mirror of
https://git.yoctoproject.org/poky
synced 2026-03-26 04:02:21 +01:00
Compare commits
403 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
c006044611 | ||
|
|
69cf476e36 | ||
|
|
0283822752 | ||
|
|
15c05fc10c | ||
|
|
cc6e20ea98 | ||
|
|
fc7f4b9711 | ||
|
|
4f1611cb8d | ||
|
|
5347bf352b | ||
|
|
d81e13a138 | ||
|
|
3d9db8b275 | ||
|
|
3faa84f835 | ||
|
|
10a8fb437e | ||
|
|
2c24e6b9b9 | ||
|
|
7f0a98f9ee | ||
|
|
47b2f03955 | ||
|
|
a02537187f | ||
|
|
78d092fe7a | ||
|
|
361eda901c | ||
|
|
373d73c7e7 | ||
|
|
b154d10232 | ||
|
|
00af854e96 | ||
|
|
4005aaf3f8 | ||
|
|
5c78a2b02d | ||
|
|
11355f3a7f | ||
|
|
a2283defe2 | ||
|
|
7ce789de38 | ||
|
|
4194c83a56 | ||
|
|
decb8953cd | ||
|
|
d6b531e6a1 | ||
|
|
d412b923ac | ||
|
|
cb69e75b7b | ||
|
|
9b33f20a73 | ||
|
|
00a8552b2b | ||
|
|
ec3aab7b04 | ||
|
|
5c51a88346 | ||
|
|
53bbe30ee7 | ||
|
|
1ca2d4316e | ||
|
|
87d0a3b594 | ||
|
|
c2c0b9f861 | ||
|
|
d1c356ad3d | ||
|
|
4f5622fb01 | ||
|
|
9ee10c93af | ||
|
|
490b71d15d | ||
|
|
60f42f2dc9 | ||
|
|
4dab699e96 | ||
|
|
1ca9ca2c7d | ||
|
|
5359255ce2 | ||
|
|
c9805a0c3c | ||
|
|
3545f453aa | ||
|
|
2319b2d2d7 | ||
|
|
da22a78bd4 | ||
|
|
0a69e60cfc | ||
|
|
2816cc0db8 | ||
|
|
c998000630 | ||
|
|
bf8d577f1d | ||
|
|
e3e50d2c69 | ||
|
|
e5cce8a57d | ||
|
|
bb855dab75 | ||
|
|
7779a1fedc | ||
|
|
1c5171b251 | ||
|
|
5eabb17202 | ||
|
|
b3cb28df9f | ||
|
|
14c9af0056 | ||
|
|
d106d15cad | ||
|
|
72f06800bc | ||
|
|
53b15f2732 | ||
|
|
1b159ff35d | ||
|
|
eabe47ed8c | ||
|
|
5299510bd3 | ||
|
|
679e3ae6de | ||
|
|
6619eff40b | ||
|
|
4e41793b5c | ||
|
|
5b1d38c0ed | ||
|
|
67ef061d39 | ||
|
|
5d3bfbbd18 | ||
|
|
36c9135215 | ||
|
|
437950723f | ||
|
|
5f92b6262f | ||
|
|
65d61e2d11 | ||
|
|
4825604977 | ||
|
|
00996de4eb | ||
|
|
5a9b3fecde | ||
|
|
2343f81fb4 | ||
|
|
d8f4a33500 | ||
|
|
a982aa5786 | ||
|
|
8404b657fa | ||
|
|
e4ab64389e | ||
|
|
9c43741ed6 | ||
|
|
586b7055b3 | ||
|
|
0401043d43 | ||
|
|
40a6a2612e | ||
|
|
2060a0d1f2 | ||
|
|
23a0019b1f | ||
|
|
aa37762223 | ||
|
|
5570e0ae78 | ||
|
|
310897df07 | ||
|
|
ca77772632 | ||
|
|
b8765d4efb | ||
|
|
c36361ed5a | ||
|
|
60ab27d71b | ||
|
|
d739fc53eb | ||
|
|
84d82c0685 | ||
|
|
9361df5ec2 | ||
|
|
5ec8233e2f | ||
|
|
c7301228c0 | ||
|
|
f77efdf544 | ||
|
|
f15a4a7677 | ||
|
|
0e55651fd0 | ||
|
|
8c888bf67a | ||
|
|
6f904b3550 | ||
|
|
5d01c9c296 | ||
|
|
55f72863b9 | ||
|
|
e086bc7c11 | ||
|
|
aa468ee163 | ||
|
|
94d2b2c563 | ||
|
|
f837ecebc6 | ||
|
|
dfb31f15b9 | ||
|
|
6bfb96bff3 | ||
|
|
88083714e3 | ||
|
|
2bd9b41760 | ||
|
|
e5f8d44d24 | ||
|
|
a3ed4e19e1 | ||
|
|
16c10b7a8d | ||
|
|
ce08910d62 | ||
|
|
d2492a6ee2 | ||
|
|
a05ffe7e61 | ||
|
|
05d95c7feb | ||
|
|
22a4bae306 | ||
|
|
dd99bbf1f3 | ||
|
|
6e902e0a31 | ||
|
|
1e10a0cf03 | ||
|
|
98820f5b74 | ||
|
|
e8486ec930 | ||
|
|
c0a58abed5 | ||
|
|
41d9bcdabe | ||
|
|
58e3304ea0 | ||
|
|
eb83549448 | ||
|
|
fdd4dc5db9 | ||
|
|
32d330889f | ||
|
|
a6620f2fcf | ||
|
|
8e4021a890 | ||
|
|
10a0dca45a | ||
|
|
347bbd1d4b | ||
|
|
da39a264ed | ||
|
|
292488656d | ||
|
|
6683544362 | ||
|
|
5ac1d6be71 | ||
|
|
97b223c6fc | ||
|
|
96bc30cf03 | ||
|
|
1d8535ccb7 | ||
|
|
6244cbc945 | ||
|
|
f76a807400 | ||
|
|
b1febbcb26 | ||
|
|
24b30e5285 | ||
|
|
47724b4320 | ||
|
|
058625b713 | ||
|
|
7d75d2cd94 | ||
|
|
4a17fc8a81 | ||
|
|
1327b6b06b | ||
|
|
8bc71db41f | ||
|
|
0137a98b28 | ||
|
|
326eb3f2cc | ||
|
|
5ed5ed5a0e | ||
|
|
e6668220f2 | ||
|
|
372e52ff6c | ||
|
|
3da8a8b9b9 | ||
|
|
841d084555 | ||
|
|
5a4d5b9c43 | ||
|
|
7959e40061 | ||
|
|
3d2c481ab0 | ||
|
|
232d7322b5 | ||
|
|
b116631418 | ||
|
|
9388aa62cf | ||
|
|
10ac9442f2 | ||
|
|
184a5c1c0a | ||
|
|
472a3b34d8 | ||
|
|
3c81ae17ea | ||
|
|
1528b88657 | ||
|
|
65a1eaf069 | ||
|
|
6d853bb196 | ||
|
|
74aeb0a2ec | ||
|
|
b02f8a482d | ||
|
|
0a11038665 | ||
|
|
01ab37c9ce | ||
|
|
db95181f8f | ||
|
|
8b6416db1e | ||
|
|
17600d23d8 | ||
|
|
e347cd769a | ||
|
|
25437936c4 | ||
|
|
063ede8698 | ||
|
|
82af8b9fb6 | ||
|
|
7b8b77444d | ||
|
|
2176606ff7 | ||
|
|
8c920456e4 | ||
|
|
a80791c568 | ||
|
|
ed8bcb28b2 | ||
|
|
a5d2854104 | ||
|
|
d3d7b1d679 | ||
|
|
4efe1437dd | ||
|
|
ee78d54023 | ||
|
|
bfdabe46df | ||
|
|
236357c05a | ||
|
|
06ba4f48dc | ||
|
|
d7635a9972 | ||
|
|
4a8dd99a9f | ||
|
|
bcc330c80e | ||
|
|
1743bba3ea | ||
|
|
74a635b919 | ||
|
|
1fc2d92bf6 | ||
|
|
df56b575cd | ||
|
|
8753278af8 | ||
|
|
6f139706ae | ||
|
|
b37e6a2234 | ||
|
|
f32ea8feff | ||
|
|
6f7f0810e0 | ||
|
|
8dee7adf47 | ||
|
|
bf4f7761b3 | ||
|
|
6f5703e473 | ||
|
|
c8bab9bca4 | ||
|
|
b209beb54b | ||
|
|
c1c7f61e80 | ||
|
|
48ea0ca37f | ||
|
|
60a7bca27e | ||
|
|
6e1e21942e | ||
|
|
8e70535583 | ||
|
|
5f5c9d133b | ||
|
|
6be2a5e54b | ||
|
|
334ff1fd4f | ||
|
|
b0df49cb10 | ||
|
|
a7b0c87a97 | ||
|
|
39734c77f7 | ||
|
|
3f689d6bfd | ||
|
|
dc08a1f933 | ||
|
|
8be338ed08 | ||
|
|
4c7131c26a | ||
|
|
3d732748b6 | ||
|
|
4d20c5ffd1 | ||
|
|
e6a8e53a8d | ||
|
|
fe6e54773e | ||
|
|
d659e6242b | ||
|
|
0cfdb4a029 | ||
|
|
37e29b5434 | ||
|
|
ed949c59cf | ||
|
|
185f2ac9ce | ||
|
|
387e05af6d | ||
|
|
806df0f8de | ||
|
|
47bbe6afe7 | ||
|
|
76f0cbaf1f | ||
|
|
51316230ba | ||
|
|
80c4ba0e03 | ||
|
|
97532bc759 | ||
|
|
a7d927af35 | ||
|
|
e9105d8b46 | ||
|
|
a4adf0d1ec | ||
|
|
0473eb2c22 | ||
|
|
d9d74a549d | ||
|
|
