlers. Events are triggered at certain points during operation, such as the beginning of operation against a given .bb, the start of a given task, task failure, task success, et cetera. The intent is to make it easy to do things like email notification on build failure.</para>
|
||||
<para>BitBake allows to install event handlers. Events are triggered at certain points during operation, such as, the beginning of operation against a given .bb, the start of a given task, task failure, task success, et cetera. The intent was to make it easy to do things like email notifications on build failure.</para>
|
||||
<para><screen>addhandler myclass_eventhandler
|
||||
python myclass_eventhandler() {
|
||||
from bb.event import getName
|
||||
@@ -250,149 +228,85 @@ of the event and the content of the <varname>FILE</varname> variable.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Variants</title>
|
||||
<para>Two BitBake features exist to facilitate the creation of multiple buildable incarnations from a single recipe file.</para>
|
||||
<para>The first is <varname>BBCLASSEXTEND</varname>. This variable is a space separated list of classes used to "extend" the recipe for each variant. As an example, setting <screen>BBCLASSEXTEND = "native"</screen> results in a second incarnation of the current recipe being available. This second incarnation will have the "native" class inherited.</para>
|
||||
<para>The second feature is <varname>BBVERSIONS</varname>. This variable allows a single recipe to build multiple versions of a project from a single recipe file, and allows you to specify conditional metadata (using the <varname>OVERRIDES</varname> mechanism) for a single version, or an optionally named range of versions:</para>
|
||||
<para>Two Bitbake features exist to facilitate the creation of multiple buildable incarnations from a single recipe file.</para>
|
||||
<para>The first is <varname>BBCLASSEXTEND</varname>. This variable is a space separated list of classes to utilize to "extend" the recipe for each variant. As an example, setting <screen>BBCLASSEXTEND = "native"</screen> results in a second incarnation of the current recipe being available. This second incarantion will have the "native" class inherited.</para>
|
||||
<para>The second feature is <varname>BBVERSIONS</varname>. This variable allows a single recipe to be able to build multiple versions of a project from a single recipe file, and allows you to specify conditional metadata (using the <varname>OVERRIDES</varname> mechanism) for a single version, or an optionally named range of versions:</para>
|
||||
<para><screen>BBVERSIONS = "1.0 2.0 git"
|
||||
SRC_URI_git = "git://someurl/somepath.git"</screen></para>
|
||||
<para><screen>BBVERSIONS = "1.0.[0-6]:1.0.0+ \
|
||||
1.0.[7-9]:1.0.7+"
|
||||
SRC_URI_append_1.0.7+ = "file://some_patch_which_the_new_versions_need.patch;patch=1"</screen></para>
|
||||
<para>Note that the name of the range will default to the original version of the recipe, so given OE, a recipe file of foo_1.0.0+.bb will default the name of its versions to 1.0.0+. This is useful, as the range name is not only placed into overrides; it's also made available for the metadata to use in the form of the <varname>BPV</varname> variable, for use in file:// search paths (<varname>FILESPATH</varname>).</para>
|
||||
<para>Note that the name of the range will default to the original version of the recipe, so given OE, a recipe file of foo_1.0.0+.bb will default the name of its versions to 1.0.0+. This is useful, as the range name is not only placed into overrides, it's also made available for the metadata to use in the form of the <varname>BPV</varname> variable, for use in file:// search paths (<varname>FILESPATH</varname>).</para>
|
||||
</section>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Variable interaction: Worked Examples</title>
|
||||
<para>Despite the documentation of the different forms of variable definition above, it can be hard to work out what happens when variable operators are combined. This section documents some common questions people have regarding the way variables interact.</para>
|
||||
|
||||
<section>
|
||||
<title>Override and append ordering</title>
|
||||
|
||||
<para>There is often confusion about which order overrides and the various append operators take effect.</para>
|
||||
|
||||
<para><screen><varname>OVERRIDES</varname> = "foo"
|
||||
<varname>A_foo_append</varname> = "X"</screen></para>
|
||||
<para>In this case, X is unconditionally appended to the variable <varname>A_foo</varname>. Since foo is an override, A_foo would then replace <varname>A</varname>.</para>
|
||||
|
||||
<para><screen><varname>OVERRIDES</varname> = "foo"
|
||||
<varname>A</varname> = "X"
|
||||
<varname>A_append_foo</varname> = "Y"</screen></para>
|
||||
<para>In this case, only when foo is in OVERRIDES, Y is appended to the variable <varname>A</varname> so the value of <varname>A</varname> would become XY (NB: no spaces are appended).</para>
|
||||
|
||||
<para><screen><varname>OVERRIDES</varname> = "foo"
|
||||
<varname>A_foo_append</varname> = "X"
|
||||
<varname>A_foo_append</varname> += "Y"</screen></para>
|
||||
<para>This behaves as per the first case above, but the value of <varname>A</varname> would be "X Y" instead of just "X".</para>
|
||||
|
||||
<para><screen><varname>A</varname> = "1"
|
||||
<varname>A_append</varname> = "2"
|
||||
<varname>A_append</varname> = "3"
|
||||
<varname>A</varname> += "4"
|
||||
<varname>A</varname> .= "5"</screen></para>
|
||||
|
||||
<para>Would ultimately result in <varname>A</varname> taking the value "1 4523" since the _append operator executes at the same time as the expansion of other overrides.</para>
|
||||
|
||||
</section>
|
||||
<section>
|
||||
<title>Key Expansion</title>
|
||||
|
||||
<para>Key expansion happens at the data store finalisation time just before overrides are expanded.</para>
|
||||
|
||||
<para><screen><varname>A${B}</varname> = "X"
|
||||
<varname>B</varname> = "2"
|
||||
<varname>A2</varname> = "Y"</screen></para>
|
||||
<para>So in this case <varname>A2</varname> would take the value of "X".</para>
|
||||
</section>
|
||||
|
||||
</section>
|
||||
<section>
|
||||
<title>Dependency handling</title>
|
||||
<para>BitBake handles dependencies at the task level since to allow for efficient operation with multiple processed executing in parallel. A robust method of specifying task dependencies is therefore needed. </para>
|
||||
<title>Dependency Handling</title>
|
||||
<para>Bitbake 1.7.x onwards works with the metadata at the task level since this is optimal when dealing with multiple threads of execution. A robust method of specifing task dependencies is therefore needed. </para>
|
||||
<section>
|
||||
<title>Dependencies internal to the .bb file</title>
|
||||
<para>Where the dependencies are internal to a given .bb file, the dependencies are handled by the previously detailed addtask directive.</para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Build Dependencies</title>
|
||||
<para>DEPENDS lists build time dependencies. The 'deptask' flag for tasks is used to signify the task of each item listed in DEPENDS which must have completed before that task can be executed.</para>
|
||||
<title>DEPENDS</title>
|
||||
<para>DEPENDS is taken to specify build time dependencies. The 'deptask' flag for tasks is used to signify the task of each DEPENDS which must have completed before that task can be executed.</para>
|
||||
<para><screen>do_configure[deptask] = "do_populate_staging"</screen></para>
|
||||
<para>means the do_populate_staging task of each item in DEPENDS must have completed before do_configure can execute.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Runtime Dependencies</title>
|
||||
<para>The PACKAGES variable lists runtime packages and each of these can have RDEPENDS and RRECOMMENDS runtime dependencies. The 'rdeptask' flag for tasks is used to signify the task of each item runtime dependency which must have completed before that task can be executed.</para>
|
||||
<title>RDEPENDS</title>
|
||||
<para>RDEPENDS is taken to specify runtime dependencies. The 'rdeptask' flag for tasks is used to signify the task of each RDEPENDS which must have completed before that task can be executed.</para>
|
||||
<para><screen>do_package_write[rdeptask] = "do_package"</screen></para>
|
||||
<para>means the do_package task of each item in RDEPENDS must have completed before do_package_write can execute.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Recursive Dependencies</title>
|
||||
<para>These are specified with the 'recrdeptask' flag which is used signify the task(s) of dependencies which must have completed before that task can be executed. It works by looking though the build and runtime dependencies of the current recipe as well as any inter-task dependencies the task has, then adding a dependency on the listed task. It will then recurse through the dependencies of those tasks and so on.</para>
|
||||
<para>It may be desireable to recurse not just through the dependencies of those tasks but through the build and runtime dependencies of dependent tasks too. If that is the case, the taskname itself should be referenced in the task list, e.g. do_a[recrdeptask] = "do_a do_b".</para>
|
||||
<title>Recursive DEPENDS</title>
|
||||
<para>These are specified with the 'recdeptask' flag and is used signify the task(s) of each DEPENDS which must have completed before that task can be executed. It applies recursively so also, the DEPENDS of each item in the original DEPENDS must be met and so on.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Inter task</title>
|
||||
<para>The 'depends' flag for tasks is a more generic form of which allows an interdependency on specific tasks rather than specifying the data in DEPENDS.</para>
|
||||
<title>Recursive RDEPENDS</title>
|
||||
<para>These are specified with the 'recrdeptask' flag and is used signify the task(s) of each RDEPENDS which must have completed before that task can be executed. It applies recursively so also, the RDEPENDS of each item in the original RDEPENDS must be met and so on. It also runs all DEPENDS first too.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Inter Task</title>
|
||||
<para>The 'depends' flag for tasks is a more generic form of which allows an interdependency on specific tasks rather than specifying the data in DEPENDS or RDEPENDS.</para>
|
||||
<para><screen>do_patch[depends] = "quilt-native:do_populate_staging"</screen></para>
|
||||
<para>means the do_populate_staging task of the target quilt-native must have completed before the do_patch can execute.</para>
|
||||
<para>The 'rdepends' flag works in a similar way but takes targets in the runtime namespace instead of the build time dependency namespace.</para>
|
||||
</section>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Parsing</title>
|
||||
<section>
|
||||
<title>Configuration files</title>
|
||||
<para>The first kind of metadata in BitBake is configuration metadata. This metadata is global, and therefore affects <emphasis>all</emphasis> packages and tasks which are executed.</para>
|
||||
<para>BitBake will first search the current working directory for an optional "conf/bblayers.conf" configuration file. This file is expected to contain a BBLAYERS variable which is a space delimited list of 'layer' directories. For each directory in this list, a "conf/layer.conf" file will be searched for and parsed with the LAYERDIR variable being set to the directory where the layer was found. The idea is these files will setup BBPATH and other variables correctly for a given build directory automatically for the user.</para>
|
||||
<para>BitBake will then expect to find 'conf/bitbake.conf' somewhere in the user specified <envar>BBPATH</envar>. That configuration file generally has include directives to pull in any other metadata (generally files specific to architecture, machine, <emphasis>local</emphasis> and so on).</para>
|
||||
<title>Configuration Files</title>
|
||||
<para>The first of the classifications of metadata in BitBake is configuration metadata. This metadata is global, and therefore affects <emphasis>all</emphasis> packages and tasks which are executed.</para>
|
||||
<para>Bitbake will first search the current working directory for an optional "conf/bblayers.conf" configuration file. This file is expected to contain a BBLAYERS variable which is a space delimited list of 'layer' directories. For each directory in this list a "conf/layer.conf" file will be searched for and parsed with the LAYERDIR variable being set to the directory where the layer was found. The idea is these files will setup BBPATH and other variables correctly for a given build directory automatically for the user.</para>
|
||||
<para>Bitbake will then expect to find 'conf/bitbake.conf' somewhere in the user specified <envar>BBPATH</envar>. That configuration file generally has include directives to pull in any other metadata (generally files specific to architecture, machine, <emphasis>local</emphasis> and so on.</para>
|
||||
<para>Only variable definitions and include directives are allowed in .conf files.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Classes</title>
|
||||
<para>BitBake classes are our rudimentary inheritance mechanism. As briefly mentioned in the metadata introduction, they're parsed when an <literal>inherit</literal> directive is encountered, and they are located in classes/ relative to the directories in <envar>BBPATH</envar>.</para>
|
||||
<para>BitBake classes are our rudimentary inheritance mechanism. As briefly mentioned in the metadata introduction, they're parsed when an <literal>inherit</literal> directive is encountered, and they are located in classes/ relative to the dirs in <envar>BBPATH</envar>.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>.bb files</title>
|
||||
<title>.bb Files</title>
|
||||
<para>A BitBake (.bb) file is a logical unit of tasks to be executed. Normally this is a package to be built. Inter-.bb dependencies are obeyed. The files themselves are located via the <varname>BBFILES</varname> variable, which is set to a space separated list of .bb files, and does handle wildcards.</para>
|
||||
</section>
|
||||
</section>
|
||||
</chapter>
|
||||
|
||||
<chapter>
|
||||
<title>File download support</title>
|
||||
<title>File Download support</title>
|
||||
<section>
|
||||
<title>Overview</title>
|
||||
<para>BitBake provides support to download files this procedure is called fetching and it handled by the fetch and fetch2 modules. At this point the original fetch code is considered to be replaced by fetch2 and this manual only related to the fetch2 codebase.</para>
|
||||
|
||||
<para>The SRC_URI is normally used to tell BitBake which files to fetch. The next sections will describe the available fetchers and their options. Each fetcher honors a set of variables and per URI parameters separated by a <quote>;</quote> consisting of a key and a value. The semantics of the variables and parameters are defined by the fetcher. BitBake tries to have consistent semantics between the different fetchers.
|
||||
<para>BitBake provides support to download files this procedure is called fetching. The SRC_URI is normally used to indicate BitBake which files to fetch. The next sections will describe th available fetchers and the options they have. Each Fetcher honors a set of Variables and
|
||||
a per URI parameters separated by a <quote>;</quote> consisting of a key and a value. The semantic of the Variables and Parameters are defined by the Fetcher. BitBakes tries to have a consistent semantic between the different Fetchers.
|
||||
</para>
|
||||
|
||||
<para>The overall fetch process is that first, fetches are attempted from PREMIRRORS. If those don't work, the original SRC_URI is attempted and if that fails, BitBake will fall back to MIRRORS. Cross urls are supported, so its possible to mirror a git repository on an http server as a tarball for example. Some example commonly used mirror definitions are:</para>
|
||||
|
||||
<para><screen><varname>PREMIRRORS</varname> ?= "\
|
||||
bzr://.*/.* http://somemirror.org/sources/ \n \
|
||||
cvs://.*/.* http://somemirror.org/sources/ \n \
|
||||
git://.*/.* http://somemirror.org/sources/ \n \
|
||||
hg://.*/.* http://somemirror.org/sources/ \n \
|
||||
osc://.*/.* http://somemirror.org/sources/ \n \
|
||||
p4://.*/.* http://somemirror.org/sources/ \n \
|
||||
svk://.*/.* http://somemirror.org/sources/ \n \
|
||||
svn://.*/.* http://somemirror.org/sources/ \n"
|
||||
|
||||
<varname>MIRRORS</varname> =+ "\
|
||||
ftp://.*/.* http://somemirror.org/sources/ \n \
|
||||
http://.*/.* http://somemirror.org/sources/ \n \
|
||||
https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
|
||||
<para>Non-local downloaded output is placed into the directory specified by the <varname>DL_DIR</varname>. For non local archive downloads the code can verify sha256 and md5 checksums for the download to ensure the file has been downloaded correctly. These may be specified either in the form <varname>SRC_URI[md5sum]</varname> for the md5 checksum and <varname>SRC_URI[sha256sum]</varname> for the sha256 checksum or as parameters on the SRC_URI such as SRC_URI="http://example.com/foobar.tar.bz2;md5sum=4a8e0f237e961fd7785d19d07fdb994d". If <varname>BB_STRICT_CHECKSUM</varname> is set, any download without a checksum will trigger an error message. In cases where multiple files are listed in SRC_URI, the name parameter is used assign names to the urls and these are then specified in the checksums in the form SRC_URI[name.sha256sum].</para>
|
||||
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Local file fetcher</title>
|
||||
<para>The URN for the local file fetcher is <emphasis>file</emphasis>. The filename can be either absolute or relative. If the filename is relative, <varname>FILESPATH</varname> and failing that <varname>FILESDIR</varname> will be used to find the appropriate relative file. The metadata usually extend these variables to include variations of the values in <varname>OVERRIDES</varname>. Single files and complete directories can be specified.
|
||||
<title>Local File Fetcher</title>
|
||||
<para>The URN for the Local File Fetcher is <emphasis>file</emphasis>. The filename can be either absolute or relative. If the filename is relative <varname>FILESPATH</varname> and <varname>FILESDIR</varname> will be used to find the appropriate relative file depending on the <varname>OVERRIDES</varname>. Single files and complete directories can be specified.
|
||||
<screen><varname>SRC_URI</varname>= "file://relativefile.patch"
|
||||
<varname>SRC_URI</varname>= "file://relativefile.patch;this=ignored"
|
||||
<varname>SRC_URI</varname>= "file:///Users/ich/very_important_software"
|
||||
@@ -401,11 +315,10 @@ https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>CVS fetcher</title>
|
||||
<para>The URN for the CVS fetcher is <emphasis>cvs</emphasis>. This fetcher honors the variables <varname>CVSDIR</varname>, <varname>SRCDATE</varname>, <varname>FETCHCOMMAND_cvs</varname>, <varname>UPDATECOMMAND_cvs</varname>. <varname>DL_DIR</varname> specifies where a temporary checkout is saved. <varname>SRCDATE</varname> specifies which date to use when doing the fetching (the special value of "now" will cause the checkout to be updated on every build). <varname>FETCHCOMMAND</varname> and <varname>UPDATECOMMAND</varname> specify which executables to use for the CVS checkout or update.
|
||||
<title>CVS File Fetcher</title>
|
||||
<para>The URN for the CVS Fetcher is <emphasis>cvs</emphasis>. This Fetcher honors the variables <varname>DL_DIR</varname>, <varname>SRCDATE</varname>, <varname>FETCHCOMMAND_cvs</varname>, <varname>UPDATECOMMAND_cvs</varname>. <varname>DL_DIR</varname> specifies where a temporary checkout is saved, <varname>SRCDATE</varname> specifies which date to use when doing the fetching (the special value of "now" will cause the checkout to be updated on every build), <varname>FETCHCOMMAND</varname> and <varname>UPDATECOMMAND</varname> specify which executables should be used when doing the CVS checkout or update.
|
||||
</para>
|
||||
<para>The supported parameters are <varname>module</varname>, <varname>tag</varname>, <varname>date</varname>, <varname>method</varname>, <varname>localdir</varname>, <varname>rsh</varname> and <varname>scmdata</varname>. The <varname>module</varname> specifies which module to check out, the <varname>tag</varname> describes which CVS TAG should be used for the checkout. By default the TAG is empty. A <varname>date</varname> can be specified to override the SRCDATE of the configuration to checkout a specific date. The special value of "now" will cause the checkout to be updated on every build.<varname>method</varname> is by default <emphasis>pserver</emphasis>. If <emphasis>ext</emphasis> is used the <varname>rsh</varname> parameter will be evaluated and <varname>CVS_RSH</varname> will be set. Finally, <varname>localdir</varname> is used to checkout into a special directory relative to <varname>CVSDIR</varname>.
|
||||
|
||||
<para>The supported Parameters are <varname>module</varname>, <varname>tag</varname>, <varname>date</varname>, <varname>method</varname>, <varname>localdir</varname>, <varname>rsh</varname> and <varname>scmdata</varname>. The <varname>module</varname> specifies which module to check out, the <varname>tag</varname> describes which CVS TAG should be used for the checkout. By default the TAG is empty. A <varname>date</varname> can be specified to override the SRCDATE of the configuration to checkout a specific date. The special value of "now" will cause the checkout to be updated on every build.<varname>method</varname> is by default <emphasis>pserver</emphasis>, if <emphasis>ext</emphasis> is used the <varname>rsh</varname> parameter will be evaluated and <varname>CVS_RSH</varname> will be set. Finally <varname>localdir</varname> is used to checkout into a special directory relative to <varname>CVSDIR</varname>. If <varname>scmdata</varname> is set to <quote>keep</quote>
|
||||
<screen><varname>SRC_URI</varname> = "cvs://CVSROOT;module=mymodule;tag=some-version;method=ext"
|
||||
<varname>SRC_URI</varname> = "cvs://CVSROOT;module=mymodule;date=20060126;localdir=usethat"
|
||||
</screen>
|
||||
@@ -413,22 +326,32 @@ https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>HTTP/FTP fetcher</title>
|
||||
<para>The URNs for the HTTP/FTP fetcher are <emphasis>http</emphasis>, <emphasis>https</emphasis> and <emphasis>ftp</emphasis>. This fetcher honors the variables <varname>FETCHCOMMAND_wget</varname>. <varname>FETCHCOMMAND</varname> contains the command used for fetching. <quote>${URI}</quote> and <quote>${FILES}</quote> will be replaced by the URI and basename of the file to be fetched.
|
||||
<title>HTTP/FTP Fetcher</title>
|
||||
<para>The URNs for the HTTP/FTP are <emphasis>http</emphasis>, <emphasis>https</emphasis> and <emphasis>ftp</emphasis>. This Fetcher honors the variables <varname>DL_DIR</varname>, <varname>FETCHCOMMAND_wget</varname>, <varname>PREMIRRORS</varname>, <varname>MIRRORS</varname>. The <varname>DL_DIR</varname> defines where to store the fetched file, <varname>FETCHCOMMAND</varname> contains the command used for fetching. <quote>${URI}</quote> and <quote>${FILES}</quote> will be replaced by the uri and basename of the to be fetched file. <varname>PREMIRRORS</varname>
|
||||
will be tried first when fetching a file if that fails the actual file will be tried and finally all <varname>MIRRORS</varname> will be tried.
|
||||
</para>
|
||||
<para><screen><varname>SRC_URI</varname> = "http://oe.handhelds.org/not_there.aac"
|
||||
<varname>SRC_URI</varname> = "ftp://oe.handhelds.org/not_there_as_well.aac"
|
||||
<varname>SRC_URI</varname> = "ftp://you@oe.handheld.sorg/home/you/secret.plan"
|
||||
<para>The only supported Parameter is <varname>md5sum</varname>. After a fetch the <varname>md5sum</varname> of the file will be calculated and the two sums will be compared.
|
||||
</para>
|
||||
<para><screen><varname>SRC_URI</varname> = "http://oe.handhelds.org/not_there.aac;md5sum=12343"
|
||||
<varname>SRC_URI</varname> = "ftp://oe.handhelds.org/not_there_as_well.aac;md5sum=1234"
|
||||
<varname>SRC_URI</varname> = "ftp://you@oe.handheld.sorg/home/you/secret.plan;md5sum=1234"
|
||||
</screen></para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>SVN fetcher</title>
|
||||
<para>The URN for the SVN fetcher is <emphasis>svn</emphasis>.
|
||||
<title>SVK Fetcher</title>
|
||||
<para>
|
||||
<emphasis>Currently NOT supported</emphasis>
|
||||
</para>
|
||||
<para>This fetcher honors the variables <varname>FETCHCOMMAND_svn</varname>, <varname>SVNDIR</varname>, <varname>SRCREV</varname>. <varname>FETCHCOMMAND</varname> contains the subversion command. <varname>SRCREV</varname> specifies which revision to use when doing the fetching.
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>SVN Fetcher</title>
|
||||
<para>The URN for the SVN Fetcher is <emphasis>svn</emphasis>.
|
||||
</para>
|
||||
<para>The supported parameters are <varname>proto</varname>, <varname>rev</varname> and <varname>scmdata</varname>. <varname>proto</varname> is the Subversion protocol, <varname>rev</varname> is the Subversion revision. If <varname>scmdata</varname> is set to <quote>keep</quote>, the <quote>.svn</quote> directories will be available during compile-time.
|
||||
<para>This Fetcher honors the variables <varname>FETCHCOMMAND_svn</varname>, <varname>DL_DIR</varname>, <varname>SRCDATE</varname>. <varname>FETCHCOMMAND</varname> contains the subversion command, <varname>DL_DIR</varname> is the directory where tarballs will be saved, <varname>SRCDATE</varname> specifies which date to use when doing the fetching (the special value of "now" will cause the checkout to be updated on every build).
|
||||
</para>
|
||||
<para>The supported Parameters are <varname>proto</varname>, <varname>rev</varname> and <varname>scmdata</varname>. <varname>proto</varname> is the subversion protocol, <varname>rev</varname> is the subversion revision. If <varname>scmdata</varname> is set to <quote>keep</quote>, the <quote>.svn</quote> directories will be available during compile-time.
|
||||
</para>
|
||||
<para><screen><varname>SRC_URI</varname> = "svn://svn.oe.handhelds.org/svn;module=vip;proto=http;rev=667"
|
||||
<varname>SRC_URI</varname> = "svn://svn.oe.handhelds.org/svn/;module=opie;proto=svn+ssh;date=20060126"
|
||||
@@ -436,12 +359,12 @@ https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>GIT fetcher</title>
|
||||
<title>GIT Fetcher</title>
|
||||
<para>The URN for the GIT Fetcher is <emphasis>git</emphasis>.
|
||||
</para>
|
||||
<para>The variable <varname>GITDIR</varname> will be used as the base directory where the git tree is cloned to.
|
||||
<para>The Variables <varname>DL_DIR</varname>, <varname>GITDIR</varname> are used. <varname>DL_DIR</varname> will be used to store the checkedout version. <varname>GITDIR</varname> will be used as the base directory where the git tree is cloned to.
|
||||
</para>
|
||||
<para>The parameters are <emphasis>tag</emphasis>, <emphasis>protocol</emphasis> and <emphasis>scmdata</emphasis>. <emphasis>tag</emphasis> is a Git tag, the default is <quote>master</quote>. <emphasis>protocol</emphasis> is the Git protocol to use and defaults to <quote>git</quote> if a hostname is set, otherwise its <quote>file</quote>. If <emphasis>scmdata</emphasis> is set to <quote>keep</quote>, the <quote>.git</quote> directory will be available during compile-time.
|
||||
<para>The Parameters are <emphasis>tag</emphasis>, <emphasis>protocol</emphasis> and <emphasis>scmdata</emphasis>. <emphasis>tag</emphasis> is a git tag, the default is <quote>master</quote>. <emphasis>protocol</emphasis> is the git protocol to use and defaults to <quote>rsync</quote>. If <emphasis>scmdata</emphasis> is set to <quote>keep</quote>, the <quote>.git</quote> directory will be available during compile-time.
|
||||
</para>
|
||||
<para><screen><varname>SRC_URI</varname> = "git://git.oe.handhelds.org/git/vip.git;tag=version-1"
|
||||
<varname>SRC_URI</varname> = "git://git.oe.handhelds.org/git/vip.git;protocol=http"
|
||||
@@ -452,13 +375,13 @@ https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
|
||||
|
||||
<chapter>
|
||||
<title>The BitBake command</title>
|
||||
<title>The bitbake command</title>
|
||||
<section>
|
||||
<title>Introduction</title>
|
||||
<para>bitbake is the primary command in the system. It facilitates executing tasks in a single .bb file, or executing a given task on a set of multiple .bb files, accounting for interdependencies amongst them.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Usage and syntax</title>
|
||||
<title>Usage and Syntax</title>
|
||||
<para>
|
||||
<screen><prompt>$ </prompt>bitbake --help
|
||||
usage: bitbake [options] [package ...]
|
||||
@@ -494,6 +417,8 @@ options:
|
||||
than once.
|
||||
-n, --dry-run don't execute, just go through the motions
|
||||
-p, --parse-only quit after parsing the BB files (developers only)
|
||||
-d, --disable-psyco disable using the psyco just-in-time compiler (not
|
||||
recommended)
|
||||
-s, --show-versions show current and preferred versions of all packages
|
||||
-e, --environment show the global or per-package environment (this is
|
||||
what used to be bbread)
|
||||
@@ -513,7 +438,7 @@ options:
|
||||
<para>
|
||||
<example>
|
||||
<title>Executing a task against a single .bb</title>
|
||||
<para>Executing tasks for a single file is relatively simple. You specify the file in question, and BitBake parses it and executes the specified task (or <quote>build</quote> by default). It obeys intertask dependencies when doing so.</para>
|
||||
<para>Executing tasks for a single file is relatively simple. You specify the file in question, and bitbake parses it and executes the specified task (or <quote>build</quote> by default). It obeys intertask dependencies when doing so.</para>
|
||||
<para><quote>clean</quote> task:</para>
|
||||
<para><screen><prompt>$ </prompt>bitbake -b blah_1.0.bb -c clean</screen></para>
|
||||
<para><quote>build</quote> task:</para>
|
||||
@@ -523,8 +448,8 @@ options:
|
||||
<para>
|
||||
<example>
|
||||
<title>Executing tasks against a set of .bb files</title>
|
||||
<para>There are a number of additional complexities introduced when one wants to manage multiple .bb files. Clearly there needs to be a way to tell BitBake what files are available, and of those, which we want to execute at this time. There also needs to be a way for each .bb to express its dependencies, both for build time and runtime. There must be a way for the user to express their preferences when multiple .bb's provide the same functionality, or when there are multiple versions of a .bb.</para>
|
||||
<para>The next section, Metadata, outlines how to specify such things.</para>
|
||||
<para>There are a number of additional complexities introduced when one wants to manage multiple .bb files. Clearly there needs to be a way to tell bitbake what files are available, and of those, which we want to execute at this time. There also needs to be a way for each .bb to express its dependencies, both for build time and runtime. There must be a way for the user to express their preferences when multiple .bb's provide the same functionality, or when there are multiple versions of a .bb.</para>
|
||||
<para>The next section, Metadata, outlines how one goes about specifying such things.</para>
|
||||
<para>Note that the bitbake command, when not using --buildfile, accepts a <varname>PROVIDER</varname>, not a filename or anything else. By default, a .bb generally PROVIDES its packagename, packagename-version, and packagename-version-revision.</para>
|
||||
<screen><prompt>$ </prompt>bitbake blah</screen>
|
||||
<screen><prompt>$ </prompt>bitbake blah-1.0</screen>
|
||||
@@ -536,8 +461,8 @@ options:
|
||||
<example>
|
||||
<title>Generating dependency graphs</title>
|
||||
<para>BitBake is able to generate dependency graphs using the dot syntax. These graphs can be converted
|
||||
to images using the <application>dot</application> application from <ulink url="http://www.graphviz.org">Graphviz</ulink>.
|
||||
Two files will be written into the current working directory, <emphasis>depends.dot</emphasis> containing dependency information at the package level and <emphasis>task-depends.dot</emphasis> containing a breakdown of the dependencies at the task level. To stop depending on common depends, one can use the <prompt>-I depend</prompt> to omit these from the graph. This can lead to more readable graphs. This way, <varname>DEPENDS</varname> from inherited classes such as base.bbclass can be removed from the graph.</para>
|
||||
to images using the <application>dot</application> application from <ulink url="http://www.graphviz.org">graphviz</ulink>.
|
||||
Two files will be written into the current working directory, <emphasis>depends.dot</emphasis> containing dependency information at the package level and <emphasis>task-depends.dot</emphasis> containing a breakdown of the dependencies at the task level. To stop depending on common depends one can use the <prompt>-I depend</prompt> to omit these from the graph. This can lead to more readable graphs. E.g. this way <varname>DEPENDS</varname> from inherited classes, e.g. base.bbclass, can be removed from the graph.</para>
|
||||
<screen><prompt>$ </prompt>bitbake -g blah</screen>
|
||||
<screen><prompt>$ </prompt>bitbake -g -I virtual/whatever -I bloom blah</screen>
|
||||
</example>
|
||||
@@ -545,20 +470,20 @@ Two files will be written into the current working directory, <emphasis>depends.
|
||||
</section>
|
||||
<section>
|
||||
<title>Special variables</title>
|
||||
<para>Certain variables affect BitBake operation:</para>
|
||||
<para>Certain variables affect bitbake operation:</para>
|
||||
<section>
|
||||
<title><varname>BB_NUMBER_THREADS</varname></title>
|
||||
<para> The number of threads BitBake should run at once (default: 1).</para>
|
||||
<para> The number of threads bitbake should run at once (default: 1).</para>
|
||||
</section>
|
||||
</section>
|
||||
<section>
|
||||
<title>Metadata</title>
|
||||
<para>As you may have seen in the usage information, or in the information about .bb files, the <varname>BBFILES</varname> variable is how the BitBake tool locates its files. This variable is a space separated list of files that are available, and supports wildcards.
|
||||
<para>As you may have seen in the usage information, or in the information about .bb files, the BBFILES variable is how the bitbake tool locates its files. This variable is a space separated list of files that are available, and supports wildcards.
|
||||
<example>
|
||||
<title>Setting BBFILES</title>
|
||||
<programlisting><varname>BBFILES</varname> = "/path/to/bbfiles/*.bb"</programlisting>
|
||||
</example></para>
|
||||
<para>With regard to dependencies, it expects the .bb to define a <varname>DEPENDS</varname> variable, which contains a space separated list of <quote>package names</quote>, which themselves are the <varname>PN</varname> variable. The <varname>PN</varname> variable is, in general, set to a component of the .bb filename by default.</para>
|
||||
<para>With regard to dependencies, it expects the .bb to define a <varname>DEPENDS</varname> variable, which contains a space separated list of <quote>package names</quote>, which themselves are the <varname>PN</varname> variable. The <varname>PN</varname> variable is, in general, by default, set to a component of the .bb filename.</para>
|
||||
<example>
|
||||
<title>Depending on another .bb</title>
|
||||
<para>a.bb:
|
||||
@@ -571,7 +496,7 @@ DEPENDS += "package-b"</screen>
|
||||
</example>
|
||||
<example>
|
||||
<title>Using PROVIDES</title>
|
||||
<para>This example shows the usage of the <varname>PROVIDES</varname> variable, which allows a given .bb to specify what functionality it provides.</para>
|
||||
<para>This example shows the usage of the PROVIDES variable, which allows a given .bb to specify what functionality it provides.</para>
|
||||
<para>package1.bb:
|
||||
<screen>PROVIDES += "virtual/package"</screen>
|
||||
</para>
|
||||
@@ -581,16 +506,16 @@ DEPENDS += "package-b"</screen>
|
||||
<para>package3.bb:
|
||||
<screen>PROVIDES += "virtual/package"</screen>
|
||||
</para>
|
||||
<para>As you can see, we have two different .bb's that provide the same functionality (virtual/package). Clearly, there needs to be a way for the person running BitBake to control which of those providers gets used. There is, indeed, such a way.</para>
|
||||
<para>As you can see, here there are two different .bb's that provide the same functionality (virtual/package). Clearly, there needs to be a way for the person running bitbake to control which of those providers gets used. There is, indeed, such a way.</para>
|
||||
<para>The following would go into a .conf file, to select package1:
|
||||
<screen>PREFERRED_PROVIDER_virtual/package = "package1"</screen>
|
||||
</para>
|
||||
</example>
|
||||
<example>
|
||||
<title>Specifying version preference</title>
|
||||
<para>When there are multiple <quote>versions</quote> of a given package, BitBake defaults to selecting the most recent version, unless otherwise specified. If the .bb in question has a <varname>DEFAULT_PREFERENCE</varname> set lower than the other .bb's (default is 0), then it will not be selected. This allows the person or persons maintaining the repository of .bb files to specify their preference for the default selected version. In addition, the user can specify their preferred version.</para>
|
||||
<para>When there are multiple <quote>versions</quote> of a given package, bitbake defaults to selecting the most recent version, unless otherwise specified. If the .bb in question has a <varname>DEFAULT_PREFERENCE</varname> set lower than the other .bb's (default is 0), then it will not be selected. This allows the person or persons maintaining the repository of .bb files to specify their preferences for the default selected version. In addition, the user can specify their preferences with regard to version.</para>
|
||||
<para>If the first .bb is named <filename>a_1.1.bb</filename>, then the <varname>PN</varname> variable will be set to <quote>a</quote>, and the <varname>PV</varname> variable will be set to 1.1.</para>
|
||||
<para>If we then have an <filename>a_1.2.bb</filename>, BitBake will choose 1.2 by default. However, if we define the following variable in a .conf that BitBake parses, we can change that.
|
||||
<para>If we then have an <filename>a_1.2.bb</filename>, bitbake will choose 1.2 by default. However, if we define the following variable in a .conf that bitbake parses, we can change that.
|
||||
<screen>PREFERRED_VERSION_a = "1.1"</screen>
|
||||
</para>
|
||||
</example>
|
||||
|
||||
@@ -21,27 +21,15 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
__version__ = "1.17.0"
|
||||
__version__ = "1.11.0"
|
||||
|
||||
import sys
|
||||
if sys.version_info < (2, 6, 0):
|
||||
raise RuntimeError("Sorry, python 2.6.0 or later is required for this version of bitbake")
|
||||
|
||||
|
||||
class BBHandledException(Exception):
|
||||
"""
|
||||
The big dilemma for generic bitbake code is what information to give the user
|
||||
when an exception occurs. Any exception inheriting this base exception class
|
||||
has already provided information to the user via some 'fired' message type such as
|
||||
an explicitly fired event using bb.fire, or a bb.error message. If bitbake
|
||||
encounters an exception derived from this class, no backtrace or other information
|
||||
will be given to the user, its assumed the earlier event provided the relevant information.
|
||||
"""
|
||||
pass
|
||||
|
||||
import os
|
||||
import logging
|
||||
|
||||
import traceback
|
||||
|
||||
class NullHandler(logging.Handler):
|
||||
def emit(self, record):
|
||||
@@ -63,12 +51,15 @@ class BBLogger(Logger):
|
||||
def verbose(self, msg, *args, **kwargs):
|
||||
return self.log(logging.INFO - 1, msg, *args, **kwargs)
|
||||
|
||||
def exception(self, msg, *args, **kwargs):
|
||||
return self.critical("%s\n%s" % (msg, traceback.format_exc()), *args, **kwargs)
|
||||
|
||||
logging.raiseExceptions = False
|
||||
logging.setLoggerClass(BBLogger)
|
||||
|
||||
logger = logging.getLogger("BitBake")
|
||||
logger.addHandler(NullHandler())
|
||||
logger.setLevel(logging.DEBUG - 2)
|
||||
logger.setLevel(logging.INFO)
|
||||
|
||||
# This has to be imported after the setLoggerClass, as the import of bb.msg
|
||||
# can result in construction of the various loggers.
|
||||
@@ -79,18 +70,15 @@ if "BBDEBUG" in os.environ:
|
||||
if level:
|
||||
bb.msg.set_debug_level(level)
|
||||
|
||||
from bb import fetch2 as fetch
|
||||
sys.modules['bb.fetch'] = sys.modules['bb.fetch2']
|
||||
if True or os.environ.get("BBFETCH2"):
|
||||
from bb import fetch2 as fetch
|
||||
sys.modules['bb.fetch'] = sys.modules['bb.fetch2']
|
||||
|
||||
# Messaging convenience functions
|
||||
def plain(*args):
|
||||
logger.plain(''.join(args))
|
||||
|
||||
def debug(lvl, *args):
|
||||
if isinstance(lvl, basestring):
|
||||
logger.warn("Passed invalid debug level '%s' to bb.debug", lvl)
|
||||
args = (lvl,) + args
|
||||
lvl = 1
|
||||
logger.debug(lvl, ''.join(args))
|
||||
|
||||
def note(*args):
|
||||
@@ -107,7 +95,7 @@ def fatal(*args):
|
||||
sys.exit(1)
|
||||
|
||||
|
||||
def deprecated(func, name=None, advice=""):
|
||||
def deprecated(func, name = None, advice = ""):
|
||||
"""This is a decorator which can be used to mark functions
|
||||
as deprecated. It will result in a warning being emmitted
|
||||
when the function is used."""
|
||||
@@ -121,8 +109,8 @@ def deprecated(func, name=None, advice=""):
|
||||
def newFunc(*args, **kwargs):
|
||||
warnings.warn("Call to deprecated function %s%s." % (name,
|
||||
advice),
|
||||
category=DeprecationWarning,
|
||||
stacklevel=2)
|
||||
category = PendingDeprecationWarning,
|
||||
stacklevel = 2)
|
||||
return func(*args, **kwargs)
|
||||
newFunc.__name__ = func.__name__
|
||||
newFunc.__doc__ = func.__doc__
|
||||
|
||||
@@ -28,12 +28,11 @@
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import shlex
|
||||
import bb
|
||||
import bb.msg
|
||||
import bb.process
|
||||
from contextlib import nested
|
||||
from bb import data, event, utils
|
||||
from bb import data, event, mkdirhier, utils
|
||||
|
||||
bblogger = logging.getLogger('BitBake')
|
||||
logger = logging.getLogger('BitBake.Build')
|
||||
@@ -53,7 +52,7 @@ class FuncFailed(Exception):
|
||||
self.logfile = logfile
|
||||
self.name = name
|
||||
if name:
|
||||
self.msg = 'Function failed: %s' % name
|
||||
self.msg = "Function '%s' failed" % name
|
||||
else:
|
||||
self.msg = "Function failed"
|
||||
|
||||
@@ -70,9 +69,9 @@ class TaskBase(event.Event):
|
||||
|
||||
def __init__(self, t, d ):
|
||||
self._task = t
|
||||
self._package = d.getVar("PF", True)
|
||||
self._package = bb.data.getVar("PF", d, 1)
|
||||
event.Event.__init__(self)
|
||||
self._message = "recipe %s: task %s: %s" % (d.getVar("PF", True), t, self.getDisplayName())
|
||||
self._message = "package %s: task %s: %s" % (bb.data.getVar("PF", d, 1), t, bb.event.getName(self)[4:])
|
||||
|
||||
def getTask(self):
|
||||
return self._task
|
||||
@@ -80,9 +79,6 @@ class TaskBase(event.Event):
|
||||
def setTask(self, task):
|
||||
self._task = task
|
||||
|
||||
def getDisplayName(self):
|
||||
return bb.event.getName(self)[4:]
|
||||
|
||||
task = property(getTask, setTask, None, "task property")
|
||||
|
||||
class TaskStarted(TaskBase):
|
||||
@@ -94,20 +90,9 @@ class TaskSucceeded(TaskBase):
|
||||
class TaskFailed(TaskBase):
|
||||
"""Task execution failed"""
|
||||
|
||||
def __init__(self, task, logfile, metadata, errprinted = False):
|
||||
self.logfile = logfile
|
||||
self.errprinted = errprinted
|
||||
super(TaskFailed, self).__init__(task, metadata)
|
||||
|
||||
class TaskFailedSilent(TaskBase):
|
||||
"""Task execution failed (silently)"""
|
||||
def __init__(self, task, logfile, metadata):
|
||||
self.logfile = logfile
|
||||
super(TaskFailedSilent, self).__init__(task, metadata)
|
||||
|
||||
def getDisplayName(self):
|
||||
# Don't need to tell the user it was silent
|
||||
return "Failed"
|
||||
super(TaskFailed, self).__init__(task, metadata)
|
||||
|
||||
class TaskInvalid(TaskBase):
|
||||
|
||||
@@ -135,8 +120,7 @@ class LogTee(object):
|
||||
|
||||
def __repr__(self):
|
||||
return '<LogTee {0}>'.format(self.name)
|
||||
def flush(self):
|
||||
self.outfile.flush()
|
||||
|
||||
|
||||
def exec_func(func, d, dirs = None):
|
||||
"""Execute an BB 'function'"""
|
||||
@@ -164,9 +148,12 @@ def exec_func(func, d, dirs = None):
|
||||
adir = dirs[-1]
|
||||
else:
|
||||
adir = data.getVar('B', d, 1)
|
||||
bb.utils.mkdirhier(adir)
|
||||
if not os.path.exists(adir):
|
||||
adir = None
|
||||
|
||||
ispython = flags.get('python')
|
||||
if flags.get('fakeroot') and not flags.get('task'):
|
||||
bb.fatal("Function %s specifies fakeroot but isn't a task?!" % func)
|
||||
|
||||
lockflag = flags.get('lockfiles')
|
||||
if lockflag:
|
||||
@@ -175,19 +162,7 @@ def exec_func(func, d, dirs = None):
|
||||
lockfiles = None
|
||||
|
||||
tempdir = data.getVar('T', d, 1)
|
||||
|
||||
# or func allows items to be executed outside of the normal
|
||||
# task set, such as buildhistory
|
||||
task = data.getVar('BB_RUNTASK', d, 1) or func
|
||||
if task == func:
|
||||
taskfunc = task
|
||||
else:
|
||||
taskfunc = "%s.%s" % (task, func)
|
||||
|
||||
runfmt = data.getVar('BB_RUNFMT', d, 1) or "run.{func}.{pid}"
|
||||
runfn = runfmt.format(taskfunc=taskfunc, task=task, func=func, pid=os.getpid())
|
||||
runfile = os.path.join(tempdir, runfn)
|
||||
bb.utils.mkdirhier(os.path.dirname(runfile))
|
||||
runfile = os.path.join(tempdir, 'run.{0}.{1}'.format(func, os.getpid()))
|
||||
|
||||
with bb.utils.fileslocked(lockfiles):
|
||||
if ispython:
|
||||
@@ -206,20 +181,18 @@ def exec_func_python(func, d, runfile, cwd=None):
|
||||
"""Execute a python BB 'function'"""
|
||||
|
||||
bbfile = d.getVar('FILE', True)
|
||||
try:
|
||||
olddir = os.getcwd()
|
||||
except OSError:
|
||||
olddir = None
|
||||
code = _functionfmt.format(function=func, body=d.getVar(func, True))
|
||||
bb.utils.mkdirhier(os.path.dirname(runfile))
|
||||
with open(runfile, 'w') as script:
|
||||
script.write(code)
|
||||
|
||||
if cwd:
|
||||
try:
|
||||
olddir = os.getcwd()
|
||||
except OSError:
|
||||
olddir = None
|
||||
os.chdir(cwd)
|
||||
|
||||
bb.debug(2, "Executing python function %s" % func)
|
||||
|
||||
try:
|
||||
comp = utils.better_compile(code, func, bbfile)
|
||||
utils.better_exec(comp, {"d": d}, code, bbfile)
|
||||
@@ -229,15 +202,10 @@ def exec_func_python(func, d, runfile, cwd=None):
|
||||
|
||||
raise FuncFailed(func, None)
|
||||
finally:
|
||||
bb.debug(2, "Python function %s finished" % func)
|
||||
if olddir:
|
||||
os.chdir(olddir)
|
||||
|
||||
if cwd and olddir:
|
||||
try:
|
||||
os.chdir(olddir)
|
||||
except OSError:
|
||||
pass
|
||||
|
||||
def exec_func_shell(func, d, runfile, cwd=None):
|
||||
def exec_func_shell(function, d, runfile, cwd=None):
|
||||
"""Execute a shell function from the metadata
|
||||
|
||||
Note on directory behavior. The 'dirs' varflag should contain a list
|
||||
@@ -250,36 +218,31 @@ def exec_func_shell(func, d, runfile, cwd=None):
|
||||
|
||||
with open(runfile, 'w') as script:
|
||||
script.write('#!/bin/sh -e\n')
|
||||
data.emit_func(func, script, d)
|
||||
|
||||
if bb.msg.loggerVerboseLogs:
|
||||
if logger.isEnabledFor(logging.DEBUG):
|
||||
script.write("set -x\n")
|
||||
data.emit_func(function, script, d)
|
||||
if cwd:
|
||||
script.write("cd %s\n" % cwd)
|
||||
script.write("%s\n" % func)
|
||||
script.write("%s\n" % function)
|
||||
os.fchmod(script.fileno(), 0775)
|
||||
|
||||
os.chmod(runfile, 0775)
|
||||
env = {
|
||||
'PATH': d.getVar('PATH', True),
|
||||
'LC_ALL': 'C',
|
||||
}
|
||||
|
||||
cmd = runfile
|
||||
if d.getVarFlag(func, 'fakeroot'):
|
||||
fakerootcmd = d.getVar('FAKEROOT', True)
|
||||
if fakerootcmd:
|
||||
cmd = [fakerootcmd, runfile]
|
||||
|
||||
if bb.msg.loggerDefaultVerbose:
|
||||
if logger.isEnabledFor(logging.DEBUG):
|
||||
logfile = LogTee(logger, sys.stdout)
|
||||
else:
|
||||
logfile = sys.stdout
|
||||
|
||||
bb.debug(2, "Executing shell function %s" % func)
|
||||
|
||||
try:
|
||||
bb.process.run(cmd, shell=False, stdin=NULL, log=logfile)
|
||||
bb.process.run(cmd, env=env, shell=False, stdin=NULL, log=logfile)
|
||||
except bb.process.CmdError:
|
||||
logfn = d.getVar('BB_LOGFILE', True)
|
||||
raise FuncFailed(func, logfn)
|
||||
|
||||
bb.debug(2, "Shell function %s finished" % func)
|
||||
raise FuncFailed(function, logfn)
|
||||
|
||||
def _task_data(fn, task, d):
|
||||
localdata = data.createCopy(d)
|
||||
@@ -310,46 +273,22 @@ def _exec_task(fn, task, d, quieterr):
|
||||
bb.fatal("T variable not set, unable to build")
|
||||
|
||||
bb.utils.mkdirhier(tempdir)
|
||||
|
||||
# Determine the logfile to generate
|
||||
logfmt = localdata.getVar('BB_LOGFMT', True) or 'log.{task}.{pid}'
|
||||
logbase = logfmt.format(task=task, pid=os.getpid())
|
||||
|
||||
# Document the order of the tasks...
|
||||
logorder = os.path.join(tempdir, 'log.task_order')
|
||||
try:
|
||||
logorderfile = file(logorder, 'a')
|
||||
except OSError:
|
||||
logger.exception("Opening log file '%s'", logorder)
|
||||
pass
|
||||
logorderfile.write('{0} ({1}): {2}\n'.format(task, os.getpid(), logbase))
|
||||
logorderfile.close()
|
||||
|
||||
# Setup the courtesy link to the logfn
|
||||
loglink = os.path.join(tempdir, 'log.{0}'.format(task))
|
||||
logfn = os.path.join(tempdir, logbase)
|
||||
logfn = os.path.join(tempdir, 'log.{0}.{1}'.format(task, os.getpid()))
|
||||
if loglink:
|
||||
bb.utils.remove(loglink)
|
||||
|
||||
try:
|
||||
os.symlink(logbase, loglink)
|
||||
os.symlink(logfn, loglink)
|
||||
except OSError:
|
||||
pass
|
||||
|
||||
prefuncs = localdata.getVarFlag(task, 'prefuncs', expand=True)
|
||||
postfuncs = localdata.getVarFlag(task, 'postfuncs', expand=True)
|
||||
|
||||
class ErrorCheckHandler(logging.Handler):
|
||||
def __init__(self):
|
||||
self.triggered = False
|
||||
logging.Handler.__init__(self, logging.ERROR)
|
||||
def emit(self, record):
|
||||
self.triggered = True
|
||||
|
||||
# Handle logfiles
|
||||
si = file('/dev/null', 'r')
|
||||
try:
|
||||
bb.utils.mkdirhier(os.path.dirname(logfn))
|
||||
logfile = file(logfn, 'w')
|
||||
except OSError:
|
||||
logger.exception("Opening log file '%s'", logfn)
|
||||
@@ -368,15 +307,9 @@ def _exec_task(fn, task, d, quieterr):
|
||||
# Ensure python logging goes to the logfile
|
||||
handler = logging.StreamHandler(logfile)
|
||||
handler.setFormatter(logformatter)
|
||||
# Always enable full debug output into task logfiles
|
||||
handler.setLevel(logging.DEBUG - 2)
|
||||
bblogger.addHandler(handler)
|
||||
|
||||
errchk = ErrorCheckHandler()
|
||||
bblogger.addHandler(errchk)
|
||||
|
||||
localdata.setVar('BB_LOGFILE', logfn)
|
||||
localdata.setVar('BB_RUNTASK', task)
|
||||
|
||||
event.fire(TaskStarted(task, localdata), localdata)
|
||||
try:
|
||||
@@ -386,12 +319,9 @@ def _exec_task(fn, task, d, quieterr):
|
||||
for func in (postfuncs or '').split():
|
||||
exec_func(func, localdata)
|
||||
except FuncFailed as exc:
|
||||
if quieterr:
|
||||
event.fire(TaskFailedSilent(task, logfn, localdata), localdata)
|
||||
else:
|
||||
errprinted = errchk.triggered
|
||||
if not quieterr:
|
||||
logger.error(str(exc))
|
||||
event.fire(TaskFailed(task, logfn, localdata, errprinted), localdata)
|
||||
event.fire(TaskFailed(task, logfn, localdata), localdata)
|
||||
return 1
|
||||
finally:
|
||||
sys.stdout.flush()
|
||||
@@ -434,7 +364,7 @@ def exec_task(fn, task, d):
|
||||
if not quieterr:
|
||||
logger.error("Build of %s failed" % (task))
|
||||
logger.error(format_exc())
|
||||
failedevent = TaskFailed(task, None, d, True)
|
||||
failedevent = TaskFailed(task, None, d)
|
||||
event.fire(failedevent, d)
|
||||
return 1
|
||||
|
||||
@@ -452,10 +382,10 @@ def stamp_internal(taskname, d, file_name):
|
||||
taskflagname = taskname.replace("_setscene", "")
|
||||
|
||||
if file_name:
|
||||
stamp = d.stamp_base[file_name].get(taskflagname) or d.stamp[file_name]
|
||||
stamp = d.stamp[file_name]
|
||||
extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
|
||||
else:
|
||||
stamp = d.getVarFlag(taskflagname, 'stamp-base', True) or d.getVar('STAMP', True)
|
||||
stamp = d.getVar('STAMP', True)
|
||||
file_name = d.getVar('BB_FILENAME', True)
|
||||
extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
|
||||
|
||||
@@ -464,48 +394,15 @@ def stamp_internal(taskname, d, file_name):
|
||||
|
||||
stamp = bb.parse.siggen.stampfile(stamp, file_name, taskname, extrainfo)
|
||||
|
||||
stampdir = os.path.dirname(stamp)
|
||||
if bb.parse.cached_mtime_noerror(stampdir) == 0:
|
||||
bb.utils.mkdirhier(stampdir)
|
||||
bb.utils.mkdirhier(os.path.dirname(stamp))
|
||||
|
||||
return stamp
|
||||
|
||||
def stamp_cleanmask_internal(taskname, d, file_name):
|
||||
"""
|
||||
Internal stamp helper function to generate stamp cleaning mask
|
||||
Returns the stamp path+filename
|
||||
|
||||
In the bitbake core, d can be a CacheData and file_name will be set.
|
||||
When called in task context, d will be a data store, file_name will not be set
|
||||
"""
|
||||
taskflagname = taskname
|
||||
if taskname.endswith("_setscene") and taskname != "do_setscene":
|
||||
taskflagname = taskname.replace("_setscene", "")
|
||||
|
||||
if file_name:
|
||||
stamp = d.stamp_base_clean[file_name].get(taskflagname) or d.stampclean[file_name]
|
||||
extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
|
||||
else:
|
||||
stamp = d.getVarFlag(taskflagname, 'stamp-base-clean', True) or d.getVar('STAMPCLEAN', True)
|
||||
file_name = d.getVar('BB_FILENAME', True)
|
||||
extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
|
||||
|
||||
if not stamp:
|
||||
return []
|
||||
|
||||
cleanmask = bb.parse.siggen.stampcleanmask(stamp, file_name, taskname, extrainfo)
|
||||
|
||||
return [cleanmask, cleanmask.replace(taskflagname, taskflagname + "_setscene")]
|
||||
|
||||
def make_stamp(task, d, file_name = None):
|
||||
"""
|
||||
Creates/updates a stamp for a given task
|
||||
(d can be a data dict or dataCache)
|
||||
"""
|
||||
cleanmask = stamp_cleanmask_internal(task, d, file_name)
|
||||
for mask in cleanmask:
|
||||
bb.utils.remove(mask)
|
||||
|
||||
stamp = stamp_internal(task, d, file_name)
|
||||
# Remove the file and recreate to force timestamp
|
||||
# change on broken NFS filesystems
|
||||
@@ -514,12 +411,6 @@ def make_stamp(task, d, file_name = None):
|
||||
f = open(stamp, "w")
|
||||
f.close()
|
||||
|
||||
# If we're in task context, write out a signature file for each task
|
||||
# as it completes
|
||||
if not task.endswith("_setscene") and task != "do_setscene" and not file_name:
|
||||
file_name = d.getVar('BB_FILENAME', True)
|
||||
bb.parse.siggen.dump_sigtask(file_name, task, d.getVar('STAMP', True), True)
|
||||
|
||||
def del_stamp(task, d, file_name = None):
|
||||
"""
|
||||
Removes a stamp for a given task
|
||||
@@ -528,24 +419,6 @@ def del_stamp(task, d, file_name = None):
|
||||
stamp = stamp_internal(task, d, file_name)
|
||||
bb.utils.remove(stamp)
|
||||
|
||||
def write_taint(task, d, file_name = None):
|
||||
"""
|
||||
Creates a "taint" file which will force the specified task and its
|
||||
dependents to be re-run the next time by influencing the value of its
|
||||
taskhash.
|
||||
(d can be a data dict or dataCache)
|
||||
"""
|
||||
import uuid
|
||||
if file_name:
|
||||
taintfn = d.stamp[file_name] + '.' + task + '.taint'
|
||||
else:
|
||||
taintfn = d.getVar('STAMP', True) + '.' + task + '.taint'
|
||||
bb.utils.mkdirhier(os.path.dirname(taintfn))
|
||||
# The specific content of the taint file is not really important,
|
||||
# we just need it to be random, so a random UUID is used
|
||||
with open(taintfn, 'w') as taintf:
|
||||
taintf.write(str(uuid.uuid4()))
|
||||
|
||||
def stampfile(taskname, d, file_name = None):
|
||||
"""
|
||||
Return the stamp for a given task
|
||||
@@ -577,14 +450,12 @@ def add_tasks(tasklist, d):
|
||||
deptask = data.expand(flags[name], d)
|
||||
task_deps[name][task] = deptask
|
||||
getTask('depends')
|
||||
getTask('rdepends')
|
||||
getTask('deptask')
|
||||
getTask('rdeptask')
|
||||
getTask('recrdeptask')
|
||||
getTask('nostamp')
|
||||
getTask('fakeroot')
|
||||
getTask('noexec')
|
||||
getTask('umask')
|
||||
task_deps['parents'][task] = []
|
||||
for dep in flags['deps']:
|
||||
dep = data.expand(dep, d)
|
||||
|
||||
@@ -1,12 +1,11 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# BitBake Cache implementation
|
||||
# BitBake 'Event' implementation
|
||||
#
|
||||
# Caching of bitbake variables before task execution
|
||||
|
||||
# Copyright (C) 2006 Richard Purdie
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
|
||||
# but small sections based on code from bin/bitbake:
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
@@ -31,7 +30,8 @@
|
||||
|
||||
import os
|
||||
import logging
|
||||
from collections import defaultdict
|
||||
from collections import defaultdict, namedtuple
|
||||
import bb.data
|
||||
import bb.utils
|
||||
|
||||
logger = logging.getLogger("BitBake.Cache")
|
||||
@@ -43,15 +43,48 @@ except ImportError:
|
||||
logger.info("Importing cPickle failed. "
|
||||
"Falling back to a very slow implementation.")
|
||||
|
||||
__cache_version__ = "145"
|
||||
__cache_version__ = "138"
|
||||
|
||||
def getCacheFile(path, filename, data_hash):
|
||||
return os.path.join(path, filename + "." + data_hash)
|
||||
recipe_fields = (
|
||||
'pn',
|
||||
'pv',
|
||||
'pr',
|
||||
'pe',
|
||||
'defaultpref',
|
||||
'depends',
|
||||
'provides',
|
||||
'task_deps',
|
||||
'stamp',
|
||||
'stamp_extrainfo',
|
||||
'broken',
|
||||
'not_world',
|
||||
'skipped',
|
||||
'timestamp',
|
||||
'packages',
|
||||
'packages_dynamic',
|
||||
'rdepends',
|
||||
'rdepends_pkg',
|
||||
'rprovides',
|
||||
'rprovides_pkg',
|
||||
'rrecommends',
|
||||
'rrecommends_pkg',
|
||||
'nocache',
|
||||
'variants',
|
||||
'file_depends',
|
||||
'tasks',
|
||||
'basetaskhashes',
|
||||
'hashfilename',
|
||||
'inherits',
|
||||
'summary',
|
||||
'license',
|
||||
'section',
|
||||
'fakerootenv',
|
||||
'fakerootdirs'
|
||||
)
|
||||
|
||||
# RecipeInfoCommon defines common data retrieving methods
|
||||
# from meta data for caches. CoreRecipeInfo as well as other
|
||||
# Extra RecipeInfo needs to inherit this class
|
||||
class RecipeInfoCommon(object):
|
||||
|
||||
class RecipeInfo(namedtuple('RecipeInfo', recipe_fields)):
|
||||
__slots__ = ()
|
||||
|
||||
@classmethod
|
||||
def listvar(cls, var, metadata):
|
||||
@@ -76,182 +109,74 @@ class RecipeInfoCommon(object):
|
||||
for task in tasks)
|
||||
|
||||
@classmethod
|
||||
def flaglist(cls, flag, varlist, metadata, squash=False):
|
||||
out_dict = dict((var, metadata.getVarFlag(var, flag, True))
|
||||
def flaglist(cls, flag, varlist, metadata):
|
||||
return dict((var, metadata.getVarFlag(var, flag, True))
|
||||
for var in varlist)
|
||||
if squash:
|
||||
return dict((k,v) for (k,v) in out_dict.iteritems() if v)
|
||||
else:
|
||||
return out_dict
|
||||
|
||||
@classmethod
|
||||
def getvar(cls, var, metadata):
|
||||
return metadata.getVar(var, True) or ''
|
||||
|
||||
|
||||
class CoreRecipeInfo(RecipeInfoCommon):
|
||||
__slots__ = ()
|
||||
|
||||
cachefile = "bb_cache.dat"
|
||||
|
||||
def __init__(self, filename, metadata):
|
||||
self.file_depends = metadata.getVar('__depends', False)
|
||||
self.timestamp = bb.parse.cached_mtime(filename)
|
||||
self.variants = self.listvar('__VARIANTS', metadata) + ['']
|
||||
self.appends = self.listvar('__BBAPPEND', metadata)
|
||||
self.nocache = self.getvar('__BB_DONT_CACHE', metadata)
|
||||
|
||||
self.skipreason = self.getvar('__SKIPPED', metadata)
|
||||
if self.skipreason:
|
||||
self.pn = self.getvar('PN', metadata) or bb.parse.BBHandler.vars_from_file(filename,metadata)[0]
|
||||
self.skipped = True
|
||||
self.provides = self.depvar('PROVIDES', metadata)
|
||||
self.rprovides = self.depvar('RPROVIDES', metadata)
|
||||
return
|
||||
|
||||
self.tasks = metadata.getVar('__BBTASKS', False)
|
||||
|
||||
self.pn = self.getvar('PN', metadata)
|
||||
self.packages = self.listvar('PACKAGES', metadata)
|
||||
if not self.pn in self.packages:
|
||||
self.packages.append(self.pn)
|
||||
|
||||
self.basetaskhashes = self.taskvar('BB_BASEHASH', self.tasks, metadata)
|
||||
self.hashfilename = self.getvar('BB_HASHFILENAME', metadata)
|
||||
|
||||
self.file_depends = metadata.getVar('__depends', False)
|
||||
self.task_deps = metadata.getVar('_task_deps', False) or {'tasks': [], 'parents': {}}
|
||||
|
||||
self.skipped = False
|
||||
self.pe = self.getvar('PE', metadata)
|
||||
self.pv = self.getvar('PV', metadata)
|
||||
self.pr = self.getvar('PR', metadata)
|
||||
self.defaultpref = self.intvar('DEFAULT_PREFERENCE', metadata)
|
||||
self.broken = self.getvar('BROKEN', metadata)
|
||||
self.not_world = self.getvar('EXCLUDE_FROM_WORLD', metadata)
|
||||
self.stamp = self.getvar('STAMP', metadata)
|
||||
self.stampclean = self.getvar('STAMPCLEAN', metadata)
|
||||
self.stamp_base = self.flaglist('stamp-base', self.tasks, metadata)
|
||||
self.stamp_base_clean = self.flaglist('stamp-base-clean', self.tasks, metadata)
|
||||
self.stamp_extrainfo = self.flaglist('stamp-extra-info', self.tasks, metadata)
|
||||
self.file_checksums = self.flaglist('file-checksums', self.tasks, metadata, True)
|
||||
self.packages_dynamic = self.listvar('PACKAGES_DYNAMIC', metadata)
|
||||
self.depends = self.depvar('DEPENDS', metadata)
|
||||
self.provides = self.depvar('PROVIDES', metadata)
|
||||
self.rdepends = self.depvar('RDEPENDS', metadata)
|
||||
self.rprovides = self.depvar('RPROVIDES', metadata)
|
||||
self.rrecommends = self.depvar('RRECOMMENDS', metadata)
|
||||
self.rprovides_pkg = self.pkgvar('RPROVIDES', self.packages, metadata)
|
||||
self.rdepends_pkg = self.pkgvar('RDEPENDS', self.packages, metadata)
|
||||
self.rrecommends_pkg = self.pkgvar('RRECOMMENDS', self.packages, metadata)
|
||||
self.inherits = self.getvar('__inherit_cache', metadata)
|
||||
self.fakerootenv = self.getvar('FAKEROOTENV', metadata)
|
||||
self.fakerootdirs = self.getvar('FAKEROOTDIRS', metadata)
|
||||
self.fakerootnoenv = self.getvar('FAKEROOTNOENV', metadata)
|
||||
@classmethod
|
||||
def make_optional(cls, default=None, **kwargs):
|
||||
"""Construct the namedtuple from the specified keyword arguments,
|
||||
with every value considered optional, using the default value if
|
||||
it was not specified."""
|
||||
for field in cls._fields:
|
||||
kwargs[field] = kwargs.get(field, default)
|
||||
return cls(**kwargs)
|
||||
|
||||
@classmethod
|
||||
def init_cacheData(cls, cachedata):
|
||||
# CacheData in Core RecipeInfo Class
|
||||
cachedata.task_deps = {}
|
||||
cachedata.pkg_fn = {}
|
||||
cachedata.pkg_pn = defaultdict(list)
|
||||
cachedata.pkg_pepvpr = {}
|
||||
cachedata.pkg_dp = {}
|
||||
def from_metadata(cls, filename, metadata):
|
||||
if cls.getvar('__SKIPPED', metadata):
|
||||
return cls.make_optional(skipped=True)
|
||||
|
||||
cachedata.stamp = {}
|
||||
cachedata.stampclean = {}
|
||||
cachedata.stamp_base = {}
|
||||
cachedata.stamp_base_clean = {}
|
||||
cachedata.stamp_extrainfo = {}
|
||||
cachedata.file_checksums = {}
|
||||
cachedata.fn_provides = {}
|
||||
cachedata.pn_provides = defaultdict(list)
|
||||
cachedata.all_depends = []
|
||||
tasks = metadata.getVar('__BBTASKS', False)
|
||||
|
||||
cachedata.deps = defaultdict(list)
|
||||
cachedata.packages = defaultdict(list)
|
||||
cachedata.providers = defaultdict(list)
|
||||
cachedata.rproviders = defaultdict(list)
|
||||
cachedata.packages_dynamic = defaultdict(list)
|
||||
pn = cls.getvar('PN', metadata)
|
||||
packages = cls.listvar('PACKAGES', metadata)
|
||||
if not pn in packages:
|
||||
packages.append(pn)
|
||||
|
||||
cachedata.rundeps = defaultdict(lambda: defaultdict(list))
|
||||
cachedata.runrecs = defaultdict(lambda: defaultdict(list))
|
||||
cachedata.possible_world = []
|
||||
cachedata.universe_target = []
|
||||
cachedata.hashfn = {}
|
||||
return RecipeInfo(
|
||||
tasks = tasks,
|
||||
basetaskhashes = cls.taskvar('BB_BASEHASH', tasks, metadata),
|
||||
hashfilename = cls.getvar('BB_HASHFILENAME', metadata),
|
||||
|
||||
cachedata.basetaskhash = {}
|
||||
cachedata.inherits = {}
|
||||
cachedata.fakerootenv = {}
|
||||
cachedata.fakerootnoenv = {}
|
||||
cachedata.fakerootdirs = {}
|
||||
|
||||
def add_cacheData(self, cachedata, fn):
|
||||
cachedata.task_deps[fn] = self.task_deps
|
||||
cachedata.pkg_fn[fn] = self.pn
|
||||
cachedata.pkg_pn[self.pn].append(fn)
|
||||
cachedata.pkg_pepvpr[fn] = (self.pe, self.pv, self.pr)
|
||||
cachedata.pkg_dp[fn] = self.defaultpref
|
||||
cachedata.stamp[fn] = self.stamp
|
||||
cachedata.stampclean[fn] = self.stampclean
|
||||
cachedata.stamp_base[fn] = self.stamp_base
|
||||
cachedata.stamp_base_clean[fn] = self.stamp_base_clean
|
||||
cachedata.stamp_extrainfo[fn] = self.stamp_extrainfo
|
||||
cachedata.file_checksums[fn] = self.file_checksums
|
||||
|
||||
provides = [self.pn]
|
||||
for provide in self.provides:
|
||||
if provide not in provides:
|
||||
provides.append(provide)
|
||||
cachedata.fn_provides[fn] = provides
|
||||
|
||||
for provide in provides:
|
||||
cachedata.providers[provide].append(fn)
|
||||
if provide not in cachedata.pn_provides[self.pn]:
|
||||
cachedata.pn_provides[self.pn].append(provide)
|
||||
|
||||
for dep in self.depends:
|
||||
if dep not in cachedata.deps[fn]:
|
||||
cachedata.deps[fn].append(dep)
|
||||
if dep not in cachedata.all_depends:
|
||||
cachedata.all_depends.append(dep)
|
||||
|
||||
rprovides = self.rprovides
|
||||
for package in self.packages:
|
||||
cachedata.packages[package].append(fn)
|
||||
rprovides += self.rprovides_pkg[package]
|
||||
|
||||
for rprovide in rprovides:
|
||||
cachedata.rproviders[rprovide].append(fn)
|
||||
|
||||
for package in self.packages_dynamic:
|
||||
cachedata.packages_dynamic[package].append(fn)
|
||||
|
||||
# Build hash of runtime depends and rececommends
|
||||
for package in self.packages + [self.pn]:
|
||||
cachedata.rundeps[fn][package] = list(self.rdepends) + self.rdepends_pkg[package]
|
||||
cachedata.runrecs[fn][package] = list(self.rrecommends) + self.rrecommends_pkg[package]
|
||||
|
||||
# Collect files we may need for possible world-dep
|
||||
# calculations
|
||||
if not self.broken and not self.not_world:
|
||||
cachedata.possible_world.append(fn)
|
||||
|
||||
# create a collection of all targets for sanity checking
|
||||
# tasks, such as upstream versions, license, and tools for
|
||||
# task and image creation.
|
||||
cachedata.universe_target.append(self.pn)
|
||||
|
||||
cachedata.hashfn[fn] = self.hashfilename
|
||||
for task, taskhash in self.basetaskhashes.iteritems():
|
||||
identifier = '%s.%s' % (fn, task)
|
||||
cachedata.basetaskhash[identifier] = taskhash
|
||||
|
||||
cachedata.inherits[fn] = self.inherits
|
||||
cachedata.fakerootenv[fn] = self.fakerootenv
|
||||
cachedata.fakerootnoenv[fn] = self.fakerootnoenv
|
||||
cachedata.fakerootdirs[fn] = self.fakerootdirs
|
||||
file_depends = metadata.getVar('__depends', False),
|
||||
task_deps = metadata.getVar('_task_deps', False) or
|
||||
{'tasks': [], 'parents': {}},
|
||||
variants = cls.listvar('__VARIANTS', metadata) + [''],
|
||||
|
||||
skipped = False,
|
||||
timestamp = bb.parse.cached_mtime(filename),
|
||||
packages = cls.listvar('PACKAGES', metadata),
|
||||
pn = pn,
|
||||
pe = cls.getvar('PE', metadata),
|
||||
pv = cls.getvar('PV', metadata),
|
||||
pr = cls.getvar('PR', metadata),
|
||||
nocache = cls.getvar('__BB_DONT_CACHE', metadata),
|
||||
defaultpref = cls.intvar('DEFAULT_PREFERENCE', metadata),
|
||||
broken = cls.getvar('BROKEN', metadata),
|
||||
not_world = cls.getvar('EXCLUDE_FROM_WORLD', metadata),
|
||||
stamp = cls.getvar('STAMP', metadata),
|
||||
stamp_extrainfo = cls.flaglist('stamp-extra-info', tasks, metadata),
|
||||
packages_dynamic = cls.listvar('PACKAGES_DYNAMIC', metadata),
|
||||
depends = cls.depvar('DEPENDS', metadata),
|
||||
provides = cls.depvar('PROVIDES', metadata),
|
||||
rdepends = cls.depvar('RDEPENDS', metadata),
|
||||
rprovides = cls.depvar('RPROVIDES', metadata),
|
||||
rrecommends = cls.depvar('RRECOMMENDS', metadata),
|
||||
rprovides_pkg = cls.pkgvar('RPROVIDES', packages, metadata),
|
||||
rdepends_pkg = cls.pkgvar('RDEPENDS', packages, metadata),
|
||||
rrecommends_pkg = cls.pkgvar('RRECOMMENDS', packages, metadata),
|
||||
inherits = cls.getvar('__inherit_cache', metadata),
|
||||
summary = cls.getvar('SUMMARY', metadata),
|
||||
license = cls.getvar('LICENSE', metadata),
|
||||
section = cls.getvar('SECTION', metadata),
|
||||
fakerootenv = cls.getvar('FAKEROOTENV', metadata),
|
||||
fakerootdirs = cls.getvar('FAKEROOTDIRS', metadata),
|
||||
)
|
||||
|
||||
|
||||
class Cache(object):
|
||||
@@ -259,19 +184,14 @@ class Cache(object):
|
||||
BitBake Cache implementation
|
||||
"""
|
||||
|
||||
def __init__(self, data, data_hash, caches_array):
|
||||
# Pass caches_array information into Cache Constructor
|
||||
# It will be used in later for deciding whether we
|
||||
# need extra cache file dump/load support
|
||||
self.caches_array = caches_array
|
||||
self.cachedir = data.getVar("CACHE", True)
|
||||
def __init__(self, data):
|
||||
self.cachedir = bb.data.getVar("CACHE", data, True)
|
||||
self.clean = set()
|
||||
self.checked = set()
|
||||
self.depends_cache = {}
|
||||
self.data = None
|
||||
self.data_fn = None
|
||||
self.cacheclean = True
|
||||
self.data_hash = data_hash
|
||||
|
||||
if self.cachedir in [None, '']:
|
||||
self.has_cache = False
|
||||
@@ -280,26 +200,26 @@ class Cache(object):
|
||||
return
|
||||
|
||||
self.has_cache = True
|
||||
self.cachefile = getCacheFile(self.cachedir, "bb_cache.dat", self.data_hash)
|
||||
self.cachefile = os.path.join(self.cachedir, "bb_cache.dat")
|
||||
|
||||
logger.debug(1, "Using cache in '%s'", self.cachedir)
|
||||
bb.utils.mkdirhier(self.cachedir)
|
||||
|
||||
cache_ok = True
|
||||
if self.caches_array:
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
cache_ok = cache_ok and os.path.exists(cachefile)
|
||||
cache_class.init_cacheData(self)
|
||||
if cache_ok:
|
||||
# If any of configuration.data's dependencies are newer than the
|
||||
# cache there isn't even any point in loading it...
|
||||
newest_mtime = 0
|
||||
deps = bb.data.getVar("__base_depends", data)
|
||||
|
||||
old_mtimes = [old_mtime for _, old_mtime in deps]
|
||||
old_mtimes.append(newest_mtime)
|
||||
newest_mtime = max(old_mtimes)
|
||||
|
||||
if bb.parse.cached_mtime_noerror(self.cachefile) >= newest_mtime:
|
||||
self.load_cachefile()
|
||||
elif os.path.isfile(self.cachefile):
|
||||
logger.info("Out of date cache found, rebuilding...")
|
||||
|
||||
def load_cachefile(self):
|
||||
# Firstly, using core cache file information for
|
||||
# valid checking
|
||||
with open(self.cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
try:
|
||||
@@ -316,52 +236,31 @@ class Cache(object):
|
||||
logger.info('Bitbake version mismatch, rebuilding...')
|
||||
return
|
||||
|
||||
cachesize = os.fstat(cachefile.fileno()).st_size
|
||||
bb.event.fire(bb.event.CacheLoadStarted(cachesize), self.data)
|
||||
|
||||
cachesize = 0
|
||||
previous_progress = 0
|
||||
previous_percent = 0
|
||||
previous_percent = 0
|
||||
while cachefile:
|
||||
try:
|
||||
key = pickled.load()
|
||||
value = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
|
||||
# Calculate the correct cachesize of all those cache files
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
cachesize += os.fstat(cachefile.fileno()).st_size
|
||||
self.depends_cache[key] = value
|
||||
|
||||
bb.event.fire(bb.event.CacheLoadStarted(cachesize), self.data)
|
||||
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
while cachefile:
|
||||
try:
|
||||
key = pickled.load()
|
||||
value = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
if self.depends_cache.has_key(key):
|
||||
self.depends_cache[key].append(value)
|
||||
else:
|
||||
self.depends_cache[key] = [value]
|
||||
# only fire events on even percentage boundaries
|
||||
current_progress = cachefile.tell() + previous_progress
|
||||
current_percent = 100 * current_progress / cachesize
|
||||
if current_percent > previous_percent:
|
||||
previous_percent = current_percent
|
||||
bb.event.fire(bb.event.CacheLoadProgress(current_progress, cachesize),
|
||||
self.data)
|
||||
# only fire events on even percentage boundaries
|
||||
current_progress = cachefile.tell()
|
||||
current_percent = 100 * current_progress / cachesize
|
||||
if current_percent > previous_percent:
|
||||
previous_percent = current_percent
|
||||
bb.event.fire(bb.event.CacheLoadProgress(current_progress),
|
||||
self.data)
|
||||
|
||||
previous_progress += current_progress
|
||||
bb.event.fire(bb.event.CacheLoadCompleted(cachesize,
|
||||
len(self.depends_cache)),
|
||||
self.data)
|
||||
|
||||
# Note: depends cache number is corresponding to the parsing file numbers.
|
||||
# The same file has several caches, still regarded as one item in the cache
|
||||
bb.event.fire(bb.event.CacheLoadCompleted(cachesize,
|
||||
len(self.depends_cache)),
|
||||
self.data)
|
||||
|
||||
|
||||
@staticmethod
|
||||
def virtualfn2realfn(virtualfn):
|
||||
"""
|
||||
@@ -371,9 +270,8 @@ class Cache(object):
|
||||
fn = virtualfn
|
||||
cls = ""
|
||||
if virtualfn.startswith('virtual:'):
|
||||
elems = virtualfn.split(':')
|
||||
cls = ":".join(elems[1:-1])
|
||||
fn = elems[-1]
|
||||
cls = virtualfn.split(':', 2)[1]
|
||||
fn = virtualfn.replace('virtual:' + cls + ':', '')
|
||||
return (fn, cls)
|
||||
|
||||
@staticmethod
|
||||
@@ -396,31 +294,24 @@ class Cache(object):
|
||||
|
||||
logger.debug(1, "Parsing %s (full)", fn)
|
||||
|
||||
cfgData.setVar("__ONLYFINALISE", virtual or "default")
|
||||
bb_data = cls.load_bbfile(fn, appends, cfgData)
|
||||
return bb_data[virtual]
|
||||
|
||||
@classmethod
|
||||
def parse(cls, filename, appends, configdata, caches_array):
|
||||
def parse(cls, filename, appends, configdata):
|
||||
"""Parse the specified filename, returning the recipe information"""
|
||||
infos = []
|
||||
datastores = cls.load_bbfile(filename, appends, configdata)
|
||||
depends = []
|
||||
depends = set()
|
||||
for variant, data in sorted(datastores.iteritems(),
|
||||
key=lambda i: i[0],
|
||||
reverse=True):
|
||||
virtualfn = cls.realfn2virtual(filename, variant)
|
||||
depends = depends + (data.getVar("__depends", False) or [])
|
||||
depends |= (data.getVar("__depends", False) or set())
|
||||
if depends and not variant:
|
||||
data.setVar("__depends", depends)
|
||||
|
||||
info_array = []
|
||||
for cache_class in caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
info = cache_class(filename, data)
|
||||
info_array.append(info)
|
||||
infos.append((virtualfn, info_array))
|
||||
|
||||
info = RecipeInfo.from_metadata(filename, data)
|
||||
infos.append((virtualfn, info))
|
||||
return infos
|
||||
|
||||
def load(self, filename, appends, configdata):
|
||||
@@ -431,17 +322,16 @@ class Cache(object):
|
||||
automatically add the information to the cache or to your
|
||||
CacheData. Use the add or add_info method to do so after
|
||||
running this, or use loadData instead."""
|
||||
cached = self.cacheValid(filename, appends)
|
||||
cached = self.cacheValid(filename)
|
||||
if cached:
|
||||
infos = []
|
||||
# info_array item is a list of [CoreRecipeInfo, XXXRecipeInfo]
|
||||
info_array = self.depends_cache[filename]
|
||||
for variant in info_array[0].variants:
|
||||
info = self.depends_cache[filename]
|
||||
for variant in info.variants:
|
||||
virtualfn = self.realfn2virtual(filename, variant)
|
||||
infos.append((virtualfn, self.depends_cache[virtualfn]))
|
||||
else:
|
||||
logger.debug(1, "Parsing %s", filename)
|
||||
return self.parse(filename, appends, configdata, self.caches_array)
|
||||
return self.parse(filename, appends, configdata)
|
||||
|
||||
return cached, infos
|
||||
|
||||
@@ -452,23 +342,23 @@ class Cache(object):
|
||||
skipped, virtuals = 0, 0
|
||||
|
||||
cached, infos = self.load(fn, appends, cfgData)
|
||||
for virtualfn, info_array in infos:
|
||||
if info_array[0].skipped:
|
||||
logger.debug(1, "Skipping %s: %s", virtualfn, info_array[0].skipreason)
|
||||
for virtualfn, info in infos:
|
||||
if info.skipped:
|
||||
logger.debug(1, "Skipping %s", virtualfn)
|
||||
skipped += 1
|
||||
else:
|
||||
self.add_info(virtualfn, info_array, cacheData, not cached)
|
||||
self.add_info(virtualfn, info, cacheData, not cached)
|
||||
virtuals += 1
|
||||
|
||||
return cached, skipped, virtuals
|
||||
|
||||
def cacheValid(self, fn, appends):
|
||||
def cacheValid(self, fn):
|
||||
"""
|
||||
Is the cache valid for fn?
|
||||
Fast version, no timestamps checked.
|
||||
"""
|
||||
if fn not in self.checked:
|
||||
self.cacheValidUpdate(fn, appends)
|
||||
self.cacheValidUpdate(fn)
|
||||
|
||||
# Is cache enabled?
|
||||
if not self.has_cache:
|
||||
@@ -477,7 +367,7 @@ class Cache(object):
|
||||
return True
|
||||
return False
|
||||
|
||||
def cacheValidUpdate(self, fn, appends):
|
||||
def cacheValidUpdate(self, fn):
|
||||
"""
|
||||
Is the cache valid for fn?
|
||||
Make thorough (slower) checks including timestamps.
|
||||
@@ -501,15 +391,15 @@ class Cache(object):
|
||||
self.remove(fn)
|
||||
return False
|
||||
|
||||
info_array = self.depends_cache[fn]
|
||||
info = self.depends_cache[fn]
|
||||
# Check the file's timestamp
|
||||
if mtime != info_array[0].timestamp:
|
||||
if mtime != info.timestamp:
|
||||
logger.debug(2, "Cache: %s changed", fn)
|
||||
self.remove(fn)
|
||||
return False
|
||||
|
||||
# Check dependencies are still valid
|
||||
depends = info_array[0].file_depends
|
||||
depends = info.file_depends
|
||||
if depends:
|
||||
for f, old_mtime in depends:
|
||||
fmtime = bb.parse.cached_mtime_noerror(f)
|
||||
@@ -526,14 +416,8 @@ class Cache(object):
|
||||
self.remove(fn)
|
||||
return False
|
||||
|
||||
if appends != info_array[0].appends:
|
||||
logger.debug(2, "Cache: appends for %s changed", fn)
|
||||
bb.note("%s to %s" % (str(appends), str(info_array[0].appends)))
|
||||
self.remove(fn)
|
||||
return False
|
||||
|
||||
invalid = False
|
||||
for cls in info_array[0].variants:
|
||||
for cls in info.variants:
|
||||
virtualfn = self.realfn2virtual(fn, cls)
|
||||
self.clean.add(virtualfn)
|
||||
if virtualfn not in self.depends_cache:
|
||||
@@ -542,7 +426,7 @@ class Cache(object):
|
||||
|
||||
# If any one of the variants is not present, mark as invalid for all
|
||||
if invalid:
|
||||
for cls in info_array[0].variants:
|
||||
for cls in info.variants:
|
||||
virtualfn = self.realfn2virtual(fn, cls)
|
||||
if virtualfn in self.clean:
|
||||
logger.debug(2, "Cache: Removing %s from cache", virtualfn)
|
||||
@@ -580,30 +464,13 @@ class Cache(object):
|
||||
logger.debug(2, "Cache is clean, not saving.")
|
||||
return
|
||||
|
||||
file_dict = {}
|
||||
pickler_dict = {}
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cache_class_name = cache_class.__name__
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
file_dict[cache_class_name] = open(cachefile, "wb")
|
||||
pickler_dict[cache_class_name] = pickle.Pickler(file_dict[cache_class_name], pickle.HIGHEST_PROTOCOL)
|
||||
|
||||
pickler_dict['CoreRecipeInfo'].dump(__cache_version__)
|
||||
pickler_dict['CoreRecipeInfo'].dump(bb.__version__)
|
||||
|
||||
try:
|
||||
for key, info_array in self.depends_cache.iteritems():
|
||||
for info in info_array:
|
||||
if isinstance(info, RecipeInfoCommon):
|
||||
cache_class_name = info.__class__.__name__
|
||||
pickler_dict[cache_class_name].dump(key)
|
||||
pickler_dict[cache_class_name].dump(info)
|
||||
finally:
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cache_class_name = cache_class.__name__
|
||||
file_dict[cache_class_name].close()
|
||||
with open(self.cachefile, "wb") as cachefile:
|
||||
pickler = pickle.Pickler(cachefile, pickle.HIGHEST_PROTOCOL)
|
||||
pickler.dump(__cache_version__)
|
||||
pickler.dump(bb.__version__)
|
||||
for key, value in self.depends_cache.iteritems():
|
||||
pickler.dump(key)
|
||||
pickler.dump(value)
|
||||
|
||||
del self.depends_cache
|
||||
|
||||
@@ -611,17 +478,15 @@ class Cache(object):
|
||||
def mtime(cachefile):
|
||||
return bb.parse.cached_mtime_noerror(cachefile)
|
||||
|
||||
def add_info(self, filename, info_array, cacheData, parsed=None):
|
||||
if isinstance(info_array[0], CoreRecipeInfo) and (not info_array[0].skipped):
|
||||
cacheData.add_from_recipeinfo(filename, info_array)
|
||||
|
||||
def add_info(self, filename, info, cacheData, parsed=None):
|
||||
cacheData.add_from_recipeinfo(filename, info)
|
||||
if not self.has_cache:
|
||||
return
|
||||
|
||||
if (info_array[0].skipped or 'SRCREVINACTION' not in info_array[0].pv) and not info_array[0].nocache:
|
||||
if 'SRCREVINACTION' not in info.pv and not info.nocache:
|
||||
if parsed:
|
||||
self.cacheclean = False
|
||||
self.depends_cache[filename] = info_array
|
||||
self.depends_cache[filename] = info
|
||||
|
||||
def add(self, file_name, data, cacheData, parsed=None):
|
||||
"""
|
||||
@@ -629,12 +494,8 @@ class Cache(object):
|
||||
"""
|
||||
|
||||
realfn = self.virtualfn2realfn(file_name)[0]
|
||||
|
||||
info_array = []
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
info_array.append(cache_class(realfn, data))
|
||||
self.add_info(file_name, info_array, cacheData, parsed)
|
||||
info = RecipeInfo.from_metadata(realfn, data)
|
||||
self.add_info(file_name, info, cacheData, parsed)
|
||||
|
||||
@staticmethod
|
||||
def load_bbfile(bbfile, appends, config):
|
||||
@@ -690,7 +551,7 @@ def init(cooker):
|
||||
Files causing parsing errors are evicted from the cache.