b5afabf41b | ||
|
|
b09e273fab | ||
|
|
6d990c8ca1 | ||
|
|
d065ae7311 | ||
|
|
f6185c6d85 | ||
|
|
0d4aa19918 | ||
|
|
4dfed39284 | ||
|
|
fc6863bea9 | ||
|
|
b4af02bcc4 | ||
|
|
811b28ae39 | ||
|
|
55b141c756 | ||
|
|
fbe5fdcd05 | ||
|
|
a2075d255b | ||
|
|
7ea36613da | ||
|
|
e4021e2d21 | ||
|
|
dfbc6b2d28 | ||
|
|
b14246e828 | ||
|
|
cc764902bc | ||
|
|
1156930bd7 | ||
|
|
a6f0062bd7 | ||
|
|
c86bd7f528 | ||
|
|
f971949135 | ||
|
|
93970e41e3 | ||
|
|
a250829cb6 | ||
|
|
aa3af99591 | ||
|
|
1800ff1c5f | ||
|
|
c7f5dcaf38 | ||
|
|
95fa18fd1b | ||
|
|
8797e389c6 | ||
|
|
8f0fc87a18 | ||
|
|
c455f4ccbd | ||
|
|
b8f4c95e21 | ||
|
|
498c628a1e | ||
|
|
5c0a84fd95 | ||
|
|
abcec8015c | ||
|
|
70febdf0ce | ||
|
|
a33a2cc024 | ||
|
|
d16085b67b | ||
|
|
5903a8fb4f | ||
|
|
e865b4f106 | ||
|
|
b507383230 | ||
|
|
ee0bd97330 | ||
|
|
cd7615343e | ||
|
|
3087be111c | ||
|
|
e415fd6d5b | ||
|
|
d6c639e64b | ||
|
|
6bb3da2236 | ||
|
|
f4b458f9e2 | ||
|
|
c966517392 | ||
|
|
1b774773ac | ||
|
|
095f420299 | ||
|
|
f6b945c739 | ||
|
|
4a7c467763 | ||
|
|
ff5680b8f1 | ||
|
|
111c268fbb | ||
|
|
20b41bd136 | ||
|
|
232dcb7241 | ||
|
|
09d166ebfd | ||
|
|
f432f1b010 | ||
|
|
d7fcae0778 | ||
|
|
223b4a9fb2 | ||
|
|
1af309aa19 | ||
|
|
13d14d0ddf | ||
|
|
66b30531ac | ||
|
|
66cf5423c6 | ||
|
|
3f0cec517b | ||
|
|
833b8160b5 | ||
|
|
a776cc376e | ||
|
|
83777bf1bc | ||
|
|
a15bc3ddd9 | ||
|
|
6dfddf5410 | ||
|
|
fb928dc8ea | ||
|
|
1bac3117fa | ||
|
|
07c55e9db4 | ||
|
|
5a8991913d | ||
|
|
fcce8449bc | ||
|
|
283d452ede | ||
|
|
52ba9b76e0 | ||
|
|
9d051f5808 | ||
|
|
b2ad1b9b42 | ||
|
|
a5d3c7c4f4 | ||
|
|
bef6f89563 | ||
|
|
4b77527f7a | ||
|
|
a080556e7e | ||
|
|
95fe31c60d | ||
|
|
8f1465aa9c | ||
|
|
1b11ff7752 | ||
|
|
101ce7109e | ||
|
|
7caf083ebe | ||
|
|
11f85405e0 | ||
|
|
be297836a1 | ||
|
|
91d72e822e | ||
|
|
8640414cca | ||
|
|
091ace83f8 | ||
|
|
e81957973d | ||
|
|
f3af7d55a8 | ||
|
|
e92f3a25ec | ||
|
|
ecbe894712 | ||
|
|
9a432a2328 | ||
|
|
976cb2d81d | ||
|
|
00d70680f9 | ||
|
|
3b8e7319f1 | ||
|
|
39c4f1f7c5 | ||
|
|
50a7f8483a | ||
|
|
52df73c3ff | ||
|
|
6adaf5a554 | ||
|
|
fc94ae7a77 | ||
|
|
ec8ab90763 | ||
|
|
5a0f713935 | ||
|
|
34921ffbba | ||
|
|
62ad9a8dc5 | ||
|
|
84752f34f9 | ||
|
|
3a39d96928 | ||
|
|
65d37c34b7 | ||
|
|
8e174d9437 | ||
|
|
4ec9b314c1 | ||
|
|
ba59c319b8 | ||
|
|
7708dde102 | ||
|
|
6c4c621475 | ||
|
|
9a8cc4eeb5 | ||
|
|
389ab65ab9 | ||
|
|
d3ae37234c | ||
|
|
f3c6ccd13c | ||
|
|
7305ee0962 | ||
|
|
38d6560c11 | ||
|
|
87ab152239 | ||
|
|
c387491661 | ||
|
|
7db4e07719 | ||
|
|
0073fae58e | ||
|
|
960c76bad2 | ||
|
|
93c36a6f68 | ||
|
|
781c12f2a9 | ||
|
|
55f3c2f438 | ||
|
|
60e922f180 | ||
|
|
a8a305a8ca | ||
|
|
87e8e1b31c | ||
|
|
f68e7a365f | ||
|
|
8abb5f60ca | ||
|
|
59aa9a23d8 | ||
|
|
6d79765420 | ||
|
|
49ca11e02d | ||
|
|
c004e18fb1 | ||
|
|
ee5918d9d7 | ||
|
|
9837e78bfc | ||
|
|
e08dc5aaae | ||
|
|
9ae2e2ef95 | ||
|
|
55b58a5d4c |
44
.gitignore
vendored
44
.gitignore
vendored
@@ -1,23 +1,37 @@
|
||||
*.pyc
|
||||
*.pyo
|
||||
/*.patch
|
||||
build*/
|
||||
pyshtables.py
|
||||
build/conf/local.conf
|
||||
build/conf/bblayers.conf
|
||||
build/downloads
|
||||
build/tmp/
|
||||
build/sstate-cache
|
||||
build/pyshtables.py
|
||||
pstage/
|
||||
scripts/oe-git-proxy-socks
|
||||
scripts/poky-git-proxy-socks
|
||||
sources/
|
||||
meta-*/
|
||||
!meta-skeleton
|
||||
!meta-hob
|
||||
hob-image-*.bb
|
||||
meta-darwin
|
||||
meta-maemo
|
||||
meta-extras
|
||||
meta-m2
|
||||
meta-prvt*
|
||||
poky-autobuilder*
|
||||
*.swp
|
||||
*.orig
|
||||
*.rej
|
||||
*~
|
||||
!meta-yocto
|
||||
!meta-yocto-bsp
|
||||
bitbake/doc/manual/html/
|
||||
bitbake/doc/manual/pdf/
|
||||
bitbake/doc/manual/txt/
|
||||
bitbake/doc/manual/xhtml/
|
||||
pull-*/
|
||||
documentation/poky-ref-manual/poky-ref-manual.html
|
||||
documentation/poky-ref-manual/poky-ref-manual.pdf
|
||||
documentation/poky-ref-manual/poky-ref-manual.tgz
|
||||
documentation/poky-ref-manual/bsp-guide.html
|
||||
documentation/poky-ref-manual/bsp-guide.pdf
|
||||
documentation/bsp-guide/bsp-guide.html
|
||||
documentation/bsp-guide/bsp-guide.pdf
|
||||
documentation/bsp-guide/bsp-guide.tgz
|
||||
documentation/yocto-project-qs/yocto-project-qs.html
|
||||
documentation/yocto-project-qs/yocto-project-qs.tgz
|
||||
documentation/kernel-manual/kernel-manual.html
|
||||
documentation/kernel-manual/kernel-manual.tgz
|
||||
documentation/kernel-manual/kernel-manual.pdf
|
||||
|
||||
|
||||
|
||||
|
||||
54
README
54
README
@@ -1,49 +1,15 @@
|
||||
Poky
|
||||
====
|
||||
|
||||
Poky is an integration of various components to form a complete prepackaged
|
||||
build system and development environment. It features support for building
|
||||
customised embedded device style images. There are reference demo images
|
||||
featuring a X11/Matchbox/GTK themed UI called Sato. The system supports
|
||||
cross-architecture application development using QEMU emulation and a
|
||||
standalone toolchain and SDK with IDE integration.
|
||||
Poky platform builder is a combined cross build system and development
|
||||
environment. It features support for building X11/Matchbox/GTK based
|
||||
filesystem images for various embedded devices and boards. It also
|
||||