|
||||
|
||||
"""
|
||||
return Cache(cooker.configuration.data, cooker.configuration.data_hash)
|
||||
return Cache(cooker.configuration.data)
|
||||
|
||||
|
||||
class CacheData(object):
|
||||
@@ -698,134 +559,99 @@ class CacheData(object):
|
||||
The data structures we compile from the cached data
|
||||
"""
|
||||
|
||||
def __init__(self, caches_array):
|
||||
self.caches_array = caches_array
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cache_class.init_cacheData(self)
|
||||
|
||||
def __init__(self):
|
||||
# Direct cache variables
|
||||
self.providers = defaultdict(list)
|
||||
self.rproviders = defaultdict(list)
|
||||
self.packages = defaultdict(list)
|
||||
self.packages_dynamic = defaultdict(list)
|
||||
self.possible_world = []
|
||||
self.pkg_pn = defaultdict(list)
|
||||
self.pkg_fn = {}
|
||||
self.pkg_pepvpr = {}
|
||||
self.pkg_dp = {}
|
||||
self.pn_provides = defaultdict(list)
|
||||
self.fn_provides = {}
|
||||
self.all_depends = []
|
||||
self.deps = defaultdict(list)
|
||||
self.rundeps = defaultdict(lambda: defaultdict(list))
|
||||
self.runrecs = defaultdict(lambda: defaultdict(list))
|
||||
self.task_queues = {}
|
||||
self.task_deps = {}
|
||||
self.stamp = {}
|
||||
self.stamp_extrainfo = {}
|
||||
self.preferred = {}
|
||||
self.tasks = {}
|
||||
self.basetaskhash = {}
|
||||
self.hashfn = {}
|
||||
self.inherits = {}
|
||||
self.summary = {}
|
||||
self.license = {}
|
||||
self.section = {}
|
||||
self.fakerootenv = {}
|
||||
self.fakerootdirs = {}
|
||||
|
||||
# Indirect Cache variables (set elsewhere)
|
||||
self.ignored_dependencies = []
|
||||
self.world_target = set()
|
||||
self.bbfile_priority = {}
|
||||
self.bbfile_config_priorities = []
|
||||
|
||||
def add_from_recipeinfo(self, fn, info_array):
|
||||
for info in info_array:
|
||||
info.add_cacheData(self, fn)
|
||||
def add_from_recipeinfo(self, fn, info):
|
||||
self.task_deps[fn] = info.task_deps
|
||||
self.pkg_fn[fn] = info.pn
|
||||
self.pkg_pn[info.pn].append(fn)
|
||||
self.pkg_pepvpr[fn] = (info.pe, info.pv, info.pr)
|
||||
self.pkg_dp[fn] = info.defaultpref
|
||||
self.stamp[fn] = info.stamp
|
||||
self.stamp_extrainfo[fn] = info.stamp_extrainfo
|
||||
|
||||
provides = [info.pn]
|
||||
for provide in info.provides:
|
||||
if provide not in provides:
|
||||
provides.append(provide)
|
||||
self.fn_provides[fn] = provides
|
||||
|
||||
class MultiProcessCache(object):
|
||||
"""
|
||||
BitBake multi-process cache implementation
|
||||
for provide in provides:
|
||||
self.providers[provide].append(fn)
|
||||
if provide not in self.pn_provides[info.pn]:
|
||||
self.pn_provides[info.pn].append(provide)
|
||||
|
||||
Used by the codeparser & file checksum caches
|
||||
"""
|
||||
for dep in info.depends:
|
||||
if dep not in self.deps[fn]:
|
||||
self.deps[fn].append(dep)
|
||||
if dep not in self.all_depends:
|
||||
self.all_depends.append(dep)
|
||||
|
||||
def __init__(self):
|
||||
self.cachefile = None
|
||||
self.cachedata = self.create_cachedata()
|
||||
self.cachedata_extras = self.create_cachedata()
|
||||
rprovides = info.rprovides
|
||||
for package in info.packages:
|
||||
self.packages[package].append(fn)
|
||||
rprovides += info.rprovides_pkg[package]
|
||||
|
||||
def init_cache(self, d):
|
||||
cachedir = (d.getVar("PERSISTENT_DIR", True) or
|
||||
d.getVar("CACHE", True))
|
||||
if cachedir in [None, '']:
|
||||
return
|
||||
bb.utils.mkdirhier(cachedir)
|
||||
self.cachefile = os.path.join(cachedir, self.__class__.cache_file_name)
|
||||
logger.debug(1, "Using cache in '%s'", self.cachefile)
|
||||
for rprovide in rprovides:
|
||||
self.rproviders[rprovide].append(fn)
|
||||
|
||||
try:
|
||||
p = pickle.Unpickler(file(self.cachefile, "rb"))
|
||||
data, version = p.load()
|
||||
except:
|
||||
return
|
||||
for package in info.packages_dynamic:
|
||||
self.packages_dynamic[package].append(fn)
|
||||
|
||||
if version != self.__class__.CACHE_VERSION:
|
||||
return
|
||||
# Build hash of runtime depends and rececommends
|
||||
for package in info.packages + [info.pn]:
|
||||
self.rundeps[fn][package] = list(info.rdepends) + info.rdepends_pkg[package]
|
||||
self.runrecs[fn][package] = list(info.rrecommends) + info.rrecommends_pkg[package]
|
||||
|
||||
self.cachedata = data
|
||||
# Collect files we may need for possible world-dep
|
||||
# calculations
|
||||
if not info.broken and not info.not_world:
|
||||
self.possible_world.append(fn)
|
||||
|
||||
def internSet(self, items):
|
||||
new = set()
|
||||
for i in items:
|
||||
new.add(intern(i))
|
||||
return new
|
||||
|
||||
def compress_keys(self, data):
|
||||
# Override in subclasses if desired
|
||||
return
|
||||
|
||||
def create_cachedata(self):
|
||||
data = [{}]
|
||||
return data
|
||||
|
||||
def save_extras(self, d):
|
||||
if not self.cachefile:
|
||||
return
|
||||
|
||||
glf = bb.utils.lockfile(self.cachefile + ".lock", shared=True)
|
||||
|
||||
i = os.getpid()
|
||||
lf = None
|
||||
while not lf:
|
||||
lf = bb.utils.lockfile(self.cachefile + ".lock." + str(i), retry=False)
|
||||
if not lf or os.path.exists(self.cachefile + "-" + str(i)):
|
||||
if lf:
|
||||
bb.utils.unlockfile(lf)
|
||||
lf = None
|
||||
i = i + 1
|
||||
continue
|
||||
|
||||
p = pickle.Pickler(file(self.cachefile + "-" + str(i), "wb"), -1)
|
||||
p.dump([self.cachedata_extras, self.__class__.CACHE_VERSION])
|
||||
|
||||
bb.utils.unlockfile(lf)
|
||||
bb.utils.unlockfile(glf)
|
||||
|
||||
def merge_data(self, source, dest):
|
||||
for j in range(0,len(dest)):
|
||||
for h in source[j]:
|
||||
if h not in dest[j]:
|
||||
dest[j][h] = source[j][h]
|
||||
|
||||
def save_merge(self, d):
|
||||
if not self.cachefile:
|
||||
return
|
||||
|
||||
glf = bb.utils.lockfile(self.cachefile + ".lock")
|
||||
|
||||
try:
|
||||
p = pickle.Unpickler(file(self.cachefile, "rb"))
|
||||
data, version = p.load()
|
||||
except (IOError, EOFError):
|
||||
data, version = None, None
|
||||
|
||||
if version != self.__class__.CACHE_VERSION:
|
||||
data = self.create_cachedata()
|
||||
|
||||
for f in [y for y in os.listdir(os.path.dirname(self.cachefile)) if y.startswith(os.path.basename(self.cachefile) + '-')]:
|
||||
f = os.path.join(os.path.dirname(self.cachefile), f)
|
||||
try:
|
||||
p = pickle.Unpickler(file(f, "rb"))
|
||||
extradata, version = p.load()
|
||||
except (IOError, EOFError):
|
||||
extradata, version = self.create_cachedata(), None
|
||||
|
||||
if version != self.__class__.CACHE_VERSION:
|
||||
continue
|
||||
|
||||
self.merge_data(extradata, data)
|
||||
os.unlink(f)
|
||||
|
||||
self.compress_keys(data)
|
||||
|
||||
p = pickle.Pickler(file(self.cachefile, "wb"), -1)
|
||||
p.dump([data, self.__class__.CACHE_VERSION])
|
||||
|
||||
bb.utils.unlockfile(glf)
|
||||
self.hashfn[fn] = info.hashfilename
|
||||
for task, taskhash in info.basetaskhashes.iteritems():
|
||||
identifier = '%s.%s' % (fn, task)
|
||||
self.basetaskhash[identifier] = taskhash
|
||||
|
||||
self.inherits[fn] = info.inherits
|
||||
self.summary[fn] = info.summary
|
||||
self.license[fn] = info.license
|
||||
self.section[fn] = info.section
|
||||
self.fakerootenv[fn] = info.fakerootenv
|
||||
self.fakerootdirs[fn] = info.fakerootdirs
|
||||
|
||||
@@ -1,57 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Extra RecipeInfo will be all defined in this file. Currently,
|
||||
# Only Hob (Image Creator) Requests some extra fields. So
|
||||
# HobRecipeInfo is defined. It's named HobRecipeInfo because it
|
||||
# is introduced by 'hob'. Users could also introduce other
|
||||
# RecipeInfo or simply use those already defined RecipeInfo.
|
||||
# In the following patch, this newly defined new extra RecipeInfo
|
||||
# will be dynamically loaded and used for loading/saving the extra
|
||||
# cache fields
|
||||
|
||||
# Copyright (C) 2011, Intel Corporation. All rights reserved.
|
||||
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
from bb.cache import RecipeInfoCommon
|
||||
|
||||
class HobRecipeInfo(RecipeInfoCommon):
|
||||
__slots__ = ()
|
||||
|
||||
classname = "HobRecipeInfo"
|
||||
# please override this member with the correct data cache file
|
||||
# such as (bb_cache.dat, bb_extracache_hob.dat)
|
||||
cachefile = "bb_extracache_" + classname +".dat"
|
||||
|
||||
def __init__(self, filename, metadata):
|
||||
|
||||
self.summary = self.getvar('SUMMARY', metadata)
|
||||
self.license = self.getvar('LICENSE', metadata)
|
||||
self.section = self.getvar('SECTION', metadata)
|
||||
self.description = self.getvar('DESCRIPTION', metadata)
|
||||
|
||||
@classmethod
|
||||
def init_cacheData(cls, cachedata):
|
||||
# CacheData in Hob RecipeInfo Class
|
||||
cachedata.summary = {}
|
||||
cachedata.license = {}
|
||||
cachedata.section = {}
|
||||
cachedata.description = {}
|
||||
|
||||
def add_cacheData(self, cachedata, fn):
|
||||
cachedata.summary[fn] = self.summary
|
||||
cachedata.license[fn] = self.license
|
||||
cachedata.section[fn] = self.section
|
||||
cachedata.description[fn] = self.description
|
||||
@@ -1,90 +0,0 @@
|
||||
# Local file checksum cache implementation
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import stat
|
||||
import bb.utils
|
||||
import logging
|
||||
from bb.cache import MultiProcessCache
|
||||
|
||||
logger = logging.getLogger("BitBake.Cache")
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
logger.info("Importing cPickle failed. "
|
||||
"Falling back to a very slow implementation.")
|
||||
|
||||
|
||||
# mtime cache (non-persistent)
|
||||
# based upon the assumption that files do not change during bitbake run
|
||||
class FileMtimeCache(object):
|
||||
cache = {}
|
||||
|
||||
def cached_mtime(self, f):
|
||||
if f not in self.cache:
|
||||
self.cache[f] = os.stat(f)[stat.ST_MTIME]
|
||||
return self.cache[f]
|
||||
|
||||
def cached_mtime_noerror(self, f):
|
||||
if f not in self.cache:
|
||||
try:
|
||||
self.cache[f] = os.stat(f)[stat.ST_MTIME]
|
||||
except OSError:
|
||||
return 0
|
||||
return self.cache[f]
|
||||
|
||||
def update_mtime(self, f):
|
||||
self.cache[f] = os.stat(f)[stat.ST_MTIME]
|
||||
return self.cache[f]
|
||||
|
||||
def clear(self):
|
||||
self.cache.clear()
|
||||
|
||||
# Checksum + mtime cache (persistent)
|
||||
class FileChecksumCache(MultiProcessCache):
|
||||
cache_file_name = "local_file_checksum_cache.dat"
|
||||
CACHE_VERSION = 1
|
||||
|
||||
def __init__(self):
|
||||
self.mtime_cache = FileMtimeCache()
|
||||
MultiProcessCache.__init__(self)
|
||||
|
||||
def get_checksum(self, f):
|
||||
entry = self.cachedata[0].get(f)
|
||||
cmtime = self.mtime_cache.cached_mtime(f)
|
||||
if entry:
|
||||
(mtime, hashval) = entry
|
||||
if cmtime == mtime:
|
||||
return hashval
|
||||
else:
|
||||
bb.debug(2, "file %s changed mtime, recompute checksum" % f)
|
||||
|
||||
hashval = bb.utils.md5_file(f)
|
||||
self.cachedata_extras[0][f] = (cmtime, hashval)
|
||||
return hashval
|
||||
|
||||
def merge_data(self, source, dest):
|
||||
for h in source[0]:
|
||||
if h in dest:
|
||||
(smtime, _) = source[0][h]
|
||||
(dmtime, _) = dest[0][h]
|
||||
if smtime > dmtime:
|
||||
dest[0][h] = source[0][h]
|
||||
else:
|
||||
dest[0][h] = source[0][h]
|
||||
@@ -5,10 +5,10 @@ import os.path
|
||||
import bb.utils, bb.data
|
||||
from itertools import chain
|
||||
from pysh import pyshyacc, pyshlex, sherrors
|
||||
from bb.cache import MultiProcessCache
|
||||
|
||||
|
||||
logger = logging.getLogger('BitBake.CodeParser')
|
||||
PARSERCACHE_VERSION = 2
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
@@ -21,176 +21,197 @@ def check_indent(codestr):
|
||||
"""If the code is indented, add a top level piece of code to 'remove' the indentation"""
|
||||
|
||||
i = 0
|
||||
while codestr[i] in ["\n", "\t", " "]:
|
||||
while codestr[i] in ["\n", " ", " "]:
|
||||
i = i + 1
|
||||
|
||||
if i == 0:
|
||||
return codestr
|
||||
|
||||
if codestr[i-1] == "\t" or codestr[i-1] == " ":
|
||||
if codestr[i-1] is " " or codestr[i-1] is " ":
|
||||
return "if 1:\n" + codestr
|
||||
|
||||
return codestr
|
||||
|
||||
pythonparsecache = {}
|
||||
shellparsecache = {}
|
||||
|
||||
class CodeParserCache(MultiProcessCache):
|
||||
cache_file_name = "bb_codeparser.dat"
|
||||
CACHE_VERSION = 2
|
||||
|
||||
def __init__(self):
|
||||
MultiProcessCache.__init__(self)
|
||||
self.pythoncache = self.cachedata[0]
|
||||
self.shellcache = self.cachedata[1]
|
||||
self.pythoncacheextras = self.cachedata_extras[0]
|
||||
self.shellcacheextras = self.cachedata_extras[1]
|
||||
|
||||
def init_cache(self, d):
|
||||
MultiProcessCache.init_cache(self, d)
|
||||
|
||||
# cachedata gets re-assigned in the parent
|
||||
self.pythoncache = self.cachedata[0]
|
||||
self.shellcache = self.cachedata[1]
|
||||
|
||||
def compress_keys(self, data):
|
||||
# When the dicts are originally created, python calls intern() on the set keys
|
||||
# which significantly improves memory usage. Sadly the pickle/unpickle process
|
||||
# doesn't call intern() on the keys and results in the same strings being duplicated
|
||||
# in memory. This also means pickle will save the same string multiple times in
|
||||
# the cache file. By interning the data here, the cache file shrinks dramatically
|
||||
# meaning faster load times and the reloaded cache files also consume much less
|
||||
# memory. This is worth any performance hit from this loops and the use of the
|
||||
# intern() data storage.
|
||||
# Python 3.x may behave better in this area
|
||||
for h in data[0]:
|
||||
data[0][h]["refs"] = self.internSet(data[0][h]["refs"])
|
||||
data[0][h]["execs"] = self.internSet(data[0][h]["execs"])
|
||||
for h in data[1]:
|
||||
data[1][h]["execs"] = self.internSet(data[1][h]["execs"])
|
||||
return
|
||||
|
||||
def create_cachedata(self):
|
||||
data = [{}, {}]
|
||||
return data
|
||||
|
||||
codeparsercache = CodeParserCache()
|
||||
def parser_cachefile(d):
|
||||
cachedir = (bb.data.getVar("PERSISTENT_DIR", d, True) or
|
||||
bb.data.getVar("CACHE", d, True))
|
||||
if cachedir in [None, '']:
|
||||
return None
|
||||
bb.utils.mkdirhier(cachedir)
|
||||
cachefile = os.path.join(cachedir, "bb_codeparser.dat")
|
||||
logger.debug(1, "Using cache in '%s' for codeparser cache", cachefile)
|
||||
return cachefile
|
||||
|
||||
def parser_cache_init(d):
|
||||
codeparsercache.init_cache(d)
|
||||
global pythonparsecache
|
||||
global shellparsecache
|
||||
|
||||
cachefile = parser_cachefile(d)
|
||||
if not cachefile:
|
||||
return
|
||||
|
||||
try:
|
||||
p = pickle.Unpickler(file(cachefile, "rb"))
|
||||
data, version = p.load()
|
||||
except:
|
||||
return
|
||||
|
||||
if version != PARSERCACHE_VERSION:
|
||||
return
|
||||
|
||||
pythonparsecache = data[0]
|
||||
shellparsecache = data[1]
|
||||
|
||||
def parser_cache_save(d):
|
||||
codeparsercache.save_extras(d)
|
||||
cachefile = parser_cachefile(d)
|
||||
if not cachefile:
|
||||
return
|
||||
|
||||
def parser_cache_savemerge(d):
|
||||
codeparsercache.save_merge(d)
|
||||
|
||||
Logger = logging.getLoggerClass()
|
||||
class BufferedLogger(Logger):
|
||||
def __init__(self, name, level=0, target=None):
|
||||
Logger.__init__(self, name)
|
||||
self.setLevel(level)
|
||||
self.buffer = []
|
||||
self.target = target
|
||||
|
||||
def handle(self, record):
|
||||
self.buffer.append(record)
|
||||
|
||||
def flush(self):
|
||||
for record in self.buffer:
|
||||
self.target.handle(record)
|
||||
self.buffer = []
|
||||
p = pickle.Pickler(file(cachefile, "wb"), -1)
|
||||
p.dump([[pythonparsecache, shellparsecache], PARSERCACHE_VERSION])
|
||||
|
||||
class PythonParser():
|
||||
getvars = ("d.getVar", "bb.data.getVar", "data.getVar")
|
||||
execfuncs = ("bb.build.exec_func", "bb.build.exec_task")
|
||||
|
||||
def warn(self, func, arg):
|
||||
"""Warn about calls of bitbake APIs which pass a non-literal
|
||||
argument for the variable name, as we're not able to track such
|
||||
a reference.
|
||||
class ValueVisitor():
|
||||
"""Visitor to traverse a python abstract syntax tree and obtain
|
||||
the variables referenced via bitbake metadata APIs, and the external
|
||||
functions called.
|
||||
"""
|
||||
|
||||
try:
|
||||
funcstr = codegen.to_source(func)
|
||||
argstr = codegen.to_source(arg)
|
||||
except TypeError:
|
||||
self.log.debug(2, 'Failed to convert function and argument to source form')
|
||||
else:
|
||||
self.log.debug(1, self.unhandled_message % (funcstr, argstr))
|
||||
getvars = ("d.getVar", "bb.data.getVar", "data.getVar")
|
||||
expands = ("d.expand", "bb.data.expand", "data.expand")
|
||||
execs = ("bb.build.exec_func", "bb.build.exec_task")
|
||||
|
||||
def visit_Call(self, node):
|
||||
name = self.called_node_name(node.func)
|
||||
if name in self.getvars:
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.var_references.add(node.args[0].s)
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif name in self.execfuncs:
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.var_execs.add(node.args[0].s)
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif name and isinstance(node.func, (ast.Name, ast.Attribute)):
|
||||
self.execs.add(name)
|
||||
@classmethod
|
||||
def _compare_name(cls, strparts, node):
|
||||
"""Given a sequence of strings representing a python name,
|
||||
where the last component is the actual Name and the prior
|
||||
elements are Attribute nodes, determine if the supplied node
|
||||
matches.
|
||||
"""
|
||||
|
||||
def called_node_name(self, node):
|
||||
"""Given a called node, return its original string form"""
|
||||
components = []
|
||||
while node:
|
||||
if not strparts:
|
||||
return True
|
||||
|
||||
current, rest = strparts[0], strparts[1:]
|
||||
if isinstance(node, ast.Attribute):
|
||||
components.append(node.attr)
|
||||
node = node.value
|
||||
if current == node.attr:
|
||||
return cls._compare_name(rest, node.value)
|
||||
elif isinstance(node, ast.Name):
|
||||
components.append(node.id)
|
||||
return '.'.join(reversed(components))
|
||||
if current == node.id:
|
||||
return True
|
||||
return False
|
||||
|
||||
@classmethod
|
||||
def compare_name(cls, value, node):
|
||||
"""Convenience function for the _compare_node method, which
|
||||
can accept a string (which is split by '.' for you), or an
|
||||
iterable of strings, in which case it checks to see if any of
|
||||
them match, similar to isinstance.
|
||||
"""
|
||||
|
||||
if isinstance(value, basestring):
|
||||
return cls._compare_name(tuple(reversed(value.split("."))),
|
||||
node)
|
||||
else:
|
||||
break
|
||||
return any(cls.compare_name(item, node) for item in value)
|
||||
|
||||
def __init__(self, name, log):
|
||||
self.var_references = set()
|
||||
self.var_execs = set()
|
||||
def __init__(self, value):
|
||||
self.var_references = set()
|
||||
self.var_execs = set()
|
||||
self.direct_func_calls = set()
|
||||
self.var_expands = set()
|
||||
self.value = value
|
||||
|
||||
@classmethod
|
||||
def warn(cls, func, arg):
|
||||
"""Warn about calls of bitbake APIs which pass a non-literal
|
||||
argument for the variable name, as we're not able to track such
|
||||
a reference.
|
||||
"""
|
||||
|
||||
try:
|
||||
funcstr = codegen.to_source(func)
|
||||
argstr = codegen.to_source(arg)
|
||||
except TypeError:
|
||||
logger.debug(2, 'Failed to convert function and argument to source form')
|
||||
else:
|
||||
logger.debug(1, "Warning: in call to '%s', argument '%s' is "
|
||||
"not a literal", funcstr, argstr)
|
||||
|
||||
def visit_Call(self, node):
|
||||
if self.compare_name(self.getvars, node.func):
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.var_references.add(node.args[0].s)
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif self.compare_name(self.expands, node.func):
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.warn(node.func, node.args[0])
|
||||
self.var_expands.update(node.args[0].s)
|
||||
elif isinstance(node.args[0], ast.Call) and \
|
||||
self.compare_name(self.getvars, node.args[0].func):
|
||||
pass
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif self.compare_name(self.execs, node.func):
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.var_execs.add(node.args[0].s)
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif isinstance(node.func, ast.Name):
|
||||
self.direct_func_calls.add(node.func.id)
|
||||
elif isinstance(node.func, ast.Attribute):
|
||||
# We must have a qualified name. Therefore we need
|
||||
# to walk the chain of 'Attribute' nodes to determine
|
||||
# the qualification.
|
||||
attr_node = node.func.value
|
||||
identifier = node.func.attr
|
||||
while isinstance(attr_node, ast.Attribute):
|
||||
identifier = attr_node.attr + "." + identifier
|
||||
attr_node = attr_node.value
|
||||
if isinstance(attr_node, ast.Name):
|
||||
identifier = attr_node.id + "." + identifier
|
||||
self.direct_func_calls.add(identifier)
|
||||
|
||||
def __init__(self):
|
||||
#self.funcdefs = set()
|
||||
self.execs = set()
|
||||
#self.external_cmds = set()
|
||||
self.references = set()
|
||||
self.log = BufferedLogger('BitBake.Data.%s' % name, logging.DEBUG, log)
|
||||
|
||||
self.unhandled_message = "in call of %s, argument '%s' is not a string literal"
|
||||
self.unhandled_message = "while parsing %s, %s" % (name, self.unhandled_message)
|
||||
|
||||
def parse_python(self, node):
|
||||
|
||||
h = hash(str(node))
|
||||
|
||||
if h in codeparsercache.pythoncache:
|
||||
self.references = codeparsercache.pythoncache[h]["refs"]
|
||||
self.execs = codeparsercache.pythoncache[h]["execs"]
|
||||
if h in pythonparsecache:
|
||||
self.references = pythonparsecache[h]["refs"]
|
||||
self.execs = pythonparsecache[h]["execs"]
|
||||
return
|
||||
|
||||
if h in codeparsercache.pythoncacheextras:
|
||||
self.references = codeparsercache.pythoncacheextras[h]["refs"]
|
||||
self.execs = codeparsercache.pythoncacheextras[h]["execs"]
|
||||
return
|
||||
|
||||
|
||||
code = compile(check_indent(str(node)), "<string>", "exec",
|
||||
ast.PyCF_ONLY_AST)
|
||||
|
||||
visitor = self.ValueVisitor(code)
|
||||
for n in ast.walk(code):
|
||||
if n.__class__.__name__ == "Call":
|
||||
self.visit_Call(n)
|
||||
visitor.visit_Call(n)
|
||||
|
||||
self.references.update(self.var_references)
|
||||
self.references.update(self.var_execs)
|
||||
self.references.update(visitor.var_references)
|
||||
self.references.update(visitor.var_execs)
|
||||
self.execs = visitor.direct_func_calls
|
||||
|
||||
codeparsercache.pythoncacheextras[h] = {}
|
||||
codeparsercache.pythoncacheextras[h]["refs"] = self.references
|
||||
codeparsercache.pythoncacheextras[h]["execs"] = self.execs
|
||||
pythonparsecache[h] = {}
|
||||
pythonparsecache[h]["refs"] = self.references
|
||||
pythonparsecache[h]["execs"] = self.execs
|
||||
|
||||
class ShellParser():
|
||||
def __init__(self, name, log):
|
||||
def __init__(self):
|
||||
self.funcdefs = set()
|
||||
self.allexecs = set()
|
||||
self.execs = set()
|
||||
self.log = BufferedLogger('BitBake.Data.%s' % name, logging.DEBUG, log)
|
||||
self.unhandled_template = "unable to handle non-literal command '%s'"
|
||||
self.unhandled_template = "while parsing %s, %s" % (name, self.unhandled_template)
|
||||
|
||||
def parse_shell(self, value):
|
||||
"""Parse the supplied shell code in a string, returning the external
|
||||
@@ -199,12 +220,8 @@ class ShellParser():
|
||||
|
||||
h = hash(str(value))
|
||||
|
||||
if h in codeparsercache.shellcache:
|
||||
self.execs = codeparsercache.shellcache[h]["execs"]
|
||||
return self.execs
|
||||
|
||||
if h in codeparsercache.shellcacheextras:
|
||||
self.execs = codeparsercache.shellcacheextras[h]["execs"]
|
||||
if h in shellparsecache:
|
||||
self.execs = shellparsecache[h]["execs"]
|
||||
return self.execs
|
||||
|
||||
try:
|
||||
@@ -216,8 +233,8 @@ class ShellParser():
|
||||
self.process_tokens(token)
|
||||
self.execs = set(cmd for cmd in self.allexecs if cmd not in self.funcdefs)
|
||||
|
||||
codeparsercache.shellcacheextras[h] = {}
|
||||
codeparsercache.shellcacheextras[h]["execs"] = self.execs
|
||||
shellparsecache[h] = {}
|
||||
shellparsecache[h]["execs"] = self.execs
|
||||
|
||||
return self.execs
|
||||
|
||||
@@ -309,7 +326,8 @@ class ShellParser():
|
||||
|
||||
cmd = word[1]
|
||||
if cmd.startswith("$"):
|
||||
self.log.debug(1, self.unhandled_template % cmd)
|
||||
logger.debug(1, "Warning: execution of non-literal "
|
||||
"command '%s'", cmd)
|
||||
elif cmd == "eval":
|
||||
command = " ".join(word for _, word in words[1:])
|
||||
self.parse_shell(command)
|
||||
|
||||
@@ -30,6 +30,11 @@ Commands are queued in a CommandQueue
|
||||
|
||||
import bb.event
|
||||
import bb.cooker
|
||||
import bb.data
|
||||
|
||||
async_cmds = {}
|
||||
sync_cmds = {}
|
||||
|
||||
|
||||
class CommandCompleted(bb.event.Event):
|
||||
pass
|
||||
@@ -44,9 +49,6 @@ class CommandFailed(CommandExit):
|
||||
self.error = message
|
||||
CommandExit.__init__(self, 1)
|
||||
|
||||
class CommandError(Exception):
|
||||
pass
|
||||
|
||||
class Command:
|
||||
"""
|
||||
A queue of asynchronous commands for bitbake
|
||||
@@ -59,26 +61,32 @@ class Command:
|
||||
# FIXME Add lock for this
|
||||
self.currentAsyncCommand = None
|
||||
|
||||
for attr in CommandsSync.__dict__:
|
||||
command = attr[:].lower()
|
||||
method = getattr(CommandsSync, attr)
|
||||
sync_cmds[command] = (method)
|
||||
|
||||
for attr in CommandsAsync.__dict__:
|
||||
command = attr[:].lower()
|
||||
method = getattr(CommandsAsync, attr)
|
||||
async_cmds[command] = (method)
|
||||
|
||||
def runCommand(self, commandline):
|
||||
command = commandline.pop(0)
|
||||
if hasattr(CommandsSync, command):
|
||||
# Can run synchronous commands straight away
|
||||
command_method = getattr(self.cmds_sync, command)
|
||||
try:
|
||||
result = command_method(self, commandline)
|
||||
except CommandError as exc:
|
||||
return None, exc.args[0]
|
||||
except Exception:
|
||||
return None, traceback.format_exc()
|
||||
else:
|
||||
return result, None
|
||||
if self.currentAsyncCommand is not None:
|
||||
return None, "Busy (%s in progress)" % self.currentAsyncCommand[0]
|
||||
if command not in CommandsAsync.__dict__:
|
||||
return None, "No such command"
|
||||
self.currentAsyncCommand = (command, commandline)
|
||||
self.cooker.server_registration_cb(self.cooker.runCommands, self.cooker)
|
||||
return True, None
|
||||
try:
|
||||
command = commandline.pop(0)
|
||||
if command in CommandsSync.__dict__:
|
||||
# Can run synchronous commands straight away
|
||||
return getattr(CommandsSync, command)(self.cmds_sync, self, commandline)
|
||||
if self.currentAsyncCommand is not None:
|
||||
return "Busy (%s in progress)" % self.currentAsyncCommand[0]
|
||||
if command not in CommandsAsync.__dict__:
|
||||
return "No such command"
|
||||
self.currentAsyncCommand = (command, commandline)
|
||||
self.cooker.server.register_idle_function(self.cooker.runCommands, self.cooker)
|
||||
return True
|
||||
except:
|
||||
import traceback
|
||||
return traceback.format_exc()
|
||||
|
||||
def runAsyncCommand(self):
|
||||
try:
|
||||
@@ -105,12 +113,9 @@ class Command:
|
||||
else:
|
||||
self.finishAsyncCommand("Exited with %s" % arg)
|
||||
return False
|
||||
except Exception as exc:
|
||||
except Exception:
|
||||
import traceback
|
||||
if isinstance(exc, bb.BBHandledException):
|
||||
self.finishAsyncCommand("")
|
||||
else:
|
||||
self.finishAsyncCommand(traceback.format_exc())
|
||||
self.finishAsyncCommand(traceback.format_exc())
|
||||
return False
|
||||
|
||||
def finishAsyncCommand(self, msg=None, code=None):
|
||||
@@ -146,11 +151,7 @@ class CommandsSync:
|
||||
"""
|
||||
Get any command parsed from the commandline
|
||||
"""
|
||||
cmd_action = command.cooker.commandlineAction
|
||||
if cmd_action['msg']:
|
||||
raise CommandError(msg)
|
||||
else:
|
||||
return cmd_action['action']
|
||||
return command.cooker.commandlineAction
|
||||
|
||||
def getVariable(self, command, params):
|
||||
"""
|
||||
@@ -161,41 +162,16 @@ class CommandsSync:
|
||||
if len(params) > 1:
|
||||
expand = params[1]
|
||||
|
||||
return command.cooker.configuration.data.getVar(varname, expand)
|
||||
return bb.data.getVar(varname, command.cooker.configuration.data, expand)
|
||||
|
||||
def setVariable(self, command, params):
|
||||
"""
|
||||
Set the value of variable in configuration.data
|
||||
"""
|
||||
varname = params[0]
|
||||
value = str(params[1])
|
||||
command.cooker.configuration.data.setVar(varname, value)
|
||||
value = params[1]
|
||||
bb.data.setVar(varname, value, command.cooker.configuration.data)
|
||||
|
||||
def initCooker(self, command, params):
|
||||
"""
|
||||
Init the cooker to initial state with nothing parsed
|
||||
"""
|
||||
command.cooker.initialize()
|
||||
|
||||
def resetCooker(self, command, params):
|
||||
"""
|
||||
Reset the cooker to its initial state, thus forcing a reparse for
|
||||
any async command that has the needcache property set to True
|
||||
"""
|
||||
command.cooker.reset()
|
||||
|
||||
def getCpuCount(self, command, params):
|
||||
"""
|
||||
Get the CPU count on the bitbake server
|
||||
"""
|
||||
return bb.utils.cpu_count()
|
||||
|
||||
def setConfFilter(self, command, params):
|
||||
"""
|
||||
Set the configuration file parsing filter
|
||||
"""
|
||||
filterfunc = params[0]
|
||||
bb.parse.parse_py.ConfHandler.confFilters.append(filterfunc)
|
||||
|
||||
class CommandsAsync:
|
||||
"""
|
||||
@@ -248,30 +224,14 @@ class CommandsAsync:
|
||||
|
||||
def generateTargetsTree(self, command, params):
|
||||
"""
|
||||
Generate a tree of buildable targets.
|
||||
If klass is provided ensure all recipes that inherit the class are
|
||||
included in the package list.
|
||||
If pkg_list provided use that list (plus any extras brought in by
|
||||
klass) rather than generating a tree for all packages.
|
||||
Generate a tree of all buildable targets.
|
||||
"""
|
||||
klass = params[0]
|
||||
pkg_list = params[1]
|
||||
|
||||
command.cooker.generateTargetsTree(klass, pkg_list)
|
||||
command.cooker.generateTargetsTree(klass)
|
||||
command.finishAsyncCommand()
|
||||
generateTargetsTree.needcache = True
|
||||
|
||||
def findCoreBaseFiles(self, command, params):
|
||||
"""
|
||||
Find certain files in COREBASE directory. i.e. Layers
|
||||
"""
|
||||
subdir = params[0]
|
||||
filename = params[1]
|
||||
|
||||
command.cooker.findCoreBaseFiles(subdir, filename)
|
||||
command.finishAsyncCommand()
|
||||
findCoreBaseFiles.needcache = False
|
||||
|
||||
def findConfigFiles(self, command, params):
|
||||
"""
|
||||
Find config files which provide appropriate values
|
||||
@@ -281,29 +241,7 @@ class CommandsAsync:
|
||||
|
||||
command.cooker.findConfigFiles(varname)
|
||||
command.finishAsyncCommand()
|
||||
findConfigFiles.needcache = False
|
||||
|
||||
def findFilesMatchingInDir(self, command, params):
|
||||
"""
|
||||
Find implementation files matching the specified pattern
|
||||
in the requested subdirectory of a BBPATH
|
||||
"""
|
||||
pattern = params[0]
|
||||
directory = params[1]
|
||||
|
||||
command.cooker.findFilesMatchingInDir(pattern, directory)
|
||||
command.finishAsyncCommand()
|
||||
findFilesMatchingInDir.needcache = False
|
||||
|
||||
def findConfigFilePath(self, command, params):
|
||||
"""
|
||||
Find the path of the requested configuration file
|
||||
"""
|
||||
configfile = params[0]
|
||||
|
||||
command.cooker.findConfigFilePath(configfile)
|
||||
command.finishAsyncCommand()
|
||||
findConfigFilePath.needcache = False
|
||||
findConfigFiles.needcache = True
|
||||
|
||||
def showVersions(self, command, params):
|
||||
"""
|
||||
@@ -343,14 +281,6 @@ class CommandsAsync:
|
||||
command.finishAsyncCommand()
|
||||
parseFiles.needcache = True
|
||||
|
||||
def reparseFiles(self, command, params):
|
||||
"""
|
||||
Reparse .bb files
|
||||
"""
|
||||
command.cooker.reparseFiles()
|
||||
command.finishAsyncCommand()
|
||||
reparseFiles.needcache = True
|
||||
|
||||
def compareRevisions(self, command, params):
|
||||
"""
|
||||
Parse the .bb files
|
||||
@@ -360,23 +290,3 @@ class CommandsAsync:
|
||||
else:
|
||||
command.finishAsyncCommand()
|
||||
compareRevisions.needcache = True
|
||||
|
||||
def parseConfigurationFiles(self, command, params):
|
||||
"""
|
||||
Parse the configuration files
|
||||
"""
|
||||
prefiles = params[0]
|
||||
postfiles = params[1]
|
||||
command.cooker.parseConfigurationFiles(prefiles, postfiles)
|
||||
command.finishAsyncCommand()
|
||||
parseConfigurationFiles.needcache = False
|
||||
|
||||
def triggerEvent(self, command, params):
|
||||
"""
|
||||
Trigger a certain event
|
||||
"""
|
||||
event = params[0]
|
||||
bb.event.fire(eval(event), command.cooker.configuration.data)
|
||||
command.currentAsyncCommand = None
|
||||
triggerEvent.needcache = False
|
||||
|
||||
|
||||
@@ -1,241 +0,0 @@
|
||||
"""Code pulled from future python versions, here for compatibility"""
|
||||
|
||||
from collections import MutableMapping, KeysView, ValuesView, ItemsView
|
||||
try:
|
||||
from thread import get_ident as _get_ident
|
||||
except ImportError:
|
||||
from dummy_thread import get_ident as _get_ident
|
||||
|
||||
def total_ordering(cls):
|
||||
"""Class decorator that fills in missing ordering methods"""
|
||||
convert = {
|
||||
'__lt__': [('__gt__', lambda self, other: other < self),
|
||||
('__le__', lambda self, other: not other < self),
|
||||
('__ge__', lambda self, other: not self < other)],
|
||||
'__le__': [('__ge__', lambda self, other: other <= self),
|
||||
('__lt__', lambda self, other: not other <= self),
|
||||
('__gt__', lambda self, other: not self <= other)],
|
||||
'__gt__': [('__lt__', lambda self, other: other > self),
|
||||
('__ge__', lambda self, other: not other > self),
|
||||
('__le__', lambda self, other: not self > other)],
|
||||
'__ge__': [('__le__', lambda self, other: other >= self),
|
||||
('__gt__', lambda self, other: not other >= self),
|
||||
('__lt__', lambda self, other: not self >= other)]
|
||||
}
|
||||
roots = set(dir(cls)) & set(convert)
|
||||
if not roots:
|
||||
raise ValueError('must define at least one ordering operation: < > <= >=')
|
||||
root = max(roots) # prefer __lt__ to __le__ to __gt__ to __ge__
|
||||
for opname, opfunc in convert[root]:
|
||||
if opname not in roots:
|
||||
opfunc.__name__ = opname
|
||||
opfunc.__doc__ = getattr(int, opname).__doc__
|
||||
setattr(cls, opname, opfunc)
|
||||
return cls
|
||||
|
||||
class OrderedDict(dict):
|
||||
'Dictionary that remembers insertion order'
|
||||
# An inherited dict maps keys to values.
|
||||
# The inherited dict provides __getitem__, __len__, __contains__, and get.
|
||||
# The remaining methods are order-aware.
|
||||
# Big-O running times for all methods are the same as regular dictionaries.
|
||||
|
||||
# The internal self.__map dict maps keys to links in a doubly linked list.
|
||||
# The circular doubly linked list starts and ends with a sentinel element.
|
||||
# The sentinel element never gets deleted (this simplifies the algorithm).
|
||||
# Each link is stored as a list of length three: [PREV, NEXT, KEY].
|
||||
|
||||
def __init__(self, *args, **kwds):
|
||||
'''Initialize an ordered dictionary. The signature is the same as
|
||||
regular dictionaries, but keyword arguments are not recommended because
|
||||
their insertion order is arbitrary.
|
||||
|
||||
'''
|
||||
if len(args) > 1:
|
||||
raise TypeError('expected at most 1 arguments, got %d' % len(args))
|
||||
try:
|
||||
self.__root
|
||||
except AttributeError:
|
||||
self.__root = root = [] # sentinel node
|
||||
root[:] = [root, root, None]
|
||||
self.__map = {}
|
||||
self.__update(*args, **kwds)
|
||||
|
||||
def __setitem__(self, key, value, PREV=0, NEXT=1, dict_setitem=dict.__setitem__):
|
||||
'od.__setitem__(i, y) <==> od[i]=y'
|
||||
# Setting a new item creates a new link at the end of the linked list,
|
||||
# and the inherited dictionary is updated with the new key/value pair.
|
||||
if key not in self:
|
||||
root = self.__root
|
||||
last = root[PREV]
|
||||
last[NEXT] = root[PREV] = self.__map[key] = [last, root, key]
|
||||
dict_setitem(self, key, value)
|
||||
|
||||
def __delitem__(self, key, PREV=0, NEXT=1, dict_delitem=dict.__delitem__):
|
||||
'od.__delitem__(y) <==> del od[y]'
|
||||
# Deleting an existing item uses self.__map to find the link which gets
|
||||
# removed by updating the links in the predecessor and successor nodes.
|
||||
dict_delitem(self, key)
|
||||
link_prev, link_next, key = self.__map.pop(key)
|
||||
link_prev[NEXT] = link_next
|
||||
link_next[PREV] = link_prev
|
||||
|
||||
def __iter__(self):
|
||||
'od.__iter__() <==> iter(od)'
|
||||
# Traverse the linked list in order.
|
||||
NEXT, KEY = 1, 2
|
||||
root = self.__root
|
||||
curr = root[NEXT]
|
||||
while curr is not root:
|
||||
yield curr[KEY]
|
||||
curr = curr[NEXT]
|
||||
|
||||
def __reversed__(self):
|
||||
'od.__reversed__() <==> reversed(od)'
|
||||
# Traverse the linked list in reverse order.
|
||||
PREV, KEY = 0, 2
|
||||
root = self.__root
|
||||
curr = root[PREV]
|
||||
while curr is not root:
|
||||
yield curr[KEY]
|
||||
curr = curr[PREV]
|
||||
|
||||
def clear(self):
|
||||
'od.clear() -> None. Remove all items from od.'
|
||||
for node in self.__map.itervalues():
|
||||
del node[:]
|
||||
root = self.__root
|
||||
root[:] = [root, root, None]
|
||||
self.__map.clear()
|
||||
dict.clear(self)
|
||||
|
||||
# -- the following methods do not depend on the internal structure --
|
||||
|
||||
def keys(self):
|
||||
'od.keys() -> list of keys in od'
|
||||
return list(self)
|
||||
|
||||
def values(self):
|
||||
'od.values() -> list of values in od'
|
||||
return [self[key] for key in self]
|
||||
|
||||
def items(self):
|
||||
'od.items() -> list of (key, value) pairs in od'
|
||||
return [(key, self[key]) for key in self]
|
||||
|
||||
def iterkeys(self):
|
||||
'od.iterkeys() -> an iterator over the keys in od'
|
||||
return iter(self)
|
||||
|
||||
def itervalues(self):
|
||||
'od.itervalues -> an iterator over the values in od'
|
||||
for k in self:
|
||||
yield self[k]
|
||||
|
||||
def iteritems(self):
|
||||
'od.iteritems -> an iterator over the (key, value) pairs in od'
|
||||
for k in self:
|
||||
yield (k, self[k])
|
||||
|
||||
update = MutableMapping.update
|
||||
|
||||
__update = update # let subclasses override update without breaking __init__
|
||||
|
||||
__marker = object()
|
||||
|
||||
def pop(self, key, default=__marker):
|
||||
'''od.pop(k[,d]) -> v, remove specified key and return the corresponding
|
||||
value. If key is not found, d is returned if given, otherwise KeyError
|
||||
is raised.
|
||||
|
||||
'''
|
||||
if key in self:
|
||||
result = self[key]
|
||||
del self[key]
|
||||
return result
|
||||
if default is self.__marker:
|
||||
raise KeyError(key)
|
||||
return default
|
||||
|
||||
def setdefault(self, key, default=None):
|
||||
'od.setdefault(k[,d]) -> od.get(k,d), also set od[k]=d if k not in od'
|
||||
if key in self:
|
||||
return self[key]
|
||||
self[key] = default
|
||||
return default
|
||||
|
||||
def popitem(self, last=True):
|
||||
'''od.popitem() -> (k, v), return and remove a (key, value) pair.
|
||||
Pairs are returned in LIFO order if last is true or FIFO order if false.
|
||||
|
||||
'''
|
||||
if not self:
|
||||
raise KeyError('dictionary is empty')
|
||||
key = next(reversed(self) if last else iter(self))
|
||||
value = self.pop(key)
|
||||
return key, value
|
||||
|
||||
def __repr__(self, _repr_running={}):
|
||||
'od.__repr__() <==> repr(od)'
|
||||
call_key = id(self), _get_ident()
|
||||
if call_key in _repr_running:
|
||||
return '...'
|
||||
_repr_running[call_key] = 1
|
||||
try:
|
||||
if not self:
|
||||
return '%s()' % (self.__class__.__name__,)
|
||||
return '%s(%r)' % (self.__class__.__name__, self.items())
|
||||
finally:
|
||||
del _repr_running[call_key]
|
||||
|
||||
def __reduce__(self):
|
||||
'Return state information for pickling'
|
||||
items = [[k, self[k]] for k in self]
|
||||
inst_dict = vars(self).copy()
|
||||
for k in vars(OrderedDict()):
|
||||
inst_dict.pop(k, None)
|
||||
if inst_dict:
|
||||
return (self.__class__, (items,), inst_dict)
|
||||
return self.__class__, (items,)
|
||||
|
||||
def copy(self):
|
||||
'od.copy() -> a shallow copy of od'
|
||||
return self.__class__(self)
|
||||
|
||||
@classmethod
|
||||
def fromkeys(cls, iterable, value=None):
|
||||
'''OD.fromkeys(S[, v]) -> New ordered dictionary with keys from S.
|
||||
If not specified, the value defaults to None.
|
||||
|
||||
'''
|
||||
self = cls()
|
||||
for key in iterable:
|
||||
self[key] = value
|
||||
return self
|
||||
|
||||
def __eq__(self, other):
|
||||
'''od.__eq__(y) <==> od==y. Comparison to another OD is order-sensitive
|
||||
while comparison to a regular mapping is order-insensitive.
|
||||
|
||||
'''
|
||||
if isinstance(other, OrderedDict):
|
||||
return len(self)==len(other) and self.items() == other.items()
|
||||
return dict.__eq__(self, other)
|
||||
|
||||
def __ne__(self, other):
|
||||
'od.__ne__(y) <==> od!=y'
|
||||
return not self == other
|
||||
|
||||
# -- the following methods support python 3.x style dictionary views --
|
||||
|
||||
def viewkeys(self):
|
||||
"od.viewkeys() -> a set-like object providing a view on od's keys"
|
||||
return KeysView(self)
|
||||
|
||||
def viewvalues(self):
|
||||
"od.viewvalues() -> an object providing a view on od's values"
|
||||
return ValuesView(self)
|
||||
|
||||
def viewitems(self):
|
||||
"od.viewitems() -> a set-like object providing a view on od's items"
|
||||
return ItemsView(self)
|
||||
File diff suppressed because it is too large
Load Diff
@@ -49,7 +49,6 @@ from bb import data_smart
|
||||
from bb import codeparser
|
||||
import bb
|
||||
|
||||
logger = data_smart.logger
|
||||
_dict_type = data_smart.DataSmart
|
||||
|
||||
def init():
|
||||
@@ -160,17 +159,16 @@ def expandKeys(alterdata, readdata = None):
|
||||
ekey = todolist[key]
|
||||
renameVar(key, ekey, alterdata)
|
||||
|
||||
def inheritFromOS(d, savedenv, permitted):
|
||||
"""Inherit variables from the initial environment."""
|
||||
def inheritFromOS(d):
|
||||
"""Inherit variables from the environment."""
|
||||
exportlist = bb.utils.preserved_envvars_exported()
|
||||
for s in savedenv.keys():
|
||||
if s in permitted:
|
||||
try:
|
||||
setVar(s, getVar(s, savedenv, True), d)
|
||||
if s in exportlist:
|
||||
setVarFlag(s, "export", True, d)
|
||||
except TypeError:
|
||||
pass
|
||||
for s in os.environ.keys():
|
||||
try:
|
||||
setVar(s, os.environ[s], d)
|
||||
if s in exportlist:
|
||||
setVarFlag(s, "export", True, d)
|
||||
except TypeError:
|
||||
pass
|
||||
|
||||
def emit_var(var, o=sys.__stdout__, d = init(), all=False):
|
||||
"""Emit a variable to be sourced by a shell."""
|
||||
@@ -189,7 +187,7 @@ def emit_var(var, o=sys.__stdout__, d = init(), all=False):
|
||||
val = getVar(var, d, 1)
|
||||
except (KeyboardInterrupt, bb.build.FuncFailed):
|
||||
raise
|
||||
except Exception as exc:
|
||||
except Exception, exc:
|
||||
o.write('# expansion of %s threw %s: %s\n' % (var, exc.__class__.__name__, str(exc)))
|
||||
return 0
|
||||
|
||||
@@ -236,20 +234,25 @@ def emit_env(o=sys.__stdout__, d = init(), all=False):
|
||||
for key in keys:
|
||||
emit_var(key, o, d, all and not isfunc) and o.write('\n')
|
||||
|
||||
def exported_keys(d):
|
||||
return (key for key in d.keys() if not key.startswith('__') and
|
||||
d.getVarFlag(key, 'export') and
|
||||
not d.getVarFlag(key, 'unexport'))
|
||||
|
||||
def exported_vars(d):
|
||||
for key in exported_keys(d):
|
||||
def export_vars(d):
|
||||
keys = (key for key in d.keys() if d.getVarFlag(key, "export"))
|
||||
ret = {}
|
||||
for k in keys:
|
||||
try:
|
||||
value = d.getVar(key, True)
|
||||
except Exception:
|
||||
v = d.getVar(k, True)
|
||||
if v:
|
||||
ret[k] = v
|
||||
except (KeyboardInterrupt, bb.build.FuncFailed):
|
||||
raise
|
||||
except Exception, exc:
|
||||
pass
|
||||
return ret
|
||||
|
||||
if value is not None:
|
||||
yield key, str(value)
|
||||
def export_envvars(v, d):
|
||||
for s in os.environ.keys():
|
||||
if s not in v:
|
||||
v[s] = os.environ[s]
|
||||
return v
|
||||
|
||||
def emit_func(func, o=sys.__stdout__, d = init()):
|
||||
"""Emits all items in the data store in a format such that it can be sourced by a shell."""
|
||||
@@ -259,73 +262,48 @@ def emit_func(func, o=sys.__stdout__, d = init()):
|
||||
emit_var(key, o, d, False) and o.write('\n')
|
||||
|
||||
emit_var(func, o, d, False) and o.write('\n')
|
||||
newdeps = bb.codeparser.ShellParser(func, logger).parse_shell(d.getVar(func, True))
|
||||
newdeps = bb.codeparser.ShellParser().parse_shell(d.getVar(func, True))
|
||||
seen = set()
|
||||
while newdeps:
|
||||
deps = newdeps
|
||||
seen |= deps
|
||||
newdeps = set()
|
||||
for dep in deps:
|
||||
if d.getVarFlag(dep, "func"):
|
||||
if bb.data.getVarFlag(dep, "func", d):
|
||||
emit_var(dep, o, d, False) and o.write('\n')
|
||||
newdeps |= bb.codeparser.ShellParser(dep, logger).parse_shell(d.getVar(dep, True))
|
||||
newdeps |= bb.codeparser.ShellParser().parse_shell(d.getVar(dep, True))
|
||||
newdeps -= seen
|
||||
|
||||
def update_data(d):
|
||||
"""Performs final steps upon the datastore, including application of overrides"""
|
||||
d.finalize()
|
||||
|
||||
def build_dependencies(key, keys, shelldeps, vardepvals, d):
|
||||
def build_dependencies(key, keys, shelldeps, d):
|
||||
deps = set()
|
||||
vardeps = d.getVarFlag(key, "vardeps", True)
|
||||
try:
|
||||
if key[-1] == ']':
|
||||
vf = key[:-1].split('[')
|
||||
value = d.getVarFlag(vf[0], vf[1], False)
|
||||
else:
|
||||
value = d.getVar(key, False)
|
||||
|
||||
if key in vardepvals:
|
||||
value = d.getVarFlag(key, "vardepvalue", True)
|
||||
elif d.getVarFlag(key, "func"):
|
||||
if d.getVarFlag(key, "func"):
|
||||
if d.getVarFlag(key, "python"):
|
||||
parsedvar = d.expandWithRefs(value, key)
|
||||
parser = bb.codeparser.PythonParser(key, logger)
|
||||
if parsedvar.value and "\t" in parsedvar.value:
|
||||
logger.warn("Variable %s contains tabs, please remove these (%s)" % (key, d.getVar("FILE", True)))
|
||||
parsedvar = d.expandWithRefs(d.getVar(key, False), key)
|
||||
parser = bb.codeparser.PythonParser()
|
||||
parser.parse_python(parsedvar.value)
|
||||
deps = deps | parser.references
|
||||
else:
|
||||
parsedvar = d.expandWithRefs(value, key)
|
||||
parser = bb.codeparser.ShellParser(key, logger)
|
||||
parsedvar = d.expandWithRefs(d.getVar(key, False), key)
|
||||
parser = bb.codeparser.ShellParser()
|
||||
parser.parse_shell(parsedvar.value)
|
||||
deps = deps | shelldeps
|
||||
if vardeps is None:
|
||||
parser.log.flush()
|
||||
deps = deps | parsedvar.references
|
||||
deps = deps | (keys & parser.execs) | (keys & parsedvar.execs)
|
||||
else:
|
||||
parser = d.expandWithRefs(value, key)
|
||||
parser = d.expandWithRefs(d.getVar(key, False), key)
|
||||
deps |= parser.references
|
||||
deps = deps | (keys & parser.execs)
|
||||
|
||||
# Add varflags, assuming an exclusion list is set
|
||||
varflagsexcl = d.getVar('BB_SIGNATURE_EXCLUDE_FLAGS', True)
|
||||
if varflagsexcl:
|
||||
varfdeps = []
|
||||
varflags = d.getVarFlags(key)
|
||||
if varflags:
|
||||
for f in varflags:
|
||||
if f not in varflagsexcl:
|
||||
varfdeps.append('%s[%s]' % (key, f))
|
||||
if varfdeps:
|
||||
deps |= set(varfdeps)
|
||||
|
||||
deps |= set((vardeps or "").split())
|
||||
deps |= set((d.getVarFlag(key, "vardeps", True) or "").split())
|
||||
deps -= set((d.getVarFlag(key, "vardepsexclude", True) or "").split())
|
||||
except Exception as e:
|
||||
raise bb.data_smart.ExpansionError(key, None, e)
|
||||
return deps, value
|
||||
except:
|
||||
bb.note("Error expanding variable %s" % key)
|
||||
raise
|
||||
return deps
|
||||
#bb.note("Variable %s references %s and calls %s" % (key, str(deps), str(execs)))
|
||||
#d.setVarFlag(key, "vardeps", deps)
|
||||
|
||||
@@ -333,14 +311,12 @@ def generate_dependencies(d):
|
||||
|
||||
keys = set(key for key in d.keys() if not key.startswith("__"))
|
||||
shelldeps = set(key for key in keys if d.getVarFlag(key, "export") and not d.getVarFlag(key, "unexport"))
|
||||
vardepvals = set(key for key in keys if d.getVarFlag(key, "vardepvalue"))
|
||||
|
||||
deps = {}
|
||||
values = {}
|
||||
|
||||
tasklist = d.getVar('__BBTASKS') or []
|
||||
tasklist = bb.data.getVar('__BBTASKS', d) or []
|
||||
for task in tasklist:
|
||||
deps[task], values[task] = build_dependencies(task, keys, shelldeps, vardepvals, d)
|
||||
deps[task] = build_dependencies(task, keys, shelldeps, d)
|
||||
newdeps = deps[task]
|
||||
seen = set()
|
||||
while newdeps:
|
||||
@@ -349,11 +325,11 @@ def generate_dependencies(d):
|
||||
newdeps = set()
|
||||
for dep in nextdeps:
|
||||
if dep not in deps:
|
||||
deps[dep], values[dep] = build_dependencies(dep, keys, shelldeps, vardepvals, d)
|
||||
deps[dep] = build_dependencies(dep, keys, shelldeps, d)
|
||||
newdeps |= deps[dep]
|
||||
newdeps -= seen
|
||||
#print "For %s: %s" % (task, str(deps[task]))
|
||||
return tasklist, deps, values
|
||||
#print "For %s: %s" % (task, str(taskdeps[task]))
|
||||
return tasklist, deps
|
||||
|
||||
def inherits_class(klass, d):
|
||||
val = getVar('__inherit_cache', d) or []
|
||||
|
||||
@@ -31,7 +31,6 @@ BitBake build tools.
|
||||
import copy, re
|
||||
from collections import MutableMapping
|
||||
import logging
|
||||
import hashlib
|
||||
import bb, bb.codeparser
|
||||
from bb import utils
|
||||
from bb.COW import COWDictBase
|
||||
@@ -39,7 +38,7 @@ from bb.COW import COWDictBase
|
||||
logger = logging.getLogger("BitBake.Data")
|
||||
|
||||
__setvar_keyword__ = ["_append", "_prepend"]
|
||||
__setvar_regexp__ = re.compile('(?P<base>.*?)(?P<keyword>_append|_prepend)(_(?P<add>.*))?$')
|
||||
__setvar_regexp__ = re.compile('(?P<base>.*?)(?P<keyword>_append|_prepend)(_(?P<add>.*))?')
|
||||
__expand_var_regexp__ = re.compile(r"\${[^{}]+}")
|
||||
__expand_python_regexp__ = re.compile(r"\${@.+?}")
|
||||
|
||||
@@ -58,7 +57,7 @@ class VariableParse:
|
||||
if self.varname and key:
|
||||
if self.varname == key:
|
||||
raise Exception("variable %s references itself!" % self.varname)
|
||||
var = self.d.getVar(key, True)
|
||||
var = self.d.getVar(key, 1)
|
||||
if var is not None:
|
||||
self.references.add(key)
|
||||
return var
|
||||
@@ -69,14 +68,8 @@ class VariableParse:
|
||||
code = match.group()[3:-1]
|
||||
codeobj = compile(code.strip(), self.varname or "<expansion>", "eval")
|
||||
|
||||
parser = bb.codeparser.PythonParser(self.varname, logger)
|
||||
parser = bb.codeparser.PythonParser()
|
||||
parser.parse_python(code)
|
||||
if self.varname:
|
||||
vardeps = self.d.getVarFlag(self.varname, "vardeps", True)
|
||||
if vardeps is None:
|
||||
parser.log.flush()
|
||||
else:
|
||||
parser.log.flush()
|
||||
self.references |= parser.references
|
||||
self.execs |= parser.execs
|
||||
|
||||
@@ -102,13 +95,7 @@ class ExpansionError(Exception):
|
||||
self.expression = expression
|
||||
self.variablename = varname
|
||||
self.exception = exception
|
||||
if varname:
|
||||
if expression:
|
||||
self.msg = "Failure expanding variable %s, expression was %s which triggered exception %s: %s" % (varname, expression, type(exception).__name__, exception)
|
||||
else:
|
||||
self.msg = "Failure expanding variable %s: %s: %s" % (varname, type(exception).__name__, exception)
|
||||
else:
|
||||
self.msg = "Failure expanding expression %s which triggered exception %s: %s" % (expression, type(exception).__name__, exception)
|
||||
self.msg = "Failure expanding variable %s, expression was %s which triggered exception %s: %s" % (varname, expression, type(exception).__name__, exception)
|
||||
Exception.__init__(self, self.msg)
|
||||
self.args = (varname, expression, exception)
|
||||
def __str__(self):
|
||||
@@ -153,7 +140,7 @@ class DataSmart(MutableMapping):
|
||||
|
||||
return varparse
|
||||
|
||||
def expand(self, s, varname = None):
|
||||
def expand(self, s, varname):
|
||||
return self.expandWithRefs(s, varname).value
|
||||
|
||||
|
||||
@@ -185,12 +172,11 @@ class DataSmart(MutableMapping):
|
||||
if o not in self._seen_overrides:
|
||||
continue
|
||||
|
||||
vars = self._seen_overrides[o].copy()
|
||||
vars = self._seen_overrides[o]
|
||||
for var in vars:
|
||||
name = var[:-l]
|
||||
try:
|
||||
self.setVar(name, self.getVar(var, False))
|
||||
self.delVar(var)
|
||||
except Exception:
|
||||
logger.info("Untracked delVar")
|
||||
|
||||
@@ -201,20 +187,15 @@ class DataSmart(MutableMapping):
|
||||
for append in appends:
|
||||
keep = []
|
||||
for (a, o) in self.getVarFlag(append, op) or []:
|
||||
match = True
|
||||
if o:
|
||||
for o2 in o.split("_"):
|
||||
if not o2 in overrides:
|
||||
match = False
|
||||
if not match:
|
||||
if o and not o in overrides:
|
||||
keep.append((a ,o))
|
||||
continue
|
||||
|
||||
if op == "_append":
|
||||
if op is "_append":
|
||||
sval = self.getVar(append, False) or ""
|
||||
sval += a
|
||||
self.setVar(append, sval)
|
||||
elif op == "_prepend":
|
||||
elif op is "_prepend":
|
||||
sval = a + (self.getVar(append, False) or "")
|
||||
self.setVar(append, sval)
|
||||
|
||||
@@ -277,19 +258,17 @@ class DataSmart(MutableMapping):
|
||||
# more cookies for the cookie monster
|
||||
if '_' in var:
|
||||
override = var[var.rfind('_')+1:]
|
||||
if len(override) > 0:
|
||||
if override not in self._seen_overrides:
|
||||
self._seen_overrides[override] = set()
|
||||
self._seen_overrides[override].add( var )
|
||||
if override not in self._seen_overrides:
|
||||
self._seen_overrides[override] = set()
|
||||
self._seen_overrides[override].add( var )
|
||||
|
||||
# setting var
|
||||
self.dict[var]["_content"] = value
|
||||
self.dict[var]["content"] = value
|
||||
|
||||
def getVar(self, var, expand=False, noweakdefault=False):
|
||||
value = self.getVarFlag(var, "_content", False, noweakdefault)
|
||||
def getVar(self, var, exp):
|
||||
value = self.getVarFlag(var, "content")
|
||||
|
||||
# Call expand() separately to make use of the expand cache
|
||||
if expand and value:
|
||||
if exp and value:
|
||||
return self.expand(value, var)
|
||||
return value
|
||||
|
||||
@@ -316,34 +295,22 @@ class DataSmart(MutableMapping):
|
||||
|
||||
self.delVar(key)
|
||||
|
||||
def appendVar(self, key, value):
|
||||
value = (self.getVar(key, False) or "") + value
|
||||
self.setVar(key, value)
|
||||
|
||||
def prependVar(self, key, value):
|
||||
value = value + (self.getVar(key, False) or "")
|
||||
self.setVar(key, value)
|
||||
|
||||
def delVar(self, var):
|
||||
self.expand_cache = {}
|
||||
self.dict[var] = {}
|
||||
if '_' in var:
|
||||
override = var[var.rfind('_')+1:]
|
||||
if override and override in self._seen_overrides and var in self._seen_overrides[override]:
|
||||
self._seen_overrides[override].remove(var)
|
||||
|
||||
def setVarFlag(self, var, flag, flagvalue):
|
||||
if not var in self.dict:
|
||||
self._makeShadowCopy(var)
|
||||
self.dict[var][flag] = flagvalue
|
||||
|
||||
def getVarFlag(self, var, flag, expand=False, noweakdefault=False):
|
||||
def getVarFlag(self, var, flag, expand=False):
|
||||
local_var = self._findVar(var)
|
||||
value = None
|
||||
if local_var:
|
||||
if flag in local_var:
|
||||
value = copy.copy(local_var[flag])
|
||||
elif flag == "_content" and "defaultval" in local_var and not noweakdefault:
|
||||
elif flag == "content" and "defaultval" in local_var:
|
||||
value = copy.copy(local_var["defaultval"])
|
||||
if expand and value:
|
||||
value = self.expand(value, None)
|
||||
@@ -359,20 +326,12 @@ class DataSmart(MutableMapping):
|
||||
if var in self.dict and flag in self.dict[var]:
|
||||
del self.dict[var][flag]
|
||||
|
||||
def appendVarFlag(self, key, flag, value):
|
||||
value = (self.getVarFlag(key, flag, False) or "") + value
|
||||
self.setVarFlag(key, flag, value)
|
||||
|
||||
def prependVarFlag(self, key, flag, value):
|
||||
value = value + (self.getVarFlag(key, flag, False) or "")
|
||||
self.setVarFlag(key, flag, value)
|
||||
|
||||
def setVarFlags(self, var, flags):
|
||||
if not var in self.dict:
|
||||
self._makeShadowCopy(var)
|
||||
|
||||
for i in flags:
|
||||
if i == "_content":
|
||||
if i == "content":
|
||||
continue
|
||||
self.dict[var][i] = flags[i]
|
||||
|
||||
@@ -382,7 +341,7 @@ class DataSmart(MutableMapping):
|
||||
|
||||
if local_var:
|
||||
for i in local_var:
|
||||
if i.startswith("_"):
|
||||
if i == "content":
|
||||
continue
|
||||
flags[i] = local_var[i]
|
||||
|
||||
@@ -399,10 +358,10 @@ class DataSmart(MutableMapping):
|
||||
content = None
|
||||
|
||||
# try to save the content
|
||||
if "_content" in self.dict[var]:
|
||||
content = self.dict[var]["_content"]
|
||||
if "content" in self.dict[var]:
|
||||
content = self.dict[var]["content"]
|
||||
self.dict[var] = {}
|
||||
self.dict[var]["_content"] = content
|
||||
self.dict[var]["content"] = content
|
||||
else:
|
||||
del self.dict[var]
|
||||
|
||||
@@ -439,22 +398,18 @@ class DataSmart(MutableMapping):
|
||||
yield key
|
||||
|
||||
def __iter__(self):
|
||||
def keylist(d):
|
||||
klist = set()
|
||||
for key in d:
|
||||
if key == "_data":
|
||||
continue
|
||||
if not d[key]:
|
||||
continue
|
||||
klist.add(key)
|
||||
|
||||
seen = set()
|
||||
def _keys(d):
|
||||
if "_data" in d:
|
||||
klist |= keylist(d["_data"])
|
||||
for key in _keys(d["_data"]):
|
||||
yield key
|
||||
|
||||
return klist
|
||||
|
||||
for k in keylist(self.dict):
|
||||
yield k
|
||||
for key in d:
|
||||
if key != "_data":
|
||||
if not key in seen:
|
||||
seen.add(key)
|
||||
yield key
|
||||
return _keys(self.dict)
|
||||
|
||||
def __len__(self):
|
||||
return len(frozenset(self))
|
||||
@@ -471,16 +426,3 @@ class DataSmart(MutableMapping):
|
||||
|
||||
def __delitem__(self, var):
|
||||
self.delVar(var)
|
||||
|
||||
def get_hash(self):
|
||||
data = {}
|
||||
config_whitelist = set((self.getVar("BB_HASHCONFIG_WHITELIST", True) or "").split())
|
||||
keys = set(key for key in iter(self) if not key.startswith("__"))
|
||||
for key in keys:
|
||||
if key in config_whitelist:
|
||||
continue
|
||||
value = self.getVar(key, False) or ""
|
||||
data.update({key:value})
|
||||
|
||||
data_str = str([(k, data[k]) for k in sorted(data.keys())])
|
||||
return hashlib.md5(data_str).hexdigest()
|
||||
|
||||
@@ -30,17 +30,13 @@ except ImportError:
|
||||
import pickle
|
||||
import logging
|
||||
import atexit
|
||||
import traceback
|
||||
import bb.utils
|
||||
import bb.compat
|
||||
|
||||
# This is the pid for which we should generate the event. This is set when
|
||||
# the runqueue forks off.
|
||||
worker_pid = 0
|
||||
worker_pipe = None
|
||||
|
||||
logger = logging.getLogger('BitBake.Event')
|
||||
|
||||
class Event(object):
|
||||
"""Base class for events"""
|
||||
|
||||
@@ -54,7 +50,7 @@ Registered = 10
|
||||
AlreadyRegistered = 14
|
||||
|
||||
# Internal
|
||||
_handlers = bb.compat.OrderedDict()
|
||||
_handlers = {}
|
||||
_ui_handlers = {}
|
||||
_ui_handler_seq = 0
|
||||
|
||||
@@ -62,37 +58,23 @@ _ui_handler_seq = 0
|
||||
bb.utils._context["NotHandled"] = NotHandled
|
||||
bb.utils._context["Handled"] = Handled
|
||||
|
||||
def execute_handler(name, handler, event, d):
|
||||
event.data = d
|
||||
try:
|
||||
ret = handler(event)
|
||||
except bb.parse.SkipPackage:
|
||||
raise
|
||||
except Exception:
|
||||
etype, value, tb = sys.exc_info()
|
||||
logger.error("Execution of event handler '%s' failed" % name,
|
||||
exc_info=(etype, value, tb.tb_next))
|
||||
raise
|
||||
except SystemExit as exc:
|
||||
if exc.code != 0:
|
||||
logger.error("Execution of event handler '%s' failed" % name)
|
||||
raise
|
||||
finally:
|
||||
del event.data
|
||||
|
||||
if ret is not None:
|
||||
warnings.warn("Using Handled/NotHandled in event handlers is deprecated",
|
||||
DeprecationWarning, stacklevel = 2)
|
||||
|
||||
def fire_class_handlers(event, d):
|
||||
if isinstance(event, logging.LogRecord):
|
||||
return
|
||||
|
||||
for name, handler in _handlers.iteritems():
|
||||
try:
|
||||
execute_handler(name, handler, event, d)
|
||||
except Exception:
|
||||
continue
|
||||
for handler in _handlers:
|
||||
h = _handlers[handler]
|
||||
event.data = d
|
||||
if type(h).__name__ == "code":
|
||||
locals = {"e": event}
|
||||
bb.utils.simple_exec(h, locals)
|
||||
ret = bb.utils.better_eval("tmpHandler(e)", locals)
|
||||
if ret is not None:
|
||||
warnings.warn("Using Handled/NotHandled in event handlers is deprecated",
|
||||
DeprecationWarning, stacklevel = 2)
|
||||
else:
|
||||
h(event)
|
||||
del event.data
|
||||
|
||||
ui_queue = []
|
||||
@atexit.register
|
||||
@@ -105,19 +87,8 @@ def print_ui_queue():
|
||||
console = logging.StreamHandler(sys.stdout)
|
||||
console.setFormatter(BBLogFormatter("%(levelname)s: %(message)s"))
|
||||
logger.handlers = [console]
|
||||
|
||||
# First check to see if we have any proper messages
|
||||
msgprint = False
|
||||
for event in ui_queue:
|
||||
if isinstance(event, logging.LogRecord):
|
||||
if event.levelno > logging.DEBUG:
|
||||
logger.handle(event)
|
||||
msgprint = True
|
||||
if msgprint:
|
||||
return
|
||||
|
||||
# Nope, so just print all of the messages we have (including debug messages)
|
||||
for event in ui_queue:
|
||||
while ui_queue:
|
||||
event = ui_queue.pop()
|
||||
if isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
|
||||
@@ -134,10 +105,7 @@ def fire_ui_handlers(event, d):
|
||||
# We use pickle here since it better handles object instances
|
||||
# which xmlrpc's marshaller does not. Events *must* be serializable
|
||||
# by pickle.
|
||||
if hasattr(_ui_handlers[h].event, "sendpickle"):
|
||||
_ui_handlers[h].event.sendpickle((pickle.dumps(event)))
|
||||
else:
|
||||
_ui_handlers[h].event.send(event)
|
||||
_ui_handlers[h].event.send((pickle.dumps(event)))
|
||||
except:
|
||||
errors.append(h)
|
||||
for h in errors:
|
||||
@@ -168,7 +136,6 @@ def fire_from_worker(event, d):
|
||||
event = pickle.loads(event[7:-8])
|
||||
fire_ui_handlers(event, d)
|
||||
|
||||
noop = lambda _: None
|
||||
def register(name, handler):
|
||||
"""Register an Event handler"""
|
||||
|
||||
@@ -179,18 +146,9 @@ def register(name, handler):
|
||||
if handler is not None:
|
||||
# handle string containing python code
|
||||
if isinstance(handler, basestring):
|
||||
tmp = "def %s(e):\n%s" % (name, handler)
|
||||
try:
|
||||
code = compile(tmp, "%s(e)" % name, "exec")
|
||||
except SyntaxError:
|
||||
logger.error("Unable to register event handler '%s':\n%s", name,
|
||||
''.join(traceback.format_exc(limit=0)))
|
||||
_handlers[name] = noop
|
||||
return
|
||||
env = {}
|
||||
bb.utils.better_exec(code, env)
|
||||
func = bb.utils.better_eval(name, env)
|
||||
_handlers[name] = func
|
||||
tmp = "def tmpHandler(e):\n%s" % handler
|
||||
comp = bb.utils.better_compile(tmp, "tmpHandler(e)", "bb.event._registerCode")
|
||||
_handlers[name] = comp
|
||||
else:
|
||||
_handlers[name] = handler
|
||||
|
||||
@@ -217,41 +175,16 @@ def getName(e):
|
||||
else:
|
||||
return e.__name__
|
||||
|
||||
class OperationStarted(Event):
|
||||
"""An operation has begun"""
|
||||
def __init__(self, msg = "Operation Started"):
|
||||
Event.__init__(self)
|
||||
self.msg = msg
|
||||
|
||||
class OperationCompleted(Event):
|
||||
"""An operation has completed"""
|
||||
def __init__(self, total, msg = "Operation Completed"):
|
||||
Event.__init__(self)
|
||||
self.total = total
|
||||
self.msg = msg
|
||||
|
||||
class OperationProgress(Event):
|
||||
"""An operation is in progress"""
|
||||
def __init__(self, current, total, msg = "Operation in Progress"):
|
||||
Event.__init__(self)
|
||||
self.current = current
|
||||
self.total = total
|
||||
self.msg = msg + ": %s/%s" % (current, total);
|
||||
|
||||
class ConfigParsed(Event):
|
||||
"""Configuration Parsing Complete"""
|
||||
|
||||
class RecipeEvent(Event):
|
||||
class RecipeParsed(Event):
|
||||
""" Recipe Parsing Complete """
|
||||
|
||||
def __init__(self, fn):
|
||||
self.fn = fn
|
||||
Event.__init__(self)
|
||||
|
||||
class RecipePreFinalise(RecipeEvent):
|
||||
""" Recipe Parsing Complete but not yet finialised"""
|
||||
|
||||
class RecipeParsed(RecipeEvent):
|
||||
""" Recipe Parsing Complete """
|
||||
|
||||
class StampUpdate(Event):
|
||||
"""Trigger for any adjustment of the stamp files to happen"""
|
||||
|
||||
@@ -310,39 +243,24 @@ class BuildBase(Event):
|
||||
|
||||
|
||||
|
||||
class BuildStarted(BuildBase, OperationStarted):
|
||||
class BuildStarted(BuildBase):
|
||||
"""bbmake build run started"""
|
||||
def __init__(self, n, p, failures = 0):
|
||||
OperationStarted.__init__(self, "Building Started")
|
||||
BuildBase.__init__(self, n, p, failures)
|
||||
|
||||
class BuildCompleted(BuildBase, OperationCompleted):
|
||||
|
||||
class BuildCompleted(BuildBase):
|
||||
"""bbmake build run completed"""
|
||||
def __init__(self, total, n, p, failures = 0):
|
||||
if not failures:
|
||||
OperationCompleted.__init__(self, total, "Building Succeeded")
|
||||
else:
|
||||
OperationCompleted.__init__(self, total, "Building Failed")
|
||||
BuildBase.__init__(self, n, p, failures)
|
||||
|
||||
class DiskFull(Event):
|
||||
"""Disk full case build aborted"""
|
||||
def __init__(self, dev, type, freespace, mountpoint):
|
||||
Event.__init__(self)
|
||||
self._dev = dev
|
||||
self._type = type
|
||||
self._free = freespace
|
||||
self._mountpoint = mountpoint
|
||||
|
||||
|
||||
|
||||
class NoProvider(Event):
|
||||
"""No Provider for an Event"""
|
||||
|
||||
def __init__(self, item, runtime=False, dependees=None, reasons=[]):
|
||||
def __init__(self, item, runtime=False, dependees=None):
|
||||
Event.__init__(self)
|
||||
self._item = item
|
||||
self._runtime = runtime
|
||||
self._dependees = dependees
|
||||
self._reasons = reasons
|
||||
|
||||
def getItem(self):
|
||||
return self._item
|
||||
@@ -377,16 +295,17 @@ class MultipleProviders(Event):
|
||||
"""
|
||||
return self._candidates
|
||||
|
||||
class ParseStarted(OperationStarted):
|
||||
class ParseStarted(Event):
|
||||
"""Recipe parsing for the runqueue has begun"""
|
||||
def __init__(self, total):
|
||||
OperationStarted.__init__(self, "Recipe parsing Started")
|
||||
Event.__init__(self)
|
||||
self.total = total
|
||||
|
||||
class ParseCompleted(OperationCompleted):
|
||||
class ParseCompleted(Event):
|
||||
"""Recipe parsing for the runqueue has completed"""
|
||||
|
||||
def __init__(self, cached, parsed, skipped, masked, virtuals, errors, total):
|
||||
OperationCompleted.__init__(self, total, "Recipe parsing Completed")
|
||||
Event.__init__(self)
|
||||
self.cached = cached
|
||||
self.parsed = parsed
|
||||
self.skipped = skipped
|
||||
@@ -394,44 +313,33 @@ class ParseCompleted(OperationCompleted):
|
||||
self.masked = masked
|
||||
self.errors = errors
|
||||
self.sofar = cached + parsed
|
||||
|
||||
class ParseProgress(OperationProgress):
|
||||
"""Recipe parsing progress"""
|
||||
def __init__(self, current, total):
|
||||
OperationProgress.__init__(self, current, total, "Recipe parsing")
|
||||
|
||||
|
||||
class CacheLoadStarted(OperationStarted):
|
||||
"""Loading of the dependency cache has begun"""
|
||||
def __init__(self, total):
|
||||
OperationStarted.__init__(self, "Loading cache Started")
|
||||
self.total = total
|
||||
|
||||
class CacheLoadProgress(OperationProgress):
|
||||
"""Cache loading progress"""
|
||||
def __init__(self, current, total):
|
||||
OperationProgress.__init__(self, current, total, "Loading cache")
|
||||
class ParseProgress(Event):
|
||||
"""Recipe parsing progress"""
|
||||
|
||||
class CacheLoadCompleted(OperationCompleted):
|
||||
def __init__(self, current):
|
||||
self.current = current
|
||||
|
||||
class CacheLoadStarted(Event):
|
||||
"""Loading of the dependency cache has begun"""
|
||||
def __init__(self, total):
|
||||
Event.__init__(self)
|
||||
self.total = total
|
||||
|
||||
class CacheLoadProgress(Event):
|
||||
"""Cache loading progress"""
|
||||
def __init__(self, current):
|
||||
Event.__init__(self)
|
||||
self.current = current
|
||||
|
||||
class CacheLoadCompleted(Event):
|
||||
"""Cache loading is complete"""
|
||||
def __init__(self, total, num_entries):
|
||||
OperationCompleted.__init__(self, total, "Loading cache Completed")
|
||||
Event.__init__(self)
|
||||
self.total = total
|
||||
self.num_entries = num_entries
|
||||
|
||||
class TreeDataPreparationStarted(OperationStarted):
|
||||
"""Tree data preparation started"""
|
||||
def __init__(self):
|
||||
OperationStarted.__init__(self, "Preparing tree data Started")
|
||||
|
||||
class TreeDataPreparationProgress(OperationProgress):
|
||||
"""Tree data preparation is in progress"""
|
||||
def __init__(self, current, total):
|
||||
OperationProgress.__init__(self, current, total, "Preparing tree data")
|
||||
|
||||
class TreeDataPreparationCompleted(OperationCompleted):
|
||||
"""Tree data preparation completed"""
|
||||
def __init__(self, total):
|
||||
OperationCompleted.__init__(self, total, "Preparing tree data Completed")
|
||||
|
||||
class DepTreeGenerated(Event):
|
||||
"""
|
||||
@@ -450,24 +358,6 @@ class TargetsTreeGenerated(Event):
|
||||
Event.__init__(self)
|
||||
self._model = model
|
||||
|
||||
class FilesMatchingFound(Event):
|
||||
"""
|
||||
Event when a list of files matching the supplied pattern has
|
||||
been generated
|
||||
"""
|
||||
def __init__(self, pattern, matches):
|
||||
Event.__init__(self)
|
||||
self._pattern = pattern
|
||||
self._matches = matches
|
||||
|
||||
class CoreBaseFilesFound(Event):
|
||||
"""
|
||||
Event when a list of appropriate config files has been generated
|
||||
"""
|
||||
def __init__(self, paths):
|
||||
Event.__init__(self)
|
||||
self._paths = paths
|
||||
|
||||
class ConfigFilesFound(Event):
|
||||
"""
|
||||
Event when a list of appropriate config files has been generated
|
||||
@@ -477,14 +367,6 @@ class ConfigFilesFound(Event):
|
||||
self._variable = variable
|
||||
self._values = values
|
||||
|
||||
class ConfigFilePathFound(Event):
|
||||
"""
|
||||
Event when a path for a config file has been found
|
||||
"""
|
||||
def __init__(self, path):
|
||||
Event.__init__(self)
|
||||
self._path = path
|
||||
|
||||
class MsgBase(Event):
|
||||
"""Base class for messages"""
|
||||
|
||||
@@ -510,75 +392,12 @@ class MsgFatal(MsgBase):
|
||||
class MsgPlain(MsgBase):
|
||||
"""General output"""
|
||||
|
||||
class LogExecTTY(Event):
|
||||
"""Send event containing program to spawn on tty of the logger"""
|
||||
def __init__(self, msg, prog, sleep_delay, retries):
|
||||
Event.__init__(self)
|
||||
self.msg = msg
|
||||
self.prog = prog
|
||||
self.sleep_delay = sleep_delay
|
||||
self.retries = retries
|
||||
|
||||
class LogHandler(logging.Handler):
|
||||
"""Dispatch logging messages as bitbake events"""
|
||||
|
||||
def emit(self, record):
|
||||
if record.exc_info:
|
||||
etype, value, tb = record.exc_info
|
||||
if hasattr(tb, 'tb_next'):
|
||||
tb = list(bb.exceptions.extract_traceback(tb, context=3))
|
||||
record.bb_exc_info = (etype, value, tb)
|
||||
record.exc_info = None
|
||||
fire(record, None)
|
||||
|
||||
def filter(self, record):
|
||||
record.taskpid = worker_pid
|
||||
return True
|
||||
|
||||
class RequestPackageInfo(Event):
|
||||
"""
|
||||
Event to request package information
|
||||
"""
|
||||
|
||||
class PackageInfo(Event):
|
||||
"""
|
||||
Package information for GUI
|
||||
"""
|
||||
def __init__(self, pkginfolist):
|
||||
Event.__init__(self)
|
||||
self._pkginfolist = pkginfolist
|
||||
|
||||
class SanityCheck(Event):
|
||||
"""
|
||||
Event to issue sanity check
|
||||
"""
|
||||
|
||||
class SanityCheckPassed(Event):
|
||||
"""
|
||||
Event to indicate sanity check is passed
|
||||
"""
|
||||
|
||||
class SanityCheckFailed(Event):
|
||||
"""
|
||||
Event to indicate sanity check has failed
|
||||
"""
|
||||
def __init__(self, msg, network_error=False):
|
||||
Event.__init__(self)
|
||||
self._msg = msg
|
||||
self._network_error = network_error
|
||||
|
||||
class NetworkTest(Event):
|
||||
"""
|
||||
Event to start network test
|
||||
"""
|
||||
|
||||
class NetworkTestPassed(Event):
|
||||
"""
|
||||
Event to indicate network test has passed
|
||||
"""
|
||||
|
||||
class NetworkTestFailed(Event):
|
||||
"""
|
||||
Event to indicate network test has failed
|
||||
"""
|
||||
|
||||
|
||||
@@ -1,91 +0,0 @@
|
||||
from __future__ import absolute_import
|
||||
import inspect
|
||||
import traceback
|
||||
import bb.namedtuple_with_abc
|
||||
from collections import namedtuple
|
||||
|
||||
|
||||
class TracebackEntry(namedtuple.abc):
|
||||
"""Pickleable representation of a traceback entry"""
|
||||
_fields = 'filename lineno function args code_context index'
|
||||
_header = ' File "{0.filename}", line {0.lineno}, in {0.function}{0.args}'
|
||||
|
||||
def format(self, formatter=None):
|
||||
if not self.code_context:
|
||||
return self._header.format(self) + '\n'
|
||||
|
||||
formatted = [self._header.format(self) + ':\n']
|
||||
|
||||
for lineindex, line in enumerate(self.code_context):
|
||||
if formatter:
|
||||
line = formatter(line)
|
||||
|
||||
if lineindex == self.index:
|
||||
formatted.append(' >%s' % line)
|
||||
else:
|
||||
formatted.append(' %s' % line)
|
||||
return formatted
|
||||
|
||||
def __str__(self):
|
||||
return ''.join(self.format())
|
||||
|
||||
def _get_frame_args(frame):
|
||||
"""Get the formatted arguments and class (if available) for a frame"""
|
||||
arginfo = inspect.getargvalues(frame)
|
||||
|
||||
try:
|
||||
if not arginfo.args:
|
||||
return '', None
|
||||
# There have been reports from the field of python 2.6 which doesn't
|
||||
# return a namedtuple here but simply a tuple so fallback gracefully if
|
||||
# args isn't present.
|
||||
except AttributeError:
|
||||
return '', None
|
||||
|
||||
firstarg = arginfo.args[0]
|
||||
if firstarg == 'self':
|
||||
self = arginfo.locals['self']
|
||||
cls = self.__class__.__name__
|
||||
|
||||
arginfo.args.pop(0)
|
||||
del arginfo.locals['self']
|
||||
else:
|
||||
cls = None
|
||||
|
||||
formatted = inspect.formatargvalues(*arginfo)
|
||||
return formatted, cls
|
||||
|
||||
def extract_traceback(tb, context=1):
|
||||
frames = inspect.getinnerframes(tb, context)
|
||||
for frame, filename, lineno, function, code_context, index in frames:
|
||||
formatted_args, cls = _get_frame_args(frame)
|
||||
if cls:
|
||||
function = '%s.%s' % (cls, function)
|
||||
yield TracebackEntry(filename, lineno, function, formatted_args,
|
||||
code_context, index)
|
||||
|
||||
def format_extracted(extracted, formatter=None, limit=None):
|
||||
if limit:
|
||||
extracted = extracted[-limit:]
|
||||
|
||||
formatted = []
|
||||
for tracebackinfo in extracted:
|
||||
formatted.extend(tracebackinfo.format(formatter))
|
||||
return formatted
|
||||
|
||||
|
||||
def format_exception(etype, value, tb, context=1, limit=None, formatter=None):
|
||||
formatted = ['Traceback (most recent call last):\n']
|
||||
|
||||
if hasattr(tb, 'tb_next'):
|
||||
tb = extract_traceback(tb, context)
|
||||
|
||||
formatted.extend(format_extracted(tb, formatter, limit))
|
||||
formatted.extend(traceback.format_exception_only(etype, value))
|
||||
return formatted
|
||||
|
||||
def to_string(exc):
|
||||
if isinstance(exc, SystemExit):
|
||||
if not isinstance(exc.code, basestring):
|
||||
return 'Exited with "%d"' % exc.code
|
||||
return str(exc)
|
||||
836
bitbake/lib/bb/fetch/__init__.py
Normal file
836
bitbake/lib/bb/fetch/__init__.py
Normal file
@@ -0,0 +1,836 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
from __future__ import absolute_import
|
||||
from __future__ import print_function
|
||||
import os, re
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb import persist_data
|
||||
from bb import utils
|
||||
|
||||
__version__ = "1"
|
||||
|
||||
logger = logging.getLogger("BitBake.Fetch")
|
||||
|
||||
class MalformedUrl(Exception):
|
||||
"""Exception raised when encountering an invalid url"""
|
||||
|
||||
class FetchError(Exception):
|
||||
"""Exception raised when a download fails"""
|
||||
|
||||
class NoMethodError(Exception):
|
||||
"""Exception raised when there is no method to obtain a supplied url or set of urls"""
|
||||
|
||||
class MissingParameterError(Exception):
|
||||
"""Exception raised when a fetch method is missing a critical parameter in the url"""
|
||||
|
||||
class ParameterError(Exception):
|
||||
"""Exception raised when a url cannot be proccessed due to invalid parameters."""
|
||||
|
||||
class MD5SumError(Exception):
|
||||
"""Exception raised when a MD5SUM of a file does not match the expected one"""
|
||||
|
||||
class InvalidSRCREV(Exception):
|
||||
"""Exception raised when an invalid SRCREV is encountered"""
|
||||
|
||||
def decodeurl(url):
|
||||
"""Decodes an URL into the tokens (scheme, network location, path,
|
||||
user, password, parameters).
|
||||
"""
|
||||
|
||||
m = re.compile('(?P<type>[^:]*)://((?P<user>.+)@)?(?P<location>[^;]+)(;(?P<parm>.*))?').match(url)
|
||||
if not m:
|
||||
raise MalformedUrl(url)
|
||||
|
||||
type = m.group('type')
|
||||
location = m.group('location')
|
||||
if not location:
|
||||
raise MalformedUrl(url)
|
||||
user = m.group('user')
|
||||
parm = m.group('parm')
|
||||
|
||||
locidx = location.find('/')
|
||||
if locidx != -1 and type.lower() != 'file':
|
||||
host = location[:locidx]
|
||||
path = location[locidx:]
|
||||
else:
|
||||
host = ""
|
||||
path = location
|
||||
if user:
|
||||
m = re.compile('(?P<user>[^:]+)(:?(?P<pswd>.*))').match(user)
|
||||
if m:
|
||||
user = m.group('user')
|
||||
pswd = m.group('pswd')
|
||||
else:
|
||||
user = ''
|
||||
pswd = ''
|
||||
|
||||
p = {}
|
||||
if parm:
|
||||
for s in parm.split(';'):
|
||||
s1, s2 = s.split('=')
|
||||
p[s1] = s2
|
||||
|
||||
return (type, host, path, user, pswd, p)
|
||||
|
||||
def encodeurl(decoded):
|
||||
"""Encodes a URL from tokens (scheme, network location, path,
|
||||
user, password, parameters).
|
||||
"""
|
||||
|
||||
(type, host, path, user, pswd, p) = decoded
|
||||
|
||||
if not type or not path:
|
||||
raise MissingParameterError("Type or path url components missing when encoding %s" % decoded)
|
||||
url = '%s://' % type
|
||||
if user:
|
||||
url += "%s" % user
|
||||
if pswd:
|
||||
url += ":%s" % pswd
|
||||
url += "@"
|
||||
if host:
|
||||
url += "%s" % host
|
||||
url += "%s" % path
|
||||
if p:
|
||||
for parm in p:
|
||||
url += ";%s=%s" % (parm, p[parm])
|
||||
|
||||
return url
|
||||
|
||||
def uri_replace(uri, uri_find, uri_replace, d):
|
||||
if not uri or not uri_find or not uri_replace:
|
||||
logger.debug(1, "uri_replace: passed an undefined value, not replacing")
|
||||
uri_decoded = list(decodeurl(uri))
|
||||
uri_find_decoded = list(decodeurl(uri_find))
|
||||
uri_replace_decoded = list(decodeurl(uri_replace))
|
||||
result_decoded = ['', '', '', '', '', {}]
|
||||
for i in uri_find_decoded:
|
||||
loc = uri_find_decoded.index(i)
|
||||
result_decoded[loc] = uri_decoded[loc]
|
||||
if isinstance(i, basestring):
|
||||
if (re.match(i, uri_decoded[loc])):
|
||||
result_decoded[loc] = re.sub(i, uri_replace_decoded[loc], uri_decoded[loc])
|
||||
if uri_find_decoded.index(i) == 2:
|
||||
if d:
|
||||
localfn = bb.fetch.localpath(uri, d)
|
||||
if localfn:
|
||||
result_decoded[loc] = os.path.join(os.path.dirname(result_decoded[loc]), os.path.basename(bb.fetch.localpath(uri, d)))
|
||||
else:
|
||||
return uri
|
||||
return encodeurl(result_decoded)
|
||||
|
||||
methods = []
|
||||
urldata_cache = {}
|
||||
saved_headrevs = {}
|
||||
|
||||
def fetcher_init(d):
|
||||
"""
|
||||
Called to initialize the fetchers once the configuration data is known.
|
||||
Calls before this must not hit the cache.
|
||||
"""
|
||||
pd = persist_data.persist(d)
|
||||
# When to drop SCM head revisions controlled by user policy
|
||||
srcrev_policy = bb.data.getVar('BB_SRCREV_POLICY', d, 1) or "clear"
|
||||
if srcrev_policy == "cache":
|
||||
logger.debug(1, "Keeping SRCREV cache due to cache policy of: %s", srcrev_policy)
|
||||
elif srcrev_policy == "clear":
|
||||
logger.debug(1, "Clearing SRCREV cache due to cache policy of: %s", srcrev_policy)
|
||||
try:
|
||||
bb.fetch.saved_headrevs = pd['BB_URI_HEADREVS'].items()
|
||||
except:
|
||||
pass
|
||||
del pd['BB_URI_HEADREVS']
|
||||
else:
|
||||
raise FetchError("Invalid SRCREV cache policy of: %s" % srcrev_policy)
|
||||
|
||||
for m in methods:
|
||||
if hasattr(m, "init"):
|
||||
m.init(d)
|
||||
|
||||
def fetcher_compare_revisions(d):
|
||||
"""
|
||||
Compare the revisions in the persistant cache with current values and
|
||||
return true/false on whether they've changed.
|
||||
"""
|
||||
|
||||
pd = persist_data.persist(d)
|
||||
data = pd['BB_URI_HEADREVS'].items()
|
||||
data2 = bb.fetch.saved_headrevs
|
||||
|
||||
changed = False
|
||||
for key in data:
|
||||
if key not in data2 or data2[key] != data[key]:
|
||||
logger.debug(1, "%s changed", key)
|
||||
changed = True
|
||||
return True
|
||||
else:
|
||||
logger.debug(2, "%s did not change", key)
|
||||
return False
|
||||
|
||||
# Function call order is usually:
|
||||
# 1. init
|
||||
# 2. go
|
||||
# 3. localpaths
|
||||
# localpath can be called at any time
|
||||
|
||||
def init(urls, d, setup = True):
|
||||
urldata = {}
|
||||
|
||||
fn = bb.data.getVar('FILE', d, 1)
|
||||
if fn in urldata_cache:
|
||||
urldata = urldata_cache[fn]
|
||||
|
||||
for url in urls:
|
||||
if url not in urldata:
|
||||
urldata[url] = FetchData(url, d)
|
||||
|
||||
if setup:
|
||||
for url in urldata:
|
||||
if not urldata[url].setup:
|
||||
urldata[url].setup_localpath(d)
|
||||
|
||||
urldata_cache[fn] = urldata
|
||||
return urldata
|
||||
|
||||
def mirror_from_string(data):
|
||||
return [ i.split() for i in (data or "").replace('\\n','\n').split('\n') if i ]
|
||||
|
||||
def verify_checksum(u, ud, d):
|
||||
"""
|
||||
verify the MD5 and SHA256 checksum for downloaded src
|
||||
|
||||
return value:
|
||||
- True: checksum matched
|
||||
- False: checksum unmatched
|
||||
|
||||
if checksum is missing in recipes file, "BB_STRICT_CHECKSUM" decide the return value.
|
||||
if BB_STRICT_CHECKSUM = "1" then return false as unmatched, otherwise return true as
|
||||
matched
|
||||
"""
|
||||
|
||||
if not ud.type in ["http", "https", "ftp", "ftps"]:
|
||||
return
|
||||
|
||||
md5data = bb.utils.md5_file(ud.localpath)
|
||||
sha256data = bb.utils.sha256_file(ud.localpath)
|
||||
|
||||
if (ud.md5_expected == None or ud.sha256_expected == None):
|
||||
logger.warn('Missing SRC_URI checksum for %s, consider adding to the recipe:\n'
|
||||
'SRC_URI[%s] = "%s"\nSRC_URI[%s] = "%s"',
|
||||
ud.localpath, ud.md5_name, md5data,
|
||||
ud.sha256_name, sha256data)
|
||||
if bb.data.getVar("BB_STRICT_CHECKSUM", d, True) == "1":
|
||||
raise FetchError("No checksum specified for %s." % u)
|
||||
return
|
||||
|
||||
if (ud.md5_expected != md5data or ud.sha256_expected != sha256data):
|
||||
logger.error('The checksums for "%s" did not match.\n'
|
||||
' MD5: expected "%s", got "%s"\n'
|
||||
' SHA256: expected "%s", got "%s"\n',
|
||||
ud.localpath, ud.md5_expected, md5data,
|
||||
ud.sha256_expected, sha256data)
|
||||
raise FetchError("%s checksum mismatch." % u)
|
||||
|
||||
def go(d, urls = None):
|
||||
"""
|
||||
Fetch all urls
|
||||
init must have previously been called
|
||||
"""
|
||||
if not urls:
|
||||
urls = d.getVar("SRC_URI", 1).split()
|
||||
urldata = init(urls, d, True)
|
||||
|
||||
for u in urls:
|
||||
ud = urldata[u]
|
||||
m = ud.method
|
||||
localpath = ""
|
||||
|
||||
if not ud.localfile:
|
||||
continue
|
||||
|
||||
lf = bb.utils.lockfile(ud.lockfile)
|
||||
|
||||
if m.try_premirror(u, ud, d):
|
||||
# First try fetching uri, u, from PREMIRRORS
|
||||
mirrors = mirror_from_string(bb.data.getVar('PREMIRRORS', d, True))
|
||||
localpath = try_mirrors(d, u, mirrors, False, m.forcefetch(u, ud, d))
|
||||
elif os.path.exists(ud.localfile):
|
||||
localpath = ud.localfile
|
||||
|
||||
# Need to re-test forcefetch() which will return true if our copy is too old
|
||||
if m.forcefetch(u, ud, d) or not localpath:
|
||||
# Next try fetching from the original uri, u
|
||||
try:
|
||||
m.go(u, ud, d)
|
||||
localpath = ud.localpath
|
||||
except FetchError:
|
||||
# Remove any incomplete file
|
||||
bb.utils.remove(ud.localpath)
|
||||
# Finally, try fetching uri, u, from MIRRORS
|
||||
mirrors = mirror_from_string(bb.data.getVar('MIRRORS', d, True))
|
||||
localpath = try_mirrors (d, u, mirrors)
|
||||
if not localpath or not os.path.exists(localpath):
|
||||
raise FetchError("Unable to fetch URL %s from any source." % u)
|
||||
|
||||
ud.localpath = localpath
|
||||
|
||||
if os.path.exists(ud.md5):
|
||||
# Touch the md5 file to show active use of the download
|
||||
try:
|
||||
os.utime(ud.md5, None)
|
||||
except:
|
||||
# Errors aren't fatal here
|
||||
pass
|
||||
else:
|
||||
# Only check the checksums if we've not seen this item before
|
||||
verify_checksum(u, ud, d)
|
||||
Fetch.write_md5sum(u, ud, d)
|
||||
|
||||
bb.utils.unlockfile(lf)
|
||||
|
||||
def checkstatus(d, urls = None):
|
||||
"""
|
||||
Check all urls exist upstream
|
||||
init must have previously been called
|
||||
"""
|
||||
urldata = init([], d, True)
|
||||
|
||||
if not urls:
|
||||
urls = urldata
|
||||
|
||||
for u in urls:
|
||||
ud = urldata[u]
|
||||
m = ud.method
|
||||
logger.debug(1, "Testing URL %s", u)
|
||||
# First try checking uri, u, from PREMIRRORS
|
||||
mirrors = mirror_from_string(bb.data.getVar('PREMIRRORS', d, True))
|
||||
ret = try_mirrors(d, u, mirrors, True)
|
||||
if not ret:
|
||||
# Next try checking from the original uri, u
|
||||
try:
|
||||
ret = m.checkstatus(u, ud, d)
|
||||
except:
|
||||
# Finally, try checking uri, u, from MIRRORS
|
||||
mirrors = mirror_from_string(bb.data.getVar('MIRRORS', d, True))
|
||||
ret = try_mirrors (d, u, mirrors, True)
|
||||
|
||||
if not ret:
|
||||
raise FetchError("URL %s doesn't work" % u)
|
||||
|
||||
def localpaths(d):
|
||||
"""
|
||||
Return a list of the local filenames, assuming successful fetch
|
||||
"""
|
||||
local = []
|
||||
urldata = init([], d, True)
|
||||
|
||||
for u in urldata:
|
||||
ud = urldata[u]
|
||||
local.append(ud.localpath)
|
||||
|
||||
return local
|
||||
|
||||
srcrev_internal_call = False
|
||||
|
||||
def get_autorev(d):
|
||||
return get_srcrev(d)
|
||||
|
||||
def get_srcrev(d):
|
||||
"""
|
||||
Return the version string for the current package
|
||||
(usually to be used as PV)
|
||||
Most packages usually only have one SCM so we just pass on the call.
|
||||
In the multi SCM case, we build a value based on SRCREV_FORMAT which must
|
||||
have been set.
|
||||
"""
|
||||
|
||||
#
|
||||
# Ugly code alert. localpath in the fetchers will try to evaluate SRCREV which
|
||||
# could translate into a call to here. If it does, we need to catch this
|
||||
# and provide some way so it knows get_srcrev is active instead of being
|
||||
# some number etc. hence the srcrev_internal_call tracking and the magic
|
||||
# "SRCREVINACTION" return value.
|
||||
#
|
||||
# Neater solutions welcome!
|
||||
#
|
||||
if bb.fetch.srcrev_internal_call:
|
||||
return "SRCREVINACTION"
|
||||
|
||||
scms = []
|
||||
|
||||
# Only call setup_localpath on URIs which supports_srcrev()
|
||||
urldata = init(bb.data.getVar('SRC_URI', d, 1).split(), d, False)
|
||||
for u in urldata:
|
||||
ud = urldata[u]
|
||||
if ud.method.supports_srcrev():
|
||||
if not ud.setup:
|
||||
ud.setup_localpath(d)
|
||||
scms.append(u)
|
||||
|
||||
if len(scms) == 0:
|
||||
logger.error("SRCREV was used yet no valid SCM was found in SRC_URI")
|
||||
raise ParameterError
|
||||
|
||||
if bb.data.getVar('BB_SRCREV_POLICY', d, True) != "cache":
|
||||
bb.data.setVar('__BB_DONT_CACHE', '1', d)
|
||||
|
||||
if len(scms) == 1:
|
||||
return urldata[scms[0]].method.sortable_revision(scms[0], urldata[scms[0]], d)
|
||||
|
||||
#
|
||||
# Mutiple SCMs are in SRC_URI so we resort to SRCREV_FORMAT
|
||||
#
|
||||
format = bb.data.getVar('SRCREV_FORMAT', d, 1)
|
||||
if not format:
|
||||
logger.error("The SRCREV_FORMAT variable must be set when multiple SCMs are used.")
|
||||
raise ParameterError
|
||||
|
||||
for scm in scms:
|
||||
if 'name' in urldata[scm].parm:
|
||||
name = urldata[scm].parm["name"]
|
||||
rev = urldata[scm].method.sortable_revision(scm, urldata[scm], d)
|
||||
format = format.replace(name, rev)
|
||||
|
||||
return format
|
||||
|
||||
def localpath(url, d, cache = True):
|
||||
"""
|
||||
Called from the parser with cache=False since the cache isn't ready
|
||||
at this point. Also called from classed in OE e.g. patch.bbclass
|
||||
"""
|
||||
ud = init([url], d)
|
||||
if ud[url].method:
|
||||
return ud[url].localpath
|
||||
return url
|
||||
|
||||
def runfetchcmd(cmd, d, quiet = False):
|
||||
"""
|
||||
Run cmd returning the command output
|
||||
Raise an error if interrupted or cmd fails
|
||||
Optionally echo command output to stdout
|
||||
"""
|
||||
|
||||
# Need to export PATH as binary could be in metadata paths
|
||||
# rather than host provided
|
||||
# Also include some other variables.
|
||||
# FIXME: Should really include all export varaiables?
|
||||
exportvars = ['PATH', 'GIT_PROXY_COMMAND', 'GIT_PROXY_HOST',
|
||||
'GIT_PROXY_PORT', 'GIT_CONFIG', 'http_proxy', 'ftp_proxy',
|
||||
'https_proxy', 'no_proxy', 'ALL_PROXY', 'all_proxy',
|
||||
'KRB5CCNAME', 'SSH_AUTH_SOCK', 'SSH_AGENT_PID', 'HOME']
|
||||
|
||||
for var in exportvars:
|
||||
val = data.getVar(var, d, True)
|
||||
if val:
|
||||
cmd = 'export ' + var + '=\"%s\"; %s' % (val, cmd)
|
||||
|
||||
logger.debug(1, "Running %s", cmd)
|
||||
|
||||
# redirect stderr to stdout
|
||||
stdout_handle = os.popen(cmd + " 2>&1", "r")
|
||||
output = ""
|
||||
|
||||
while True:
|
||||
line = stdout_handle.readline()
|
||||
if not line:
|
||||
break
|
||||
if not quiet:
|
||||
print(line, end=' ')
|
||||
output += line
|
||||
|
||||
status = stdout_handle.close() or 0
|
||||
signal = status >> 8
|
||||
exitstatus = status & 0xff
|
||||
|
||||
if signal:
|
||||
raise FetchError("Fetch command %s failed with signal %s, output:\n%s" % (cmd, signal, output))
|
||||
elif status != 0:
|
||||
raise FetchError("Fetch command %s failed with exit code %s, output:\n%s" % (cmd, status, output))
|
||||
|
||||
return output
|
||||
|
||||
def try_mirrors(d, uri, mirrors, check = False, force = False):
|
||||
"""
|
||||
Try to use a mirrored version of the sources.
|
||||
This method will be automatically called before the fetchers go.
|
||||
|
||||
d Is a bb.data instance
|
||||
uri is the original uri we're trying to download
|
||||
mirrors is the list of mirrors we're going to try
|
||||
"""
|
||||
fpath = os.path.join(data.getVar("DL_DIR", d, 1), os.path.basename(uri))
|
||||
if not check and os.access(fpath, os.R_OK) and not force:
|
||||
logger.debug(1, "%s already exists, skipping checkout.", fpath)
|
||||
return fpath
|
||||
|
||||
ld = d.createCopy()
|
||||
for (find, replace) in mirrors:
|
||||
newuri = uri_replace(uri, find, replace, ld)
|
||||
if newuri != uri:
|
||||
try:
|
||||
ud = FetchData(newuri, ld)
|
||||
except bb.fetch.NoMethodError:
|
||||
logger.debug(1, "No method for %s", uri)
|
||||
continue
|
||||
|
||||
ud.setup_localpath(ld)
|
||||
|
||||
try:
|
||||
if check:
|
||||
found = ud.method.checkstatus(newuri, ud, ld)
|
||||
if found:
|
||||
return found
|
||||
else:
|
||||
ud.method.go(newuri, ud, ld)
|
||||
return ud.localpath
|
||||
except (bb.fetch.MissingParameterError,
|
||||
bb.fetch.FetchError,
|
||||
bb.fetch.MD5SumError):
|
||||
import sys
|
||||
(type, value, traceback) = sys.exc_info()
|
||||
logger.debug(2, "Mirror fetch failure: %s", value)
|
||||
bb.utils.remove(ud.localpath)
|
||||
continue
|
||||
return None
|
||||
|
||||
|
||||
class FetchData(object):
|
||||
"""
|
||||
A class which represents the fetcher state for a given URI.
|
||||
"""
|
||||
def __init__(self, url, d):
|
||||
self.localfile = ""
|
||||
(self.type, self.host, self.path, self.user, self.pswd, self.parm) = decodeurl(data.expand(url, d))
|
||||
self.date = Fetch.getSRCDate(self, d)
|
||||
self.url = url
|
||||
if not self.user and "user" in self.parm:
|
||||
self.user = self.parm["user"]
|
||||
if not self.pswd and "pswd" in self.parm:
|
||||
self.pswd = self.parm["pswd"]
|
||||
self.setup = False
|
||||
|
||||
if "name" in self.parm:
|
||||
self.md5_name = "%s.md5sum" % self.parm["name"]
|
||||
self.sha256_name = "%s.sha256sum" % self.parm["name"]
|
||||
else:
|
||||
self.md5_name = "md5sum"
|
||||
self.sha256_name = "sha256sum"
|
||||
self.md5_expected = bb.data.getVarFlag("SRC_URI", self.md5_name, d)
|
||||
self.sha256_expected = bb.data.getVarFlag("SRC_URI", self.sha256_name, d)
|
||||
|
||||
for m in methods:
|
||||
if m.supports(url, self, d):
|
||||
self.method = m
|
||||
return
|
||||
raise NoMethodError("Missing implementation for url %s" % url)
|
||||
|
||||
def setup_localpath(self, d):
|
||||
self.setup = True
|
||||
if "localpath" in self.parm:
|
||||
# if user sets localpath for file, use it instead.
|
||||
self.localpath = self.parm["localpath"]
|
||||
self.basename = os.path.basename(self.localpath)
|
||||
else:
|
||||
premirrors = bb.data.getVar('PREMIRRORS', d, True)
|
||||
local = ""
|
||||
if premirrors and self.url:
|
||||
aurl = self.url.split(";")[0]
|
||||
mirrors = mirror_from_string(premirrors)
|
||||
for (find, replace) in mirrors:
|
||||
if replace.startswith("file://"):
|
||||
path = aurl.split("://")[1]
|
||||
path = path.split(";")[0]
|
||||
local = replace.split("://")[1] + os.path.basename(path)
|
||||
if local == aurl or not os.path.exists(local) or os.path.isdir(local):
|
||||
local = ""
|
||||
self.localpath = local
|
||||
if not local:
|
||||
try:
|
||||
bb.fetch.srcrev_internal_call = True
|
||||
self.localpath = self.method.localpath(self.url, self, d)
|
||||
finally:
|
||||
bb.fetch.srcrev_internal_call = False
|
||||
# We have to clear data's internal caches since the cached value of SRCREV is now wrong.
|
||||
# Horrible...
|
||||
bb.data.delVar("ISHOULDNEVEREXIST", d)
|
||||
|
||||
if self.localpath is not None:
|
||||
# Note: These files should always be in DL_DIR whereas localpath may not be.
|
||||
basepath = bb.data.expand("${DL_DIR}/%s" % os.path.basename(self.localpath), d)
|
||||
self.md5 = basepath + '.md5'
|
||||
self.lockfile = basepath + '.lock'
|
||||
|
||||
|
||||
class Fetch(object):
|
||||
"""Base class for 'fetch'ing data"""
|
||||
|
||||
def __init__(self, urls = []):
|
||||
self.urls = []
|
||||
|
||||
def supports(self, url, urldata, d):
|
||||
"""
|
||||
Check to see if this fetch class supports a given url.
|
||||
"""
|
||||
return 0
|
||||
|
||||
def localpath(self, url, urldata, d):
|
||||
"""
|
||||
Return the local filename of a given url assuming a successful fetch.
|
||||
Can also setup variables in urldata for use in go (saving code duplication
|
||||
and duplicate code execution)
|
||||
"""
|
||||
return url
|
||||
def _strip_leading_slashes(self, relpath):
|
||||
"""
|
||||
Remove leading slash as os.path.join can't cope
|
||||
"""
|
||||
while os.path.isabs(relpath):
|
||||
relpath = relpath[1:]
|
||||
return relpath
|
||||
|
||||
def setUrls(self, urls):
|
||||
self.__urls = urls
|
||||
|
||||
def getUrls(self):
|
||||
return self.__urls
|
||||
|
||||
urls = property(getUrls, setUrls, None, "Urls property")
|
||||
|
||||
def forcefetch(self, url, urldata, d):
|
||||
"""
|
||||
Force a fetch, even if localpath exists?
|
||||
"""
|
||||
return False
|
||||
|
||||
def supports_srcrev(self):
|
||||
"""
|
||||
The fetcher supports auto source revisions (SRCREV)
|
||||
"""
|
||||
return False
|
||||
|
||||
def go(self, url, urldata, d):
|
||||
"""
|
||||
Fetch urls
|
||||
Assumes localpath was called first
|
||||
"""
|
||||
raise NoMethodError("Missing implementation for url")
|
||||
|
||||
def try_premirror(self, url, urldata, d):
|
||||
"""
|
||||
Should premirrors be used?
|
||||
"""
|
||||
if urldata.method.forcefetch(url, urldata, d):
|
||||
return True
|
||||
elif os.path.exists(urldata.md5) and os.path.exists(urldata.localfile):
|
||||
return False
|
||||
else:
|
||||
return True
|
||||
|
||||
def checkstatus(self, url, urldata, d):
|
||||
"""
|
||||
Check the status of a URL
|
||||
Assumes localpath was called first
|
||||
"""
|
||||
logger.info("URL %s could not be checked for status since no method exists.", url)
|
||||
return True
|
||||
|
||||
def getSRCDate(urldata, d):
|
||||
"""
|
||||
Return the SRC Date for the component
|
||||
|
||||
d the bb.data module
|
||||
"""
|
||||
if "srcdate" in urldata.parm:
|
||||
return urldata.parm['srcdate']
|
||||
|
||||
pn = data.getVar("PN", d, 1)
|
||||
|
||||
if pn:
|
||||
return data.getVar("SRCDATE_%s" % pn, d, 1) or data.getVar("CVSDATE_%s" % pn, d, 1) or data.getVar("SRCDATE", d, 1) or data.getVar("CVSDATE", d, 1) or data.getVar("DATE", d, 1)
|
||||
|
||||
return data.getVar("SRCDATE", d, 1) or data.getVar("CVSDATE", d, 1) or data.getVar("DATE", d, 1)
|
||||
getSRCDate = staticmethod(getSRCDate)
|
||||
|
||||
def srcrev_internal_helper(ud, d):
|
||||
"""
|
||||
Return:
|
||||
a) a source revision if specified
|
||||
b) True if auto srcrev is in action
|
||||
c) False otherwise
|
||||
"""
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
return ud.parm['rev']
|
||||
|
||||
if 'tag' in ud.parm:
|
||||
return ud.parm['tag']
|
||||
|
||||
rev = None
|
||||
if 'name' in ud.parm:
|
||||
pn = data.getVar("PN", d, 1)
|
||||
rev = data.getVar("SRCREV_%s_pn-%s" % (ud.parm['name'], pn), d, 1)
|
||||
if not rev:
|
||||
rev = data.getVar("SRCREV_pn-%s_%s" % (pn, ud.parm['name']), d, 1)
|
||||
if not rev:
|
||||
rev = data.getVar("SRCREV_%s" % (ud.parm['name']), d, 1)
|
||||
if not rev:
|
||||
rev = data.getVar("SRCREV", d, 1)
|
||||
if rev == "INVALID":
|
||||
raise InvalidSRCREV("Please set SRCREV to a valid value")
|
||||
if not rev:
|
||||
return False
|
||||
if rev == "SRCREVINACTION":
|
||||
return True
|
||||
return rev
|
||||
|
||||
srcrev_internal_helper = staticmethod(srcrev_internal_helper)
|
||||
|
||||
def localcount_internal_helper(ud, d):
|
||||
"""
|
||||
Return:
|
||||
a) a locked localcount if specified
|
||||
b) None otherwise
|
||||
"""
|
||||
|
||||
localcount = None
|
||||
if 'name' in ud.parm:
|
||||
pn = data.getVar("PN", d, 1)
|
||||
localcount = data.getVar("LOCALCOUNT_" + ud.parm['name'], d, 1)
|
||||
if not localcount:
|
||||
localcount = data.getVar("LOCALCOUNT", d, 1)
|
||||
return localcount
|
||||
|
||||
localcount_internal_helper = staticmethod(localcount_internal_helper)
|
||||
|
||||
def verify_md5sum(ud, got_sum):
|
||||
"""
|
||||
Verify the md5sum we wanted with the one we got
|
||||
"""
|
||||
wanted_sum = ud.parm.get('md5sum')
|
||||
if not wanted_sum:
|
||||
return True
|
||||
|
||||
return wanted_sum == got_sum
|
||||
verify_md5sum = staticmethod(verify_md5sum)
|
||||
|
||||
def write_md5sum(url, ud, d):
|
||||
md5data = bb.utils.md5_file(ud.localpath)
|
||||
# verify the md5sum
|
||||
if not Fetch.verify_md5sum(ud, md5data):
|
||||
raise MD5SumError(url)
|
||||
|
||||
md5out = file(ud.md5, 'w')
|
||||
md5out.write(md5data)
|
||||
md5out.close()
|
||||
write_md5sum = staticmethod(write_md5sum)
|
||||
|
||||
def latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Look in the cache for the latest revision, if not present ask the SCM.
|
||||
"""
|
||||
if not hasattr(self, "_latest_revision"):
|
||||
raise ParameterError
|
||||
|
||||
pd = persist_data.persist(d)
|
||||
revs = pd['BB_URI_HEADREVS']
|
||||
key = self.generate_revision_key(url, ud, d)
|
||||
rev = revs[key]
|
||||
if rev != None:
|
||||
return str(rev)
|
||||
|
||||
revs[key] = rev = self._latest_revision(url, ud, d)
|
||||
return rev
|
||||
|
||||
def sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
|
||||
"""
|
||||
if hasattr(self, "_sortable_revision"):
|
||||
return self._sortable_revision(url, ud, d)
|
||||
|
||||
pd = persist_data.persist(d)
|
||||
localcounts = pd['BB_URI_LOCALCOUNT']
|
||||
key = self.generate_revision_key(url, ud, d)
|
||||
|
||||
latest_rev = self._build_revision(url, ud, d)
|
||||
last_rev = localcounts[key + '_rev']
|
||||
uselocalcount = bb.data.getVar("BB_LOCALCOUNT_OVERRIDE", d, True) or False
|
||||
count = None
|
||||
if uselocalcount:
|
||||
count = Fetch.localcount_internal_helper(ud, d)
|
||||
if count is None:
|
||||
count = localcounts[key + '_count']
|
||||
|
||||
if last_rev == latest_rev:
|
||||
return str(count + "+" + latest_rev)
|
||||
|
||||
buildindex_provided = hasattr(self, "_sortable_buildindex")
|
||||
if buildindex_provided:
|
||||
count = self._sortable_buildindex(url, ud, d, latest_rev)
|
||||
|
||||
if count is None:
|
||||
count = "0"
|
||||
elif uselocalcount or buildindex_provided:
|
||||
count = str(count)
|
||||
else:
|
||||
count = str(int(count) + 1)
|
||||
|
||||
localcounts[key + '_rev'] = latest_rev
|
||||
localcounts[key + '_count'] = count
|
||||
|
||||
return str(count + "+" + latest_rev)
|
||||
|
||||
def generate_revision_key(self, url, ud, d):
|
||||
key = self._revision_key(url, ud, d)
|
||||
return "%s-%s" % (key, bb.data.getVar("PN", d, True) or "")
|
||||
|
||||
from . import cvs
|
||||
from . import git
|
||||
from . import local
|
||||
from . import svn
|
||||
from . import wget
|
||||
from . import svk
|
||||
from . import ssh
|
||||
from . import perforce
|
||||
from . import bzr
|
||||
from . import hg
|
||||
from . import osc
|
||||
from . import repo
|
||||
|
||||
methods.append(local.Local())
|
||||
methods.append(wget.Wget())
|
||||
methods.append(svn.Svn())
|
||||
methods.append(git.Git())
|
||||
methods.append(cvs.Cvs())
|
||||
methods.append(svk.Svk())
|
||||
methods.append(ssh.SSH())
|
||||
methods.append(perforce.Perforce())
|
||||
methods.append(bzr.Bzr())
|
||||
methods.append(hg.Hg())
|
||||
methods.append(osc.Osc())
|
||||
methods.append(repo.Repo())
|
||||
148
bitbake/lib/bb/fetch/bzr.py
Normal file
148
bitbake/lib/bb/fetch/bzr.py
Normal file
@@ -0,0 +1,148 @@
|
||||
"""
|
||||
BitBake 'Fetch' implementation for bzr.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2007 Ross Burton
|
||||
# Copyright (C) 2007 Richard Purdie
|
||||
#
|
||||
# Classes for obtaining upstream sources for the
|
||||
# BitBake build tools.
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch, FetchError, runfetchcmd, logger
|
||||
|
||||
class Bzr(Fetch):
|
||||
def supports(self, url, ud, d):
|
||||
return ud.type in ['bzr']
|
||||
|
||||
def localpath (self, url, ud, d):
|
||||
|
||||
# Create paths to bzr checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(data.expand('${BZRDIR}', d), ud.host, relpath)
|
||||
|
||||
revision = Fetch.srcrev_internal_helper(ud, d)
|
||||
if revision is True:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
elif revision:
|
||||
ud.revision = revision
|
||||
|
||||
if not ud.revision:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
|
||||
ud.localfile = data.expand('bzr_%s_%s_%s.tar.gz' % (ud.host, ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def _buildbzrcommand(self, ud, d, command):
|
||||
"""
|
||||
Build up an bzr commandline based on ud
|
||||
command is "fetch", "update", "revno"
|
||||
"""
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_bzr}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'http')
|
||||
|
||||
bzrroot = ud.host + ud.path
|
||||
|
||||
options = []
|
||||
|
||||
if command is "revno":
|
||||
bzrcmd = "%s revno %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
else:
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
if command is "fetch":
|
||||
bzrcmd = "%s co %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
elif command is "update":
|
||||
bzrcmd = "%s pull %s --overwrite" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid bzr command %s" % command)
|
||||
|
||||
return bzrcmd
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
if os.access(os.path.join(ud.pkgdir, os.path.basename(ud.pkgdir), '.bzr'), os.R_OK):
|
||||
bzrcmd = self._buildbzrcommand(ud, d, "update")
|
||||
logger.debug(1, "BZR Update %s", loc)
|
||||
os.chdir(os.path.join (ud.pkgdir, os.path.basename(ud.path)))
|
||||
runfetchcmd(bzrcmd, d)
|
||||
else:
|
||||
bb.utils.remove(os.path.join(ud.pkgdir, os.path.basename(ud.pkgdir)), True)
|
||||
bzrcmd = self._buildbzrcommand(ud, d, "fetch")
|
||||
logger.debug(1, "BZR Checkout %s", loc)
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", bzrcmd)
|
||||
runfetchcmd(bzrcmd, d)
|
||||
|
||||
os.chdir(ud.pkgdir)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude '.bzr' --exclude '.bzrtags'"
|
||||
|
||||
# tar them up to a defined filename
|
||||
try:
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(ud.pkgdir)), d)
|
||||
except:
|
||||
t, v, tb = sys.exc_info()
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise t, v, tb
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
def _revision_key(self, url, ud, d):
|
||||
"""
|
||||
Return a unique key for the url
|
||||
"""
|
||||
return "bzr:" + ud.pkgdir
|
||||
|
||||
def _latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Return the latest upstream revision number
|
||||
"""
|
||||
logger.debug(2, "BZR fetcher hitting network for %s", url)
|
||||
|
||||
output = runfetchcmd(self._buildbzrcommand(ud, d, "revno"), d, True)
|
||||
|
||||
return output.strip()
|
||||
|
||||
def _sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
Return a sortable revision number which in our case is the revision number
|
||||
"""
|
||||
|
||||
return self._build_revision(url, ud, d)
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
172
bitbake/lib/bb/fetch/cvs.py
Normal file
172
bitbake/lib/bb/fetch/cvs.py
Normal file
@@ -0,0 +1,172 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
#Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
#
|
||||
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch, FetchError, MissingParameterError, logger
|
||||
|
||||
class Cvs(Fetch):
|
||||
"""
|
||||
Class to fetch a module or modules from cvs repositories
|
||||
"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with cvs.
|
||||
"""
|
||||
return ud.type in ['cvs']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("cvs method needs a 'module' parameter")
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
ud.tag = ud.parm.get('tag', "")
|
||||
|
||||
# Override the default date in certain cases
|
||||
if 'date' in ud.parm:
|
||||
ud.date = ud.parm['date']
|
||||
elif ud.tag:
|
||||
ud.date = ""
|
||||
|
||||
norecurse = ''
|
||||
if 'norecurse' in ud.parm:
|
||||
norecurse = '_norecurse'
|
||||
|
||||
fullpath = ''
|
||||
if 'fullpath' in ud.parm:
|
||||
fullpath = '_fullpath'
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def forcefetch(self, url, ud, d):
|
||||
if (ud.date == "now"):
|
||||
return True
|
||||
return False
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
|
||||
method = ud.parm.get('method', 'pserver')
|
||||
localdir = ud.parm.get('localdir', ud.module)
|
||||
cvs_port = ud.parm.get('port', '')
|
||||
|
||||
cvs_rsh = None
|
||||
if method == "ext":
|
||||
if "rsh" in ud.parm:
|
||||
cvs_rsh = ud.parm["rsh"]
|
||||
|
||||
if method == "dir":
|
||||
cvsroot = ud.path
|
||||
else:
|
||||
cvsroot = ":" + method
|
||||
cvsproxyhost = data.getVar('CVS_PROXY_HOST', d, True)
|
||||
if cvsproxyhost:
|
||||
cvsroot += ";proxy=" + cvsproxyhost
|
||||
cvsproxyport = data.getVar('CVS_PROXY_PORT', d, True)
|
||||
if cvsproxyport:
|
||||
cvsroot += ";proxyport=" + cvsproxyport
|
||||
cvsroot += ":" + ud.user
|
||||
if ud.pswd:
|
||||
cvsroot += ":" + ud.pswd
|
||||
cvsroot += "@" + ud.host + ":" + cvs_port + ud.path
|
||||
|
||||
options = []
|
||||
if 'norecurse' in ud.parm:
|
||||
options.append("-l")
|
||||
if ud.date:
|
||||
# treat YYYYMMDDHHMM specially for CVS
|
||||
if len(ud.date) == 12:
|
||||
options.append("-D \"%s %s:%s UTC\"" % (ud.date[0:8], ud.date[8:10], ud.date[10:12]))
|
||||
else:
|
||||
options.append("-D \"%s UTC\"" % ud.date)
|
||||
if ud.tag:
|
||||
options.append("-r %s" % ud.tag)
|
||||
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "cvs:%s" % data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
data.setVar('CVSROOT', cvsroot, localdata)
|
||||
data.setVar('CVSCOOPTS', " ".join(options), localdata)
|
||||
data.setVar('CVSMODULE', ud.module, localdata)
|
||||
cvscmd = data.getVar('FETCHCOMMAND', localdata, 1)
|
||||
cvsupdatecmd = data.getVar('UPDATECOMMAND', localdata, 1)
|
||||
|
||||
if cvs_rsh:
|
||||
cvscmd = "CVS_RSH=\"%s\" %s" % (cvs_rsh, cvscmd)
|
||||
cvsupdatecmd = "CVS_RSH=\"%s\" %s" % (cvs_rsh, cvsupdatecmd)
|
||||
|
||||
# create module directory
|
||||
logger.debug(2, "Fetch: checking for module directory")
|
||||
pkg = data.expand('${PN}', d)
|
||||
pkgdir = os.path.join(data.expand('${CVSDIR}', localdata), pkg)
|
||||
moddir = os.path.join(pkgdir, localdir)
|
||||
if os.access(os.path.join(moddir, 'CVS'), os.R_OK):
|
||||
logger.info("Update " + loc)
|
||||
# update sources there
|
||||
os.chdir(moddir)
|
||||
myret = os.system(cvsupdatecmd)
|
||||
else:
|
||||
logger.info("Fetch " + loc)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(pkgdir)
|
||||
os.chdir(pkgdir)
|
||||
logger.debug(1, "Running %s", cvscmd)
|
||||
myret = os.system(cvscmd)
|
||||
|
||||
if myret != 0 or not os.access(moddir, os.R_OK):
|
||||
try:
|
||||
os.rmdir(moddir)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(ud.module)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude 'CVS'"
|
||||
|
||||
# tar them up to a defined filename
|
||||
if 'fullpath' in ud.parm:
|
||||
os.chdir(pkgdir)
|
||||
myret = os.system("tar %s -czf %s %s" % (tar_flags, ud.localpath, localdir))
|
||||
else:
|
||||
os.chdir(moddir)
|
||||
os.chdir('..')
|
||||
myret = os.system("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(moddir)))
|
||||
|
||||
if myret != 0:
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(ud.module)
|
||||
339
bitbake/lib/bb/fetch/git.py
Normal file
339
bitbake/lib/bb/fetch/git.py
Normal file
@@ -0,0 +1,339 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' git implementation
|
||||
|
||||
"""
|
||||
|
||||
#Copyright (C) 2005 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import bb
|
||||
import bb.persist_data
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import runfetchcmd
|
||||
from bb.fetch import logger
|
||||
|
||||
class Git(Fetch):
|
||||
"""Class to fetch a module or modules from git repositories"""
|
||||
def init(self, d):
|
||||
#
|
||||
# Only enable _sortable revision if the key is set
|
||||
#
|
||||
if bb.data.getVar("BB_GIT_CLONE_FOR_SRCREV", d, True):
|
||||
self._sortable_buildindex = self._sortable_buildindex_disabled
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with git.
|
||||
"""
|
||||
return ud.type in ['git']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
|
||||
if 'protocol' in ud.parm:
|
||||
ud.proto = ud.parm['protocol']
|
||||
elif not ud.host:
|
||||
ud.proto = 'file'
|
||||
else:
|
||||
ud.proto = "rsync"
|
||||
|
||||
ud.branch = ud.parm.get("branch", "master")
|
||||
|
||||
gitsrcname = '%s%s' % (ud.host, ud.path.replace('/', '.'))
|
||||
ud.mirrortarball = 'git_%s.tar.gz' % (gitsrcname)
|
||||
ud.clonedir = os.path.join(data.expand('${GITDIR}', d), gitsrcname)
|
||||
|
||||
tag = Fetch.srcrev_internal_helper(ud, d)
|
||||
if tag is True:
|
||||
ud.tag = self.latest_revision(url, ud, d)
|
||||
elif tag:
|
||||
ud.tag = tag
|
||||
|
||||
if not ud.tag or ud.tag == "master":
|
||||
ud.tag = self.latest_revision(url, ud, d)
|
||||
|
||||
subdir = ud.parm.get("subpath", "")
|
||||
if subdir != "":
|
||||
if subdir.endswith("/"):
|
||||
subdir = subdir[:-1]
|
||||
subdirpath = os.path.join(ud.path, subdir);
|
||||
else:
|
||||
subdirpath = ud.path;
|
||||
|
||||
if 'fullclone' in ud.parm:
|
||||
ud.localfile = ud.mirrortarball
|
||||
else:
|
||||
ud.localfile = data.expand('git_%s%s_%s.tar.gz' % (ud.host, subdirpath.replace('/', '.'), ud.tag), d)
|
||||
|
||||
ud.basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
|
||||
if 'noclone' in ud.parm:
|
||||
ud.localfile = None
|
||||
return None
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def forcefetch(self, url, ud, d):
|
||||
if 'fullclone' in ud.parm:
|
||||
return True
|
||||
if 'noclone' in ud.parm:
|
||||
return False
|
||||
if os.path.exists(ud.localpath):
|
||||
return False
|
||||
if not self._contains_ref(ud.tag, d):
|
||||
return True
|
||||
return False
|
||||
|
||||
def try_premirror(self, u, ud, d):
|
||||
if 'noclone' in ud.parm:
|
||||
return False
|
||||
if os.path.exists(ud.clonedir):
|
||||
return False
|
||||
if os.path.exists(ud.localpath):
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
if ud.user:
|
||||
username = ud.user + '@'
|
||||
else:
|
||||
username = ""
|
||||
|
||||
repofile = os.path.join(data.getVar("DL_DIR", d, 1), ud.mirrortarball)
|
||||
|
||||
|
||||
coname = '%s' % (ud.tag)
|
||||
codir = os.path.join(ud.clonedir, coname)
|
||||
|
||||
# If we have no existing clone and no mirror tarball, try and obtain one
|
||||
if not os.path.exists(ud.clonedir) and not os.path.exists(repofile):
|
||||
try:
|
||||
Fetch.try_mirrors(ud.mirrortarball)
|
||||
except:
|
||||
pass
|
||||
|
||||
# If the checkout doesn't exist and the mirror tarball does, extract it
|
||||
if not os.path.exists(ud.clonedir) and os.path.exists(repofile):
|
||||
bb.utils.mkdirhier(ud.clonedir)
|
||||
os.chdir(ud.clonedir)
|
||||
runfetchcmd("tar -xzf %s" % (repofile), d)
|
||||
|
||||
# If the repo still doesn't exist, fallback to cloning it
|
||||
if not os.path.exists(ud.clonedir):
|
||||
runfetchcmd("%s clone -n %s://%s%s%s %s" % (ud.basecmd, ud.proto, username, ud.host, ud.path, ud.clonedir), d)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
# Update the checkout if needed
|
||||
if not self._contains_ref(ud.tag, d) or 'fullclone' in ud.parm:
|
||||
# Remove all but the .git directory
|
||||
runfetchcmd("rm * -Rf", d)
|
||||
if 'fullclone' in ud.parm:
|
||||
runfetchcmd("%s fetch --all" % (ud.basecmd), d)
|
||||
else:
|
||||
runfetchcmd("%s fetch %s://%s%s%s %s" % (ud.basecmd, ud.proto, username, ud.host, ud.path, ud.branch), d)
|
||||
runfetchcmd("%s fetch --tags %s://%s%s%s" % (ud.basecmd, ud.proto, username, ud.host, ud.path), d)
|
||||
runfetchcmd("%s prune-packed" % ud.basecmd, d)
|
||||
runfetchcmd("%s pack-redundant --all | xargs -r rm" % ud.basecmd, d)
|
||||
|
||||
# Generate a mirror tarball if needed
|
||||
os.chdir(ud.clonedir)
|
||||
mirror_tarballs = data.getVar("BB_GENERATE_MIRROR_TARBALLS", d, True)
|
||||
if mirror_tarballs != "0" or 'fullclone' in ud.parm:
|
||||
logger.info("Creating tarball of git repository")
|
||||
runfetchcmd("tar -czf %s %s" % (repofile, os.path.join(".", ".git", "*") ), d)
|
||||
|
||||
if 'fullclone' in ud.parm:
|
||||
return
|
||||
|
||||
if os.path.exists(codir):
|
||||
bb.utils.prunedir(codir)
|
||||
|
||||
subdir = ud.parm.get("subpath", "")
|
||||
if subdir != "":
|
||||
if subdir.endswith("/"):
|
||||
subdirbase = os.path.basename(subdir[:-1])
|
||||
else:
|
||||
subdirbase = os.path.basename(subdir)
|
||||
else:
|
||||
subdirbase = ""
|
||||
|
||||
if subdir != "":
|
||||
readpathspec = ":%s" % (subdir)
|
||||
codir = os.path.join(codir, "git")
|
||||
coprefix = os.path.join(codir, subdirbase, "")
|
||||
else:
|
||||
readpathspec = ""
|
||||
coprefix = os.path.join(codir, "git", "")
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
runfetchcmd("%s clone -n %s %s" % (ud.basecmd, ud.clonedir, coprefix), d)
|
||||
os.chdir(coprefix)
|
||||
runfetchcmd("%s checkout -q -f %s%s" % (ud.basecmd, ud.tag, readpathspec), d)
|
||||
else:
|
||||
bb.utils.mkdirhier(codir)
|
||||
os.chdir(ud.clonedir)
|
||||
runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.tag, readpathspec), d)
|
||||
runfetchcmd("%s checkout-index -q -f --prefix=%s -a" % (ud.basecmd, coprefix), d)
|
||||
|
||||
os.chdir(codir)
|
||||
logger.info("Creating tarball of git checkout")
|
||||
runfetchcmd("tar -czf %s %s" % (ud.localpath, os.path.join(".", "*") ), d)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
bb.utils.prunedir(codir)
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
def _contains_ref(self, tag, d):
|
||||
basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
output = runfetchcmd("%s log --pretty=oneline -n 1 %s -- 2> /dev/null | wc -l" % (basecmd, tag), d, quiet=True)
|
||||
return output.split()[0] != "0"
|
||||
|
||||
def _revision_key(self, url, ud, d, branch=False):
|
||||
"""
|
||||
Return a unique key for the url
|
||||
"""
|
||||
key = 'git:' + ud.host + ud.path.replace('/', '.')
|
||||
if branch:
|
||||
return key + ud.branch
|
||||
else:
|
||||
return key
|
||||
|
||||
def generate_revision_key(self, url, ud, d, branch=False):
|
||||
key = self._revision_key(url, ud, d, branch)
|
||||
return "%s-%s" % (key, bb.data.getVar("PN", d, True) or "")
|
||||
|
||||
def _latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Compute the HEAD revision for the url
|
||||
"""
|
||||
if ud.user:
|
||||
username = ud.user + '@'
|
||||
else:
|
||||
username = ""
|
||||
|
||||
basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
cmd = "%s ls-remote %s://%s%s%s %s" % (basecmd, ud.proto, username, ud.host, ud.path, ud.branch)
|
||||
output = runfetchcmd(cmd, d, True)
|
||||
if not output:
|
||||
raise bb.fetch.FetchError("Fetch command %s gave empty output\n" % (cmd))
|
||||
return output.split()[0]
|
||||
|
||||
def latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Look in the cache for the latest revision, if not present ask the SCM.
|
||||
"""
|
||||
persisted = bb.persist_data.persist(d)
|
||||
revs = persisted['BB_URI_HEADREVS']
|
||||
|
||||
key = self.generate_revision_key(url, ud, d, branch=True)
|
||||
rev = revs[key]
|
||||
if rev is None:
|
||||
# Compatibility with old key format, no branch included
|
||||
oldkey = self.generate_revision_key(url, ud, d, branch=False)
|
||||
rev = revs[oldkey]
|
||||
if rev is not None:
|
||||
del revs[oldkey]
|
||||
else:
|
||||
rev = self._latest_revision(url, ud, d)
|
||||
revs[key] = rev
|
||||
|
||||
return str(rev)
|
||||
|
||||
def sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
|
||||
"""
|
||||
pd = bb.persist_data.persist(d)
|
||||
localcounts = pd['BB_URI_LOCALCOUNT']
|
||||
key = self.generate_revision_key(url, ud, d, branch=True)
|
||||
oldkey = self.generate_revision_key(url, ud, d, branch=False)
|
||||
|
||||
latest_rev = self._build_revision(url, ud, d)
|
||||
last_rev = localcounts[key + '_rev']
|
||||
if last_rev is None:
|
||||
last_rev = localcounts[oldkey + '_rev']
|
||||
if last_rev is not None:
|
||||
del localcounts[oldkey + '_rev']
|
||||
localcounts[key + '_rev'] = last_rev
|
||||
|
||||
uselocalcount = bb.data.getVar("BB_LOCALCOUNT_OVERRIDE", d, True) or False
|
||||
count = None
|
||||
if uselocalcount:
|
||||
count = Fetch.localcount_internal_helper(ud, d)
|
||||
if count is None:
|
||||
count = localcounts[key + '_count']
|
||||
if count is None:
|
||||
count = localcounts[oldkey + '_count']
|
||||
if count is not None:
|
||||
del localcounts[oldkey + '_count']
|
||||
localcounts[key + '_count'] = count
|
||||
|
||||
if last_rev == latest_rev:
|
||||
return str(count + "+" + latest_rev)
|
||||
|
||||
buildindex_provided = hasattr(self, "_sortable_buildindex")
|
||||
if buildindex_provided:
|
||||
count = self._sortable_buildindex(url, ud, d, latest_rev)
|
||||
if count is None:
|
||||
count = "0"
|
||||
elif uselocalcount or buildindex_provided:
|
||||
count = str(count)
|
||||
else:
|
||||
count = str(int(count) + 1)
|
||||
|
||||
localcounts[key + '_rev'] = latest_rev
|
||||
localcounts[key + '_count'] = count
|
||||
|
||||
return str(count + "+" + latest_rev)
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.tag
|
||||
|
||||
def _sortable_buildindex_disabled(self, url, ud, d, rev):
|
||||
"""
|
||||
Return a suitable buildindex for the revision specified. This is done by counting revisions
|
||||
using "git rev-list" which may or may not work in different circumstances.
|
||||
"""
|
||||
|
||||
cwd = os.getcwd()
|
||||
|
||||
# Check if we have the rev already
|
||||
|
||||
if not os.path.exists(ud.clonedir):
|
||||
print("no repo")
|
||||
self.go(None, ud, d)
|
||||
if not os.path.exists(ud.clonedir):
|
||||
logger.error("GIT repository for %s doesn't exist in %s, cannot get sortable buildnumber, using old value", url, ud.clonedir)
|
||||
return None
|
||||
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
if not self._contains_ref(rev, d):
|
||||
self.go(None, ud, d)
|
||||
|
||||
output = runfetchcmd("%s rev-list %s -- 2> /dev/null | wc -l" % (ud.basecmd, rev), d, quiet=True)
|
||||
os.chdir(cwd)
|
||||
|
||||
buildindex = "%s" % output.split()[0]
|
||||
logger.debug(1, "GIT repository for %s in %s is returning %s revisions in rev-list before %s", url, ud.clonedir, buildindex, rev)
|
||||
return buildindex
|
||||
180
bitbake/lib/bb/fetch/hg.py
Normal file
180
bitbake/lib/bb/fetch/hg.py
Normal file
@@ -0,0 +1,180 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementation for mercurial DRCS (hg).
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
# Copyright (C) 2004 Marcin Juszkiewicz
|
||||
# Copyright (C) 2007 Robert Schuster
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import MissingParameterError
|
||||
from bb.fetch import runfetchcmd
|
||||
from bb.fetch import logger
|
||||
|
||||
class Hg(Fetch):
|
||||
"""Class to fetch from mercurial repositories"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with mercurial.
|
||||
"""
|
||||
return ud.type in ['hg']
|
||||
|
||||
def forcefetch(self, url, ud, d):
|
||||
revTag = ud.parm.get('rev', 'tip')
|
||||
return revTag == "tip"
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("hg method needs a 'module' parameter")
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
# Create paths to mercurial checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(data.expand('${HGDIR}', d), ud.host, relpath)
|
||||
ud.moddir = os.path.join(ud.pkgdir, ud.module)
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
ud.revision = ud.parm['rev']
|
||||
else:
|
||||
tag = Fetch.srcrev_internal_helper(ud, d)
|
||||
if tag is True:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
elif tag:
|
||||
ud.revision = tag
|
||||
else:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def _buildhgcommand(self, ud, d, command):
|
||||
"""
|
||||
Build up an hg commandline based on ud
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_hg}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'http')
|
||||
|
||||
host = ud.host
|
||||
if proto == "file":
|
||||
host = "/"
|
||||
ud.host = "localhost"
|
||||
|
||||
if not ud.user:
|
||||
hgroot = host + ud.path
|
||||
else:
|
||||
hgroot = ud.user + "@" + host + ud.path
|
||||
|
||||
if command is "info":
|
||||
return "%s identify -i %s://%s/%s" % (basecmd, proto, hgroot, ud.module)
|
||||
|
||||
options = [];
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
if command is "fetch":
|
||||
cmd = "%s clone %s %s://%s/%s %s" % (basecmd, " ".join(options), proto, hgroot, ud.module, ud.module)
|
||||
elif command is "pull":
|
||||
# do not pass options list; limiting pull to rev causes the local
|
||||
# repo not to contain it and immediately following "update" command
|
||||
# will crash
|
||||
cmd = "%s pull" % (basecmd)
|
||||
elif command is "update":
|
||||
cmd = "%s update -C %s" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid hg command %s" % command)
|
||||
|
||||
return cmd
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
|
||||
|
||||
if os.access(os.path.join(ud.moddir, '.hg'), os.R_OK):
|
||||
updatecmd = self._buildhgcommand(ud, d, "pull")
|
||||
logger.info("Update " + loc)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", updatecmd)
|
||||
runfetchcmd(updatecmd, d)
|
||||
|
||||
else:
|
||||
fetchcmd = self._buildhgcommand(ud, d, "fetch")
|
||||
logger.info("Fetch " + loc)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", fetchcmd)
|
||||
runfetchcmd(fetchcmd, d)
|
||||
|
||||
# Even when we clone (fetch), we still need to update as hg's clone
|
||||
# won't checkout the specified revision if its on a branch
|
||||
updatecmd = self._buildhgcommand(ud, d, "update")
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", updatecmd)
|
||||
runfetchcmd(updatecmd, d)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude '.hg' --exclude '.hgrags'"
|
||||
|
||||
os.chdir(ud.pkgdir)
|
||||
try:
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d)
|
||||
except:
|
||||
t, v, tb = sys.exc_info()
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise t, v, tb
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
def _latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Compute tip revision for the url
|
||||
"""
|
||||
output = runfetchcmd(self._buildhgcommand(ud, d, "info"), d)
|
||||
return output.strip()
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
|
||||
def _revision_key(self, url, ud, d):
|
||||
"""
|
||||
Return a unique key for the url
|
||||
"""
|
||||
return "hg:" + ud.moddir
|
||||
73
bitbake/lib/bb/fetch/local.py
Normal file
73
bitbake/lib/bb/fetch/local.py
Normal file
@@ -0,0 +1,73 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import bb
|
||||
import bb.utils
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
|
||||
class Local(Fetch):
|
||||
def supports(self, url, urldata, d):
|
||||
"""
|
||||
Check to see if a given url represents a local fetch.
|
||||
"""
|
||||
return urldata.type in ['file']
|
||||
|
||||
def localpath(self, url, urldata, d):
|
||||
"""
|
||||
Return the local filename of a given url assuming a successful fetch.
|
||||
"""
|
||||
path = url.split("://")[1]
|
||||
path = path.split(";")[0]
|
||||
newpath = path
|
||||
if path[0] != "/":
|
||||
filespath = data.getVar('FILESPATH', d, 1)
|
||||
if filespath:
|
||||
newpath = bb.utils.which(filespath, path)
|
||||
if not newpath:
|
||||
filesdir = data.getVar('FILESDIR', d, 1)
|
||||
if filesdir:
|
||||
newpath = os.path.join(filesdir, path)
|
||||
# We don't set localfile as for this fetcher the file is already local!
|
||||
return newpath
|
||||
|
||||
def go(self, url, urldata, d):
|
||||
"""Fetch urls (no-op for Local method)"""
|
||||
# no need to fetch local files, we'll deal with them in place.
|
||||
return 1
|
||||
|
||||
def checkstatus(self, url, urldata, d):
|
||||
"""
|
||||
Check the status of the url
|
||||
"""
|
||||
if urldata.localpath.find("*") != -1:
|
||||
logger.info("URL %s looks like a glob and was therefore not checked.", url)
|
||||
return True
|
||||
if os.path.exists(urldata.localpath):
|
||||
return True
|
||||
return False
|
||||
143
bitbake/lib/bb/fetch/osc.py
Normal file
143
bitbake/lib/bb/fetch/osc.py
Normal file
@@ -0,0 +1,143 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
Bitbake "Fetch" implementation for osc (Opensuse build service client).
|
||||
Based on the svn "Fetch" implementation.
|
||||
|
||||
"""
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb import utils
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import MissingParameterError
|
||||
from bb.fetch import runfetchcmd
|
||||
|
||||
class Osc(Fetch):
|
||||
"""Class to fetch a module or modules from Opensuse build server
|
||||
repositories."""
|
||||
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with osc.
|
||||
"""
|
||||
return ud.type in ['osc']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("osc method needs a 'module' parameter.")
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
# Create paths to osc checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(data.expand('${OSCDIR}', d), ud.host)
|
||||
ud.moddir = os.path.join(ud.pkgdir, relpath, ud.module)
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
ud.revision = ud.parm['rev']
|
||||
else:
|
||||
pv = data.getVar("PV", d, 0)
|
||||
rev = Fetch.srcrev_internal_helper(ud, d)
|
||||
if rev and rev != True:
|
||||
ud.revision = rev
|
||||
else:
|
||||
ud.revision = ""
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def _buildosccommand(self, ud, d, command):
|
||||
"""
|
||||
Build up an ocs commandline based on ud
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_osc}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'ocs')
|
||||
|
||||
options = []
|
||||
|
||||
config = "-c %s" % self.generate_config(ud, d)
|
||||
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
coroot = self._strip_leading_slashes(ud.path)
|
||||
|
||||
if command is "fetch":
|
||||
osccmd = "%s %s co %s/%s %s" % (basecmd, config, coroot, ud.module, " ".join(options))
|
||||
elif command is "update":
|
||||
osccmd = "%s %s up %s" % (basecmd, config, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid osc command %s" % command)
|
||||
|
||||
return osccmd
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""
|
||||
Fetch url
|
||||
"""
|
||||
|
||||
logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
|
||||
|
||||
if os.access(os.path.join(data.expand('${OSCDIR}', d), ud.path, ud.module), os.R_OK):
|
||||
oscupdatecmd = self._buildosccommand(ud, d, "update")
|
||||
logger.info("Update "+ loc)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", oscupdatecmd)
|
||||
runfetchcmd(oscupdatecmd, d)
|
||||
else:
|
||||
oscfetchcmd = self._buildosccommand(ud, d, "fetch")
|
||||
logger.info("Fetch " + loc)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", oscfetchcmd)
|
||||
runfetchcmd(oscfetchcmd, d)
|
||||
|
||||
os.chdir(os.path.join(ud.pkgdir + ud.path))
|
||||
# tar them up to a defined filename
|
||||
try:
|
||||
runfetchcmd("tar -czf %s %s" % (ud.localpath, ud.module), d)
|
||||
except:
|
||||
t, v, tb = sys.exc_info()
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise t, v, tb
|
||||
|
||||
def supports_srcrev(self):
|
||||
return False
|
||||
|
||||
def generate_config(self, ud, d):
|
||||
"""
|
||||
Generate a .oscrc to be used for this run.
|
||||
"""
|
||||
|
||||
config_path = os.path.join(data.expand('${OSCDIR}', d), "oscrc")
|
||||
bb.utils.remove(config_path)
|
||||
|
||||
f = open(config_path, 'w')
|
||||
f.write("[general]\n")
|
||||
f.write("apisrv = %s\n" % ud.host)
|
||||
f.write("scheme = http\n")
|
||||
f.write("su-wrapper = su -c\n")
|
||||
f.write("build-root = %s\n" % data.expand('${WORKDIR}', d))
|
||||
f.write("urllist = http://moblin-obs.jf.intel.com:8888/build/%(project)s/%(repository)s/%(buildarch)s/:full/%(name)s.rpm\n")
|
||||
f.write("extra-pkgs = gzip\n")
|
||||
f.write("\n")
|
||||
f.write("[%s]\n" % ud.host)
|
||||
f.write("user = %s\n" % ud.parm["user"])
|
||||
f.write("pass = %s\n" % ud.parm["pswd"])
|
||||
f.close()
|
||||
|
||||
return config_path
|
||||
206
bitbake/lib/bb/fetch/perforce.py
Normal file
206
bitbake/lib/bb/fetch/perforce.py
Normal file
@@ -0,0 +1,206 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
from future_builtins import zip
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import logger
|
||||
|
||||
class Perforce(Fetch):
|
||||
def supports(self, url, ud, d):
|
||||
return ud.type in ['p4']
|
||||
|
||||
def doparse(url, d):
|
||||
parm = {}
|
||||
path = url.split("://")[1]
|
||||
delim = path.find("@");
|
||||
if delim != -1:
|
||||
(user, pswd, host, port) = path.split('@')[0].split(":")
|
||||
path = path.split('@')[1]
|
||||
else:
|
||||
(host, port) = data.getVar('P4PORT', d).split(':')
|
||||
user = ""
|
||||
pswd = ""
|
||||
|
||||
if path.find(";") != -1:
|
||||
keys=[]
|
||||
values=[]
|
||||
plist = path.split(';')
|
||||
for item in plist:
|
||||
if item.count('='):
|
||||
(key, value) = item.split('=')
|
||||
keys.append(key)
|
||||
values.append(value)
|
||||
|
||||
parm = dict(zip(keys, values))
|
||||
path = "//" + path.split(';')[0]
|
||||
host += ":%s" % (port)
|
||||
parm["cset"] = Perforce.getcset(d, path, host, user, pswd, parm)
|
||||
|
||||
return host, path, user, pswd, parm
|
||||
doparse = staticmethod(doparse)
|
||||
|
||||
def getcset(d, depot, host, user, pswd, parm):
|
||||
p4opt = ""
|
||||
if "cset" in parm:
|
||||
return parm["cset"];
|
||||
if user:
|
||||
p4opt += " -u %s" % (user)
|
||||
if pswd:
|
||||
p4opt += " -P %s" % (pswd)
|
||||
if host:
|
||||
p4opt += " -p %s" % (host)
|
||||
|
||||
p4date = data.getVar("P4DATE", d, 1)
|
||||
if "revision" in parm:
|
||||
depot += "#%s" % (parm["revision"])
|
||||
elif "label" in parm:
|
||||
depot += "@%s" % (parm["label"])
|
||||
elif p4date:
|
||||
depot += "@%s" % (p4date)
|
||||
|
||||
p4cmd = data.getVar('FETCHCOMMAND_p4', d, 1)
|
||||
logger.debug(1, "Running %s%s changes -m 1 %s", p4cmd, p4opt, depot)
|
||||
p4file = os.popen("%s%s changes -m 1 %s" % (p4cmd, p4opt, depot))
|
||||
cset = p4file.readline().strip()
|
||||
logger.debug(1, "READ %s", cset)
|
||||
if not cset:
|
||||
return -1
|
||||
|
||||
return cset.split(' ')[1]
|
||||
getcset = staticmethod(getcset)
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
|
||||
(host, path, user, pswd, parm) = Perforce.doparse(url, d)
|
||||
|
||||
# If a label is specified, we use that as our filename
|
||||
|
||||
if "label" in parm:
|
||||
ud.localfile = "%s.tar.gz" % (parm["label"])
|
||||
return os.path.join(data.getVar("DL_DIR", d, 1), ud.localfile)
|
||||
|
||||
base = path
|
||||
which = path.find('/...')
|
||||
if which != -1:
|
||||
base = path[:which]
|
||||
|
||||
base = self._strip_leading_slashes(base)
|
||||
|
||||
cset = Perforce.getcset(d, path, host, user, pswd, parm)
|
||||
|
||||
ud.localfile = data.expand('%s+%s+%s.tar.gz' % (host, base.replace('/', '.'), cset), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, 1), ud.localfile)
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""
|
||||
Fetch urls
|
||||
"""
|
||||
|
||||
(host, depot, user, pswd, parm) = Perforce.doparse(loc, d)
|
||||
|
||||
if depot.find('/...') != -1:
|
||||
path = depot[:depot.find('/...')]
|
||||
else:
|
||||
path = depot
|
||||
|
||||
module = parm.get('module', os.path.basename(path))
|
||||
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "p4:%s" % data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
# Get the p4 command
|
||||
p4opt = ""
|
||||
if user:
|
||||
p4opt += " -u %s" % (user)
|
||||
|
||||
if pswd:
|
||||
p4opt += " -P %s" % (pswd)
|
||||
|
||||
if host:
|
||||
p4opt += " -p %s" % (host)
|
||||
|
||||
p4cmd = data.getVar('FETCHCOMMAND', localdata, 1)
|
||||
|
||||
# create temp directory
|
||||
logger.debug(2, "Fetch: creating temporary directory")
|
||||
bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
|
||||
data.setVar('TMPBASE', data.expand('${WORKDIR}/oep4.XXXXXX', localdata), localdata)
|
||||
tmppipe = os.popen(data.getVar('MKTEMPDIRCMD', localdata, 1) or "false")
|
||||
tmpfile = tmppipe.readline().strip()
|
||||
if not tmpfile:
|
||||
logger.error("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.")
|
||||
raise FetchError(module)
|
||||
|
||||
if "label" in parm:
|
||||
depot = "%s@%s" % (depot, parm["label"])
|
||||
else:
|
||||
cset = Perforce.getcset(d, depot, host, user, pswd, parm)
|
||||
depot = "%s@%s" % (depot, cset)
|
||||
|
||||
os.chdir(tmpfile)
|
||||
logger.info("Fetch " + loc)
|
||||
logger.info("%s%s files %s", p4cmd, p4opt, depot)
|
||||
p4file = os.popen("%s%s files %s" % (p4cmd, p4opt, depot))
|
||||
|
||||
if not p4file:
|
||||
logger.error("Fetch: unable to get the P4 files from %s", depot)
|
||||
raise FetchError(module)
|
||||
|
||||
count = 0
|
||||
|
||||
for file in p4file:
|
||||
list = file.split()
|
||||
|
||||
if list[2] == "delete":
|
||||
continue
|
||||
|
||||
dest = list[0][len(path)+1:]
|
||||
where = dest.find("#")
|
||||
|
||||
os.system("%s%s print -o %s/%s %s" % (p4cmd, p4opt, module, dest[:where], list[0]))
|
||||
count = count + 1
|
||||
|
||||
if count == 0:
|
||||
logger.error("Fetch: No files gathered from the P4 fetch")
|
||||
raise FetchError(module)
|
||||
|
||||
myret = os.system("tar -czf %s %s" % (ud.localpath, module))
|
||||
if myret != 0:
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(module)
|
||||
# cleanup
|
||||
bb.utils.prunedir(tmpfile)
|
||||
98
bitbake/lib/bb/fetch/repo.py
Normal file
98
bitbake/lib/bb/fetch/repo.py
Normal file
@@ -0,0 +1,98 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake "Fetch" repo (git) implementation
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2009 Tom Rini <trini@embeddedalley.com>
|
||||
#
|
||||
# Based on git.py which is:
|
||||
#Copyright (C) 2005 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import runfetchcmd
|
||||
|
||||
class Repo(Fetch):
|
||||
"""Class to fetch a module or modules from repo (git) repositories"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with repo.
|
||||
"""
|
||||
return ud.type in ["repo"]
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
"""
|
||||
We don"t care about the git rev of the manifests repository, but
|
||||
we do care about the manifest to use. The default is "default".
|
||||
We also care about the branch or tag to be used. The default is
|
||||
"master".
|
||||
"""
|
||||
|
||||
ud.proto = ud.parm.get('protocol', 'git')
|
||||
ud.branch = ud.parm.get('branch', 'master')
|
||||
ud.manifest = ud.parm.get('manifest', 'default.xml')
|
||||
if not ud.manifest.endswith('.xml'):
|
||||
ud.manifest += '.xml'
|
||||
|
||||
ud.localfile = data.expand("repo_%s%s_%s_%s.tar.gz" % (ud.host, ud.path.replace("/", "."), ud.manifest, ud.branch), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
if os.access(os.path.join(data.getVar("DL_DIR", d, True), ud.localfile), os.R_OK):
|
||||
logger.debug(1, "%s already exists (or was stashed). Skipping repo init / sync.", ud.localpath)
|
||||
return
|
||||
|
||||
gitsrcname = "%s%s" % (ud.host, ud.path.replace("/", "."))
|
||||
repodir = data.getVar("REPODIR", d, True) or os.path.join(data.getVar("DL_DIR", d, True), "repo")
|
||||
codir = os.path.join(repodir, gitsrcname, ud.manifest)
|
||||
|
||||
if ud.user:
|
||||
username = ud.user + "@"
|
||||
else:
|
||||
username = ""
|
||||
|
||||
bb.utils.mkdirhier(os.path.join(codir, "repo"))
|
||||
os.chdir(os.path.join(codir, "repo"))
|
||||
if not os.path.exists(os.path.join(codir, "repo", ".repo")):
|
||||
runfetchcmd("repo init -m %s -b %s -u %s://%s%s%s" % (ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), d)
|
||||
|
||||
runfetchcmd("repo sync", d)
|
||||
os.chdir(codir)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude '.repo' --exclude '.git'"
|
||||
|
||||
# Create a cache
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.join(".", "*") ), d)
|
||||
|
||||
def supports_srcrev(self):
|
||||
return False
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.manifest
|
||||
|
||||
def _want_sortable_revision(self, url, ud, d):
|
||||
return False
|
||||
118
bitbake/lib/bb/fetch/ssh.py
Normal file
118
bitbake/lib/bb/fetch/ssh.py
Normal file
@@ -0,0 +1,118 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
'''
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
This implementation is for Secure Shell (SSH), and attempts to comply with the
|
||||
IETF secsh internet draft:
|
||||
http://tools.ietf.org/wg/secsh/draft-ietf-secsh-scp-sftp-ssh-uri/
|
||||
|
||||
Currently does not support the sftp parameters, as this uses scp
|
||||
Also does not support the 'fingerprint' connection parameter.
|
||||
|
||||
'''
|
||||
|
||||
# Copyright (C) 2006 OpenedHand Ltd.
|
||||
#
|
||||
#
|
||||
# Based in part on svk.py:
|
||||
# Copyright (C) 2006 Holger Hans Peter Freyther
|
||||
# Based on svn.py:
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
# Based on functions from the base bb module:
|
||||
# Copyright 2003 Holger Schurig
|
||||
#
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import re, os
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
|
||||
|
||||
__pattern__ = re.compile(r'''
|
||||
\s* # Skip leading whitespace
|
||||
ssh:// # scheme
|
||||
( # Optional username/password block
|
||||
(?P<user>\S+) # username
|
||||
(:(?P<pass>\S+))? # colon followed by the password (optional)
|
||||
)?
|
||||
(?P<cparam>(;[^;]+)*)? # connection parameters block (optional)
|
||||
@
|
||||
(?P<host>\S+?) # non-greedy match of the host
|
||||
(:(?P<port>[0-9]+))? # colon followed by the port (optional)
|
||||
/
|
||||
(?P<path>[^;]+) # path on the remote system, may be absolute or relative,
|
||||
# and may include the use of '~' to reference the remote home
|
||||
# directory
|
||||
(?P<sparam>(;[^;]+)*)? # parameters block (optional)
|
||||
$
|
||||
''', re.VERBOSE)
|
||||
|
||||
class SSH(Fetch):
|
||||
'''Class to fetch a module or modules via Secure Shell'''
|
||||
|
||||
def supports(self, url, urldata, d):
|
||||
return __pattern__.match(url) != None
|
||||
|
||||
def localpath(self, url, urldata, d):
|
||||
m = __pattern__.match(url)
|
||||
path = m.group('path')
|
||||
host = m.group('host')
|
||||
lpath = os.path.join(data.getVar('DL_DIR', d, True), host, os.path.basename(path))
|
||||
return lpath
|
||||
|
||||
def go(self, url, urldata, d):
|
||||
dldir = data.getVar('DL_DIR', d, 1)
|
||||
|
||||
m = __pattern__.match(url)
|
||||
path = m.group('path')
|
||||
host = m.group('host')
|
||||
port = m.group('port')
|
||||
user = m.group('user')
|
||||
password = m.group('pass')
|
||||
|
||||
ldir = os.path.join(dldir, host)
|
||||
lpath = os.path.join(ldir, os.path.basename(path))
|
||||
|
||||
if not os.path.exists(ldir):
|
||||
os.makedirs(ldir)
|
||||
|
||||
if port:
|
||||
port = '-P %s' % port
|
||||
else:
|
||||
port = ''
|
||||
|
||||
if user:
|
||||
fr = user
|
||||
if password:
|
||||
fr += ':%s' % password
|
||||
fr += '@%s' % host
|
||||
else:
|
||||
fr = host
|
||||
fr += ':%s' % path
|
||||
|
||||
|
||||
import commands
|
||||
cmd = 'scp -B -r %s %s %s/' % (
|
||||
port,
|
||||
commands.mkarg(fr),
|
||||
commands.mkarg(ldir)
|
||||
)
|
||||
|
||||
(exitstatus, output) = commands.getstatusoutput(cmd)
|
||||
if exitstatus != 0:
|
||||
print(output)
|
||||
raise FetchError('Unable to fetch %s' % url)
|
||||
104
bitbake/lib/bb/fetch/svk.py
Normal file
104
bitbake/lib/bb/fetch/svk.py
Normal file
@@ -0,0 +1,104 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
This implementation is for svk. It is based on the svn implementation
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2006 Holger Hans Peter Freyther
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import MissingParameterError
|
||||
from bb.fetch import logger
|
||||
|
||||
class Svk(Fetch):
|
||||
"""Class to fetch a module or modules from svk repositories"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with svk.
|
||||
"""
|
||||
return ud.type in ['svk']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("svk method needs a 'module' parameter")
|
||||
else:
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
ud.revision = ud.parm.get('rev', "")
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision, ud.date), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def forcefetch(self, url, ud, d):
|
||||
return ud.date == "now"
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch urls"""
|
||||
|
||||
svkroot = ud.host + ud.path
|
||||
|
||||
svkcmd = "svk co -r {%s} %s/%s" % (ud.date, svkroot, ud.module)
|
||||
|
||||
if ud.revision:
|
||||
svkcmd = "svk co -r %s %s/%s" % (ud.revision, svkroot, ud.module)
|
||||
|
||||
# create temp directory
|
||||
localdata = data.createCopy(d)
|
||||
data.update_data(localdata)
|
||||
logger.debug(2, "Fetch: creating temporary directory")
|
||||
bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
|
||||
data.setVar('TMPBASE', data.expand('${WORKDIR}/oesvk.XXXXXX', localdata), localdata)
|
||||
tmppipe = os.popen(data.getVar('MKTEMPDIRCMD', localdata, 1) or "false")
|
||||
tmpfile = tmppipe.readline().strip()
|
||||
if not tmpfile:
|
||||
logger.error("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.")
|
||||
raise FetchError(ud.module)
|
||||
|
||||
# check out sources there
|
||||
os.chdir(tmpfile)
|
||||
logger.info("Fetch " + loc)
|
||||
logger.debug(1, "Running %s", svkcmd)
|
||||
myret = os.system(svkcmd)
|
||||
if myret != 0:
|
||||
try:
|
||||
os.rmdir(tmpfile)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(ud.module)
|
||||
|
||||
os.chdir(os.path.join(tmpfile, os.path.dirname(ud.module)))
|
||||
# tar them up to a defined filename
|
||||
myret = os.system("tar -czf %s %s" % (ud.localpath, os.path.basename(ud.module)))
|
||||
if myret != 0:
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(ud.module)
|
||||
# cleanup
|
||||
bb.utils.prunedir(tmpfile)
|
||||
204
bitbake/lib/bb/fetch/svn.py
Normal file
204
bitbake/lib/bb/fetch/svn.py
Normal file
@@ -0,0 +1,204 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementation for svn.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
# Copyright (C) 2004 Marcin Juszkiewicz
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import MissingParameterError
|
||||
from bb.fetch import runfetchcmd
|
||||
from bb.fetch import logger
|
||||
|
||||
class Svn(Fetch):
|
||||
"""Class to fetch a module or modules from svn repositories"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with svn.
|
||||
"""
|
||||
return ud.type in ['svn']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("svn method needs a 'module' parameter")
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
# Create paths to svn checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(data.expand('${SVNDIR}', d), ud.host, relpath)
|
||||
ud.moddir = os.path.join(ud.pkgdir, ud.module)
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
ud.date = ""
|
||||
ud.revision = ud.parm['rev']
|
||||
elif 'date' in ud.date:
|
||||
ud.date = ud.parm['date']
|
||||
ud.revision = ""
|
||||
else:
|
||||
#
|
||||
# ***Nasty hack***
|
||||
# If DATE in unexpanded PV, use ud.date (which is set from SRCDATE)
|
||||
# Should warn people to switch to SRCREV here
|
||||
#
|
||||
pv = data.getVar("PV", d, 0)
|
||||
if "DATE" in pv:
|
||||
ud.revision = ""
|
||||
else:
|
||||
rev = Fetch.srcrev_internal_helper(ud, d)
|
||||
if rev is True:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
ud.date = ""
|
||||
elif rev:
|
||||
ud.revision = rev
|
||||
ud.date = ""
|
||||
else:
|
||||
ud.revision = ""
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision, ud.date), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def _buildsvncommand(self, ud, d, command):
|
||||
"""
|
||||
Build up an svn commandline based on ud
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_svn}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'svn')
|
||||
|
||||
svn_rsh = None
|
||||
if proto == "svn+ssh" and "rsh" in ud.parm:
|
||||
svn_rsh = ud.parm["rsh"]
|
||||
|
||||
svnroot = ud.host + ud.path
|
||||
|
||||
# either use the revision, or SRCDATE in braces,
|
||||
options = []
|
||||
|
||||
if ud.user:
|
||||
options.append("--username %s" % ud.user)
|
||||
|
||||
if ud.pswd:
|
||||
options.append("--password %s" % ud.pswd)
|
||||
|
||||
if command is "info":
|
||||
svncmd = "%s info %s %s://%s/%s/" % (basecmd, " ".join(options), proto, svnroot, ud.module)
|
||||
else:
|
||||
suffix = ""
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
suffix = "@%s" % (ud.revision)
|
||||
elif ud.date:
|
||||
options.append("-r {%s}" % ud.date)
|
||||
|
||||
if command is "fetch":
|
||||
svncmd = "%s co %s %s://%s/%s%s %s" % (basecmd, " ".join(options), proto, svnroot, ud.module, suffix, ud.module)
|
||||
elif command is "update":
|
||||
svncmd = "%s update %s" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid svn command %s" % command)
|
||||
|
||||
if svn_rsh:
|
||||
svncmd = "svn_RSH=\"%s\" %s" % (svn_rsh, svncmd)
|
||||
|
||||
return svncmd
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
|
||||
|
||||
if os.access(os.path.join(ud.moddir, '.svn'), os.R_OK):
|
||||
svnupdatecmd = self._buildsvncommand(ud, d, "update")
|
||||
logger.info("Update " + loc)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", svnupdatecmd)
|
||||
runfetchcmd(svnupdatecmd, d)
|
||||
else:
|
||||
svnfetchcmd = self._buildsvncommand(ud, d, "fetch")
|
||||
logger.info("Fetch " + loc)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", svnfetchcmd)
|
||||
runfetchcmd(svnfetchcmd, d)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude '.svn'"
|
||||
|
||||
os.chdir(ud.pkgdir)
|
||||
# tar them up to a defined filename
|
||||
try:
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d)
|
||||
except:
|
||||
t, v, tb = sys.exc_info()
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise t, v, tb
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
def _revision_key(self, url, ud, d):
|
||||
"""
|
||||
Return a unique key for the url
|
||||
"""
|
||||
return "svn:" + ud.moddir
|
||||
|
||||
def _latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Return the latest upstream revision number
|
||||
"""
|
||||
logger.debug(2, "SVN fetcher hitting network for %s", url)
|
||||
|
||||
output = runfetchcmd("LANG=C LC_ALL=C " + self._buildsvncommand(ud, d, "info"), d, True)
|
||||
|
||||
revision = None
|
||||
for line in output.splitlines():
|
||||
if "Last Changed Rev" in line:
|
||||
revision = line.split(":")[1].strip()
|
||||
|
||||
return revision
|
||||
|
||||
def _sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
Return a sortable revision number which in our case is the revision number
|
||||
"""
|
||||
|
||||
return self._build_revision(url, ud, d)
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
93
bitbake/lib/bb/fetch/wget.py
Normal file
93
bitbake/lib/bb/fetch/wget.py
Normal file
@@ -0,0 +1,93 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
import urllib
|
||||
from bb import data
|
||||
from bb.fetch import Fetch, FetchError, encodeurl, decodeurl, logger, runfetchcmd
|
||||
|
||||
class Wget(Fetch):
|
||||
"""Class to fetch urls via 'wget'"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with wget.
|
||||
"""
|
||||
return ud.type in ['http', 'https', 'ftp']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
|
||||
url = encodeurl([ud.type, ud.host, ud.path, ud.user, ud.pswd, {}])
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
ud.localfile = data.expand(urllib.unquote(ud.basename), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def go(self, uri, ud, d, checkonly = False):
|
||||
"""Fetch urls"""
|
||||
|
||||
def fetch_uri(uri, ud, d):
|
||||
if checkonly:
|
||||
fetchcmd = data.getVar("CHECKCOMMAND", d, 1)
|
||||
elif os.path.exists(ud.localpath):
|
||||
# file exists, but we didnt complete it.. trying again..
|
||||
fetchcmd = data.getVar("RESUMECOMMAND", d, 1)
|
||||
else:
|
||||
fetchcmd = data.getVar("FETCHCOMMAND", d, 1)
|
||||
|
||||
uri = uri.split(";")[0]
|
||||
uri_decoded = list(decodeurl(uri))
|
||||
uri_type = uri_decoded[0]
|
||||
uri_host = uri_decoded[1]
|
||||
|
||||
fetchcmd = fetchcmd.replace("${URI}", uri.split(";")[0])
|
||||
fetchcmd = fetchcmd.replace("${FILE}", ud.basename)
|
||||
logger.info("fetch " + uri)
|
||||
logger.debug(2, "executing " + fetchcmd)
|
||||
runfetchcmd(fetchcmd, d)
|
||||
|
||||
# Sanity check since wget can pretend it succeed when it didn't
|
||||
# Also, this used to happen if sourceforge sent us to the mirror page
|
||||
if not os.path.exists(ud.localpath) and not checkonly:
|
||||
logger.debug(2, "The fetch command for %s returned success but %s doesn't exist?...", uri, ud.localpath)
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "wget:" + data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
if fetch_uri(uri, ud, localdata):
|
||||
return True
|
||||
|
||||
raise FetchError(uri)
|
||||
|
||||
|
||||
def checkstatus(self, uri, ud, d):
|
||||
return self.go(uri, ud, d, True)
|
||||
File diff suppressed because it is too large
Load Diff
@@ -60,21 +60,21 @@ class Bzr(FetchMethod):
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_bzr}', d)
|
||||
|
||||
proto = ud.parm.get('protocol', 'http')
|
||||
proto = ud.parm.get('proto', 'http')
|
||||
|
||||
bzrroot = ud.host + ud.path
|
||||
|
||||
options = []
|
||||
|
||||
if command == "revno":
|
||||
if command is "revno":
|
||||
bzrcmd = "%s revno %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
else:
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
if command == "fetch":
|
||||
bzrcmd = "%s branch %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
elif command == "update":
|
||||
if command is "fetch":
|
||||
bzrcmd = "%s co %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
elif command is "update":
|
||||
bzrcmd = "%s pull %s --overwrite" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid bzr command %s" % command, ud.url)
|
||||
|
||||
@@ -29,6 +29,7 @@ BitBake build tools.