supports cross-architecture application development using QEMU emulation
|
||||
and a standalone toolchain and SDK with IDE integration.
|
||||
|
||||
Poky has an extensive handbook, the source of which is contained in
|
||||
the handbook directory. For compiled HTML or pdf versions of this,
|
||||
see the Poky website http://pokylinux.org.
|
||||
|
||||
Additional information on the specifics of hardware that Poky supports
|
||||
is available in README.hardware. Further hardware support can easily be added
|
||||
in the form of layers which extend the systems capabilities in a modular way.
|
||||
|
||||
As an integration layer Poky consists of several upstream projects such as
|
||||
BitBake, OpenEmbedded-Core, Yocto documentation and various sources of information
|
||||
e.g. for the hardware support. Poky is in turn a component of the Yocto Project.
|
||||
|
||||
The Yocto Project has extensive documentation about the system including a
|
||||
reference manual which can be found at:
|
||||
http://yoctoproject.org/documentation
|
||||
|
||||
OpenEmbedded-Core is a layer containing the core metadata for current versions
|
||||
of OpenEmbedded. It is distro-less (can build a functional image with
|
||||
DISTRO = "") and contains only emulated machine support.
|
||||
|
||||
For information about OpenEmbedded, see the OpenEmbedded website:
|
||||
http://www.openembedded.org/
|
||||
|
||||
Where to Send Patches
|
||||
=====================
|
||||
|
||||
As Poky is an integration repository, patches against the various components
|
||||
should be sent to their respective upstreams.
|
||||
|
||||
bitbake:
|
||||
bitbake-devel@lists.openembedded.org
|
||||
|
||||
meta-yocto:
|
||||
poky@yoctoproject.org
|
||||
|
||||
Most everything else should be sent to the OpenEmbedded Core mailing list. If
|
||||
in doubt, check the oe-core git repository for the content you intend to modify.
|
||||
Before sending, be sure the patches apply cleanly to the current oe-core git
|
||||
repository.
|
||||
openembedded-core@lists.openembedded.org
|
||||
|
||||
Note: The scripts directory should be treated with extra care as it is a mix
|
||||
of oe-core and poky-specific files.
|
||||
is available in README.hardware.
|
||||
|
||||
186
README.hardware
186
README.hardware
@@ -1,34 +1,28 @@
|
||||
Poky Hardware README
|
||||
====================
|
||||
|
||||
This file gives details about using Poky with the reference machines
|
||||
supported out of the box. A full list of supported reference target machines
|
||||
can be found by looking in the following directories:
|
||||
|
||||
meta/conf/machine/
|
||||
meta-yocto-bsp/conf/machine/
|
||||
|
||||
If you are in doubt about using Poky/OpenEmbedded with your hardware, consult
|
||||
the documentation for your board/device.
|
||||
This file gives details about using Poky with different hardware reference
|
||||
boards and consumer devices. A full list of target machines can be found by
|
||||
looking in the meta/conf/machine/ directory. If in doubt about using Poky with
|
||||
your hardware, consult the documentation for your board/device.
|
||||
|
||||
Support for additional devices is normally added by creating BSP layers - for
|
||||
more information please see the Yocto Board Support Package (BSP) Developer's
|
||||
Guide - documentation source is in documentation/bspguide or download the PDF
|
||||
from:
|
||||
|
||||
http://yoctoproject.org/documentation
|
||||
http://yoctoproject.org/community/documentation
|
||||
|
||||
Support for physical reference hardware has now been split out into a
|
||||
meta-yocto-bsp layer which can be removed separately from other layers if not
|
||||
needed.
|
||||
Support for machines other than QEMU may be moved out to separate BSP layers in
|
||||
future versions.
|
||||
|
||||
|
||||
QEMU Emulation Targets
|
||||
======================
|
||||
|
||||
To simplify development, the build system supports building images to
|
||||
work with the QEMU emulator in system emulation mode. Several architectures
|
||||
are currently supported:
|
||||
To simplify development Poky supports building images to work with the QEMU
|
||||
emulator in system emulation mode. Several architectures are currently
|
||||
supported:
|
||||
|
||||
* ARM (qemuarm)
|
||||
* x86 (qemux86)
|
||||
@@ -36,33 +30,32 @@ are currently supported:
|
||||
* PowerPC (qemuppc)
|
||||
* MIPS (qemumips)
|
||||
|
||||
Use of the QEMU images is covered in the Yocto Project Reference Manual.
|
||||
The appropriate MACHINE variable value corresponding to the target is given
|
||||
in brackets.
|
||||
Use of the QEMU images is covered in the Poky Reference Manual. The Poky
|
||||
MACHINE setting corresponding to the target is given in brackets.
|
||||
|
||||
|
||||
Hardware Reference Boards
|
||||
=========================
|
||||
|
||||
The following boards are supported by the meta-yocto-bsp layer:
|
||||
The following boards are supported by Poky's core layer:
|
||||
|
||||
* Texas Instruments Beagleboard (beagleboard)
|
||||
* Freescale MPC8315E-RDB (mpc8315e-rdb)
|
||||
* Ubiquiti Networks RouterStation Pro (routerstationpro)
|
||||
|
||||
For more information see the board's section below. The appropriate MACHINE
|
||||
variable value corresponding to the board is given in brackets.