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod, FetchError, MissingParameterError, logger
|
||||
from bb.fetch2 import runfetchcmd
|
||||
|
||||
@@ -63,7 +64,7 @@ class Cvs(FetchMethod):
|
||||
if 'fullpath' in ud.parm:
|
||||
fullpath = '_fullpath'
|
||||
|
||||
ud.localfile = bb.data.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath), d)
|
||||
ud.localfile = data.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath), d)
|
||||
|
||||
def need_update(self, url, ud, d):
|
||||
if (ud.date == "now"):
|
||||
@@ -87,10 +88,10 @@ class Cvs(FetchMethod):
|
||||
cvsroot = ud.path
|
||||
else:
|
||||
cvsroot = ":" + method
|
||||
cvsproxyhost = d.getVar('CVS_PROXY_HOST', True)
|
||||
cvsproxyhost = data.getVar('CVS_PROXY_HOST', d, True)
|
||||
if cvsproxyhost:
|
||||
cvsroot += ";proxy=" + cvsproxyhost
|
||||
cvsproxyport = d.getVar('CVS_PROXY_PORT', True)
|
||||
cvsproxyport = data.getVar('CVS_PROXY_PORT', d, True)
|
||||
if cvsproxyport:
|
||||
cvsroot += ";proxyport=" + cvsproxyport
|
||||
cvsroot += ":" + ud.user
|
||||
@@ -110,9 +111,15 @@ class Cvs(FetchMethod):
|
||||
if ud.tag:
|
||||
options.append("-r %s" % ud.tag)
|
||||
|
||||
cvsbasecmd = d.getVar("FETCHCMD_cvs", True)
|
||||
cvscmd = cvsbasecmd + " '-d" + cvsroot + "' co " + " ".join(options) + " " + ud.module
|
||||
cvsupdatecmd = cvsbasecmd + " '-d" + cvsroot + "' update -d -P " + " ".join(options)
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "cvs:%s" % data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
data.setVar('CVSROOT', cvsroot, localdata)
|
||||
data.setVar('CVSCOOPTS', " ".join(options), localdata)
|
||||
data.setVar('CVSMODULE', ud.module, localdata)
|
||||
cvscmd = data.getVar('FETCHCOMMAND', localdata, True)
|
||||
cvsupdatecmd = data.getVar('UPDATECOMMAND', localdata, True)
|
||||
|
||||
if cvs_rsh:
|
||||
cvscmd = "CVS_RSH=\"%s\" %s" % (cvs_rsh, cvscmd)
|
||||
@@ -120,8 +127,8 @@ class Cvs(FetchMethod):
|
||||
|
||||
# create module directory
|
||||
logger.debug(2, "Fetch: checking for module directory")
|
||||
pkg = d.getVar('PN', True)
|
||||
pkgdir = os.path.join(d.getVar('CVSDIR', True), pkg)
|
||||
pkg = data.expand('${PN}', d)
|
||||
pkgdir = os.path.join(data.expand('${CVSDIR}', localdata), pkg)
|
||||
moddir = os.path.join(pkgdir, localdir)
|
||||
if os.access(os.path.join(moddir, 'CVS'), os.R_OK):
|
||||
logger.info("Update " + loc)
|
||||
@@ -162,9 +169,12 @@ class Cvs(FetchMethod):
|
||||
|
||||
def clean(self, ud, d):
|
||||
""" Clean CVS Files and tarballs """
|
||||
|
||||
pkg = d.getVar('PN', True)
|
||||
pkgdir = os.path.join(d.getVar("CVSDIR", True), pkg)
|
||||
|
||||
pkg = data.expand('${PN}', d)
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "cvs:%s" % data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
pkgdir = os.path.join(data.expand('${CVSDIR}', localdata), pkg)
|
||||
|
||||
bb.utils.remove(pkgdir, True)
|
||||
bb.utils.remove(ud.localpath)
|
||||
|
||||
@@ -3,47 +3,6 @@
|
||||
"""
|
||||
BitBake 'Fetch' git implementation
|
||||
|
||||
git fetcher support the SRC_URI with format of:
|
||||
SRC_URI = "git://some.host/somepath;OptionA=xxx;OptionB=xxx;..."
|
||||
|
||||
Supported SRC_URI options are:
|
||||
|
||||
- branch
|
||||
The git branch to retrieve from. The default is "master"
|
||||
|
||||
this option also support multiple branches fetching, branches
|
||||
are seperated by comma. in multiple branches case, the name option
|
||||
must have the same number of names to match the branches, which is
|
||||
used to specify the SRC_REV for the branch
|
||||
e.g:
|
||||
SRC_URI="git://some.host/somepath;branch=branchX,branchY;name=nameX,nameY"
|
||||
SRCREV_nameX = "xxxxxxxxxxxxxxxxxxxx"
|
||||
SRCREV_nameY = "YYYYYYYYYYYYYYYYYYYY"
|
||||
|
||||
- tag
|
||||
The git tag to retrieve. The default is "master"
|
||||
|
||||
- protocol
|
||||
The method to use to access the repository. Common options are "git",
|
||||
"http", "file" and "rsync". The default is "git"
|
||||
|
||||
- rebaseable
|
||||
rebaseable indicates that the upstream git repo may rebase in the future,
|
||||
and current revision may disappear from upstream repo. This option will
|
||||
reminder fetcher to preserve local cache carefully for future use.
|
||||
The default value is "0", set rebaseable=1 for rebaseable git repo
|
||||
|
||||
- nocheckout
|
||||
Don't checkout source code when unpacking. set this option for the recipe
|
||||
who has its own routine to checkout code.
|
||||
The default is "0", set nocheckout=1 if needed.
|
||||
|
||||
- bareclone
|
||||
Create a bare clone of the source code and don't checkout the source code
|
||||
when unpacking. Set this option for the recipe who has its own routine to
|
||||
checkout code and tracking branch requirements.
|
||||
The default is "0", set bareclone=1 if needed.
|
||||
|
||||
"""
|
||||
|
||||
#Copyright (C) 2005 Richard Purdie
|
||||
@@ -74,7 +33,7 @@ class Git(FetchMethod):
|
||||
#
|
||||
# Only enable _sortable revision if the key is set
|
||||
#
|
||||
if d.getVar("BB_GIT_CLONE_FOR_SRCREV", True):
|
||||
if bb.data.getVar("BB_GIT_CLONE_FOR_SRCREV", d, True):
|
||||
self._sortable_buildindex = self._sortable_buildindex_disabled
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
@@ -82,9 +41,6 @@ class Git(FetchMethod):
|
||||
"""
|
||||
return ud.type in ['git']
|
||||
|
||||
def supports_checksum(self, urldata):
|
||||
return False
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
"""
|
||||
init git specific variable within url data
|
||||
@@ -95,20 +51,12 @@ class Git(FetchMethod):
|
||||
elif not ud.host:
|
||||
ud.proto = 'file'
|
||||
else:
|
||||
ud.proto = "git"
|
||||
ud.proto = "rsync"
|
||||
|
||||
if not ud.proto in ('git', 'file', 'ssh', 'http', 'https', 'rsync'):
|
||||
raise bb.fetch2.ParameterError("Invalid protocol type", ud.url)
|
||||
ud.nocheckout = False
|
||||
if 'nocheckout' in ud.parm:
|
||||
ud.nocheckout = True
|
||||
|
||||
ud.nocheckout = ud.parm.get("nocheckout","0") == "1"
|
||||
|
||||
ud.rebaseable = ud.parm.get("rebaseable","0") == "1"
|
||||
|
||||
# bareclone implies nocheckout
|
||||
ud.bareclone = ud.parm.get("bareclone","0") == "1"
|
||||
if ud.bareclone:
|
||||
ud.nocheckout = 1
|
||||
|
||||
branches = ud.parm.get("branch", "master").split(',')
|
||||
if len(branches) != len(ud.names):
|
||||
raise bb.fetch2.ParameterError("The number of name and branch parameters is not balanced", ud.url)
|
||||
@@ -117,34 +65,25 @@ class Git(FetchMethod):
|
||||
branch = branches[ud.names.index(name)]
|
||||
ud.branches[name] = branch
|
||||
|
||||
gitsrcname = '%s%s' % (ud.host, ud.path.replace('/', '.'))
|
||||
ud.mirrortarball = 'git2_%s.tar.gz' % (gitsrcname)
|
||||
ud.fullmirror = os.path.join(data.getVar("DL_DIR", d, True), ud.mirrortarball)
|
||||
ud.clonedir = os.path.join(data.expand('${GITDIR}', d), gitsrcname)
|
||||
|
||||
ud.basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
|
||||
ud.write_tarballs = ((data.getVar("BB_GENERATE_MIRROR_TARBALLS", d, True) or "0") != "0") or ud.rebaseable
|
||||
ud.write_tarballs = (data.getVar("BB_GENERATE_MIRROR_TARBALLS", d, True) or "0") != "0"
|
||||
|
||||
ud.localfile = ud.clonedir
|
||||
|
||||
ud.setup_revisons(d)
|
||||
|
||||
for name in ud.names:
|
||||
# Ensure anything that doesn't look like a sha256 checksum/revision is translated into one
|
||||
if not ud.revisions[name] or len(ud.revisions[name]) != 40 or (False in [c in "abcdef0123456789" for c in ud.revisions[name]]):
|
||||
if ud.revisions[name]:
|
||||
ud.branches[name] = ud.revisions[name]
|
||||
ud.branches[name] = ud.revisions[name]
|
||||
ud.revisions[name] = self.latest_revision(ud.url, ud, d, name)
|
||||
|
||||
gitsrcname = '%s%s' % (ud.host.replace(':','.'), ud.path.replace('/', '.').replace('*', '.'))
|
||||
# for rebaseable git repo, it is necessary to keep mirror tar ball
|
||||
# per revision, so that even the revision disappears from the
|
||||
# upstream repo in the future, the mirror will remain intact and still
|
||||
# contains the revision
|
||||
if ud.rebaseable:
|
||||
for name in ud.names:
|
||||
gitsrcname = gitsrcname + '_' + ud.revisions[name]
|
||||
ud.mirrortarball = 'git2_%s.tar.gz' % (gitsrcname)
|
||||
ud.fullmirror = os.path.join(d.getVar("DL_DIR", True), ud.mirrortarball)
|
||||
gitdir = d.getVar("GITDIR", True) or (d.getVar("DL_DIR", True) + "/git2/")
|
||||
ud.clonedir = os.path.join(gitdir, gitsrcname)
|
||||
|
||||
ud.localfile = ud.clonedir
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
return ud.clonedir
|
||||
|
||||
@@ -162,7 +101,7 @@ class Git(FetchMethod):
|
||||
def try_premirror(self, u, ud, d):
|
||||
# If we don't do this, updating an existing checkout with only premirrors
|
||||
# is not possible
|
||||
if d.getVar("BB_FETCH_PREMIRRORONLY", True) is not None:
|
||||
if bb.data.getVar("BB_FETCH_PREMIRRORONLY", d, True) is not None:
|
||||
return True
|
||||
if os.path.exists(ud.clonedir):
|
||||
return False
|
||||
@@ -184,17 +123,10 @@ class Git(FetchMethod):
|
||||
os.chdir(ud.clonedir)
|
||||
runfetchcmd("tar -xzf %s" % (ud.fullmirror), d)
|
||||
|
||||
repourl = "%s://%s%s%s" % (ud.proto, username, ud.host, ud.path)
|
||||
|
||||
# If the repo still doesn't exist, fallback to cloning it
|
||||
if not os.path.exists(ud.clonedir):
|
||||
# We do this since git will use a "-l" option automatically for local urls where possible
|
||||
if repourl.startswith("file://"):
|
||||
repourl = repourl[7:]
|
||||
clone_cmd = "%s clone --bare --mirror %s %s" % (ud.basecmd, repourl, ud.clonedir)
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, clone_cmd)
|
||||
runfetchcmd(clone_cmd, d)
|
||||
bb.fetch2.check_network_access(d, "git clone --bare %s%s" % (ud.host, ud.path))
|
||||
runfetchcmd("%s clone --bare %s://%s%s%s %s" % (ud.basecmd, ud.proto, username, ud.host, ud.path, ud.clonedir), d)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
# Update the checkout if needed
|
||||
@@ -203,16 +135,15 @@ class Git(FetchMethod):
|
||||
if not self._contains_ref(ud.revisions[name], d):
|
||||
needupdate = True
|
||||
if needupdate:
|
||||
bb.fetch2.check_network_access(d, "git fetch %s%s" % (ud.host, ud.path), ud.url)
|
||||
try:
|
||||
runfetchcmd("%s remote prune origin" % ud.basecmd, d)
|
||||
runfetchcmd("%s remote rm origin" % ud.basecmd, d)
|
||||
except bb.fetch2.FetchError:
|
||||
logger.debug(1, "No Origin")
|
||||
|
||||
runfetchcmd("%s remote add --mirror=fetch origin %s" % (ud.basecmd, repourl), d)
|
||||
fetch_cmd = "%s fetch -f --prune %s refs/*:refs/*" % (ud.basecmd, repourl)
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, fetch_cmd, ud.url)
|
||||
runfetchcmd(fetch_cmd, d)
|
||||
|
||||
runfetchcmd("%s remote add origin %s://%s%s%s" % (ud.basecmd, ud.proto, username, ud.host, ud.path), d)
|
||||
runfetchcmd("%s fetch --all -t" % ud.basecmd, d)
|
||||
runfetchcmd("%s prune-packed" % ud.basecmd, d)
|
||||
runfetchcmd("%s pack-redundant --all | xargs -r rm" % ud.basecmd, d)
|
||||
ud.repochanged = True
|
||||
@@ -223,7 +154,6 @@ class Git(FetchMethod):
|
||||
os.chdir(ud.clonedir)
|
||||
logger.info("Creating tarball of git repository")
|
||||
runfetchcmd("tar -czf %s %s" % (ud.fullmirror, os.path.join(".") ), d)
|
||||
runfetchcmd("touch %s.done" % (ud.fullmirror), d)
|
||||
|
||||
def unpack(self, ud, destdir, d):
|
||||
""" unpack the downloaded src to destdir"""
|
||||
@@ -231,44 +161,18 @@ class Git(FetchMethod):
|
||||
subdir = ud.parm.get("subpath", "")
|
||||
if subdir != "":
|
||||
readpathspec = ":%s" % (subdir)
|
||||
def_destsuffix = "%s/" % os.path.basename(subdir)
|
||||
else:
|
||||
readpathspec = ""
|
||||
def_destsuffix = "git/"
|
||||
|
||||
destsuffix = ud.parm.get("destsuffix", def_destsuffix)
|
||||
destdir = os.path.join(destdir, destsuffix)
|
||||
destdir = os.path.join(destdir, "git/")
|
||||
if os.path.exists(destdir):
|
||||
bb.utils.prunedir(destdir)
|
||||
|
||||
cloneflags = "-s -n"
|
||||
if ud.bareclone:
|
||||
cloneflags += " --mirror"
|
||||
|
||||
# Versions of git prior to 1.7.9.2 have issues where foo.git and foo get confused
|
||||
# and you end up with some horrible union of the two when you attempt to clone it
|
||||
# The least invasive workaround seems to be a symlink to the real directory to
|
||||
# fool git into ignoring any .git version that may also be present.
|
||||
#
|
||||
# The issue is fixed in more recent versions of git so we can drop this hack in future
|
||||
# when that version becomes common enough.
|
||||
clonedir = ud.clonedir
|
||||
if not ud.path.endswith(".git"):
|
||||
indirectiondir = destdir[:-1] + ".indirectionsymlink"
|
||||
if os.path.exists(indirectiondir):
|
||||
os.remove(indirectiondir)
|
||||
bb.utils.mkdirhier(os.path.dirname(indirectiondir))
|
||||
os.symlink(ud.clonedir, indirectiondir)
|
||||
clonedir = indirectiondir
|
||||
|
||||
runfetchcmd("git clone %s %s/ %s" % (cloneflags, clonedir, destdir), d)
|
||||
runfetchcmd("git clone -s -n %s %s" % (ud.clonedir, destdir), d)
|
||||
if not ud.nocheckout:
|
||||
os.chdir(destdir)
|
||||
if subdir != "":
|
||||
runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.revisions[ud.names[0]], readpathspec), d)
|
||||
runfetchcmd("%s checkout-index -q -f -a" % ud.basecmd, d)
|
||||
else:
|
||||
runfetchcmd("%s checkout %s" % (ud.basecmd, ud.revisions[ud.names[0]]), d)
|
||||
runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.revisions[ud.names[0]], readpathspec), d)
|
||||
runfetchcmd("%s checkout-index -q -f -a" % ud.basecmd, d)
|
||||
return True
|
||||
|
||||
def clean(self, ud, d):
|
||||
@@ -282,10 +186,7 @@ class Git(FetchMethod):
|
||||
|
||||
def _contains_ref(self, tag, d):
|
||||
basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
cmd = "%s log --pretty=oneline -n 1 %s -- 2> /dev/null | wc -l" % (basecmd, tag)
|
||||
output = runfetchcmd(cmd, d, quiet=True)
|
||||
if len(output.split()) > 1:
|
||||
raise bb.fetch2.FetchError("The command '%s' gave output with more then 1 line unexpectedly, output: '%s'" % (cmd, output))
|
||||
output = runfetchcmd("%s log --pretty=oneline -n 1 %s -- 2> /dev/null | wc -l" % (basecmd, tag), d, quiet=True)
|
||||
return output.split()[0] != "0"
|
||||
|
||||
def _revision_key(self, url, ud, d, name):
|
||||
@@ -303,11 +204,9 @@ class Git(FetchMethod):
|
||||
else:
|
||||
username = ""
|
||||
|
||||
bb.fetch2.check_network_access(d, "git ls-remote %s%s %s" % (ud.host, ud.path, ud.branches[name]))
|
||||
basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
cmd = "%s ls-remote %s://%s%s%s %s" % \
|
||||
(basecmd, ud.proto, username, ud.host, ud.path, ud.branches[name])
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, cmd)
|
||||
cmd = "%s ls-remote %s://%s%s%s %s" % (basecmd, ud.proto, username, ud.host, ud.path, ud.branches[name])
|
||||
output = runfetchcmd(cmd, d, True)
|
||||
if not output:
|
||||
raise bb.fetch2.FetchError("The command %s gave empty output unexpectedly" % cmd, url)
|
||||
@@ -327,13 +226,10 @@ class Git(FetchMethod):
|
||||
# Check if we have the rev already
|
||||
|
||||
if not os.path.exists(ud.clonedir):
|
||||
logger.debug(1, "GIT repository for %s does not exist in %s. \
|
||||
Downloading.", url, ud.clonedir)
|
||||
print("no repo")
|
||||
self.download(None, ud, d)
|
||||
if not os.path.exists(ud.clonedir):
|
||||
logger.error("GIT repository for %s does not exist in %s after \
|
||||
download. Cannot get sortable buildnumber, using \
|
||||
old value", url, ud.clonedir)
|
||||
logger.error("GIT repository for %s doesn't exist in %s, cannot get sortable buildnumber, using old value", url, ud.clonedir)
|
||||
return None
|
||||
|
||||
|
||||
@@ -347,11 +243,3 @@ class Git(FetchMethod):
|
||||
buildindex = "%s" % output.split()[0]
|
||||
logger.debug(1, "GIT repository for %s in %s is returning %s revisions in rev-list before %s", url, ud.clonedir, buildindex, rev)
|
||||
return buildindex
|
||||
|
||||
def checkstatus(self, uri, ud, d):
|
||||
fetchcmd = "%s ls-remote %s" % (ud.basecmd, uri)
|
||||
try:
|
||||
runfetchcmd(fetchcmd, d, quiet=True)
|
||||
return True
|
||||
except FetchError:
|
||||
return False
|
||||
|
||||
@@ -82,7 +82,7 @@ class Hg(FetchMethod):
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_hg}', d)
|
||||
|
||||
proto = ud.parm.get('protocol', 'http')
|
||||
proto = ud.parm.get('proto', 'http')
|
||||
|
||||
host = ud.host
|
||||
if proto == "file":
|
||||
@@ -94,21 +94,21 @@ class Hg(FetchMethod):
|
||||
else:
|
||||
hgroot = ud.user + "@" + host + ud.path
|
||||
|
||||
if command == "info":
|
||||
if command is "info":
|
||||
return "%s identify -i %s://%s/%s" % (basecmd, proto, hgroot, ud.module)
|
||||
|
||||
options = [];
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
if command == "fetch":
|
||||
if command is "fetch":
|
||||
cmd = "%s clone %s %s://%s/%s %s" % (basecmd, " ".join(options), proto, hgroot, ud.module, ud.module)
|
||||
elif command == "pull":
|
||||
elif command is "pull":
|
||||
# do not pass options list; limiting pull to rev causes the local
|
||||
# repo not to contain it and immediately following "update" command
|
||||
# will crash
|
||||
cmd = "%s pull" % (basecmd)
|
||||
elif command == "update":
|
||||
elif command is "update":
|
||||
cmd = "%s update -C %s" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid hg command %s" % command, ud.url)
|
||||
@@ -166,7 +166,7 @@ class Hg(FetchMethod):
|
||||
output = runfetchcmd(self._buildhgcommand(ud, d, "info"), d)
|
||||
return output.strip()
|
||||
|
||||
def _build_revision(self, url, ud, d, name):
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
|
||||
def _revision_key(self, url, ud, d, name):
|
||||
|
||||
@@ -26,12 +26,10 @@ BitBake build tools.
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import urllib
|
||||
import bb
|
||||
import bb.utils
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod, FetchError
|
||||
from bb.fetch2 import logger
|
||||
from bb.fetch2 import FetchMethod
|
||||
|
||||
class Local(FetchMethod):
|
||||
def supports(self, url, urldata, d):
|
||||
@@ -42,37 +40,29 @@ class Local(FetchMethod):
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
# We don't set localfile as for this fetcher the file is already local!
|
||||
ud.decodedurl = urllib.unquote(ud.url.split("://")[1].split(";")[0])
|
||||
ud.basename = os.path.basename(ud.decodedurl)
|
||||
ud.basepath = ud.decodedurl
|
||||
ud.basename = os.path.basename(ud.url.split("://")[1].split(";")[0])
|
||||
return
|
||||
|
||||
def localpath(self, url, urldata, d):
|
||||
"""
|
||||
Return the local filename of a given url assuming a successful fetch.
|
||||
"""
|
||||
path = urldata.decodedurl
|
||||
path = url.split("://")[1]
|
||||
path = path.split(";")[0]
|
||||
newpath = path
|
||||
dldirfile = os.path.join(data.getVar("DL_DIR", d, True), os.path.basename(path))
|
||||
if os.path.exists(dldirfile):
|
||||
return dldirfile
|
||||
if path[0] != "/":
|
||||
filespath = data.getVar('FILESPATH', d, True)
|
||||
if filespath:
|
||||
logger.debug(2, "Searching for %s in paths: \n%s" % (path, "\n ".join(filespath.split(":"))))
|
||||
newpath = bb.utils.which(filespath, path)
|
||||
if not newpath:
|
||||
filesdir = data.getVar('FILESDIR', d, True)
|
||||
if filesdir:
|
||||
logger.debug(2, "Searching for %s in path: %s" % (path, filesdir))
|
||||
newpath = os.path.join(filesdir, path)
|
||||
if (not newpath or not os.path.exists(newpath)) and path.find("*") != -1:
|
||||
# For expressions using '*', best we can do is take the first directory in FILESPATH that exists
|
||||
newpath = bb.utils.which(filespath, ".")
|
||||
logger.debug(2, "Searching for %s in path: %s" % (path, newpath))
|
||||
return newpath
|
||||
if not os.path.exists(newpath):
|
||||
dldirfile = os.path.join(d.getVar("DL_DIR", True), path)
|
||||
logger.debug(2, "Defaulting to %s for %s" % (dldirfile, path))
|
||||
bb.utils.mkdirhier(os.path.dirname(dldirfile))
|
||||
return dldirfile
|
||||
if not os.path.exists(newpath) and path.find("*") == -1:
|
||||
return dldirfile
|
||||
return newpath
|
||||
|
||||
def need_update(self, url, ud, d):
|
||||
@@ -85,20 +75,7 @@ class Local(FetchMethod):
|
||||
def download(self, url, urldata, d):
|
||||
"""Fetch urls (no-op for Local method)"""
|
||||
# no need to fetch local files, we'll deal with them in place.
|
||||
if self.supports_checksum(urldata) and not os.path.exists(urldata.localpath):
|
||||
locations = []
|
||||
filespath = data.getVar('FILESPATH', d, True)
|
||||
if filespath:
|
||||
locations = filespath.split(":")
|
||||
filesdir = data.getVar('FILESDIR', d, True)
|
||||
if filesdir:
|
||||
locations.append(filesdir)
|
||||
locations.append(d.getVar("DL_DIR", True))
|
||||
|
||||
msg = "Unable to find file " + url + " anywhere. The paths that were searched were:\n " + "\n ".join(locations)
|
||||
raise FetchError(msg)
|
||||
|
||||
return True
|
||||
return 1
|
||||
|
||||
def checkstatus(self, url, urldata, d):
|
||||
"""
|
||||
|
||||
@@ -57,7 +57,7 @@ class Osc(FetchMethod):
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_osc}', d)
|
||||
|
||||
proto = ud.parm.get('protocol', 'ocs')
|
||||
proto = ud.parm.get('proto', 'ocs')
|
||||
|
||||
options = []
|
||||
|
||||
@@ -68,9 +68,9 @@ class Osc(FetchMethod):
|
||||
|
||||
coroot = self._strip_leading_slashes(ud.path)
|
||||
|
||||
if command == "fetch":
|
||||
if command is "fetch":
|
||||
osccmd = "%s %s co %s/%s %s" % (basecmd, config, coroot, ud.module, " ".join(options))
|
||||
elif command == "update":
|
||||
elif command is "update":
|
||||
osccmd = "%s %s up %s" % (basecmd, config, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid osc command %s" % command, ud.url)
|
||||
|
||||
@@ -27,7 +27,6 @@ BitBake build tools.
|
||||
|
||||
from future_builtins import zip
|
||||
import os
|
||||
import subprocess
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
@@ -91,8 +90,8 @@ class Perforce(FetchMethod):
|
||||
|
||||
p4cmd = data.getVar('FETCHCOMMAND_p4', d, True)
|
||||
logger.debug(1, "Running %s%s changes -m 1 %s", p4cmd, p4opt, depot)
|
||||
p4file, errors = bb.process.run("%s%s changes -m 1 %s" % (p4cmd, p4opt, depot))
|
||||
cset = p4file.strip()
|
||||
p4file = os.popen("%s%s changes -m 1 %s" % (p4cmd, p4opt, depot))
|
||||
cset = p4file.readline().strip()
|
||||
logger.debug(1, "READ %s", cset)
|
||||
if not cset:
|
||||
return -1
|
||||
@@ -155,8 +154,8 @@ class Perforce(FetchMethod):
|
||||
logger.debug(2, "Fetch: creating temporary directory")
|
||||
bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
|
||||
data.setVar('TMPBASE', data.expand('${WORKDIR}/oep4.XXXXXX', localdata), localdata)
|
||||
tmpfile, errors = bb.process.run(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
|
||||
tmpfile = tmpfile.strip()
|
||||
tmppipe = os.popen(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
|
||||
tmpfile = tmppipe.readline().strip()
|
||||
if not tmpfile:
|
||||
raise FetchError("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.", loc)
|
||||
|
||||
@@ -169,8 +168,7 @@ class Perforce(FetchMethod):
|
||||
os.chdir(tmpfile)
|
||||
logger.info("Fetch " + loc)
|
||||
logger.info("%s%s files %s", p4cmd, p4opt, depot)
|
||||
p4file, errors = bb.process.run("%s%s files %s" % (p4cmd, p4opt, depot))
|
||||
p4file = p4file.strip()
|
||||
p4file = os.popen("%s%s files %s" % (p4cmd, p4opt, depot))
|
||||
|
||||
if not p4file:
|
||||
raise FetchError("Fetch: unable to get the P4 files from %s" % depot, loc)
|
||||
@@ -186,7 +184,7 @@ class Perforce(FetchMethod):
|
||||
dest = list[0][len(path)+1:]
|
||||
where = dest.find("#")
|
||||
|
||||
subprocess.call("%s%s print -o %s/%s %s" % (p4cmd, p4opt, module, dest[:where], list[0]), shell=True)
|
||||
os.system("%s%s print -o %s/%s %s" % (p4cmd, p4opt, module, dest[:where], list[0]))
|
||||
count = count + 1
|
||||
|
||||
if count == 0:
|
||||
|
||||
@@ -69,9 +69,6 @@ class SSH(FetchMethod):
|
||||
def supports(self, url, urldata, d):
|
||||
return __pattern__.match(url) != None
|
||||
|
||||
def supports_checksum(self, urldata):
|
||||
return False
|
||||
|
||||
def localpath(self, url, urldata, d):
|
||||
m = __pattern__.match(urldata.url)
|
||||
path = m.group('path')
|
||||
|
||||
@@ -77,8 +77,8 @@ class Svk(FetchMethod):
|
||||
logger.debug(2, "Fetch: creating temporary directory")
|
||||
bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
|
||||
data.setVar('TMPBASE', data.expand('${WORKDIR}/oesvk.XXXXXX', localdata), localdata)
|
||||
tmpfile, errors = bb.process.run(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
|
||||
tmpfile = tmpfile.strip()
|
||||
tmppipe = os.popen(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
|
||||
tmpfile = tmppipe.readline().strip()
|
||||
if not tmpfile:
|
||||
logger.error()
|
||||
raise FetchError("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.", loc)
|
||||
|
||||
@@ -49,8 +49,6 @@ class Svn(FetchMethod):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError('module', ud.url)
|
||||
|
||||
ud.basecmd = d.getVar('FETCHCMD_svn', True)
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
# Create paths to svn checkouts
|
||||
@@ -71,7 +69,9 @@ class Svn(FetchMethod):
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
proto = ud.parm.get('protocol', 'svn')
|
||||
basecmd = data.expand('${FETCHCMD_svn}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'svn')
|
||||
|
||||
svn_rsh = None
|
||||
if proto == "svn+ssh" and "rsh" in ud.parm:
|
||||
@@ -87,18 +87,18 @@ class Svn(FetchMethod):
|
||||
if ud.pswd:
|
||||
options.append("--password %s" % ud.pswd)
|
||||
|
||||
if command == "info":
|
||||
svncmd = "%s info %s %s://%s/%s/" % (ud.basecmd, " ".join(options), proto, svnroot, ud.module)
|
||||
if command is "info":
|
||||
svncmd = "%s info %s %s://%s/%s/" % (basecmd, " ".join(options), proto, svnroot, ud.module)
|
||||
else:
|
||||
suffix = ""
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
suffix = "@%s" % (ud.revision)
|
||||
|
||||
if command == "fetch":
|
||||
svncmd = "%s co %s %s://%s/%s%s %s" % (ud.basecmd, " ".join(options), proto, svnroot, ud.module, suffix, ud.module)
|
||||
elif command == "update":
|
||||
svncmd = "%s update %s" % (ud.basecmd, " ".join(options))
|
||||
if command is "fetch":
|
||||
svncmd = "%s co %s %s://%s/%s%s %s" % (basecmd, " ".join(options), proto, svnroot, ud.module, suffix, ud.module)
|
||||
elif command is "update":
|
||||
svncmd = "%s update %s" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid svn command %s" % command, ud.url)
|
||||
|
||||
@@ -117,11 +117,6 @@ class Svn(FetchMethod):
|
||||
logger.info("Update " + loc)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
# We need to attempt to run svn upgrade first in case its an older working format
|
||||
try:
|
||||
runfetchcmd(ud.basecmd + " upgrade", d)
|
||||
except FetchError:
|
||||
pass
|
||||
logger.debug(1, "Running %s", svnupdatecmd)
|
||||
bb.fetch2.check_network_access(d, svnupdatecmd, ud.url)
|
||||
runfetchcmd(svnupdatecmd, d)
|
||||
|
||||
@@ -45,55 +45,46 @@ class Wget(FetchMethod):
|
||||
"""
|
||||
return ud.type in ['http', 'https', 'ftp']
|
||||
|
||||
def recommends_checksum(self, urldata):
|
||||
return True
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
if 'protocol' in ud.parm:
|
||||
if ud.parm['protocol'] == 'git':
|
||||
raise bb.fetch2.ParameterError("Invalid protocol - if you wish to fetch from a git repository using http, you need to instead use the git:// prefix with protocol=http", ud.url)
|
||||
|
||||
if 'downloadfilename' in ud.parm:
|
||||
ud.basename = ud.parm['downloadfilename']
|
||||
else:
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
ud.localfile = data.expand(urllib.unquote(ud.basename), d)
|
||||
|
||||
def download(self, uri, ud, d, checkonly = False):
|
||||
"""Fetch urls"""
|
||||
|
||||
basecmd = d.getVar("FETCHCMD_wget", True) or "/usr/bin/env wget -t 2 -T 30 -nv --passive-ftp --no-check-certificate"
|
||||
def fetch_uri(uri, ud, d):
|
||||
if checkonly:
|
||||
fetchcmd = data.getVar("CHECKCOMMAND", d, True)
|
||||
elif os.path.exists(ud.localpath):
|
||||
# file exists, but we didnt complete it.. trying again..
|
||||
fetchcmd = data.getVar("RESUMECOMMAND", d, True)
|
||||
else:
|
||||
fetchcmd = data.getVar("FETCHCOMMAND", d, True)
|
||||
|
||||
if 'downloadfilename' in ud.parm:
|
||||
basecmd += " -O ${DL_DIR}/" + ud.localfile
|
||||
uri = uri.split(";")[0]
|
||||
uri_decoded = list(decodeurl(uri))
|
||||
uri_type = uri_decoded[0]
|
||||
uri_host = uri_decoded[1]
|
||||
|
||||
if checkonly:
|
||||
fetchcmd = d.getVar("CHECKCOMMAND_wget", True) or d.expand(basecmd + " --spider '${URI}'")
|
||||
elif os.path.exists(ud.localpath):
|
||||
# file exists, but we didnt complete it.. trying again..
|
||||
fetchcmd = d.getVar("RESUMECOMMAND_wget", True) or d.expand(basecmd + " -c -P ${DL_DIR} '${URI}'")
|
||||
else:
|
||||
fetchcmd = d.getVar("FETCHCOMMAND_wget", True) or d.expand(basecmd + " -P ${DL_DIR} '${URI}'")
|
||||
|
||||
uri = uri.split(";")[0]
|
||||
uri_decoded = list(decodeurl(uri))
|
||||
uri_type = uri_decoded[0]
|
||||
uri_host = uri_decoded[1]
|
||||
|
||||
fetchcmd = fetchcmd.replace("${URI}", uri.split(";")[0])
|
||||
fetchcmd = fetchcmd.replace("${FILE}", ud.basename)
|
||||
if not checkonly:
|
||||
fetchcmd = fetchcmd.replace("${URI}", uri.split(";")[0])
|
||||
fetchcmd = fetchcmd.replace("${FILE}", ud.basename)
|
||||
logger.info("fetch " + uri)
|
||||
logger.debug(2, "executing " + fetchcmd)
|
||||
bb.fetch2.check_network_access(d, fetchcmd)
|
||||
runfetchcmd(fetchcmd, d, quiet=checkonly)
|
||||
bb.fetch2.check_network_access(d, fetchcmd)
|
||||
runfetchcmd(fetchcmd, d)
|
||||
|
||||
# Sanity check since wget can pretend it succeed when it didn't
|
||||
# Also, this used to happen if sourceforge sent us to the mirror page
|
||||
if not os.path.exists(ud.localpath) and not checkonly:
|
||||
raise FetchError("The fetch command returned success for url %s but %s doesn't exist?!" % (uri, ud.localpath), uri)
|
||||
# Sanity check since wget can pretend it succeed when it didn't
|
||||
# Also, this used to happen if sourceforge sent us to the mirror page
|
||||
if not os.path.exists(ud.localpath) and not checkonly:
|
||||
raise FetchError("The fetch command returned success for url %s but %s doesn't exist?!" % (uri, ud.localpath), uri)
|
||||
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "wget:" + data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
fetch_uri(uri, ud, localdata)
|
||||
|
||||
return True
|
||||
|
||||
def checkstatus(self, uri, ud, d):
|
||||
|
||||
@@ -33,7 +33,9 @@
|
||||
from bb.utils import better_compile, better_exec
|
||||
from bb import error
|
||||
|
||||
# A dict of function names we have seen
|
||||
# A dict of modules we have handled
|
||||
# it is the number of .bbclasses + x in size
|
||||
_parsed_methods = { }
|
||||
_parsed_fns = { }
|
||||
|
||||
def insert_method(modulename, code, fn):
|
||||
@@ -50,22 +52,33 @@ def insert_method(modulename, code, fn):
|
||||
if name in ['None', 'False']:
|
||||
continue
|
||||
elif name in _parsed_fns and not _parsed_fns[name] == modulename:
|
||||
error("The function %s defined in %s was already declared in %s. BitBake has a global python function namespace so shared functions should be declared in a common include file rather than being duplicated, or if the functions are different, please use different function names." % (name, modulename, _parsed_fns[name]))
|
||||
error( "Error Method already seen: %s in' %s' now in '%s'" % (name, _parsed_fns[name], modulename))
|
||||
else:
|
||||
_parsed_fns[name] = modulename
|
||||
|
||||
# A dict of modules the parser has finished with
|
||||
_parsed_methods = {}
|
||||
def check_insert_method(modulename, code, fn):
|
||||
"""
|
||||
Add the code if it wasnt added before. The module
|
||||
name will be used for that
|
||||
|
||||
Variables:
|
||||
@modulename a short name e.g. base.bbclass
|
||||
@code The actual python code
|
||||
@fn The filename from the outer file
|
||||
"""
|
||||
if not modulename in _parsed_methods:
|
||||
return insert_method(modulename, code, fn)
|
||||
_parsed_methods[modulename] = 1
|
||||
|
||||
def parsed_module(modulename):
|
||||
"""
|
||||
Has module been parsed?
|
||||
Inform me file xyz was parsed
|
||||
"""
|
||||
return modulename in _parsed_methods
|
||||
|
||||
def set_parsed_module(modulename):
|
||||
"""
|
||||
Set module as parsed
|
||||
"""
|
||||
_parsed_methods[modulename] = True
|
||||
|
||||
def get_parsed_dict():
|
||||
"""
|
||||
shortcut
|
||||
"""
|
||||
return _parsed_methods
|
||||
|
||||
@@ -1,249 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Copyright (C) 2012 Robert Yang
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os, logging, re, sys
|
||||
import bb
|
||||
logger = logging.getLogger("BitBake.Monitor")
|
||||
|
||||
def printErr(info):
|
||||
logger.error("%s\n Disk space monitor will NOT be enabled" % info)
|
||||
|
||||
def convertGMK(unit):
|
||||
|
||||
""" Convert the space unit G, M, K, the unit is case-insensitive """
|
||||
|
||||
unitG = re.match('([1-9][0-9]*)[gG]\s?$', unit)
|
||||
if unitG:
|
||||
return int(unitG.group(1)) * (1024 ** 3)
|
||||
unitM = re.match('([1-9][0-9]*)[mM]\s?$', unit)
|
||||
if unitM:
|
||||
return int(unitM.group(1)) * (1024 ** 2)
|
||||
unitK = re.match('([1-9][0-9]*)[kK]\s?$', unit)
|
||||
if unitK:
|
||||
return int(unitK.group(1)) * 1024
|
||||
unitN = re.match('([1-9][0-9]*)\s?$', unit)
|
||||
if unitN:
|
||||
return int(unitN.group(1))
|
||||
else:
|
||||
return None
|
||||
|
||||
def getMountedDev(path):
|
||||
|
||||
""" Get the device mounted at the path, uses /proc/mounts """
|
||||
|
||||
# Get the mount point of the filesystem containing path
|
||||
# st_dev is the ID of device containing file
|
||||
parentDev = os.stat(path).st_dev
|
||||
currentDev = parentDev
|
||||
# When the current directory's device is different from the
|
||||
# parrent's, then the current directory is a mount point
|
||||
while parentDev == currentDev:
|
||||
mountPoint = path
|
||||
# Use dirname to get the parrent's directory
|
||||
path = os.path.dirname(path)
|
||||
# Reach the "/"
|
||||
if path == mountPoint:
|
||||
break
|
||||
parentDev= os.stat(path).st_dev
|
||||
|
||||
try:
|
||||
with open("/proc/mounts", "r") as ifp:
|
||||
for line in ifp:
|
||||
procLines = line.rstrip('\n').split()
|
||||
if procLines[1] == mountPoint:
|
||||
return procLines[0]
|
||||
except EnvironmentError:
|
||||
pass
|
||||
return None
|
||||
|
||||
def getDiskData(BBDirs, configuration):
|
||||
|
||||
"""Prepare disk data for disk space monitor"""
|
||||
|
||||
# Save the device IDs, need the ID to be unique (the dictionary's key is
|
||||
# unique), so that when more than one directories are located in the same
|
||||
# device, we just monitor it once
|
||||
devDict = {}
|
||||
for pathSpaceInode in BBDirs.split():
|
||||
# The input format is: "dir,space,inode", dir is a must, space
|
||||
# and inode are optional
|
||||
pathSpaceInodeRe = re.match('([^,]*),([^,]*),([^,]*),?(.*)', pathSpaceInode)
|
||||
if not pathSpaceInodeRe:
|
||||
printErr("Invalid value in BB_DISKMON_DIRS: %s" % pathSpaceInode)
|
||||
return None
|
||||
|
||||
action = pathSpaceInodeRe.group(1)
|
||||
if action not in ("ABORT", "STOPTASKS", "WARN"):
|
||||
printErr("Unknown disk space monitor action: %s" % action)
|
||||
return None
|
||||
|
||||
path = os.path.realpath(pathSpaceInodeRe.group(2))
|
||||
if not path:
|
||||
printErr("Invalid path value in BB_DISKMON_DIRS: %s" % pathSpaceInode)
|
||||
return None
|
||||
|
||||
# The disk space or inode is optional, but it should have a correct
|
||||
# value once it is specified
|
||||
minSpace = pathSpaceInodeRe.group(3)
|
||||
if minSpace:
|
||||
minSpace = convertGMK(minSpace)
|
||||
if not minSpace:
|
||||
printErr("Invalid disk space value in BB_DISKMON_DIRS: %s" % pathSpaceInodeRe.group(3))
|
||||
return None
|
||||
else:
|
||||
# 0 means that it is not specified
|
||||
minSpace = None
|
||||
|
||||
minInode = pathSpaceInodeRe.group(4)
|
||||
if minInode:
|
||||
minInode = convertGMK(minInode)
|
||||
if not minInode:
|
||||
printErr("Invalid inode value in BB_DISKMON_DIRS: %s" % pathSpaceInodeRe.group(4))
|
||||
return None
|
||||
else:
|
||||
# 0 means that it is not specified
|
||||
minInode = None
|
||||
|
||||
if minSpace is None and minInode is None:
|
||||
printErr("No disk space or inode value in found BB_DISKMON_DIRS: %s" % pathSpaceInode)
|
||||
return None
|
||||
# mkdir for the directory since it may not exist, for example the
|
||||
# DL_DIR may not exist at the very beginning
|
||||
if not os.path.exists(path):
|
||||
bb.utils.mkdirhier(path)
|
||||
mountedDev = getMountedDev(path)
|
||||
devDict[mountedDev] = action, path, minSpace, minInode
|
||||
|
||||
return devDict
|
||||
|
||||
def getInterval(configuration):
|
||||
|
||||
""" Get the disk space interval """
|
||||
|
||||
# The default value is 50M and 5K.
|
||||
spaceDefault = 50 * 1024 * 1024
|
||||
inodeDefault = 5 * 1024
|
||||
|
||||
interval = configuration.getVar("BB_DISKMON_WARNINTERVAL", True)
|
||||
if not interval:
|
||||
return spaceDefault, inodeDefault
|
||||
else:
|
||||
# The disk space or inode interval is optional, but it should
|
||||
# have a correct value once it is specified
|
||||
intervalRe = re.match('([^,]*),?\s*(.*)', interval)
|
||||
if intervalRe:
|
||||
intervalSpace = intervalRe.group(1)
|
||||
if intervalSpace:
|
||||
intervalSpace = convertGMK(intervalSpace)
|
||||
if not intervalSpace:
|
||||
printErr("Invalid disk space interval value in BB_DISKMON_WARNINTERVAL: %s" % intervalRe.group(1))
|
||||
return None, None
|
||||
else:
|
||||
intervalSpace = spaceDefault
|
||||
intervalInode = intervalRe.group(2)
|
||||
if intervalInode:
|
||||
intervalInode = convertGMK(intervalInode)
|
||||
if not intervalInode:
|
||||
printErr("Invalid disk inode interval value in BB_DISKMON_WARNINTERVAL: %s" % intervalRe.group(2))
|
||||
return None, None
|
||||
else:
|
||||
intervalInode = inodeDefault
|
||||
return intervalSpace, intervalInode
|
||||
else:
|
||||
printErr("Invalid interval value in BB_DISKMON_WARNINTERVAL: %s" % interval)
|
||||
return None, None
|
||||
|
||||
class diskMonitor:
|
||||
|
||||
"""Prepare the disk space monitor data"""
|
||||
|
||||
def __init__(self, configuration):
|
||||
|
||||
self.enableMonitor = False
|
||||
self.configuration = configuration
|
||||
|
||||
BBDirs = configuration.getVar("BB_DISKMON_DIRS", True) or None
|
||||
if BBDirs:
|
||||
self.devDict = getDiskData(BBDirs, configuration)
|
||||
if self.devDict:
|
||||
self.spaceInterval, self.inodeInterval = getInterval(configuration)
|
||||
if self.spaceInterval and self.inodeInterval:
|
||||
self.enableMonitor = True
|
||||
# These are for saving the previous disk free space and inode, we
|
||||
# use them to avoid print too many warning messages
|
||||
self.preFreeS = {}
|
||||
self.preFreeI = {}
|
||||
# This is for STOPTASKS and ABORT, to avoid print the message repeatly
|
||||
# during waiting the tasks to finish
|
||||
self.checked = {}
|
||||
for dev in self.devDict:
|
||||
self.preFreeS[dev] = 0
|
||||
self.preFreeI[dev] = 0
|
||||
self.checked[dev] = False
|
||||
if self.spaceInterval is None and self.inodeInterval is None:
|
||||
self.enableMonitor = False
|
||||
|
||||
def check(self, rq):
|
||||
|
||||
""" Take action for the monitor """
|
||||
|
||||
if self.enableMonitor:
|
||||
for dev in self.devDict:
|
||||
st = os.statvfs(self.devDict[dev][1])
|
||||
|
||||
# The free space, float point number
|
||||
freeSpace = st.f_bavail * st.f_frsize
|
||||
|
||||
if self.devDict[dev][2] and freeSpace < self.devDict[dev][2]:
|
||||
# Always show warning, the self.checked would always be False if the action is WARN
|
||||
if self.preFreeS[dev] == 0 or self.preFreeS[dev] - freeSpace > self.spaceInterval and not self.checked[dev]:
|
||||
logger.warn("The free space of %s is running low (%.3fGB left)" % (dev, freeSpace / 1024 / 1024 / 1024.0))
|
||||
self.preFreeS[dev] = freeSpace
|
||||
|
||||
if self.devDict[dev][0] == "STOPTASKS" and not self.checked[dev]:
|
||||
logger.error("No new tasks can be excuted since the disk space monitor action is \"STOPTASKS\"!")
|
||||
self.checked[dev] = True
|
||||
rq.finish_runqueue(False)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'disk', freeSpace, self.devDict[dev][1]), self.configuration)
|
||||
elif self.devDict[dev][0] == "ABORT" and not self.checked[dev]:
|
||||
logger.error("Immediately abort since the disk space monitor action is \"ABORT\"!")
|
||||
self.checked[dev] = True
|
||||
rq.finish_runqueue(True)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'disk', freeSpace, self.devDict[dev][1]), self.configuration)
|
||||
|
||||
# The free inodes, float point number
|
||||
freeInode = st.f_favail
|
||||
|
||||
if self.devDict[dev][3] and freeInode < self.devDict[dev][3]:
|
||||
# Always show warning, the self.checked would always be False if the action is WARN
|
||||
if self.preFreeI[dev] == 0 or self.preFreeI[dev] - freeInode > self.inodeInterval and not self.checked[dev]:
|
||||
logger.warn("The free inode of %s is running low (%.3fK left)" % (dev, freeInode / 1024.0))
|
||||
self.preFreeI[dev] = freeInode
|
||||
|
||||
if self.devDict[dev][0] == "STOPTASKS" and not self.checked[dev]:
|
||||
logger.error("No new tasks can be excuted since the disk space monitor action is \"STOPTASKS\"!")
|
||||
self.checked[dev] = True
|
||||
rq.finish_runqueue(False)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'inode', freeSpace, self.devDict[dev][1]), self.configuration)
|
||||
elif self.devDict[dev][0] == "ABORT" and not self.checked[dev]:
|
||||
logger.error("Immediately abort since the disk space monitor action is \"ABORT\"!")
|
||||
self.checked[dev] = True
|
||||
rq.finish_runqueue(True)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'inode', freeSpace, self.devDict[dev][1]), self.configuration)
|
||||
return
|
||||
@@ -23,7 +23,6 @@ Message handling infrastructure for bitbake
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import sys
|
||||
import copy
|
||||
import logging
|
||||
import collections
|
||||
from itertools import groupby
|
||||
@@ -56,25 +55,6 @@ class BBLogFormatter(logging.Formatter):
|
||||
CRITICAL: 'ERROR',
|
||||
}
|
||||
|
||||
color_enabled = False
|
||||
BASECOLOR, BLACK, RED, GREEN, YELLOW, BLUE, MAGENTA, CYAN, WHITE = range(29,38)
|
||||
|
||||
COLORS = {
|
||||
DEBUG3 : CYAN,
|
||||
DEBUG2 : CYAN,
|
||||
DEBUG : CYAN,
|
||||
VERBOSE : BASECOLOR,
|
||||
NOTE : BASECOLOR,
|
||||
PLAIN : BASECOLOR,
|
||||
WARNING : YELLOW,
|
||||
ERROR : RED,
|
||||
CRITICAL: RED,
|
||||
}
|
||||
|
||||
BLD = '\033[1;%dm'
|
||||
STD = '\033[%dm'
|
||||
RST = '\033[0m'
|
||||
|
||||
def getLevelName(self, levelno):
|
||||
try:
|
||||
return self.levelnames[levelno]
|
||||
@@ -85,95 +65,136 @@ class BBLogFormatter(logging.Formatter):
|
||||
def format(self, record):
|
||||
record.levelname = self.getLevelName(record.levelno)
|
||||
if record.levelno == self.PLAIN:
|
||||
msg = record.getMessage()
|
||||
return record.getMessage()
|
||||
else:
|
||||
if self.color_enabled:
|
||||
record = self.colorize(record)
|
||||
msg = logging.Formatter.format(self, record)
|
||||
return logging.Formatter.format(self, record)
|
||||
|
||||
if hasattr(record, 'bb_exc_info'):
|
||||
etype, value, tb = record.bb_exc_info
|
||||
formatted = bb.exceptions.format_exception(etype, value, tb, limit=5)
|
||||
msg += '\n' + ''.join(formatted)
|
||||
return msg
|
||||
class Loggers(dict):
|
||||
def __getitem__(self, key):
|
||||
if key in self:
|
||||
return dict.__getitem__(self, key)
|
||||
else:
|
||||
log = logging.getLogger("BitBake.%s" % domain._fields[key])
|
||||
dict.__setitem__(self, key, log)
|
||||
return log
|
||||
|
||||
def colorize(self, record):
|
||||
color = self.COLORS[record.levelno]
|
||||
if self.color_enabled and color is not None:
|
||||
record = copy.copy(record)
|
||||
record.levelname = "".join([self.BLD % color, record.levelname, self.RST])
|
||||
record.msg = "".join([self.STD % color, record.msg, self.RST])
|
||||
return record
|
||||
|
||||
def enable_color(self):
|
||||
self.color_enabled = True
|
||||
|
||||
class BBLogFilter(object):
|
||||
def __init__(self, handler, level, debug_domains):
|
||||
self.stdlevel = level
|
||||
self.debug_domains = debug_domains
|
||||
loglevel = level
|
||||
for domain in debug_domains:
|
||||
if debug_domains[domain] < loglevel:
|
||||
loglevel = debug_domains[domain]
|
||||
handler.setLevel(loglevel)
|
||||
handler.addFilter(self)
|
||||
|
||||
def filter(self, record):
|
||||
if record.levelno >= self.stdlevel:
|
||||
return True
|
||||
if record.name in self.debug_domains and record.levelno >= self.debug_domains[record.name]:
|
||||
return True
|
||||
return False
|
||||
class DebugLevel(dict):
|
||||
def __getitem__(self, key):
|
||||
if key == "default":
|
||||
key = domain.Default
|
||||
return get_debug_level(key)
|
||||
|
||||
def _NamedTuple(name, fields):
|
||||
Tuple = collections.namedtuple(name, " ".join(fields))
|
||||
return Tuple(*range(len(fields)))
|
||||
|
||||
domain = _NamedTuple("Domain", (
|
||||
"Default",
|
||||
"Build",
|
||||
"Cache",
|
||||
"Collection",
|
||||
"Data",
|
||||
"Depends",
|
||||
"Fetcher",
|
||||
"Parsing",
|
||||
"PersistData",
|
||||
"Provider",
|
||||
"RunQueue",
|
||||
"TaskData",
|
||||
"Util"))
|
||||
logger = logging.getLogger("BitBake")
|
||||
loggers = Loggers()
|
||||
debug_level = DebugLevel()
|
||||
|
||||
# Message control functions
|
||||
#
|
||||
|
||||
loggerDefaultDebugLevel = 0
|
||||
loggerDefaultVerbose = False
|
||||
loggerVerboseLogs = False
|
||||
loggerDefaultDomains = []
|
||||
def set_debug_level(level):
|
||||
for log in loggers.itervalues():
|
||||
log.setLevel(logging.NOTSET)
|
||||
|
||||
def init_msgconfig(verbose, debug, debug_domains = []):
|
||||
"""
|
||||
Set default verbosity and debug levels config the logger
|
||||
"""
|
||||
bb.msg.loggerDefaultDebugLevel = debug
|
||||
bb.msg.loggerDefaultVerbose = verbose
|
||||
if verbose:
|
||||
bb.msg.loggerVerboseLogs = True
|
||||
bb.msg.loggerDefaultDomains = debug_domains
|
||||
|
||||
def addDefaultlogFilter(handler):
|
||||
|
||||
debug = loggerDefaultDebugLevel
|
||||
verbose = loggerDefaultVerbose
|
||||
domains = loggerDefaultDomains
|
||||
|
||||
if debug:
|
||||
level = BBLogFormatter.DEBUG - debug + 1
|
||||
elif verbose:
|
||||
level = BBLogFormatter.VERBOSE
|
||||
if level:
|
||||
logger.setLevel(logging.DEBUG - level + 1)
|
||||
else:
|
||||
level = BBLogFormatter.NOTE
|
||||
logger.setLevel(logging.INFO)
|
||||
|
||||
debug_domains = {}
|
||||
for (domainarg, iterator) in groupby(domains):
|
||||
dlevel = len(tuple(iterator))
|
||||
debug_domains["BitBake.%s" % domainarg] = logging.DEBUG - dlevel + 1
|
||||
def get_debug_level(msgdomain = domain.Default):
|
||||
if not msgdomain:
|
||||
level = logger.getEffectiveLevel()
|
||||
else:
|
||||
level = loggers[msgdomain].getEffectiveLevel()
|
||||
return max(0, logging.DEBUG - level + 1)
|
||||
|
||||
BBLogFilter(handler, level, debug_domains)
|
||||
def set_verbose(level):
|
||||
if level:
|
||||
logger.setLevel(BBLogFormatter.VERBOSE)
|
||||
else:
|
||||
logger.setLevel(BBLogFormatter.INFO)
|
||||
|
||||
def set_debug_domains(domainargs):
|
||||
for (domainarg, iterator) in groupby(domainargs):
|
||||
for index, msgdomain in enumerate(domain._fields):
|
||||
if msgdomain == domainarg:
|
||||
level = len(tuple(iterator))
|
||||
if level:
|
||||
loggers[index].setLevel(logging.DEBUG - level + 1)
|
||||
break
|
||||
else:
|
||||
warn(None, "Logging domain %s is not valid, ignoring" % domainarg)
|
||||
|
||||
#
|
||||
# Message handling functions
|
||||
#
|
||||
|
||||
def fatal(msgdomain, msg):
|
||||
if msgdomain:
|
||||
logger = logging.getLogger("BitBake.%s" % msgdomain)
|
||||
def debug(level, msgdomain, msg):
|
||||
warnings.warn("bb.msg.debug will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
level = logging.DEBUG - (level - 1)
|
||||
if not msgdomain:
|
||||
logger.debug(level, msg)
|
||||
else:
|
||||
logger = logging.getLogger("BitBake")
|
||||
logger.critical(msg)
|
||||
loggers[msgdomain].debug(level, msg)
|
||||
|
||||
def plain(msg):
|
||||
warnings.warn("bb.msg.plain will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
logger.plain(msg)
|
||||
|
||||
def note(level, msgdomain, msg):
|
||||
warnings.warn("bb.msg.note will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
if level > 1:
|
||||
if msgdomain:
|
||||
logger.verbose(msg)
|
||||
else:
|
||||
loggers[msgdomain].verbose(msg)
|
||||
else:
|
||||
if msgdomain:
|
||||
logger.info(msg)
|
||||
else:
|
||||
loggers[msgdomain].info(msg)
|
||||
|
||||
def warn(msgdomain, msg):
|
||||
warnings.warn("bb.msg.warn will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
if not msgdomain:
|
||||
logger.warn(msg)
|
||||
else:
|
||||
loggers[msgdomain].warn(msg)
|
||||
|
||||
def error(msgdomain, msg):
|
||||
warnings.warn("bb.msg.error will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
if not msgdomain:
|
||||
logger.error(msg)
|
||||
else:
|
||||
loggers[msgdomain].error(msg)
|
||||
|
||||
def fatal(msgdomain, msg):
|
||||
warnings.warn("bb.msg.fatal will soon be deprecated in favor of raising appropriate exceptions",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
if not msgdomain:
|
||||
logger.critical(msg)
|
||||
else:
|
||||
loggers[msgdomain].critical(msg)
|
||||
sys.exit(1)
|
||||
|
||||
@@ -1,255 +0,0 @@
|
||||
# http://code.activestate.com/recipes/577629-namedtupleabc-abstract-base-class-mix-in-for-named/
|
||||
#!/usr/bin/env python
|
||||
# Copyright (c) 2011 Jan Kaliszewski (zuo). Available under the MIT License.
|
||||
|
||||
"""
|
||||
namedtuple_with_abc.py:
|
||||
* named tuple mix-in + ABC (abstract base class) recipe,
|
||||
* works under Python 2.6, 2.7 as well as 3.x.
|
||||
|
||||
Import this module to patch collections.namedtuple() factory function
|
||||
-- enriching it with the 'abc' attribute (an abstract base class + mix-in
|
||||
for named tuples) and decorating it with a wrapper that registers each
|
||||
newly created named tuple as a subclass of namedtuple.abc.
|
||||
|
||||
How to import:
|
||||
import collections, namedtuple_with_abc
|
||||
or:
|
||||
import namedtuple_with_abc
|
||||
from collections import namedtuple
|
||||
# ^ in this variant you must import namedtuple function
|
||||
# *after* importing namedtuple_with_abc module
|
||||
or simply:
|
||||
from namedtuple_with_abc import namedtuple
|
||||
|
||||
Simple usage example:
|
||||
class Credentials(namedtuple.abc):
|
||||
_fields = 'username password'
|
||||
def __str__(self):
|
||||
return ('{0.__class__.__name__}'
|
||||
'(username={0.username}, password=...)'.format(self))
|
||||
print(Credentials("alice", "Alice's password"))
|
||||
|
||||
For more advanced examples -- see below the "if __name__ == '__main__':".
|
||||
"""
|
||||
|
||||
import collections
|
||||
from abc import ABCMeta, abstractproperty
|
||||
from functools import wraps
|
||||
from sys import version_info
|
||||
|
||||
__all__ = ('namedtuple',)
|
||||
_namedtuple = collections.namedtuple
|
||||
|
||||
|
||||
class _NamedTupleABCMeta(ABCMeta):
|
||||
'''The metaclass for the abstract base class + mix-in for named tuples.'''
|
||||
def __new__(mcls, name, bases, namespace):
|
||||
fields = namespace.get('_fields')
|
||||
for base in bases:
|
||||
if fields is not None:
|
||||
break
|
||||
fields = getattr(base, '_fields', None)
|
||||
if not isinstance(fields, abstractproperty):
|
||||
basetuple = _namedtuple(name, fields)
|
||||
bases = (basetuple,) + bases
|
||||
namespace.pop('_fields', None)
|
||||
namespace.setdefault('__doc__', basetuple.__doc__)
|
||||
namespace.setdefault('__slots__', ())
|
||||
return ABCMeta.__new__(mcls, name, bases, namespace)
|
||||
|
||||
|
||||
exec(
|
||||
# Python 2.x metaclass declaration syntax
|
||||
"""class _NamedTupleABC(object):
|
||||
'''The abstract base class + mix-in for named tuples.'''
|
||||
__metaclass__ = _NamedTupleABCMeta
|
||||
_fields = abstractproperty()""" if version_info[0] < 3 else
|
||||
# Python 3.x metaclass declaration syntax
|
||||
"""class _NamedTupleABC(metaclass=_NamedTupleABCMeta):
|
||||
'''The abstract base class + mix-in for named tuples.'''
|
||||
_fields = abstractproperty()"""
|
||||
)
|
||||
|
||||
|
||||
_namedtuple.abc = _NamedTupleABC
|
||||
#_NamedTupleABC.register(type(version_info)) # (and similar, in the future...)
|
||||
|
||||
@wraps(_namedtuple)
|
||||
def namedtuple(*args, **kwargs):
|
||||
'''Named tuple factory with namedtuple.abc subclass registration.'''
|
||||
cls = _namedtuple(*args, **kwargs)
|
||||
_NamedTupleABC.register(cls)
|
||||
return cls
|
||||
|
||||
collections.namedtuple = namedtuple
|
||||
|
||||
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
|
||||
'''Examples and explanations'''
|
||||
|
||||
# Simple usage
|
||||
|
||||
class MyRecord(namedtuple.abc):
|
||||
_fields = 'x y z' # such form will be transformed into ('x', 'y', 'z')
|
||||
def _my_custom_method(self):
|
||||
return list(self._asdict().items())
|
||||
# (the '_fields' attribute belongs to the named tuple public API anyway)
|
||||
|
||||
rec = MyRecord(1, 2, 3)
|
||||
print(rec)
|
||||
print(rec._my_custom_method())
|
||||
print(rec._replace(y=222))
|
||||
print(rec._replace(y=222)._my_custom_method())
|
||||
|
||||
# Custom abstract classes...
|
||||
|
||||
class MyAbstractRecord(namedtuple.abc):
|
||||
def _my_custom_method(self):
|
||||
return list(self._asdict().items())
|
||||
|
||||
try:
|
||||
MyAbstractRecord() # (abstract classes cannot be instantiated)
|
||||
except TypeError as exc:
|
||||
print(exc)
|
||||
|
||||
class AnotherAbstractRecord(MyAbstractRecord):
|
||||
def __str__(self):
|
||||
return '<<<{0}>>>'.format(super(AnotherAbstractRecord,
|
||||
self).__str__())
|
||||
|
||||
# ...and their non-abstract subclasses
|
||||
|
||||
class MyRecord2(MyAbstractRecord):
|
||||
_fields = 'a, b'
|
||||
|
||||
class MyRecord3(AnotherAbstractRecord):
|
||||
_fields = 'p', 'q', 'r'
|
||||
|
||||
rec2 = MyRecord2('foo', 'bar')
|
||||
print(rec2)
|
||||
print(rec2._my_custom_method())
|
||||
print(rec2._replace(b=222))
|
||||
print(rec2._replace(b=222)._my_custom_method())
|
||||
|
||||
rec3 = MyRecord3('foo', 'bar', 'baz')
|
||||
print(rec3)
|
||||
print(rec3._my_custom_method())
|
||||
print(rec3._replace(q=222))
|
||||
print(rec3._replace(q=222)._my_custom_method())
|
||||
|
||||
# You can also subclass non-abstract ones...
|
||||
|
||||
class MyRecord33(MyRecord3):
|
||||
def __str__(self):
|
||||
return '< {0!r}, ..., {0!r} >'.format(self.p, self.r)
|
||||
|
||||
rec33 = MyRecord33('foo', 'bar', 'baz')
|
||||
print(rec33)
|
||||
print(rec33._my_custom_method())
|
||||
print(rec33._replace(q=222))
|
||||
print(rec33._replace(q=222)._my_custom_method())
|
||||
|
||||
# ...and even override the magic '_fields' attribute again
|
||||
|
||||
class MyRecord345(MyRecord3):
|
||||
_fields = 'e f g h i j k'
|
||||
|
||||
rec345 = MyRecord345(1, 2, 3, 4, 3, 2, 1)
|
||||
print(rec345)
|
||||
print(rec345._my_custom_method())
|
||||
print(rec345._replace(f=222))
|
||||
print(rec345._replace(f=222)._my_custom_method())
|
||||
|
||||
# Mixing-in some other classes is also possible:
|
||||
|
||||
class MyMixIn(object):
|
||||
def method(self):
|
||||
return "MyMixIn.method() called"
|
||||
def _my_custom_method(self):
|
||||
return "MyMixIn._my_custom_method() called"
|
||||
def count(self, item):
|
||||
return "MyMixIn.count({0}) called".format(item)
|
||||
def _asdict(self): # (cannot override a namedtuple method, see below)
|
||||
return "MyMixIn._asdict() called"
|
||||
|
||||
class MyRecord4(MyRecord33, MyMixIn): # mix-in on the right
|
||||
_fields = 'j k l x'
|
||||
|
||||
class MyRecord5(MyMixIn, MyRecord33): # mix-in on the left
|
||||
_fields = 'j k l x y'
|
||||
|
||||
rec4 = MyRecord4(1, 2, 3, 2)
|
||||
print(rec4)
|
||||
print(rec4.method())
|
||||
print(rec4._my_custom_method()) # MyRecord33's
|
||||
print(rec4.count(2)) # tuple's
|
||||
print(rec4._replace(k=222))
|
||||
print(rec4._replace(k=222).method())
|
||||
print(rec4._replace(k=222)._my_custom_method()) # MyRecord33's
|
||||
print(rec4._replace(k=222).count(8)) # tuple's
|
||||
|
||||
rec5 = MyRecord5(1, 2, 3, 2, 1)
|
||||
print(rec5)
|
||||
print(rec5.method())
|
||||
print(rec5._my_custom_method()) # MyMixIn's
|
||||
print(rec5.count(2)) # MyMixIn's
|
||||
print(rec5._replace(k=222))
|
||||
print(rec5._replace(k=222).method())
|
||||
print(rec5._replace(k=222)._my_custom_method()) # MyMixIn's
|
||||
print(rec5._replace(k=222).count(2)) # MyMixIn's
|
||||
|
||||
# None that behavior: the standard namedtuple methods cannot be
|
||||
# overriden by a foreign mix-in -- even if the mix-in is declared
|
||||
# as the leftmost base class (but, obviously, you can override them
|
||||
# in the defined class or its subclasses):
|
||||
|
||||
print(rec4._asdict()) # (returns a dict, not "MyMixIn._asdict() called")
|
||||
print(rec5._asdict()) # (returns a dict, not "MyMixIn._asdict() called")
|
||||
|
||||
class MyRecord6(MyRecord33):
|
||||
_fields = 'j k l x y z'
|
||||
def _asdict(self):
|
||||
return "MyRecord6._asdict() called"
|
||||
rec6 = MyRecord6(1, 2, 3, 1, 2, 3)
|
||||
print(rec6._asdict()) # (this returns "MyRecord6._asdict() called")
|
||||
|
||||
# All that record classes are real subclasses of namedtuple.abc:
|
||||
|
||||
assert issubclass(MyRecord, namedtuple.abc)
|
||||
assert issubclass(MyAbstractRecord, namedtuple.abc)
|
||||
assert issubclass(AnotherAbstractRecord, namedtuple.abc)
|
||||
assert issubclass(MyRecord2, namedtuple.abc)
|
||||
assert issubclass(MyRecord3, namedtuple.abc)
|
||||
assert issubclass(MyRecord33, namedtuple.abc)
|
||||
assert issubclass(MyRecord345, namedtuple.abc)
|
||||
assert issubclass(MyRecord4, namedtuple.abc)
|
||||
assert issubclass(MyRecord5, namedtuple.abc)
|
||||
assert issubclass(MyRecord6, namedtuple.abc)
|
||||
|
||||
# ...but abstract ones are not subclasses of tuple
|
||||
# (and this is what you probably want):
|
||||
|
||||
assert not issubclass(MyAbstractRecord, tuple)
|
||||
assert not issubclass(AnotherAbstractRecord, tuple)
|
||||
|
||||
assert issubclass(MyRecord, tuple)
|
||||
assert issubclass(MyRecord2, tuple)
|
||||
assert issubclass(MyRecord3, tuple)
|
||||
assert issubclass(MyRecord33, tuple)
|
||||
assert issubclass(MyRecord345, tuple)
|
||||
assert issubclass(MyRecord4, tuple)
|
||||
assert issubclass(MyRecord5, tuple)
|
||||
assert issubclass(MyRecord6, tuple)
|
||||
|
||||
# Named tuple classes created with namedtuple() factory function
|
||||
# (in the "traditional" way) are registered as "virtual" subclasses
|
||||
# of namedtuple.abc:
|
||||
|
||||
MyTuple = namedtuple('MyTuple', 'a b c')
|
||||
mt = MyTuple(1, 2, 3)
|
||||
assert issubclass(MyTuple, namedtuple.abc)
|
||||
assert isinstance(mt, namedtuple.abc)
|
||||
@@ -37,17 +37,6 @@ logger = logging.getLogger("BitBake.Parsing")
|
||||
|
||||
class ParseError(Exception):
|
||||
"""Exception raised when parsing fails"""
|
||||
def __init__(self, msg, filename, lineno=0):
|
||||
self.msg = msg
|
||||
self.filename = filename
|
||||
self.lineno = lineno
|
||||
Exception.__init__(self, msg, filename, lineno)
|
||||
|
||||
def __str__(self):
|
||||
if self.lineno:
|
||||
return "ParseError at %s:%d: %s" % (self.filename, self.lineno, self.msg)
|
||||
else:
|
||||
return "ParseError in %s: %s" % (self.filename, self.msg)
|
||||
|
||||
class SkipPackage(Exception):
|
||||
"""Exception raised to skip this package"""
|
||||
@@ -73,8 +62,9 @@ def update_mtime(f):
|
||||
def mark_dependency(d, f):
|
||||
if f.startswith('./'):
|
||||
f = "%s/%s" % (os.getcwd(), f[2:])
|
||||
deps = (d.getVar('__depends') or []) + [(f, cached_mtime(f))]
|
||||
d.setVar('__depends', deps)
|
||||
deps = bb.data.getVar('__depends', d) or set()
|
||||
deps.update([(f, cached_mtime(f))])
|
||||
bb.data.setVar('__depends', deps, d)
|
||||
|
||||
def supports(fn, data):
|
||||
"""Returns true if we have a handler for this file, false otherwise"""
|
||||
@@ -88,7 +78,7 @@ def handle(fn, data, include = 0):
|
||||
for h in handlers:
|
||||
if h['supports'](fn, data):
|
||||
return h['handle'](fn, data, include)
|
||||
raise ParseError("not a BitBake file", fn)
|
||||
raise ParseError("%s is not a BitBake file" % fn)
|
||||
|
||||
def init(fn, data):
|
||||
for h in handlers:
|
||||
@@ -100,7 +90,7 @@ def init_parser(d):
|
||||
|
||||
def resolve_file(fn, d):
|
||||
if not os.path.isabs(fn):
|
||||
bbpath = d.getVar("BBPATH", True)
|
||||
bbpath = bb.data.getVar("BBPATH", d, True)
|
||||
newfn = bb.utils.which(bbpath, fn)
|
||||
if not newfn:
|
||||
raise IOError("file %s not found in %s" % (fn, bbpath))
|
||||
@@ -121,7 +111,7 @@ def vars_from_file(mypkg, d):
|
||||
parts = myfile[0].split('_')
|
||||
__pkgsplit_cache__[mypkg] = parts
|
||||
if len(parts) > 3:
|
||||
raise ParseError("Unable to generate default variables from filename (too many underscores)", mypkg)
|
||||
raise ParseError("Unable to generate default variables from the filename: %s (too many underscores)" % mypkg)
|
||||
exp = 3 - len(parts)
|
||||
tmplist = []
|
||||
while exp != 0:
|
||||
@@ -130,13 +120,4 @@ def vars_from_file(mypkg, d):
|
||||
parts.extend(tmplist)
|
||||
return parts
|
||||
|
||||
def get_file_depends(d):
|
||||
'''Return the dependent files'''
|
||||
dep_files = []
|
||||
depends = d.getVar('__base_depends', True) or []
|
||||
depends = depends + (d.getVar('__depends', True) or [])
|
||||
for (fn, _) in depends:
|
||||
dep_files.append(os.path.abspath(fn))
|
||||
return " ".join(dep_files)
|
||||
|
||||
from bb.parse.parse_py import __version__, ConfHandler, BBHandler
|
||||
|
||||
@@ -31,6 +31,7 @@ import itertools
|
||||
from bb import methodpool
|
||||
from bb.parse import logger
|
||||
|
||||
__parsed_methods__ = bb.methodpool.get_parsed_dict()
|
||||
_bbversions_re = re.compile(r"\[(?P<from>[0-9]+)-(?P<to>[0-9]+)\]")
|
||||
|
||||
class StatementGroup(list):
|
||||
@@ -53,14 +54,14 @@ class IncludeNode(AstNode):
|
||||
"""
|
||||
Include the file and evaluate the statements
|
||||
"""
|
||||
s = data.expand(self.what_file)
|
||||
s = bb.data.expand(self.what_file, data)
|
||||
logger.debug(2, "CONF %s:%s: including %s", self.filename, self.lineno, s)
|
||||
|
||||
# TODO: Cache those includes... maybe not here though
|
||||
if self.force:
|
||||
bb.parse.ConfHandler.include(self.filename, s, self.lineno, data, "include required")
|
||||
bb.parse.ConfHandler.include(self.filename, s, data, "include required")
|
||||
else:
|
||||
bb.parse.ConfHandler.include(self.filename, s, self.lineno, data, False)
|
||||
bb.parse.ConfHandler.include(self.filename, s, data, False)
|
||||
|
||||
class ExportNode(AstNode):
|
||||
def __init__(self, filename, lineno, var):
|
||||
@@ -68,7 +69,7 @@ class ExportNode(AstNode):
|
||||
self.var = var
|
||||
|
||||
def eval(self, data):
|
||||
data.setVarFlag(self.var, "export", 1)
|
||||
bb.data.setVarFlag(self.var, "export", 1, data)
|
||||
|
||||
class DataNode(AstNode):
|
||||
"""
|
||||
@@ -83,15 +84,15 @@ class DataNode(AstNode):
|
||||
|
||||
def getFunc(self, key, data):
|
||||
if 'flag' in self.groupd and self.groupd['flag'] != None:
|
||||
return data.getVarFlag(key, self.groupd['flag'], noweakdefault=True)
|
||||
return bb.data.getVarFlag(key, self.groupd['flag'], data)
|
||||
else:
|
||||
return data.getVar(key, noweakdefault=True)
|
||||
return bb.data.getVar(key, data)
|
||||
|
||||
def eval(self, data):
|
||||
groupd = self.groupd
|
||||
key = groupd["var"]
|
||||
if "exp" in groupd and groupd["exp"] != None:
|
||||
data.setVarFlag(key, "export", 1)
|
||||
bb.data.setVarFlag(key, "export", 1, data)
|
||||
if "ques" in groupd and groupd["ques"] != None:
|
||||
val = self.getFunc(key, data)
|
||||
if val == None:
|
||||
@@ -99,7 +100,7 @@ class DataNode(AstNode):
|
||||
elif "colon" in groupd and groupd["colon"] != None:
|
||||
e = data.createCopy()
|
||||
bb.data.update_data(e)
|
||||
val = e.expand(groupd["value"], key + "[:=]")
|
||||
val = bb.data.expand(groupd["value"], e)
|
||||
elif "append" in groupd and groupd["append"] != None:
|
||||
val = "%s %s" % ((self.getFunc(key, data) or ""), groupd["value"])
|
||||
elif "prepend" in groupd and groupd["prepend"] != None:
|
||||
@@ -112,11 +113,11 @@ class DataNode(AstNode):
|
||||
val = groupd["value"]
|
||||
|
||||
if 'flag' in groupd and groupd['flag'] != None:
|
||||
data.setVarFlag(key, groupd['flag'], val)
|
||||
bb.data.setVarFlag(key, groupd['flag'], val, data)
|
||||
elif groupd["lazyques"]:
|
||||
data.setVarFlag(key, "defaultval", val)
|
||||
bb.data.setVarFlag(key, "defaultval", val, data)
|
||||
else:
|
||||
data.setVar(key, val)
|
||||
bb.data.setVar(key, val, data)
|
||||
|
||||
class MethodNode(AstNode):
|
||||
def __init__(self, filename, lineno, func_name, body):
|
||||
@@ -125,25 +126,23 @@ class MethodNode(AstNode):
|
||||
self.body = body
|
||||
|
||||
def eval(self, data):
|
||||
text = '\n'.join(self.body)
|
||||
if self.func_name == "__anonymous":
|
||||
funcname = ("__anon_%s_%s" % (self.lineno, self.filename.translate(string.maketrans('/.+-', '____'))))
|
||||
if not funcname in bb.methodpool._parsed_fns:
|
||||
text = "def %s(d):\n" % (funcname) + text
|
||||
text = "def %s(d):\n" % (funcname) + '\n'.join(self.body)
|
||||
bb.methodpool.insert_method(funcname, text, self.filename)
|
||||
anonfuncs = data.getVar('__BBANONFUNCS') or []
|
||||
anonfuncs = bb.data.getVar('__BBANONFUNCS', data) or []
|
||||
anonfuncs.append(funcname)
|
||||
data.setVar('__BBANONFUNCS', anonfuncs)
|
||||
data.setVar(funcname, text)
|
||||
bb.data.setVar('__BBANONFUNCS', anonfuncs, data)
|
||||
else:
|
||||
data.setVarFlag(self.func_name, "func", 1)
|
||||
data.setVar(self.func_name, text)
|
||||
bb.data.setVarFlag(self.func_name, "func", 1, data)
|
||||
bb.data.setVar(self.func_name, '\n'.join(self.body), data)
|
||||
|
||||
class PythonMethodNode(AstNode):
|
||||
def __init__(self, filename, lineno, function, modulename, body):
|
||||
def __init__(self, filename, lineno, function, define, body):
|
||||
AstNode.__init__(self, filename, lineno)
|
||||
self.function = function
|
||||
self.modulename = modulename
|
||||
self.define = define
|
||||
self.body = body
|
||||
|
||||
def eval(self, data):
|
||||
@@ -151,11 +150,11 @@ class PythonMethodNode(AstNode):
|
||||
# 'this' file. This means we will not parse methods from
|
||||
# bb classes twice
|
||||
text = '\n'.join(self.body)
|
||||
if not bb.methodpool.parsed_module(self.modulename):
|
||||
bb.methodpool.insert_method(self.modulename, text, self.filename)
|
||||
data.setVarFlag(self.function, "func", 1)
|
||||
data.setVarFlag(self.function, "python", 1)
|
||||
data.setVar(self.function, text)
|
||||
if not bb.methodpool.parsed_module(self.define):
|
||||
bb.methodpool.insert_method(self.define, text, self.filename)
|
||||
bb.data.setVarFlag(self.function, "func", 1, data)
|
||||
bb.data.setVarFlag(self.function, "python", 1, data)
|
||||
bb.data.setVar(self.function, text, data)
|
||||
|
||||
class MethodFlagsNode(AstNode):
|
||||
def __init__(self, filename, lineno, key, m):
|
||||
@@ -164,19 +163,19 @@ class MethodFlagsNode(AstNode):
|
||||
self.m = m
|
||||
|
||||
def eval(self, data):
|
||||
if data.getVar(self.key):
|
||||
if bb.data.getVar(self.key, data):
|
||||
# clean up old version of this piece of metadata, as its
|
||||
# flags could cause problems
|
||||
data.setVarFlag(self.key, 'python', None)
|
||||
data.setVarFlag(self.key, 'fakeroot', None)
|
||||
bb.data.setVarFlag(self.key, 'python', None, data)
|
||||
bb.data.setVarFlag(self.key, 'fakeroot', None, data)
|
||||
if self.m.group("py") is not None:
|
||||
data.setVarFlag(self.key, "python", "1")
|
||||
bb.data.setVarFlag(self.key, "python", "1", data)
|
||||
else:
|
||||
data.delVarFlag(self.key, "python")
|
||||
bb.data.delVarFlag(self.key, "python", data)
|
||||
if self.m.group("fr") is not None:
|
||||
data.setVarFlag(self.key, "fakeroot", "1")
|
||||
bb.data.setVarFlag(self.key, "fakeroot", "1", data)
|
||||
else:
|
||||
data.delVarFlag(self.key, "fakeroot")
|
||||
bb.data.delVarFlag(self.key, "fakeroot", data)
|
||||
|
||||
class ExportFuncsNode(AstNode):
|
||||
def __init__(self, filename, lineno, fns, classes):
|
||||
@@ -198,25 +197,25 @@ class ExportFuncsNode(AstNode):
|
||||
vars.append([allvars[0], allvars[2]])
|
||||
|
||||
for (var, calledvar) in vars:
|
||||
if data.getVar(var) and not data.getVarFlag(var, 'export_func'):
|
||||
if bb.data.getVar(var, data) and not bb.data.getVarFlag(var, 'export_func', data):
|
||||
continue
|
||||
|
||||
if data.getVar(var):
|
||||
data.setVarFlag(var, 'python', None)
|
||||
data.setVarFlag(var, 'func', None)
|
||||
if bb.data.getVar(var, data):
|
||||
bb.data.setVarFlag(var, 'python', None, data)
|
||||
bb.data.setVarFlag(var, 'func', None, data)
|
||||
|
||||
for flag in [ "func", "python" ]:
|
||||
if data.getVarFlag(calledvar, flag):
|
||||
data.setVarFlag(var, flag, data.getVarFlag(calledvar, flag))
|
||||
if bb.data.getVarFlag(calledvar, flag, data):
|
||||
bb.data.setVarFlag(var, flag, bb.data.getVarFlag(calledvar, flag, data), data)
|
||||
for flag in [ "dirs" ]:
|
||||
if data.getVarFlag(var, flag):
|
||||
data.setVarFlag(calledvar, flag, data.getVarFlag(var, flag))
|
||||
if bb.data.getVarFlag(var, flag, data):
|
||||
bb.data.setVarFlag(calledvar, flag, bb.data.getVarFlag(var, flag, data), data)
|
||||
|
||||
if data.getVarFlag(calledvar, "python"):
|
||||
data.setVar(var, " bb.build.exec_func('" + calledvar + "', d)\n")
|
||||
if bb.data.getVarFlag(calledvar, "python", data):
|
||||
bb.data.setVar(var, "\tbb.build.exec_func('" + calledvar + "', d)\n", data)
|
||||
else:
|
||||
data.setVar(var, " " + calledvar + "\n")
|
||||
data.setVarFlag(var, 'export_func', '1')
|
||||
bb.data.setVar(var, "\t" + calledvar + "\n", data)
|
||||
bb.data.setVarFlag(var, 'export_func', '1', data)
|
||||
|
||||
class AddTaskNode(AstNode):
|
||||
def __init__(self, filename, lineno, func, before, after):
|
||||
@@ -230,25 +229,25 @@ class AddTaskNode(AstNode):
|
||||
if self.func[:3] != "do_":
|
||||
var = "do_" + self.func
|
||||
|
||||
data.setVarFlag(var, "task", 1)
|
||||
bbtasks = data.getVar('__BBTASKS') or []
|
||||
bb.data.setVarFlag(var, "task", 1, data)
|
||||
bbtasks = bb.data.getVar('__BBTASKS', data) or []
|
||||
if not var in bbtasks:
|
||||
bbtasks.append(var)
|
||||
data.setVar('__BBTASKS', bbtasks)
|
||||
bb.data.setVar('__BBTASKS', bbtasks, data)
|
||||
|
||||
existing = data.getVarFlag(var, "deps") or []
|
||||
existing = bb.data.getVarFlag(var, "deps", data) or []
|
||||
if self.after is not None:
|
||||
# set up deps for function
|
||||
for entry in self.after.split():
|
||||
if entry not in existing:
|
||||
existing.append(entry)
|
||||
data.setVarFlag(var, "deps", existing)
|
||||
bb.data.setVarFlag(var, "deps", existing, data)
|
||||
if self.before is not None:
|
||||
# set up things that depend on this func
|
||||
for entry in self.before.split():
|
||||
existing = data.getVarFlag(entry, "deps") or []
|
||||
existing = bb.data.getVarFlag(entry, "deps", data) or []
|
||||
if var not in existing:
|
||||
data.setVarFlag(entry, "deps", [var] + existing)
|
||||
bb.data.setVarFlag(entry, "deps", [var] + existing, data)
|
||||
|
||||
class BBHandlerNode(AstNode):
|
||||
def __init__(self, filename, lineno, fns):
|
||||
@@ -256,11 +255,11 @@ class BBHandlerNode(AstNode):
|
||||
self.hs = fns.split()
|
||||
|
||||
def eval(self, data):
|
||||
bbhands = data.getVar('__BBHANDLERS') or []
|
||||
bbhands = bb.data.getVar('__BBHANDLERS', data) or []
|
||||
for h in self.hs:
|
||||
bbhands.append(h)
|
||||
data.setVarFlag(h, "handler", 1)
|
||||
data.setVar('__BBHANDLERS', bbhands)
|
||||
bb.data.setVarFlag(h, "handler", 1, data)
|
||||
bb.data.setVar('__BBHANDLERS', bbhands, data)
|
||||
|
||||
class InheritNode(AstNode):
|
||||
def __init__(self, filename, lineno, classes):
|
||||
@@ -268,7 +267,7 @@ class InheritNode(AstNode):
|
||||
self.classes = classes
|
||||
|
||||
def eval(self, data):
|
||||
bb.parse.BBHandler.inherit(self.classes, self.filename, self.lineno, data)
|
||||
bb.parse.BBHandler.inherit(self.classes, data)
|
||||
|
||||
def handleInclude(statements, filename, lineno, m, force):
|
||||
statements.append(IncludeNode(filename, lineno, m.group(1), force))
|
||||
@@ -282,8 +281,8 @@ def handleData(statements, filename, lineno, groupd):
|
||||
def handleMethod(statements, filename, lineno, func_name, body):
|
||||
statements.append(MethodNode(filename, lineno, func_name, body))
|
||||
|
||||
def handlePythonMethod(statements, filename, lineno, funcname, modulename, body):
|
||||
statements.append(PythonMethodNode(filename, lineno, funcname, modulename, body))
|
||||
def handlePythonMethod(statements, filename, lineno, funcname, root, body):
|
||||
statements.append(PythonMethodNode(filename, lineno, funcname, root, body))
|
||||
|
||||
def handleMethodFlags(statements, filename, lineno, key, m):
|
||||
statements.append(MethodFlagsNode(filename, lineno, key, m))
|
||||
@@ -305,32 +304,28 @@ def handleBBHandlers(statements, filename, lineno, m):
|
||||
|
||||
def handleInherit(statements, filename, lineno, m):
|
||||
classes = m.group(1)
|
||||
statements.append(InheritNode(filename, lineno, classes))
|
||||
statements.append(InheritNode(filename, lineno, classes.split()))
|
||||
|
||||
def finalize(fn, d, variant = None):
|
||||
all_handlers = {}
|
||||
for var in d.getVar('__BBHANDLERS') or []:
|
||||
# try to add the handler
|
||||
handler = d.getVar(var)
|
||||
bb.event.register(var, handler)
|
||||
|
||||
bb.event.fire(bb.event.RecipePreFinalise(fn), d)
|
||||
|
||||
bb.data.expandKeys(d)
|
||||
bb.data.update_data(d)
|
||||
code = []
|
||||
for funcname in d.getVar("__BBANONFUNCS") or []:
|
||||
for funcname in bb.data.getVar("__BBANONFUNCS", d) or []:
|
||||
code.append("%s(d)" % funcname)
|
||||
bb.utils.better_exec("\n".join(code), {"d": d})
|
||||
bb.utils.simple_exec("\n".join(code), {"d": d})
|
||||
bb.data.update_data(d)
|
||||
|
||||
tasklist = d.getVar('__BBTASKS') or []
|
||||
all_handlers = {}
|
||||
for var in bb.data.getVar('__BBHANDLERS', d) or []:
|
||||
# try to add the handler
|
||||
handler = bb.data.getVar(var, d)
|
||||
bb.event.register(var, handler)
|
||||
|
||||
tasklist = bb.data.getVar('__BBTASKS', d) or []
|
||||
bb.build.add_tasks(tasklist, d)
|
||||
|
||||
bb.parse.siggen.finalise(fn, d, variant)
|
||||
|
||||
d.setVar('BBINCLUDED', bb.parse.get_file_depends(d))
|
||||
|
||||
bb.event.fire(bb.event.RecipeParsed(fn), d)
|
||||
|
||||
def _create_variants(datastores, names, function):
|
||||
@@ -374,14 +369,12 @@ def multi_finalize(fn, d):
|
||||
logger.debug(2, "Appending .bbappend file %s to %s", append, fn)
|
||||
bb.parse.BBHandler.handle(append, d, True)
|
||||
|
||||
onlyfinalise = d.getVar("__ONLYFINALISE", False)
|
||||
|
||||
safe_d = d
|
||||
d = bb.data.createCopy(safe_d)
|
||||
try:
|
||||
finalize(fn, d)
|
||||
except bb.parse.SkipPackage as e:
|
||||
d.setVar("__SKIPPED", e.args[0])
|
||||
except bb.parse.SkipPackage:
|
||||
bb.data.setVar("__SKIPPED", True, d)
|
||||
datastores = {"": safe_d}
|
||||
|
||||
versions = (d.getVar("BBVERSIONS", True) or "").split()
|
||||
@@ -423,48 +416,27 @@ def multi_finalize(fn, d):
|
||||
verfunc(pv, d, safe_d)
|
||||
try:
|
||||
finalize(fn, d)
|
||||
except bb.parse.SkipPackage as e:
|
||||
d.setVar("__SKIPPED", e.args[0])
|
||||
except bb.parse.SkipPackage:
|
||||
bb.data.setVar("__SKIPPED", True, d)
|
||||
|
||||
_create_variants(datastores, versions, verfunc)
|
||||
|
||||
extended = d.getVar("BBCLASSEXTEND", True) or ""
|
||||
if extended:
|
||||
# the following is to support bbextends with arguments, for e.g. multilib
|
||||
# an example is as follows:
|
||||
# BBCLASSEXTEND = "multilib:lib32"
|
||||
# it will create foo-lib32, inheriting multilib.bbclass and set
|
||||
# BBEXTENDCURR to "multilib" and BBEXTENDVARIANT to "lib32"
|
||||
extendedmap = {}
|
||||
variantmap = {}
|
||||
|
||||
for ext in extended.split():
|
||||
eext = ext.split(':', 2)
|
||||
if len(eext) > 1:
|
||||
extendedmap[ext] = eext[0]
|
||||
variantmap[ext] = eext[1]
|
||||
else:
|
||||
extendedmap[ext] = ext
|
||||
|
||||
pn = d.getVar("PN", True)
|
||||
def extendfunc(name, d):
|
||||
if name != extendedmap[name]:
|
||||
d.setVar("BBEXTENDCURR", extendedmap[name])
|
||||
d.setVar("BBEXTENDVARIANT", variantmap[name])
|
||||
else:
|
||||
d.setVar("PN", "%s-%s" % (pn, name))
|
||||
bb.parse.BBHandler.inherit(extendedmap[name], fn, 0, d)
|
||||
d.setVar("PN", "%s-%s" % (pn, name))
|
||||
bb.parse.BBHandler.inherit([name], d)
|
||||
|
||||
safe_d.setVar("BBCLASSEXTEND", extended)
|
||||
_create_variants(datastores, extendedmap.keys(), extendfunc)
|
||||
_create_variants(datastores, extended.split(), extendfunc)
|
||||
|
||||
for variant, variant_d in datastores.iteritems():
|
||||
if variant:
|
||||
try:
|
||||
if not onlyfinalise or variant in onlyfinalise:
|
||||
finalize(fn, variant_d, variant)
|
||||
except bb.parse.SkipPackage as e:
|
||||
variant_d.setVar("__SKIPPED", e.args[0])
|
||||
finalize(fn, variant_d, variant)
|
||||
except bb.parse.SkipPackage:
|
||||
bb.data.setVar("__SKIPPED", True, variant_d)
|
||||
|
||||
if len(datastores) > 1:
|
||||
variants = filter(None, datastores.iterkeys())
|
||||
|
||||
@@ -68,10 +68,12 @@ def supports(fn, d):
|
||||
"""Return True if fn has a supported extension"""
|
||||
return os.path.splitext(fn)[-1] in [".bb", ".bbclass", ".inc"]
|
||||
|
||||
def inherit(files, fn, lineno, d):
|
||||
__inherit_cache = d.getVar('__inherit_cache') or []
|
||||
files = d.expand(files).split()
|
||||
def inherit(files, d):
|
||||
__inherit_cache = data.getVar('__inherit_cache', d) or []
|
||||
fn = ""
|
||||
lineno = 0
|
||||
for file in files:
|
||||
file = data.expand(file, d)
|
||||
if not os.path.isabs(file) and not file.endswith(".bbclass"):
|
||||
file = os.path.join('classes', '%s.bbclass' % file)
|
||||
|
||||
@@ -79,8 +81,8 @@ def inherit(files, fn, lineno, d):
|
||||
logger.log(logging.DEBUG -1, "BB %s:%d: inheriting %s", fn, lineno, file)
|
||||
__inherit_cache.append( file )
|
||||
data.setVar('__inherit_cache', __inherit_cache, d)
|
||||
include(fn, file, lineno, d, "inherit")
|
||||
__inherit_cache = d.getVar('__inherit_cache') or []
|
||||
include(fn, file, d, "inherit")
|
||||
__inherit_cache = data.getVar('__inherit_cache', d) or []
|
||||
|
||||
def get_statements(filename, absolute_filename, base_name):
|
||||
global cached_statements
|
||||
@@ -126,13 +128,13 @@ def handle(fn, d, include):
|
||||
if ext == ".bbclass":
|
||||
__classname__ = root
|
||||
classes.append(__classname__)
|
||||
__inherit_cache = d.getVar('__inherit_cache') or []
|
||||
__inherit_cache = data.getVar('__inherit_cache', d) or []
|
||||
if not fn in __inherit_cache:
|
||||
__inherit_cache.append(fn)
|
||||
data.setVar('__inherit_cache', __inherit_cache, d)
|
||||
|
||||
if include != 0:
|
||||
oldfile = d.getVar('FILE')
|
||||
oldfile = data.getVar('FILE', d)
|
||||
else:
|
||||
oldfile = None
|
||||
|
||||
@@ -146,7 +148,7 @@ def handle(fn, d, include):
|
||||
|
||||
# DONE WITH PARSING... time to evaluate
|
||||
if ext != ".bbclass":
|
||||
data.setVar('FILE', abs_fn, d)
|
||||
data.setVar('FILE', fn, d)
|
||||
|
||||
statements.eval(d)
|
||||
|
||||
@@ -157,11 +159,11 @@ def handle(fn, d, include):
|
||||
return ast.multi_finalize(fn, d)
|
||||
|
||||
if oldfile:
|
||||
d.setVar("FILE", oldfile)
|
||||
bb.data.setVar("FILE", oldfile, d)
|
||||
|
||||
# we have parsed the bb class now
|
||||
if ext == ".bbclass" or ext == ".inc":
|
||||
bb.methodpool.set_parsed_module(base_name)
|
||||
bb.methodpool.get_parsed_dict()[base_name] = 1
|
||||
|
||||
return d
|
||||
|
||||
@@ -191,21 +193,22 @@ def feeder(lineno, s, fn, root, statements):
|
||||
if lineno == IN_PYTHON_EOF:
|
||||
return
|
||||
|
||||
if s and s[0] == '#':
|
||||
|
||||
# Skip empty lines
|
||||
if s == '':
|
||||
return
|
||||
|
||||
if s[0] == '#':
|
||||
if len(__residue__) != 0 and __residue__[0][0] != "#":
|
||||
bb.error("There is a comment on line %s of file %s (%s) which is in the middle of a multiline expression.\nBitbake used to ignore these but no longer does so, please fix your metadata as errors are likely as a result of this change." % (lineno, fn, s))
|
||||
|
||||
if s and s[-1] == '\\':
|
||||
if s[-1] == '\\':
|
||||
__residue__.append(s[:-1])
|
||||
return
|
||||
|
||||
s = "".join(__residue__) + s
|
||||
__residue__ = []
|
||||
|
||||
# Skip empty lines
|
||||
if s == '':
|
||||
return
|
||||
|
||||
# Skip comments
|
||||
if s[0] == '#':
|
||||
return
|
||||
|
||||
@@ -24,41 +24,41 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import re, os
|
||||
import re, bb.data, os
|
||||
import logging
|
||||
import bb.utils
|
||||
from bb.parse import ParseError, resolve_file, ast, logger
|
||||
|
||||
__config_regexp__ = re.compile( r"(?P<exp>export\s*)?(?P<var>[a-zA-Z0-9\-_+.${}/]+)(\[(?P<flag>[a-zA-Z0-9\-_+.]+)\])?\s*((?P<colon>:=)|(?P<lazyques>\?\?=)|(?P<ques>\?=)|(?P<append>\+=)|(?P<prepend>=\+)|(?P<predot>=\.)|(?P<postdot>\.=)|=)\s*(?!'[^']*'[^']*'$)(?!\"[^\"]*\"[^\"]*\"$)(?P<apo>['\"])(?P<value>.*)(?P=apo)$")
|
||||
#__config_regexp__ = re.compile( r"(?P<exp>export\s*)?(?P<var>[a-zA-Z0-9\-_+.${}]+)\s*(?P<colon>:)?(?P<ques>\?)?=\s*(?P<apo>['\"]?)(?P<value>.*)(?P=apo)$")
|
||||
__config_regexp__ = re.compile( r"(?P<exp>export\s*)?(?P<var>[a-zA-Z0-9\-_+.${}/]+)(\[(?P<flag>[a-zA-Z0-9\-_+.]+)\])?\s*((?P<colon>:=)|(?P<lazyques>\?\?=)|(?P<ques>\?=)|(?P<append>\+=)|(?P<prepend>=\+)|(?P<predot>=\.)|(?P<postdot>\.=)|=)\s*(?P<apo>['\"]?)(?P<value>.*)(?P=apo)$")
|
||||
__include_regexp__ = re.compile( r"include\s+(.+)" )
|
||||
__require_regexp__ = re.compile( r"require\s+(.+)" )
|
||||
__export_regexp__ = re.compile( r"export\s+([a-zA-Z0-9\-_+.${}/]+)$" )
|
||||
__export_regexp__ = re.compile( r"export\s+(.+)" )
|
||||
|
||||
def init(data):
|
||||
topdir = data.getVar('TOPDIR')
|
||||
topdir = bb.data.getVar('TOPDIR', data)
|
||||
if not topdir:
|
||||
data.setVar('TOPDIR', os.getcwd())
|
||||
bb.data.setVar('TOPDIR', os.getcwd(), data)
|
||||
|
||||
|
||||
def supports(fn, d):
|
||||
return fn[-5:] == ".conf"
|
||||
|
||||
def include(oldfn, fn, lineno, data, error_out):
|
||||
def include(oldfn, fn, data, error_out):
|
||||
"""
|
||||
error_out: A string indicating the verb (e.g. "include", "inherit") to be
|
||||
used in a ParseError that will be raised if the file to be included could
|
||||
not be included. Specify False to avoid raising an error in this case.
|
||||
error_out If True a ParseError will be raised if the to be included
|
||||
config-files could not be included.