|
||||
For more information see the board's section below. The Poky MACHINE setting
|
||||
corresponding to the board is given in brackets.
|
||||
|
||||
|
||||
Consumer Devices
|
||||
================
|
||||
|
||||
The following consumer devices are supported by the meta-yocto-bsp layer:
|
||||
The following consumer devices are supported by Poky's core layer:
|
||||
|
||||
* Intel x86 based PCs and devices (genericx86)
|
||||
* Intel Atom based PCs and devices (atom-pc)
|
||||
|
||||
For more information see the device's section below. The appropriate MACHINE
|
||||
variable value corresponding to the device is given in brackets.
|
||||
For more information see the device's section below. The Poky MACHINE setting
|
||||
corresponding to the device is given in brackets.
|
||||
|
||||
|
||||
|
||||
@@ -70,42 +63,49 @@ variable value corresponding to the device is given in brackets.
|
||||
===============================
|
||||
|
||||
|
||||
Intel x86 based PCs and devices (genericx86)
|
||||
Intel Atom based PCs and devices (atom-pc)
|
||||
==========================================
|
||||
|
||||
The genericx86 MACHINE is tested on the following platforms:
|
||||
The atom-pc MACHINE is tested on the following platforms:
|
||||
|
||||
o Asus EeePC 901
|
||||
o Asus eee901
|
||||
o Acer Aspire One
|
||||
o Toshiba NB305
|
||||
o Intel Embedded Development Board 1-N450 (Black Sand)
|
||||
|
||||
and is likely to work on many unlisted Atom based devices. The MACHINE type
|
||||
and is likely to work on many unlisted atom based devices. The MACHINE type
|
||||
supports ethernet, wifi, sound, and i915 graphics by default in addition to
|
||||
common PC input devices, busses, and so on.
|
||||
|
||||
Depending on the device, it can boot from a traditional hard-disk, a USB device,
|
||||
or over the network. Writing generated images to physical media is
|
||||
or over the network. Writing poky generated images to physical media is
|
||||
straightforward with a caveat for USB devices. The following examples assume the
|
||||
target boot device is /dev/sdb, be sure to verify this and use the correct
|
||||
device as the following commands are run as root and are not reversable.
|
||||
|
||||
USB Device:
|
||||
1. Build a live image. This image type consists of a simple filesystem
|
||||
without a partition table, which is suitable for USB keys, and with the
|
||||
default setup for the genericx86 machine, this image type is built
|
||||
automatically for any image you build. For example:
|
||||
Hard Disk:
|
||||
1. Build a directdisk image format. This will generate proper partition tables
|
||||
that will in turn be written to the physical media. For example:
|
||||
|
||||
$ bitbake core-image-minimal
|
||||
$ bitbake poky-image-minimal-directdisk
|
||||
|
||||
2. Use the "dd" utility to write the image to the raw block device. For example:
|
||||
|
||||
# dd if=poky-image-minimal-directdisk-atom-pc.hdddirect of=/dev/sdb
|
||||
|
||||
USB Device:
|
||||
1. Build an hddimg image format. This is a simple filesystem without partition
|
||||
tables and is suitable for USB keys. For example:
|
||||
|
||||
$ bitbake poky-image-minimal-live
|
||||
|
||||
2. Use the "dd" utility to write the image to the raw block device. For
|
||||
example:
|
||||
|
||||
# dd if=core-image-minimal-genericx86.hddimg of=/dev/sdb
|
||||
# dd if=poky-image-minimal-live-atom-pc.hddimg of=/dev/sdb
|
||||
|
||||
If the device fails to boot with "Boot error" displayed, or apparently
|
||||
stops just after the SYSLINUX version banner, it is likely the BIOS cannot
|
||||
understand the physical layout of the disk (or rather it expects a
|
||||
If the device fails to boot with "Boot error" displayed, it is likely the BIOS
|
||||
cannot understand the physical layout of the disk (or rather it expects a
|
||||
particular layout and cannot handle anything else). There are two possible
|
||||
solutions to this problem:
|
||||
|
||||
@@ -114,47 +114,26 @@ USB Device:
|
||||
geometry from the device.
|
||||
|
||||
2. Without such an option, the BIOS generally boots the device in USB-ZIP
|
||||
mode. To write an image to a USB device that will be bootable in
|
||||
USB-ZIP mode, carry out the following actions:
|
||||
mode.
|
||||
|
||||
a. Determine the geometry of your USB device using fdisk:
|
||||
|
||||
# fdisk /dev/sdb
|
||||
Command (m for help): p
|
||||
|
||||
Disk /dev/sdb: 4011 MB, 4011491328 bytes
|
||||
124 heads, 62 sectors/track, 1019 cylinders, total 7834944 sectors
|
||||
...
|
||||
|
||||
Command (m for help): q
|
||||
|
||||
b. Configure the USB device for USB-ZIP mode:
|
||||
a. Configure the USB device for USB-ZIP mode:
|
||||
|
||||
# mkdiskimage -4 /dev/sdb 1019 124 62
|
||||
# mkdiskimage -4 /dev/sdb 0 63 62
|
||||
|
||||
Where 1019, 124 and 62 are the cylinder, head and sectors/track counts
|
||||
as reported by fdisk (substitute the values reported for your device).
|
||||
When the operation has finished and the access LED (if any) on the
|
||||
device stops flashing, remove and reinsert the device to allow the
|
||||
kernel to detect the new partition layout.
|
||||
Where 63 and 62 are the head and sector count as reported by fdisk.
|
||||
Remove and reinsert the device to allow the kernel to detect the new
|
||||
partition layout.
|
||||
|
||||
c. Copy the contents of the image to the USB-ZIP mode device:
|
||||
b. Copy the contents of the poky image to the USB-ZIP mode device:
|
||||
|
||||
# mkdir /tmp/image
|
||||
# mkdir /tmp/usbkey
|
||||
# mount -o loop core-image-minimal-genericx86.hddimg /tmp/image
|
||||
# mount -o loop poky-image-minimal-live-atom-pc.hddimg /tmp/image
|
||||
# mount /dev/sdb4 /tmp/usbkey
|
||||
# cp -rf /tmp/image/* /tmp/usbkey
|
||||
|
||||
d. Install the syslinux boot loader:
|
||||
c. Install the syslinux boot loader:
|
||||
|
||||
# syslinux /dev/sdb4
|
||||
|
||||
e. Unmount everything:
|
||||
|
||||
# umount /tmp/image
|
||||
# umount /tmp/usbkey
|
||||
|
||||
Install the boot device in the target board and configure the BIOS to boot
|
||||
from it.
|
||||
|
||||
@@ -171,7 +150,7 @@ faster CPU, more RAM, an ethernet port, more USB ports, microSD, and removes
|
||||
the NAND flash. The beagleboard MACHINE is tested on the following platforms:
|
||||
|
||||
o Beagleboard C4
|
||||
o Beagleboard xM rev A & B
|
||||
o Beagleboard xM Rev A
|
||||
|
||||
The Beagleboard C4 has NAND, while the xM does not. For the sake of simplicity,
|
||||
these instructions assume you have erased the NAND on the C4 so its boot
|
||||
@@ -217,7 +196,7 @@ if used via a usb card reader):
|
||||
# cp u-boot-beagleboard.bin /media/boot/u-boot.bin
|
||||
|
||||
3. Install the root filesystem
|
||||
# tar x -C /media/root -f core-image-$IMAGE_TYPE-beagleboard.tar.bz2
|
||||
# tar x -C /media/root -f poky-image-$IMAGE_TYPE-beagleboard.tar.bz2
|
||||
# tar x -C /media/root -f modules-$KERNEL_VERSION-beagleboard.tgz
|
||||
|
||||
4. Install the kernel uImage
|
||||
@@ -260,57 +239,30 @@ software development of network attached storage (NAS) and digital media server
|
||||
applications. The MPC8315E-RDB features the PowerQUICC II Pro processor, which
|
||||
includes a built-in security accelerator.