|
||||
"""
|
||||
if oldfn == fn: # prevent infinite recursion
|
||||
return None
|
||||
|
||||
import bb
|
||||
fn = data.expand(fn)
|
||||
oldfn = data.expand(oldfn)
|
||||
fn = bb.data.expand(fn, data)
|
||||
oldfn = bb.data.expand(oldfn, data)
|
||||
|
||||
if not os.path.isabs(fn):
|
||||
dname = os.path.dirname(oldfn)
|
||||
bbpath = "%s:%s" % (dname, data.getVar("BBPATH", True))
|
||||
bbpath = "%s:%s" % (dname, bb.data.getVar("BBPATH", data, 1))
|
||||
abs_fn = bb.utils.which(bbpath, fn)
|
||||
if abs_fn:
|
||||
fn = abs_fn
|
||||
@@ -68,24 +68,16 @@ def include(oldfn, fn, lineno, data, error_out):
|
||||
ret = handle(fn, data, True)
|
||||
except IOError:
|
||||
if error_out:
|
||||
raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
|
||||
raise ParseError("Could not %(error_out)s file %(fn)s" % vars() )
|
||||
logger.debug(2, "CONF file '%s' not found", fn)
|
||||
|
||||
# We have an issue where a UI might want to enforce particular settings such as
|
||||
# an empty DISTRO variable. If configuration files do something like assigning
|
||||
# a weak default, it turns out to be very difficult to filter out these changes,
|
||||
# particularly when the weak default might appear half way though parsing a chain
|
||||
# of configuration files. We therefore let the UIs hook into configuration file
|
||||
# parsing. This turns out to be a hard problem to solve any other way.
|
||||
confFilters = []
|
||||
|
||||
def handle(fn, data, include):
|
||||
init(data)
|
||||
|
||||
if include == 0:
|
||||
oldfile = None
|
||||
else:
|
||||
oldfile = data.getVar('FILE')
|
||||
oldfile = bb.data.getVar('FILE', data)
|
||||
|
||||
abs_fn = resolve_file(fn, data)
|
||||
f = open(abs_fn, 'r')
|
||||
@@ -104,19 +96,16 @@ def handle(fn, data, include):
|
||||
s = s.rstrip()
|
||||
if s[0] == '#': continue # skip comments
|
||||
while s[-1] == '\\':
|
||||
s2 = f.readline().strip()
|
||||
s2 = f.readline()[:-1].strip()
|
||||
lineno = lineno + 1
|
||||
s = s[:-1] + s2
|
||||
feeder(lineno, s, fn, statements)
|
||||
|
||||
# DONE WITH PARSING... time to evaluate
|
||||
data.setVar('FILE', abs_fn)
|
||||
bb.data.setVar('FILE', fn, data)
|
||||
statements.eval(data)
|
||||
if oldfile:
|
||||
data.setVar('FILE', oldfile)
|
||||
|
||||
for f in confFilters:
|
||||
f(fn, data)
|
||||
bb.data.setVar('FILE', oldfile, data)
|
||||
|
||||
return data
|
||||
|
||||
@@ -142,7 +131,7 @@ def feeder(lineno, s, fn, statements):
|
||||
ast.handleExport(statements, fn, lineno, m)
|
||||
return
|
||||
|
||||
raise ParseError("unparsed line: '%s'" % s, fn, lineno);
|
||||
raise ParseError("%s:%d: unparsed line: '%s'" % (fn, lineno, s));
|
||||
|
||||
# Add us to the handlers list
|
||||
from bb.parse import handlers
|
||||
|
||||
@@ -26,8 +26,7 @@ import logging
|
||||
import os.path
|
||||
import sys
|
||||
import warnings
|
||||
from bb.compat import total_ordering
|
||||
from collections import Mapping
|
||||
import bb.msg, bb.data, bb.utils
|
||||
|
||||
try:
|
||||
import sqlite3
|
||||
@@ -40,20 +39,13 @@ if sqlversion[0] < 3 or (sqlversion[0] == 3 and sqlversion[1] < 3):
|
||||
|
||||
|
||||
logger = logging.getLogger("BitBake.PersistData")
|
||||
if hasattr(sqlite3, 'enable_shared_cache'):
|
||||
try:
|
||||
sqlite3.enable_shared_cache(True)
|
||||
except sqlite3.OperationalError:
|
||||
pass
|
||||
|
||||
|
||||
@total_ordering
|
||||
class SQLTable(collections.MutableMapping):
|
||||
"""Object representing a table/domain in the database"""
|
||||
def __init__(self, cachefile, table):
|
||||
self.cachefile = cachefile
|
||||
def __init__(self, cursor, table):
|
||||
self.cursor = cursor
|
||||
self.table = table
|
||||
self.cursor = connect(self.cachefile)
|
||||
|
||||
self._execute("CREATE TABLE IF NOT EXISTS %s(key TEXT, value TEXT);"
|
||||
% table)
|
||||
@@ -67,36 +59,19 @@ class SQLTable(collections.MutableMapping):
|
||||
except sqlite3.OperationalError as exc:
|
||||
if 'database is locked' in str(exc) and count < 500:
|
||||
count = count + 1
|
||||
self.cursor.close()
|
||||
self.cursor = connect(self.cachefile)
|
||||
continue
|
||||
raise
|
||||
|
||||
def __enter__(self):
|
||||
self.cursor.__enter__()
|
||||
return self
|
||||
|
||||
def __exit__(self, *excinfo):
|
||||
self.cursor.__exit__(*excinfo)
|
||||
|
||||
def __getitem__(self, key):
|
||||
data = self._execute("SELECT * from %s where key=?;" %
|
||||
self.table, [key])
|
||||
for row in data:
|
||||
return row[1]
|
||||
raise KeyError(key)
|
||||
|
||||
def __delitem__(self, key):
|
||||
if key not in self:
|
||||
raise KeyError(key)
|
||||
self._execute("DELETE from %s where key=?;" % self.table, [key])
|
||||
|
||||
def __setitem__(self, key, value):
|
||||
if not isinstance(key, basestring):
|
||||
raise TypeError('Only string keys are supported')
|
||||
elif not isinstance(value, basestring):
|
||||
raise TypeError('Only string values are supported')
|
||||
|
||||
data = self._execute("SELECT * from %s where key=?;" %
|
||||
self.table, [key])
|
||||
exists = len(list(data))
|
||||
@@ -117,40 +92,53 @@ class SQLTable(collections.MutableMapping):
|
||||
|
||||
def __iter__(self):
|
||||
data = self._execute("SELECT key FROM %s;" % self.table)
|
||||
return (row[0] for row in data)
|
||||
for row in data:
|
||||
yield row[0]
|
||||
|
||||
def __lt__(self, other):
|
||||
if not isinstance(other, Mapping):
|
||||
raise NotImplemented
|
||||
|
||||
return len(self) < len(other)
|
||||
|
||||
def values(self):
|
||||
return list(self.itervalues())
|
||||
def iteritems(self):
|
||||
data = self._execute("SELECT * FROM %s;" % self.table)
|
||||
for row in data:
|
||||
yield row[0], row[1]
|
||||
|
||||
def itervalues(self):
|
||||
data = self._execute("SELECT value FROM %s;" % self.table)
|
||||
return (row[0] for row in data)
|
||||
for row in data:
|
||||
yield row[0]
|
||||
|
||||
def items(self):
|
||||
return list(self.iteritems())
|
||||
|
||||
def iteritems(self):
|
||||
return self._execute("SELECT * FROM %s;" % self.table)
|
||||
class SQLData(object):
|
||||
"""Object representing the persistent data"""
|
||||
def __init__(self, filename):
|
||||
bb.utils.mkdirhier(os.path.dirname(filename))
|
||||
|
||||
def clear(self):
|
||||
self._execute("DELETE FROM %s;" % self.table)
|
||||
self.filename = filename
|
||||
self.connection = sqlite3.connect(filename, timeout=30,
|
||||
isolation_level=None)
|
||||
self.cursor = self.connection.cursor()
|
||||
self._tables = {}
|
||||
|
||||
def has_key(self, key):
|
||||
return key in self
|
||||
def __getitem__(self, table):
|
||||
if not isinstance(table, basestring):
|
||||
raise TypeError("table argument must be a string, not '%s'" %
|
||||
type(table))
|
||||
|
||||
if table in self._tables:
|
||||
return self._tables[table]
|
||||
else:
|
||||
tableobj = self._tables[table] = SQLTable(self.cursor, table)
|
||||
return tableobj
|
||||
|
||||
def __delitem__(self, table):
|
||||
if table in self._tables:
|
||||
del self._tables[table]
|
||||
self.cursor.execute("DROP TABLE IF EXISTS %s;" % table)
|
||||
|
||||
|
||||
class PersistData(object):
|
||||
"""Deprecated representation of the bitbake persistent data store"""
|
||||
def __init__(self, d):
|
||||
warnings.warn("Use of PersistData is deprecated. Please use "
|
||||
"persist(domain, d) instead.",
|
||||
category=DeprecationWarning,
|
||||
warnings.warn("Use of PersistData will be deprecated in the future",
|
||||
category=PendingDeprecationWarning,
|
||||
stacklevel=2)
|
||||
|
||||
self.data = persist(d)
|
||||
@@ -193,18 +181,14 @@ class PersistData(object):
|
||||
"""
|
||||
del self.data[domain][key]
|
||||
|
||||
def connect(database):
|
||||
return sqlite3.connect(database, timeout=5, isolation_level=None)
|
||||
|
||||
def persist(domain, d):
|
||||
"""Convenience factory for SQLTable objects based upon metadata"""
|
||||
import bb.utils
|
||||
cachedir = (d.getVar("PERSISTENT_DIR", True) or
|
||||
d.getVar("CACHE", True))
|
||||
def persist(d):
|
||||
"""Convenience factory for construction of SQLData based upon metadata"""
|
||||
cachedir = (bb.data.getVar("PERSISTENT_DIR", d, True) or
|
||||
bb.data.getVar("CACHE", d, True))
|
||||
if not cachedir:
|
||||
logger.critical("Please set the 'PERSISTENT_DIR' or 'CACHE' variable")
|
||||
sys.exit(1)
|
||||
|
||||
bb.utils.mkdirhier(cachedir)
|
||||
cachefile = os.path.join(cachedir, "bb_persist_data.sqlite3")
|
||||
return SQLTable(cachefile, domain)
|
||||
return SQLData(cachefile)
|
||||
|
||||
@@ -1,8 +1,6 @@
|
||||
import logging
|
||||
import signal
|
||||
import subprocess
|
||||
import errno
|
||||
import select
|
||||
|
||||
logger = logging.getLogger('BitBake.Process')
|
||||
|
||||
@@ -70,38 +68,20 @@ def _logged_communicate(pipe, log, input):
|
||||
pipe.stdin.write(input)
|
||||
pipe.stdin.close()
|
||||
|
||||
bufsize = 512
|
||||
outdata, errdata = [], []
|
||||
rin = []
|
||||
while pipe.poll() is None:
|
||||
if pipe.stdout is not None:
|
||||
data = pipe.stdout.read(bufsize)
|
||||
if data is not None:
|
||||
outdata.append(data)
|
||||
log.write(data)
|
||||
|
||||
if pipe.stdout is not None:
|
||||
bb.utils.nonblockingfd(pipe.stdout.fileno())
|
||||
rin.append(pipe.stdout)
|
||||
if pipe.stderr is not None:
|
||||
bb.utils.nonblockingfd(pipe.stderr.fileno())
|
||||
rin.append(pipe.stderr)
|
||||
|
||||
try:
|
||||
while pipe.poll() is None:
|
||||
rlist = rin
|
||||
try:
|
||||
r,w,e = select.select (rlist, [], [])
|
||||
except OSError, e:
|
||||
if e.errno != errno.EINTR:
|
||||
raise
|
||||
|
||||
if pipe.stdout in r:
|
||||
data = pipe.stdout.read()
|
||||
if data is not None:
|
||||
outdata.append(data)
|
||||
log.write(data)
|
||||
|
||||
if pipe.stderr in r:
|
||||
data = pipe.stderr.read()
|
||||
if data is not None:
|
||||
errdata.append(data)
|
||||
log.write(data)
|
||||
finally:
|
||||
log.flush()
|
||||
if pipe.stderr is not None:
|
||||
data = pipe.stderr.read(bufsize)
|
||||
if data is not None:
|
||||
errdata.append(data)
|
||||
log.write(data)
|
||||
return ''.join(outdata), ''.join(errdata)
|
||||
|
||||
def run(cmd, input=None, log=None, **options):
|
||||
@@ -113,7 +93,7 @@ def run(cmd, input=None, log=None, **options):
|
||||
|
||||
try:
|
||||
pipe = Popen(cmd, **options)
|
||||
except OSError as exc:
|
||||
except OSError, exc:
|
||||
if exc.errno == 2:
|
||||
raise NotFoundError(cmd)
|
||||
else:
|
||||
|
||||
@@ -24,54 +24,16 @@
|
||||
import re
|
||||
import logging
|
||||
from bb import data, utils
|
||||
from collections import defaultdict
|
||||
import bb
|
||||
|
||||
logger = logging.getLogger("BitBake.Provider")
|
||||
|
||||
class NoProvider(bb.BBHandledException):
|
||||
class NoProvider(Exception):
|
||||
"""Exception raised when no provider of a build dependency can be found"""
|
||||
|
||||
class NoRProvider(bb.BBHandledException):
|
||||
class NoRProvider(Exception):
|
||||
"""Exception raised when no provider of a runtime dependency can be found"""
|
||||
|
||||
class MultipleRProvider(bb.BBHandledException):
|
||||
"""Exception raised when multiple providers of a runtime dependency can be found"""
|
||||
|
||||
def findProviders(cfgData, dataCache, pkg_pn = None):
|
||||
"""
|
||||
Convenience function to get latest and preferred providers in pkg_pn
|
||||
"""
|
||||
|
||||
if not pkg_pn:
|
||||
pkg_pn = dataCache.pkg_pn
|
||||
|
||||
# Need to ensure data store is expanded
|
||||
localdata = data.createCopy(cfgData)
|
||||
bb.data.update_data(localdata)
|
||||
bb.data.expandKeys(localdata)
|
||||
|
||||
preferred_versions = {}
|
||||
latest_versions = {}
|
||||
|
||||
for pn in pkg_pn:
|
||||
(last_ver, last_file, pref_ver, pref_file) = findBestProvider(pn, localdata, dataCache, pkg_pn)
|
||||
preferred_versions[pn] = (pref_ver, pref_file)
|
||||
latest_versions[pn] = (last_ver, last_file)
|
||||
|
||||
return (latest_versions, preferred_versions)
|
||||
|
||||
|
||||
def allProviders(dataCache):
|
||||
"""
|
||||
Find all providers for each pn
|
||||
"""
|
||||
all_providers = defaultdict(list)
|
||||
for (fn, pn) in dataCache.pkg_fn.items():
|
||||
ver = dataCache.pkg_pepvpr[fn]
|
||||
all_providers[pn].append((ver, fn))
|
||||
return all_providers
|
||||
|
||||
|
||||
def sortPriorities(pn, dataCache, pkg_pn = None):
|
||||
"""
|
||||
@@ -122,15 +84,15 @@ def findPreferredProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
|
||||
preferred_ver = None
|
||||
|
||||
localdata = data.createCopy(cfgData)
|
||||
localdata.setVar('OVERRIDES', "%s:pn-%s:%s" % (data.getVar('OVERRIDES', localdata), pn, pn))
|
||||
bb.data.setVar('OVERRIDES', "pn-%s:%s:%s" % (pn, pn, data.getVar('OVERRIDES', localdata)), localdata)
|
||||
bb.data.update_data(localdata)
|
||||
|
||||
preferred_v = localdata.getVar('PREFERRED_VERSION', True)
|
||||
preferred_v = bb.data.getVar('PREFERRED_VERSION_%s' % pn, localdata, True)
|
||||
if preferred_v:
|
||||
m = re.match('(\d+:)*(.*)(_.*)*', preferred_v)
|
||||
if m:
|
||||
if m.group(1):
|
||||
preferred_e = m.group(1)[:-1]
|
||||
preferred_e = int(m.group(1)[:-1])
|
||||
else:
|
||||
preferred_e = None
|
||||
preferred_v = m.group(2)
|
||||
@@ -162,18 +124,6 @@ def findPreferredProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
|
||||
itemstr = " (for item %s)" % item
|
||||
if preferred_file is None:
|
||||
logger.info("preferred version %s of %s not available%s", pv_str, pn, itemstr)
|
||||
available_vers = []
|
||||
for file_set in pkg_pn:
|
||||
for f in file_set:
|
||||
pe, pv, pr = dataCache.pkg_pepvpr[f]
|
||||
ver_str = pv
|
||||
if pe:
|
||||
ver_str = "%s:%s" % (pe, ver_str)
|
||||
if not ver_str in available_vers:
|
||||
available_vers.append(ver_str)
|
||||
if available_vers:
|
||||
available_vers.sort()
|
||||
logger.info("versions of %s available: %s", pn, ' '.join(available_vers))
|
||||
else:
|
||||
logger.debug(1, "selecting %s as PREFERRED_VERSION %s of package %s%s", preferred_file, pv_str, pn, itemstr)
|
||||
|
||||
@@ -286,7 +236,7 @@ def filterProviders(providers, item, cfgData, dataCache):
|
||||
|
||||
eligible = _filterProviders(providers, item, cfgData, dataCache)
|
||||
|
||||
prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % item, True)
|
||||
prefervar = bb.data.getVar('PREFERRED_PROVIDER_%s' % item, cfgData, 1)
|
||||
if prefervar:
|
||||
dataCache.preferred[item] = prefervar
|
||||
|
||||
@@ -324,8 +274,8 @@ def filterProvidersRunTime(providers, item, cfgData, dataCache):
|
||||
pn = dataCache.pkg_fn[p]
|
||||
provides = dataCache.pn_provides[pn]
|
||||
for provide in provides:
|
||||
prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % provide, True)
|
||||
logger.debug(1, "checking PREFERRED_PROVIDER_%s (value %s) against %s", provide, prefervar, pns.keys())
|
||||
prefervar = bb.data.getVar('PREFERRED_PROVIDER_%s' % provide, cfgData, 1)
|
||||
logger.verbose("checking PREFERRED_PROVIDER_%s (value %s) against %s", provide, prefervar, pns.keys())
|
||||
if prefervar in pns and pns[prefervar] not in preferred:
|
||||
var = "PREFERRED_PROVIDER_%s = %s" % (provide, prefervar)
|
||||
logger.verbose("selecting %s to satisfy runtime %s due to %s", prefervar, item, var)
|
||||
|
||||
@@ -151,7 +151,7 @@ def builtin_trap(name, args, interp, env, stdin, stdout, stderr, debugflags):
|
||||
for sig in args[1:]:
|
||||
try:
|
||||
env.traps[sig] = action
|
||||
except Exception as e:
|
||||
except Exception, e:
|
||||
stderr.write('trap: %s\n' % str(e))
|
||||
return 0
|
||||
|
||||
@@ -214,7 +214,7 @@ def utility_cat(name, args, interp, env, stdin, stdout, stderr, debugflags):
|
||||
data = f.read()
|
||||
finally:
|
||||
f.close()
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
if e.errno != errno.ENOENT:
|
||||
raise
|
||||
status = 1
|
||||
@@ -433,7 +433,7 @@ def utility_mkdir(name, args, interp, env, stdin, stdout, stderr, debugflags):
|
||||
if option.has_p:
|
||||
try:
|
||||
os.makedirs(path)
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
if e.errno != errno.EEXIST:
|
||||
raise
|
||||
else:
|
||||
@@ -561,7 +561,7 @@ def utility_sort(name, args, interp, env, stdin, stdout, stderr, debugflags):
|
||||
lines = f.readlines()
|
||||
finally:
|
||||
f.close()
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
stderr.write(str(e) + '\n')
|
||||
return 1
|
||||
|
||||
@@ -679,7 +679,7 @@ def run_command(name, args, interp, env, stdin, stdout,
|
||||
p = subprocess.Popen([name] + args, cwd=env['PWD'], env=exec_env,
|
||||
stdin=stdin, stdout=subprocess.PIPE, stderr=subprocess.STDOUT)
|
||||
out, err = p.communicate()
|
||||
except WindowsError as e:
|
||||
except WindowsError, e:
|
||||
raise UtilityError(str(e))
|
||||
|
||||
if not unixoutput:
|
||||
|
||||
@@ -248,7 +248,7 @@ class Redirections:
|
||||
raise NotImplementedError('cannot open absolute path %s' % repr(filename))
|
||||
else:
|
||||
f = file(filename, mode+'b')
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
raise RedirectionError(str(e))
|
||||
|
||||
wrapper = None
|
||||
@@ -368,7 +368,7 @@ def resolve_shebang(path, ignoreshell=False):
|
||||
if arg is None:
|
||||
return [cmd, win32_to_unix_path(path)]
|
||||
return [cmd, arg, win32_to_unix_path(path)]
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
if e.errno!=errno.ENOENT and \
|
||||
(e.errno!=errno.EPERM and not os.path.isdir(path)): # Opening a directory raises EPERM
|
||||
raise
|
||||
@@ -747,7 +747,7 @@ class Interpreter:
|
||||
for cmd in cmds:
|
||||
try:
|
||||
status = self.execute(cmd)
|
||||
except ExitSignal as e:
|
||||
except ExitSignal, e:
|
||||
if sourced:
|
||||
raise
|
||||
status = int(e.args[0])
|
||||
@@ -758,13 +758,13 @@ class Interpreter:
|
||||
if 'debug-utility' in self._debugflags or 'debug-cmd' in self._debugflags:
|
||||
self.log('returncode ' + str(status)+ '\n')
|
||||
return status
|
||||
except CommandNotFound as e:
|
||||
except CommandNotFound, e:
|
||||
print >>self._redirs.stderr, str(e)
|
||||
self._redirs.stderr.flush()
|
||||
# Command not found by non-interactive shell
|
||||
# return 127
|
||||
raise
|
||||
except RedirectionError as e:
|
||||
except RedirectionError, e:
|
||||
# TODO: should be handled depending on the utility status
|
||||
print >>self._redirs.stderr, str(e)
|
||||
self._redirs.stderr.flush()
|
||||
@@ -948,7 +948,7 @@ class Interpreter:
|
||||
status = self.execute(func, redirs)
|
||||
finally:
|
||||
redirs.close()
|
||||
except ReturnSignal as e:
|
||||
except ReturnSignal, e:
|
||||
status = int(e.args[0])
|
||||
env['?'] = status
|
||||
return status
|
||||
@@ -1044,7 +1044,7 @@ class Interpreter:
|
||||
|
||||
except ReturnSignal:
|
||||
raise
|
||||
except ShellError as e:
|
||||
except ShellError, e:
|
||||
if is_special or isinstance(e, (ExitSignal,
|
||||
ShellSyntaxError, ExpansionError)):
|
||||
raise e
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -28,6 +28,7 @@
|
||||
|
||||
import time
|
||||
import bb
|
||||
import pickle
|
||||
import signal
|
||||
|
||||
DEBUG = False
|
||||
@@ -35,7 +36,8 @@ DEBUG = False
|
||||
import inspect, select
|
||||
|
||||
class BitBakeServerCommands():
|
||||
def __init__(self, server):
|
||||
def __init__(self, server, cooker):
|
||||
self.cooker = cooker
|
||||
self.server = server
|
||||
|
||||
def runCommand(self, command):
|
||||
@@ -67,7 +69,7 @@ class BBUIEventQueue:
|
||||
self.parent = parent
|
||||
@staticmethod
|
||||
def send(event):
|
||||
bb.server.none.eventQueue.append(event)
|
||||
bb.server.none.eventQueue.append(pickle.loads(event))
|
||||
@staticmethod
|
||||
def quit():
|
||||
return
|
||||
@@ -104,17 +106,13 @@ class BBUIEventQueue:
|
||||
def chldhandler(signum, stackframe):
|
||||
pass
|
||||
|
||||
class BitBakeNoneServer():
|
||||
class BitBakeServer():
|
||||
# remove this when you're done with debugging
|
||||
# allow_reuse_address = True
|
||||
|
||||
def __init__(self):
|
||||
def __init__(self, cooker):
|
||||
self._idlefuns = {}
|
||||
self.commands = BitBakeServerCommands(self)
|
||||
|
||||
def addcooker(self, cooker):
|
||||
self.cooker = cooker
|
||||
self.commands.cooker = cooker
|
||||
self.commands = BitBakeServerCommands(self, cooker)
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
"""Register a function to be called while the server is idle"""
|
||||
@@ -159,10 +157,25 @@ class BitBakeNoneServer():
|
||||
except:
|
||||
pass
|
||||
|
||||
class BitBakeServerConnection():
|
||||
class BitbakeServerInfo():
|
||||
def __init__(self, server):
|
||||
self.server = server.server
|
||||
self.connection = self.server.commands
|
||||
self.server = server
|
||||
self.commands = server.commands
|
||||
|
||||
class BitBakeServerFork():
|
||||
def __init__(self, cooker, server, serverinfo, logfile):
|
||||
serverinfo.logfile = logfile
|
||||
serverinfo.cooker = cooker
|
||||
serverinfo.server = server
|
||||
|
||||
class BitbakeUILauch():
|
||||
def launch(self, serverinfo, uifunc, *args):
|
||||
return bb.cooker.server_main(serverinfo.cooker, uifunc, *args)
|
||||
|
||||
class BitBakeServerConnection():
|
||||
def __init__(self, serverinfo):
|
||||
self.server = serverinfo.server
|
||||
self.connection = serverinfo.commands
|
||||
self.events = bb.server.none.BBUIEventQueue(self.server)
|
||||
for event in bb.event.ui_queue:
|
||||
self.events.queue_event(event)
|
||||
@@ -176,28 +189,3 @@ class BitBakeServerConnection():
|
||||
self.connection.terminateServer()
|
||||
except:
|
||||
pass
|
||||
|
||||
class BitBakeServer(object):
|
||||
def initServer(self):
|
||||
self.server = BitBakeNoneServer()
|
||||
|
||||
def addcooker(self, cooker):
|
||||
self.cooker = cooker
|
||||
self.server.addcooker(cooker)
|
||||
|
||||
def getServerIdleCB(self):
|
||||
return self.server.register_idle_function
|
||||
|
||||
def saveConnectionDetails(self):
|
||||
return
|
||||
|
||||
def detach(self):
|
||||
return
|
||||
|
||||
def establishConnection(self):
|
||||
self.connection = BitBakeServerConnection(self)
|
||||
return self.connection
|
||||
|
||||
def launchUI(self, uifunc, *args):
|
||||
return bb.cooker.server_main(self.cooker, uifunc, *args)
|
||||
|
||||
|
||||
@@ -1,270 +0,0 @@
|
||||
#
|
||||
# BitBake Process based server.
|
||||
#
|
||||
# Copyright (C) 2010 Bob Foerster <robert@erafx.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
"""
|
||||
This module implements a multiprocessing.Process based server for bitbake.
|
||||
"""
|
||||
|
||||
import bb
|
||||
import bb.event
|
||||
import itertools
|
||||
import logging
|
||||
import multiprocessing
|
||||
import os
|
||||
import signal
|
||||
import sys
|
||||
import time
|
||||
from Queue import Empty
|
||||
from multiprocessing import Event, Process, util, Queue, Pipe, queues
|
||||
|
||||
logger = logging.getLogger('BitBake')
|
||||
|
||||
class ServerCommunicator():
|
||||
def __init__(self, connection):
|
||||
self.connection = connection
|
||||
|
||||
def runCommand(self, command):
|
||||
# @todo try/except
|
||||
self.connection.send(command)
|
||||
|
||||
while True:
|
||||
# don't let the user ctrl-c while we're waiting for a response
|
||||
try:
|
||||
if self.connection.poll(20):
|
||||
return self.connection.recv()
|
||||
else:
|
||||
bb.fatal("Timeout while attempting to communicate with bitbake server")
|
||||
except KeyboardInterrupt:
|
||||
pass
|
||||
|
||||
|
||||
class EventAdapter():
|
||||
"""
|
||||
Adapter to wrap our event queue since the caller (bb.event) expects to
|
||||
call a send() method, but our actual queue only has put()
|
||||
"""
|
||||
def __init__(self, queue):
|
||||
self.queue = queue
|
||||
|
||||
def send(self, event):
|
||||
try:
|
||||
self.queue.put(event)
|
||||
except Exception as err:
|
||||
print("EventAdapter puked: %s" % str(err))
|
||||
|
||||
|
||||
class ProcessServer(Process):
|
||||
profile_filename = "profile.log"
|
||||
profile_processed_filename = "profile.log.processed"
|
||||
|
||||
def __init__(self, command_channel, event_queue):
|
||||
Process.__init__(self)
|
||||
self.command_channel = command_channel
|
||||
self.event_queue = event_queue
|
||||
self.event = EventAdapter(event_queue)
|
||||
self._idlefunctions = {}
|
||||
self.quit = False
|
||||
|
||||
self.keep_running = Event()
|
||||
self.keep_running.set()
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
"""Register a function to be called while the server is idle"""
|
||||
assert hasattr(function, '__call__')
|
||||
self._idlefunctions[function] = data
|
||||
|
||||
def run(self):
|
||||
for event in bb.event.ui_queue:
|
||||
self.event_queue.put(event)
|
||||
self.event_handle = bb.event.register_UIHhandler(self)
|
||||
bb.cooker.server_main(self.cooker, self.main)
|
||||
|
||||
def main(self):
|
||||
# Ignore SIGINT within the server, as all SIGINT handling is done by
|
||||
# the UI and communicated to us
|
||||
signal.signal(signal.SIGINT, signal.SIG_IGN)
|
||||
while self.keep_running.is_set():
|
||||
try:
|
||||
if self.command_channel.poll():
|
||||
command = self.command_channel.recv()
|
||||
self.runCommand(command)
|
||||
|
||||
self.idle_commands(.1)
|
||||
except Exception:
|
||||
logger.exception('Running command %s', command)
|
||||
|
||||
self.event_queue.cancel_join_thread()
|
||||
bb.event.unregister_UIHhandler(self.event_handle)
|
||||
self.command_channel.close()
|
||||
self.cooker.stop()
|
||||
self.idle_commands(.1)
|
||||
|
||||
def idle_commands(self, delay):
|
||||
nextsleep = delay
|
||||
|
||||
for function, data in self._idlefunctions.items():
|
||||
try:
|
||||
retval = function(self, data, False)
|
||||
if retval is False:
|
||||
del self._idlefunctions[function]
|
||||
elif retval is True:
|
||||
nextsleep = None
|
||||
elif nextsleep is None:
|
||||
continue
|
||||
elif retval < nextsleep:
|
||||
nextsleep = retval
|
||||
except SystemExit:
|
||||
raise
|
||||
except Exception:
|
||||
logger.exception('Running idle function')
|
||||
|
||||
if nextsleep is not None:
|
||||
time.sleep(nextsleep)
|
||||
|
||||
def runCommand(self, command):
|
||||
"""
|
||||
Run a cooker command on the server
|
||||
"""
|
||||
self.command_channel.send(self.cooker.command.runCommand(command))
|
||||
|
||||
def stop(self):
|
||||
self.keep_running.clear()
|
||||
|
||||
def bootstrap_2_6_6(self):
|
||||
"""Pulled from python 2.6.6. Needed to ensure we have the fix from
|
||||
http://bugs.python.org/issue5313 when running on python version 2.6.2
|
||||
or lower."""
|
||||
|
||||
try:
|
||||
self._children = set()
|
||||
self._counter = itertools.count(1)
|
||||
try:
|
||||
sys.stdin.close()
|
||||
sys.stdin = open(os.devnull)
|
||||
except (OSError, ValueError):
|
||||
pass
|
||||
multiprocessing._current_process = self
|
||||
util._finalizer_registry.clear()
|
||||
util._run_after_forkers()
|
||||
util.info('child process calling self.run()')
|
||||
try:
|
||||
self.run()
|
||||
exitcode = 0
|
||||
finally:
|
||||
util._exit_function()
|
||||
except SystemExit as e:
|
||||
if not e.args:
|
||||
exitcode = 1
|
||||
elif type(e.args[0]) is int:
|
||||
exitcode = e.args[0]
|
||||
else:
|
||||
sys.stderr.write(e.args[0] + '\n')
|
||||
sys.stderr.flush()
|
||||
exitcode = 1
|
||||
except:
|
||||
exitcode = 1
|
||||
import traceback
|
||||
sys.stderr.write('Process %s:\n' % self.name)
|
||||
sys.stderr.flush()
|
||||
traceback.print_exc()
|
||||
|
||||
util.info('process exiting with exitcode %d' % exitcode)
|
||||
return exitcode
|
||||
|
||||
# Python versions 2.6.0 through 2.6.2 suffer from a multiprocessing bug
|
||||
# which can result in a bitbake server hang during the parsing process
|
||||
if (2, 6, 0) <= sys.version_info < (2, 6, 3):
|
||||
_bootstrap = bootstrap_2_6_6
|
||||
|
||||
class BitBakeServerConnection():
|
||||
def __init__(self, server):
|
||||
self.server = server
|
||||
self.procserver = server.server
|
||||
self.connection = ServerCommunicator(server.ui_channel)
|
||||
self.events = server.event_queue
|
||||
|
||||
def terminate(self, force = False):
|
||||
signal.signal(signal.SIGINT, signal.SIG_IGN)
|
||||
self.procserver.stop()
|
||||
if force:
|
||||
self.procserver.join(0.5)
|
||||
if self.procserver.is_alive():
|
||||
self.procserver.terminate()
|
||||
self.procserver.join()
|
||||
else:
|
||||
self.procserver.join()
|
||||
while True:
|
||||
try:
|
||||
event = self.server.event_queue.get(block=False)
|
||||
except (Empty, IOError):
|
||||
break
|
||||
if isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
self.server.ui_channel.close()
|
||||
self.server.event_queue.close()
|
||||
if force:
|
||||
sys.exit(1)
|
||||
|
||||
# Wrap Queue to provide API which isn't server implementation specific
|
||||
class ProcessEventQueue(multiprocessing.queues.Queue):
|
||||
def waitEvent(self, timeout):
|
||||
try:
|
||||
return self.get(True, timeout)
|
||||
except Empty:
|
||||
return None
|
||||
|
||||
def getEvent(self):
|
||||
try:
|
||||
return self.get(False)
|
||||
except Empty:
|
||||
return None
|
||||
|
||||
|
||||
class BitBakeServer(object):
|
||||
def initServer(self):
|
||||
# establish communication channels. We use bidirectional pipes for
|
||||
# ui <--> server command/response pairs
|
||||
# and a queue for server -> ui event notifications
|
||||
#
|
||||
self.ui_channel, self.server_channel = Pipe()
|
||||
self.event_queue = ProcessEventQueue(0)
|
||||
|
||||
self.server = ProcessServer(self.server_channel, self.event_queue)
|
||||
|
||||
def addcooker(self, cooker):
|
||||
self.cooker = cooker
|
||||
self.server.cooker = cooker
|
||||
|
||||
def getServerIdleCB(self):
|
||||
return self.server.register_idle_function
|
||||
|
||||
def saveConnectionDetails(self):
|
||||
return
|
||||
|
||||
def detach(self):
|
||||
self.server.start()
|
||||
return
|
||||
|
||||
def establishConnection(self):
|
||||
self.connection = BitBakeServerConnection(self)
|
||||
signal.signal(signal.SIGTERM, lambda i, s: self.connection.terminate(force=True))
|
||||
return self.connection
|
||||
|
||||
def launchUI(self, uifunc, *args):
|
||||
return bb.cooker.server_main(self.cooker, uifunc, *args)
|
||||
|
||||
@@ -122,7 +122,8 @@ def _create_server(host, port):
|
||||
return s
|
||||
|
||||
class BitBakeServerCommands():
|
||||
def __init__(self, server):
|
||||
def __init__(self, server, cooker):
|
||||
self.cooker = cooker
|
||||
self.server = server
|
||||
|
||||
def registerEventHandler(self, host, port):
|
||||
@@ -150,7 +151,7 @@ class BitBakeServerCommands():
|
||||
Trigger the server to quit
|
||||
"""
|
||||
self.server.quit = True
|
||||
print("Server (cooker) exiting")
|
||||
print("Server (cooker) exitting")
|
||||
return
|
||||
|
||||
def ping(self):
|
||||
@@ -159,11 +160,11 @@ class BitBakeServerCommands():
|
||||
"""
|
||||
return True
|
||||
|
||||
class BitBakeXMLRPCServer(SimpleXMLRPCServer):
|
||||
class BitBakeServer(SimpleXMLRPCServer):
|
||||
# remove this when you're done with debugging
|
||||
# allow_reuse_address = True
|
||||
|
||||
def __init__(self, interface):
|
||||
def __init__(self, cooker, interface = ("localhost", 0)):
|
||||
"""
|
||||
Constructor
|
||||
"""
|
||||
@@ -173,12 +174,9 @@ class BitBakeXMLRPCServer(SimpleXMLRPCServer):
|
||||
self._idlefuns = {}
|
||||
self.host, self.port = self.socket.getsockname()
|
||||
#self.register_introspection_functions()
|
||||
self.commands = BitBakeServerCommands(self)
|
||||
self.autoregister_all_functions(self.commands, "")
|
||||
|
||||
def addcooker(self, cooker):
|
||||
commands = BitBakeServerCommands(self, cooker)
|
||||
self.autoregister_all_functions(commands, "")
|
||||
self.cooker = cooker
|
||||
self.commands.cooker = cooker
|
||||
|
||||
def autoregister_all_functions(self, context, prefix):
|
||||
"""
|
||||
@@ -242,14 +240,22 @@ class BitBakeXMLRPCServer(SimpleXMLRPCServer):
|
||||
return
|
||||
|
||||
class BitbakeServerInfo():
|
||||
def __init__(self, host, port):
|
||||
self.host = host
|
||||
self.port = port
|
||||
def __init__(self, server):
|
||||
self.host = server.host
|
||||
self.port = server.port
|
||||
|
||||
class BitBakeServerFork():
|
||||
def __init__(self, cooker, server, serverinfo, logfile):
|
||||
daemonize.createDaemon(server.serve_forever, logfile)
|
||||
|
||||
class BitbakeUILauch():
|
||||
def launch(self, serverinfo, uifunc, *args):
|
||||
return uifunc(*args)
|
||||
|
||||
class BitBakeServerConnection():
|
||||
def __init__(self, serverinfo, clientinfo=("localhost", 0)):
|
||||
def __init__(self, serverinfo):
|
||||
self.connection = _create_server(serverinfo.host, serverinfo.port)
|
||||
self.events = uievent.BBUIEventQueue(self.connection, clientinfo)
|
||||
self.events = uievent.BBUIEventQueue(self.connection)
|
||||
for event in bb.event.ui_queue:
|
||||
self.events.queue_event(event)
|
||||
|
||||
@@ -265,31 +271,3 @@ class BitBakeServerConnection():
|
||||
self.connection.terminateServer()
|
||||
except:
|
||||
pass
|
||||
|
||||
class BitBakeServer(object):
|
||||
def initServer(self, interface = ("localhost", 0)):
|
||||
self.server = BitBakeXMLRPCServer(interface)
|
||||
|
||||
def addcooker(self, cooker):
|
||||
self.cooker = cooker
|
||||
self.server.addcooker(cooker)
|
||||
|
||||
def getServerIdleCB(self):
|
||||
return self.server.register_idle_function
|
||||
|
||||
def saveConnectionDetails(self):
|
||||
self.serverinfo = BitbakeServerInfo(self.server.host, self.server.port)
|
||||
|
||||
def detach(self):
|
||||
daemonize.createDaemon(self.server.serve_forever)
|
||||
del self.cooker
|
||||
del self.server
|
||||
|
||||
def establishConnection(self):
|
||||
self.connection = BitBakeServerConnection(self.serverinfo)
|
||||
return self.connection
|
||||
|
||||
def launchUI(self, uifunc, *args):
|
||||
return uifunc(*args)
|
||||
|
||||
|
||||
|
||||
@@ -407,7 +407,7 @@ SRC_URI = ""
|
||||
|
||||
def parse( self, params ):
|
||||
"""(Re-)parse .bb files and calculate the dependency graph"""
|
||||
cooker.status = cache.CacheData(cooker.caches_array)
|
||||
cooker.status = cache.CacheData()
|
||||
ignore = data.getVar("ASSUME_PROVIDED", cooker.configuration.data, 1) or ""
|
||||
cooker.status.ignored_dependencies = set( ignore.split() )
|
||||
cooker.handleCollections( data.getVar("BBFILE_COLLECTIONS", cooker.configuration.data, 1) )
|
||||
|
||||
@@ -1,8 +1,6 @@
|
||||
import hashlib
|
||||
import logging
|
||||
import os
|
||||
import re
|
||||
import tempfile
|
||||
import bb.data
|
||||
|
||||
logger = logging.getLogger('BitBake.SigGen')
|
||||
@@ -17,7 +15,7 @@ def init(d):
|
||||
siggens = [obj for obj in globals().itervalues()
|
||||
if type(obj) is type and issubclass(obj, SignatureGenerator)]
|
||||
|
||||
desired = d.getVar("BB_SIGNATURE_HANDLER", True) or "noop"
|
||||
desired = bb.data.getVar("BB_SIGNATURE_HANDLER", d, True) or "noop"
|
||||
for sg in siggens:
|
||||
if desired == sg.name:
|
||||
return sg(d)
|
||||
@@ -40,7 +38,7 @@ class SignatureGenerator(object):
|
||||
return
|
||||
|
||||
def get_taskhash(self, fn, task, deps, dataCache):
|
||||
return "0"
|
||||
return 0
|
||||
|
||||
def set_taskdata(self, hashes, deps):
|
||||
return
|
||||
@@ -48,16 +46,6 @@ class SignatureGenerator(object):
|
||||
def stampfile(self, stampbase, file_name, taskname, extrainfo):
|
||||
return ("%s.%s.%s" % (stampbase, taskname, extrainfo)).rstrip('.')
|
||||
|
||||
def stampcleanmask(self, stampbase, file_name, taskname, extrainfo):
|
||||
return ("%s.%s.%s" % (stampbase, taskname, extrainfo)).rstrip('.')
|
||||
|
||||
def dump_sigtask(self, fn, task, stampbase, runtime):
|
||||
return
|
||||
|
||||
def invalidate_task(self, task, d, fn):
|
||||
bb.build.del_stamp(task, d, fn)
|
||||
|
||||
|
||||
class SignatureGeneratorBasic(SignatureGenerator):
|
||||
"""
|
||||
"""
|
||||
@@ -68,16 +56,11 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
self.taskhash = {}
|
||||
self.taskdeps = {}
|
||||
self.runtaskdeps = {}
|
||||
self.file_checksum_values = {}
|
||||
self.gendeps = {}
|
||||
self.lookupcache = {}
|
||||
self.pkgnameextract = re.compile("(?P<fn>.*)\..*")
|
||||
self.basewhitelist = set((data.getVar("BB_HASHBASE_WHITELIST", True) or "").split())
|
||||
self.taskwhitelist = None
|
||||
self.init_rundepcheck(data)
|
||||
|
||||
def init_rundepcheck(self, data):
|
||||
self.taskwhitelist = data.getVar("BB_HASHTASK_WHITELIST", True) or None
|
||||
|
||||
if self.taskwhitelist:
|
||||
self.twl = re.compile(self.taskwhitelist)
|
||||
else:
|
||||
@@ -85,19 +68,16 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
|
||||
def _build_data(self, fn, d):
|
||||
|
||||
tasklist, gendeps, lookupcache = bb.data.generate_dependencies(d)
|
||||
tasklist, gendeps = bb.data.generate_dependencies(d)
|
||||
|
||||
taskdeps = {}
|
||||
basehash = {}
|
||||
lookupcache = {}
|
||||
|
||||
for task in tasklist:
|
||||
data = d.getVar(task, False)
|
||||
lookupcache[task] = data
|
||||
|
||||
if data is None:
|
||||
bb.error("Task %s from %s seems to be empty?!" % (task, fn))
|
||||
data = ''
|
||||
|
||||
newdeps = gendeps[task]
|
||||
seen = set()
|
||||
while newdeps:
|
||||
@@ -113,18 +93,15 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
alldeps = seen - self.basewhitelist
|
||||
|
||||
for dep in sorted(alldeps):
|
||||
data = data + dep
|
||||
if dep in lookupcache:
|
||||
var = lookupcache[dep]
|
||||
elif dep[-1] == ']':
|
||||
vf = dep[:-1].split('[')
|
||||
var = d.getVarFlag(vf[0], vf[1], False)
|
||||
lookupcache[dep] = var
|
||||
else:
|
||||
var = d.getVar(dep, False)
|
||||
lookupcache[dep] = var
|
||||
if var:
|
||||
data = data + str(var)
|
||||
data = data + var
|
||||
if data is None:
|
||||
bb.error("Task %s from %s seems to be empty?!" % (task, fn))
|
||||
self.basehash[fn + "." + task] = hashlib.md5(data).hexdigest()
|
||||
taskdeps[task] = sorted(alldeps)
|
||||
|
||||
@@ -139,11 +116,7 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
if variant:
|
||||
fn = "virtual:" + variant + ":" + fn
|
||||
|
||||
try:
|
||||
taskdeps = self._build_data(fn, d)
|
||||
except:
|
||||
bb.note("Error during finalise of %s" % fn)
|
||||
raise
|
||||
taskdeps = self._build_data(fn, d)
|
||||
|
||||
#Slow but can be useful for debugging mismatched basehashes
|
||||
#for task in self.taskdeps[fn]:
|
||||
@@ -152,49 +125,21 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
for task in taskdeps:
|
||||
d.setVar("BB_BASEHASH_task-%s" % task, self.basehash[fn + "." + task])
|
||||
|
||||
def rundep_check(self, fn, recipename, task, dep, depname, dataCache):
|
||||
# Return True if we should keep the dependency, False to drop it
|
||||
# We only manipulate the dependencies for packages not in the whitelist
|
||||
if self.twl and not self.twl.search(recipename):
|
||||
# then process the actual dependencies
|
||||
if self.twl.search(depname):
|
||||
return False
|
||||
return True
|
||||
|
||||
def read_taint(self, fn, task, stampbase):
|
||||
taint = None
|
||||
try:
|
||||
with open(stampbase + '.' + task + '.taint', 'r') as taintf:
|
||||
taint = taintf.read()
|
||||
except IOError:
|
||||
pass
|
||||
return taint
|
||||
|
||||
def get_taskhash(self, fn, task, deps, dataCache):
|
||||
k = fn + "." + task
|
||||
data = dataCache.basetaskhash[k]
|
||||
self.runtaskdeps[k] = []
|
||||
self.file_checksum_values[k] = {}
|
||||
recipename = dataCache.pkg_fn[fn]
|
||||
for dep in sorted(deps, key=clean_basepath):
|
||||
depname = dataCache.pkg_fn[self.pkgnameextract.search(dep).group('fn')]
|
||||
if not self.rundep_check(fn, recipename, task, dep, depname, dataCache):
|
||||
continue
|
||||
for dep in sorted(deps):
|
||||
# We only manipulate the dependencies for packages not in the whitelist
|
||||
if self.twl and not self.twl.search(dataCache.pkg_fn[fn]):
|
||||
# then process the actual dependencies
|
||||
dep_fn = re.search("(?P<fn>.*)\..*", dep).group('fn')
|
||||
if self.twl.search(dataCache.pkg_fn[dep_fn]):
|
||||
continue
|
||||
if dep not in self.taskhash:
|
||||
bb.fatal("%s is not in taskhash, caller isn't calling in dependency order?", dep)
|
||||
data = data + self.taskhash[dep]
|
||||
self.runtaskdeps[k].append(dep)
|
||||
|
||||
if task in dataCache.file_checksums[fn]:
|
||||
checksums = bb.fetch2.get_file_checksums(dataCache.file_checksums[fn][task], recipename)
|
||||
for (f,cs) in checksums:
|
||||
self.file_checksum_values[k][f] = cs
|
||||
data = data + cs
|
||||
|
||||
taint = self.read_taint(fn, task, dataCache.stamp[fn])
|
||||
if taint:
|
||||
data = data + taint
|
||||
|
||||
h = hashlib.md5(data).hexdigest()
|
||||
self.taskhash[k] = h
|
||||
#d.setVar("BB_TASKHASH_task-%s" % task, taskhash[task])
|
||||
@@ -208,7 +153,7 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
k = fn + "." + task
|
||||
if runtime == "customfile":
|
||||
sigfile = stampbase
|
||||
elif runtime and k in self.taskhash:
|
||||
elif runtime:
|
||||
sigfile = stampbase + "." + task + ".sigdata" + "." + self.taskhash[k]
|
||||
else:
|
||||
sigfile = stampbase + "." + task + ".sigbasedata" + "." + self.basehash[k]
|
||||
@@ -229,31 +174,14 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
data['gendeps'][dep] = self.gendeps[fn][dep]
|
||||
data['varvals'][dep] = self.lookupcache[fn][dep]
|
||||
|
||||
if runtime and k in self.taskhash:
|
||||
if runtime:
|
||||
data['runtaskdeps'] = self.runtaskdeps[k]
|
||||
data['file_checksum_values'] = self.file_checksum_values[k]
|
||||
data['runtaskhashes'] = {}
|
||||
for dep in data['runtaskdeps']:
|
||||
data['runtaskhashes'][dep] = self.taskhash[dep]
|
||||
|
||||
taint = self.read_taint(fn, task, stampbase)
|
||||
if taint:
|
||||
data['taint'] = taint
|
||||
|
||||
fd, tmpfile = tempfile.mkstemp(dir=os.path.dirname(sigfile), prefix="sigtask.")
|
||||
try:
|
||||
with os.fdopen(fd, "wb") as stream:
|
||||
p = pickle.dump(data, stream, -1)
|
||||
stream.flush()
|
||||
os.fsync(fd)
|
||||
os.chmod(tmpfile, 0664)
|
||||
os.rename(tmpfile, sigfile)
|
||||
except (OSError, IOError), err:
|
||||
try:
|
||||
os.unlink(tmpfile)
|
||||
except OSError:
|
||||
pass
|
||||
raise err
|
||||
p = pickle.Pickler(file(sigfile, "wb"), -1)
|
||||
p.dump(data)
|
||||
|
||||
def dump_sigs(self, dataCache):
|
||||
for fn in self.taskdeps:
|
||||
@@ -269,184 +197,102 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
|
||||
name = "basichash"
|
||||
|
||||
def stampfile(self, stampbase, fn, taskname, extrainfo, clean=False):
|
||||
def stampfile(self, stampbase, fn, taskname, extrainfo):
|
||||
if taskname != "do_setscene" and taskname.endswith("_setscene"):
|
||||
k = fn + "." + taskname[:-9]
|
||||
else:
|
||||
k = fn + "." + taskname
|
||||
if clean:
|
||||
h = "*"
|
||||
elif k in self.taskhash:
|
||||
h = self.taskhash[k]
|
||||
else:
|
||||
# If k is not in basehash, then error
|
||||
h = self.basehash[k]
|
||||
h = self.taskhash[k]
|
||||
return ("%s.%s.%s.%s" % (stampbase, taskname, h, extrainfo)).rstrip('.')
|
||||
|
||||
def stampcleanmask(self, stampbase, fn, taskname, extrainfo):
|
||||
return self.stampfile(stampbase, fn, taskname, extrainfo, clean=True)
|
||||
|
||||
def invalidate_task(self, task, d, fn):
|
||||
bb.note("Tainting hash to force rebuild of task %s, %s" % (fn, task))
|
||||
bb.build.write_taint(task, d, fn)
|
||||
|
||||
def dump_this_task(outfile, d):
|
||||
import bb.parse
|
||||
fn = d.getVar("BB_FILENAME", True)
|
||||
task = "do_" + d.getVar("BB_CURRENTTASK", True)
|
||||
bb.parse.siggen.dump_sigtask(fn, task, outfile, "customfile")
|
||||
|
||||
def clean_basepath(a):
|
||||
if a.startswith("virtual:"):
|
||||
b = a.rsplit(":", 1)[0] + ":" + a.rsplit("/", 1)[1]
|
||||
else:
|
||||
b = a.rsplit("/", 1)[1]
|
||||
return b
|
||||
|
||||
def clean_basepaths(a):
|
||||
b = {}
|
||||
for x in a:
|
||||
b[clean_basepath(x)] = a[x]
|
||||
return b
|
||||
|
||||
def compare_sigfiles(a, b, recursecb = None):
|
||||
output = []
|
||||
|
||||
p1 = pickle.Unpickler(open(a, "rb"))
|
||||
def compare_sigfiles(a, b):
|
||||
p1 = pickle.Unpickler(file(a, "rb"))
|
||||
a_data = p1.load()
|
||||
p2 = pickle.Unpickler(open(b, "rb"))
|
||||
p2 = pickle.Unpickler(file(b, "rb"))
|
||||
b_data = p2.load()
|
||||
|
||||
def dict_diff(a, b, whitelist=set()):
|
||||
def dict_diff(a, b):
|
||||
sa = set(a.keys())
|
||||
sb = set(b.keys())
|
||||
common = sa & sb
|
||||
changed = set()
|
||||
for i in common:
|
||||
if a[i] != b[i] and i not in whitelist:
|
||||
if a[i] != b[i]:
|
||||
changed.add(i)
|
||||
added = sa - sb
|
||||
removed = sb - sa
|
||||
return changed, added, removed
|
||||
|
||||
if 'basewhitelist' in a_data and a_data['basewhitelist'] != b_data['basewhitelist']:
|
||||
output.append("basewhitelist changed from %s to %s" % (a_data['basewhitelist'], b_data['basewhitelist']))
|
||||
if a_data['basewhitelist'] and b_data['basewhitelist']:
|
||||
output.append("changed items: %s" % a_data['basewhitelist'].symmetric_difference(b_data['basewhitelist']))
|
||||
print "basewhitelist changed from %s to %s" % (a_data['basewhitelist'], b_data['basewhitelist'])
|
||||
|
||||
if 'taskwhitelist' in a_data and a_data['taskwhitelist'] != b_data['taskwhitelist']:
|
||||
output.append("taskwhitelist changed from %s to %s" % (a_data['taskwhitelist'], b_data['taskwhitelist']))
|
||||
if a_data['taskwhitelist'] and b_data['taskwhitelist']:
|
||||
output.append("changed items: %s" % a_data['taskwhitelist'].symmetric_difference(b_data['taskwhitelist']))
|
||||
print "taskwhitelist changed from %s to %s" % (a_data['taskwhitelist'], b_data['taskwhitelist'])
|
||||
|
||||
if a_data['taskdeps'] != b_data['taskdeps']:
|
||||
output.append("Task dependencies changed from:\n%s\nto:\n%s" % (sorted(a_data['taskdeps']), sorted(b_data['taskdeps'])))
|
||||
print "Task dependencies changed from %s to %s" % (sorted(a_data['taskdeps']), sorted(b_data['taskdeps']))
|
||||
|
||||
if a_data['basehash'] != b_data['basehash']:
|
||||
output.append("basehash changed from %s to %s" % (a_data['basehash'], b_data['basehash']))
|
||||
print "basehash changed from %s to %s" % (a_data['basehash'], b_data['basehash'])
|
||||
|
||||
changed, added, removed = dict_diff(a_data['gendeps'], b_data['gendeps'], a_data['basewhitelist'] & b_data['basewhitelist'])
|
||||
changed, added, removed = dict_diff(a_data['gendeps'], b_data['gendeps'])
|
||||
if changed:
|
||||
for dep in changed:
|
||||
output.append("List of dependencies for variable %s changed from %s to %s" % (dep, a_data['gendeps'][dep], b_data['gendeps'][dep]))
|
||||
if a_data['gendeps'][dep] and b_data['gendeps'][dep]:
|
||||
output.append("changed items: %s" % a_data['gendeps'][dep].symmetric_difference(b_data['gendeps'][dep]))
|
||||
print "List of dependencies for variable %s changed from %s to %s" % (dep, a_data['gendeps'][dep], b_data['gendeps'][dep])
|
||||
if added:
|
||||
for dep in added:
|
||||
output.append("Dependency on variable %s was added" % (dep))
|
||||
print "Dependency on variable %s was added" % (dep)
|
||||
if removed:
|
||||
for dep in removed:
|
||||
output.append("Dependency on Variable %s was removed" % (dep))
|
||||
print "Dependency on Variable %s was removed" % (dep)
|
||||
|
||||
|
||||
changed, added, removed = dict_diff(a_data['varvals'], b_data['varvals'])
|
||||
if changed:
|
||||
for dep in changed:
|
||||
output.append("Variable %s value changed from %s to %s" % (dep, a_data['varvals'][dep], b_data['varvals'][dep]))
|
||||
|
||||
changed, added, removed = dict_diff(a_data['file_checksum_values'], b_data['file_checksum_values'])
|
||||
if changed:
|
||||
for f in changed:
|
||||
output.append("Checksum for file %s changed from %s to %s" % (f, a_data['file_checksum_values'][f], b_data['file_checksum_values'][f]))
|
||||
if added:
|
||||
for f in added:
|
||||
output.append("Dependency on checksum of file %s was added" % (f))
|
||||
if removed:
|
||||
for f in removed:
|
||||
output.append("Dependency on checksum of file %s was removed" % (f))
|
||||
|
||||
print "Variable %s value changed from %s to %s" % (dep, a_data['varvals'][dep], b_data['varvals'][dep])
|
||||
|
||||
if 'runtaskhashes' in a_data and 'runtaskhashes' in b_data:
|
||||
a = a_data['runtaskhashes']
|
||||
b = b_data['runtaskhashes']
|
||||
changed, added, removed = dict_diff(a, b)
|
||||
changed, added, removed = dict_diff(a_data['runtaskhashes'], b_data['runtaskhashes'])
|
||||
if added:
|
||||
for dep in added:
|
||||
bdep_found = False
|
||||
if removed:
|
||||
for bdep in removed:
|
||||
if a[dep] == b[bdep]:
|
||||
#output.append("Dependency on task %s was replaced by %s with same hash" % (dep, bdep))
|
||||
bdep_found = True
|
||||
if not bdep_found:
|
||||
output.append("Dependency on task %s was added with hash %s" % (clean_basepath(dep), a[dep]))
|
||||
print "Dependency on task %s was added" % (dep)
|
||||
if removed:
|
||||
for dep in removed:
|
||||
adep_found = False
|
||||
if added:
|
||||
for adep in added:
|
||||
if a[adep] == b[dep]:
|
||||
#output.append("Dependency on task %s was replaced by %s with same hash" % (adep, dep))
|
||||
adep_found = True
|
||||
if not adep_found:
|
||||
output.append("Dependency on task %s was removed with hash %s" % (clean_basepath(dep), b[dep]))
|
||||
print "Dependency on task %s was removed" % (dep)
|
||||
if changed:
|
||||
for dep in changed:
|
||||
output.append("Hash for dependent task %s changed from %s to %s" % (clean_basepath(dep), a[dep], b[dep]))
|
||||
if callable(recursecb):
|
||||
recout = recursecb(dep, a[dep], b[dep])
|
||||
if recout:
|
||||
output.extend(recout)
|
||||
|
||||
a_taint = a_data.get('taint', None)
|
||||
b_taint = b_data.get('taint', None)
|
||||
if a_taint != b_taint:
|
||||
output.append("Taint (by forced/invalidated task) changed from %s to %s" % (a_taint, b_taint))
|
||||
|
||||
return output
|
||||
|
||||
print "Hash for dependent task %s changed from %s to %s" % (dep, a_data['runtaskhashes'][dep], b_data['runtaskhashes'][dep])
|
||||
elif 'runtaskdeps' in a_data and 'runtaskdeps' in b_data and sorted(a_data['runtaskdeps']) != sorted(b_data['runtaskdeps']):
|
||||
print "Tasks this task depends on changed from %s to %s" % (sorted(a_data['runtaskdeps']), sorted(b_data['runtaskdeps']))
|
||||
|
||||
def dump_sigfile(a):
|
||||
output = []
|
||||
|
||||
p1 = pickle.Unpickler(open(a, "rb"))
|
||||
p1 = pickle.Unpickler(file(a, "rb"))
|
||||
a_data = p1.load()
|
||||
|
||||
output.append("basewhitelist: %s" % (a_data['basewhitelist']))
|
||||
print "basewhitelist: %s" % (a_data['basewhitelist'])
|
||||
|
||||
output.append("taskwhitelist: %s" % (a_data['taskwhitelist']))
|
||||
print "taskwhitelist: %s" % (a_data['taskwhitelist'])
|
||||
|
||||
output.append("Task dependencies: %s" % (sorted(a_data['taskdeps'])))
|
||||
print "Task dependencies: %s" % (sorted(a_data['taskdeps']))
|
||||
|
||||
output.append("basehash: %s" % (a_data['basehash']))
|
||||
print "basehash: %s" % (a_data['basehash'])
|
||||
|
||||
for dep in a_data['gendeps']:
|
||||
output.append("List of dependencies for variable %s is %s" % (dep, a_data['gendeps'][dep]))
|
||||
print "List of dependencies for variable %s is %s" % (dep, a_data['gendeps'][dep])
|
||||
|
||||
for dep in a_data['varvals']:
|
||||
output.append("Variable %s value is %s" % (dep, a_data['varvals'][dep]))
|
||||
print "Variable %s value is %s" % (dep, a_data['varvals'][dep])
|
||||
|
||||
if 'runtaskdeps' in a_data:
|
||||
output.append("Tasks this task depends on: %s" % (a_data['runtaskdeps']))
|
||||
|
||||
if 'file_checksum_values' in a_data:
|
||||
output.append("This task depends on the checksums of files: %s" % (a_data['file_checksum_values']))
|
||||
print "Tasks this task depends on: %s" % (a_data['runtaskdeps'])
|
||||
|
||||
if 'runtaskhashes' in a_data:
|
||||
for dep in a_data['runtaskhashes']:
|
||||
output.append("Hash for dependent task %s is %s" % (dep, a_data['runtaskhashes'][dep]))
|
||||
|
||||
if 'taint' in a_data:
|
||||
output.append("Tainted (by forced/invalidated task): %s" % a_data['taint'])
|
||||
|
||||
return output
|
||||
print "Hash for dependent task %s is %s" % (dep, a_data['runtaskhashes'][dep])
|
||||
|
||||
@@ -41,7 +41,7 @@ class TaskData:
|
||||
"""
|
||||
BitBake Task Data implementation
|
||||
"""
|
||||
def __init__(self, abort = True, tryaltconfigs = False, skiplist = None):
|
||||
def __init__(self, abort = True, tryaltconfigs = False):
|
||||
self.build_names_index = []
|
||||
self.run_names_index = []
|
||||
self.fn_index = []
|
||||
@@ -55,7 +55,6 @@ class TaskData:
|
||||
self.tasks_name = []
|
||||
self.tasks_tdepends = []
|
||||
self.tasks_idepends = []
|
||||
self.tasks_irdepends = []
|
||||
# Cache to speed up task ID lookups
|
||||
self.tasks_lookup = {}
|
||||
|
||||
@@ -71,8 +70,6 @@ class TaskData:
|
||||
self.abort = abort
|
||||
self.tryaltconfigs = tryaltconfigs
|
||||
|
||||
self.skiplist = skiplist
|
||||
|
||||
def getbuild_id(self, name):
|
||||
"""
|
||||
Return an ID number for the build target name.
|
||||
@@ -116,16 +113,6 @@ class TaskData:
|
||||
ids.append(self.tasks_lookup[fnid][task])
|
||||
return ids
|
||||
|
||||
def gettask_id_fromfnid(self, fnid, task):
|
||||
"""
|
||||
Return an ID number for the task matching fnid and task.
|
||||
"""
|
||||
if fnid in self.tasks_lookup:
|
||||
if task in self.tasks_lookup[fnid]:
|
||||
return self.tasks_lookup[fnid][task]
|
||||
|
||||
return None
|
||||
|
||||
def gettask_id(self, fn, task, create = True):
|
||||
"""
|
||||
Return an ID number for the task matching fn and task.
|
||||
@@ -145,7 +132,6 @@ class TaskData:
|
||||
self.tasks_fnid.append(fnid)
|
||||
self.tasks_tdepends.append([])
|
||||
self.tasks_idepends.append([])
|
||||
self.tasks_irdepends.append([])
|
||||
|
||||
listid = len(self.tasks_name) - 1
|
||||
|
||||
@@ -165,7 +151,7 @@ class TaskData:
|
||||
fnid = self.getfn_id(fn)
|
||||
|
||||
if fnid in self.failed_fnids:
|
||||
bb.msg.fatal("TaskData", "Trying to re-add a failed file? Something is broken...")
|
||||
bb.msg.fatal(bb.msg.domain.TaskData, "Trying to re-add a failed file? Something is broken...")
|
||||
|
||||
# Check if we've already seen this fn
|
||||
if fnid in self.tasks_fnid:
|
||||
@@ -176,9 +162,6 @@ class TaskData:
|
||||
# Work out task dependencies
|
||||
parentids = []
|
||||
for dep in task_deps['parents'][task]:
|
||||
if dep not in task_deps['tasks']:
|
||||
bb.debug(2, "Not adding dependeny of %s on %s since %s does not exist" % (task, dep, dep))
|
||||
continue
|
||||
parentid = self.gettask_id(fn, dep)
|
||||
parentids.append(parentid)
|
||||
taskid = self.gettask_id(fn, task)
|
||||
@@ -190,18 +173,9 @@ class TaskData:
|
||||
for dep in task_deps['depends'][task].split():
|
||||
if dep:
|
||||
if ":" not in dep:
|
||||
bb.msg.fatal("TaskData", "Error for %s, dependency %s does not contain ':' character\n. Task 'depends' should be specified in the form 'packagename:task'" % (fn, dep))
|
||||
bb.msg.fatal(bb.msg.domain.TaskData, "Error, dependency %s does not contain ':' character\n. Task 'depends' should be specified in the form 'packagename:task'" % (dep, fn))
|
||||
ids.append(((self.getbuild_id(dep.split(":")[0])), dep.split(":")[1]))
|
||||
self.tasks_idepends[taskid].extend(ids)
|
||||
if 'rdepends' in task_deps and task in task_deps['rdepends']:
|
||||
ids = []
|
||||
for dep in task_deps['rdepends'][task].split():
|
||||
if dep:
|
||||
if ":" not in dep:
|
||||
bb.msg.fatal("TaskData", "Error for %s, dependency %s does not contain ':' character\n. Task 'rdepends' should be specified in the form 'packagename:task'" % (fn, dep))
|
||||
ids.append(((self.getrun_id(dep.split(":")[0])), dep.split(":")[1]))
|
||||
self.tasks_irdepends[taskid].extend(ids)
|
||||
|
||||
|
||||
# Work out build dependencies
|
||||
if not fnid in self.depids:
|
||||
@@ -374,22 +348,6 @@ class TaskData:
|
||||
dependees.append(self.fn_index[fnid])
|
||||
return dependees
|
||||
|
||||
def get_reasons(self, item, runtime=False):
|
||||
"""
|
||||
Get the reason(s) for an item not being provided, if any
|
||||
"""
|
||||
reasons = []
|
||||
if self.skiplist:
|
||||
for fn in self.skiplist:
|
||||
skipitem = self.skiplist[fn]
|
||||
if skipitem.pn == item:
|
||||
reasons.append("%s was skipped: %s" % (skipitem.pn, skipitem.skipreason))
|
||||
elif runtime and item in skipitem.rprovides:
|
||||
reasons.append("%s RPROVIDES %s but was skipped: %s" % (skipitem.pn, item, skipitem.skipreason))
|
||||
elif not runtime and item in skipitem.provides:
|
||||
reasons.append("%s PROVIDES %s but was skipped: %s" % (skipitem.pn, item, skipitem.skipreason))
|
||||
return reasons
|
||||
|
||||
def add_provider(self, cfgData, dataCache, item):
|
||||
try:
|
||||
self.add_provider_internal(cfgData, dataCache, item)
|
||||
@@ -411,7 +369,7 @@ class TaskData:
|
||||
return
|
||||
|
||||
if not item in dataCache.providers:
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item), reasons=self.get_reasons(item)), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_rdependees_str(item)), cfgData)
|
||||
raise bb.providers.NoProvider(item)
|
||||
|
||||
if self.have_build_target(item):
|
||||
@@ -423,7 +381,7 @@ class TaskData:
|
||||
eligible = [p for p in eligible if not self.getfn_id(p) in self.failed_fnids]
|
||||
|
||||
if not eligible:
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item), reasons=["No eligible PROVIDERs exist for '%s'" % item]), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item)), cfgData)
|
||||
raise bb.providers.NoProvider(item)
|
||||
|
||||
if len(eligible) > 1 and foundUnique == False:
|
||||
@@ -460,14 +418,14 @@ class TaskData:
|
||||
all_p = bb.providers.getRuntimeProviders(dataCache, item)
|
||||
|
||||
if not all_p:
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item), reasons=self.get_reasons(item, True)), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item)), cfgData)
|
||||
raise bb.providers.NoRProvider(item)
|
||||
|
||||
eligible, numberPreferred = bb.providers.filterProvidersRunTime(all_p, item, cfgData, dataCache)
|
||||
eligible = [p for p in eligible if not self.getfn_id(p) in self.failed_fnids]
|
||||
|
||||
if not eligible:
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item), reasons=["No eligible RPROVIDERs exist for '%s'" % item]), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item)), cfgData)
|
||||
raise bb.providers.NoRProvider(item)
|
||||
|
||||
if len(eligible) > 1 and numberPreferred == 0:
|
||||
@@ -485,7 +443,6 @@ class TaskData:
|
||||
providers_list.append(dataCache.pkg_fn[fn])
|
||||
bb.event.fire(bb.event.MultipleProviders(item, providers_list, runtime=True), cfgData)
|
||||
self.consider_msgs_cache.append(item)
|
||||
raise bb.providers.MultipleRProvider(item)
|
||||
|
||||
# run through the list until we find one that we can build
|
||||
for fn in eligible:
|
||||
@@ -558,11 +515,6 @@ class TaskData:
|
||||
dependees = self.get_rdependees(targetid)
|
||||
for fnid in dependees:
|
||||
self.fail_fnid(fnid, missing_list)
|
||||
for taskid in xrange(len(self.tasks_irdepends)):
|
||||
irdepends = self.tasks_irdepends[taskid]
|
||||
for (idependid, idependtask) in irdepends:
|
||||
if idependid == targetid:
|
||||
self.fail_fnid(self.tasks_fnid[taskid], missing_list)
|
||||
|
||||
def add_unresolved(self, cfgData, dataCache):
|
||||
"""
|
||||
@@ -584,7 +536,7 @@ class TaskData:
|
||||
try:
|
||||
self.add_rprovider(cfgData, dataCache, target)
|
||||
added = added + 1
|
||||
except (bb.providers.NoRProvider, bb.providers.MultipleRProvider):
|
||||
except bb.providers.NoRProvider:
|
||||
self.remove_runtarget(self.getrun_id(target))
|
||||
logger.debug(1, "Resolved " + str(added) + " extra dependencies")
|
||||
if added == 0:
|
||||
|
||||
@@ -1,369 +0,0 @@
|
||||
#
|
||||
# BitBake Test for codeparser.py
|
||||
#
|
||||
# Copyright (C) 2010 Chris Larson
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import logging
|
||||
import bb
|
||||
|
||||
logger = logging.getLogger('BitBake.TestCodeParser')
|
||||
|
||||
import bb.data
|
||||
|
||||
class ReferenceTest(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
|
||||
def setEmptyVars(self, varlist):
|
||||
for k in varlist:
|
||||
self.d.setVar(k, "")
|
||||
|
||||
def setValues(self, values):
|
||||
for k, v in values.items():
|
||||
self.d.setVar(k, v)
|
||||
|
||||
def assertReferences(self, refs):
|
||||
self.assertEqual(self.references, refs)
|
||||
|
||||
def assertExecs(self, execs):
|
||||
self.assertEqual(self.execs, execs)
|
||||
|
||||
class VariableReferenceTest(ReferenceTest):
|
||||
|
||||
def parseExpression(self, exp):
|
||||
parsedvar = self.d.expandWithRefs(exp, None)
|
||||
self.references = parsedvar.references
|
||||
|
||||
def test_simple_reference(self):
|
||||
self.setEmptyVars(["FOO"])
|
||||
self.parseExpression("${FOO}")
|
||||
self.assertReferences(set(["FOO"]))
|
||||
|
||||
def test_nested_reference(self):
|
||||
self.setEmptyVars(["BAR"])
|
||||
self.d.setVar("FOO", "BAR")
|
||||
self.parseExpression("${${FOO}}")
|
||||
self.assertReferences(set(["FOO", "BAR"]))
|
||||
|
||||
def test_python_reference(self):
|
||||
self.setEmptyVars(["BAR"])
|
||||
self.parseExpression("${@bb.data.getVar('BAR', d, True) + 'foo'}")
|
||||
self.assertReferences(set(["BAR"]))
|
||||
|
||||
class ShellReferenceTest(ReferenceTest):
|
||||
|
||||
def parseExpression(self, exp):
|
||||
parsedvar = self.d.expandWithRefs(exp, None)
|
||||
parser = bb.codeparser.ShellParser("ParserTest", logger)
|
||||
parser.parse_shell(parsedvar.value)
|
||||
|
||||
self.references = parsedvar.references
|
||||
self.execs = parser.execs
|
||||
|
||||
def test_quotes_inside_assign(self):
|
||||
self.parseExpression('foo=foo"bar"baz')
|
||||
self.assertReferences(set([]))
|
||||
|
||||
def test_quotes_inside_arg(self):
|
||||
self.parseExpression('sed s#"bar baz"#"alpha beta"#g')
|
||||
self.assertExecs(set(["sed"]))
|
||||
|
||||
def test_arg_continuation(self):
|
||||
self.parseExpression("sed -i -e s,foo,bar,g \\\n *.pc")
|
||||
self.assertExecs(set(["sed"]))
|
||||
|
||||
def test_dollar_in_quoted(self):
|
||||
self.parseExpression('sed -i -e "foo$" *.pc')
|
||||
self.assertExecs(set(["sed"]))
|
||||
|
||||
def test_quotes_inside_arg_continuation(self):
|
||||
self.setEmptyVars(["bindir", "D", "libdir"])
|
||||
self.parseExpression("""
|
||||
sed -i -e s#"moc_location=.*$"#"moc_location=${bindir}/moc4"# \\
|
||||
-e s#"uic_location=.*$"#"uic_location=${bindir}/uic4"# \\
|
||||
${D}${libdir}/pkgconfig/*.pc
|
||||
""")
|
||||
self.assertReferences(set(["bindir", "D", "libdir"]))
|
||||
|
||||
def test_assign_subshell_expansion(self):
|
||||
self.parseExpression("foo=$(echo bar)")
|
||||
self.assertExecs(set(["echo"]))
|
||||
|
||||
def test_shell_unexpanded(self):
|
||||
self.setEmptyVars(["QT_BASE_NAME"])
|
||||
self.parseExpression('echo "${QT_BASE_NAME}"')
|
||||
self.assertExecs(set(["echo"]))
|
||||
self.assertReferences(set(["QT_BASE_NAME"]))
|
||||
|
||||
def test_incomplete_varexp_single_quotes(self):
|
||||
self.parseExpression("sed -i -e 's:IP{:I${:g' $pc")
|
||||
self.assertExecs(set(["sed"]))
|
||||
|
||||
|
||||
def test_until(self):
|
||||
self.parseExpression("until false; do echo true; done")
|
||||
self.assertExecs(set(["false", "echo"]))
|
||||
self.assertReferences(set())
|
||||
|
||||
def test_case(self):
|
||||
self.parseExpression("""
|
||||
case $foo in
|
||||
*)
|
||||
bar
|
||||
;;
|
||||
esac
|
||||
""")
|
||||
self.assertExecs(set(["bar"]))
|
||||
self.assertReferences(set())
|
||||
|
||||
def test_assign_exec(self):
|
||||
self.parseExpression("a=b c='foo bar' alpha 1 2 3")
|
||||
self.assertExecs(set(["alpha"]))
|
||||
|
||||
def test_redirect_to_file(self):
|
||||
self.setEmptyVars(["foo"])
|
||||
self.parseExpression("echo foo >${foo}/bar")
|
||||
self.assertExecs(set(["echo"]))
|
||||
self.assertReferences(set(["foo"]))
|
||||
|
||||
def test_heredoc(self):
|
||||
self.setEmptyVars(["theta"])
|
||||
self.parseExpression("""
|
||||
cat <<END
|
||||
alpha
|
||||
beta
|
||||
${theta}
|
||||
END
|
||||
""")
|
||||
self.assertReferences(set(["theta"]))
|
||||
|
||||
def test_redirect_from_heredoc(self):
|
||||
v = ["B", "SHADOW_MAILDIR", "SHADOW_MAILFILE", "SHADOW_UTMPDIR", "SHADOW_LOGDIR", "bindir"]
|
||||
self.setEmptyVars(v)
|
||||
self.parseExpression("""
|
||||
cat <<END >${B}/cachedpaths
|
||||
shadow_cv_maildir=${SHADOW_MAILDIR}
|
||||
shadow_cv_mailfile=${SHADOW_MAILFILE}
|
||||
shadow_cv_utmpdir=${SHADOW_UTMPDIR}
|
||||
shadow_cv_logdir=${SHADOW_LOGDIR}
|
||||
shadow_cv_passwd_dir=${bindir}
|
||||
END
|
||||
""")
|
||||
self.assertReferences(set(v))
|
||||
self.assertExecs(set(["cat"]))
|
||||
|
||||
# def test_incomplete_command_expansion(self):
|
||||
# self.assertRaises(reftracker.ShellSyntaxError, reftracker.execs,
|
||||
# bbvalue.shparse("cp foo`", self.d), self.d)
|
||||
|
||||
# def test_rogue_dollarsign(self):
|
||||
# self.setValues({"D" : "/tmp"})
|
||||
# self.parseExpression("install -d ${D}$")
|
||||
# self.assertReferences(set(["D"]))
|
||||
# self.assertExecs(set(["install"]))
|
||||
|
||||
|
||||
class PythonReferenceTest(ReferenceTest):
|
||||
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
if hasattr(bb.utils, "_context"):
|
||||
self.context = bb.utils._context
|
||||
else:
|
||||
import __builtin__
|
||||
self.context = __builtin__.__dict__
|
||||
|
||||
def parseExpression(self, exp):
|
||||
parsedvar = self.d.expandWithRefs(exp, None)
|
||||
parser = bb.codeparser.PythonParser("ParserTest", logger)
|
||||
parser.parse_python(parsedvar.value)
|
||||
|
||||
self.references = parsedvar.references | parser.references
|
||||
self.execs = parser.execs
|
||||
|
||||
@staticmethod
|
||||
def indent(value):
|
||||
"""Python Snippets have to be indented, python values don't have to
|
||||
be. These unit tests are testing snippets."""
|
||||
return " " + value
|
||||
|
||||
def test_getvar_reference(self):
|
||||
self.parseExpression("bb.data.getVar('foo', d, True)")
|
||||
self.assertReferences(set(["foo"]))
|
||||
self.assertExecs(set())
|
||||
|
||||
def test_getvar_computed_reference(self):
|
||||
self.parseExpression("bb.data.getVar('f' + 'o' + 'o', d, True)")
|
||||
self.assertReferences(set())
|
||||
self.assertExecs(set())
|
||||
|
||||
def test_getvar_exec_reference(self):
|
||||
self.parseExpression("eval('bb.data.getVar(\"foo\", d, True)')")
|
||||
self.assertReferences(set())
|
||||
self.assertExecs(set(["eval"]))
|
||||
|
||||
def test_var_reference(self):
|
||||
self.context["foo"] = lambda x: x
|
||||
self.setEmptyVars(["FOO"])
|
||||
self.parseExpression("foo('${FOO}')")
|
||||
self.assertReferences(set(["FOO"]))
|
||||
self.assertExecs(set(["foo"]))
|
||||
del self.context["foo"]
|
||||
|
||||
def test_var_exec(self):
|
||||
for etype in ("func", "task"):
|
||||
self.d.setVar("do_something", "echo 'hi mom! ${FOO}'")
|
||||
self.d.setVarFlag("do_something", etype, True)
|
||||
self.parseExpression("bb.build.exec_func('do_something', d)")
|
||||
self.assertReferences(set(["do_something"]))
|
||||
|
||||
def test_function_reference(self):
|
||||
self.context["testfunc"] = lambda msg: bb.msg.note(1, None, msg)
|
||||
self.d.setVar("FOO", "Hello, World!")
|
||||
self.parseExpression("testfunc('${FOO}')")
|
||||
self.assertReferences(set(["FOO"]))
|
||||
self.assertExecs(set(["testfunc"]))
|
||||
del self.context["testfunc"]
|
||||
|
||||
def test_qualified_function_reference(self):
|
||||
self.parseExpression("time.time()")
|
||||
self.assertExecs(set(["time.time"]))
|
||||
|
||||
def test_qualified_function_reference_2(self):
|
||||
self.parseExpression("os.path.dirname('/foo/bar')")
|
||||
self.assertExecs(set(["os.path.dirname"]))
|
||||
|
||||
def test_qualified_function_reference_nested(self):
|
||||
self.parseExpression("time.strftime('%Y%m%d',time.gmtime())")
|
||||
self.assertExecs(set(["time.strftime", "time.gmtime"]))
|
||||
|
||||
def test_function_reference_chained(self):
|
||||
self.context["testget"] = lambda: "\tstrip me "
|
||||
self.parseExpression("testget().strip()")
|
||||
self.assertExecs(set(["testget"]))
|
||||
del self.context["testget"]
|
||||
|
||||
|
||||
class DependencyReferenceTest(ReferenceTest):
|
||||
|
||||
pydata = """
|
||||
bb.data.getVar('somevar', d, True)
|
||||
def test(d):
|
||||
foo = 'bar %s' % 'foo'
|
||||
def test2(d):
|
||||
d.getVar(foo, True)
|
||||
d.getVar('bar', False)
|
||||
test2(d)
|
||||
|
||||
def a():
|
||||
\"\"\"some
|
||||
stuff
|
||||
\"\"\"
|
||||
return "heh"
|
||||
|
||||
test(d)
|
||||
|
||||
bb.data.expand(bb.data.getVar("something", False, d), d)
|
||||
bb.data.expand("${inexpand} somethingelse", d)
|
||||
bb.data.getVar(a(), d, False)
|
||||
"""
|
||||
|
||||
def test_python(self):
|
||||
self.d.setVar("FOO", self.pydata)
|
||||
self.setEmptyVars(["inexpand", "a", "test2", "test"])
|
||||
self.d.setVarFlags("FOO", {"func": True, "python": True})
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEquals(deps, set(["somevar", "bar", "something", "inexpand", "test", "test2", "a"]))
|
||||
|
||||
|
||||
shelldata = """
|
||||
foo () {
|
||||
bar
|
||||
}
|
||||
{
|
||||
echo baz
|
||||
$(heh)
|
||||
eval `moo`
|
||||
}
|
||||
a=b
|
||||
c=d
|
||||
(
|
||||
true && false
|
||||
test -f foo
|
||||
testval=something
|
||||
$testval
|
||||
) || aiee
|
||||
! inverted
|
||||
echo ${somevar}
|
||||
|
||||
case foo in
|
||||
bar)
|
||||
echo bar
|
||||
;;
|
||||
baz)
|
||||
echo baz
|
||||
;;
|
||||
foo*)
|
||||
echo foo
|
||||
;;
|
||||
esac
|
||||
"""
|
||||
|
||||
def test_shell(self):
|
||||
execs = ["bar", "echo", "heh", "moo", "true", "aiee"]
|
||||
self.d.setVar("somevar", "heh")
|
||||
self.d.setVar("inverted", "echo inverted...")
|
||||
self.d.setVarFlag("inverted", "func", True)
|
||||
self.d.setVar("FOO", self.shelldata)
|
||||
self.d.setVarFlags("FOO", {"func": True})
|
||||
self.setEmptyVars(execs)
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEquals(deps, set(["somevar", "inverted"] + execs))
|
||||
|
||||
|
||||
def test_vardeps(self):
|
||||
self.d.setVar("oe_libinstall", "echo test")
|
||||
self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
|
||||
self.d.setVarFlag("FOO", "vardeps", "oe_libinstall")
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEquals(deps, set(["oe_libinstall"]))
|
||||
|
||||
def test_vardeps_expand(self):
|
||||
self.d.setVar("oe_libinstall", "echo test")
|
||||
self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
|
||||
self.d.setVarFlag("FOO", "vardeps", "${@'oe_libinstall'}")
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEquals(deps, set(["oe_libinstall"]))
|
||||
|
||||
#Currently no wildcard support
|
||||
#def test_vardeps_wildcards(self):
|
||||
# self.d.setVar("oe_libinstall", "echo test")
|
||||
# self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
|
||||
# self.d.setVarFlag("FOO", "vardeps", "oe_*")
|
||||
# self.assertEquals(deps, set(["oe_libinstall"]))
|
||||
|
||||
|
||||
@@ -1,134 +0,0 @@
|
||||
#
|
||||
# BitBake Tests for Copy-on-Write (cow.py)
|
||||
#
|
||||
# Copyright 2006 Holger Freyther <freyther@handhelds.org>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import os
|
||||
|
||||
class COWTestCase(unittest.TestCase):
|
||||
"""
|
||||
Test case for the COW module from mithro
|
||||
"""
|
||||
|
||||
def testGetSet(self):
|
||||
"""
|
||||
Test and set
|
||||
"""
|
||||
from bb.COW import COWDictBase
|
||||
a = COWDictBase.copy()
|
||||
|
||||
self.assertEquals(False, a.has_key('a'))
|
||||
|
||||
a['a'] = 'a'
|
||||
a['b'] = 'b'
|
||||
self.assertEquals(True, a.has_key('a'))
|
||||
self.assertEquals(True, a.has_key('b'))
|
||||
self.assertEquals('a', a['a'] )
|
||||
self.assertEquals('b', a['b'] )
|
||||
|
||||
def testCopyCopy(self):
|
||||
"""
|
||||
Test the copy of copies
|
||||
"""
|
||||
|
||||
from bb.COW import COWDictBase
|
||||
|
||||
# create two COW dict 'instances'
|
||||
b = COWDictBase.copy()
|
||||
c = COWDictBase.copy()
|
||||
|
||||
# assign some keys to one instance, some keys to another
|
||||
b['a'] = 10
|
||||
b['c'] = 20
|
||||
c['a'] = 30
|
||||
|
||||
# test separation of the two instances
|
||||
self.assertEquals(False, c.has_key('c'))
|
||||
self.assertEquals(30, c['a'])
|
||||
self.assertEquals(10, b['a'])
|
||||
|
||||
# test copy
|
||||
b_2 = b.copy()
|
||||
c_2 = c.copy()
|
||||
|
||||
self.assertEquals(False, c_2.has_key('c'))
|
||||
self.assertEquals(10, b_2['a'])
|
||||
|
||||
b_2['d'] = 40
|
||||
self.assertEquals(False, c_2.has_key('d'))
|
||||
self.assertEquals(True, b_2.has_key('d'))
|
||||
self.assertEquals(40, b_2['d'])
|
||||
self.assertEquals(False, b.has_key('d'))
|
||||
self.assertEquals(False, c.has_key('d'))
|
||||
|
||||
c_2['d'] = 30
|
||||
self.assertEquals(True, c_2.has_key('d'))
|
||||
self.assertEquals(True, b_2.has_key('d'))
|
||||
self.assertEquals(30, c_2['d'])
|
||||
self.assertEquals(40, b_2['d'])
|
||||
self.assertEquals(False, b.has_key('d'))
|
||||
self.assertEquals(False, c.has_key('d'))
|
||||
|
||||
# test copy of the copy
|
||||
c_3 = c_2.copy()
|
||||
b_3 = b_2.copy()
|
||||
b_3_2 = b_2.copy()
|
||||
|
||||
c_3['e'] = 4711
|
||||
self.assertEquals(4711, c_3['e'])
|
||||
self.assertEquals(False, c_2.has_key('e'))
|
||||
self.assertEquals(False, b_3.has_key('e'))
|
||||
self.assertEquals(False, b_3_2.has_key('e'))
|
||||
self.assertEquals(False, b_2.has_key('e'))
|
||||
|
||||
b_3['e'] = 'viel'
|
||||
self.assertEquals('viel', b_3['e'])
|
||||
self.assertEquals(4711, c_3['e'])
|
||||
self.assertEquals(False, c_2.has_key('e'))
|
||||
self.assertEquals(True, b_3.has_key('e'))
|
||||
self.assertEquals(False, b_3_2.has_key('e'))
|
||||
self.assertEquals(False, b_2.has_key('e'))
|
||||
|
||||
def testCow(self):
|
||||
from bb.COW import COWDictBase
|
||||
c = COWDictBase.copy()
|
||||
c['123'] = 1027
|
||||
c['other'] = 4711
|
||||
c['d'] = { 'abc' : 10, 'bcd' : 20 }
|
||||
|
||||
copy = c.copy()
|
||||
|
||||
self.assertEquals(1027, c['123'])
|
||||
self.assertEquals(4711, c['other'])
|
||||
self.assertEquals({'abc':10, 'bcd':20}, c['d'])
|
||||
self.assertEquals(1027, copy['123'])
|
||||
self.assertEquals(4711, copy['other'])
|
||||
self.assertEquals({'abc':10, 'bcd':20}, copy['d'])
|
||||
|
||||
# cow it now
|
||||
copy['123'] = 1028
|
||||
copy['other'] = 4712
|
||||
copy['d']['abc'] = 20
|
||||
|
||||
|
||||
self.assertEquals(1027, c['123'])
|
||||
self.assertEquals(4711, c['other'])
|
||||
self.assertEquals({'abc':10, 'bcd':20}, c['d'])
|
||||
self.assertEquals(1028, copy['123'])
|
||||
self.assertEquals(4712, copy['other'])
|
||||
self.assertEquals({'abc':20, 'bcd':20}, copy['d'])
|
||||
@@ -1,252 +0,0 @@
|
||||
#
|
||||
# BitBake Tests for the Data Store (data.py/data_smart.py)
|
||||
#
|
||||
# Copyright (C) 2010 Chris Larson
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import bb
|
||||
import bb.data
|
||||
|
||||
class DataExpansions(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d["foo"] = "value of foo"
|
||||
self.d["bar"] = "value of bar"
|
||||
self.d["value of foo"] = "value of 'value of foo'"
|
||||
|
||||
def test_one_var(self):
|
||||
val = self.d.expand("${foo}")
|
||||
self.assertEqual(str(val), "value of foo")
|
||||
|
||||
def test_indirect_one_var(self):
|
||||
val = self.d.expand("${${foo}}")
|
||||
self.assertEqual(str(val), "value of 'value of foo'")
|
||||
|
||||
def test_indirect_and_another(self):
|
||||
val = self.d.expand("${${foo}} ${bar}")
|
||||
self.assertEqual(str(val), "value of 'value of foo' value of bar")
|
||||
|
||||
def test_python_snippet(self):
|
||||
val = self.d.expand("${@5*12}")
|
||||
self.assertEqual(str(val), "60")
|
||||
|
||||
def test_expand_in_python_snippet(self):
|
||||
val = self.d.expand("${@'boo ' + '${foo}'}")
|
||||
self.assertEqual(str(val), "boo value of foo")
|
||||
|
||||
def test_python_snippet_getvar(self):
|
||||
val = self.d.expand("${@d.getVar('foo', True) + ' ${bar}'}")
|
||||
self.assertEqual(str(val), "value of foo value of bar")
|
||||
|
||||
def test_python_snippet_syntax_error(self):
|
||||
self.d.setVar("FOO", "${@foo = 5}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_python_snippet_runtime_error(self):
|
||||
self.d.setVar("FOO", "${@int('test')}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_python_snippet_error_path(self):
|
||||
self.d.setVar("FOO", "foo value ${BAR}")
|
||||
self.d.setVar("BAR", "bar value ${@int('test')}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_value_containing_value(self):
|
||||
val = self.d.expand("${@d.getVar('foo', True) + ' ${bar}'}")
|
||||
self.assertEqual(str(val), "value of foo value of bar")
|
||||
|
||||
def test_reference_undefined_var(self):
|
||||
val = self.d.expand("${undefinedvar} meh")
|
||||
self.assertEqual(str(val), "${undefinedvar} meh")
|
||||
|
||||
def test_double_reference(self):
|
||||
self.d.setVar("BAR", "bar value")
|
||||
self.d.setVar("FOO", "${BAR} foo ${BAR}")
|
||||
val = self.d.getVar("FOO", True)
|
||||
self.assertEqual(str(val), "bar value foo bar value")
|
||||
|
||||
def test_direct_recursion(self):
|
||||
self.d.setVar("FOO", "${FOO}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_indirect_recursion(self):
|
||||
self.d.setVar("FOO", "${BAR}")
|
||||
self.d.setVar("BAR", "${BAZ}")
|
||||
self.d.setVar("BAZ", "${FOO}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_recursion_exception(self):
|
||||
self.d.setVar("FOO", "${BAR}")
|
||||
self.d.setVar("BAR", "${${@'FOO'}}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_incomplete_varexp_single_quotes(self):
|
||||
self.d.setVar("FOO", "sed -i -e 's:IP{:I${:g' $pc")
|
||||
val = self.d.getVar("FOO", True)
|
||||
self.assertEqual(str(val), "sed -i -e 's:IP{:I${:g' $pc")
|
||||
|
||||
def test_nonstring(self):
|
||||
self.d.setVar("TEST", 5)
|
||||
val = self.d.getVar("TEST", True)
|
||||
self.assertEqual(str(val), "5")
|
||||
|
||||
def test_rename(self):
|
||||
self.d.renameVar("foo", "newfoo")
|
||||
self.assertEqual(self.d.getVar("newfoo"), "value of foo")
|
||||
self.assertEqual(self.d.getVar("foo"), None)
|
||||
|
||||
def test_deletion(self):
|
||||
self.d.delVar("foo")
|
||||
self.assertEqual(self.d.getVar("foo"), None)
|
||||
|
||||
def test_keys(self):
|
||||
keys = self.d.keys()
|
||||
self.assertEqual(keys, ['value of foo', 'foo', 'bar'])
|
||||
|
||||
class TestNestedExpansions(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d["foo"] = "foo"
|
||||
self.d["bar"] = "bar"
|
||||
self.d["value of foobar"] = "187"
|
||||
|
||||
def test_refs(self):
|
||||
val = self.d.expand("${value of ${foo}${bar}}")
|
||||
self.assertEqual(str(val), "187")
|
||||
|
||||
#def test_python_refs(self):
|
||||
# val = self.d.expand("${@${@3}**2 + ${@4}**2}")
|
||||
# self.assertEqual(str(val), "25")
|
||||
|
||||
def test_ref_in_python_ref(self):
|
||||
val = self.d.expand("${@'${foo}' + 'bar'}")
|
||||
self.assertEqual(str(val), "foobar")
|
||||
|
||||
def test_python_ref_in_ref(self):
|
||||
val = self.d.expand("${${@'f'+'o'+'o'}}")
|
||||
self.assertEqual(str(val), "foo")
|
||||
|
||||
def test_deep_nesting(self):
|
||||
depth = 100
|
||||
val = self.d.expand("${" * depth + "foo" + "}" * depth)
|
||||
self.assertEqual(str(val), "foo")
|
||||
|
||||
#def test_deep_python_nesting(self):
|
||||
# depth = 50
|
||||
# val = self.d.expand("${@" * depth + "1" + "+1}" * depth)
|
||||
# self.assertEqual(str(val), str(depth + 1))
|
||||
|
||||
def test_mixed(self):
|
||||
val = self.d.expand("${value of ${@('${foo}'+'bar')[0:3]}${${@'BAR'.lower()}}}")
|
||||
self.assertEqual(str(val), "187")
|
||||
|
||||
def test_runtime(self):
|
||||
val = self.d.expand("${${@'value of' + ' f'+'o'+'o'+'b'+'a'+'r'}}")
|
||||
self.assertEqual(str(val), "187")
|
||||
|
||||
class TestMemoize(unittest.TestCase):
|
||||
def test_memoized(self):
|
||||
d = bb.data.init()
|
||||
d.setVar("FOO", "bar")
|
||||
self.assertTrue(d.getVar("FOO") is d.getVar("FOO"))
|
||||
|
||||
def test_not_memoized(self):
|
||||
d1 = bb.data.init()
|
||||
d2 = bb.data.init()
|
||||
d1.setVar("FOO", "bar")
|
||||
d2.setVar("FOO", "bar2")
|
||||
self.assertTrue(d1.getVar("FOO") is not d2.getVar("FOO"))
|
||||
|
||||
def test_changed_after_memoized(self):
|
||||
d = bb.data.init()
|
||||
d.setVar("foo", "value of foo")
|
||||
self.assertEqual(str(d.getVar("foo")), "value of foo")
|
||||
d.setVar("foo", "second value of foo")
|
||||
self.assertEqual(str(d.getVar("foo")), "second value of foo")
|
||||
|
||||
def test_same_value(self):
|
||||
d = bb.data.init()
|
||||
d.setVar("foo", "value of")
|
||||
d.setVar("bar", "value of")
|
||||
self.assertEqual(d.getVar("foo"),
|
||||
d.getVar("bar"))
|
||||
|
||||
class TestConcat(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d.setVar("FOO", "foo")
|
||||
self.d.setVar("VAL", "val")
|
||||
self.d.setVar("BAR", "bar")
|
||||
|
||||
def test_prepend(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.prependVar("TEST", "${FOO}:")
|
||||
self.assertEqual(self.d.getVar("TEST", True), "foo:val")
|
||||
|
||||
def test_append(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.appendVar("TEST", ":${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST", True), "val:bar")
|
||||
|
||||
def test_multiple_append(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.prependVar("TEST", "${FOO}:")
|
||||
self.d.appendVar("TEST", ":val2")
|
||||
self.d.appendVar("TEST", ":${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST", True), "foo:val:val2:bar")
|
||||
|
||||
class TestOverrides(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d.setVar("OVERRIDES", "foo:bar:local")
|
||||
self.d.setVar("TEST", "testvalue")
|
||||
|
||||
def test_no_override(self):
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "testvalue")
|
||||
|
||||
def test_one_override(self):
|
||||
self.d.setVar("TEST_bar", "testvalue2")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "testvalue2")
|
||||
|
||||
def test_multiple_override(self):
|
||||
self.d.setVar("TEST_bar", "testvalue2")
|
||||
self.d.setVar("TEST_local", "testvalue3")
|
||||
self.d.setVar("TEST_foo", "testvalue4")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "testvalue3")
|
||||
|
||||
|
||||
class TestFlags(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d.setVar("foo", "value of foo")
|
||||
self.d.setVarFlag("foo", "flag1", "value of flag1")
|
||||
self.d.setVarFlag("foo", "flag2", "value of flag2")
|
||||
|
||||
def test_setflag(self):
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag1"), "value of flag1")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag2"), "value of flag2")
|
||||
|
||||
def test_delflag(self):
|
||||
self.d.delVarFlag("foo", "flag2")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag1"), "value of flag1")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag2"), None)
|
||||
|
||||
|
||||
@@ -1,191 +0,0 @@
|
||||
#
|
||||
# BitBake Tests for the Fetcher (fetch2/)
|
||||
#
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import tempfile
|
||||
import subprocess
|
||||
import os
|
||||
import bb
|
||||
|
||||
|
||||
class FetcherTest(unittest.TestCase):
|
||||
|
||||
replaceuris = {
|
||||
("git://git.invalid.infradead.org/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "http://somewhere.org/somedir/")
|
||||
: "http://somewhere.org/somedir/git2_git.invalid.infradead.org.mtd-utils.git.tar.gz",
|
||||
("git://git.invalid.infradead.org/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/([^/]+/)*([^/]*)", "git://somewhere.org/somedir/\\2;protocol=http")
|
||||
: "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/([^/]+/)*([^/]*)", "git://somewhere.org/somedir/\\2;protocol=http")
|
||||
: "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/([^/]+/)*([^/]*)", "git://somewhere.org/\\2;protocol=http")
|
||||
: "git://somewhere.org/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://someserver.org/bitbake;tag=1234567890123456789012345678901234567890", "git://someserver.org/bitbake", "git://git.openembedded.org/bitbake")
|
||||
: "git://git.openembedded.org/bitbake;tag=1234567890123456789012345678901234567890",
|
||||
("file://sstate-xyz.tgz", "file://.*", "file:///somewhere/1234/sstate-cache")
|
||||
: "file:///somewhere/1234/sstate-cache/sstate-xyz.tgz",
|
||||
("file://sstate-xyz.tgz", "file://.*", "file:///somewhere/1234/sstate-cache/")
|
||||
: "file:///somewhere/1234/sstate-cache/sstate-xyz.tgz",
|
||||
("http://somewhere.org/somedir1/somedir2/somefile_1.2.3.tar.gz", "http://.*/.*", "http://somewhere2.org/somedir3")
|
||||
: "http://somewhere2.org/somedir3/somefile_1.2.3.tar.gz",
|
||||
("http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere2.org/somedir3/somefile_1.2.3.tar.gz")
|
||||
: "http://somewhere2.org/somedir3/somefile_1.2.3.tar.gz",
|
||||
("http://www.apache.org/dist/subversion/subversion-1.7.1.tar.bz2", "http://www.apache.org/dist", "http://archive.apache.org/dist")
|
||||
: "http://archive.apache.org/dist/subversion/subversion-1.7.1.tar.bz2",
|
||||
("http://www.apache.org/dist/subversion/subversion-1.7.1.tar.bz2", "http://.*/.*", "file:///somepath/downloads/")
|
||||
: "file:///somepath/downloads/subversion-1.7.1.tar.bz2",
|
||||
("git://git.invalid.infradead.org/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "git://somewhere.org/somedir/BASENAME;protocol=http")
|
||||
: "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "git://somewhere.org/somedir/BASENAME;protocol=http")
|
||||
: "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "git://somewhere.org/somedir/MIRRORNAME;protocol=http")
|
||||
: "git://somewhere.org/somedir/git.invalid.infradead.org.foo.mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
|
||||
#Renaming files doesn't work
|
||||
#("http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere2.org/somedir3/somefile_2.3.4.tar.gz") : "http://somewhere2.org/somedir3/somefile_2.3.4.tar.gz"
|
||||
#("file://sstate-xyz.tgz", "file://.*/.*", "file:///somewhere/1234/sstate-cache") : "file:///somewhere/1234/sstate-cache/sstate-xyz.tgz",
|
||||
}
|
||||
|
||||
mirrorvar = "http://.*/.* file:///somepath/downloads/ \n" \
|
||||
"git://someserver.org/bitbake git://git.openembedded.org/bitbake \n" \
|
||||
"https://.*/.* file:///someotherpath/downloads/ \n" \
|
||||
"http://.*/.* file:///someotherpath/downloads/ \n"
|
||||
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.tempdir = tempfile.mkdtemp()
|
||||
self.dldir = os.path.join(self.tempdir, "download")
|
||||
os.mkdir(self.dldir)
|
||||
self.d.setVar("DL_DIR", self.dldir)
|
||||
self.unpackdir = os.path.join(self.tempdir, "unpacked")
|
||||
os.mkdir(self.unpackdir)
|
||||
persistdir = os.path.join(self.tempdir, "persistdata")
|
||||
self.d.setVar("PERSISTENT_DIR", persistdir)
|
||||
|
||||
def tearDown(self):
|
||||
bb.utils.prunedir(self.tempdir)
|
||||
|
||||
def test_fetch(self):
|
||||
fetcher = bb.fetch.Fetch(["http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", "http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.1.tar.gz"], self.d)
|
||||
fetcher.download()
|
||||
self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.0.tar.gz"), 57749)
|
||||
self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.1.tar.gz"), 57892)
|
||||
self.d.setVar("BB_NO_NETWORK", "1")
|
||||
fetcher = bb.fetch.Fetch(["http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", "http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.1.tar.gz"], self.d)
|
||||
fetcher.download()
|
||||
fetcher.unpack(self.unpackdir)
|
||||
self.assertEqual(len(os.listdir(self.unpackdir + "/bitbake-1.0/")), 9)
|
||||
self.assertEqual(len(os.listdir(self.unpackdir + "/bitbake-1.1/")), 9)
|
||||
|
||||
def test_fetch_mirror(self):
|
||||
self.d.setVar("MIRRORS", "http://.*/.* http://downloads.yoctoproject.org/releases/bitbake")
|
||||
fetcher = bb.fetch.Fetch(["http://invalid.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz"], self.d)
|
||||
fetcher.download()
|
||||
self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.0.tar.gz"), 57749)
|
||||
|
||||
def test_fetch_premirror(self):
|
||||
self.d.setVar("PREMIRRORS", "http://.*/.* http://downloads.yoctoproject.org/releases/bitbake")
|
||||
fetcher = bb.fetch.Fetch(["http://invalid.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz"], self.d)
|
||||
fetcher.download()
|
||||
self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.0.tar.gz"), 57749)
|
||||
|
||||
def gitfetcher(self, url1, url2):
|
||||
def checkrevision(self, fetcher):
|
||||
fetcher.unpack(self.unpackdir)
|
||||
revision = subprocess.check_output("git rev-parse HEAD", shell=True, cwd=self.unpackdir + "/git").strip()
|
||||
self.assertEqual(revision, "270a05b0b4ba0959fe0624d2a4885d7b70426da5")
|
||||
|
||||
self.d.setVar("BB_GENERATE_MIRROR_TARBALLS", "1")
|
||||
self.d.setVar("SRCREV", "270a05b0b4ba0959fe0624d2a4885d7b70426da5")
|
||||
fetcher = bb.fetch.Fetch([url1], self.d)
|
||||
fetcher.download()
|
||||
checkrevision(self, fetcher)
|
||||
# Wipe out the dldir clone and the unpacked source, turn off the network and check mirror tarball works
|
||||
bb.utils.prunedir(self.dldir + "/git2/")
|
||||
bb.utils.prunedir(self.unpackdir)
|
||||
self.d.setVar("BB_NO_NETWORK", "1")
|
||||
fetcher = bb.fetch.Fetch([url2], self.d)
|
||||
fetcher.download()
|
||||
checkrevision(self, fetcher)
|
||||
|
||||
def test_gitfetch(self):
|
||||
url1 = url2 = "git://git.openembedded.org/bitbake"
|
||||
self.gitfetcher(url1, url2)
|
||||
|
||||
def test_gitfetch_premirror(self):
|
||||
url1 = "git://git.openembedded.org/bitbake"
|
||||
url2 = "git://someserver.org/bitbake"
|
||||
self.d.setVar("PREMIRRORS", "git://someserver.org/bitbake git://git.openembedded.org/bitbake \n")
|
||||
self.gitfetcher(url1, url2)
|
||||
|
||||
def test_gitfetch_premirror2(self):
|
||||
url1 = url2 = "git://someserver.org/bitbake"
|
||||
self.d.setVar("PREMIRRORS", "git://someserver.org/bitbake git://git.openembedded.org/bitbake \n")
|
||||
self.gitfetcher(url1, url2)
|
||||
|
||||
def test_gitfetch_premirror3(self):
|
||||
realurl = "git://git.openembedded.org/bitbake"
|
||||
dummyurl = "git://someserver.org/bitbake"
|
||||
self.sourcedir = self.unpackdir.replace("unpacked", "sourcemirror.git")
|
||||
os.chdir(self.tempdir)
|
||||
subprocess.check_output("git clone %s %s 2> /dev/null" % (realurl, self.sourcedir), shell=True)
|
||||
self.d.setVar("PREMIRRORS", "%s git://%s;protocol=file \n" % (dummyurl, self.sourcedir))
|
||||
self.gitfetcher(dummyurl, dummyurl)
|
||||
|
||||
def test_urireplace(self):
|
||||
for k, v in self.replaceuris.items():
|
||||
ud = bb.fetch.FetchData(k[0], self.d)
|
||||
ud.setup_localpath(self.d)
|
||||
mirrors = bb.fetch2.mirror_from_string("%s %s" % (k[1], k[2]))
|
||||
newuris, uds = bb.fetch2.build_mirroruris(ud, mirrors, self.d)
|
||||
self.assertEqual([v], newuris)
|
||||
|
||||
def test_urilist1(self):
|
||||
fetcher = bb.fetch.FetchData("http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", self.d)
|
||||
mirrors = bb.fetch2.mirror_from_string(self.mirrorvar)
|
||||
uris, uds = bb.fetch2.build_mirroruris(fetcher, mirrors, self.d)
|
||||
self.assertEqual(uris, ['file:///somepath/downloads/bitbake-1.0.tar.gz', 'file:///someotherpath/downloads/bitbake-1.0.tar.gz'])
|
||||
|
||||
def test_urilist2(self):
|
||||
# Catch https:// -> files:// bug
|
||||
fetcher = bb.fetch.FetchData("https://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", self.d)
|
||||
mirrors = bb.fetch2.mirror_from_string(self.mirrorvar)
|
||||
uris, uds = bb.fetch2.build_mirroruris(fetcher, mirrors, self.d)
|
||||
self.assertEqual(uris, ['file:///someotherpath/downloads/bitbake-1.0.tar.gz'])
|
||||
|
||||
|
||||
class URLHandle(unittest.TestCase):
|
||||
|
||||
datatable = {
|
||||
"http://www.google.com/index.html" : ('http', 'www.google.com', '/index.html', '', '', {}),
|
||||
"cvs://anoncvs@cvs.handhelds.org/cvs;module=familiar/dist/ipkg" : ('cvs', 'cvs.handhelds.org', '/cvs', 'anoncvs', '', {'module': 'familiar/dist/ipkg'}),
|
||||
"cvs://anoncvs:anonymous@cvs.handhelds.org/cvs;tag=V0-99-81;module=familiar/dist/ipkg" : ('cvs', 'cvs.handhelds.org', '/cvs', 'anoncvs', 'anonymous', {'tag': 'V0-99-81', 'module': 'familiar/dist/ipkg'})
|
||||
}
|
||||
|
||||
def test_decodeurl(self):
|
||||
for k, v in self.datatable.items():
|
||||
result = bb.fetch.decodeurl(k)
|
||||
self.assertEqual(result, v)
|
||||
|
||||
def test_encodeurl(self):
|
||||
for k, v in self.datatable.items():
|
||||
result = bb.fetch.encodeurl(v)
|
||||
self.assertEqual(result, k)
|
||||
|
||||
|
||||
|
||||
@@ -1,51 +0,0 @@
|
||||
#
|
||||
# BitBake Tests for utils.py
|
||||
#
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import bb
|
||||
|
||||
class VerCmpString(unittest.TestCase):
|
||||
|
||||
def test_vercmpstring(self):
|
||||
result = bb.utils.vercmp_string('1', '2')
|
||||
self.assertTrue(result < 0)
|
||||
result = bb.utils.vercmp_string('2', '1')
|
||||
self.assertTrue(result > 0)
|
||||
result = bb.utils.vercmp_string('1', '1.0')
|
||||
self.assertTrue(result < 0)
|
||||
result = bb.utils.vercmp_string('1', '1.1')
|
||||
self.assertTrue(result < 0)
|
||||
result = bb.utils.vercmp_string('1.1', '1_p2')
|
||||
self.assertTrue(result < 0)
|
||||
|
||||
def test_explode_dep_versions(self):
|
||||
correctresult = {"foo" : ["= 1.10"]}
|
||||
result = bb.utils.explode_dep_versions2("foo (= 1.10)")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo (=1.10)")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo ( = 1.10)")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo ( =1.10)")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo ( = 1.10 )")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo ( =1.10 )")
|
||||
self.assertEqual(result, correctresult)
|
||||
|
||||
@@ -1,98 +0,0 @@
|
||||
# tinfoil: a simple wrapper around cooker for bitbake-based command-line utilities
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
# Copyright (C) 2011 Mentor Graphics Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import logging
|
||||
import warnings
|
||||
import os
|
||||
import sys
|
||||
|
||||
import bb.cache
|
||||
import bb.cooker
|
||||
import bb.providers
|
||||
import bb.utils
|
||||
from bb.cooker import state
|
||||
import bb.fetch2
|
||||
|
||||
class Tinfoil:
|
||||
def __init__(self):
|
||||
# Needed to avoid deprecation warnings with python 2.6
|
||||
warnings.filterwarnings("ignore", category=DeprecationWarning)
|
||||
|
||||
# Set up logging
|
||||
self.logger = logging.getLogger('BitBake')
|
||||
console = logging.StreamHandler(sys.stdout)
|
||||
format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
|
||||
bb.msg.addDefaultlogFilter(console)
|
||||
console.setFormatter(format)
|
||||
self.logger.addHandler(console)
|
||||
|
||||
initialenv = os.environ.copy()
|
||||
bb.utils.clean_environment()
|
||||
self.config = TinfoilConfig(parse_only=True)
|
||||
self.cooker = bb.cooker.BBCooker(self.config,
|
||||
self.register_idle_function,
|
||||
initialenv)
|
||||
self.config_data = self.cooker.configuration.data
|
||||
bb.providers.logger.setLevel(logging.ERROR)
|
||||
self.cooker_data = None
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
pass
|
||||
|
||||
def parseRecipes(self):
|
||||
sys.stderr.write("Parsing recipes..")
|
||||
self.logger.setLevel(logging.WARNING)
|
||||
|
||||
try:
|
||||
while self.cooker.state in (state.initial, state.parsing):
|
||||
self.cooker.updateCache()
|
||||
except KeyboardInterrupt:
|
||||
self.cooker.shutdown()
|
||||
self.cooker.updateCache()
|
||||
sys.exit(2)
|
||||
|
||||
self.logger.setLevel(logging.INFO)
|
||||
sys.stderr.write("done.\n")
|
||||
|
||||
self.cooker_data = self.cooker.status
|
||||
|
||||
def prepare(self, config_only = False):
|
||||
if not self.cooker_data:
|
||||
if config_only:
|
||||
self.cooker.parseConfiguration()
|
||||
self.cooker_data = self.cooker.status
|
||||
else:
|
||||
self.parseRecipes()
|
||||
|
||||
|
||||
class TinfoilConfig(object):
|
||||
def __init__(self, **options):
|
||||
self.pkgs_to_build = []
|
||||
self.debug_domains = []
|
||||
self.extra_assume_provided = []
|
||||
self.prefile = []
|
||||
self.postfile = []
|
||||
self.debug = 0
|
||||
self.__dict__.update(options)
|
||||
|
||||
def __getattr__(self, attribute):
|
||||
try:
|
||||
return super(TinfoilConfig, self).__getattribute__(attribute)
|
||||
except AttributeError:
|
||||
return None
|
||||
|
||||
@@ -1,449 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import pango
|
||||
import gobject
|
||||
import bb.process
|
||||
from bb.ui.crumbs.progressbar import HobProgressBar
|
||||
from bb.ui.crumbs.hobwidget import hic, HobNotebook, HobAltButton, HobWarpCellRendererText, HobButton, HobInfoButton
|
||||
from bb.ui.crumbs.runningbuild import RunningBuildTreeView
|
||||
from bb.ui.crumbs.runningbuild import BuildFailureTreeView
|
||||
from bb.ui.crumbs.hobpages import HobPage
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
from bb.ui.crumbs.hobthreads import OpeningLogThread
|
||||
from bb.ui.crumbs.hig import OpeningLogDialog
|
||||
|
||||
class BuildConfigurationTreeView(gtk.TreeView):
|
||||
def __init__ (self):
|
||||
gtk.TreeView.__init__(self)
|
||||
self.set_rules_hint(False)
|
||||
self.set_headers_visible(False)
|
||||
self.set_property("hover-expand", True)
|
||||
self.get_selection().set_mode(gtk.SELECTION_SINGLE)
|
||||
|
||||
# The icon that indicates whether we're building or failed.
|
||||
renderer0 = gtk.CellRendererText()
|
||||
renderer0.set_property('font-desc', pango.FontDescription('courier bold 12'))
|
||||
col0 = gtk.TreeViewColumn ("Name", renderer0, text=0)
|
||||
self.append_column (col0)
|
||||
|
||||
# The message of configuration.
|
||||
renderer1 = HobWarpCellRendererText(col_number=1)
|
||||
col1 = gtk.TreeViewColumn ("Values", renderer1, text=1)
|
||||
self.append_column (col1)
|
||||
|
||||
def set_vars(self, key="", var=[""]):
|
||||
d = {}
|
||||
if type(var) == str:
|
||||
d = {key: [var]}
|
||||
elif type(var) == list and len(var) > 1:
|
||||
#create the sub item line
|
||||
l = []
|
||||
text = ""
|
||||
for item in var:
|
||||
text = " - " + item
|
||||
l.append(text)
|
||||
d = {key: var}
|
||||
|
||||
return d
|
||||
|
||||
def set_config_model(self, show_vars):
|
||||
listmodel = gtk.TreeStore(gobject.TYPE_STRING, gobject.TYPE_STRING)
|
||||
parent = None
|
||||
for var in show_vars:
|
||||
for subitem in var.items():
|
||||
name = subitem[0]
|
||||
is_parent = True
|
||||
for value in subitem[1]:
|
||||
if is_parent:
|
||||
parent = listmodel.append(parent, (name, value))
|
||||
is_parent = False
|
||||
else:
|
||||
listmodel.append(parent, (None, value))
|
||||
name = " - "
|
||||
parent = None
|
||||
# renew the tree model after get the configuration messages
|
||||
self.set_model(listmodel)
|
||||
|
||||
def show(self, src_config_info, src_params):
|
||||
vars = []
|
||||
vars.append(self.set_vars("BB version:", src_params.bb_version))
|
||||
vars.append(self.set_vars("Target arch:", src_params.target_arch))
|
||||
vars.append(self.set_vars("Target OS:", src_params.target_os))
|
||||
vars.append(self.set_vars("Machine:", src_config_info.curr_mach))
|
||||
vars.append(self.set_vars("Distro:", src_config_info.curr_distro))
|
||||
vars.append(self.set_vars("Distro version:", src_params.distro_version))
|
||||
vars.append(self.set_vars("SDK machine:", src_config_info.curr_sdk_machine))
|
||||
vars.append(self.set_vars("Tune features:", src_params.tune_pkgarch))
|
||||
vars.append(self.set_vars("Layers:", src_config_info.layers))
|
||||
|
||||
for path in src_config_info.layers:
|
||||
import os, os.path
|
||||
if os.path.exists(path):
|
||||
branch = bb.process.run('cd %s; git branch | grep "^* " | tr -d "* "' % path)[0]
|
||||
if branch.startswith("fatal:"):
|
||||
branch = "(unknown)"
|
||||
if branch:
|
||||
branch = branch.strip('\n')
|
||||
vars.append(self.set_vars("Branch:", branch))
|
||||
break
|
||||
|
||||
self.set_config_model(vars)
|
||||
|
||||
def reset(self):
|
||||
self.set_model(None)
|
||||
|
||||
#
|
||||
# BuildDetailsPage
|
||||
#
|
||||
|
||||
class BuildDetailsPage (HobPage):
|
||||
|
||||
def __init__(self, builder):
|
||||
super(BuildDetailsPage, self).__init__(builder, "Building ...")
|
||||
|
||||
self.num_of_issues = 0
|
||||
self.endpath = (0,)
|
||||
# create visual elements
|
||||
self.create_visual_elements()
|
||||
|
||||
def create_visual_elements(self):
|
||||
# create visual elements
|
||||
self.vbox = gtk.VBox(False, 12)
|
||||
|
||||
self.progress_box = gtk.VBox(False, 12)
|
||||
self.task_status = gtk.Label("\n") # to ensure layout is correct
|
||||
self.task_status.set_alignment(0.0, 0.5)
|
||||
self.progress_box.pack_start(self.task_status, expand=False, fill=False)
|
||||
self.progress_hbox = gtk.HBox(False, 6)
|
||||
self.progress_box.pack_end(self.progress_hbox, expand=True, fill=True)
|
||||
self.progress_bar = HobProgressBar()
|
||||
self.progress_hbox.pack_start(self.progress_bar, expand=True, fill=True)
|
||||
self.stop_button = HobAltButton("Stop")
|
||||
self.stop_button.connect("clicked", self.stop_button_clicked_cb)
|
||||
self.stop_button.set_sensitive(False)
|
||||
self.progress_hbox.pack_end(self.stop_button, expand=False, fill=False)
|
||||
|
||||
self.notebook = HobNotebook()
|
||||
self.config_tv = BuildConfigurationTreeView()
|
||||
self.scrolled_view_config = gtk.ScrolledWindow ()
|
||||
self.scrolled_view_config.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
|
||||
self.scrolled_view_config.add(self.config_tv)
|
||||
self.notebook.append_page(self.scrolled_view_config, "Build configuration")
|
||||
|
||||
self.failure_tv = BuildFailureTreeView()
|
||||
self.failure_model = self.builder.handler.build.model.failure_model()
|
||||
self.failure_tv.set_model(self.failure_model)
|
||||
self.scrolled_view_failure = gtk.ScrolledWindow ()
|
||||
self.scrolled_view_failure.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
|
||||
self.scrolled_view_failure.add(self.failure_tv)
|
||||
self.notebook.append_page(self.scrolled_view_failure, "Issues")
|
||||
|
||||
self.build_tv = RunningBuildTreeView(readonly=True, hob=True)
|
||||
self.build_tv.set_model(self.builder.handler.build.model)
|
||||
self.scrolled_view_build = gtk.ScrolledWindow ()
|
||||
self.scrolled_view_build.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
|
||||
self.scrolled_view_build.add(self.build_tv)
|
||||
self.notebook.append_page(self.scrolled_view_build, "Log")
|
||||
|
||||
self.builder.handler.build.model.connect_after("row-changed", self.scroll_to_present_row, self.scrolled_view_build.get_vadjustment(), self.build_tv)
|
||||
|
||||
self.button_box = gtk.HBox(False, 6)
|
||||
self.back_button = HobAltButton('<< Back')
|
||||
self.back_button.connect("clicked", self.back_button_clicked_cb)
|
||||
self.button_box.pack_start(self.back_button, expand=False, fill=False)
|
||||
|
||||
def update_build_status(self, current, total, task):
|
||||
recipe_path, recipe_task = task.split(", ")
|
||||
recipe = os.path.basename(recipe_path).rstrip(".bb")
|
||||
tsk_msg = "<b>Running task %s of %s:</b> %s\n<b>Recipe:</b> %s" % (current, total, recipe_task, recipe)
|
||||
self.task_status.set_markup(tsk_msg)
|
||||
self.stop_button.set_sensitive(True)
|
||||
|
||||
def reset_build_status(self):
|
||||
self.task_status.set_markup("\n") # to ensure layout is correct
|
||||
self.endpath = (0,)
|
||||
|
||||
def show_issues(self):
|
||||
self.num_of_issues += 1
|
||||
self.notebook.show_indicator_icon("Issues", self.num_of_issues)
|
||||
|
||||
def reset_issues(self):
|
||||
self.num_of_issues = 0
|
||||
self.notebook.hide_indicator_icon("Issues")
|
||||
|
||||
def _remove_all_widget(self):
|
||||
children = self.vbox.get_children() or []
|
||||
for child in children:
|
||||
self.vbox.remove(child)
|
||||
children = self.box_group_area.get_children() or []
|
||||
for child in children:
|
||||
self.box_group_area.remove(child)
|
||||
children = self.get_children() or []
|
||||
for child in children:
|
||||
self.remove(child)
|
||||
|
||||
def add_build_fail_top_bar(self, actions, log_file=None):
|
||||
primary_action = "Edit %s" % actions
|
||||
|
||||
color = HobColors.ERROR
|
||||
build_fail_top = gtk.EventBox()
|
||||
#build_fail_top.set_size_request(-1, 200)
|
||||
build_fail_top.modify_bg(gtk.STATE_NORMAL, gtk.gdk.color_parse(color))
|
||||
|
||||
build_fail_tab = gtk.Table(14, 46, True)
|
||||
build_fail_top.add(build_fail_tab)
|
||||
|
||||
icon = gtk.Image()
|
||||
icon_pix_buffer = gtk.gdk.pixbuf_new_from_file(hic.ICON_INDI_ERROR_FILE)
|
||||
icon.set_from_pixbuf(icon_pix_buffer)
|
||||
build_fail_tab.attach(icon, 1, 4, 0, 6)
|
||||
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
label.set_markup("<span size='x-large'><b>%s</b></span>" % self.title)
|
||||
build_fail_tab.attach(label, 4, 26, 0, 6)
|
||||
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
# Ensure variable disk_full is defined
|
||||
try:
|
||||
self.builder.disk_full
|
||||
except NameError:
|
||||
self.builder.disk_full = False
|
||||
if self.builder.disk_full:
|
||||
markup = "<span size='medium'>There is no disk space left, so Hob cannot finish building your image. Free up some disk space\n"
|
||||
markup += "and restart the build. Check the \"Issues\" tab for more details</span>"
|
||||
label.set_markup(markup)
|
||||
else:
|
||||
label.set_markup("<span size='medium'>Check the \"Issues\" information for more details</span>")
|
||||
build_fail_tab.attach(label, 4, 40, 4, 9)
|
||||
|
||||
# create button 'Edit packages'
|
||||
action_button = HobButton(primary_action)
|
||||
#action_button.set_size_request(-1, 40)
|
||||
action_button.set_tooltip_text("Edit the %s parameters" % actions)
|
||||
action_button.connect('clicked', self.failure_primary_action_button_clicked_cb, primary_action)
|
||||
|
||||
if log_file:
|
||||
open_log_button = HobAltButton("Open log")
|
||||
open_log_button.set_relief(gtk.RELIEF_HALF)
|
||||
open_log_button.set_tooltip_text("Open the build's log file")
|
||||
open_log_button.connect('clicked', self.open_log_button_clicked_cb, log_file)
|
||||
|
||||
attach_pos = (24 if log_file else 14)
|
||||
file_bug_button = HobAltButton('File a bug')
|
||||
file_bug_button.set_relief(gtk.RELIEF_HALF)
|
||||
file_bug_button.set_tooltip_text("Open the Yocto Project bug tracking website")
|
||||
file_bug_button.connect('clicked', self.failure_activate_file_bug_link_cb)
|
||||
|
||||
if not self.builder.disk_full:
|
||||
build_fail_tab.attach(action_button, 4, 13, 9, 12)
|
||||
if log_file:
|
||||
build_fail_tab.attach(open_log_button, 14, 23, 9, 12)
|
||||
build_fail_tab.attach(file_bug_button, attach_pos, attach_pos + 9, 9, 12)
|
||||
|
||||
else:
|
||||
restart_build = HobButton("Restart the build")
|
||||
restart_build.set_tooltip_text("Restart the build")
|
||||
restart_build.connect('clicked', self.restart_build_button_clicked_cb)
|
||||
|
||||
build_fail_tab.attach(restart_build, 4, 13, 9, 12)
|
||||
build_fail_tab.attach(action_button, 14, 23, 9, 12)
|
||||
if log_file:
|
||||
build_fail_tab.attach(open_log_button, attach_pos, attach_pos + 9, 9, 12)
|
||||
|
||||
self.builder.disk_full = False
|
||||
return build_fail_top
|
||||
|
||||
def show_fail_page(self, title):
|
||||
self._remove_all_widget()
|
||||
self.title = "Hob cannot build your %s" % title
|
||||
|
||||
self.build_fail_bar = self.add_build_fail_top_bar(title, self.builder.current_logfile)
|
||||
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
self.box_group_area.pack_start(self.build_fail_bar, expand=False, fill=False)
|
||||
self.box_group_area.pack_start(self.vbox, expand=True, fill=True)
|
||||
|
||||
self.vbox.pack_start(self.notebook, expand=True, fill=True)
|
||||
self.show_all()
|
||||
self.notebook.set_page("Issues")
|
||||
self.back_button.hide()
|
||||
|
||||
def add_build_stop_top_bar(self, action, log_file=None):
|
||||
color = HobColors.LIGHT_GRAY
|
||||
build_stop_top = gtk.EventBox()
|
||||
#build_stop_top.set_size_request(-1, 200)
|
||||
build_stop_top.modify_bg(gtk.STATE_NORMAL, gtk.gdk.color_parse(color))
|
||||
build_stop_top.set_flags(gtk.CAN_DEFAULT)
|
||||
build_stop_top.grab_default()
|
||||
|
||||
build_stop_tab = gtk.Table(11, 46, True)
|
||||
build_stop_top.add(build_stop_tab)
|
||||
|
||||
icon = gtk.Image()
|
||||
icon_pix_buffer = gtk.gdk.pixbuf_new_from_file(hic.ICON_INFO_HOVER_FILE)
|
||||
icon.set_from_pixbuf(icon_pix_buffer)
|
||||
build_stop_tab.attach(icon, 1, 4, 0, 6)
|
||||
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
label.set_markup("<span size='x-large'><b>%s</b></span>" % self.title)
|
||||
build_stop_tab.attach(label, 4, 26, 0, 6)
|
||||
|
||||
action_button = HobButton("Edit %s" % action)
|
||||
action_button.set_size_request(-1, 40)
|
||||
if action == "image":
|
||||
action_button.set_tooltip_text("Edit the image parameters")
|
||||
elif action == "recipes":
|
||||
action_button.set_tooltip_text("Edit the included recipes")
|
||||
elif action == "packages":
|
||||
action_button.set_tooltip_text("Edit the included packages")
|
||||
action_button.connect('clicked', self.stop_primary_action_button_clicked_cb, action)
|
||||
build_stop_tab.attach(action_button, 4, 13, 6, 9)
|
||||
|
||||
if log_file:
|
||||
open_log_button = HobAltButton("Open log")
|
||||
open_log_button.set_relief(gtk.RELIEF_HALF)
|
||||
open_log_button.set_tooltip_text("Open the build's log file")
|
||||
open_log_button.connect('clicked', self.open_log_button_clicked_cb, log_file)
|
||||
build_stop_tab.attach(open_log_button, 14, 23, 6, 9)
|
||||
|
||||
attach_pos = (24 if log_file else 14)
|
||||
build_button = HobAltButton("Build new image")
|
||||
#build_button.set_size_request(-1, 40)
|
||||
build_button.set_tooltip_text("Create a new image from scratch")
|
||||
build_button.connect('clicked', self.new_image_button_clicked_cb)
|
||||
build_stop_tab.attach(build_button, attach_pos, attach_pos + 9, 6, 9)
|
||||
|
||||
return build_stop_top, action_button
|
||||
|
||||
def show_stop_page(self, action):
|
||||
self._remove_all_widget()
|
||||
self.title = "Build stopped"
|
||||
self.build_stop_bar, action_button = self.add_build_stop_top_bar(action, self.builder.current_logfile)
|
||||
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
self.box_group_area.pack_start(self.build_stop_bar, expand=False, fill=False)
|
||||
self.box_group_area.pack_start(self.vbox, expand=True, fill=True)
|
||||
|
||||
self.vbox.pack_start(self.notebook, expand=True, fill=True)
|
||||
self.show_all()
|
||||
self.back_button.hide()
|
||||
return action_button
|
||||
|
||||
def show_page(self, step):
|
||||
self._remove_all_widget()
|
||||
if step == self.builder.PACKAGE_GENERATING or step == self.builder.FAST_IMAGE_GENERATING:
|
||||
self.title = "Building packages ..."
|
||||
else:
|
||||
self.title = "Building image ..."
|
||||
self.build_details_top = self.add_onto_top_bar(None)
|
||||
self.pack_start(self.build_details_top, expand=False, fill=False)
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
|
||||
self.box_group_area.pack_start(self.vbox, expand=True, fill=True)
|
||||
|
||||
self.progress_bar.reset()
|
||||
self.config_tv.reset()
|
||||
self.vbox.pack_start(self.progress_box, expand=False, fill=False)
|
||||
|
||||
self.vbox.pack_start(self.notebook, expand=True, fill=True)
|
||||
|
||||
self.box_group_area.pack_end(self.button_box, expand=False, fill=False)
|
||||
self.show_all()
|
||||
self.notebook.set_page("Log")
|
||||
self.back_button.hide()
|
||||
|
||||
self.reset_build_status()
|
||||
self.reset_issues()
|
||||
|
||||
def update_progress_bar(self, title, fraction, status=None):
|
||||
self.progress_bar.update(fraction)
|
||||
self.progress_bar.set_title(title)
|
||||
self.progress_bar.set_rcstyle(status)
|
||||
|
||||
def back_button_clicked_cb(self, button):
|
||||
self.builder.show_configuration()
|
||||
|
||||
def new_image_button_clicked_cb(self, button):
|
||||
self.builder.reset()
|
||||
|
||||
def show_back_button(self):
|
||||
self.back_button.show()
|
||||
|
||||
def stop_button_clicked_cb(self, button):
|
||||
self.builder.stop_build()
|
||||
|
||||
def hide_stop_button(self):
|
||||
self.stop_button.set_sensitive(False)
|
||||
self.stop_button.hide()
|
||||
|
||||
def scroll_to_present_row(self, model, path, iter, v_adj, treeview):
|
||||
if treeview and v_adj:
|
||||
if path[0] > self.endpath[0]: # check the event is a new row append or not
|
||||
self.endpath = path
|
||||
# check the gtk.adjustment position is at end boundary or not
|
||||
if (v_adj.upper <= v_adj.page_size) or (v_adj.value == v_adj.upper - v_adj.page_size):
|
||||
treeview.scroll_to_cell(path)
|
||||
|
||||
def show_configurations(self, configurations, params):
|
||||
self.config_tv.show(configurations, params)
|
||||
|
||||
def failure_primary_action_button_clicked_cb(self, button, action):
|
||||
if "Edit recipes" in action:
|
||||
self.builder.show_recipes()
|
||||
elif "Edit packages" in action:
|
||||
self.builder.show_packages()
|
||||
elif "Edit image" in action:
|
||||
self.builder.show_configuration()
|
||||
|
||||
def restart_build_button_clicked_cb(self, button):
|
||||
self.builder.just_bake()
|
||||
|
||||
def stop_primary_action_button_clicked_cb(self, button, action):
|
||||
if "recipes" in action:
|
||||
self.builder.show_recipes()
|
||||
elif "packages" in action:
|
||||
self.builder.show_packages(ask=False)
|
||||
elif "image" in action:
|
||||
self.builder.show_configuration()
|
||||
|
||||
def open_log_button_clicked_cb(self, button, log_file):
|
||||
if log_file:
|
||||
self.stop = False
|
||||
dialog = OpeningLogDialog(title = "Opening Log",
|
||||
parent = None,
|
||||
flags = gtk.DIALOG_MODAL
|
||||
| gtk.DIALOG_DESTROY_WITH_PARENT
|
||||
| gtk.DIALOG_NO_SEPARATOR)
|
||||
#create a thread to open log file
|
||||
background = OpeningLogThread(dialog, log_file, self)
|
||||
background.start()
|
||||
response = dialog.run()
|
||||
self.stop = True
|
||||
background.join()
|
||||
|
||||
def failure_activate_file_bug_link_cb(self, button):
|
||||
button.child.emit('activate-link', "http://bugzilla.yoctoproject.org")
|
||||
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
@@ -1,37 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
class HobColors:
|
||||
WHITE = "#ffffff"
|
||||
PALE_GREEN = "#aaffaa"
|
||||
ORANGE = "#eb8e68"
|
||||
PALE_RED = "#ffaaaa"
|
||||
GRAY = "#aaaaaa"
|
||||
LIGHT_GRAY = "#dddddd"
|
||||
SLIGHT_DARK = "#5f5f5f"
|
||||
DARK = "#3c3b37"
|
||||
BLACK = "#000000"
|
||||
PALE_BLUE = "#53b8ff"
|
||||
DEEP_RED = "#aa3e3e"
|
||||
|
||||
OK = WHITE
|
||||
RUNNING = PALE_GREEN
|
||||
WARNING = ORANGE
|
||||
ERROR = PALE_RED
|
||||
@@ -4,7 +4,6 @@
|
||||
# Copyright (C) 2011 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
@@ -20,8 +19,9 @@
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gobject
|
||||
import logging
|
||||
from bb.ui.crumbs.runningbuild import RunningBuild
|
||||
from bb.ui.crumbs.progress import ProgressBar
|
||||
|
||||
progress_total = 0
|
||||
|
||||
class HobHandler(gobject.GObject):
|
||||
|
||||
@@ -29,524 +29,109 @@ class HobHandler(gobject.GObject):
|
||||
This object does BitBake event handling for the hob gui.
|
||||
"""
|
||||
__gsignals__ = {
|
||||
"package-formats-updated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,)),
|
||||
"config-updated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_STRING, gobject.TYPE_PYOBJECT,)),
|
||||
"command-succeeded" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_INT,)),
|
||||
"command-failed" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_STRING,)),
|
||||
"sanity-failed" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_STRING, gobject.TYPE_INT)),
|
||||
"generating-data" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
"data-generated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
"parsing-started" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,)),
|
||||
"parsing" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,)),
|
||||
"parsing-completed" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,)),
|
||||
"recipe-populated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
"package-populated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
"network-passed" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
"network-failed" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
"machines-updated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,)),
|
||||
"distros-updated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,)),
|
||||
"generating-data" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
"data-generated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
())
|
||||
}
|
||||
|
||||
(GENERATE_CONFIGURATION, GENERATE_RECIPES, GENERATE_PACKAGES, GENERATE_IMAGE, POPULATE_PACKAGEINFO, SANITY_CHECK, NETWORK_TEST) = range(7)
|
||||
(SUB_PATH_LAYERS, SUB_FILES_DISTRO, SUB_FILES_MACH, SUB_FILES_SDKMACH, SUB_MATCH_CLASS, SUB_PARSE_CONFIG, SUB_SANITY_CHECK,
|
||||
SUB_GNERATE_TGTS, SUB_GENERATE_PKGINFO, SUB_BUILD_RECIPES, SUB_BUILD_IMAGE, SUB_NETWORK_TEST) = range(12)
|
||||
|
||||
def __init__(self, server, recipe_model, package_model):
|
||||
super(HobHandler, self).__init__()
|
||||
|
||||
self.build = RunningBuild(sequential=True)
|
||||
|
||||
self.recipe_model = recipe_model
|
||||
self.package_model = package_model
|
||||
|
||||
self.commands_async = []
|
||||
self.generating = False
|
||||
self.current_phase = None
|
||||
self.building = False
|
||||
self.recipe_queue = []
|
||||
self.package_queue = []
|
||||
def __init__(self, taskmodel, server):
|
||||
gobject.GObject.__init__(self)
|
||||
|
||||
self.model = taskmodel
|
||||
self.server = server
|
||||
self.error_msg = ""
|
||||
self.initcmd = None
|
||||
self.current_command = None
|
||||
self.building = False
|
||||
|
||||
def set_busy(self):
|
||||
if not self.generating:
|
||||
self.emit("generating-data")
|
||||
self.generating = True
|
||||
self.command_map = {
|
||||
"findConfigFilesDistro" : ("findConfigFiles", "MACHINE", "findConfigFilesMachine"),
|
||||
"findConfigFilesMachine" : ("generateTargetsTree", "classes/image.bbclass", None),
|
||||
"generateTargetsTree" : (None, None, None),
|
||||
}
|
||||
|
||||
def clear_busy(self):
|
||||
if self.generating:
|
||||
self.emit("data-generated")
|
||||
self.generating = False
|
||||
def run_next_command(self):
|
||||
# FIXME: this is ugly and I *will* replace it
|
||||
if self.current_command:
|
||||
next_cmd = self.command_map[self.current_command]
|
||||
command = next_cmd[0]
|
||||
argument = next_cmd[1]
|
||||
self.current_command = next_cmd[2]
|
||||
if command == "generateTargetsTree":
|
||||
self.emit("generating-data")
|
||||
self.server.runCommand([command, argument])
|
||||
|
||||
def runCommand(self, commandline):
|
||||
try:
|
||||
result, error = self.server.runCommand(commandline)
|
||||
if error:
|
||||
raise Exception("Error running command '%s': %s" % (commandline, error))
|
||||
return result
|
||||
except Exception as e:
|
||||
self.commands_async = []
|
||||
self.clear_busy()
|
||||
self.emit("command-failed", "Hob Exception - %s" % (str(e)))
|
||||
return None
|
||||
|
||||
def run_next_command(self, initcmd=None):
|
||||
if initcmd != None:
|
||||
self.initcmd = initcmd
|
||||
|
||||
if self.commands_async:
|
||||
self.set_busy()
|
||||
next_command = self.commands_async.pop(0)
|
||||
else:
|
||||
self.clear_busy()
|
||||
if self.initcmd != None:
|
||||
self.emit("command-succeeded", self.initcmd)
|
||||
return
|
||||
|
||||
if next_command == self.SUB_PATH_LAYERS:
|
||||
self.runCommand(["findConfigFilePath", "bblayers.conf"])
|
||||
elif next_command == self.SUB_FILES_DISTRO:
|
||||
self.runCommand(["findConfigFiles", "DISTRO"])
|
||||
elif next_command == self.SUB_FILES_MACH:
|
||||
self.runCommand(["findConfigFiles", "MACHINE"])
|
||||
elif next_command == self.SUB_FILES_SDKMACH:
|
||||
self.runCommand(["findConfigFiles", "MACHINE-SDK"])
|
||||
elif next_command == self.SUB_MATCH_CLASS:
|
||||
self.runCommand(["findFilesMatchingInDir", "rootfs_", "classes"])
|
||||
elif next_command == self.SUB_PARSE_CONFIG:
|
||||
self.runCommand(["parseConfigurationFiles", "", ""])
|
||||
elif next_command == self.SUB_GNERATE_TGTS:
|
||||
self.runCommand(["generateTargetsTree", "classes/image.bbclass", []])
|
||||
elif next_command == self.SUB_GENERATE_PKGINFO:
|
||||
self.runCommand(["triggerEvent", "bb.event.RequestPackageInfo()"])
|
||||
elif next_command == self.SUB_SANITY_CHECK:
|
||||
self.runCommand(["triggerEvent", "bb.event.SanityCheck()"])
|
||||
elif next_command == self.SUB_NETWORK_TEST:
|
||||
self.runCommand(["triggerEvent", "bb.event.NetworkTest()"])
|
||||
elif next_command == self.SUB_BUILD_RECIPES:
|
||||
self.clear_busy()
|
||||
self.building = True
|
||||
self.runCommand(["buildTargets", self.recipe_queue, self.default_task])
|
||||
self.recipe_queue = []
|
||||
elif next_command == self.SUB_BUILD_IMAGE:
|
||||
self.clear_busy()
|
||||
self.building = True
|
||||
targets = [self.image]
|
||||
if self.package_queue:
|
||||
self.runCommand(["setVariable", "LINGUAS_INSTALL", ""])
|
||||
self.runCommand(["setVariable", "PACKAGE_INSTALL", " ".join(self.package_queue)])
|
||||
if self.toolchain_packages:
|
||||
self.runCommand(["setVariable", "TOOLCHAIN_TARGET_TASK", " ".join(self.toolchain_packages)])
|
||||
targets.append(self.toolchain)
|
||||
self.runCommand(["buildTargets", targets, self.default_task])
|
||||
|
||||
def display_error(self):
|
||||
self.clear_busy()
|
||||
self.emit("command-failed", self.error_msg)
|
||||
self.error_msg = ""
|
||||
if self.building:
|
||||
self.building = False
|
||||
|
||||
def handle_event(self, event):
|
||||
def handle_event(self, event, running_build, pbar=None):
|
||||
if not event:
|
||||
return
|
||||
return
|
||||
|
||||
# If we're running a build, use the RunningBuild event handler
|
||||
if self.building:
|
||||
self.current_phase = "building"
|
||||
self.build.handle_event(event)
|
||||
|
||||
if isinstance(event, bb.event.PackageInfo):
|
||||
self.package_model.populate(event._pkginfolist)
|
||||
self.emit("package-populated")
|
||||
self.run_next_command()
|
||||
|
||||
elif isinstance(event, bb.event.SanityCheckPassed):
|
||||
self.run_next_command()
|
||||
|
||||
elif isinstance(event, bb.event.SanityCheckFailed):
|
||||
self.emit("sanity-failed", event._msg, event._network_error)
|
||||
|
||||
elif isinstance(event, logging.LogRecord):
|
||||
if not self.building:
|
||||
if event.levelno >= logging.ERROR:
|
||||
formatter = bb.msg.BBLogFormatter()
|
||||
msg = formatter.format(event)
|
||||
self.error_msg += msg + '\n'
|
||||
|
||||
running_build.handle_event(event)
|
||||
elif isinstance(event, bb.event.TargetsTreeGenerated):
|
||||
self.current_phase = "data generation"
|
||||
self.emit("data-generated")
|
||||
if event._model:
|
||||
self.recipe_model.populate(event._model)
|
||||
self.emit("recipe-populated")
|
||||
self.model.populate(event._model)
|
||||
|
||||
elif isinstance(event, bb.event.ConfigFilesFound):
|
||||
self.current_phase = "configuration lookup"
|
||||
var = event._variable
|
||||
values = event._values
|
||||
values.sort()
|
||||
self.emit("config-updated", var, values)
|
||||
elif isinstance(event, bb.event.ConfigFilePathFound):
|
||||
self.current_phase = "configuration lookup"
|
||||
elif isinstance(event, bb.event.FilesMatchingFound):
|
||||
self.current_phase = "configuration lookup"
|
||||
# FIXME: hard coding, should at least be a variable shared between
|
||||
# here and the caller
|
||||
if event._pattern == "rootfs_":
|
||||
formats = []
|
||||
for match in event._matches:
|
||||
classname, sep, cls = match.rpartition(".")
|
||||
fs, sep, format = classname.rpartition("_")
|
||||
formats.append(format)
|
||||
formats.sort()
|
||||
self.emit("package-formats-updated", formats)
|
||||
if var == "distro":
|
||||
distros = event._values
|
||||
distros.sort()
|
||||
self.emit("distros-updated", distros)
|
||||
elif var == "machine":
|
||||
machines = event._values
|
||||
machines.sort()
|
||||
self.emit("machines-updated", machines)
|
||||
|
||||
elif isinstance(event, bb.command.CommandCompleted):
|
||||
self.current_phase = None
|
||||
self.run_next_command()
|
||||
elif isinstance(event, bb.command.CommandFailed):
|
||||
self.commands_async = []
|
||||
self.display_error()
|
||||
elif isinstance(event, (bb.event.ParseStarted,
|
||||
bb.event.CacheLoadStarted,
|
||||
bb.event.TreeDataPreparationStarted,
|
||||
)):
|
||||
message = {}
|
||||
message["eventname"] = bb.event.getName(event)
|
||||
message["current"] = 0
|
||||
message["total"] = None
|
||||
message["title"] = "Parsing recipes"
|
||||
self.emit("parsing-started", message)
|
||||
elif isinstance(event, (bb.event.ParseProgress,
|
||||
bb.event.CacheLoadProgress,
|
||||
bb.event.TreeDataPreparationProgress)):
|
||||
message = {}
|
||||
message["eventname"] = bb.event.getName(event)
|
||||
message["current"] = event.current
|
||||
message["total"] = event.total
|
||||
message["title"] = "Parsing recipes"
|
||||
self.emit("parsing", message)
|
||||
elif isinstance(event, (bb.event.ParseCompleted,
|
||||
bb.event.CacheLoadCompleted,
|
||||
bb.event.TreeDataPreparationCompleted)):
|
||||
message = {}
|
||||
message["eventname"] = bb.event.getName(event)
|
||||
message["current"] = event.total
|
||||
message["total"] = event.total
|
||||
message["title"] = "Parsing recipes"
|
||||
self.emit("parsing-completed", message)
|
||||
elif isinstance(event, bb.event.NetworkTestFailed):
|
||||
self.emit("network-failed")
|
||||
self.run_next_command()
|
||||
elif isinstance(event, bb.event.NetworkTestPassed):
|
||||
self.emit("network-passed")
|
||||
self.run_next_command()
|
||||
|
||||
if self.error_msg and not self.commands_async:
|
||||
self.display_error()
|
||||
|
||||
elif isinstance(event, bb.event.CacheLoadStarted) and pbar:
|
||||
pbar.set_title("Loading cache")
|
||||
bb.ui.crumbs.hobeventhandler.progress_total = event.total
|
||||
pbar.update(0, bb.ui.crumbs.hobeventhandler.progress_total)
|
||||
elif isinstance(event, bb.event.CacheLoadProgress) and pbar:
|
||||
pbar.update(event.current, bb.ui.crumbs.hobeventhandler.progress_total)
|
||||
elif isinstance(event, bb.event.CacheLoadCompleted) and pbar:
|
||||
pbar.update(bb.ui.crumbs.hobeventhandler.progress_total, bb.ui.crumbs.hobeventhandler.progress_total)
|
||||
elif isinstance(event, bb.event.ParseStarted) and pbar:
|
||||
pbar.set_title("Processing recipes")
|
||||
bb.ui.crumbs.hobeventhandler.progress_total = event.total
|
||||
pbar.update(0, bb.ui.crumbs.hobeventhandler.progress_total)
|
||||
elif isinstance(event, bb.event.ParseProgress) and pbar:
|
||||
pbar.update(event.current, bb.ui.crumbs.hobeventhandler.progress_total)
|
||||
elif isinstance(event, bb.event.ParseCompleted) and pbar:
|
||||
pbar.hide()
|
||||
|
||||
return
|
||||
|
||||
def init_cooker(self):
|
||||
self.runCommand(["initCooker"])
|
||||
|
||||
def set_extra_inherit(self, bbclass):
|
||||
inherits = self.runCommand(["getVariable", "INHERIT"]) or ""
|
||||
inherits = inherits + " " + bbclass
|
||||
self.runCommand(["setVariable", "INHERIT", inherits])
|
||||
|
||||
def set_bblayers(self, bblayers):
|
||||
self.runCommand(["setVariable", "BBLAYERS_HOB", " ".join(bblayers)])
|
||||
def event_handle_idle_func (self, eventHandler, running_build, pbar):
|
||||
# Consume as many messages as we can in the time available to us
|
||||
event = eventHandler.getEvent()
|
||||
while event:
|
||||
self.handle_event(event, running_build, pbar)
|
||||
event = eventHandler.getEvent()
|
||||
return True
|
||||
|
||||
def set_machine(self, machine):
|
||||
if machine:
|
||||
self.runCommand(["setVariable", "MACHINE_HOB", machine])
|
||||
|
||||
def set_sdk_machine(self, sdk_machine):
|
||||
self.runCommand(["setVariable", "SDKMACHINE_HOB", sdk_machine])
|
||||
|
||||
def set_image_fstypes(self, image_fstypes):
|
||||
self.runCommand(["setVariable", "IMAGE_FSTYPES", image_fstypes])
|
||||
self.server.runCommand(["setVariable", "MACHINE", machine])
|
||||
self.current_command = "findConfigFilesMachine"
|
||||
self.run_next_command()
|
||||
|
||||
def set_distro(self, distro):
|
||||
self.runCommand(["setVariable", "DISTRO_HOB", distro])
|
||||
self.server.runCommand(["setVariable", "DISTRO", distro])
|
||||
|
||||
def set_package_format(self, format):
|
||||
package_classes = ""
|
||||
for pkgfmt in format.split():
|
||||
package_classes += ("package_%s" % pkgfmt + " ")
|
||||
self.runCommand(["setVariable", "PACKAGE_CLASSES_HOB", package_classes])
|
||||
def run_build(self, targets):
|
||||
self.building = True
|
||||
self.server.runCommand(["buildTargets", targets, "build"])
|
||||
|
||||
def set_bbthreads(self, threads):
|
||||
self.runCommand(["setVariable", "BB_NUMBER_THREADS_HOB", threads])
|
||||
|
||||
def set_pmake(self, threads):
|
||||
pmake = "-j %s" % threads
|
||||
self.runCommand(["setVariable", "PARALLEL_MAKE_HOB", pmake])
|
||||
|
||||
def set_dl_dir(self, directory):
|
||||
self.runCommand(["setVariable", "DL_DIR_HOB", directory])
|
||||
|
||||
def set_sstate_dir(self, directory):
|
||||
self.runCommand(["setVariable", "SSTATE_DIR_HOB", directory])
|
||||
|
||||
def set_sstate_mirrors(self, url):
|
||||
self.runCommand(["setVariable", "SSTATE_MIRRORS_HOB", url])
|
||||
|
||||
def set_extra_size(self, image_extra_size):
|
||||
self.runCommand(["setVariable", "IMAGE_ROOTFS_EXTRA_SPACE", str(image_extra_size)])
|
||||
|
||||
def set_rootfs_size(self, image_rootfs_size):
|
||||
self.runCommand(["setVariable", "IMAGE_ROOTFS_SIZE", str(image_rootfs_size)])
|
||||
|
||||
def set_incompatible_license(self, incompat_license):
|
||||
self.runCommand(["setVariable", "INCOMPATIBLE_LICENSE_HOB", incompat_license])
|
||||
|
||||
def set_extra_config(self, extra_setting):
|
||||
for key in extra_setting.keys():
|
||||
value = extra_setting[key]
|
||||
self.runCommand(["setVariable", key, value])
|
||||
|
||||
def set_config_filter(self, config_filter):
|
||||
self.runCommand(["setConfFilter", config_filter])
|
||||
|
||||
def set_http_proxy(self, http_proxy):
|
||||
self.runCommand(["setVariable", "http_proxy", http_proxy])
|
||||
|
||||
def set_https_proxy(self, https_proxy):
|
||||
self.runCommand(["setVariable", "https_proxy", https_proxy])
|
||||
|
||||
def set_ftp_proxy(self, ftp_proxy):
|
||||
self.runCommand(["setVariable", "ftp_proxy", ftp_proxy])
|
||||
|
||||
def set_git_proxy(self, host, port):
|
||||
self.runCommand(["setVariable", "GIT_PROXY_HOST", host])
|
||||
self.runCommand(["setVariable", "GIT_PROXY_PORT", port])
|
||||
|
||||
def set_cvs_proxy(self, host, port):
|
||||
self.runCommand(["setVariable", "CVS_PROXY_HOST", host])
|
||||
self.runCommand(["setVariable", "CVS_PROXY_PORT", port])
|
||||
|
||||
def request_package_info(self):
|
||||
self.commands_async.append(self.SUB_GENERATE_PKGINFO)
|
||||
self.run_next_command(self.POPULATE_PACKAGEINFO)
|
||||
|
||||
def trigger_sanity_check(self):
|
||||
self.commands_async.append(self.SUB_SANITY_CHECK)
|
||||
self.run_next_command(self.SANITY_CHECK)
|
||||
|
||||
def trigger_network_test(self):
|
||||
self.commands_async.append(self.SUB_NETWORK_TEST)
|
||||
self.run_next_command(self.NETWORK_TEST)
|
||||
|
||||
def generate_configuration(self):
|
||||
self.commands_async.append(self.SUB_PARSE_CONFIG)
|
||||
self.commands_async.append(self.SUB_PATH_LAYERS)
|
||||
self.commands_async.append(self.SUB_FILES_DISTRO)
|
||||
self.commands_async.append(self.SUB_FILES_MACH)
|
||||
self.commands_async.append(self.SUB_FILES_SDKMACH)
|
||||
self.commands_async.append(self.SUB_MATCH_CLASS)
|
||||
self.run_next_command(self.GENERATE_CONFIGURATION)
|
||||
|
||||
def generate_recipes(self):
|
||||
self.commands_async.append(self.SUB_PARSE_CONFIG)
|
||||
self.commands_async.append(self.SUB_GNERATE_TGTS)
|
||||
self.run_next_command(self.GENERATE_RECIPES)
|
||||
|
||||
def generate_packages(self, tgts, default_task="build"):
|
||||
targets = []
|
||||
targets.extend(tgts)
|
||||
self.recipe_queue = targets
|
||||
self.default_task = default_task
|
||||
self.commands_async.append(self.SUB_PARSE_CONFIG)
|
||||
self.commands_async.append(self.SUB_BUILD_RECIPES)
|
||||
self.run_next_command(self.GENERATE_PACKAGES)
|
||||
|
||||
def generate_image(self, image, toolchain, image_packages=[], toolchain_packages=[], default_task="build"):
|
||||
self.image = image
|
||||
self.toolchain = toolchain
|
||||
self.package_queue = image_packages
|
||||
self.toolchain_packages = toolchain_packages
|
||||
self.default_task = default_task
|
||||
self.commands_async.append(self.SUB_PARSE_CONFIG)
|
||||
self.commands_async.append(self.SUB_BUILD_IMAGE)
|
||||
self.run_next_command(self.GENERATE_IMAGE)
|
||||
|
||||
def build_succeeded_async(self):
|
||||
self.building = False
|
||||
|
||||
def build_failed_async(self):
|
||||
self.initcmd = None
|
||||
self.commands_async = []
|
||||
self.building = False
|
||||
|
||||
def cancel_parse(self):
|
||||
self.runCommand(["stateStop"])
|
||||
|
||||
def cancel_build(self, force=False):
|
||||
if force:
|
||||
# Force the cooker to stop as quickly as possible
|
||||
self.runCommand(["stateStop"])
|
||||
else:
|
||||
# Wait for tasks to complete before shutting down, this helps
|
||||
# leave the workdir in a usable state
|
||||
self.runCommand(["stateShutdown"])
|
||||
|
||||
def reset_build(self):
|
||||
self.build.reset()
|
||||
|
||||
def get_logfile(self):
|
||||
return self.server.runCommand(["getVariable", "BB_CONSOLELOG"])[0]
|
||||
|
||||
def _remove_redundant(self, string):
|
||||
ret = []
|
||||
for i in string.split():
|
||||
if i not in ret:
|
||||
ret.append(i)
|
||||
return " ".join(ret)
|
||||
|
||||
def get_parameters(self):
|
||||
# retrieve the parameters from bitbake
|
||||
params = {}
|
||||
params["core_base"] = self.runCommand(["getVariable", "COREBASE"]) or ""
|
||||
hob_layer = params["core_base"] + "/meta-hob"
|
||||
params["layer"] = self.runCommand(["getVariable", "BBLAYERS"]) or ""
|
||||
params["layers_non_removable"] = self.runCommand(["getVariable", "BBLAYERS_NON_REMOVABLE"]) or ""
|
||||
if hob_layer not in params["layer"].split():
|
||||
params["layer"] += (" " + hob_layer)
|
||||
if hob_layer not in params["layers_non_removable"].split():
|
||||
params["layers_non_removable"] += (" " + hob_layer)
|
||||
params["dldir"] = self.runCommand(["getVariable", "DL_DIR"]) or ""
|
||||
params["machine"] = self.runCommand(["getVariable", "MACHINE"]) or ""
|
||||
params["distro"] = self.runCommand(["getVariable", "DISTRO"]) or "defaultsetup"
|
||||
params["pclass"] = self.runCommand(["getVariable", "PACKAGE_CLASSES"]) or ""
|
||||
params["sstatedir"] = self.runCommand(["getVariable", "SSTATE_DIR"]) or ""
|
||||
params["sstatemirror"] = self.runCommand(["getVariable", "SSTATE_MIRRORS"]) or ""
|
||||
|
||||
num_threads = self.runCommand(["getCpuCount"])
|
||||
if not num_threads:
|
||||
num_threads = 1
|
||||
max_threads = 65536
|
||||
else:
|
||||
try:
|
||||
num_threads = int(num_threads)
|
||||
max_threads = 16 * num_threads
|
||||
except:
|
||||
num_threads = 1
|
||||
max_threads = 65536
|
||||
params["max_threads"] = max_threads
|
||||
|
||||
bbthread = self.runCommand(["getVariable", "BB_NUMBER_THREADS"])
|
||||
if not bbthread:
|
||||
bbthread = num_threads
|
||||
else:
|
||||
try:
|
||||
bbthread = int(bbthread)
|
||||
except:
|
||||
bbthread = num_threads
|
||||
params["bbthread"] = bbthread
|
||||
|
||||
pmake = self.runCommand(["getVariable", "PARALLEL_MAKE"])
|
||||
if not pmake:
|
||||
pmake = num_threads
|
||||
elif isinstance(pmake, int):
|
||||
pass
|
||||
else:
|
||||
try:
|
||||
pmake = int(pmake.lstrip("-j "))
|
||||
except:
|
||||
pmake = num_threads
|
||||
params["pmake"] = "-j %s" % pmake
|
||||
|
||||
params["image_addr"] = self.runCommand(["getVariable", "DEPLOY_DIR_IMAGE"]) or ""
|
||||
|
||||
image_extra_size = self.runCommand(["getVariable", "IMAGE_ROOTFS_EXTRA_SPACE"])
|
||||
if not image_extra_size:
|
||||
image_extra_size = 0
|
||||
else:
|
||||
try:
|
||||
image_extra_size = int(image_extra_size)
|
||||
except:
|
||||
image_extra_size = 0
|
||||
params["image_extra_size"] = image_extra_size
|
||||
|
||||
image_rootfs_size = self.runCommand(["getVariable", "IMAGE_ROOTFS_SIZE"])
|
||||
if not image_rootfs_size:
|
||||
image_rootfs_size = 0
|
||||
else:
|
||||
try:
|
||||
image_rootfs_size = int(image_rootfs_size)
|
||||
except:
|
||||
image_rootfs_size = 0
|
||||
params["image_rootfs_size"] = image_rootfs_size
|
||||
|
||||
image_overhead_factor = self.runCommand(["getVariable", "IMAGE_OVERHEAD_FACTOR"])
|
||||
if not image_overhead_factor:
|
||||
image_overhead_factor = 1
|
||||
else:
|
||||
try:
|
||||
image_overhead_factor = float(image_overhead_factor)
|
||||
except:
|
||||
image_overhead_factor = 1
|
||||
params['image_overhead_factor'] = image_overhead_factor
|
||||
|
||||
params["incompat_license"] = self._remove_redundant(self.runCommand(["getVariable", "INCOMPATIBLE_LICENSE"]) or "")
|
||||
params["sdk_machine"] = self.runCommand(["getVariable", "SDKMACHINE"]) or self.runCommand(["getVariable", "SDK_ARCH"]) or ""
|
||||
|
||||
params["image_fstypes"] = self._remove_redundant(self.runCommand(["getVariable", "IMAGE_FSTYPES"]) or "")
|
||||
|
||||
params["image_types"] = self._remove_redundant(self.runCommand(["getVariable", "IMAGE_TYPES"]) or "")
|
||||
|
||||
params["conf_version"] = self.runCommand(["getVariable", "CONF_VERSION"]) or ""
|
||||
params["lconf_version"] = self.runCommand(["getVariable", "LCONF_VERSION"]) or ""
|
||||
|
||||
params["runnable_image_types"] = self._remove_redundant(self.runCommand(["getVariable", "RUNNABLE_IMAGE_TYPES"]) or "")
|
||||
params["runnable_machine_patterns"] = self._remove_redundant(self.runCommand(["getVariable", "RUNNABLE_MACHINE_PATTERNS"]) or "")
|
||||
params["deployable_image_types"] = self._remove_redundant(self.runCommand(["getVariable", "DEPLOYABLE_IMAGE_TYPES"]) or "")
|
||||
params["kernel_image_type"] = self.runCommand(["getVariable", "KERNEL_IMAGETYPE"]) or ""
|
||||
params["tmpdir"] = self.runCommand(["getVariable", "TMPDIR"]) or ""
|
||||
params["distro_version"] = self.runCommand(["getVariable", "DISTRO_VERSION"]) or ""
|
||||
params["target_os"] = self.runCommand(["getVariable", "TARGET_OS"]) or ""
|
||||
params["target_arch"] = self.runCommand(["getVariable", "TARGET_ARCH"]) or ""
|
||||
params["tune_pkgarch"] = self.runCommand(["getVariable", "TUNE_PKGARCH"]) or ""
|
||||
params["bb_version"] = self.runCommand(["getVariable", "BB_MIN_VERSION"]) or ""
|
||||
|
||||
params["default_task"] = self.runCommand(["getVariable", "BB_DEFAULT_TASK"]) or "build"
|
||||
|
||||
params["git_proxy_host"] = self.runCommand(["getVariable", "GIT_PROXY_HOST"]) or ""
|
||||
params["git_proxy_port"] = self.runCommand(["getVariable", "GIT_PROXY_PORT"]) or ""
|
||||
|
||||
params["http_proxy"] = self.runCommand(["getVariable", "http_proxy"]) or ""
|
||||
params["ftp_proxy"] = self.runCommand(["getVariable", "ftp_proxy"]) or ""
|
||||
params["https_proxy"] = self.runCommand(["getVariable", "https_proxy"]) or ""
|
||||
|
||||
params["cvs_proxy_host"] = self.runCommand(["getVariable", "CVS_PROXY_HOST"]) or ""
|
||||
params["cvs_proxy_port"] = self.runCommand(["getVariable", "CVS_PROXY_PORT"]) or ""
|
||||
|
||||
params["image_white_pattern"] = self.runCommand(["getVariable", "BBUI_IMAGE_WHITE_PATTERN"]) or ""
|
||||
params["image_black_pattern"] = self.runCommand(["getVariable", "BBUI_IMAGE_BLACK_PATTERN"]) or ""
|
||||
return params
|
||||
def cancel_build(self):
|
||||
# Note: this may not be the right way to stop an in-progress build
|
||||
self.server.runCommand(["stateStop"])
|
||||
|
||||
@@ -1,768 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import gobject
|
||||
from bb.ui.crumbs.hobpages import HobPage
|
||||
|
||||
#
|
||||
# PackageListModel
|
||||
#
|
||||
class PackageListModel(gtk.TreeStore):
|
||||
"""
|
||||
This class defines an gtk.TreeStore subclass which will convert the output
|
||||
of the bb.event.TargetsTreeGenerated event into a gtk.TreeStore whilst also
|
||||
providing convenience functions to access gtk.TreeModel subclasses which
|
||||
provide filtered views of the data.
|
||||
"""
|
||||
(COL_NAME, COL_VER, COL_REV, COL_RNM, COL_SEC, COL_SUM, COL_RDEP, COL_RPROV, COL_SIZE, COL_BINB, COL_INC, COL_FADE_INC, COL_FONT) = range(13)
|
||||
|
||||
__gsignals__ = {
|
||||
"package-selection-changed" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
}
|
||||
|
||||
__toolchain_required_packages__ = ["packagegroup-core-standalone-sdk-target", "packagegroup-core-standalone-sdk-target-dbg"]
|
||||
|
||||
def __init__(self):
|
||||
|
||||
self.contents = None
|
||||
self.images = None
|
||||
self.pkgs_size = 0
|
||||
self.pn_path = {}
|
||||
self.pkg_path = {}
|
||||
self.rprov_pkg = {}
|
||||
|
||||
gtk.TreeStore.__init__ (self,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_BOOLEAN,
|
||||
gobject.TYPE_BOOLEAN,
|
||||
gobject.TYPE_STRING)
|
||||
|
||||
|
||||
"""
|
||||
Find the model path for the item_name
|
||||
Returns the path in the model or None
|
||||
"""
|
||||
def find_path_for_item(self, item_name):
|
||||
pkg = item_name
|
||||
if item_name not in self.pkg_path.keys():
|
||||
if item_name not in self.rprov_pkg.keys():
|
||||
return None
|
||||
pkg = self.rprov_pkg[item_name]
|
||||
if pkg not in self.pkg_path.keys():
|
||||
return None
|
||||
|
||||
return self.pkg_path[pkg]
|
||||
|
||||
def find_item_for_path(self, item_path):
|
||||
return self[item_path][self.COL_NAME]
|
||||
|
||||
"""
|
||||
Helper function to determine whether an item is an item specified by filter
|
||||
"""
|
||||
def tree_model_filter(self, model, it, filter):
|
||||
for key in filter.keys():
|
||||
if model.get_value(it, key) not in filter[key]:
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
"""
|
||||
Create, if required, and return a filtered gtk.TreeModelSort
|
||||
containing only the items specified by filter
|
||||
"""
|
||||
def tree_model(self, filter):
|
||||
model = self.filter_new()
|
||||
model.set_visible_func(self.tree_model_filter, filter)
|
||||
|
||||
sort = gtk.TreeModelSort(model)
|
||||
sort.set_sort_column_id(PackageListModel.COL_NAME, gtk.SORT_ASCENDING)
|
||||
sort.set_default_sort_func(None)
|
||||
return sort
|
||||
|
||||
def convert_vpath_to_path(self, view_model, view_path):
|
||||
# view_model is the model sorted
|
||||
# get the path of the model filtered
|
||||
filtered_model_path = view_model.convert_path_to_child_path(view_path)
|
||||
# get the model filtered
|
||||
filtered_model = view_model.get_model()
|
||||
# get the path of the original model
|
||||
path = filtered_model.convert_path_to_child_path(filtered_model_path)
|
||||
return path
|
||||
|
||||
def convert_path_to_vpath(self, view_model, path):
|
||||
name = self.find_item_for_path(path)
|
||||
it = view_model.get_iter_first()
|
||||
while it:
|
||||
child_it = view_model.iter_children(it)
|
||||
while child_it:
|
||||
view_name = view_model.get_value(child_it, self.COL_NAME)
|
||||
if view_name == name:
|
||||
view_path = view_model.get_path(child_it)
|
||||
return view_path
|
||||
child_it = view_model.iter_next(child_it)
|
||||
it = view_model.iter_next(it)
|
||||
return None
|
||||
|
||||
"""
|
||||
The populate() function takes as input the data from a
|
||||
bb.event.PackageInfo event and populates the package list.
|
||||
"""
|
||||
def populate(self, pkginfolist):
|
||||
self.clear()
|
||||
self.pkgs_size = 0
|
||||
self.pn_path = {}
|
||||
self.pkg_path = {}
|
||||
self.rprov_pkg = {}
|
||||
|
||||
def getpkgvalue(pkgdict, key, pkgname, defaultval = None):
|
||||
value = pkgdict.get('%s_%s' % (key, pkgname), None)
|
||||
if not value:
|
||||
value = pkgdict.get(key, defaultval)
|
||||
return value
|
||||
|
||||
for pkginfo in pkginfolist:
|
||||
pn = pkginfo['PN']
|
||||
pv = pkginfo['PV']
|
||||
pr = pkginfo['PR']
|
||||
if pn in self.pn_path.keys():
|
||||
pniter = self.get_iter(self.pn_path[pn])
|
||||
else:
|
||||
pniter = self.append(None)
|
||||
self.set(pniter, self.COL_NAME, pn + '-' + pv + '-' + pr,
|
||||
self.COL_INC, False)
|
||||
self.pn_path[pn] = self.get_path(pniter)
|
||||
|
||||
# PKG is always present
|
||||
pkg = pkginfo['PKG']
|
||||
pkgv = getpkgvalue(pkginfo, 'PKGV', pkg)
|
||||
pkgr = getpkgvalue(pkginfo, 'PKGR', pkg)
|
||||
# PKGSIZE is artificial, will always be overridden with the package name if present
|
||||
pkgsize = pkginfo.get('PKGSIZE_%s' % pkg, "0")
|
||||
# PKG_%s is the renamed version
|
||||
pkg_rename = pkginfo.get('PKG_%s' % pkg, "")
|
||||
# The rest may be overridden or not
|
||||
section = getpkgvalue(pkginfo, 'SECTION', pkg, "")
|
||||
summary = getpkgvalue(pkginfo, 'SUMMARY', pkg, "")
|
||||
rdep = getpkgvalue(pkginfo, 'RDEPENDS', pkg, "")
|
||||
rrec = getpkgvalue(pkginfo, 'RRECOMMENDS', pkg, "")
|
||||
rprov = getpkgvalue(pkginfo, 'RPROVIDES', pkg, "")
|
||||
for i in rprov.split():
|
||||
self.rprov_pkg[i] = pkg
|
||||
|
||||
allow_empty = getpkgvalue(pkginfo, 'ALLOW_EMPTY', pkg, "")
|
||||
|
||||
if pkgsize == "0" and not allow_empty:
|
||||
continue
|
||||
|
||||
# pkgsize is in KB
|
||||
size = HobPage._size_to_string(HobPage._string_to_size(pkgsize + ' KB'))
|
||||
|
||||
it = self.append(pniter)
|
||||
self.pkg_path[pkg] = self.get_path(it)
|
||||
self.set(it, self.COL_NAME, pkg, self.COL_VER, pkgv,
|
||||
self.COL_REV, pkgr, self.COL_RNM, pkg_rename,
|
||||
self.COL_SEC, section, self.COL_SUM, summary,
|
||||
self.COL_RDEP, rdep + ' ' + rrec,
|
||||
self.COL_RPROV, rprov, self.COL_SIZE, size,
|
||||
self.COL_BINB, "", self.COL_INC, False, self.COL_FONT, '10')
|
||||
|
||||
"""
|
||||
Check whether the item at item_path is included or not
|
||||
"""
|
||||
def path_included(self, item_path):
|
||||
return self[item_path][self.COL_INC]
|
||||
|
||||
"""
|
||||
Update the model, send out the notification.
|
||||
"""
|
||||
def selection_change_notification(self):
|
||||
self.emit("package-selection-changed")
|
||||
|
||||
"""
|
||||
Mark a certain package as selected.
|
||||
All its dependencies are marked as selected.
|
||||
The recipe provides the package is marked as selected.
|
||||
If user explicitly selects a recipe, all its providing packages are selected
|
||||
"""
|
||||
def include_item(self, item_path, binb=""):
|
||||
if self.path_included(item_path):
|
||||
return
|
||||
|
||||
item_name = self[item_path][self.COL_NAME]
|
||||
item_rdep = self[item_path][self.COL_RDEP]
|
||||
|
||||
self[item_path][self.COL_INC] = True
|
||||
|
||||
it = self.get_iter(item_path)
|
||||
|
||||
# If user explicitly selects a recipe, all its providing packages are selected.
|
||||
if not self[item_path][self.COL_VER] and binb == "User Selected":
|
||||
child_it = self.iter_children(it)
|
||||
while child_it:
|
||||
child_path = self.get_path(child_it)
|
||||
child_included = self.path_included(child_path)
|
||||
if not child_included:
|
||||
self.include_item(child_path, binb="User Selected")
|
||||
child_it = self.iter_next(child_it)
|
||||
return
|
||||
|
||||
# The recipe provides the package is also marked as selected
|
||||
parent_it = self.iter_parent(it)
|
||||
if parent_it:
|
||||
parent_path = self.get_path(parent_it)
|
||||
self[parent_path][self.COL_INC] = True
|
||||
|
||||
item_bin = self[item_path][self.COL_BINB].split(', ')
|
||||
if binb and not binb in item_bin:
|
||||
item_bin.append(binb)
|
||||
self[item_path][self.COL_BINB] = ', '.join(item_bin).lstrip(', ')
|
||||
|
||||
if item_rdep:
|
||||
# Ensure all of the items deps are included and, where appropriate,
|
||||
# add this item to their COL_BINB
|
||||
for dep in item_rdep.split(" "):
|
||||
if dep.startswith('('):
|
||||
continue
|
||||
# If the contents model doesn't already contain dep, add it
|
||||
dep_path = self.find_path_for_item(dep)
|
||||
if not dep_path:
|
||||
continue
|
||||
dep_included = self.path_included(dep_path)
|
||||
|
||||
if dep_included and not dep in item_bin:
|
||||
# don't set the COL_BINB to this item if the target is an
|
||||
# item in our own COL_BINB
|
||||
dep_bin = self[dep_path][self.COL_BINB].split(', ')
|
||||
if not item_name in dep_bin:
|
||||
dep_bin.append(item_name)
|
||||
self[dep_path][self.COL_BINB] = ', '.join(dep_bin).lstrip(', ')
|
||||
elif not dep_included:
|
||||
self.include_item(dep_path, binb=item_name)
|
||||
|
||||
"""
|
||||
Mark a certain package as de-selected.
|
||||
All other packages that depends on this package are marked as de-selected.
|
||||
If none of the packages provided by the recipe, the recipe should be marked as de-selected.
|
||||
If user explicitly de-select a recipe, all its providing packages are de-selected.
|
||||
"""
|
||||
def exclude_item(self, item_path):
|
||||
if not self.path_included(item_path):
|
||||
return
|
||||
|
||||
self[item_path][self.COL_INC] = False
|
||||
|
||||
item_name = self[item_path][self.COL_NAME]
|
||||
item_rdep = self[item_path][self.COL_RDEP]
|
||||
it = self.get_iter(item_path)
|
||||
|
||||
# If user explicitly de-select a recipe, all its providing packages are de-selected.
|
||||
if not self[item_path][self.COL_VER]:
|
||||
child_it = self.iter_children(it)
|
||||
while child_it:
|
||||
child_path = self.get_path(child_it)
|
||||
child_included = self[child_path][self.COL_INC]
|
||||
if child_included:
|
||||
self.exclude_item(child_path)
|
||||
child_it = self.iter_next(child_it)
|
||||
return
|
||||
|
||||
# If none of the packages provided by the recipe, the recipe should be marked as de-selected.
|
||||
parent_it = self.iter_parent(it)
|
||||
peer_iter = self.iter_children(parent_it)
|
||||
enabled = 0
|
||||
while peer_iter:
|
||||
peer_path = self.get_path(peer_iter)
|
||||
if self[peer_path][self.COL_INC]:
|
||||
enabled = 1
|
||||
break
|
||||
peer_iter = self.iter_next(peer_iter)
|
||||
if not enabled:
|
||||
parent_path = self.get_path(parent_it)
|
||||
self[parent_path][self.COL_INC] = False
|
||||
|
||||
# All packages that depends on this package are de-selected.
|
||||
if item_rdep:
|
||||
for dep in item_rdep.split(" "):
|
||||
if dep.startswith('('):
|
||||
continue
|
||||
dep_path = self.find_path_for_item(dep)
|
||||
if not dep_path:
|
||||
continue
|
||||
dep_bin = self[dep_path][self.COL_BINB].split(', ')
|
||||
if item_name in dep_bin:
|
||||
dep_bin.remove(item_name)
|
||||
self[dep_path][self.COL_BINB] = ', '.join(dep_bin).lstrip(', ')
|
||||
|
||||
item_bin = self[item_path][self.COL_BINB].split(', ')
|
||||
if item_bin:
|
||||
for binb in item_bin:
|
||||
binb_path = self.find_path_for_item(binb)
|
||||
if not binb_path:
|
||||
continue
|
||||
self.exclude_item(binb_path)
|
||||
|
||||
"""
|
||||
Package model may be incomplete, therefore when calling the
|
||||
set_selected_packages(), some packages will not be set included.
|
||||
Return the un-set packages list.
|
||||
"""
|
||||
def set_selected_packages(self, packagelist, user_selected=False):
|
||||
left = []
|
||||
binb = 'User Selected' if user_selected else ''
|
||||
for pn in packagelist:
|
||||
if pn in self.pkg_path.keys():
|
||||
path = self.pkg_path[pn]
|
||||
self.include_item(item_path=path, binb=binb)
|
||||
else:
|
||||
left.append(pn)
|
||||
|
||||
self.selection_change_notification()
|
||||
return left
|
||||
|
||||
def get_user_selected_packages(self):
|
||||
packagelist = []
|
||||
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
child_it = self.iter_children(it)
|
||||
while child_it:
|
||||
if self.get_value(child_it, self.COL_INC):
|
||||
binb = self.get_value(child_it, self.COL_BINB)
|
||||
if binb == "User Selected":
|
||||
name = self.get_value(child_it, self.COL_NAME)
|
||||
packagelist.append(name)
|
||||
child_it = self.iter_next(child_it)
|
||||
it = self.iter_next(it)
|
||||
|
||||
return packagelist
|
||||
|
||||
def get_selected_packages(self):
|
||||
packagelist = []
|
||||
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
child_it = self.iter_children(it)
|
||||
while child_it:
|
||||
if self.get_value(child_it, self.COL_INC):
|
||||
name = self.get_value(child_it, self.COL_NAME)
|
||||
packagelist.append(name)
|
||||
child_it = self.iter_next(child_it)
|
||||
it = self.iter_next(it)
|
||||
|
||||
return packagelist
|
||||
|
||||
def get_selected_packages_toolchain(self):
|
||||
packagelist = []
|
||||
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
if self.get_value(it, self.COL_INC):
|
||||
child_it = self.iter_children(it)
|
||||
while child_it:
|
||||
name = self.get_value(child_it, self.COL_NAME)
|
||||
inc = self.get_value(child_it, self.COL_INC)
|
||||
if inc or name.endswith("-dev") or name.endswith("-dbg"):
|
||||
packagelist.append(name)
|
||||
child_it = self.iter_next(child_it)
|
||||
it = self.iter_next(it)
|
||||
|
||||
return list(set(packagelist + self.__toolchain_required_packages__));
|
||||
"""
|
||||
Return the selected package size, unit is B.
|
||||
"""
|
||||
def get_packages_size(self):
|
||||
packages_size = 0
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
child_it = self.iter_children(it)
|
||||
while child_it:
|
||||
if self.get_value(child_it, self.COL_INC):
|
||||
str_size = self.get_value(child_it, self.COL_SIZE)
|
||||
if not str_size:
|
||||
continue
|
||||
|
||||
packages_size += HobPage._string_to_size(str_size)
|
||||
|
||||
child_it = self.iter_next(child_it)
|
||||
it = self.iter_next(it)
|
||||
return packages_size
|
||||
|
||||
"""
|
||||
Empty self.contents by setting the include of each entry to None
|
||||
"""
|
||||
def reset(self):
|
||||
self.pkgs_size = 0
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
self.set(it, self.COL_INC, False)
|
||||
child_it = self.iter_children(it)
|
||||
while child_it:
|
||||
self.set(child_it,
|
||||
self.COL_INC, False,
|
||||
self.COL_BINB, "")
|
||||
child_it = self.iter_next(child_it)
|
||||
it = self.iter_next(it)
|
||||
|
||||
self.selection_change_notification()
|
||||
|
||||
"""
|
||||
Resync the state of included items to a backup column before performing the fadeout visible effect
|
||||
"""
|
||||
def resync_fadeout_column(self, model_first_iter=None):
|
||||
it = model_first_iter
|
||||
while it:
|
||||
active = self.get_value(it, self.COL_INC)
|
||||
self.set(it, self.COL_FADE_INC, active)
|
||||
if self.iter_has_child(it):
|
||||
self.resync_fadeout_column(self.iter_children(it))
|
||||
|
||||
it = self.iter_next(it)
|
||||
|
||||
#
|
||||
# RecipeListModel
|
||||
#
|
||||
class RecipeListModel(gtk.ListStore):
|
||||
"""
|
||||
This class defines an gtk.ListStore subclass which will convert the output
|
||||
of the bb.event.TargetsTreeGenerated event into a gtk.ListStore whilst also
|
||||
providing convenience functions to access gtk.TreeModel subclasses which
|
||||
provide filtered views of the data.