|
||||
|
||||
(Note: you may find it easier to order MPC8315E-RDBA; this appears to be the
|
||||
same board in an enclosure with accessories. In any case it is fully
|
||||
compatible with the instructions given here.)
|
||||
|
||||
Setup instructions
|
||||
------------------
|
||||
|
||||
You will need the following:
|
||||
* NFS root setup on your workstation
|
||||
* TFTP server installed on your workstation
|
||||
* Straight-thru 9-conductor serial cable (DB9, M/F) connected from your
|
||||
PC to UART1
|
||||
* Ethernet connected to the first ethernet port on the board
|
||||
* nfs root setup on your workstation
|
||||
* tftp server installed on your workstation
|
||||
|
||||
--- Preparation ---
|
||||
Load the kernel and boot it as follows:
|
||||
|
||||
Note: if you have altered your board's ethernet MAC address(es) from the
|
||||
defaults, or you need to do so because you want multiple boards on the same
|
||||
network, then you will need to change the values in the dts file (patch
|
||||
linux/arch/powerpc/boot/dts/mpc8315erdb.dts within the kernel source). If
|
||||
you have left them at the factory default then you shouldn't need to do
|
||||
anything here.
|
||||
|
||||
--- Booting from NFS root ---
|
||||
|
||||
Load the kernel and dtb (device tree blob), and boot the system as follows:
|
||||
|
||||
1. Get the kernel (uImage-mpc8315e-rdb.bin) and dtb (uImage-mpc8315e-rdb.dtb)
|
||||
files from the tmp/deploy directory, and make them available on your TFTP
|
||||
1. Get the kernel (uImage.mpc8315erdb) and dtb (mpc8315erdb.dtb) files from
|
||||
the Poky build tmp/deploy directory, and make them available on your tftp
|
||||
server.
|
||||
|
||||
2. Connect the board's first serial port to your workstation and then start up
|
||||
your favourite serial terminal so that you will be able to interact with
|
||||
the serial console. If you don't have a favourite, picocom is suggested:
|
||||
2. Set up the environment in U-Boot:
|
||||
|
||||
$ picocom /dev/ttyUSB0 -b 115200
|
||||
=>setenv ipaddr <board ip>
|
||||
=>setenv serverip <tftp server ip>
|
||||
=>setenv bootargs root=/dev/nfs rw nfsroot=<nfsroot ip>:<rootfs path> ip=<board ip>:<server ip>:<gateway ip>:255.255.255.0:mpc8315e:eth0:off console=ttyS0,115200
|
||||
|
||||
3. Power up or reset the board and press a key on the terminal when prompted
|
||||
to get to the U-Boot command line
|
||||
3. Download kernel and dtb to boot kernel.
|
||||
|
||||
4. Set up the environment in U-Boot:
|
||||
|
||||
=> setenv ipaddr <board ip>
|
||||
=> setenv serverip <tftp server ip>
|
||||
=> setenv bootargs root=/dev/nfs rw nfsroot=<nfsroot ip>:<rootfs path> ip=<board ip>:<server ip>:<gateway ip>:255.255.255.0:mpc8315e:eth0:off console=ttyS0,115200
|
||||
|
||||
5. Download the kernel and dtb, and boot:
|
||||
|
||||
=> tftp 1000000 uImage-mpc8315e-rdb.bin
|
||||
=> tftp 2000000 uImage-mpc8315e-rdb.dtb
|
||||
=> bootm 1000000 - 2000000
|
||||
=>tftp 800000 uImage.mpc8315erdb
|
||||
=>tftp 780000 mpc8315erdb.dtb
|
||||
=>bootm 800000 - 780000
|
||||
|
||||
|
||||
Ubiquiti Networks RouterStation Pro (routerstationpro)
|
||||
@@ -339,11 +291,11 @@ name in all commands where appropriate.
|
||||
|
||||
--- Preparation ---
|
||||
|
||||
1) Build an image (e.g. core-image-minimal) using "routerstationpro" as the
|
||||
1) Build an image (e.g. poky-image-minimal) using "routerstationpro" as the
|
||||
MACHINE
|
||||
|
||||
2) Partition the USB drive so that primary partition 1 is type Linux (83).
|
||||
Minimum size depends on your root image size - core-image-minimal probably
|
||||
Minimum size depends on your root image size - poky-image-minimal probably
|
||||
only needs 8-16MB, other images will need more.
|
||||
|
||||
# fdisk /dev/sdb
|
||||
@@ -364,11 +316,11 @@ only needs 8-16MB, other images will need more.
|
||||
# mke2fs -j /dev/sdb1
|
||||
|
||||
4) Mount partition 1 and then extract the contents of
|
||||
tmp/deploy/images/core-image-XXXX.tar.bz2 into it (preserving permissions).
|
||||
tmp/deploy/images/poky-image-XXXX.tar.bz2 into it (preserving permissions).
|
||||
|
||||
# mount /dev/sdb1 /media/sdb1
|
||||
# cd /media/sdb1
|
||||
# tar -xvjpf tmp/deploy/images/core-image-XXXX.tar.bz2
|
||||
# tar -xvjpf tmp/deploy/images/poky-image-XXXX.tar.bz2
|
||||
|
||||
5) Unmount the USB drive and then plug it into the board's USB port
|
||||
|
||||
|
||||
@@ -32,61 +32,47 @@ import warnings
|
||||
from traceback import format_exception
|
||||
try:
|
||||
import bb
|
||||
except RuntimeError as exc:
|
||||
except RuntimeError, exc:
|
||||
sys.exit(str(exc))
|
||||
from bb import event
|
||||
import bb.msg
|
||||
from bb import cooker
|
||||
from bb import ui
|
||||
from bb import server
|
||||
from bb import cookerdata
|
||||
from bb.server import none
|
||||
#from bb.server import xmlrpc
|
||||
|
||||
__version__ = "1.19.1"
|
||||
__version__ = "1.11.0"
|
||||
logger = logging.getLogger("BitBake")
|
||||
|
||||
# Python multiprocessing requires /dev/shm
|
||||
if not os.access('/dev/shm', os.W_OK | os.X_OK):
|
||||
sys.exit("FATAL: /dev/shm does not exist or is not writable")
|
||||
|
||||
# Unbuffer stdout to avoid log truncation in the event
|
||||
# of an unorderly exit as well as to provide timely
|
||||
# updates to log files for use with tail
|
||||
try:
|
||||
if sys.stdout.name == '<stdout>':
|
||||
sys.stdout = os.fdopen(sys.stdout.fileno(), 'w', 0)
|
||||
except:
|
||||
pass
|
||||
class BBConfiguration(object):
|
||||
"""
|
||||
Manages build options and configurations for one run
|
||||
"""
|
||||
|
||||
def __init__(self, options):
|
||||
for key, val in options.__dict__.items():
|
||||
setattr(self, key, val)
|
||||
self.pkgs_to_build = []
|
||||
|
||||
|
||||
def get_ui(config):
|
||||
if not config.ui:
|
||||
# modify 'ui' attribute because it is also read by cooker
|
||||
config.ui = os.environ.get('BITBAKE_UI', 'knotty')
|
||||
|
||||
interface = config.ui
|
||||
if config.ui:
|
||||
interface = config.ui
|
||||
else:
|
||||
interface = 'knotty'
|
||||
|
||||
try:
|
||||
# Dynamically load the UI based on the ui name. Although we
|
||||
# suggest a fixed set this allows you to have flexibility in which
|
||||
# ones are available.
|
||||
module = __import__("bb.ui", fromlist = [interface])
|
||||
return getattr(module, interface)
|
||||
return getattr(module, interface).main
|
||||
except AttributeError:
|
||||
sys.exit("FATAL: Invalid user interface '%s' specified.\n"
|
||||
"Valid interfaces: depexp, goggle, ncurses, hob, knotty [default]." % interface)
|
||||
"Valid interfaces: depexp, goggle, ncurses, knotty [default]." % interface)
|
||||
|
||||
def gather_extra_cache_data():
|
||||
extra = []
|
||||
interfaces = ['depexp', 'goggle', 'ncurses', 'hob', 'knotty']
|
||||
for i in interfaces:
|
||||
try:
|
||||
ui = __import__("bb.ui." + i, fromlist = [i])
|
||||
if hasattr(ui, "extraCaches"):
|
||||
extra = extra + ui.extraCaches
|
||||
del ui
|
||||
except:
|
||||
pass
|
||||
return extra
|
||||
|
||||
# Display bitbake/OE warnings via the BitBake.Warnings logger, ignoring others"""
|
||||
warnlog = logging.getLogger("BitBake.Warnings")
|
||||
@@ -107,234 +93,126 @@ warnings.filterwarnings("ignore", category=ImportWarning)
|
||||
warnings.filterwarnings("ignore", category=DeprecationWarning, module="<string>$")
|
||||
warnings.filterwarnings("ignore", message="With-statements now directly support multiple context managers")
|
||||
|
||||
class BitBakeConfigParameters(cookerdata.ConfigParameters):
|
||||
|
||||
def parseCommandLine(self):
|
||||
parser = optparse.OptionParser(
|
||||
version = "BitBake Build Tool Core version %s, %%prog version %s" % (bb.__version__, __version__),
|
||||
usage = """%prog [options] [package ...]
|
||||
|
||||
Executes the specified task (default is 'build') for a given set of BitBake files.
|
||||
It expects that BBFILES is defined, which is a space separated list of files to
|
||||
be executed. BBFILES does support wildcards.
|
||||
Default BBFILES are the .bb files in the current directory.""")
|
||||
|
||||
parser.add_option("-b", "--buildfile", help = "execute the task against this .bb file, rather than a package from BBFILES. Does not handle any dependencies.",
|
||||
action = "store", dest = "buildfile", default = None)
|
||||
|
||||
parser.add_option("-k", "--continue", help = "continue as much as possible after an error. While the target that failed, and those that depend on it, cannot be remade, the other dependencies of these targets can be processed all the same.",
|
||||
action = "store_false", dest = "abort", default = True)
|
||||
|
||||
parser.add_option("-a", "--tryaltconfigs", help = "continue with builds by trying to use alternative providers where possible.",
|
||||
action = "store_true", dest = "tryaltconfigs", default = False)
|
||||
|
||||
parser.add_option("-f", "--force", help = "force run of specified cmd, regardless of stamp status",
|
||||
action = "store_true", dest = "force", default = False)
|
||||
|
||||
parser.add_option("-c", "--cmd", help = "Specify task to execute. Note that this only executes the specified task for the providee and the packages it depends on, i.e. 'compile' does not implicitly call stage for the dependencies (IOW: use only if you know what you are doing). Depending on the base.bbclass a listtasks tasks is defined and will show available tasks",
|
||||
action = "store", dest = "cmd")
|
||||
|
||||
parser.add_option("-C", "--clear-stamp", help = "Invalidate the stamp for the specified cmd such as 'compile' and run the default task for the specified target(s)",
|
||||
action = "store", dest = "invalidate_stamp")
|
||||
|
||||
parser.add_option("-r", "--read", help = "read the specified file before bitbake.conf",
|
||||
action = "append", dest = "prefile", default = [])
|
||||
|
||||
parser.add_option("-R", "--postread", help = "read the specified file after bitbake.conf",
|
||||
action = "append", dest = "postfile", default = [])
|
||||
|
||||
parser.add_option("-v", "--verbose", help = "output more chit-chat to the terminal",
|
||||
action = "store_true", dest = "verbose", default = False)
|
||||
|
||||
parser.add_option("-D", "--debug", help = "Increase the debug level. You can specify this more than once.",
|
||||
action = "count", dest="debug", default = 0)
|
||||
|
||||
parser.add_option("-n", "--dry-run", help = "don't execute, just go through the motions",
|
||||
action = "store_true", dest = "dry_run", default = False)
|
||||
|
||||
parser.add_option("-S", "--dump-signatures", help = "don't execute, just dump out the signature construction information",
|
||||
action = "store_true", dest = "dump_signatures", default = False)
|
||||
|
||||
parser.add_option("-p", "--parse-only", help = "quit after parsing the BB files (developers only)",
|
||||
action = "store_true", dest = "parse_only", default = False)
|
||||
|
||||
parser.add_option("-s", "--show-versions", help = "show current and preferred versions of all recipes",
|
||||
action = "store_true", dest = "show_versions", default = False)
|
||||
|
||||
parser.add_option("-e", "--environment", help = "show the global or per-package environment (this is what used to be bbread)",
|
||||
action = "store_true", dest = "show_environment", default = False)
|
||||
|
||||
parser.add_option("-g", "--graphviz", help = "emit the dependency trees of the specified packages in the dot syntax, and the pn-buildlist to show the build list",
|
||||
action = "store_true", dest = "dot_graph", default = False)
|
||||
|
||||
parser.add_option("-I", "--ignore-deps", help = """Assume these dependencies don't exist and are already provided (equivalent to ASSUME_PROVIDED). Useful to make dependency graphs more appealing""",
|
||||
action = "append", dest = "extra_assume_provided", default = [])
|
||||
|
||||
parser.add_option("-l", "--log-domains", help = """Show debug logging for the specified logging domains""",
|
||||
action = "append", dest = "debug_domains", default = [])
|
||||
|
||||
parser.add_option("-P", "--profile", help = "profile the command and print a report",
|
||||
action = "store_true", dest = "profile", default = False)
|
||||
|
||||
parser.add_option("-u", "--ui", help = "userinterface to use",
|
||||
action = "store", dest = "ui")
|
||||
|
||||
parser.add_option("-t", "--servertype", help = "Choose which server to use, process or xmlrpc",
|
||||
action = "store", dest = "servertype")
|
||||
|
||||
parser.add_option("", "--revisions-changed", help = "Set the exit code depending on whether upstream floating revisions have changed or not",
|
||||
action = "store_true", dest = "revisions_changed", default = False)
|
||||
|
||||
parser.add_option("", "--server-only", help = "Run bitbake without UI, the frontend can connect with bitbake server itself",
|
||||
action = "store_true", dest = "server_only", default = False)
|
||||
|
||||
parser.add_option("-B", "--bind", help = "The name/address for the bitbake server to bind to",
|
||||
action = "store", dest = "bind", default = False)
|
||||
|
||||
parser.add_option("", "--no-setscene", help = "Do not run any setscene tasks, forces builds",
|
||||
action = "store_true", dest = "nosetscene", default = False)
|
||||
|
||||
parser.add_option("", "--remote-server", help = "Connect to the specified server",
|
||||
action = "store", dest = "remote_server", default = False)
|
||||
|
||||
parser.add_option("-m", "--kill-server", help = "Terminate the remote server",
|
||||
action = "store_true", dest = "kill_server", default = False)
|
||||
|
||||
parser.add_option("", "--observe-only", help = "Connect to a server as an observing-only client",
|
||||
action = "store_true", dest = "observe_only", default = False)
|
||||
|
||||
options, targets = parser.parse_args(sys.argv)
|
||||
|
||||
# some environmental variables set also configuration options
|
||||
if "BBSERVER" in os.environ:
|
||||
options.servertype = "xmlrpc"
|
||||
options.remote_server = os.environ["BBSERVER"]
|
||||
|
||||
return options, targets[1:]
|
||||
|
||||
|
||||
def start_server(servermodule, configParams, configuration):
|
||||
server = servermodule.BitBakeServer()
|
||||
if configParams.bind:
|
||||
(host, port) = configParams.bind.split(':')
|
||||
server.initServer((host, int(port)))
|
||||
else:
|
||||
server.initServer()
|
||||
|
||||
try:
|
||||
configuration.setServerRegIdleCallback(server.getServerIdleCB())
|
||||
|
||||
cooker = bb.cooker.BBCooker(configuration)
|
||||
|
||||
server.addcooker(cooker)
|
||||
server.saveConnectionDetails()
|
||||
except Exception as e:
|
||||
exc_info = sys.exc_info()
|
||||
while True:
|
||||
try:
|
||||
import queue
|
||||
except ImportError:
|
||||
import Queue as queue
|
||||
try:
|
||||
event = server.event_queue.get(block=False)
|
||||
except (queue.Empty, IOError):
|
||||
break
|
||||
if isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
raise exc_info[1], None, exc_info[2]
|
||||
server.detach()
|
||||
return server
|
||||
|
||||
|
||||
|
||||
def main():
|
||||
parser = optparse.OptionParser(
|
||||
version = "BitBake Build Tool Core version %s, %%prog version %s" % (bb.__version__, __version__),
|
||||
usage = """%prog [options] [package ...]