|
||||
"""
|
||||
(COL_NAME, COL_DESC, COL_LIC, COL_GROUP, COL_DEPS, COL_BINB, COL_TYPE, COL_INC, COL_IMG, COL_INSTALL, COL_PN, COL_FADE_INC) = range(12)
|
||||
|
||||
__custom_image__ = "Create your own image"
|
||||
|
||||
__gsignals__ = {
|
||||
"recipe-selection-changed" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
}
|
||||
|
||||
"""
|
||||
"""
|
||||
def __init__(self):
|
||||
gtk.ListStore.__init__ (self,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_BOOLEAN,
|
||||
gobject.TYPE_BOOLEAN,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_BOOLEAN)
|
||||
|
||||
"""
|
||||
Find the model path for the item_name
|
||||
Returns the path in the model or None
|
||||
"""
|
||||
def find_path_for_item(self, item_name):
|
||||
if self.non_target_name(item_name) or item_name not in self.pn_path.keys():
|
||||
return None
|
||||
else:
|
||||
return self.pn_path[item_name]
|
||||
|
||||
def find_item_for_path(self, item_path):
|
||||
return self[item_path][self.COL_NAME]
|
||||
|
||||
"""
|
||||
Helper method to determine whether name is a target pn
|
||||
"""
|
||||
def non_target_name(self, name):
|
||||
if name and ('-native' in name):
|
||||
return True
|
||||
return False
|
||||
|
||||
"""
|
||||
Helper function to determine whether an item is an item specified by filter
|
||||
"""
|
||||
def tree_model_filter(self, model, it, filter):
|
||||
name = model.get_value(it, self.COL_NAME)
|
||||
if self.non_target_name(name):
|
||||
return False
|
||||
|
||||
for key in filter.keys():
|
||||
if model.get_value(it, key) not in filter[key]:
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
def exclude_item_sort_func(self, model, iter1, iter2):
|
||||
val1 = model.get_value(iter1, RecipeListModel.COL_FADE_INC)
|
||||
val2 = model.get_value(iter2, RecipeListModel.COL_INC)
|
||||
return ((val1 == True) and (val2 == False))
|
||||
|
||||
def include_item_sort_func(self, model, iter1, iter2):
|
||||
val1 = model.get_value(iter1, RecipeListModel.COL_INC)
|
||||
val2 = model.get_value(iter2, RecipeListModel.COL_INC)
|
||||
return ((val1 == False) and (val2 == True))
|
||||
|
||||
"""
|
||||
Create, if required, and return a filtered gtk.TreeModelSort
|
||||
containing only the items which are items specified by filter
|
||||
"""
|
||||
def tree_model(self, filter, excluded_items_ahead=False, included_items_ahead=True):
|
||||
model = self.filter_new()
|
||||
model.set_visible_func(self.tree_model_filter, filter)
|
||||
|
||||
sort = gtk.TreeModelSort(model)
|
||||
if excluded_items_ahead:
|
||||
sort.set_default_sort_func(self.exclude_item_sort_func)
|
||||
elif included_items_ahead:
|
||||
sort.set_default_sort_func(self.include_item_sort_func)
|
||||
else:
|
||||
sort.set_sort_column_id(RecipeListModel.COL_NAME, gtk.SORT_ASCENDING)
|
||||
sort.set_default_sort_func(None)
|
||||
return sort
|
||||
|
||||
def convert_vpath_to_path(self, view_model, view_path):
|
||||
filtered_model_path = view_model.convert_path_to_child_path(view_path)
|
||||
filtered_model = view_model.get_model()
|
||||
|
||||
# get the path of the original model
|
||||
path = filtered_model.convert_path_to_child_path(filtered_model_path)
|
||||
return path
|
||||
|
||||
def convert_path_to_vpath(self, view_model, path):
|
||||
it = view_model.get_iter_first()
|
||||
while it:
|
||||
name = self.find_item_for_path(path)
|
||||
view_name = view_model.get_value(it, RecipeListModel.COL_NAME)
|
||||
if view_name == name:
|
||||
view_path = view_model.get_path(it)
|
||||
return view_path
|
||||
it = view_model.iter_next(it)
|
||||
return None
|
||||
|
||||
"""
|
||||
The populate() function takes as input the data from a
|
||||
bb.event.TargetsTreeGenerated event and populates the RecipeList.
|
||||
"""
|
||||
def populate(self, event_model):
|
||||
# First clear the model, in case repopulating
|
||||
self.clear()
|
||||
|
||||
# dummy image for prompt
|
||||
self.set(self.append(), self.COL_NAME, self.__custom_image__,
|
||||
self.COL_DESC, "Use 'Edit image' to customize recipes and packages " \
|
||||
"to be included in your image ",
|
||||
self.COL_LIC, "", self.COL_GROUP, "",
|
||||
self.COL_DEPS, "", self.COL_BINB, "",
|
||||
self.COL_TYPE, "image", self.COL_INC, False,
|
||||
self.COL_IMG, False, self.COL_INSTALL, "", self.COL_PN, self.__custom_image__)
|
||||
|
||||
for item in event_model["pn"]:
|
||||
name = item
|
||||
desc = event_model["pn"][item]["description"]
|
||||
lic = event_model["pn"][item]["license"]
|
||||
group = event_model["pn"][item]["section"]
|
||||
inherits = event_model["pn"][item]["inherits"]
|
||||
install = []
|
||||
|
||||
depends = event_model["depends"].get(item, []) + event_model["rdepends-pn"].get(item, [])
|
||||
|
||||
if ('packagegroup.bbclass' in " ".join(inherits)):
|
||||
atype = 'packagegroup'
|
||||
elif ('image.bbclass' in " ".join(inherits)):
|
||||
if name != "hob-image":
|
||||
atype = 'image'
|
||||
install = event_model["rdepends-pkg"].get(item, []) + event_model["rrecs-pkg"].get(item, [])
|
||||
elif ('meta-' in name):
|
||||
atype = 'toolchain'
|
||||
elif (name == 'dummy-image' or name == 'dummy-toolchain'):
|
||||
atype = 'dummy'
|
||||
else:
|
||||
atype = 'recipe'
|
||||
|
||||
self.set(self.append(), self.COL_NAME, item, self.COL_DESC, desc,
|
||||
self.COL_LIC, lic, self.COL_GROUP, group,
|
||||
self.COL_DEPS, " ".join(depends), self.COL_BINB, "",
|
||||
self.COL_TYPE, atype, self.COL_INC, False,
|
||||
self.COL_IMG, False, self.COL_INSTALL, " ".join(install), self.COL_PN, item)
|
||||
|
||||
self.pn_path = {}
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
pn = self.get_value(it, self.COL_NAME)
|
||||
path = self.get_path(it)
|
||||
self.pn_path[pn] = path
|
||||
it = self.iter_next(it)
|
||||
|
||||
"""
|
||||
Update the model, send out the notification.
|
||||
"""
|
||||
def selection_change_notification(self):
|
||||
self.emit("recipe-selection-changed")
|
||||
|
||||
def path_included(self, item_path):
|
||||
return self[item_path][self.COL_INC]
|
||||
|
||||
"""
|
||||
Add this item, and any of its dependencies, to the image contents
|
||||
"""
|
||||
def include_item(self, item_path, binb="", image_contents=False):
|
||||
if self.path_included(item_path):
|
||||
return
|
||||
|
||||
item_name = self[item_path][self.COL_NAME]
|
||||
item_deps = self[item_path][self.COL_DEPS]
|
||||
|
||||
self[item_path][self.COL_INC] = True
|
||||
|
||||
item_bin = self[item_path][self.COL_BINB].split(', ')
|
||||
if binb and not binb in item_bin:
|
||||
item_bin.append(binb)
|
||||
self[item_path][self.COL_BINB] = ', '.join(item_bin).lstrip(', ')
|
||||
|
||||
# We want to do some magic with things which are brought in by the
|
||||
# base image so tag them as so
|
||||
if image_contents:
|
||||
self[item_path][self.COL_IMG] = True
|
||||
|
||||
if item_deps:
|
||||
# Ensure all of the items deps are included and, where appropriate,
|
||||
# add this item to their COL_BINB
|
||||
for dep in item_deps.split(" "):
|
||||
# If the contents model doesn't already contain dep, add it
|
||||
dep_path = self.find_path_for_item(dep)
|
||||
if not dep_path:
|
||||
continue
|
||||
dep_included = self.path_included(dep_path)
|
||||
|
||||
if dep_included and not dep in item_bin:
|
||||
# don't set the COL_BINB to this item if the target is an
|
||||
# item in our own COL_BINB
|
||||
dep_bin = self[dep_path][self.COL_BINB].split(', ')
|
||||
if not item_name in dep_bin:
|
||||
dep_bin.append(item_name)
|
||||
self[dep_path][self.COL_BINB] = ', '.join(dep_bin).lstrip(', ')
|
||||
elif not dep_included:
|
||||
self.include_item(dep_path, binb=item_name, image_contents=image_contents)
|
||||
dep_bin = self[item_path][self.COL_BINB].split(', ')
|
||||
if self[item_path][self.COL_NAME] in dep_bin:
|
||||
dep_bin.remove(self[item_path][self.COL_NAME])
|
||||
self[item_path][self.COL_BINB] = ', '.join(dep_bin).lstrip(', ')
|
||||
|
||||
def exclude_item(self, item_path):
|
||||
if not self.path_included(item_path):
|
||||
return
|
||||
|
||||
self[item_path][self.COL_INC] = False
|
||||
|
||||
item_name = self[item_path][self.COL_NAME]
|
||||
item_deps = self[item_path][self.COL_DEPS]
|
||||
if item_deps:
|
||||
for dep in item_deps.split(" "):
|
||||
dep_path = self.find_path_for_item(dep)
|
||||
if not dep_path:
|
||||
continue
|
||||
dep_bin = self[dep_path][self.COL_BINB].split(', ')
|
||||
if item_name in dep_bin:
|
||||
dep_bin.remove(item_name)
|
||||
self[dep_path][self.COL_BINB] = ', '.join(dep_bin).lstrip(', ')
|
||||
|
||||
item_bin = self[item_path][self.COL_BINB].split(', ')
|
||||
if item_bin:
|
||||
for binb in item_bin:
|
||||
binb_path = self.find_path_for_item(binb)
|
||||
if not binb_path:
|
||||
continue
|
||||
self.exclude_item(binb_path)
|
||||
|
||||
def reset(self):
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
self.set(it,
|
||||
self.COL_INC, False,
|
||||
self.COL_BINB, "",
|
||||
self.COL_IMG, False)
|
||||
it = self.iter_next(it)
|
||||
|
||||
self.selection_change_notification()
|
||||
|
||||
"""
|
||||
Returns two lists. One of user selected recipes and the other containing
|
||||
all selected recipes
|
||||
"""
|
||||
def get_selected_recipes(self):
|
||||
allrecipes = []
|
||||
userrecipes = []
|
||||
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
if self.get_value(it, self.COL_INC):
|
||||
name = self.get_value(it, self.COL_PN)
|
||||
type = self.get_value(it, self.COL_TYPE)
|
||||
if type != "image":
|
||||
allrecipes.append(name)
|
||||
sel = "User Selected" in self.get_value(it, self.COL_BINB)
|
||||
if sel:
|
||||
userrecipes.append(name)
|
||||
it = self.iter_next(it)
|
||||
|
||||
return list(set(userrecipes)), list(set(allrecipes))
|
||||
|
||||
def set_selected_recipes(self, recipelist):
|
||||
for pn in recipelist:
|
||||
if pn in self.pn_path.keys():
|
||||
path = self.pn_path[pn]
|
||||
self.include_item(item_path=path,
|
||||
binb="User Selected")
|
||||
self.selection_change_notification()
|
||||
|
||||
def get_selected_image(self):
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
if self.get_value(it, self.COL_INC):
|
||||
name = self.get_value(it, self.COL_PN)
|
||||
type = self.get_value(it, self.COL_TYPE)
|
||||
if type == "image":
|
||||
sel = "User Selected" in self.get_value(it, self.COL_BINB)
|
||||
if sel:
|
||||
return name
|
||||
it = self.iter_next(it)
|
||||
return None
|
||||
|
||||
def set_selected_image(self, img):
|
||||
if not img:
|
||||
return
|
||||
self.reset()
|
||||
path = self.find_path_for_item(img)
|
||||
self.include_item(item_path=path,
|
||||
binb="User Selected",
|
||||
image_contents=True)
|
||||
self.selection_change_notification()
|
||||
@@ -1,128 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
from bb.ui.crumbs.hobwidget import hwc
|
||||
|
||||
#
|
||||
# HobPage: the super class for all Hob-related pages
|
||||
#
|
||||
class HobPage (gtk.VBox):
|
||||
|
||||
def __init__(self, builder, title = None):
|
||||
super(HobPage, self).__init__(False, 0)
|
||||
self.builder = builder
|
||||
self.builder_width, self.builder_height = self.builder.size_request()
|
||||
|
||||
if not title:
|
||||
self.title = "Hob -- Image Creator"
|
||||
else:
|
||||
self.title = title
|
||||
self.title_label = gtk.Label()
|
||||
|
||||
self.box_group_area = gtk.VBox(False, 12)
|
||||
self.box_group_area.set_size_request(self.builder_width - 73 - 73, self.builder_height - 88 - 15 - 15)
|
||||
self.group_align = gtk.Alignment(xalign = 0, yalign=0.5, xscale=1, yscale=1)
|
||||
self.group_align.set_padding(15, 15, 73, 73)
|
||||
self.group_align.add(self.box_group_area)
|
||||
self.box_group_area.set_homogeneous(False)
|
||||
|
||||
def set_title(self, title):
|
||||
self.title = title
|
||||
self.title_label.set_markup("<span size='x-large'>%s</span>" % self.title)
|
||||
|
||||
def add_onto_top_bar(self, widget = None, padding = 0):
|
||||
# the top button occupies 1/7 of the page height
|
||||
# setup an event box
|
||||
eventbox = gtk.EventBox()
|
||||
style = eventbox.get_style().copy()
|
||||
style.bg[gtk.STATE_NORMAL] = eventbox.get_colormap().alloc_color(HobColors.LIGHT_GRAY, False, False)
|
||||
eventbox.set_style(style)
|
||||
eventbox.set_size_request(-1, 88)
|
||||
|
||||
hbox = gtk.HBox()
|
||||
|
||||
self.title_label = gtk.Label()
|
||||
self.title_label.set_markup("<span size='x-large'>%s</span>" % self.title)
|
||||
hbox.pack_start(self.title_label, expand=False, fill=False, padding=20)
|
||||
|
||||
if widget:
|
||||
# add the widget in the event box
|
||||
hbox.pack_end(widget, expand=False, fill=False, padding=padding)
|
||||
eventbox.add(hbox)
|
||||
|
||||
return eventbox
|
||||
|
||||
def span_tag(self, size="medium", weight="normal", forground="#1c1c1c"):
|
||||
span_tag = "weight='%s' foreground='%s' size='%s'" % (weight, forground, size)
|
||||
return span_tag
|
||||
|
||||
def append_toolbar_button(self, toolbar, buttonname, icon_disp, icon_hovor, tip, cb):
|
||||
# Create a button and append it on the toolbar according to button name
|
||||
icon = gtk.Image()
|
||||
icon_display = icon_disp
|
||||
icon_hover = icon_hovor
|
||||
pix_buffer = gtk.gdk.pixbuf_new_from_file(icon_display)
|
||||
icon.set_from_pixbuf(pix_buffer)
|
||||
tip_text = tip
|
||||
button = toolbar.append_item(buttonname, tip, None, icon, cb)
|
||||
return button
|
||||
|
||||
@staticmethod
|
||||
def _size_to_string(size):
|
||||
try:
|
||||
if not size:
|
||||
size_str = "0 B"
|
||||
else:
|
||||
if len(str(int(size))) > 6:
|
||||
size_str = '%.1f' % (size*1.0/(1024*1024)) + ' MB'
|
||||
elif len(str(int(size))) > 3:
|
||||
size_str = '%.1f' % (size*1.0/1024) + ' KB'
|
||||
else:
|
||||
size_str = str(size) + ' B'
|
||||
except:
|
||||
size_str = "0 B"
|
||||
return size_str
|
||||
|
||||
@staticmethod
|
||||
def _string_to_size(str_size):
|
||||
try:
|
||||
if not str_size:
|
||||
size = 0
|
||||
else:
|
||||
unit = str_size.split()
|
||||
if len(unit) > 1:
|
||||
if unit[1] == 'MB':
|
||||
size = float(unit[0])*1024*1024
|
||||
elif unit[1] == 'KB':
|
||||
size = float(unit[0])*1024
|
||||
elif unit[1] == 'B':
|
||||
size = float(unit[0])
|
||||
else:
|
||||
size = 0
|
||||
else:
|
||||
size = float(unit[0])
|
||||
except:
|
||||
size = 0
|
||||
return size
|
||||
|
||||
@@ -1,51 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Cristiana Voicu <cristiana.voicu@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import threading
|
||||
import gtk
|
||||
import subprocess
|
||||
|
||||
#
|
||||
# OpeningLogThread
|
||||
#
|
||||
class OpeningLogThread(threading.Thread):
|
||||
def __init__(self, dialog, log_file, parent):
|
||||
threading.Thread.__init__(self)
|
||||
self.dialog =dialog
|
||||
self.log_file = log_file
|
||||
self.parent = parent
|
||||
|
||||
def run(self):
|
||||
p = subprocess.Popen(['xdg-open',self.log_file])
|
||||
retcode = p.poll()
|
||||
while (retcode == None):
|
||||
if self.parent.stop:
|
||||
try:
|
||||
p.terminate()
|
||||
except OSError, e:
|
||||
if e.errno == 3:
|
||||
pass # no such process
|
||||
else:
|
||||
raise
|
||||
retcode = p.poll()
|
||||
|
||||
self.dialog.destroy()
|
||||
|
||||
@@ -1,845 +0,0 @@
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2012 Intel Corporation
|
||||
#
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
import gtk
|
||||
import gobject
|
||||
import os
|
||||
import os.path
|
||||
import sys
|
||||
import pango, pangocairo
|
||||
import cairo
|
||||
import math
|
||||
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
from bb.ui.crumbs.persistenttooltip import PersistentTooltip
|
||||
|
||||
class hwc:
|
||||
|
||||
MAIN_WIN_WIDTH = 1024
|
||||
MAIN_WIN_HEIGHT = 700
|
||||
|
||||
class hic:
|
||||
|
||||
HOB_ICON_BASE_DIR = os.path.join(os.path.dirname(os.path.dirname(os.path.dirname(__file__))), ("ui/icons/"))
|
||||
|
||||
ICON_RCIPE_DISPLAY_FILE = os.path.join(HOB_ICON_BASE_DIR, ('recipe/recipe_display.png'))
|
||||
ICON_RCIPE_HOVER_FILE = os.path.join(HOB_ICON_BASE_DIR, ('recipe/recipe_hover.png'))
|
||||
ICON_PACKAGES_DISPLAY_FILE = os.path.join(HOB_ICON_BASE_DIR, ('packages/packages_display.png'))
|
||||
ICON_PACKAGES_HOVER_FILE = os.path.join(HOB_ICON_BASE_DIR, ('packages/packages_hover.png'))
|
||||
ICON_LAYERS_DISPLAY_FILE = os.path.join(HOB_ICON_BASE_DIR, ('layers/layers_display.png'))
|
||||
ICON_LAYERS_HOVER_FILE = os.path.join(HOB_ICON_BASE_DIR, ('layers/layers_hover.png'))
|
||||
ICON_TEMPLATES_DISPLAY_FILE = os.path.join(HOB_ICON_BASE_DIR, ('templates/templates_display.png'))
|
||||
ICON_TEMPLATES_HOVER_FILE = os.path.join(HOB_ICON_BASE_DIR, ('templates/templates_hover.png'))
|
||||
ICON_IMAGES_DISPLAY_FILE = os.path.join(HOB_ICON_BASE_DIR, ('images/images_display.png'))
|
||||
ICON_IMAGES_HOVER_FILE = os.path.join(HOB_ICON_BASE_DIR, ('images/images_hover.png'))
|
||||
ICON_SETTINGS_DISPLAY_FILE = os.path.join(HOB_ICON_BASE_DIR, ('settings/settings_display.png'))
|
||||
ICON_SETTINGS_HOVER_FILE = os.path.join(HOB_ICON_BASE_DIR, ('settings/settings_hover.png'))
|
||||
ICON_INFO_DISPLAY_FILE = os.path.join(HOB_ICON_BASE_DIR, ('info/info_display.png'))
|
||||
ICON_INFO_HOVER_FILE = os.path.join(HOB_ICON_BASE_DIR, ('info/info_hover.png'))
|
||||
ICON_INDI_CONFIRM_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/confirmation.png'))
|
||||
ICON_INDI_ERROR_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/denied.png'))
|
||||
ICON_INDI_REMOVE_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/remove.png'))
|
||||
ICON_INDI_REMOVE_HOVER_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/remove-hover.png'))
|
||||
ICON_INDI_ADD_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/add.png'))
|
||||
ICON_INDI_ADD_HOVER_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/add-hover.png'))
|
||||
ICON_INDI_REFRESH_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/refresh.png'))
|
||||
ICON_INDI_ALERT_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/alert.png'))
|
||||
ICON_INDI_TICK_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/tick.png'))
|
||||
ICON_INDI_INFO_FILE = os.path.join(HOB_ICON_BASE_DIR, ('indicators/info.png'))
|
||||
|
||||
class HobViewTable (gtk.VBox):
|
||||
"""
|
||||
A VBox to contain the table for different recipe views and package view
|
||||
"""
|
||||
__gsignals__ = {
|
||||
"toggled" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_INT,
|
||||
gobject.TYPE_PYOBJECT,)),
|
||||
"row-activated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,
|
||||
gobject.TYPE_PYOBJECT,)),
|
||||
"cell-fadeinout-stopped" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,
|
||||
gobject.TYPE_PYOBJECT,
|
||||
gobject.TYPE_PYOBJECT,)),
|
||||
}
|
||||
|
||||
def __init__(self, columns):
|
||||
gtk.VBox.__init__(self, False, 6)
|
||||
self.table_tree = gtk.TreeView()
|
||||
self.table_tree.set_headers_visible(True)
|
||||
self.table_tree.set_headers_clickable(True)
|
||||
self.table_tree.set_enable_search(True)
|
||||
self.table_tree.set_rules_hint(True)
|
||||
self.table_tree.set_enable_tree_lines(True)
|
||||
self.table_tree.get_selection().set_mode(gtk.SELECTION_SINGLE)
|
||||
self.toggle_columns = []
|
||||
self.table_tree.connect("row-activated", self.row_activated_cb)
|
||||
|
||||
for i, column in enumerate(columns):
|
||||
col = gtk.TreeViewColumn(column['col_name'])
|
||||
col.set_clickable(True)
|
||||
col.set_resizable(True)
|
||||
col.set_sort_column_id(column['col_id'])
|
||||
if 'col_min' in column.keys():
|
||||
col.set_min_width(column['col_min'])
|
||||
if 'col_max' in column.keys():
|
||||
col.set_max_width(column['col_max'])
|
||||
if 'expand' in column.keys():
|
||||
col.set_expand(True)
|
||||
self.table_tree.append_column(col)
|
||||
|
||||
if (not 'col_style' in column.keys()) or column['col_style'] == 'text':
|
||||
cell = gtk.CellRendererText()
|
||||
col.pack_start(cell, True)
|
||||
col.set_attributes(cell, text=column['col_id'])
|
||||
if 'col_t_id' in column.keys():
|
||||
col.add_attribute(cell, 'font', column['col_t_id'])
|
||||
elif column['col_style'] == 'check toggle':
|
||||
cell = HobCellRendererToggle()
|
||||
cell.set_property('activatable', True)
|
||||
cell.connect("toggled", self.toggled_cb, i, self.table_tree)
|
||||
cell.connect_render_state_changed(self.stop_cell_fadeinout_cb, self.table_tree)
|
||||
self.toggle_id = i
|
||||
col.pack_end(cell, True)
|
||||
col.set_attributes(cell, active=column['col_id'])
|
||||
self.toggle_columns.append(column['col_name'])
|
||||
if 'col_group' in column.keys():
|
||||
col.set_cell_data_func(cell, self.set_group_number_cb)
|
||||
elif column['col_style'] == 'radio toggle':
|
||||
cell = gtk.CellRendererToggle()
|
||||
cell.set_property('activatable', True)
|
||||
cell.set_radio(True)
|
||||
cell.connect("toggled", self.toggled_cb, i, self.table_tree)
|
||||
self.toggle_id = i
|
||||
col.pack_end(cell, True)
|
||||
col.set_attributes(cell, active=column['col_id'])
|
||||
self.toggle_columns.append(column['col_name'])
|
||||
elif column['col_style'] == 'binb':
|
||||
cell = gtk.CellRendererText()
|
||||
col.pack_start(cell, True)
|
||||
col.set_cell_data_func(cell, self.display_binb_cb, column['col_id'])
|
||||
if 'col_t_id' in column.keys():
|
||||
col.add_attribute(cell, 'font', column['col_t_id'])
|
||||
|
||||
scroll = gtk.ScrolledWindow()
|
||||
scroll.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
|
||||
scroll.add(self.table_tree)
|
||||
self.pack_start(scroll, True, True, 0)
|
||||
|
||||
def display_binb_cb(self, col, cell, model, it, col_id):
|
||||
binb = model.get_value(it, col_id)
|
||||
# Just display the first item
|
||||
if binb:
|
||||
bin = binb.split(', ')
|
||||
total_no = len(bin)
|
||||
if total_no > 1 and bin[0] == "User Selected":
|
||||
if total_no > 2:
|
||||
present_binb = bin[1] + ' (+' + str(total_no - 1) + ')'
|
||||
else:
|
||||
present_binb = bin[1]
|
||||
else:
|
||||
if total_no > 1:
|
||||
present_binb = bin[0] + ' (+' + str(total_no - 1) + ')'
|
||||
else:
|
||||
present_binb = bin[0]
|
||||
cell.set_property('text', present_binb)
|
||||
else:
|
||||
cell.set_property('text', "")
|
||||
return True
|
||||
|
||||
def set_model(self, tree_model):
|
||||
self.table_tree.set_model(tree_model)
|
||||
|
||||
def set_search_entry(self, search_column_id, entry):
|
||||
self.table_tree.set_search_column(search_column_id)
|
||||
self.table_tree.set_search_entry(entry)
|
||||
|
||||
def toggle_default(self):
|
||||
model = self.table_tree.get_model()
|
||||
if not model:
|
||||
return
|
||||
iter = model.get_iter_first()
|
||||
if iter:
|
||||
rowpath = model.get_path(iter)
|
||||
model[rowpath][self.toggle_id] = True
|
||||
|
||||
def toggled_cb(self, cell, path, columnid, tree):
|
||||
self.emit("toggled", cell, path, columnid, tree)
|
||||
|
||||
def row_activated_cb(self, tree, path, view_column):
|
||||
if not view_column.get_title() in self.toggle_columns:
|
||||
self.emit("row-activated", tree.get_model(), path)
|
||||
|
||||
def stop_cell_fadeinout_cb(self, ctrl, cell, tree):
|
||||
self.emit("cell-fadeinout-stopped", ctrl, cell, tree)
|
||||
|
||||
def set_group_number_cb(self, col, cell, model, iter):
|
||||
if model and (model.iter_parent(iter) == None):
|
||||
cell.cell_attr["number_of_children"] = model.iter_n_children(iter)
|
||||
else:
|
||||
cell.cell_attr["number_of_children"] = 0
|
||||
|
||||
def connect_group_selection(self, cb_func):
|
||||
self.table_tree.get_selection().connect("changed", cb_func)
|
||||
|
||||
"""
|
||||
A method to calculate a softened value for the colour of widget when in the
|
||||
provided state.
|
||||
|
||||
widget: the widget whose style to use
|
||||
state: the state of the widget to use the style for
|
||||
|
||||
Returns a string value representing the softened colour
|
||||
"""
|
||||
def soften_color(widget, state=gtk.STATE_NORMAL):
|
||||
# this colour munging routine is heavily inspired bu gdu_util_get_mix_color()
|
||||
# from gnome-disk-utility:
|
||||
# http://git.gnome.org/browse/gnome-disk-utility/tree/src/gdu-gtk/gdu-gtk.c?h=gnome-3-0
|
||||
blend = 0.7
|
||||
style = widget.get_style()
|
||||
color = style.text[state]
|
||||
color.red = color.red * blend + style.base[state].red * (1.0 - blend)
|
||||
color.green = color.green * blend + style.base[state].green * (1.0 - blend)
|
||||
color.blue = color.blue * blend + style.base[state].blue * (1.0 - blend)
|
||||
return color.to_string()
|
||||
|
||||
class BaseHobButton(gtk.Button):
|
||||
"""
|
||||
A gtk.Button subclass which follows the visual design of Hob for primary
|
||||
action buttons
|
||||
|
||||
label: the text to display as the button's label
|
||||
"""
|
||||
def __init__(self, label):
|
||||
gtk.Button.__init__(self, label)
|
||||
HobButton.style_button(self)
|
||||
|
||||
@staticmethod
|
||||
def style_button(button):
|
||||
style = button.get_style()
|
||||
style = gtk.rc_get_style_by_paths(gtk.settings_get_default(), 'gtk-button', 'gtk-button', gobject.TYPE_NONE)
|
||||
|
||||
button.set_flags(gtk.CAN_DEFAULT)
|
||||
button.grab_default()
|
||||
|
||||
# label = "<span size='x-large'><b>%s</b></span>" % gobject.markup_escape_text(button.get_label())
|
||||
label = button.get_label()
|
||||
button.set_label(label)
|
||||
button.child.set_use_markup(True)
|
||||
|
||||
class HobButton(BaseHobButton):
|
||||
"""
|
||||
A gtk.Button subclass which follows the visual design of Hob for primary
|
||||
action buttons
|
||||
|
||||
label: the text to display as the button's label
|
||||
"""
|
||||
def __init__(self, label):
|
||||
BaseHobButton.__init__(self, label)
|
||||
HobButton.style_button(self)
|
||||
|
||||
class HobAltButton(BaseHobButton):
|
||||
"""
|
||||
A gtk.Button subclass which has no relief, and so is more discrete
|
||||
"""
|
||||
def __init__(self, label):
|
||||
BaseHobButton.__init__(self, label)
|
||||
HobAltButton.style_button(self)
|
||||
|
||||
"""
|
||||
A callback for the state-changed event to ensure the text is displayed
|
||||
differently when the widget is not sensitive
|
||||
"""
|
||||
@staticmethod
|
||||
def desensitise_on_state_change_cb(button, state):
|
||||
if not button.get_property("sensitive"):
|
||||
HobAltButton.set_text(button, False)
|
||||
else:
|
||||
HobAltButton.set_text(button, True)
|
||||
|
||||
"""
|
||||
Set the button label with an appropriate colour for the current widget state
|
||||
"""
|
||||
@staticmethod
|
||||
def set_text(button, sensitive=True):
|
||||
if sensitive:
|
||||
colour = HobColors.PALE_BLUE
|
||||
else:
|
||||
colour = HobColors.LIGHT_GRAY
|
||||
button.set_label("<span size='large' color='%s'><b>%s</b></span>" % (colour, gobject.markup_escape_text(button.text)))
|
||||
button.child.set_use_markup(True)
|
||||
|
||||
class HobImageButton(gtk.Button):
|
||||
"""
|
||||
A gtk.Button with an icon and two rows of text, the second of which is
|
||||
displayed in a blended colour.
|
||||
|
||||
primary_text: the main button label
|
||||
secondary_text: optional second line of text
|
||||
icon_path: path to the icon file to display on the button
|
||||
"""
|
||||
def __init__(self, primary_text, secondary_text="", icon_path="", hover_icon_path=""):
|
||||
gtk.Button.__init__(self)
|
||||
self.set_relief(gtk.RELIEF_NONE)
|
||||
|
||||
self.icon_path = icon_path
|
||||
self.hover_icon_path = hover_icon_path
|
||||
|
||||
hbox = gtk.HBox(False, 10)
|
||||
hbox.show()
|
||||
self.add(hbox)
|
||||
self.icon = gtk.Image()
|
||||
self.icon.set_from_file(self.icon_path)
|
||||
self.icon.set_alignment(0.5, 0.0)
|
||||
self.icon.show()
|
||||
if self.hover_icon_path and len(self.hover_icon_path):
|
||||
self.connect("enter-notify-event", self.set_hover_icon_cb)
|
||||
self.connect("leave-notify-event", self.set_icon_cb)
|
||||
hbox.pack_start(self.icon, False, False, 0)
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
colour = soften_color(label)
|
||||
mark = "<span size='x-large'>%s</span>\n<span size='medium' fgcolor='%s' weight='ultralight'>%s</span>" % (primary_text, colour, secondary_text)
|
||||
label.set_markup(mark)
|
||||
label.show()
|
||||
hbox.pack_start(label, True, True, 0)
|
||||
|
||||
def set_hover_icon_cb(self, widget, event):
|
||||
self.icon.set_from_file(self.hover_icon_path)
|
||||
|
||||
def set_icon_cb(self, widget, event):
|
||||
self.icon.set_from_file(self.icon_path)
|
||||
|
||||
class HobInfoButton(gtk.EventBox):
|
||||
"""
|
||||
This class implements a button-like widget per the Hob visual and UX designs
|
||||
which will display a persistent tooltip, with the contents of tip_markup, when
|
||||
clicked.
|
||||
|
||||
tip_markup: the Pango Markup to be displayed in the persistent tooltip
|
||||
"""
|
||||
def __init__(self, tip_markup, parent=None):
|
||||
gtk.EventBox.__init__(self)
|
||||
self.image = gtk.Image()
|
||||
self.image.set_from_file(
|
||||
hic.ICON_INFO_DISPLAY_FILE)
|
||||
self.image.show()
|
||||
self.add(self.image)
|
||||
|
||||
self.set_events(gtk.gdk.BUTTON_RELEASE |
|
||||
gtk.gdk.ENTER_NOTIFY_MASK |
|
||||
gtk.gdk.LEAVE_NOTIFY_MASK)
|
||||
|
||||
self.ptip = PersistentTooltip(tip_markup)
|
||||
|
||||
if parent:
|
||||
self.ptip.set_parent(parent)
|
||||
self.ptip.set_transient_for(parent)
|
||||
self.ptip.set_destroy_with_parent(True)
|
||||
|
||||
self.connect("button-release-event", self.button_release_cb)
|
||||
self.connect("enter-notify-event", self.mouse_in_cb)
|
||||
self.connect("leave-notify-event", self.mouse_out_cb)
|
||||
|
||||
"""
|
||||
When the mouse click is released emulate a button-click and show the associated
|
||||
PersistentTooltip
|
||||
"""
|
||||
def button_release_cb(self, widget, event):
|
||||
self.ptip.show()
|
||||
|
||||
"""
|
||||
Change to the prelight image when the mouse enters the widget
|
||||
"""
|
||||
def mouse_in_cb(self, widget, event):
|
||||
self.image.set_from_file(hic.ICON_INFO_HOVER_FILE)
|
||||
|
||||
"""
|
||||
Change to the stock image when the mouse enters the widget
|
||||
"""
|
||||
def mouse_out_cb(self, widget, event):
|
||||
self.image.set_from_file(hic.ICON_INFO_DISPLAY_FILE)
|
||||
|
||||
class HobIndicator(gtk.DrawingArea):
|
||||
def __init__(self, count):
|
||||
gtk.DrawingArea.__init__(self)
|
||||
# Set no window for transparent background
|
||||
self.set_has_window(False)
|
||||
self.set_size_request(38,38)
|
||||
# We need to pass through button clicks
|
||||
self.add_events(gtk.gdk.BUTTON_PRESS_MASK | gtk.gdk.BUTTON_RELEASE_MASK)
|
||||
|
||||
self.connect('expose-event', self.expose)
|
||||
|
||||
self.count = count
|
||||
self.color = HobColors.GRAY
|
||||
|
||||
def expose(self, widget, event):
|
||||
if self.count and self.count > 0:
|
||||
ctx = widget.window.cairo_create()
|
||||
|
||||
x, y, w, h = self.allocation
|
||||
|
||||
ctx.set_operator(cairo.OPERATOR_OVER)
|
||||
ctx.set_source_color(gtk.gdk.color_parse(self.color))
|
||||
ctx.translate(w/2, h/2)
|
||||
ctx.arc(x, y, min(w,h)/2 - 2, 0, 2*math.pi)
|
||||
ctx.fill_preserve()
|
||||
|
||||
layout = self.create_pango_layout(str(self.count))
|
||||
textw, texth = layout.get_pixel_size()
|
||||
x = (w/2)-(textw/2) + x
|
||||
y = (h/2) - (texth/2) + y
|
||||
ctx.move_to(x, y)
|
||||
self.window.draw_layout(self.style.light_gc[gtk.STATE_NORMAL], int(x), int(y), layout)
|
||||
|
||||
def set_count(self, count):
|
||||
self.count = count
|
||||
|
||||
def set_active(self, active):
|
||||
if active:
|
||||
self.color = HobColors.DEEP_RED
|
||||
else:
|
||||
self.color = HobColors.GRAY
|
||||
|
||||
class HobTabLabel(gtk.HBox):
|
||||
def __init__(self, text, count=0):
|
||||
gtk.HBox.__init__(self, False, 0)
|
||||
self.indicator = HobIndicator(count)
|
||||
self.indicator.show()
|
||||
self.pack_end(self.indicator, False, False)
|
||||
self.lbl = gtk.Label(text)
|
||||
self.lbl.set_alignment(0.0, 0.5)
|
||||
self.lbl.show()
|
||||
self.pack_end(self.lbl, True, True, 6)
|
||||
|
||||
def set_count(self, count):
|
||||
self.indicator.set_count(count)
|
||||
|
||||
def set_active(self, active=True):
|
||||
self.indicator.set_active(active)
|
||||
|
||||
class HobNotebook(gtk.Notebook):
|
||||
def __init__(self):
|
||||
gtk.Notebook.__init__(self)
|
||||
self.set_property('homogeneous', True)
|
||||
|
||||
self.pages = []
|
||||
|
||||
self.search = None
|
||||
self.search_name = ""
|
||||
|
||||
self.connect("switch-page", self.page_changed_cb)
|
||||
|
||||
self.show_all()
|
||||
|
||||
def page_changed_cb(self, nb, page, page_num):
|
||||
for p, lbl in enumerate(self.pages):
|
||||
if p == page_num:
|
||||
lbl.set_active()
|
||||
else:
|
||||
lbl.set_active(False)
|
||||
|
||||
def append_page(self, child, tab_label, tab_tooltip=None):
|
||||
label = HobTabLabel(tab_label)
|
||||
if tab_tooltip:
|
||||
label.set_tooltip_text(tab_tooltip)
|
||||
label.set_active(False)
|
||||
self.pages.append(label)
|
||||
gtk.Notebook.append_page(self, child, label)
|
||||
|
||||
def set_entry(self, name="Search:"):
|
||||
self.search = gtk.Entry()
|
||||
self.search_name = name
|
||||
style = self.search.get_style()
|
||||
style.text[gtk.STATE_NORMAL] = self.get_colormap().alloc_color(HobColors.GRAY, False, False)
|
||||
self.search.set_style(style)
|
||||
self.search.set_text(name)
|
||||
self.search.set_editable(False)
|
||||
self.search.set_icon_from_stock(gtk.ENTRY_ICON_SECONDARY, gtk.STOCK_CLEAR)
|
||||
self.search.connect("icon-release", self.set_search_entry_clear_cb)
|
||||
self.search.show()
|
||||
|
||||
self.search.connect("focus-in-event", self.set_search_entry_editable_cb)
|
||||
self.search.connect("focus-out-event", self.set_search_entry_reset_cb)
|
||||
self.set_action_widget(self.search, gtk.PACK_END)
|
||||
|
||||
def show_indicator_icon(self, title, number):
|
||||
for child in self.pages:
|
||||
if child.lbl.get_label() == title:
|
||||
child.set_count(number)
|
||||
|
||||
def hide_indicator_icon(self, title):
|
||||
for child in self.pages:
|
||||
if child.lbl.get_label() == title:
|
||||
child.set_count(0)
|
||||
|
||||
def set_search_entry_editable_cb(self, search, event):
|
||||
search.set_editable(True)
|
||||
search.set_text("")
|
||||
style = self.search.get_style()
|
||||
style.text[gtk.STATE_NORMAL] = self.get_colormap().alloc_color(HobColors.BLACK, False, False)
|
||||
search.set_style(style)
|
||||
|
||||
def reset_entry(self, entry):
|
||||
style = entry.get_style()
|
||||
style.text[gtk.STATE_NORMAL] = self.get_colormap().alloc_color(HobColors.GRAY, False, False)
|
||||
entry.set_style(style)
|
||||
entry.set_text(self.search_name)
|
||||
entry.set_editable(False)
|
||||
|
||||
def set_search_entry_reset_cb(self, search, event):
|
||||
self.reset_entry(search)
|
||||
|
||||
def set_search_entry_clear_cb(self, search, icon_pos, event):
|
||||
if search.get_editable() == True:
|
||||
search.set_text("")
|
||||
|
||||
def set_page(self, title):
|
||||
for child in self.pages:
|
||||
if child.lbl.get_label() == title:
|
||||
child.grab_focus()
|
||||
self.set_current_page(self.pages.index(child))
|
||||
return
|
||||
|
||||
class HobWarpCellRendererText(gtk.CellRendererText):
|
||||
def __init__(self, col_number):
|
||||
gtk.CellRendererText.__init__(self)
|
||||
self.set_property("wrap-mode", pango.WRAP_WORD_CHAR)
|
||||
self.set_property("wrap-width", 300) # default value wrap width is 300
|
||||
self.col_n = col_number
|
||||
|
||||
def do_render(self, window, widget, background_area, cell_area, expose_area, flags):
|
||||
if widget:
|
||||
self.props.wrap_width = self.get_resized_wrap_width(widget, widget.get_column(self.col_n))
|
||||
return gtk.CellRendererText.do_render(self, window, widget, background_area, cell_area, expose_area, flags)
|
||||
|
||||
def get_resized_wrap_width(self, treeview, column):
|
||||
otherCols = []
|
||||
for col in treeview.get_columns():
|
||||
if col != column:
|
||||
otherCols.append(col)
|
||||
adjwidth = treeview.allocation.width - sum(c.get_width() for c in otherCols)
|
||||
adjwidth -= treeview.style_get_property("horizontal-separator") * 4
|
||||
if self.props.wrap_width == adjwidth or adjwidth <= 0:
|
||||
adjwidth = self.props.wrap_width
|
||||
return adjwidth
|
||||
|
||||
gobject.type_register(HobWarpCellRendererText)
|
||||
|
||||
class HobIconChecker(hic):
|
||||
def set_hob_icon_to_stock_icon(self, file_path, stock_id=""):
|
||||
try:
|
||||
pixbuf = gtk.gdk.pixbuf_new_from_file(file_path)
|
||||
except Exception, e:
|
||||
return None
|
||||
|
||||
if stock_id and (gtk.icon_factory_lookup_default(stock_id) == None):
|
||||
icon_factory = gtk.IconFactory()
|
||||
icon_factory.add_default()
|
||||
icon_factory.add(stock_id, gtk.IconSet(pixbuf))
|
||||
gtk.stock_add([(stock_id, '_label', 0, 0, '')])
|
||||
|
||||
return icon_factory.lookup(stock_id)
|
||||
|
||||
return None
|
||||
|
||||
"""
|
||||
For make hob icon consistently by request, and avoid icon view diff by system or gtk version, we use some 'hob icon' to replace the 'gtk icon'.
|
||||
this function check the stock_id and make hob_id to replaced the gtk_id then return it or ""
|
||||
"""
|
||||
def check_stock_icon(self, stock_name=""):
|
||||
HOB_CHECK_STOCK_NAME = {
|
||||
('hic-dialog-info', 'gtk-dialog-info', 'dialog-info') : self.ICON_INDI_INFO_FILE,
|
||||
('hic-ok', 'gtk-ok', 'ok') : self.ICON_INDI_TICK_FILE,
|
||||
('hic-dialog-error', 'gtk-dialog-error', 'dialog-error') : self.ICON_INDI_ERROR_FILE,
|
||||
('hic-dialog-warning', 'gtk-dialog-warning', 'dialog-warning') : self.ICON_INDI_ALERT_FILE,
|
||||
('hic-task-refresh', 'gtk-execute', 'execute') : self.ICON_INDI_REFRESH_FILE,
|
||||
}
|
||||
valid_stock_id = stock_name
|
||||
if stock_name:
|
||||
for names, path in HOB_CHECK_STOCK_NAME.iteritems():
|
||||
if stock_name in names:
|
||||
valid_stock_id = names[0]
|
||||
if not gtk.icon_factory_lookup_default(valid_stock_id):
|
||||
self.set_hob_icon_to_stock_icon(path, valid_stock_id)
|
||||
|
||||
return valid_stock_id
|
||||
|
||||
class HobCellRendererController(gobject.GObject):
|
||||
(MODE_CYCLE_RUNNING, MODE_ONE_SHORT) = range(2)
|
||||
__gsignals__ = {
|
||||
"run-timer-stopped" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
}
|
||||
def __init__(self, runningmode=MODE_CYCLE_RUNNING, is_draw_row=False):
|
||||
gobject.GObject.__init__(self)
|
||||
self.timeout_id = None
|
||||
self.current_angle_pos = 0.0
|
||||
self.step_angle = 0.0
|
||||
self.tree_headers_height = 0
|
||||
self.running_cell_areas = []
|
||||
self.running_mode = runningmode
|
||||
self.is_queue_draw_row_area = is_draw_row
|
||||
self.force_stop_enable = False
|
||||
|
||||
def is_active(self):
|
||||
if self.timeout_id:
|
||||
return True
|
||||
else:
|
||||
return False
|
||||
|
||||
def reset_run(self):
|
||||
self.force_stop()
|
||||
self.running_cell_areas = []
|
||||
self.current_angle_pos = 0.0
|
||||
self.step_angle = 0.0
|
||||
|
||||
''' time_iterval: (1~1000)ms, which will be as the basic interval count for timer
|
||||
init_usrdata: the current data which related the progress-bar will be at
|
||||
min_usrdata: the range of min of user data
|
||||
max_usrdata: the range of max of user data
|
||||
step: each step which you want to progress
|
||||
Note: the init_usrdata should in the range of from min to max, and max should > min
|
||||
step should < (max - min)
|
||||
'''
|
||||
def start_run(self, time_iterval, init_usrdata, min_usrdata, max_usrdata, step, tree):
|
||||
if (not time_iterval) or (not max_usrdata):
|
||||
return
|
||||
usr_range = (max_usrdata - min_usrdata) * 1.0
|
||||
self.current_angle_pos = (init_usrdata * 1.0) / usr_range
|
||||
self.step_angle = (step * 1) / usr_range
|
||||
self.timeout_id = gobject.timeout_add(int(time_iterval),
|
||||
self.make_image_on_progressing_cb, tree)
|
||||
self.tree_headers_height = self.get_treeview_headers_height(tree)
|
||||
self.force_stop_enable = False
|
||||
|
||||
def force_stop(self):
|
||||
self.emit("run-timer-stopped")
|
||||
self.force_stop_enable = True
|
||||
if self.timeout_id:
|
||||
if gobject.source_remove(self.timeout_id):
|
||||
self.timeout_id = None
|
||||
|
||||
def on_draw_pixbuf_cb(self, pixbuf, cr, x, y, img_width, img_height, do_refresh=True):
|
||||
if pixbuf:
|
||||
r = max(img_width/2, img_height/2)
|
||||
cr.translate(x + r, y + r)
|
||||
if do_refresh:
|
||||
cr.rotate(2 * math.pi * self.current_angle_pos)
|
||||
|
||||
cr.set_source_pixbuf(pixbuf, -img_width/2, -img_height/2)
|
||||
cr.paint()
|
||||
|
||||
def on_draw_fadeinout_cb(self, cr, color, x, y, width, height, do_fadeout=True):
|
||||
if do_fadeout:
|
||||
alpha = self.current_angle_pos * 0.8
|
||||
else:
|
||||
alpha = (1.0 - self.current_angle_pos) * 0.8
|
||||
|
||||
cr.set_source_rgba(color.red, color.green, color.blue, alpha)
|
||||
cr.rectangle(x, y, width, height)
|
||||
cr.fill()
|
||||
|
||||
def get_treeview_headers_height(self, tree):
|
||||
if tree and (tree.get_property("headers-visible") == True):
|
||||
height = tree.get_allocation().height - tree.get_bin_window().get_size()[1]
|
||||
return height
|
||||
|
||||
return 0
|
||||
|
||||
def make_image_on_progressing_cb(self, tree):
|
||||
self.current_angle_pos += self.step_angle
|
||||
if self.running_mode == self.MODE_CYCLE_RUNNING:
|
||||
if (self.current_angle_pos >= 1):
|
||||
self.current_angle_pos = self.step_angle
|
||||
else:
|
||||
if self.current_angle_pos > 1:
|
||||
self.force_stop()
|
||||
return False
|
||||
|
||||
if self.is_queue_draw_row_area:
|
||||
for path in self.running_cell_areas:
|
||||
rect = tree.get_cell_area(path, tree.get_column(0))
|
||||
row_x, _, row_width, _ = tree.get_visible_rect()
|
||||
tree.queue_draw_area(row_x, rect.y + self.tree_headers_height, row_width, rect.height)
|
||||
else:
|
||||
for rect in self.running_cell_areas:
|
||||
tree.queue_draw_area(rect.x, rect.y + self.tree_headers_height, rect.width, rect.height)
|
||||
|
||||
return (not self.force_stop_enable)
|
||||
|
||||
def append_running_cell_area(self, cell_area):
|
||||
if cell_area and (cell_area not in self.running_cell_areas):
|
||||
self.running_cell_areas.append(cell_area)
|
||||
|
||||
def remove_running_cell_area(self, cell_area):
|
||||
if cell_area in self.running_cell_areas:
|
||||
self.running_cell_areas.remove(cell_area)
|
||||
if not self.running_cell_areas:
|
||||
self.reset_run()
|
||||
|
||||
gobject.type_register(HobCellRendererController)
|
||||
|
||||
class HobCellRendererPixbuf(gtk.CellRendererPixbuf):
|
||||
def __init__(self):
|
||||
gtk.CellRendererPixbuf.__init__(self)
|
||||
self.control = HobCellRendererController()
|
||||
# add icon checker for make the gtk-icon transfer to hob-icon
|
||||
self.checker = HobIconChecker()
|
||||
self.set_property("stock-size", gtk.ICON_SIZE_DND)
|
||||
|
||||
def get_pixbuf_from_stock_icon(self, widget, stock_id="", size=gtk.ICON_SIZE_DIALOG):
|
||||
if widget and stock_id and gtk.icon_factory_lookup_default(stock_id):
|
||||
return widget.render_icon(stock_id, size)
|
||||
|
||||
return None
|
||||
|
||||
def set_icon_name_to_id(self, new_name):
|
||||
if new_name and type(new_name) == str:
|
||||
# check the name is need to transfer to hob icon or not
|
||||
name = self.checker.check_stock_icon(new_name)
|
||||
if name.startswith("hic") or name.startswith("gtk"):
|
||||
stock_id = name
|
||||
else:
|
||||
stock_id = 'gtk-' + name
|
||||
|
||||
return stock_id
|
||||
|
||||
''' render cell exactly, "icon-name" is priority
|
||||
if use the 'hic-task-refresh' will make the pix animation
|
||||
if 'pix' will change the pixbuf for it from the pixbuf or image.
|
||||
'''
|
||||
def do_render(self, window, tree, background_area,cell_area, expose_area, flags):
|
||||
if (not self.control) or (not tree):
|
||||
return
|
||||
|
||||
x, y, w, h = self.on_get_size(tree, cell_area)
|
||||
x += cell_area.x
|
||||
y += cell_area.y
|
||||
w -= 2 * self.get_property("xpad")
|
||||
h -= 2 * self.get_property("ypad")
|
||||
|
||||
stock_id = ""
|
||||
if self.props.icon_name:
|
||||
stock_id = self.set_icon_name_to_id(self.props.icon_name)
|
||||
elif self.props.stock_id:
|
||||
stock_id = self.props.stock_id
|
||||
elif self.props.pixbuf:
|
||||
pix = self.props.pixbuf
|
||||
else:
|
||||
return
|
||||
|
||||
if stock_id:
|
||||
pix = self.get_pixbuf_from_stock_icon(tree, stock_id, self.props.stock_size)
|
||||
if stock_id == 'hic-task-refresh':
|
||||
self.control.append_running_cell_area(cell_area)
|
||||
if self.control.is_active():
|
||||
self.control.on_draw_pixbuf_cb(pix, window.cairo_create(), x, y, w, h, True)
|
||||
else:
|
||||
self.control.start_run(200, 0, 0, 1000, 150, tree)
|
||||
else:
|
||||
self.control.remove_running_cell_area(cell_area)
|
||||
self.control.on_draw_pixbuf_cb(pix, window.cairo_create(), x, y, w, h, False)
|
||||
|
||||
def on_get_size(self, widget, cell_area):
|
||||
if self.props.icon_name or self.props.pixbuf or self.props.stock_id:
|
||||
w, h = gtk.icon_size_lookup(self.props.stock_size)
|
||||
calc_width = self.get_property("xpad") * 2 + w
|
||||
calc_height = self.get_property("ypad") * 2 + h
|
||||
x_offset = 0
|
||||
y_offset = 0
|
||||
if cell_area and w > 0 and h > 0:
|
||||
x_offset = self.get_property("xalign") * (cell_area.width - calc_width - self.get_property("xpad"))
|
||||
y_offset = self.get_property("yalign") * (cell_area.height - calc_height - self.get_property("ypad"))
|
||||
|
||||
return x_offset, y_offset, w, h
|
||||
|
||||
return 0, 0, 0, 0
|
||||
|
||||
gobject.type_register(HobCellRendererPixbuf)
|
||||
|
||||
class HobCellRendererToggle(gtk.CellRendererToggle):
|
||||
def __init__(self):
|
||||
gtk.CellRendererToggle.__init__(self)
|
||||
self.ctrl = HobCellRendererController(is_draw_row=True)
|
||||
self.ctrl.running_mode = self.ctrl.MODE_ONE_SHORT
|
||||
self.cell_attr = {"fadeout": False, "number_of_children": 0}
|
||||
|
||||
def do_render(self, window, widget, background_area, cell_area, expose_area, flags):
|
||||
if (not self.ctrl) or (not widget):
|
||||
return
|
||||
|
||||
if flags & gtk.CELL_RENDERER_SELECTED:
|
||||
state = gtk.STATE_SELECTED
|
||||
else:
|
||||
state = gtk.STATE_NORMAL
|
||||
|
||||
if self.ctrl.is_active():
|
||||
path = widget.get_path_at_pos(cell_area.x + cell_area.width/2, cell_area.y + cell_area.height/2)
|
||||
# sometimes the parameters of cell_area will be a negative number,such as pull up down the scroll bar
|
||||
# it's over the tree container range, so the path will be bad
|
||||
if not path: return
|
||||
path = path[0]
|
||||
if path in self.ctrl.running_cell_areas:
|
||||
cr = window.cairo_create()
|
||||
color = widget.get_style().base[state]
|
||||
|
||||
row_x, _, row_width, _ = widget.get_visible_rect()
|
||||
border_y = self.get_property("ypad")
|
||||
self.ctrl.on_draw_fadeinout_cb(cr, color, row_x, cell_area.y - border_y, row_width, \
|
||||
cell_area.height + border_y * 2, self.cell_attr["fadeout"])
|
||||
# draw number of a group
|
||||
if self.cell_attr["number_of_children"]:
|
||||
text = "%d pkg" % self.cell_attr["number_of_children"]
|
||||
pangolayout = widget.create_pango_layout(text)
|
||||
textw, texth = pangolayout.get_pixel_size()
|
||||
x = cell_area.x + (cell_area.width/2) - (textw/2)
|
||||
y = cell_area.y + (cell_area.height/2) - (texth/2)
|
||||
|
||||
widget.style.paint_layout(window, state, True, cell_area, widget, "checkbox", x, y, pangolayout)
|
||||
else:
|
||||
return gtk.CellRendererToggle.do_render(self, window, widget, background_area, cell_area, expose_area, flags)
|
||||
|
||||
'''delay: normally delay time is 1000ms
|
||||
cell_list: whilch cells need to be render
|
||||
'''
|
||||
def fadeout(self, tree, delay, cell_list=None):
|
||||
if (delay < 200) or (not tree):
|
||||
return
|
||||
self.cell_attr["fadeout"] = True
|
||||
self.ctrl.running_cell_areas = cell_list
|
||||
self.ctrl.start_run(200, 0, 0, delay, (delay * 200 / 1000), tree)
|
||||
|
||||
def connect_render_state_changed(self, func, usrdata=None):
|
||||
if not func:
|
||||
return
|
||||
if usrdata:
|
||||
self.ctrl.connect("run-timer-stopped", func, self, usrdata)
|
||||
else:
|
||||
self.ctrl.connect("run-timer-stopped", func, self)
|
||||
|
||||
gobject.type_register(HobCellRendererToggle)
|
||||
@@ -1,460 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import glib
|
||||
import re
|
||||
from bb.ui.crumbs.progressbar import HobProgressBar
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
from bb.ui.crumbs.hobwidget import hic, HobImageButton, HobInfoButton, HobAltButton, HobButton
|
||||
from bb.ui.crumbs.hoblistmodel import RecipeListModel
|
||||
from bb.ui.crumbs.hobpages import HobPage
|
||||
|
||||
#
|
||||
# ImageConfigurationPage
|
||||
#
|
||||
class ImageConfigurationPage (HobPage):
|
||||
|
||||
__dummy_machine__ = "--select a machine--"
|
||||
__dummy_image__ = "--select a base image--"
|
||||
|
||||
def __init__(self, builder):
|
||||
super(ImageConfigurationPage, self).__init__(builder, "Image configuration")
|
||||
|
||||
self.image_combo_id = None
|
||||
# we use machine_combo_changed_by_manual to identify the machine is changed by code
|
||||
# or by manual. If by manual, all user's recipe selection and package selection are
|
||||
# cleared.
|
||||
self.machine_combo_changed_by_manual = True
|
||||
self.stopping = False
|
||||
self.create_visual_elements()
|
||||
|
||||
def create_visual_elements(self):
|
||||
# create visual elements
|
||||
self.toolbar = gtk.Toolbar()
|
||||
self.toolbar.set_orientation(gtk.ORIENTATION_HORIZONTAL)
|
||||
self.toolbar.set_style(gtk.TOOLBAR_BOTH)
|
||||
|
||||
template_button = self.append_toolbar_button(self.toolbar,
|
||||
"Templates",
|
||||
hic.ICON_TEMPLATES_DISPLAY_FILE,
|
||||
hic.ICON_TEMPLATES_HOVER_FILE,
|
||||
"Load a previously saved template",
|
||||
self.template_button_clicked_cb)
|
||||
my_images_button = self.append_toolbar_button(self.toolbar,
|
||||
"Images",
|
||||
hic.ICON_IMAGES_DISPLAY_FILE,
|
||||
hic.ICON_IMAGES_HOVER_FILE,
|
||||
"Open previously built images",
|
||||
self.my_images_button_clicked_cb)
|
||||
settings_button = self.append_toolbar_button(self.toolbar,
|
||||
"Settings",
|
||||
hic.ICON_SETTINGS_DISPLAY_FILE,
|
||||
hic.ICON_SETTINGS_HOVER_FILE,
|
||||
"View additional build settings",
|
||||
self.settings_button_clicked_cb)
|
||||
|
||||
self.config_top_button = self.add_onto_top_bar(self.toolbar)
|
||||
|
||||
self.gtable = gtk.Table(40, 40, True)
|
||||
self.create_config_machine()
|
||||
self.create_config_baseimg()
|
||||
self.config_build_button = self.create_config_build_button()
|
||||
|
||||
def _remove_all_widget(self):
|
||||
children = self.gtable.get_children() or []
|
||||
for child in children:
|
||||
self.gtable.remove(child)
|
||||
children = self.box_group_area.get_children() or []
|
||||
for child in children:
|
||||
self.box_group_area.remove(child)
|
||||
children = self.get_children() or []
|
||||
for child in children:
|
||||
self.remove(child)
|
||||
|
||||
def _pack_components(self, pack_config_build_button = False):
|
||||
self._remove_all_widget()
|
||||
self.pack_start(self.config_top_button, expand=False, fill=False)
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
|
||||
self.box_group_area.pack_start(self.gtable, expand=True, fill=True)
|
||||
if pack_config_build_button:
|
||||
self.box_group_area.pack_end(self.config_build_button, expand=False, fill=False)
|
||||
else:
|
||||
box = gtk.HBox(False, 6)
|
||||
box.show()
|
||||
subbox = gtk.HBox(False, 0)
|
||||
subbox.set_size_request(205, 49)
|
||||
subbox.show()
|
||||
box.add(subbox)
|
||||
self.box_group_area.pack_end(box, False, False)
|
||||
|
||||
def show_machine(self):
|
||||
self.progress_bar.reset()
|
||||
self._pack_components(pack_config_build_button = False)
|
||||
self.set_config_machine_layout(show_progress_bar = False)
|
||||
self.show_all()
|
||||
|
||||
def update_progress_bar(self, title, fraction, status=None):
|
||||
if self.stopping == False:
|
||||
self.progress_bar.update(fraction)
|
||||
self.progress_bar.set_text(title)
|
||||
self.progress_bar.set_rcstyle(status)
|
||||
|
||||
def show_info_populating(self):
|
||||
self._pack_components(pack_config_build_button = False)
|
||||
self.set_config_machine_layout(show_progress_bar = True)
|
||||
self.show_all()
|
||||
|
||||
def show_info_populated(self):
|
||||
self.progress_bar.reset()
|
||||
self._pack_components(pack_config_build_button = False)
|
||||
self.set_config_machine_layout(show_progress_bar = False)
|
||||
self.set_config_baseimg_layout()
|
||||
self.show_all()
|
||||
|
||||
def show_baseimg_selected(self):
|
||||
self.progress_bar.reset()
|
||||
self._pack_components(pack_config_build_button = True)
|
||||
self.set_config_machine_layout(show_progress_bar = False)
|
||||
self.set_config_baseimg_layout()
|
||||
self.show_all()
|
||||
if self.builder.recipe_model.get_selected_image() == self.builder.recipe_model.__custom_image__:
|
||||
self.just_bake_button.hide()
|
||||
|
||||
def create_config_machine(self):
|
||||
self.machine_title = gtk.Label()
|
||||
self.machine_title.set_alignment(0.0, 0.5)
|
||||
mark = "<span %s>Select a machine</span>" % self.span_tag('x-large', 'bold')
|
||||
self.machine_title.set_markup(mark)
|
||||
|
||||
self.machine_title_desc = gtk.Label()
|
||||
self.machine_title_desc.set_alignment(0.0, 0.5)
|
||||
mark = ("<span %s>Your selection is the profile of the target machine for which you"
|
||||
" are building the image.\n</span>") % (self.span_tag('medium'))
|
||||
self.machine_title_desc.set_markup(mark)
|
||||
|
||||
self.machine_combo = gtk.combo_box_new_text()
|
||||
self.machine_combo.connect("changed", self.machine_combo_changed_cb)
|
||||
|
||||
icon_file = hic.ICON_LAYERS_DISPLAY_FILE
|
||||
hover_file = hic.ICON_LAYERS_HOVER_FILE
|
||||
self.layer_button = HobImageButton("Layers", "Add support for machines, software, etc.",
|
||||
icon_file, hover_file)
|
||||
self.layer_button.connect("clicked", self.layer_button_clicked_cb)
|
||||
|
||||
markup = "Layers are a powerful mechanism to extend the Yocto Project "
|
||||
markup += "with your own functionality.\n"
|
||||
markup += "For more on layers, check the <a href=\""
|
||||
markup += "http://www.yoctoproject.org/docs/current/dev-manual/"
|
||||
markup += "dev-manual.html#understanding-and-using-layers\">reference manual</a>."
|
||||
self.layer_info_icon = HobInfoButton(markup, self.get_parent())
|
||||
|
||||
# self.progress_box = gtk.HBox(False, 6)
|
||||
self.progress_bar = HobProgressBar()
|
||||
# self.progress_box.pack_start(self.progress_bar, expand=True, fill=True)
|
||||
self.stop_button = HobAltButton("Stop")
|
||||
self.stop_button.connect("clicked", self.stop_button_clicked_cb)
|
||||
# self.progress_box.pack_end(stop_button, expand=False, fill=False)
|
||||
self.machine_separator = gtk.HSeparator()
|
||||
|
||||
def set_config_machine_layout(self, show_progress_bar = False):
|
||||
self.gtable.attach(self.machine_title, 0, 40, 0, 4)
|
||||
self.gtable.attach(self.machine_title_desc, 0, 40, 4, 6)
|
||||
self.gtable.attach(self.machine_combo, 0, 12, 7, 10)
|
||||
self.gtable.attach(self.layer_button, 14, 36, 7, 12)
|
||||
self.gtable.attach(self.layer_info_icon, 36, 40, 7, 11)
|
||||
if show_progress_bar:
|
||||
#self.gtable.attach(self.progress_box, 0, 40, 15, 18)
|
||||
self.gtable.attach(self.progress_bar, 0, 37, 15, 18)
|
||||
self.gtable.attach(self.stop_button, 37, 40, 15, 18, 0, 0)
|
||||
self.gtable.attach(self.machine_separator, 0, 40, 13, 14)
|
||||
|
||||
def create_config_baseimg(self):
|
||||
self.image_title = gtk.Label()
|
||||
self.image_title.set_alignment(0, 1.0)
|
||||
mark = "<span %s>Select a base image</span>" % self.span_tag('x-large', 'bold')
|
||||
self.image_title.set_markup(mark)
|
||||
|
||||
self.image_title_desc = gtk.Label()
|
||||
self.image_title_desc.set_alignment(0, 0.5)
|
||||
mark = ("<span %s>Base images are a starting point for the type of image you want. "
|
||||
"You can build them as \n"
|
||||
"they are or customize them to your specific needs.\n</span>") % self.span_tag('medium')
|
||||
self.image_title_desc.set_markup(mark)
|
||||
|
||||
self.image_combo = gtk.combo_box_new_text()
|
||||
self.image_combo_id = self.image_combo.connect("changed", self.image_combo_changed_cb)
|
||||
|
||||
self.image_desc = gtk.Label()
|
||||
self.image_desc.set_alignment(0.0, 0.5)
|
||||
self.image_desc.set_size_request(256, -1)
|
||||
self.image_desc.set_justify(gtk.JUSTIFY_LEFT)
|
||||
self.image_desc.set_line_wrap(True)
|
||||
|
||||
# button to view recipes
|
||||
icon_file = hic.ICON_RCIPE_DISPLAY_FILE
|
||||
hover_file = hic.ICON_RCIPE_HOVER_FILE
|
||||
self.view_adv_configuration_button = HobImageButton("Advanced configuration",
|
||||
"Select image types, package formats, etc",
|
||||
icon_file, hover_file)
|
||||
self.view_adv_configuration_button.connect("clicked", self.view_adv_configuration_button_clicked_cb)
|
||||
|
||||
self.image_separator = gtk.HSeparator()
|
||||
|
||||
def set_config_baseimg_layout(self):
|
||||
self.gtable.attach(self.image_title, 0, 40, 15, 17)
|
||||
self.gtable.attach(self.image_title_desc, 0, 40, 18, 22)
|
||||
self.gtable.attach(self.image_combo, 0, 12, 23, 26)
|
||||
self.gtable.attach(self.image_desc, 0, 12, 27, 33)
|
||||
self.gtable.attach(self.view_adv_configuration_button, 14, 36, 23, 28)
|
||||
self.gtable.attach(self.image_separator, 0, 40, 35, 36)
|
||||
|
||||
def create_config_build_button(self):
|
||||
# Create the "Build packages" and "Build image" buttons at the bottom
|
||||
button_box = gtk.HBox(False, 6)
|
||||
|
||||
# create button "Build image"
|
||||
self.just_bake_button = HobButton("Build image")
|
||||
#self.just_bake_button.set_size_request(205, 49)
|
||||
self.just_bake_button.set_tooltip_text("Build target image")
|
||||
self.just_bake_button.connect("clicked", self.just_bake_button_clicked_cb)
|
||||
button_box.pack_end(self.just_bake_button, expand=False, fill=False)
|
||||
|
||||
# create button "Edit Image"
|
||||
self.edit_image_button = HobAltButton("Edit image")
|
||||
#self.edit_image_button.set_size_request(205, 49)
|
||||
self.edit_image_button.set_tooltip_text("Edit target image")
|
||||
self.edit_image_button.connect("clicked", self.edit_image_button_clicked_cb)
|
||||
button_box.pack_end(self.edit_image_button, expand=False, fill=False)
|
||||
|
||||
return button_box
|
||||
|
||||
def stop_button_clicked_cb(self, button):
|
||||
self.stopping = True
|
||||
self.progress_bar.set_text("Stopping recipe parsing")
|
||||
self.progress_bar.set_rcstyle("stop")
|
||||
self.builder.cancel_parse_sync()
|
||||
|
||||
def machine_combo_changed_cb(self, machine_combo):
|
||||
self.stopping = False
|
||||
combo_item = machine_combo.get_active_text()
|
||||
if not combo_item or combo_item == self.__dummy_machine__:
|
||||
return
|
||||
|
||||
# remove __dummy_machine__ item from the store list after first user selection
|
||||
# because it is no longer valid
|
||||
combo_store = machine_combo.get_model()
|
||||
if len(combo_store) and (combo_store[0][0] == self.__dummy_machine__):
|
||||
machine_combo.remove_text(0)
|
||||
|
||||
self.builder.configuration.curr_mach = combo_item
|
||||
if self.machine_combo_changed_by_manual:
|
||||
self.builder.configuration.clear_selection()
|
||||
# reset machine_combo_changed_by_manual
|
||||
self.machine_combo_changed_by_manual = True
|
||||
|
||||
# Do reparse recipes
|
||||
self.builder.populate_recipe_package_info_async()
|
||||
|
||||
def update_machine_combo(self):
|
||||
all_machines = [self.__dummy_machine__] + self.builder.parameters.all_machines
|
||||
|
||||
model = self.machine_combo.get_model()
|
||||
model.clear()
|
||||
for machine in all_machines:
|
||||
self.machine_combo.append_text(machine)
|
||||
self.machine_combo.set_active(0)
|
||||
|
||||
def switch_machine_combo(self):
|
||||
self.machine_combo_changed_by_manual = False
|
||||
model = self.machine_combo.get_model()
|
||||
active = 0
|
||||
while active < len(model):
|
||||
if model[active][0] == self.builder.configuration.curr_mach:
|
||||
self.machine_combo.set_active(active)
|
||||
return
|
||||
active += 1
|
||||
|
||||
if model[0][0] != self.__dummy_machine__:
|
||||
self.machine_combo.insert_text(0, self.__dummy_machine__)
|
||||
|
||||
self.machine_combo.set_active(0)
|
||||
|
||||
def update_image_desc(self):
|
||||
desc = ""
|
||||
selected_image = self.image_combo.get_active_text()
|
||||
if selected_image and selected_image in self.builder.recipe_model.pn_path.keys():
|
||||
image_path = self.builder.recipe_model.pn_path[selected_image]
|
||||
image_iter = self.builder.recipe_model.get_iter(image_path)
|
||||
desc = self.builder.recipe_model.get_value(image_iter, self.builder.recipe_model.COL_DESC)
|
||||
|
||||
mark = ("<span %s>%s</span>\n") % (self.span_tag('small'), desc)
|
||||
self.image_desc.set_markup(mark)
|
||||
|
||||
def image_combo_changed_idle_cb(self, selected_image, selected_recipes, selected_packages):
|
||||
self.builder.update_recipe_model(selected_image, selected_recipes)
|
||||
self.builder.update_package_model(selected_packages)
|
||||
self.builder.window_sensitive(True)
|
||||
|
||||
def image_combo_changed_cb(self, combo):
|
||||
self.builder.window_sensitive(False)
|
||||
selected_image = self.image_combo.get_active_text()
|
||||
if not selected_image or (selected_image == self.__dummy_image__):
|
||||
return
|
||||
|
||||
# remove __dummy_image__ item from the store list after first user selection
|
||||
# because it is no longer valid
|
||||
combo_store = combo.get_model()
|
||||
if len(combo_store) and (combo_store[0][0] == self.__dummy_image__):
|
||||
combo.remove_text(0)
|
||||
|
||||
self.builder.customized = False
|
||||
|
||||
selected_recipes = []
|
||||
|
||||
image_path = self.builder.recipe_model.pn_path[selected_image]
|
||||
image_iter = self.builder.recipe_model.get_iter(image_path)
|
||||
selected_packages = self.builder.recipe_model.get_value(image_iter, self.builder.recipe_model.COL_INSTALL).split()
|
||||
self.update_image_desc()
|
||||
|
||||
self.builder.recipe_model.reset()
|
||||
self.builder.package_model.reset()
|
||||
|
||||
self.show_baseimg_selected()
|
||||
|
||||
if selected_image == self.builder.recipe_model.__custom_image__:
|
||||
self.just_bake_button.hide()
|
||||
|
||||
glib.idle_add(self.image_combo_changed_idle_cb, selected_image, selected_recipes, selected_packages)
|
||||
|
||||
def _image_combo_connect_signal(self):
|
||||
if not self.image_combo_id:
|
||||
self.image_combo_id = self.image_combo.connect("changed", self.image_combo_changed_cb)
|
||||
|
||||
def _image_combo_disconnect_signal(self):
|
||||
if self.image_combo_id:
|
||||
self.image_combo.disconnect(self.image_combo_id)
|
||||
self.image_combo_id = None
|
||||
|
||||
def update_image_combo(self, recipe_model, selected_image):
|
||||
# Update the image combo according to the images in the recipe_model
|
||||
# populate image combo
|
||||
filter = {RecipeListModel.COL_TYPE : ['image']}
|
||||
image_model = recipe_model.tree_model(filter)
|
||||
image_model.set_sort_column_id(recipe_model.COL_NAME, gtk.SORT_ASCENDING)
|
||||
active = 0
|
||||
cnt = 1
|
||||
|
||||
white_pattern = []
|
||||
if self.builder.parameters.image_white_pattern:
|
||||
for i in self.builder.parameters.image_white_pattern.split():
|
||||
white_pattern.append(re.compile(i))
|
||||
|
||||
black_pattern = []
|
||||
if self.builder.parameters.image_black_pattern:
|
||||
for i in self.builder.parameters.image_black_pattern.split():
|
||||
black_pattern.append(re.compile(i))
|
||||
black_pattern.append(re.compile("hob-image"))
|
||||
|
||||
it = image_model.get_iter_first()
|
||||
self._image_combo_disconnect_signal()
|
||||
model = self.image_combo.get_model()
|
||||
model.clear()
|
||||
# Set a indicator text to combo store when first open
|
||||
self.image_combo.append_text(self.__dummy_image__)
|
||||
# append and set active
|
||||
while it:
|
||||
path = image_model.get_path(it)
|
||||
it = image_model.iter_next(it)
|
||||
image_name = image_model[path][recipe_model.COL_NAME]
|
||||
if image_name == self.builder.recipe_model.__custom_image__:
|
||||
continue
|
||||
|
||||
if black_pattern:
|
||||
allow = True
|
||||
for pattern in black_pattern:
|
||||
if pattern.search(image_name):
|
||||
allow = False
|
||||
break
|
||||
elif white_pattern:
|
||||
allow = False
|
||||
for pattern in white_pattern:
|
||||
if pattern.search(image_name):
|
||||
allow = True
|
||||
break
|
||||
else:
|
||||
allow = True
|
||||
|
||||
if allow:
|
||||
self.image_combo.append_text(image_name)
|
||||
if image_name == selected_image:
|
||||
active = cnt
|
||||
cnt = cnt + 1
|
||||
|
||||
self.image_combo.append_text(self.builder.recipe_model.__custom_image__)
|
||||
if selected_image == self.builder.recipe_model.__custom_image__:
|
||||
active = cnt
|
||||
|
||||
self.image_combo.set_active(active)
|
||||
|
||||
if active != 0:
|
||||
self.show_baseimg_selected()
|
||||
|
||||
self._image_combo_connect_signal()
|
||||
|
||||
def layer_button_clicked_cb(self, button):
|
||||
# Create a layer selection dialog
|
||||
self.builder.show_layer_selection_dialog()
|
||||
|
||||
def view_adv_configuration_button_clicked_cb(self, button):
|
||||
# Create an advanced settings dialog
|
||||
response, settings_changed = self.builder.show_adv_settings_dialog()
|
||||
if not response:
|
||||
return
|
||||
if settings_changed:
|
||||
self.builder.reparse_post_adv_settings()
|
||||
|
||||
def just_bake_button_clicked_cb(self, button):
|
||||
self.builder.just_bake()
|
||||
|
||||
def edit_image_button_clicked_cb(self, button):
|
||||
self.builder.configuration.initial_selected_image = self.builder.configuration.selected_image
|
||||
self.builder.show_recipes()
|
||||
|
||||
def template_button_clicked_cb(self, button):
|
||||
response, path = self.builder.show_load_template_dialog()
|
||||
if not response:
|
||||
return
|
||||
if path:
|
||||
self.builder.load_template(path)
|
||||
|
||||
def my_images_button_clicked_cb(self, button):
|
||||
self.builder.show_load_my_images_dialog()
|
||||
|
||||
def settings_button_clicked_cb(self, button):
|
||||
# Create an advanced settings dialog
|
||||
response, settings_changed = self.builder.show_simple_settings_dialog()
|
||||
if not response:
|
||||
return
|
||||
if settings_changed:
|
||||
self.builder.reparse_post_adv_settings()
|
||||
@@ -1,679 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gobject
|
||||
import gtk
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
from bb.ui.crumbs.hobwidget import hic, HobViewTable, HobAltButton, HobButton
|
||||
from bb.ui.crumbs.hobpages import HobPage
|
||||
import subprocess
|
||||
from bb.ui.crumbs.hig import CrumbsDialog
|
||||
from bb.ui.crumbs.hobthreads import OpeningLogThread
|
||||
from bb.ui.crumbs.hig import OpeningLogDialog
|
||||
|
||||
#
|
||||
# ImageDetailsPage
|
||||
#
|
||||
class ImageDetailsPage (HobPage):
|
||||
|
||||
class DetailBox (gtk.EventBox):
|
||||
def __init__(self, widget = None, varlist = None, vallist = None, icon = None, button = None, button2=None, color = HobColors.LIGHT_GRAY):
|
||||
gtk.EventBox.__init__(self)
|
||||
|
||||
# set color
|
||||
style = self.get_style().copy()
|
||||
style.bg[gtk.STATE_NORMAL] = self.get_colormap().alloc_color(color, False, False)
|
||||
self.set_style(style)
|
||||
|
||||
self.row = gtk.Table(1, 2, False)
|
||||
self.row.set_border_width(10)
|
||||
self.add(self.row)
|
||||
|
||||
total_rows = 0
|
||||
if widget:
|
||||
total_rows = 10
|
||||
if varlist and vallist:
|
||||
# pack the icon and the text on the left
|
||||
total_rows += len(varlist)
|
||||
self.table = gtk.Table(total_rows, 20, True)
|
||||
self.table.set_row_spacings(6)
|
||||
self.table.set_size_request(100, -1)
|
||||
self.row.attach(self.table, 0, 1, 0, 1, xoptions=gtk.FILL|gtk.EXPAND, yoptions=gtk.FILL)
|
||||
|
||||
colid = 0
|
||||
rowid = 0
|
||||
self.line_widgets = {}
|
||||
if icon:
|
||||
self.table.attach(icon, colid, colid + 2, 0, 1)
|
||||
colid = colid + 2
|
||||
if widget:
|
||||
self.table.attach(widget, colid, 20, 0, 10)
|
||||
rowid = 10
|
||||
if varlist and vallist:
|
||||
for row in range(rowid, total_rows):
|
||||
index = row - rowid
|
||||
self.line_widgets[varlist[index]] = self.text2label(varlist[index], vallist[index])
|
||||
self.table.attach(self.line_widgets[varlist[index]], colid, 20, row, row + 1)
|
||||
# pack the button on the right
|
||||
if button:
|
||||
self.bbox = gtk.VBox()
|
||||
self.bbox.pack_start(button, expand=True, fill=False)
|
||||
if button2:
|
||||
self.bbox.pack_start(button2, expand=True, fill=False)
|
||||
self.bbox.set_size_request(150,-1)
|
||||
self.row.attach(self.bbox, 1, 2, 0, 1, xoptions=gtk.FILL, yoptions=gtk.EXPAND)
|
||||
|
||||
def update_line_widgets(self, variable, value):
|
||||
if len(self.line_widgets) == 0:
|
||||
return
|
||||
if not isinstance(self.line_widgets[variable], gtk.Label):
|
||||
return
|
||||
self.line_widgets[variable].set_markup(self.format_line(variable, value))
|
||||
|
||||
def wrap_line(self, inputs):
|
||||
# wrap the long text of inputs
|
||||
wrap_width_chars = 75
|
||||
outputs = ""
|
||||
tmps = inputs
|
||||
less_chars = len(inputs)
|
||||
while (less_chars - wrap_width_chars) > 0:
|
||||
less_chars -= wrap_width_chars
|
||||
outputs += tmps[:wrap_width_chars] + "\n "
|
||||
tmps = inputs[less_chars:]
|
||||
outputs += tmps
|
||||
return outputs
|
||||
|
||||
def format_line(self, variable, value):
|
||||
wraped_value = self.wrap_line(value)
|
||||
markup = "<span weight=\'bold\'>%s</span>" % variable
|
||||
markup += "<span weight=\'normal\' foreground=\'#1c1c1c\' font_desc=\'14px\'>%s</span>" % wraped_value
|
||||
return markup
|
||||
|
||||
def text2label(self, variable, value):
|
||||
# append the name:value to the left box
|
||||
# such as "Name: hob-core-minimal-variant-2011-12-15-beagleboard"
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
label.set_markup(self.format_line(variable, value))
|
||||
return label
|
||||
|
||||
class BuildDetailBox (gtk.EventBox):
|
||||
def __init__(self, varlist = None, vallist = None, icon = None, color = HobColors.LIGHT_GRAY):
|
||||
gtk.EventBox.__init__(self)
|
||||
|
||||
# set color
|
||||
style = self.get_style().copy()
|
||||
style.bg[gtk.STATE_NORMAL] = self.get_colormap().alloc_color(color, False, False)
|
||||
self.set_style(style)
|
||||
|
||||
self.hbox = gtk.HBox()
|
||||
self.hbox.set_border_width(10)
|
||||
self.add(self.hbox)
|
||||
|
||||
total_rows = 0
|
||||
if varlist and vallist:
|
||||
# pack the icon and the text on the left
|
||||
total_rows += len(varlist)
|
||||
self.table = gtk.Table(total_rows, 20, True)
|
||||
self.table.set_row_spacings(6)
|
||||
self.table.set_size_request(100, -1)
|
||||
self.hbox.pack_start(self.table, expand=True, fill=True, padding=15)
|
||||
|
||||
colid = 0
|
||||
rowid = 0
|
||||
self.line_widgets = {}
|
||||
if icon:
|
||||
self.table.attach(icon, colid, colid + 2, 0, 1)
|
||||
colid = colid + 2
|
||||
if varlist and vallist:
|
||||
for row in range(rowid, total_rows):
|
||||
index = row - rowid
|
||||
self.line_widgets[varlist[index]] = self.text2label(varlist[index], vallist[index])
|
||||
self.table.attach(self.line_widgets[varlist[index]], colid, 20, row, row + 1)
|
||||
|
||||
def update_line_widgets(self, variable, value):
|
||||
if len(self.line_widgets) == 0:
|
||||
return
|
||||
if not isinstance(self.line_widgets[variable], gtk.Label):
|
||||
return
|
||||
self.line_widgets[variable].set_markup(self.format_line(variable, value))
|
||||
|
||||
def wrap_line(self, inputs):
|
||||
# wrap the long text of inputs
|
||||
wrap_width_chars = 75
|
||||
outputs = ""
|
||||
tmps = inputs
|
||||
less_chars = len(inputs)
|
||||
while (less_chars - wrap_width_chars) > 0:
|
||||
less_chars -= wrap_width_chars
|
||||
outputs += tmps[:wrap_width_chars] + "\n "
|
||||
tmps = inputs[less_chars:]
|
||||
outputs += tmps
|
||||
return outputs
|
||||
|
||||
def format_line(self, variable, value):
|
||||
wraped_value = self.wrap_line(value)
|
||||
markup = "<span weight=\'bold\'>%s</span>" % variable
|
||||
markup += "<span weight=\'normal\' foreground=\'#1c1c1c\' font_desc=\'14px\'>%s</span>" % wraped_value
|
||||
return markup
|
||||
|
||||
def text2label(self, variable, value):
|
||||
# append the name:value to the left box
|
||||
# such as "Name: hob-core-minimal-variant-2011-12-15-beagleboard"
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
label.set_markup(self.format_line(variable, value))
|
||||
return label
|
||||
|
||||
def __init__(self, builder):
|
||||
super(ImageDetailsPage, self).__init__(builder, "Image details")
|
||||
|
||||
self.image_store = []
|
||||
self.button_ids = {}
|
||||
self.details_bottom_buttons = gtk.HBox(False, 6)
|
||||
self.create_visual_elements()
|
||||
|
||||
def create_visual_elements(self):
|
||||
# create visual elements
|
||||
# create the toolbar
|
||||
self.toolbar = gtk.Toolbar()
|
||||
self.toolbar.set_orientation(gtk.ORIENTATION_HORIZONTAL)
|
||||
self.toolbar.set_style(gtk.TOOLBAR_BOTH)
|
||||
|
||||
template_button = self.append_toolbar_button(self.toolbar,
|
||||
"Templates",
|
||||
hic.ICON_TEMPLATES_DISPLAY_FILE,
|
||||
hic.ICON_TEMPLATES_HOVER_FILE,
|
||||
"Load a previously saved template",
|
||||
self.template_button_clicked_cb)
|
||||
my_images_button = self.append_toolbar_button(self.toolbar,
|
||||
"Images",
|
||||
hic.ICON_IMAGES_DISPLAY_FILE,
|
||||
hic.ICON_IMAGES_HOVER_FILE,
|
||||
"Open previously built images",
|
||||
self.my_images_button_clicked_cb)
|
||||
settings_button = self.append_toolbar_button(self.toolbar,
|
||||
"Settings",
|
||||
hic.ICON_SETTINGS_DISPLAY_FILE,
|
||||
hic.ICON_SETTINGS_HOVER_FILE,
|
||||
"View additional build settings",
|
||||
self.settings_button_clicked_cb)
|
||||
|
||||
self.details_top_buttons = self.add_onto_top_bar(self.toolbar)
|
||||
|
||||
def _remove_all_widget(self):
|
||||
children = self.get_children() or []
|
||||
for child in children:
|
||||
self.remove(child)
|
||||
children = self.box_group_area.get_children() or []
|
||||
for child in children:
|
||||
self.box_group_area.remove(child)
|
||||
children = self.details_bottom_buttons.get_children() or []
|
||||
for child in children:
|
||||
self.details_bottom_buttons.remove(child)
|
||||
|
||||
def show_page(self, step):
|
||||
self.build_succeeded = (step == self.builder.IMAGE_GENERATED)
|
||||
image_addr = self.builder.parameters.image_addr
|
||||
image_names = self.builder.parameters.image_names
|
||||
if self.build_succeeded:
|
||||
machine = self.builder.configuration.curr_mach
|
||||
base_image = self.builder.recipe_model.get_selected_image()
|
||||
layers = self.builder.configuration.layers
|
||||
pkg_num = "%s" % len(self.builder.package_model.get_selected_packages())
|
||||
log_file = self.builder.current_logfile
|
||||
else:
|
||||
pkg_num = "N/A"
|
||||
log_file = None
|
||||
|
||||
# remove
|
||||
for button_id, button in self.button_ids.items():
|
||||
button.disconnect(button_id)
|
||||
self._remove_all_widget()
|
||||
|
||||
# repack
|
||||
self.pack_start(self.details_top_buttons, expand=False, fill=False)
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
|
||||
self.build_result = None
|
||||
if self.build_succeeded and self.builder.current_step == self.builder.IMAGE_GENERATING:
|
||||
# building is the previous step
|
||||
icon = gtk.Image()
|
||||
pixmap_path = hic.ICON_INDI_CONFIRM_FILE
|
||||
color = HobColors.RUNNING
|
||||
pix_buffer = gtk.gdk.pixbuf_new_from_file(pixmap_path)
|
||||
icon.set_from_pixbuf(pix_buffer)
|
||||
varlist = [""]
|
||||
vallist = ["Your image is ready"]
|
||||
self.build_result = self.BuildDetailBox(varlist=varlist, vallist=vallist, icon=icon, color=color)
|
||||
self.box_group_area.pack_start(self.build_result, expand=False, fill=False)
|
||||
|
||||
# create the buttons at the bottom first because the buttons are used in apply_button_per_image()
|
||||
if self.build_succeeded:
|
||||
self.buttonlist = ["Build new image", "Save as template", "Run image", "Deploy image"]
|
||||
else: # get to this page from "My images"
|
||||
self.buttonlist = ["Build new image", "Run image", "Deploy image"]
|
||||
|
||||
# Name
|
||||
self.image_store = []
|
||||
self.toggled_image = ""
|
||||
default_image_size = 0
|
||||
self.num_toggled = 0
|
||||
i = 0
|
||||
for image_name in image_names:
|
||||
image_size = HobPage._size_to_string(os.stat(os.path.join(image_addr, image_name)).st_size)
|
||||
|
||||
image_attr = ("run" if (self.test_type_runnable(image_name) and self.test_mach_runnable(image_name)) else \
|
||||
("deploy" if self.test_deployable(image_name) else ""))
|
||||
is_toggled = (image_attr != "")
|
||||
|
||||
if not self.toggled_image:
|
||||
if i == (len(image_names) - 1):
|
||||
is_toggled = True
|
||||
if is_toggled:
|
||||
default_image_size = image_size
|
||||
self.toggled_image = image_name
|
||||
|
||||
split_stuff = image_name.split('.')