|
||||
|
||||
configParams = BitBakeConfigParameters()
|
||||
configuration = cookerdata.CookerConfiguration()
|
||||
configuration.setConfigParameters(configParams)
|
||||
Executes the specified task (default is 'build') for a given set of BitBake files.
|
||||
It expects that BBFILES is defined, which is a space separated list of files to
|
||||
be executed. BBFILES does support wildcards.
|
||||
Default BBFILES are the .bb files in the current directory.""")
|
||||
|
||||
ui_module = get_ui(configParams)
|
||||
parser.add_option("-b", "--buildfile", help = "execute the task against this .bb file, rather than a package from BBFILES.",
|
||||
action = "store", dest = "buildfile", default = None)
|
||||
|
||||
# Server type can be xmlrpc or process currently, if nothing is specified,
|
||||
# the default server is process
|
||||
if configParams.servertype:
|
||||
server_type = configParams.servertype
|
||||
else:
|
||||
server_type = 'process'
|
||||
parser.add_option("-k", "--continue", help = "continue as much as possible after an error. While the target that failed, and those that depend on it, cannot be remade, the other dependencies of these targets can be processed all the same.",
|
||||
action = "store_false", dest = "abort", default = True)
|
||||
|
||||
try:
|
||||
module = __import__("bb.server", fromlist = [server_type])
|
||||
servermodule = getattr(module, server_type)
|
||||
except AttributeError:
|
||||
sys.exit("FATAL: Invalid server type '%s' specified.\n"
|
||||
"Valid interfaces: xmlrpc, process [default]." % servertype)
|
||||
parser.add_option("-a", "--tryaltconfigs", help = "continue with builds by trying to use alternative providers where possible.",
|
||||
action = "store_true", dest = "tryaltconfigs", default = False)
|
||||
|
||||
if configParams.server_only:
|
||||
if configParams.servertype != "xmlrpc":
|
||||
sys.exit("FATAL: If '--server-only' is defined, we must set the servertype as 'xmlrpc'.\n")
|
||||
if not configParams.bind:
|
||||
sys.exit("FATAL: The '--server-only' option requires a name/address to bind to with the -B option.\n")
|
||||
if configParams.remote_server:
|
||||
sys.exit("FATAL: The '--server-only' option conflicts with the '--remote-server' option. %s\n" %
|
||||
("Please check your BBSERVER environment" if "BBSERVER" in os.environ else "" ))
|
||||
parser.add_option("-f", "--force", help = "force run of specified cmd, regardless of stamp status",
|
||||
action = "store_true", dest = "force", default = False)
|
||||
|
||||
if configParams.bind and configParams.servertype != "xmlrpc":
|
||||
sys.exit("FATAL: If '-B' or '--bind' is defined, we must set the servertype as 'xmlrpc'.\n")
|
||||
parser.add_option("-c", "--cmd", help = "Specify task to execute. Note that this only executes the specified task for the providee and the packages it depends on, i.e. 'compile' does not implicitly call stage for the dependencies (IOW: use only if you know what you are doing). Depending on the base.bbclass a listtasks tasks is defined and will show available tasks",
|
||||
action = "store", dest = "cmd")
|
||||
|
||||
if configParams.remote_server and configParams.servertype != "xmlrpc":
|
||||
sys.exit("FATAL: If '--remote-server' is defined, we must set the servertype as 'xmlrpc'.\n")
|
||||
parser.add_option("-r", "--read", help = "read the specified file before bitbake.conf",
|
||||
action = "append", dest = "file", default = [])
|
||||
|
||||
if configParams.observe_only and (not configParams.remote_server or configParams.bind):
|
||||
sys.exit("FATAL: '--observe-only' can only be used by UI clients connecting to a server.\n")
|
||||
parser.add_option("-v", "--verbose", help = "output more chit-chat to the terminal",
|
||||
action = "store_true", dest = "verbose", default = False)
|
||||
|
||||
if "BBDEBUG" in os.environ:
|
||||
level = int(os.environ["BBDEBUG"])
|
||||
if level > configuration.debug:
|
||||
configuration.debug = level
|
||||
parser.add_option("-D", "--debug", help = "Increase the debug level. You can specify this more than once.",
|
||||
action = "count", dest="debug", default = 0)
|
||||
|
||||
bb.msg.init_msgconfig(configParams.verbose, configuration.debug,
|
||||
parser.add_option("-n", "--dry-run", help = "don't execute, just go through the motions",
|
||||
action = "store_true", dest = "dry_run", default = False)
|
||||
|
||||
parser.add_option("-S", "--dump-signatures", help = "don't execute, just dump out the signature construction information",
|
||||
action = "store_true", dest = "dump_signatures", default = False)
|
||||
|
||||
parser.add_option("-p", "--parse-only", help = "quit after parsing the BB files (developers only)",
|
||||
action = "store_true", dest = "parse_only", default = False)
|
||||
|
||||
parser.add_option("-d", "--disable-psyco", help = "disable using the psyco just-in-time compiler (not recommended)",
|
||||
action = "store_true", dest = "disable_psyco", default = False)
|
||||
|
||||
parser.add_option("-s", "--show-versions", help = "show current and preferred versions of all packages",
|
||||
action = "store_true", dest = "show_versions", default = False)
|
||||
|
||||
parser.add_option("-e", "--environment", help = "show the global or per-package environment (this is what used to be bbread)",
|
||||
action = "store_true", dest = "show_environment", default = False)
|
||||
|
||||
parser.add_option("-g", "--graphviz", help = "emit the dependency trees of the specified packages in the dot syntax",
|
||||
action = "store_true", dest = "dot_graph", default = False)
|
||||
|
||||
parser.add_option("-I", "--ignore-deps", help = """Assume these dependencies don't exist and are already provided (equivalent to ASSUME_PROVIDED). Useful to make dependency graphs more appealing""",
|
||||
action = "append", dest = "extra_assume_provided", default = [])
|
||||
|
||||
parser.add_option("-l", "--log-domains", help = """Show debug logging for the specified logging domains""",
|
||||
action = "append", dest = "debug_domains", default = [])
|
||||
|
||||
parser.add_option("-P", "--profile", help = "profile the command and print a report",
|
||||
action = "store_true", dest = "profile", default = False)
|
||||
|
||||
parser.add_option("-u", "--ui", help = "userinterface to use",
|
||||
action = "store", dest = "ui")
|
||||
|
||||
parser.add_option("", "--revisions-changed", help = "Set the exit code depending on whether upstream floating revisions have changed or not",
|
||||
action = "store_true", dest = "revisions_changed", default = False)
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
|
||||
configuration = BBConfiguration(options)
|
||||
configuration.pkgs_to_build.extend(args[1:])
|
||||
configuration.initial_path = os.environ['PATH']
|
||||
|
||||
ui_main = get_ui(configuration)
|
||||
|
||||
loghandler = event.LogHandler()
|
||||
logger.addHandler(loghandler)