|
||||
if "rootfs" in split_stuff:
|
||||
image_type = image_name[(len(split_stuff[0]) + len(".rootfs") + 1):]
|
||||
else:
|
||||
image_type = image_name[(len(split_stuff[0]) + 1):]
|
||||
|
||||
self.image_store.append({'name': image_name,
|
||||
'type': image_type,
|
||||
'size': image_size,
|
||||
'is_toggled': is_toggled,
|
||||
'action_attr': image_attr,})
|
||||
|
||||
i = i + 1
|
||||
self.num_toggled += is_toggled
|
||||
|
||||
is_runnable = self.create_bottom_buttons(self.buttonlist, self.toggled_image)
|
||||
|
||||
# Generated image files info
|
||||
varlist = ["Name: ", "Files created: ", "Directory: "]
|
||||
vallist = []
|
||||
|
||||
vallist.append(image_name.split('.')[0])
|
||||
vallist.append(', '.join(fileitem['type'] for fileitem in self.image_store))
|
||||
vallist.append(image_addr)
|
||||
|
||||
view_files_button = HobAltButton("View files")
|
||||
view_files_button.connect("clicked", self.view_files_clicked_cb, image_addr)
|
||||
view_files_button.set_tooltip_text("Open the directory containing the image files")
|
||||
open_log_button = None
|
||||
if log_file:
|
||||
open_log_button = HobAltButton("Open log")
|
||||
open_log_button.connect("clicked", self.open_log_clicked_cb, log_file)
|
||||
open_log_button.set_tooltip_text("Open the build's log file")
|
||||
self.image_detail = self.DetailBox(varlist=varlist, vallist=vallist, button=view_files_button, button2=open_log_button)
|
||||
self.box_group_area.pack_start(self.image_detail, expand=False, fill=True)
|
||||
|
||||
# The default kernel box for the qemu images
|
||||
self.sel_kernel = ""
|
||||
self.kernel_detail = None
|
||||
if 'qemu' in image_name:
|
||||
self.sel_kernel = self.get_kernel_file_name()
|
||||
|
||||
# varlist = ["Kernel: "]
|
||||
# vallist = []
|
||||
# vallist.append(self.sel_kernel)
|
||||
|
||||
# change_kernel_button = HobAltButton("Change")
|
||||
# change_kernel_button.connect("clicked", self.change_kernel_cb)
|
||||
# change_kernel_button.set_tooltip_text("Change qemu kernel file")
|
||||
# self.kernel_detail = self.DetailBox(varlist=varlist, vallist=vallist, button=change_kernel_button)
|
||||
# self.box_group_area.pack_start(self.kernel_detail, expand=True, fill=True)
|
||||
|
||||
# Machine, Base image and Layers
|
||||
layer_num_limit = 15
|
||||
varlist = ["Machine: ", "Base image: ", "Layers: "]
|
||||
vallist = []
|
||||
self.setting_detail = None
|
||||
if self.build_succeeded:
|
||||
vallist.append(machine)
|
||||
vallist.append(base_image)
|
||||
i = 0
|
||||
for layer in layers:
|
||||
varlist.append(" - ")
|
||||
if i > layer_num_limit:
|
||||
break
|
||||
i += 1
|
||||
vallist.append("")
|
||||
i = 0
|
||||
for layer in layers:
|
||||
if i > layer_num_limit:
|
||||
break
|
||||
elif i == layer_num_limit:
|
||||
vallist.append("and more...")
|
||||
else:
|
||||
vallist.append(layer)
|
||||
i += 1
|
||||
|
||||
edit_config_button = HobAltButton("Edit configuration")
|
||||
edit_config_button.set_tooltip_text("Edit machine, base image and recipes")
|
||||
edit_config_button.connect("clicked", self.edit_config_button_clicked_cb)
|
||||
self.setting_detail = self.DetailBox(varlist=varlist, vallist=vallist, button=edit_config_button)
|
||||
self.box_group_area.pack_start(self.setting_detail, expand=True, fill=True)
|
||||
|
||||
# Packages included, and Total image size
|
||||
varlist = ["Packages included: ", "Total image size: "]
|
||||
vallist = []
|
||||
vallist.append(pkg_num)
|
||||
vallist.append(default_image_size)
|
||||
if self.build_succeeded:
|
||||
edit_packages_button = HobAltButton("Edit packages")
|
||||
edit_packages_button.set_tooltip_text("Edit the packages included in your image")
|
||||
edit_packages_button.connect("clicked", self.edit_packages_button_clicked_cb)
|
||||
else: # get to this page from "My images"
|
||||
edit_packages_button = None
|
||||
self.package_detail = self.DetailBox(varlist=varlist, vallist=vallist, button=edit_packages_button)
|
||||
self.box_group_area.pack_start(self.package_detail, expand=True, fill=True)
|
||||
|
||||
# pack the buttons at the bottom, at this time they are already created.
|
||||
if self.build_succeeded:
|
||||
self.box_group_area.pack_end(self.details_bottom_buttons, expand=False, fill=False)
|
||||
else: # for "My images" page
|
||||
self.details_separator = gtk.HSeparator()
|
||||
self.box_group_area.pack_start(self.details_separator, expand=False, fill=False)
|
||||
self.box_group_area.pack_start(self.details_bottom_buttons, expand=False, fill=False)
|
||||
|
||||
self.show_all()
|
||||
if self.kernel_detail and (not is_runnable):
|
||||
self.kernel_detail.hide()
|
||||
|
||||
def view_files_clicked_cb(self, button, image_addr):
|
||||
subprocess.call("xdg-open /%s" % image_addr, shell=True)
|
||||
|
||||
def open_log_clicked_cb(self, button, log_file):
|
||||
if log_file:
|
||||
self.stop = False
|
||||
dialog = OpeningLogDialog(title = "Opening Log",
|
||||
parent = None,
|
||||
flags = gtk.DIALOG_MODAL
|
||||
| gtk.DIALOG_DESTROY_WITH_PARENT
|
||||
| gtk.DIALOG_NO_SEPARATOR)
|
||||
#create a thread to open log file
|
||||
background = OpeningLogThread(dialog, log_file, self)
|
||||
background.start()
|
||||
response = dialog.run()
|
||||
self.stop = True
|
||||
background.join()
|
||||
|
||||
def refresh_package_detail_box(self, image_size):
|
||||
self.package_detail.update_line_widgets("Total image size: ", image_size)
|
||||
|
||||
def test_type_runnable(self, image_name):
|
||||
type_runnable = False
|
||||
for t in self.builder.parameters.runnable_image_types:
|
||||
if image_name.endswith(t):
|
||||
type_runnable = True
|
||||
break
|
||||
return type_runnable
|
||||
|
||||
def test_mach_runnable(self, image_name):
|
||||
mach_runnable = False
|
||||
for t in self.builder.parameters.runnable_machine_patterns:
|
||||
if t in image_name:
|
||||
mach_runnable = True
|
||||
break
|
||||
return mach_runnable
|
||||
|
||||
def test_deployable(self, image_name):
|
||||
if self.builder.configuration.curr_mach.startswith("qemu"):
|
||||
return False
|
||||
deployable = False
|
||||
for t in self.builder.parameters.deployable_image_types:
|
||||
if image_name.endswith(t):
|
||||
deployable = True
|
||||
break
|
||||
return deployable
|
||||
|
||||
def get_kernel_file_name(self, kernel_addr=""):
|
||||
kernel_name = ""
|
||||
|
||||
if not kernel_addr:
|
||||
kernel_addr = self.builder.parameters.image_addr
|
||||
|
||||
files = [f for f in os.listdir(kernel_addr) if f[0] <> '.']
|
||||
for check_file in files:
|
||||
if check_file.endswith(".bin"):
|
||||
name_splits = check_file.split(".")[0]
|
||||
if self.builder.parameters.kernel_image_type in name_splits.split("-"):
|
||||
kernel_name = check_file
|
||||
break
|
||||
|
||||
return kernel_name
|
||||
|
||||
def show_builded_images_dialog(self, widget, primary_action=""):
|
||||
title = primary_action if primary_action else "Your builded images"
|
||||
dialog = CrumbsDialog(title, self.builder,
|
||||
gtk.DIALOG_MODAL | gtk.DIALOG_DESTROY_WITH_PARENT)
|
||||
dialog.set_border_width(12)
|
||||
|
||||
label = gtk.Label()
|
||||
label.set_use_markup(True)
|
||||
label.set_alignment(0.0, 0.5)
|
||||
label.set_padding(12,0)
|
||||
if primary_action == "Run image":
|
||||
label.set_markup("<span font_desc='12'>Select the image file you want to run:</span>")
|
||||
elif primary_action == "Deploy image":
|
||||
label.set_markup("<span font_desc='12'>Select the image file you want to deploy:</span>")
|
||||
else:
|
||||
label.set_markup("<span font_desc='12'>Select the image file you want to %s</span>" % primary_action)
|
||||
dialog.vbox.pack_start(label, expand=False, fill=False)
|
||||
|
||||
# filter created images as action attribution (deploy or run)
|
||||
action_attr = ""
|
||||
action_images = []
|
||||
for fileitem in self.image_store:
|
||||
action_attr = fileitem['action_attr']
|
||||
if (action_attr == 'run' and primary_action == "Run image") \
|
||||
or (action_attr == 'deploy' and primary_action == "Deploy image"):
|
||||
action_images.append(fileitem)
|
||||
|
||||
# pack the corresponding 'runnable' or 'deploy' radio_buttons, if there has no more than one file.
|
||||
# assume that there does not both have 'deploy' and 'runnable' files in the same building result
|
||||
# in possible as design.
|
||||
curr_row = 0
|
||||
rows = (len(action_images)) if len(action_images) < 10 else 10
|
||||
table = gtk.Table(rows, 10, True)
|
||||
table.set_row_spacings(6)
|
||||
table.set_col_spacing(0, 12)
|
||||
table.set_col_spacing(5, 12)
|
||||
|
||||
sel_parent_btn = None
|
||||
for fileitem in action_images:
|
||||
sel_btn = gtk.RadioButton(sel_parent_btn, fileitem['type'])
|
||||
sel_parent_btn = sel_btn if not sel_parent_btn else sel_parent_btn
|
||||
sel_btn.set_active(fileitem['is_toggled'])
|
||||
sel_btn.connect('toggled', self.table_selected_cb, fileitem)
|
||||
if curr_row < 10:
|
||||
table.attach(sel_btn, 0, 4, curr_row, curr_row + 1, xpadding=24)
|
||||
else:
|
||||
table.attach(sel_btn, 5, 9, curr_row - 10, curr_row - 9, xpadding=24)
|
||||
curr_row += 1
|
||||
|
||||
dialog.vbox.pack_start(table, expand=False, fill=False, padding=6)
|
||||
|
||||
button = dialog.add_button("Cancel", gtk.RESPONSE_CANCEL)
|
||||
HobAltButton.style_button(button)
|
||||
|
||||
if primary_action:
|
||||
button = dialog.add_button(primary_action, gtk.RESPONSE_YES)
|
||||
HobButton.style_button(button)
|
||||
|
||||
dialog.show_all()
|
||||
|
||||
response = dialog.run()
|
||||
dialog.destroy()
|
||||
|
||||
if response != gtk.RESPONSE_YES:
|
||||
return
|
||||
|
||||
for fileitem in self.image_store:
|
||||
if fileitem['is_toggled']:
|
||||
if fileitem['action_attr'] == 'run':
|
||||
self.builder.runqemu_image(fileitem['name'], self.sel_kernel)
|
||||
elif fileitem['action_attr'] == 'deploy':
|
||||
self.builder.deploy_image(fileitem['name'])
|
||||
|
||||
def table_selected_cb(self, tbutton, image):
|
||||
image['is_toggled'] = tbutton.get_active()
|
||||
if image['is_toggled']:
|
||||
self.toggled_image = image['name']
|
||||
|
||||
def change_kernel_cb(self, widget):
|
||||
kernel_path = self.builder.show_load_kernel_dialog()
|
||||
if kernel_path and self.kernel_detail:
|
||||
import os.path
|
||||
self.sel_kernel = os.path.basename(kernel_path)
|
||||
markup = self.kernel_detail.format_line("Kernel: ", self.sel_kernel)
|
||||
label = ((self.kernel_detail.get_children()[0]).get_children()[0]).get_children()[0]
|
||||
label.set_markup(markup)
|
||||
|
||||
def create_bottom_buttons(self, buttonlist, image_name):
|
||||
# Create the buttons at the bottom
|
||||
created = False
|
||||
packed = False
|
||||
self.button_ids = {}
|
||||
is_runnable = False
|
||||
|
||||
# create button "Deploy image"
|
||||
name = "Deploy image"
|
||||
if name in buttonlist and self.test_deployable(image_name):
|
||||
deploy_button = HobButton('Deploy image')
|
||||
#deploy_button.set_size_request(205, 49)
|
||||
deploy_button.set_tooltip_text("Burn a live image to a USB drive or flash memory")
|
||||
deploy_button.set_flags(gtk.CAN_DEFAULT)
|
||||
button_id = deploy_button.connect("clicked", self.deploy_button_clicked_cb)
|
||||
self.button_ids[button_id] = deploy_button
|
||||
self.details_bottom_buttons.pack_end(deploy_button, expand=False, fill=False)
|
||||
created = True
|
||||
packed = True
|
||||
|
||||
name = "Run image"
|
||||
if name in buttonlist and self.test_type_runnable(image_name) and self.test_mach_runnable(image_name):
|
||||
if created == True:
|
||||
# separator
|
||||
#label = gtk.Label(" or ")
|
||||
#self.details_bottom_buttons.pack_end(label, expand=False, fill=False)
|
||||
|
||||
# create button "Run image"
|
||||
run_button = HobAltButton("Run image")
|
||||
else:
|
||||
# create button "Run image" as the primary button
|
||||
run_button = HobButton("Run image")
|
||||
#run_button.set_size_request(205, 49)
|
||||
run_button.set_flags(gtk.CAN_DEFAULT)
|
||||
packed = True
|
||||
run_button.set_tooltip_text("Start up an image with qemu emulator")
|
||||
button_id = run_button.connect("clicked", self.run_button_clicked_cb)
|
||||
self.button_ids[button_id] = run_button
|
||||
self.details_bottom_buttons.pack_end(run_button, expand=False, fill=False)
|
||||
created = True
|
||||
is_runnable = True
|
||||
|
||||
name = "Save as template"
|
||||
if name in buttonlist:
|
||||
if created == True:
|
||||
# separator
|
||||
#label = gtk.Label(" or ")
|
||||
#self.details_bottom_buttons.pack_end(label, expand=False, fill=False)
|
||||
|
||||
# create button "Save as template"
|
||||
save_button = HobAltButton("Save as template")
|
||||
else:
|
||||
save_button = HobButton("Save as template")
|
||||
#save_button.set_size_request(205, 49)
|
||||
save_button.set_flags(gtk.CAN_DEFAULT)
|
||||
packed = True
|
||||
save_button.set_tooltip_text("Save the image configuration for reuse")
|
||||
button_id = save_button.connect("clicked", self.save_button_clicked_cb)
|
||||
self.button_ids[button_id] = save_button
|
||||
self.details_bottom_buttons.pack_end(save_button, expand=False, fill=False)
|
||||
create = True
|
||||
|
||||
name = "Build new image"
|
||||
if name in buttonlist:
|
||||
# create button "Build new image"
|
||||
if packed:
|
||||
build_new_button = HobAltButton("Build new image")
|
||||
else:
|
||||
build_new_button = HobButton("Build new image")
|
||||
build_new_button.set_flags(gtk.CAN_DEFAULT)
|
||||
#build_new_button.set_size_request(205, 49)
|
||||
self.details_bottom_buttons.pack_end(build_new_button, expand=False, fill=False)
|
||||
build_new_button.set_tooltip_text("Create a new image from scratch")
|
||||
button_id = build_new_button.connect("clicked", self.build_new_button_clicked_cb)
|
||||
self.button_ids[button_id] = build_new_button
|
||||
|
||||
return is_runnable
|
||||
|
||||
def save_button_clicked_cb(self, button):
|
||||
self.builder.show_save_template_dialog()
|
||||
|
||||
def deploy_button_clicked_cb(self, button):
|
||||
if self.toggled_image:
|
||||
if self.num_toggled > 1:
|
||||
self.set_sensitive(False)
|
||||
self.show_builded_images_dialog(None, "Deploy image")
|
||||
self.set_sensitive(True)
|
||||
else:
|
||||
self.builder.deploy_image(self.toggled_image)
|
||||
|
||||
def run_button_clicked_cb(self, button):
|
||||
if self.toggled_image:
|
||||
if self.num_toggled > 1:
|
||||
self.set_sensitive(False)
|
||||
self.show_builded_images_dialog(None, "Run image")
|
||||
self.set_sensitive(True)
|
||||
else:
|
||||
self.builder.runqemu_image(self.toggled_image, self.sel_kernel)
|
||||
|
||||
def build_new_button_clicked_cb(self, button):
|
||||
self.builder.initiate_new_build_async()
|
||||
|
||||
def edit_config_button_clicked_cb(self, button):
|
||||
self.builder.show_configuration()
|
||||
|
||||
def edit_packages_button_clicked_cb(self, button):
|
||||
self.builder.show_packages(ask=False)
|
||||
|
||||
def template_button_clicked_cb(self, button):
|
||||
response, path = self.builder.show_load_template_dialog()
|
||||
if not response:
|
||||
return
|
||||
if path:
|
||||
self.builder.load_template(path)
|
||||
|
||||
def my_images_button_clicked_cb(self, button):
|
||||
self.builder.show_load_my_images_dialog()
|
||||
|
||||
def settings_button_clicked_cb(self, button):
|
||||
# Create an advanced settings dialog
|
||||
response, settings_changed = self.builder.show_simple_settings_dialog()
|
||||
if not response:
|
||||
return
|
||||
if settings_changed:
|
||||
self.builder.reparse_post_adv_settings()
|
||||
@@ -1,299 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import glib
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
from bb.ui.crumbs.hobwidget import HobViewTable, HobNotebook, HobAltButton, HobButton
|
||||
from bb.ui.crumbs.hoblistmodel import PackageListModel
|
||||
from bb.ui.crumbs.hobpages import HobPage
|
||||
from bb.ui.crumbs.hobthreads import OpeningLogThread
|
||||
from bb.ui.crumbs.hig import OpeningLogDialog
|
||||
|
||||
#
|
||||
# PackageSelectionPage
|
||||
#
|
||||
class PackageSelectionPage (HobPage):
|
||||
|
||||
pages = [
|
||||
{
|
||||
'name' : 'Included packages',
|
||||
'tooltip' : 'The packages currently included for your image',
|
||||
'filter' : { PackageListModel.COL_INC : [True] },
|
||||
'columns' : [{
|
||||
'col_name' : 'Package name',
|
||||
'col_id' : PackageListModel.COL_NAME,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 300,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Size',
|
||||
'col_id' : PackageListModel.COL_SIZE,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 300,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Brought in by (+others)',
|
||||
'col_id' : PackageListModel.COL_BINB,
|
||||
'col_style': 'binb',
|
||||
'col_min' : 100,
|
||||
'col_max' : 350,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Included',
|
||||
'col_id' : PackageListModel.COL_INC,
|
||||
'col_style': 'check toggle',
|
||||
'col_min' : 100,
|
||||
'col_max' : 100
|
||||
}]
|
||||
}, {
|
||||
'name' : 'All packages',
|
||||
'tooltip' : 'All packages that have been built',
|
||||
'filter' : {},
|
||||
'columns' : [{
|
||||
'col_name' : 'Package name',
|
||||
'col_id' : PackageListModel.COL_NAME,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 400,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Size',
|
||||
'col_id' : PackageListModel.COL_SIZE,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 500,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Included',
|
||||
'col_id' : PackageListModel.COL_INC,
|
||||
'col_style': 'check toggle',
|
||||
'col_min' : 100,
|
||||
'col_max' : 100
|
||||
}]
|
||||
}
|
||||
]
|
||||
|
||||
(INCLUDED,
|
||||
ALL) = range(2)
|
||||
|
||||
def __init__(self, builder):
|
||||
super(PackageSelectionPage, self).__init__(builder, "Edit packages")
|
||||
|
||||
# set invisiable members
|
||||
self.recipe_model = self.builder.recipe_model
|
||||
self.package_model = self.builder.package_model
|
||||
|
||||
# create visual elements
|
||||
self.create_visual_elements()
|
||||
|
||||
def included_clicked_cb(self, button):
|
||||
self.ins.set_current_page(self.INCLUDED)
|
||||
|
||||
def create_visual_elements(self):
|
||||
self.label = gtk.Label("Packages included: 0\nSelected packages size: 0 MB")
|
||||
self.eventbox = self.add_onto_top_bar(self.label, 73)
|
||||
self.pack_start(self.eventbox, expand=False, fill=False)
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
|
||||
# set visible members
|
||||
self.ins = HobNotebook()
|
||||
self.tables = [] # we need to modify table when the dialog is shown
|
||||
# append the tab
|
||||
for page in self.pages:
|
||||
columns = page['columns']
|
||||
tab = HobViewTable(columns)
|
||||
filter = page['filter']
|
||||
tab.set_model(self.package_model.tree_model(filter))
|
||||
tab.connect("toggled", self.table_toggled_cb, page['name'])
|
||||
if page['name'] == "Included packages":
|
||||
tab.connect("button-release-event", self.button_click_cb)
|
||||
tab.connect("cell-fadeinout-stopped", self.after_fadeout_checkin_include)
|
||||
self.ins.append_page(tab, page['name'], page['tooltip'])
|
||||
self.tables.append(tab)
|
||||
|
||||
self.ins.set_entry("Search packages:")
|
||||
# set the search entry for each table
|
||||
for tab in self.tables:
|
||||
search_tip = "Enter a package name to find it"
|
||||
self.ins.search.set_tooltip_text(search_tip)
|
||||
self.ins.search.props.has_tooltip = True
|
||||
tab.set_search_entry(0, self.ins.search)
|
||||
|
||||
# add all into the dialog
|
||||
self.box_group_area.pack_start(self.ins, expand=True, fill=True)
|
||||
|
||||
self.button_box = gtk.HBox(False, 6)
|
||||
self.box_group_area.pack_start(self.button_box, expand=False, fill=False)
|
||||
|
||||
self.build_image_button = HobButton('Build image')
|
||||
#self.build_image_button.set_size_request(205, 49)
|
||||
self.build_image_button.set_tooltip_text("Build target image")
|
||||
self.build_image_button.set_flags(gtk.CAN_DEFAULT)
|
||||
self.build_image_button.grab_default()
|
||||
self.build_image_button.connect("clicked", self.build_image_clicked_cb)
|
||||
self.button_box.pack_end(self.build_image_button, expand=False, fill=False)
|
||||
|
||||
self.back_button = HobAltButton('Cancel')
|
||||
self.back_button.connect("clicked", self.back_button_clicked_cb)
|
||||
self.button_box.pack_end(self.back_button, expand=False, fill=False)
|
||||
|
||||
def button_click_cb(self, widget, event):
|
||||
path, col = widget.table_tree.get_cursor()
|
||||
tree_model = widget.table_tree.get_model()
|
||||
if path: # else activation is likely a removal
|
||||
binb = tree_model.get_value(tree_model.get_iter(path), PackageListModel.COL_BINB)
|
||||
if binb:
|
||||
self.builder.show_binb_dialog(binb)
|
||||
|
||||
def open_log_clicked_cb(self, button, log_file):
|
||||
if log_file:
|
||||
self.stop = False
|
||||
dialog = OpeningLogDialog(title = "Opening Log",
|
||||
parent = None,
|
||||
flags = gtk.DIALOG_MODAL
|
||||
| gtk.DIALOG_DESTROY_WITH_PARENT
|
||||
| gtk.DIALOG_NO_SEPARATOR)
|
||||
#create a thread to open log file
|
||||
background = OpeningLogThread(dialog, log_file, self)
|
||||
background.start()
|
||||
response = dialog.run()
|
||||
self.stop = True
|
||||
background.join()
|
||||
|
||||
def show_page(self, log_file):
|
||||
children = self.button_box.get_children() or []
|
||||
for child in children:
|
||||
self.button_box.remove(child)
|
||||
# re-packed the buttons as request, add the 'open log' button if build success
|
||||
self.button_box.pack_end(self.build_image_button, expand=False, fill=False)
|
||||
if log_file:
|
||||
open_log_button = HobAltButton("Open log")
|
||||
open_log_button.connect("clicked", self.open_log_clicked_cb, log_file)
|
||||
open_log_button.set_tooltip_text("Open the build's log file")
|
||||
self.button_box.pack_end(open_log_button, expand=False, fill=False)
|
||||
self.button_box.pack_end(self.back_button, expand=False, fill=False)
|
||||
self.show_all()
|
||||
|
||||
def build_image_clicked_cb(self, button):
|
||||
self.builder.build_image()
|
||||
|
||||
def back_button_clicked_cb(self, button):
|
||||
if self.builder.previous_step == self.builder.IMAGE_GENERATED:
|
||||
self.builder.restore_initial_selected_packages()
|
||||
self.refresh_selection()
|
||||
self.builder.show_image_details()
|
||||
else:
|
||||
self.builder.show_configuration()
|
||||
|
||||
def _expand_all(self):
|
||||
for tab in self.tables:
|
||||
tab.table_tree.expand_all()
|
||||
|
||||
def refresh_selection(self):
|
||||
self._expand_all()
|
||||
|
||||
self.builder.configuration.selected_packages = self.package_model.get_selected_packages()
|
||||
self.builder.configuration.user_selected_packages = self.package_model.get_user_selected_packages()
|
||||
selected_packages_num = len(self.builder.configuration.selected_packages)
|
||||
selected_packages_size = self.package_model.get_packages_size()
|
||||
selected_packages_size_str = HobPage._size_to_string(selected_packages_size)
|
||||
|
||||
image_overhead_factor = self.builder.configuration.image_overhead_factor
|
||||
image_rootfs_size = self.builder.configuration.image_rootfs_size / 1024 # image_rootfs_size is KB
|
||||
image_extra_size = self.builder.configuration.image_extra_size / 1024 # image_extra_size is KB
|
||||
base_size = image_overhead_factor * selected_packages_size
|
||||
image_total_size = max(base_size, image_rootfs_size) + image_extra_size
|
||||
if "zypper" in self.builder.configuration.selected_packages:
|
||||
image_total_size += (51200 * 1024)
|
||||
image_total_size_str = HobPage._size_to_string(image_total_size)
|
||||
|
||||
self.label.set_label("Packages included: %s\nSelected packages size: %s\nTotal image size: %s" %
|
||||
(selected_packages_num, selected_packages_size_str, image_total_size_str))
|
||||
self.ins.show_indicator_icon("Included packages", selected_packages_num)
|
||||
|
||||
def toggle_item_idle_cb(self, path, view_tree, cell, pagename):
|
||||
if not self.package_model.path_included(path):
|
||||
self.package_model.include_item(item_path=path, binb="User Selected")
|
||||
else:
|
||||
if pagename == "Included packages":
|
||||
self.pre_fadeout_checkout_include(view_tree)
|
||||
self.package_model.exclude_item(item_path=path)
|
||||
self.render_fadeout(view_tree, cell)
|
||||
else:
|
||||
self.package_model.exclude_item(item_path=path)
|
||||
|
||||
self.refresh_selection()
|
||||
if not self.builder.customized:
|
||||
self.builder.customized = True
|
||||
self.builder.configuration.selected_image = self.recipe_model.__custom_image__
|
||||
self.builder.rcppkglist_populated()
|
||||
|
||||
self.builder.window_sensitive(True)
|
||||
|
||||
def table_toggled_cb(self, table, cell, view_path, toggled_columnid, view_tree, pagename):
|
||||
# Click to include a package
|
||||
self.builder.window_sensitive(False)
|
||||
view_model = view_tree.get_model()
|
||||
path = self.package_model.convert_vpath_to_path(view_model, view_path)
|
||||
glib.idle_add(self.toggle_item_idle_cb, path, view_tree, cell, pagename)
|
||||
|
||||
def pre_fadeout_checkout_include(self, tree):
|
||||
self.package_model.resync_fadeout_column(self.package_model.get_iter_first())
|
||||
# Check out a model which base on the column COL_FADE_INC,
|
||||
# it's save the prev state of column COL_INC before do exclude_item
|
||||
filter = { PackageListModel.COL_FADE_INC : [True]}
|
||||
new_model = self.package_model.tree_model(filter)
|
||||
tree.set_model(new_model)
|
||||
tree.expand_all()
|
||||
|
||||
def get_excluded_rows(self, to_render_cells, model, it):
|
||||
while it:
|
||||
path = model.get_path(it)
|
||||
prev_cell_is_active = model.get_value(it, PackageListModel.COL_FADE_INC)
|
||||
curr_cell_is_active = model.get_value(it, PackageListModel.COL_INC)
|
||||
if (prev_cell_is_active == True) and (curr_cell_is_active == False):
|
||||
to_render_cells.append(path)
|
||||
if model.iter_has_child(it):
|
||||
self.get_excluded_rows(to_render_cells, model, model.iter_children(it))
|
||||
it = model.iter_next(it)
|
||||
|
||||
return to_render_cells
|
||||
|
||||
def render_fadeout(self, tree, cell):
|
||||
if (not cell) or (not tree):
|
||||
return
|
||||
to_render_cells = []
|
||||
view_model = tree.get_model()
|
||||
self.get_excluded_rows(to_render_cells, view_model, view_model.get_iter_first())
|
||||
|
||||
cell.fadeout(tree, 1000, to_render_cells)
|
||||
|
||||
def after_fadeout_checkin_include(self, table, ctrl, cell, tree):
|
||||
tree.set_model(self.package_model.tree_model(self.pages[0]['filter']))
|
||||
tree.expand_all()
|
||||
|
||||
def set_packages_curr_tab(self, curr_page):
|
||||
self.ins.set_current_page(curr_page)
|
||||
|
||||
@@ -1,186 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gobject
|
||||
import gtk
|
||||
try:
|
||||
import gconf
|
||||
except:
|
||||
pass
|
||||
|
||||
class PersistentTooltip(gtk.Window):
|
||||
"""
|
||||
A tooltip which persists once shown until the user dismisses it with the Esc
|
||||
key or by clicking the close button.
|
||||
|
||||
# FIXME: the PersistentTooltip should be disabled when the user clicks anywhere off
|
||||
# it. We can't do this with focus-out-event becuase modal ensures we have focus?
|
||||
|
||||
markup: some Pango text markup to display in the tooltip
|
||||
"""
|
||||
def __init__(self, markup, parent_win=None):
|
||||
gtk.Window.__init__(self, gtk.WINDOW_POPUP)
|
||||
|
||||
# Inherit the system theme for a tooltip
|
||||
style = gtk.rc_get_style_by_paths(gtk.settings_get_default(),
|
||||
'gtk-tooltip', 'gtk-tooltip', gobject.TYPE_NONE)
|
||||
self.set_style(style)
|
||||
|
||||
# The placement of the close button on the tip should reflect how the
|
||||
# window manager of the users system places close buttons. Try to read
|
||||
# the metacity gconf key to determine whether the close button is on the
|
||||
# left or the right.
|
||||
# In the case that we can't determine the users configuration we default
|
||||
# to close buttons being on the right.
|
||||
__button_right = True
|
||||
try:
|
||||
client = gconf.client_get_default()
|
||||
order = client.get_string("/apps/metacity/general/button_layout")
|
||||
if order and order.endswith(":"):
|
||||
__button_right = False
|
||||
except NameError:
|
||||
pass
|
||||
|
||||
# We need to ensure we're only shown once
|
||||
self.shown = False
|
||||
|
||||
# We don't want any WM decorations
|
||||
self.set_decorated(False)
|
||||
# We don't want to show in the taskbar or window switcher
|
||||
self.set_skip_pager_hint(True)
|
||||
self.set_skip_taskbar_hint(True)
|
||||
# We must be modal to ensure we grab focus when presented from a gtk.Dialog
|
||||
self.set_modal(True)
|
||||
|
||||
self.set_border_width(0)
|
||||
self.set_position(gtk.WIN_POS_MOUSE)
|
||||
self.set_opacity(0.95)
|
||||
|
||||
# Ensure a reasonable minimum size
|
||||
self.set_geometry_hints(self, 100, 50)
|
||||
|
||||
# Set this window as a transient window for parent(main window)
|
||||
if parent_win:
|
||||
self.set_transient_for(parent_win)
|
||||
self.set_destroy_with_parent(True)
|
||||
# Draw our label and close buttons
|
||||
hbox = gtk.HBox(False, 0)
|
||||
hbox.show()
|
||||
self.add(hbox)
|
||||
|
||||
img = gtk.Image()
|
||||
img.set_from_stock(gtk.STOCK_CLOSE, gtk.ICON_SIZE_BUTTON)
|
||||
|
||||
self.button = gtk.Button()
|
||||
self.button.set_image(img)
|
||||
self.button.connect("clicked", self._dismiss_cb)
|
||||
self.button.set_flags(gtk.CAN_DEFAULT)
|
||||
self.button.grab_focus()
|
||||
self.button.show()
|
||||
vbox = gtk.VBox(False, 0)
|
||||
vbox.show()
|
||||
vbox.pack_start(self.button, False, False, 0)
|
||||
if __button_right:
|
||||
hbox.pack_end(vbox, True, True, 0)
|
||||
else:
|
||||
hbox.pack_start(vbox, True, True, 0)
|
||||
|
||||
self.set_default(self.button)
|
||||
|
||||
bin = gtk.HBox(True, 6)
|
||||
bin.set_border_width(6)
|
||||
bin.show()
|
||||
self.label = gtk.Label()
|
||||
self.label.set_line_wrap(True)
|
||||
# We want to match the colours of the normal tooltips, as dictated by
|
||||
# the users gtk+-2.0 theme, wherever possible - on some systems this
|
||||
# requires explicitly setting a fg_color for the label which matches the
|
||||
# tooltip_fg_color
|
||||
settings = gtk.settings_get_default()
|
||||
colours = settings.get_property('gtk-color-scheme').split('\n')
|
||||
# remove any empty lines, there's likely to be a trailing one after
|
||||
# calling split on a dictionary-like string
|
||||
colours = filter(None, colours)
|
||||
for col in colours:
|
||||
item, val = col.split(': ')
|
||||
if item == 'tooltip_fg_color':
|
||||
style = self.label.get_style()
|
||||
style.fg[gtk.STATE_NORMAL] = gtk.gdk.color_parse(val)
|
||||
self.label.set_style(style)
|
||||
break # we only care for the tooltip_fg_color
|
||||
|
||||
self.label.set_markup(markup)
|
||||
self.label.show()
|
||||
bin.add(self.label)
|
||||
hbox.pack_end(bin, True, True, 6)
|
||||
|
||||
# add the original URL display for user reference
|
||||
if 'a href' in markup:
|
||||
hbox.set_tooltip_text(self.get_markup_url(markup))
|
||||
hbox.show()
|
||||
|
||||
self.connect("key-press-event", self._catch_esc_cb)
|
||||
|
||||
"""
|
||||
Callback when the PersistentTooltip's close button is clicked.
|
||||
Hides the PersistentTooltip.
|
||||
"""
|
||||
def _dismiss_cb(self, button):
|
||||
self.hide()
|
||||
return True
|
||||
|
||||
"""
|
||||
Callback when the Esc key is detected. Hides the PersistentTooltip.
|
||||
"""
|
||||
def _catch_esc_cb(self, widget, event):
|
||||
keyname = gtk.gdk.keyval_name(event.keyval)
|
||||
if keyname == "Escape":
|
||||
self.hide()
|
||||
return True
|
||||
|
||||
"""
|
||||
Called to present the PersistentTooltip.
|
||||
Overrides the superclasses show() method to include state tracking.
|
||||
"""
|
||||
def show(self):
|
||||
if not self.shown:
|
||||
self.shown = True
|
||||
gtk.Window.show(self)
|
||||
|
||||
"""
|
||||
Called to hide the PersistentTooltip.
|
||||
Overrides the superclasses hide() method to include state tracking.
|
||||
"""
|
||||
def hide(self):
|
||||
self.shown = False
|
||||
gtk.Window.hide(self)
|
||||
|
||||
"""
|
||||
Called to get the hyperlink URL from markup text.
|
||||
"""
|
||||
def get_markup_url(self, markup):
|
||||
url = "http:"
|
||||
if markup and type(markup) == str:
|
||||
s = markup
|
||||
if 'http:' in s:
|
||||
import re
|
||||
url = re.search('(http:[^,\\ "]+)', s).group(0)
|
||||
|
||||
return url
|
||||
@@ -11,9 +11,6 @@ class ProgressBar(gtk.Dialog):
|
||||
self.vbox.pack_start(self.progress)
|
||||
self.show_all()
|
||||
|
||||
def set_text(self, msg):
|
||||
self.progress.set_text(msg)
|
||||
|
||||
def update(self, x, y):
|
||||
self.progress.set_fraction(float(x)/float(y))
|
||||
self.progress.set_text("%2d %%" % (x*100/y))
|
||||
|
||||
@@ -1,59 +0,0 @@
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011 Intel Corporation
|
||||
#
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
|
||||
class HobProgressBar (gtk.ProgressBar):
|
||||
def __init__(self):
|
||||
gtk.ProgressBar.__init__(self)
|
||||
self.set_rcstyle(True)
|
||||
self.percentage = 0
|
||||
|
||||
def set_rcstyle(self, status):
|
||||
rcstyle = gtk.RcStyle()
|
||||
rcstyle.fg[2] = gtk.gdk.Color(HobColors.BLACK)
|
||||
if status == "stop":
|
||||
rcstyle.bg[3] = gtk.gdk.Color(HobColors.WARNING)
|
||||
elif status == "fail":
|
||||
rcstyle.bg[3] = gtk.gdk.Color(HobColors.ERROR)
|
||||
else:
|
||||
rcstyle.bg[3] = gtk.gdk.Color(HobColors.RUNNING)
|
||||
self.modify_style(rcstyle)
|
||||
|
||||
def set_title(self, text=None):
|
||||
if not text:
|
||||
text = ""
|
||||
text += " %.0f%%" % self.percentage
|
||||
self.set_text(text)
|
||||
|
||||
def set_stop_title(self, text=None):
|
||||
if not text:
|
||||
text = ""
|
||||
self.set_text(text)
|
||||
|
||||
def reset(self):
|
||||
self.set_fraction(0)
|
||||
self.set_text("")
|
||||
self.set_rcstyle(True)
|
||||
self.percentage = 0
|
||||
|
||||
def update(self, fraction):
|
||||
self.percentage = int(fraction * 100)
|
||||
self.set_fraction(fraction)
|
||||
@@ -1,266 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import glib
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
from bb.ui.crumbs.hobwidget import HobViewTable, HobNotebook, HobAltButton, HobButton
|
||||
from bb.ui.crumbs.hoblistmodel import RecipeListModel
|
||||
from bb.ui.crumbs.hobpages import HobPage
|
||||
|
||||
#
|
||||
# RecipeSelectionPage
|
||||
#
|
||||
class RecipeSelectionPage (HobPage):
|
||||
pages = [
|
||||
{
|
||||
'name' : 'Included recipes',
|
||||
'tooltip' : 'The recipes currently included for your image',
|
||||
'filter' : { RecipeListModel.COL_INC : [True],
|
||||
RecipeListModel.COL_TYPE : ['recipe', 'packagegroup'] },
|
||||
'columns' : [{
|
||||
'col_name' : 'Recipe name',
|
||||
'col_id' : RecipeListModel.COL_NAME,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 400,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Group',
|
||||
'col_id' : RecipeListModel.COL_GROUP,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 300,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Brought in by (+others)',
|
||||
'col_id' : RecipeListModel.COL_BINB,
|
||||
'col_style': 'binb',
|
||||
'col_min' : 100,
|
||||
'col_max' : 500,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Included',
|
||||
'col_id' : RecipeListModel.COL_INC,
|
||||
'col_style': 'check toggle',
|
||||
'col_min' : 100,
|
||||
'col_max' : 100
|
||||
}]
|
||||
}, {
|
||||
'name' : 'All recipes',
|
||||
'tooltip' : 'All recipes in your configured layers',
|
||||
'filter' : { RecipeListModel.COL_TYPE : ['recipe'] },
|
||||
'columns' : [{
|
||||
'col_name' : 'Recipe name',
|
||||
'col_id' : RecipeListModel.COL_NAME,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 400,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Group',
|
||||
'col_id' : RecipeListModel.COL_GROUP,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 400,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'License',
|
||||
'col_id' : RecipeListModel.COL_LIC,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 400,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Included',
|
||||
'col_id' : RecipeListModel.COL_INC,
|
||||
'col_style': 'check toggle',
|
||||
'col_min' : 100,
|
||||
'col_max' : 100
|
||||
}]
|
||||
}, {
|
||||
'name' : 'Package Groups',
|
||||
'tooltip' : 'All package groups in your configured layers',
|
||||
'filter' : { RecipeListModel.COL_TYPE : ['packagegroup'] },
|
||||
'columns' : [{
|
||||
'col_name' : 'Package group name',
|
||||
'col_id' : RecipeListModel.COL_NAME,
|
||||
'col_style': 'text',
|
||||
'col_min' : 100,
|
||||
'col_max' : 400,
|
||||
'expand' : 'True'
|
||||
}, {
|
||||
'col_name' : 'Included',
|
||||
'col_id' : RecipeListModel.COL_INC,
|
||||
'col_style': 'check toggle',
|
||||
'col_min' : 100,
|
||||
'col_max' : 100
|
||||
}]
|
||||
}
|
||||
]
|
||||
|
||||
(INCLUDED,
|
||||
ALL,
|
||||
TASKS) = range(3)
|
||||
|
||||
def __init__(self, builder = None):
|
||||
super(RecipeSelectionPage, self).__init__(builder, "Step 1 of 2: Edit recipes")
|
||||
|
||||
# set invisible members
|
||||
self.recipe_model = self.builder.recipe_model
|
||||
|
||||
# create visual elements
|
||||
self.create_visual_elements()
|
||||
|
||||
def included_clicked_cb(self, button):
|
||||
self.ins.set_current_page(self.INCLUDED)
|
||||
|
||||
def create_visual_elements(self):
|
||||
self.eventbox = self.add_onto_top_bar(None, 73)
|
||||
self.pack_start(self.eventbox, expand=False, fill=False)
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
|
||||
# set visible members
|
||||
self.ins = HobNotebook()
|
||||
self.tables = [] # we need modify table when the dialog is shown
|
||||
# append the tabs in order
|
||||
for page in self.pages:
|
||||
columns = page['columns']
|
||||
tab = HobViewTable(columns)
|
||||
filter = page['filter']
|
||||
tab.set_model(self.recipe_model.tree_model(filter))
|
||||
tab.connect("toggled", self.table_toggled_cb, page['name'])
|
||||
if page['name'] == "Included recipes":
|
||||
tab.connect("button-release-event", self.button_click_cb)
|
||||
tab.connect("cell-fadeinout-stopped", self.after_fadeout_checkin_include)
|
||||
self.ins.append_page(tab, page['name'], page['tooltip'])
|
||||
self.tables.append(tab)
|
||||
|
||||
self.ins.set_entry("Search recipes:")
|
||||
# set the search entry for each table
|
||||
for tab in self.tables:
|
||||
search_tip = "Enter a recipe's or task's name to find it"
|
||||
self.ins.search.set_tooltip_text(search_tip)
|
||||
self.ins.search.props.has_tooltip = True
|
||||
tab.set_search_entry(0, self.ins.search)
|
||||
|
||||
# add all into the window
|
||||
self.box_group_area.pack_start(self.ins, expand=True, fill=True)
|
||||
|
||||
button_box = gtk.HBox(False, 6)
|
||||
self.box_group_area.pack_end(button_box, expand=False, fill=False)
|
||||
|
||||
self.build_packages_button = HobButton('Build packages')
|
||||
#self.build_packages_button.set_size_request(205, 49)
|
||||
self.build_packages_button.set_tooltip_text("Build selected recipes into packages")
|
||||
self.build_packages_button.set_flags(gtk.CAN_DEFAULT)
|
||||
self.build_packages_button.grab_default()
|
||||
self.build_packages_button.connect("clicked", self.build_packages_clicked_cb)
|
||||
button_box.pack_end(self.build_packages_button, expand=False, fill=False)
|
||||
|
||||
self.back_button = HobAltButton('Cancel')
|
||||
self.back_button.connect("clicked", self.back_button_clicked_cb)
|
||||
button_box.pack_end(self.back_button, expand=False, fill=False)
|
||||
|
||||
def button_click_cb(self, widget, event):
|
||||
path, col = widget.table_tree.get_cursor()
|
||||
tree_model = widget.table_tree.get_model()
|
||||
if path: # else activation is likely a removal
|
||||
binb = tree_model.get_value(tree_model.get_iter(path), RecipeListModel.COL_BINB)
|
||||
if binb:
|
||||
self.builder.show_binb_dialog(binb)
|
||||
|
||||
def build_packages_clicked_cb(self, button):
|
||||
self.builder.build_packages()
|
||||
|
||||
def back_button_clicked_cb(self, button):
|
||||
self.builder.recipe_model.set_selected_image(self.builder.configuration.initial_selected_image)
|
||||
self.builder.image_configuration_page.update_image_combo(self.builder.recipe_model, self.builder.configuration.initial_selected_image)
|
||||
self.builder.image_configuration_page.update_image_desc()
|
||||
self.builder.show_configuration()
|
||||
|
||||
def refresh_selection(self):
|
||||
self.builder.configuration.selected_image = self.recipe_model.get_selected_image()
|
||||
_, self.builder.configuration.selected_recipes = self.recipe_model.get_selected_recipes()
|
||||
self.ins.show_indicator_icon("Included recipes", len(self.builder.configuration.selected_recipes))
|
||||
|
||||
def toggle_item_idle_cb(self, path, view_tree, cell, pagename):
|
||||
if not self.recipe_model.path_included(path):
|
||||
self.recipe_model.include_item(item_path=path, binb="User Selected", image_contents=False)
|
||||
else:
|
||||
if pagename == "Included recipes":
|
||||
self.pre_fadeout_checkout_include(view_tree)
|
||||
self.recipe_model.exclude_item(item_path=path)
|
||||
self.render_fadeout(view_tree, cell)
|
||||
else:
|
||||
self.recipe_model.exclude_item(item_path=path)
|
||||
|
||||
self.refresh_selection()
|
||||
if not self.builder.customized:
|
||||
self.builder.customized = True
|
||||
self.builder.configuration.selected_image = self.recipe_model.__custom_image__
|
||||
self.builder.rcppkglist_populated()
|
||||
|
||||
self.builder.window_sensitive(True)
|
||||
|
||||
def table_toggled_cb(self, table, cell, view_path, toggled_columnid, view_tree, pagename):
|
||||
# Click to include a recipe
|
||||
self.builder.window_sensitive(False)
|
||||
view_model = view_tree.get_model()
|
||||
path = self.recipe_model.convert_vpath_to_path(view_model, view_path)
|
||||
glib.idle_add(self.toggle_item_idle_cb, path, view_tree, cell, pagename)
|
||||
|
||||
def pre_fadeout_checkout_include(self, tree):
|
||||
#resync the included items to a backup fade include column
|
||||
it = self.recipe_model.get_iter_first()
|
||||
while it:
|
||||
active = self.recipe_model.get_value(it, self.recipe_model.COL_INC)
|
||||
self.recipe_model.set(it, self.recipe_model.COL_FADE_INC, active)
|
||||
it = self.recipe_model.iter_next(it)
|
||||
# Check out a model which base on the column COL_FADE_INC,
|
||||
# it's save the prev state of column COL_INC before do exclude_item
|
||||
filter = { RecipeListModel.COL_FADE_INC : [True],
|
||||
RecipeListModel.COL_TYPE : ['recipe', 'packagegroup'] }
|
||||
new_model = self.recipe_model.tree_model(filter, excluded_items_ahead=True)
|
||||
tree.set_model(new_model)
|
||||
|
||||
def render_fadeout(self, tree, cell):
|
||||
if (not cell) or (not tree):
|
||||
return
|
||||
to_render_cells = []
|
||||
model = tree.get_model()
|
||||
it = model.get_iter_first()
|
||||
while it:
|
||||
path = model.get_path(it)
|
||||
prev_cell_is_active = model.get_value(it, RecipeListModel.COL_FADE_INC)
|
||||
curr_cell_is_active = model.get_value(it, RecipeListModel.COL_INC)
|
||||
if (prev_cell_is_active == True) and (curr_cell_is_active == False):
|
||||
to_render_cells.append(path)
|
||||
it = model.iter_next(it)
|
||||
|
||||
cell.fadeout(tree, 1000, to_render_cells)
|
||||
|
||||
def after_fadeout_checkin_include(self, table, ctrl, cell, tree):
|
||||
tree.set_model(self.recipe_model.tree_model(self.pages[0]['filter']))
|
||||
|
||||
def set_recipe_curr_tab(self, curr_page):
|
||||
self.ins.set_current_page(curr_page)
|
||||
@@ -25,9 +25,12 @@ import logging
|
||||
import time
|
||||
import urllib
|
||||
import urllib2
|
||||
import pango
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
from bb.ui.crumbs.hobwidget import HobWarpCellRendererText, HobCellRendererPixbuf
|
||||
|
||||
class Colors(object):
|
||||
OK = "#ffffff"
|
||||
RUNNING = "#aaffaa"
|
||||
WARNING ="#f88017"
|
||||
ERROR = "#ffaaaa"
|
||||
|
||||
class RunningBuildModel (gtk.TreeStore):
|
||||
(COL_LOG, COL_PACKAGE, COL_TASK, COL_MESSAGE, COL_ICON, COL_COLOR, COL_NUM_ACTIVE) = range(7)
|
||||
@@ -42,75 +45,21 @@ class RunningBuildModel (gtk.TreeStore):
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_INT)
|
||||
|
||||
def failure_model_filter(self, model, it):
|
||||
color = model.get(it, self.COL_COLOR)[0]
|
||||
if not color:
|
||||
return False
|
||||
if color == HobColors.ERROR or color == HobColors.WARNING:
|
||||
return True
|
||||
return False
|
||||
|
||||
def failure_model(self):
|
||||
model = self.filter_new()
|
||||
model.set_visible_func(self.failure_model_filter)
|
||||
return model
|
||||
|
||||
def foreach_cell_func(self, model, path, iter, usr_data=None):
|
||||
if model.get_value(iter, self.COL_ICON) == "gtk-execute":
|
||||
model.set(iter, self.COL_ICON, "")
|
||||
|
||||
def close_task_refresh(self):
|
||||
self.foreach(self.foreach_cell_func, None)
|
||||
|
||||
class RunningBuild (gobject.GObject):
|
||||
__gsignals__ = {
|
||||
'build-started' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
'build-succeeded' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
'build-succeeded' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
'build-failed' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
'build-complete' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
'build-aborted' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
'task-started' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,)),
|
||||
'log-error' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
'log-warning' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
'disk-full' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
()),
|
||||
'no-provider' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_PYOBJECT,)),
|
||||
'log' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_STRING, gobject.TYPE_PYOBJECT,)),
|
||||
'build-failed' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
())
|
||||
}
|
||||
pids_to_task = {}
|
||||
tasks_to_iter = {}
|
||||
|
||||
def __init__ (self, sequential=False):
|
||||
def __init__ (self):
|
||||
gobject.GObject.__init__ (self)
|
||||
self.model = RunningBuildModel()
|
||||
self.sequential = sequential
|
||||
self.buildaborted = False
|
||||
|
||||
def reset (self):
|
||||
self.pids_to_task.clear()
|
||||
self.tasks_to_iter.clear()
|
||||
self.model.clear()
|
||||
|
||||
def handle_event (self, event, pbar=None):
|
||||
# Handle an event from the event queue, this may result in updating
|
||||
@@ -135,44 +84,33 @@ class RunningBuild (gobject.GObject):
|
||||
parent = self.tasks_to_iter[(package, task)]
|
||||
|
||||
if(isinstance(event, logging.LogRecord)):
|
||||
if event.taskpid == 0 or event.levelno > logging.INFO:
|
||||
self.emit("log", "handle", event)
|
||||
# FIXME: this is a hack! More info in Yocto #1433
|
||||
# http://bugzilla.pokylinux.org/show_bug.cgi?id=1433, temporarily
|
||||
# mask the error message as it's not informative for the user.
|
||||
if event.msg.startswith("Execution of event handler 'run_buildstats' failed"):
|
||||
return
|
||||
|
||||
if (event.levelno < logging.INFO or
|
||||
event.msg.startswith("Running task")):
|
||||
if (event.msg.startswith ("Running task")):
|
||||
return # don't add these to the list
|
||||
|
||||
if event.levelno >= logging.ERROR:
|
||||
icon = "dialog-error"
|
||||
color = HobColors.ERROR
|
||||
self.emit("log-error")
|
||||
color = Colors.ERROR
|
||||
elif event.levelno >= logging.WARNING:
|
||||
icon = "dialog-warning"
|
||||
color = HobColors.WARNING
|
||||
self.emit("log-warning")
|
||||
color = Colors.WARNING
|
||||
else:
|
||||
icon = None
|
||||
color = HobColors.OK
|
||||
color = Colors.OK
|
||||
|
||||
# if we know which package we belong to, we'll append onto its list.
|
||||
# otherwise, we'll jump to the top of the master list
|
||||
if self.sequential or not parent:
|
||||
if parent:
|
||||
tree_add = self.model.append
|
||||
else:
|
||||
tree_add = self.model.prepend
|
||||
tree_add(parent,
|
||||
(None,
|
||||
package,
|
||||
task,
|
||||
event.getMessage(),
|
||||
icon,
|
||||
color,
|
||||
0))
|
||||
(None,
|
||||
package,
|
||||
task,
|
||||
event.getMessage(),
|
||||
icon,
|
||||
color,
|
||||
0))
|
||||
|
||||
elif isinstance(event, bb.build.TaskStarted):
|
||||
(package, task) = (event._package, event._task)
|
||||
@@ -186,24 +124,20 @@ class RunningBuild (gobject.GObject):
|
||||
if ((package, None) in self.tasks_to_iter):
|
||||
parent = self.tasks_to_iter[(package, None)]
|
||||
else:
|
||||
if self.sequential:
|
||||
add = self.model.append
|
||||
else:
|
||||
add = self.model.prepend
|
||||
parent = add(None, (None,
|
||||
package,
|
||||
None,
|
||||
"Package: %s" % (package),
|
||||
None,
|
||||
HobColors.OK,
|
||||
0))
|
||||
parent = self.model.prepend(None, (None,
|
||||
package,
|
||||
None,
|
||||
"Package: %s" % (package),
|
||||
None,
|
||||
Colors.OK,
|
||||
0))
|
||||
self.tasks_to_iter[(package, None)] = parent
|
||||
|
||||
# Because this parent package now has an active child mark it as
|
||||
# such.
|
||||
# @todo if parent is already in error, don't mark it green
|
||||
self.model.set(parent, self.model.COL_ICON, "gtk-execute",
|
||||
self.model.COL_COLOR, HobColors.RUNNING)
|
||||
self.model.COL_COLOR, Colors.RUNNING)
|
||||
|
||||
# Add an entry in the model for this task
|
||||
i = self.model.append (parent, (None,
|
||||
@@ -211,7 +145,7 @@ class RunningBuild (gobject.GObject):
|
||||
task,
|
||||
"Task: %s" % (task),
|
||||
"gtk-execute",
|
||||
HobColors.RUNNING,
|
||||
Colors.RUNNING,
|
||||
0))
|
||||
|
||||
# update the parent's active task count
|
||||
@@ -223,7 +157,6 @@ class RunningBuild (gobject.GObject):
|
||||
self.tasks_to_iter[(package, task)] = i
|
||||
|
||||
elif isinstance(event, bb.build.TaskBase):
|
||||
self.emit("log", "info", event._message)
|
||||
current = self.tasks_to_iter[(package, task)]
|
||||
parent = self.tasks_to_iter[(package, None)]
|
||||
|
||||
@@ -234,20 +167,20 @@ class RunningBuild (gobject.GObject):
|
||||
if isinstance(event, bb.build.TaskFailed):
|
||||
# Mark the task and parent as failed
|
||||
icon = "dialog-error"
|
||||
color = HobColors.ERROR
|
||||
color = Colors.ERROR
|
||||
|
||||
logfile = event.logfile
|
||||
if logfile and os.path.exists(logfile):
|
||||
with open(logfile) as f:
|
||||
logdata = f.read()
|
||||
self.model.append(current, ('pastebin', None, None, logdata, 'gtk-error', HobColors.OK, 0))
|
||||
self.model.append(current, ('pastebin', None, None, logdata, 'gtk-error', Colors.OK, 0))
|
||||
|
||||
for i in (current, parent):
|
||||
self.model.set(i, self.model.COL_ICON, icon,
|
||||
self.model.COL_COLOR, color)
|
||||
else:
|
||||
icon = None
|
||||
color = HobColors.OK
|
||||
color = Colors.OK
|
||||
|
||||
# Mark the task as inactive
|
||||
self.model.set(current, self.model.COL_ICON, icon,
|
||||
@@ -259,7 +192,7 @@ class RunningBuild (gobject.GObject):
|
||||
if self.model.get(parent, self.model.COL_ICON) != 'dialog-error':
|
||||
self.model.set(parent, self.model.COL_ICON, icon)
|
||||
if num_active == 0:
|
||||
self.model.set(parent, self.model.COL_COLOR, HobColors.OK)
|
||||
self.model.set(parent, self.model.COL_COLOR, Colors.OK)
|
||||
|
||||
# Clear the iters and the pids since when the task goes away the
|
||||
# pid will no longer be used for messages
|
||||
@@ -268,18 +201,13 @@ class RunningBuild (gobject.GObject):
|
||||
|
||||
elif isinstance(event, bb.event.BuildStarted):
|
||||
|
||||
self.emit("build-started")
|
||||
self.model.prepend(None, (None,
|
||||
None,
|
||||
None,
|
||||
"Build Started (%s)" % time.strftime('%m/%d/%Y %H:%M:%S'),
|
||||
None,
|
||||
HobColors.OK,
|
||||
Colors.OK,
|
||||
0))
|
||||
if pbar:
|
||||
pbar.update(0, self.progress_total)
|
||||
pbar.set_title(bb.event.getName(event))
|
||||
|
||||
elif isinstance(event, bb.event.BuildCompleted):
|
||||
failures = int (event._failures)
|
||||
self.model.prepend(None, (None,
|
||||
@@ -287,37 +215,14 @@ class RunningBuild (gobject.GObject):
|
||||
None,
|
||||
"Build Completed (%s)" % time.strftime('%m/%d/%Y %H:%M:%S'),
|
||||
None,
|
||||
HobColors.OK,
|
||||
Colors.OK,
|
||||
0))
|
||||
|
||||
# Emit the appropriate signal depending on the number of failures
|
||||
if self.buildaborted:
|
||||
self.emit ("build-aborted")
|
||||
self.buildaborted = False
|
||||
elif (failures >= 1):
|
||||
if (failures >= 1):
|
||||
self.emit ("build-failed")
|
||||
else:
|
||||
self.emit ("build-succeeded")
|
||||
# Emit a generic "build-complete" signal for things wishing to
|
||||
# handle when the build is finished
|
||||
self.emit("build-complete")
|
||||
# reset the all cell's icon indicator
|
||||
self.model.close_task_refresh()
|
||||
if pbar:
|
||||
pbar.set_text(event.msg)
|
||||
|
||||
elif isinstance(event, bb.event.DiskFull):
|
||||
self.buildaborted = True
|
||||
self.emit("disk-full")
|
||||
|
||||
elif isinstance(event, bb.command.CommandFailed):
|
||||
self.emit("log", "error", "Command execution failed: %s" % (event.error))
|
||||
if event.error.startswith("Exited with"):
|
||||
# If the command fails with an exit code we're done, emit the
|
||||
# generic signal for the UI to notify the user
|
||||
self.emit("build-complete")
|
||||
# reset the all cell's icon indicator
|
||||
self.model.close_task_refresh()
|
||||
|
||||
elif isinstance(event, bb.event.CacheLoadStarted) and pbar:
|
||||
pbar.set_title("Loading cache")
|
||||
@@ -327,10 +232,8 @@ class RunningBuild (gobject.GObject):
|
||||
pbar.update(event.current, self.progress_total)
|
||||
elif isinstance(event, bb.event.CacheLoadCompleted) and pbar:
|
||||
pbar.update(self.progress_total, self.progress_total)
|
||||
pbar.hide()
|
||||
|
||||
elif isinstance(event, bb.event.ParseStarted) and pbar:
|
||||
if event.total == 0:
|
||||
return
|
||||
pbar.set_title("Processing recipes")
|
||||
self.progress_total = event.total
|
||||
pbar.update(0, self.progress_total)
|
||||
@@ -338,79 +241,6 @@ class RunningBuild (gobject.GObject):
|
||||
pbar.update(event.current, self.progress_total)
|
||||
elif isinstance(event, bb.event.ParseCompleted) and pbar:
|
||||
pbar.hide()
|
||||
#using runqueue events as many as possible to update the progress bar
|
||||
elif isinstance(event, bb.runqueue.runQueueTaskFailed):
|
||||
self.emit("log", "error", "Task %s (%s) failed with exit code '%s'" % (event.taskid, event.taskstring, event.exitcode))
|
||||
elif isinstance(event, bb.runqueue.sceneQueueTaskFailed):
|
||||
self.emit("log", "warn", "Setscene task %s (%s) failed with exit code '%s' - real task will be run instead" \
|
||||
% (event.taskid, event.taskstring, event.exitcode))
|
||||
elif isinstance(event, (bb.runqueue.runQueueTaskStarted, bb.runqueue.sceneQueueTaskStarted)):
|
||||
if isinstance(event, bb.runqueue.sceneQueueTaskStarted):
|
||||
self.emit("log", "info", "Running setscene task %d of %d (%s)" % \
|
||||
(event.stats.completed + event.stats.active + event.stats.failed + 1,
|
||||
event.stats.total, event.taskstring))
|
||||
else:
|
||||
if event.noexec:
|
||||
tasktype = 'noexec task'
|
||||
else:
|
||||
tasktype = 'task'
|
||||
self.emit("log", "info", "Running %s %s of %s (ID: %s, %s)" % \
|
||||
(tasktype, event.stats.completed + event.stats.active + event.stats.failed + 1,
|
||||
event.stats.total, event.taskid, event.taskstring))
|
||||
message = {}
|
||||
message["eventname"] = bb.event.getName(event)
|
||||
num_of_completed = event.stats.completed + event.stats.failed
|
||||
message["current"] = num_of_completed
|
||||
message["total"] = event.stats.total
|
||||
message["title"] = ""
|
||||
message["task"] = event.taskstring
|
||||
self.emit("task-started", message)
|
||||
elif isinstance(event, bb.event.MultipleProviders):
|
||||
self.emit("log", "info", "multiple providers are available for %s%s (%s)" \
|
||||
% (event._is_runtime and "runtime " or "", event._item, ", ".join(event._candidates)))
|
||||
self.emit("log", "info", "consider defining a PREFERRED_PROVIDER entry to match %s" % (event._item))
|
||||
elif isinstance(event, bb.event.NoProvider):
|
||||
msg = ""
|
||||
if event._runtime:
|
||||
r = "R"
|
||||
else:
|
||||
r = ""
|
||||
if event._dependees:
|
||||
msg = "Nothing %sPROVIDES '%s' (but %s %sDEPENDS on or otherwise requires it)\n" % (r, event._item, ", ".join(event._dependees), r)
|
||||
else:
|
||||
msg = "Nothing %sPROVIDES '%s'\n" % (r, event._item)
|
||||
if event._reasons:
|
||||
for reason in event._reasons:
|
||||
msg += ("%s\n" % reason)
|
||||
self.emit("no-provider", msg)
|
||||
self.emit("log", "error", msg)
|
||||
elif isinstance(event, bb.event.LogExecTTY):
|
||||
icon = "dialog-warning"
|
||||
color = HobColors.WARNING
|
||||
if self.sequential or not parent:
|
||||
tree_add = self.model.append
|
||||
else:
|
||||
tree_add = self.model.prepend
|
||||
tree_add(parent,
|
||||
(None,
|
||||
package,
|
||||
task,
|
||||
event.msg,
|
||||
icon,
|
||||
color,
|
||||
0))
|
||||
else:
|
||||
if not isinstance(event, (bb.event.BuildBase,
|
||||
bb.event.StampUpdate,
|
||||
bb.event.ConfigParsed,
|
||||
bb.event.RecipeParsed,
|
||||
bb.event.RecipePreFinalise,
|
||||
bb.runqueue.runQueueEvent,
|
||||
bb.runqueue.runQueueExitWait,
|
||||
bb.event.OperationStarted,
|
||||
bb.event.OperationCompleted,
|
||||
bb.event.OperationProgress)):
|
||||
self.emit("log", "error", "Unknown event: %s" % (event.error if hasattr(event, 'error') else 'error'))
|
||||
|
||||
return
|
||||
|
||||
@@ -430,29 +260,20 @@ class RunningBuildTreeView (gtk.TreeView):
|
||||
__gsignals__ = {
|
||||
"button_press_event" : "override"
|
||||
}
|
||||
def __init__ (self, readonly=False, hob=False):
|
||||
def __init__ (self):
|
||||
gtk.TreeView.__init__ (self)
|
||||
self.readonly = readonly
|
||||
|
||||
# The icon that indicates whether we're building or failed.
|
||||
# add 'hob' flag because there has not only hob to share this code
|
||||
if hob:
|
||||
renderer = HobCellRendererPixbuf ()
|
||||
else:
|
||||
renderer = gtk.CellRendererPixbuf()
|
||||
renderer = gtk.CellRendererPixbuf ()
|
||||
col = gtk.TreeViewColumn ("Status", renderer)
|
||||
col.add_attribute (renderer, "icon-name", 4)
|
||||
self.append_column (col)
|
||||
|
||||
# The message of the build.
|
||||
# add 'hob' flag because there has not only hob to share this code
|
||||
if hob:
|
||||
self.message_renderer = HobWarpCellRendererText (col_number=1)
|
||||
else:
|
||||
self.message_renderer = gtk.CellRendererText ()
|
||||
self.message_renderer = gtk.CellRendererText ()
|
||||
self.message_column = gtk.TreeViewColumn ("Message", self.message_renderer, text=3)
|
||||
self.message_column.add_attribute(self.message_renderer, 'background', 5)
|
||||
self.message_renderer.set_property('editable', (not self.readonly))
|
||||
self.message_renderer.set_property('editable', 5)
|
||||
self.append_column (self.message_column)
|
||||
|
||||
def do_button_press_event(self, event):
|
||||
@@ -460,68 +281,31 @@ class RunningBuildTreeView (gtk.TreeView):
|
||||
|
||||
if event.button == 3:
|
||||
selection = super(RunningBuildTreeView, self).get_selection()
|
||||
(model, it) = selection.get_selected()
|
||||
if it is not None:
|
||||
can_paste = model.get(it, model.COL_LOG)[0]
|
||||
(model, iter) = selection.get_selected()
|
||||
if iter is not None:
|
||||
can_paste = model.get(iter, model.COL_LOG)[0]
|
||||
if can_paste == 'pastebin':
|
||||
# build a simple menu with a pastebin option
|
||||
menu = gtk.Menu()
|
||||
menuitem = gtk.MenuItem("Copy")
|
||||
menu.append(menuitem)
|
||||
menuitem.connect("activate", self.clipboard_handler, (model, it))
|
||||
menuitem.show()
|
||||
menuitem = gtk.MenuItem("Send log to pastebin")
|
||||
menu.append(menuitem)
|
||||
menuitem.connect("activate", self.pastebin_handler, (model, it))
|
||||
menuitem.connect("activate", self.pastebin_handler, (model, iter))
|
||||
menuitem.show()
|
||||
menu.show()
|
||||
menu.popup(None, None, None, event.button, event.time)
|
||||
|
||||
def _add_to_clipboard(self, clipping):
|
||||
"""
|
||||
Add the contents of clipping to the system clipboard.
|
||||
"""
|
||||
clipboard = gtk.clipboard_get()
|
||||
clipboard.set_text(clipping)
|
||||
clipboard.store()
|
||||
|
||||
def pastebin_handler(self, widget, data):
|
||||
"""
|
||||
Send the log data to pastebin, then add the new paste url to the
|
||||
clipboard.
|
||||
"""
|
||||
(model, it) = data
|
||||
paste_url = do_pastebin(model.get(it, model.COL_MESSAGE)[0])
|
||||
(model, iter) = data
|
||||
paste_url = do_pastebin(model.get(iter, model.COL_MESSAGE)[0])
|
||||
|
||||
# @todo Provide visual feedback to the user that it is done and that
|
||||
# it worked.
|
||||
print paste_url
|
||||
|
||||
self._add_to_clipboard(paste_url)
|
||||
|
||||
def clipboard_handler(self, widget, data):
|
||||
"""
|
||||
"""
|
||||
(model, it) = data
|
||||
message = model.get(it, model.COL_MESSAGE)[0]
|
||||
|
||||
self._add_to_clipboard(message)
|
||||
|
||||
class BuildFailureTreeView(gtk.TreeView):
|
||||
|
||||
def __init__ (self):
|
||||
gtk.TreeView.__init__(self)
|
||||
self.set_rules_hint(False)
|
||||
self.set_headers_visible(False)
|
||||
self.get_selection().set_mode(gtk.SELECTION_SINGLE)
|
||||
|
||||
# The icon that indicates whether we're building or failed.
|
||||
renderer = HobCellRendererPixbuf ()
|
||||
col = gtk.TreeViewColumn ("Status", renderer)
|
||||
col.add_attribute (renderer, "icon-name", RunningBuildModel.COL_ICON)
|
||||
self.append_column (col)
|
||||
|
||||
# The message of the build.
|
||||
self.message_renderer = HobWarpCellRendererText (col_number=1)
|
||||
self.message_column = gtk.TreeViewColumn ("Message", self.message_renderer, text=RunningBuildModel.COL_MESSAGE, background=RunningBuildModel.COL_COLOR)
|
||||
self.append_column (self.message_column)
|
||||
clipboard = gtk.clipboard_get()
|
||||
clipboard.set_text(paste_url)
|
||||
clipboard.store()
|
||||
@@ -1,85 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Bogdan Marinescu <bogdan.a.marinescu@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk, gobject
|
||||
from bb.ui.crumbs.progressbar import HobProgressBar
|
||||
from bb.ui.crumbs.hobwidget import hic
|
||||
from bb.ui.crumbs.hobpages import HobPage
|
||||
|
||||
#
|
||||
# SanityCheckPage
|
||||
#
|
||||
class SanityCheckPage (HobPage):
|
||||
|
||||
def __init__(self, builder):
|
||||
super(SanityCheckPage, self).__init__(builder)
|
||||
self.running = False
|
||||
self.create_visual_elements()
|
||||
self.show_all()
|
||||
|
||||
def make_label(self, text, bold=True):
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
mark = "<span %s>%s</span>" % (self.span_tag('x-large', 'bold') if bold else self.span_tag('medium'), text)
|
||||
label.set_markup(mark)
|
||||
return label
|
||||
|
||||
def start(self):
|
||||
if not self.running:
|
||||
self.running = True
|
||||
gobject.timeout_add(100, self.timer_func)
|
||||
|
||||
def stop(self):
|
||||
self.running = False
|
||||
|
||||
def is_running(self):
|
||||
return self.running
|
||||
|
||||
def timer_func(self):
|
||||
self.progress_bar.pulse()
|
||||
return self.running
|
||||
|
||||
def create_visual_elements(self):
|
||||
# Table'd layout. 'rows' and 'cols' give the table size
|
||||
rows, cols = 30, 50
|
||||
self.table = gtk.Table(rows, cols, True)
|
||||
self.pack_start(self.table, expand=False, fill=False)
|
||||
sx, sy = 2, 2
|
||||
# 'info' icon
|
||||
image = gtk.Image()
|
||||
image.set_from_file(hic.ICON_INFO_DISPLAY_FILE)
|
||||
self.table.attach(image, sx, sx + 2, sy, sy + 3 )
|
||||
image.show()
|
||||
# 'Checking' message
|
||||
label = self.make_label('Hob is checking for correct build system setup')
|
||||
self.table.attach(label, sx + 2, cols, sy, sy + 3, xpadding=5 )
|
||||
label.show()
|
||||
# 'Shouldn't take long' message.
|
||||
label = self.make_label("The check shouldn't take long.", False)
|
||||
self.table.attach(label, sx + 2, cols, sy + 3, sy + 4, xpadding=5)
|
||||
label.show()
|
||||
# Progress bar
|
||||
self.progress_bar = HobProgressBar()
|
||||
self.table.attach(self.progress_bar, sx + 2, cols - 3, sy + 5, sy + 7, xpadding=5)
|
||||
self.progress_bar.show()
|
||||
# All done
|
||||
self.table.show()
|
||||
|
||||
346
bitbake/lib/bb/ui/crumbs/tasklistmodel.py
Normal file
346
bitbake/lib/bb/ui/crumbs/tasklistmodel.py
Normal file
@@ -0,0 +1,346 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import gobject
|
||||
|
||||
class TaskListModel(gtk.ListStore):
|
||||
"""
|
||||
This class defines an gtk.ListStore subclass which will convert the output
|
||||
of the bb.event.TargetsTreeGenerated event into a gtk.ListStore whilst also
|
||||
providing convenience functions to access gtk.TreeModel subclasses which
|
||||
provide filtered views of the data.
|
||||
"""
|
||||
(COL_NAME, COL_DESC, COL_LIC, COL_GROUP, COL_DEPS, COL_BINB, COL_TYPE, COL_INC) = range(8)
|
||||
|
||||
__gsignals__ = {
|
||||
"tasklist-populated" : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
())
|
||||
}
|
||||
|
||||
"""
|
||||
"""
|
||||
def __init__(self):
|
||||
self.contents = None
|
||||
self.tasks = None
|
||||
self.packages = None
|
||||
self.images = None
|
||||
|
||||
gtk.ListStore.__init__ (self,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_STRING,
|
||||
gobject.TYPE_BOOLEAN)
|
||||
|
||||
"""
|
||||
Create, if required, and return a filtered gtk.TreeModel
|
||||
containing only the items which are to be included in the
|
||||
image
|
||||
"""
|
||||
def contents_model(self):
|
||||
if not self.contents:
|
||||
self.contents = self.filter_new()
|
||||
self.contents.set_visible_column(self.COL_INC)
|
||||
return self.contents
|
||||
|
||||
"""
|
||||
Helper function to determine whether an item is a task
|
||||
"""
|
||||
def task_model_filter(self, model, it):
|
||||
if model.get_value(it, self.COL_TYPE) == 'task':
|
||||
return True
|
||||
else:
|
||||
return False
|
||||
|
||||
"""
|
||||
Create, if required, and return a filtered gtk.TreeModel
|
||||
containing only the items which are tasks
|
||||
"""
|
||||
def tasks_model(self):
|
||||
if not self.tasks:
|
||||
self.tasks = self.filter_new()
|
||||
self.tasks.set_visible_func(self.task_model_filter)
|
||||
return self.tasks
|
||||
|
||||
"""
|
||||
Helper function to determine whether an item is an image
|
||||
"""
|
||||
def image_model_filter(self, model, it):
|
||||
if model.get_value(it, self.COL_TYPE) == 'image':
|
||||
return True
|
||||
else:
|
||||
return False
|
||||
|
||||
"""
|
||||
Create, if required, and return a filtered gtk.TreeModel
|
||||
containing only the items which are images
|
||||
"""
|
||||
def images_model(self):
|
||||
if not self.images:
|
||||
self.images = self.filter_new()
|
||||
self.images.set_visible_func(self.image_model_filter)
|
||||
return self.images
|
||||
|
||||
"""
|
||||
Helper function to determine whether an item is a package
|
||||
"""
|
||||
def package_model_filter(self, model, it):
|
||||
if model.get_value(it, self.COL_TYPE) == 'package':
|
||||
return True
|
||||
else:
|
||||
return False
|
||||
|
||||
"""
|
||||
Create, if required, and return a filtered gtk.TreeModel
|
||||
containing only the items which are packages
|
||||
"""
|
||||
def packages_model(self):
|
||||
if not self.packages:
|
||||
self.packages = self.filter_new()
|
||||
self.packages.set_visible_func(self.package_model_filter)
|
||||
return self.packages
|
||||
|
||||
"""
|
||||
The populate() function takes as input the data from a
|
||||
bb.event.TargetsTreeGenerated event and populates the TaskList.
|
||||
Once the population is done it emits gsignal tasklist-populated
|
||||
to notify any listeners that the model is ready
|
||||
"""
|
||||
def populate(self, event_model):
|
||||
for item in event_model["pn"]:
|
||||
atype = 'package'
|
||||
name = item
|
||||
summary = event_model["pn"][item]["summary"]
|
||||
license = event_model["pn"][item]["license"]
|
||||
group = event_model["pn"][item]["section"]
|
||||
|
||||
depends = event_model["depends"].get(item, "")
|
||||
rdepends = event_model["rdepends-pn"].get(item, "")
|
||||
depends = depends + rdepends
|
||||
self.squish(depends)
|
||||
deps = " ".join(depends)
|
||||
|
||||
if name.count('task-') > 0:
|
||||
atype = 'task'
|
||||
elif name.count('-image-') > 0:
|
||||
atype = 'image'
|
||||
|
||||
self.set(self.append(), self.COL_NAME, name, self.COL_DESC, summary,
|
||||
self.COL_LIC, license, self.COL_GROUP, group,
|
||||
self.COL_DEPS, deps, self.COL_BINB, "",
|
||||
self.COL_TYPE, atype, self.COL_INC, False)
|
||||
|
||||
self.emit("tasklist-populated")
|
||||
|
||||
"""
|
||||
squish lst so that it doesn't contain any duplicates
|
||||
"""
|
||||
def squish(self, lst):
|
||||
seen = {}
|
||||
for l in lst:
|
||||
seen[l] = 1
|
||||
return seen.keys()
|
||||
|
||||
"""
|
||||
Mark the item at path as not included
|
||||
NOTE:
|
||||
path should be a gtk.TreeModelPath into self (not a filtered model)
|
||||
"""
|
||||
def remove_item_path(self, path):
|
||||
self[path][self.COL_BINB] = ""
|
||||
self[path][self.COL_INC] = False
|
||||
|
||||
"""
|
||||
"""
|
||||
def mark(self, path):
|
||||
name = self[path][self.COL_NAME]
|
||||
it = self.get_iter_first()
|
||||
removals = []
|
||||
#print("Removing %s" % name)
|
||||
|
||||
self.remove_item_path(path)
|
||||
|
||||
# Remove all dependent packages, update binb
|
||||
while it:
|
||||
path = self.get_path(it)
|
||||
# FIXME: need to ensure partial name matching doesn't happen, regexp?
|
||||
if self[path][self.COL_INC] and self[path][self.COL_DEPS].count(name):
|
||||
#print("%s depended on %s, marking for removal" % (self[path][self.COL_NAME], name))
|
||||
# found a dependency, remove it
|
||||
self.mark(path)
|
||||
if self[path][self.COL_INC] and self[path][self.COL_BINB].count(name):
|
||||
binb = self.find_alt_dependency(self[path][self.COL_NAME])
|
||||
#print("%s was brought in by %s, binb set to %s" % (self[path][self.COL_NAME], name, binb))
|
||||
self[path][self.COL_BINB] = binb
|
||||
it = self.iter_next(it)
|
||||
|
||||
"""
|
||||
"""
|
||||
def sweep_up(self):
|
||||
removals = []
|
||||
it = self.get_iter_first()
|
||||
|
||||
while it:
|
||||
path = self.get_path(it)
|
||||
binb = self[path][self.COL_BINB]
|
||||
if binb == "" or binb is None:
|
||||
#print("Sweeping up %s" % self[path][self.COL_NAME])
|
||||
if not path in removals:
|
||||
removals.extend(path)
|
||||
it = self.iter_next(it)
|
||||
|
||||
while removals:
|
||||
path = removals.pop()
|
||||
self.mark(path)
|
||||
|
||||
"""
|
||||
Remove an item from the contents
|
||||
"""
|
||||
def remove_item(self, path):
|
||||
self.mark(path)
|
||||
self.sweep_up()
|
||||
|
||||
"""
|
||||
Find the name of an item in the image contents which depends on the item
|
||||
at contents_path returns either an item name (str) or None
|
||||
NOTE:
|
||||
contents_path must be a path in the self.contents gtk.TreeModel
|
||||
"""
|
||||
def find_alt_dependency(self, name):
|
||||
it = self.get_iter_first()
|
||||
while it:
|
||||
# iterate all items in the model
|
||||
path = self.get_path(it)
|
||||
deps = self[path][self.COL_DEPS]
|
||||
itname = self[path][self.COL_NAME]
|
||||
inc = self[path][self.COL_INC]
|
||||
if itname != name and inc and deps.count(name) > 0:
|
||||
# if this item depends on the item, return this items name
|
||||
#print("%s depends on %s" % (itname, name))
|
||||
return itname
|
||||
it = self.iter_next(it)
|
||||
return ""
|
||||
|
||||
"""
|
||||
Convert a path in self to a path in the filtered contents model
|
||||
"""
|
||||
def contents_path_for_path(self, path):
|
||||
return self.contents.convert_child_path_to_path(path)
|
||||
|
||||
"""
|
||||
Check the self.contents gtk.TreeModel for an item
|
||||
where COL_NAME matches item_name
|
||||
Returns True if a match is found, False otherwise
|
||||
"""
|
||||
def contents_includes_name(self, item_name):
|
||||
it = self.contents.get_iter_first()
|
||||
while it:
|
||||
path = self.contents.get_path(it)
|
||||
if self.contents[path][self.COL_NAME] == item_name:
|
||||
return True
|
||||
it = self.contents.iter_next(it)
|
||||
return False
|
||||
|
||||
"""
|
||||
Add this item, and any of its dependencies, to the image contents
|
||||
"""
|
||||
def include_item(self, item_path, binb=""):
|
||||
name = self[item_path][self.COL_NAME]
|
||||
deps = self[item_path][self.COL_DEPS]
|
||||
cur_inc = self[item_path][self.COL_INC]
|
||||
#print("Adding %s for %s dependency" % (name, binb))
|
||||
if not cur_inc:
|
||||
self[item_path][self.COL_INC] = True
|
||||
self[item_path][self.COL_BINB] = binb
|
||||
if deps:
|
||||
#print("Dependencies of %s are %s" % (name, deps))
|
||||
# add all of the deps and set their binb to this item
|
||||
for dep in deps.split(" "):
|
||||
# FIXME: this skipping virtuals can't be right? Unless we choose only to show target
|
||||
# packages? In which case we should handle this server side...
|
||||
# If the contents model doesn't already contain dep, add it
|
||||
if not dep.startswith("virtual") and not self.contents_includes_name(dep):
|
||||
path = self.find_path_for_item(dep)
|
||||
if path:
|
||||
self.include_item(path, name)
|
||||
else:
|
||||
pass
|
||||
|
||||
"""
|
||||
Find the model path for the item_name
|
||||
Returns the path in the model or None
|
||||
"""
|
||||
def find_path_for_item(self, item_name):
|
||||
it = self.get_iter_first()
|
||||
path = None
|
||||
while it:
|
||||
path = self.get_path(it)
|
||||
if (self[path][self.COL_NAME] == item_name):
|
||||
return path
|
||||
else:
|
||||
it = self.iter_next(it)
|
||||
return None
|
||||
|
||||
"""
|
||||
Empty self.contents by setting the include of each entry to None
|
||||
"""
|
||||
def reset(self):
|
||||
it = self.contents.get_iter_first()
|
||||
while it:
|
||||
path = self.contents.get_path(it)
|
||||
opath = self.contents.convert_path_to_child_path(path)
|
||||
self[opath][self.COL_INC] = False
|
||||
self[opath][self.COL_BINB] = ""
|
||||
# As we've just removed the first item...
|
||||
it = self.contents.get_iter_first()
|
||||
|
||||
"""
|
||||
Returns True if one of the selected tasks is an image, False otherwise
|
||||
"""
|
||||
def targets_contains_image(self):
|
||||
it = self.images.get_iter_first()
|
||||
while it:
|
||||
path = self.images.get_path(it)
|
||||
inc = self.images[path][self.COL_INC]
|
||||
if inc:
|
||||
return True
|
||||
it = self.images.iter_next(it)
|
||||
return False
|
||||
|
||||
"""
|
||||
Return a list of all selected items which are not -native or -cross
|
||||
"""
|
||||
def get_targets(self):
|
||||
tasks = []
|
||||
|
||||
it = self.contents.get_iter_first()
|
||||
while it:
|
||||
path = self.contents.get_path(it)
|
||||
name = self.contents[path][self.COL_NAME]
|
||||
stype = self.contents[path][self.COL_TYPE]
|
||||
if not name.count('-native') and not name.count('-cross'):
|
||||
tasks.append(name)
|
||||
it = self.contents.iter_next(it)
|
||||
return tasks
|
||||
@@ -1,211 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011 Intel Corporation
|
||||
#
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gobject
|
||||
import os
|
||||
import re
|
||||
|
||||
class File(gobject.GObject):
|
||||
|
||||
def __init__(self, pathfilename, suffix):
|
||||
if not pathfilename.endswith(suffix):
|
||||
pathfilename = "%s%s" % (pathfilename, suffix)
|
||||
gobject.GObject.__init__(self)
|
||||
self.pathfilename = pathfilename
|
||||
|
||||
def readFile(self):
|
||||
if not os.path.isfile(self.pathfilename):
|
||||
return None
|
||||
if not os.path.exists(self.pathfilename):
|
||||
return None
|
||||
|
||||
with open(self.pathfilename, 'r') as f:
|
||||
contents = f.readlines()
|
||||
f.close()
|
||||
|
||||
return contents
|
||||
|
||||
def writeFile(self, contents):
|
||||
if os.path.exists(self.pathfilename):
|
||||
orig = "%s.orig" % self.pathfilename
|
||||
if os.path.exists(orig):
|
||||
os.remove(orig)
|
||||
os.rename(self.pathfilename, orig)
|
||||
|
||||
with open(self.pathfilename, 'w') as f:
|
||||
f.write(contents)
|
||||
f.close()
|
||||
|
||||
class ConfigFile(File):
|
||||
"""
|
||||
This object does save general config file. (say bblayers.conf, or local.conf). Again, it is the base class for other template files and image bb files.
|
||||
"""
|
||||
def __init__(self, pathfilename, suffix = None, header = None):
|
||||
if suffix:
|
||||
File.__init__(self, pathfilename, suffix)
|
||||
else:
|
||||
File.__init__(self, pathfilename, ".conf")
|
||||
if header:
|
||||
self.header = header
|
||||
else:
|
||||
self.header = "# Config generated by Hob\n\n"
|
||||
self.dictionary = {}
|
||||
|
||||
def setVar(self, var, val):
|
||||
if isinstance(val, list):
|
||||
liststr = ""
|
||||
if val:
|
||||
i = 0
|
||||
for value in val:
|
||||
if i < len(val) - 1:
|
||||
liststr += "%s " % value
|
||||
else:
|
||||
liststr += "%s" % value
|
||||
i += 1
|
||||
self.dictionary[var] = liststr
|
||||
else:
|
||||
self.dictionary[var] = val
|
||||
|
||||
def save(self):
|
||||
contents = self.header
|
||||
for var, val in self.dictionary.items():
|
||||
contents += "%s = \"%s\"\n" % (var, val)
|
||||
File.writeFile(self, contents)
|
||||
|
||||
class HobTemplateFile(ConfigFile):
|
||||
"""
|
||||
This object does save or load hob specific file.
|
||||
"""
|
||||
def __init__(self, pathfilename):
|
||||
ConfigFile.__init__(self, pathfilename, ".hob", "# Hob Template generated by Hob\n\n")
|
||||
|
||||
def getVar(self, var):
|
||||
if var in self.dictionary:
|
||||
return self.dictionary[var]
|
||||
else:
|
||||
return ""
|
||||
|
||||
def getVersion(self):
|
||||
contents = ConfigFile.readFile(self)
|
||||
|
||||
pattern = "^\s*(\S+)\s*=\s*(\".*?\")"
|
||||
|
||||
for line in contents:
|
||||
match = re.search(pattern, line)
|
||||
if match:
|
||||
if match.group(1) == "VERSION":
|
||||
return match.group(2).strip('"')
|
||||
return None
|
||||
|
||||
def load(self):
|
||||
contents = ConfigFile.readFile(self)
|
||||
self.dictionary.clear()
|
||||
|
||||
pattern = "^\s*(\S+)\s*=\s*(\".*?\")"
|
||||
|
||||
for line in contents:
|
||||
match = re.search(pattern, line)
|
||||
if match:
|
||||
var = match.group(1)
|
||||
val = match.group(2).strip('"')
|
||||
self.dictionary[var] = val
|
||||
return self.dictionary
|
||||
|
||||
class RecipeFile(ConfigFile):
|
||||
"""
|
||||
This object is for image bb file.
|
||||
"""
|
||||
def __init__(self, pathfilename):
|
||||
ConfigFile.__init__(self, pathfilename, ".bb", "# Recipe generated by Hob\n\ninherit core-image\n")
|
||||
|
||||
class TemplateMgr(gobject.GObject):
|
||||
|
||||
__gLocalVars__ = ["MACHINE", "PACKAGE_CLASSES", "DISTRO", "DL_DIR", "SSTATE_DIR", "SSTATE_MIRRORS", "PARALLEL_MAKE", "BB_NUMBER_THREADS", "CONF_VERSION"]
|
||||
__gBBLayersVars__ = ["BBLAYERS", "LCONF_VERSION"]
|
||||
__gRecipeVars__ = ["DEPENDS", "IMAGE_INSTALL"]
|
||||
|
||||
def __init__(self):
|
||||
gobject.GObject.__init__(self)
|
||||
self.template_hob = None
|
||||
self.bblayers_conf = None
|
||||
self.local_conf = None
|
||||
self.image_bb = None
|
||||
|
||||
@classmethod
|
||||
def convert_to_template_pathfilename(cls, filename, path):
|
||||
return "%s/%s%s%s" % (path, "template-", filename, ".hob")
|
||||
|
||||
@classmethod
|
||||
def convert_to_bblayers_pathfilename(cls, filename, path):
|
||||
return "%s/%s%s%s" % (path, "bblayers-", filename, ".conf")
|
||||
|
||||
@classmethod
|
||||
def convert_to_local_pathfilename(cls, filename, path):
|
||||
return "%s/%s%s%s" % (path, "local-", filename, ".conf")
|
||||
|
||||
@classmethod
|
||||
def convert_to_image_pathfilename(cls, filename, path):
|
||||
return "%s/%s%s%s" % (path, "hob-image-", filename, ".bb")
|
||||
|
||||
def open(self, filename, path):
|
||||
self.template_hob = HobTemplateFile(TemplateMgr.convert_to_template_pathfilename(filename, path))
|
||||
self.bblayers_conf = ConfigFile(TemplateMgr.convert_to_bblayers_pathfilename(filename, path))
|
||||
self.local_conf = ConfigFile(TemplateMgr.convert_to_local_pathfilename(filename, path))
|
||||
self.image_bb = RecipeFile(TemplateMgr.convert_to_image_pathfilename(filename, path))
|
||||
|
||||
def setVar(self, var, val):
|
||||
if var in TemplateMgr.__gLocalVars__:
|
||||
self.local_conf.setVar(var, val)
|
||||
if var in TemplateMgr.__gBBLayersVars__:
|
||||
self.bblayers_conf.setVar(var, val)
|
||||
if var in TemplateMgr.__gRecipeVars__:
|
||||
self.image_bb.setVar(var, val)
|
||||
|
||||
self.template_hob.setVar(var, val)
|
||||
|
||||
def save(self):
|
||||
self.local_conf.save()
|
||||
self.bblayers_conf.save()
|
||||
self.image_bb.save()
|
||||
self.template_hob.save()
|
||||
|
||||
def getVersion(self, path):
|
||||
return HobTemplateFile(path).getVersion()
|
||||
|
||||
def load(self, path):
|
||||
self.template_hob = HobTemplateFile(path)
|
||||
self.dictionary = self.template_hob.load()
|
||||
|
||||
def getVar(self, var):
|
||||
return self.template_hob.getVar(var)
|
||||
|
||||
def destroy(self):
|
||||
if self.template_hob:
|
||||
del self.template_hob
|
||||
template_hob = None
|
||||
if self.bblayers_conf:
|
||||
del self.bblayers_conf
|
||||
self.bblayers_conf = None
|
||||
if self.local_conf:
|
||||
del self.local_conf
|
||||
self.local_conf = None
|
||||
if self.image_bb:
|
||||
del self.image_bb
|
||||
self.image_bb = None
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user