|
||||
|
||||
#server = bb.server.xmlrpc
|
||||
server = bb.server.none
|
||||
|
||||
# Save a logfile for cooker into the current working directory. When the
|
||||
# server is daemonized this logfile will be truncated.
|
||||
cooker_logfile = os.path.join(os.getcwd(), "cooker.log")
|
||||
|
||||
bb.utils.init_logger(bb.msg, configuration.verbose, configuration.debug,
|
||||
configuration.debug_domains)
|
||||
|
||||
# Ensure logging messages get sent to the UI as events
|
||||
handler = bb.event.LogHandler()
|
||||
logger.addHandler(handler)
|
||||
# Clear away any spurious environment variables. But don't wipe the
|
||||
# environment totally. This is necessary to ensure the correct operation
|
||||
# of the UIs (e.g. for DISPLAY, etc.)
|
||||
bb.utils.clean_environment()
|
||||
|
||||
# Clear away any spurious environment variables while we stoke up the cooker
|
||||
cleanedvars = bb.utils.clean_environment()
|
||||
cooker = bb.cooker.BBCooker(configuration, server)
|
||||
cooker.parseCommandLine()
|
||||
|
||||
# Collect all the caches we need
|
||||
if configParams.server_only:
|
||||
configuration.extra_caches = gather_extra_cache_data()
|
||||
serverinfo = server.BitbakeServerInfo(cooker.server)
|
||||
|
||||
server.BitBakeServerFork(cooker, cooker.server, serverinfo, cooker_logfile)
|
||||
del cooker
|
||||
|
||||
logger.removeHandler(loghandler)
|
||||
|
||||
# Setup a connection to the server (cooker)
|
||||
server_connection = server.BitBakeServerConnection(serverinfo)
|
||||
|
||||
# Launch the UI
|
||||
if configuration.ui:
|
||||
ui = configuration.ui
|
||||
else:
|
||||
configuration.extra_caches = getattr(ui_module, "extraCaches", [])
|
||||
ui = "knotty"
|
||||
|
||||
if not configParams.remote_server:
|
||||
# we start a server with a given configuration
|
||||
server = start_server(servermodule, configParams, configuration)
|
||||
else:
|
||||
# we start a stub server that is actually a XMLRPClient to
|
||||
server = servermodule.BitBakeXMLRPCClient(configParams.observe_only)
|
||||
server.saveConnectionDetails(configParams.remote_server)
|
||||
|
||||
logger.removeHandler(handler)
|
||||
|
||||
if not configParams.server_only:
|
||||
# Setup a connection to the server (cooker)
|
||||
server_connection = server.establishConnection()
|
||||
|
||||
# Restore the environment in case the UI needs it
|
||||
for k in cleanedvars:
|
||||
os.environ[k] = cleanedvars[k]
|
||||
|
||||
try:
|
||||
return ui_module.main(server_connection.connection, server_connection.events, configParams)
|
||||
finally:
|
||||
bb.event.ui_queue = []
|
||||
server_connection.terminate()
|
||||
else:
|
||||
print("server address: %s, server port: %s" % (server.serverImpl.host, server.serverImpl.port))
|
||||
|
||||
return 1
|
||||
try:
|
||||
return server.BitbakeUILauch().launch(serverinfo, ui_main, server_connection.connection, server_connection.events)
|
||||
finally:
|
||||
server_connection.terminate()
|
||||
|
||||
if __name__ == "__main__":
|
||||
try:
|
||||
@@ -342,6 +220,5 @@ if __name__ == "__main__":
|
||||
except Exception:
|
||||
ret = 1
|
||||
import traceback
|
||||
traceback.print_exc()
|
||||
traceback.print_exc(5)
|
||||
sys.exit(ret)
|
||||
|
||||
|
||||
@@ -1,102 +1,12 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# bitbake-diffsigs
|
||||
# BitBake task signature data comparison utility
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
import fnmatch
|
||||
import optparse
|
||||
import logging
|
||||
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
|
||||
|
||||
import bb.tinfoil
|
||||
import bb.siggen
|
||||
|
||||
logger = logging.getLogger('BitBake')
|
||||
|
||||
def find_compare_task(bbhandler, pn, taskname):
|
||||
""" Find the most recent signature files for the specified PN/task and compare them """
|
||||
|
||||
if not hasattr(bb.siggen, 'find_siginfo'):
|
||||
logger.error('Metadata does not support finding signature data files')
|
||||
sys.exit(1)
|
||||
|
||||
filedates = bb.siggen.find_siginfo(pn, taskname, None, bbhandler.config_data)
|
||||
latestfiles = sorted(filedates.keys(), key=lambda f: filedates[f])[-2:]
|
||||
if not latestfiles:
|
||||
logger.error('No sigdata files found matching %s %s' % (pn, taskname))
|
||||
sys.exit(1)
|
||||
elif len(latestfiles) < 2:
|
||||
logger.error('Only one matching sigdata file found for the specified task (%s %s)' % (pn, taskname))
|
||||
sys.exit(1)
|
||||
else:
|
||||
# Define recursion callback
|
||||
def recursecb(key, hash1, hash2):
|
||||
hashes = [hash1, hash2]
|
||||
hashfiles = bb.siggen.find_siginfo(key, None, hashes, bbhandler.config_data)
|
||||
|
||||
recout = []
|
||||
if len(hashfiles) == 2:
|
||||
out2 = bb.siggen.compare_sigfiles(hashfiles[hash1], hashfiles[hash2], recursecb)
|
||||
recout.extend(list(' ' + l for l in out2))
|
||||
else:
|
||||
recout.append("Unable to find matching sigdata for %s with hashes %s or %s" % (key, hash1, hash2))
|
||||
|
||||
return recout
|
||||
|
||||
# Recurse into signature comparison
|
||||
output = bb.siggen.compare_sigfiles(latestfiles[0], latestfiles[1], recursecb)
|
||||
if output:
|
||||
print '\n'.join(output)
|
||||
sys.exit(0)
|
||||
|
||||
|
||||
|
||||
parser = optparse.OptionParser(
|
||||
usage = """
|
||||
%prog -t recipename taskname
|
||||
%prog sigdatafile1 sigdatafile2
|
||||
%prog sigdatafile1""")
|
||||
|
||||
parser.add_option("-t", "--task",
|
||||
help = "find the signature data files for last two runs of the specified task and compare them",
|
||||
action="store_true", dest="taskmode")
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
|
||||
if len(args) == 1:
|
||||
parser.print_help()
|
||||
if len(sys.argv) > 2:
|
||||
bb.siggen.compare_sigfiles(sys.argv[1], sys.argv[2])
|
||||
else:
|
||||
if options.taskmode:
|
||||
tinfoil = bb.tinfoil.Tinfoil()
|
||||
if len(args) < 3:
|
||||
logger.error("Please specify a recipe and task name")
|
||||
sys.exit(1)
|
||||
tinfoil.prepare(config_only = True)
|
||||
find_compare_task(tinfoil, args[1], args[2])
|
||||
else:
|
||||
if len(args) == 2:
|
||||
output = bb.siggen.dump_sigfile(sys.argv[1])
|
||||
else:
|
||||
output = bb.siggen.compare_sigfiles(sys.argv[1], sys.argv[2])
|
||||
|
||||
if output:
|
||||
print '\n'.join(output)
|
||||
bb.siggen.dump_sigfile(sys.argv[1])
|
||||
|
||||
@@ -1,11 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
|
||||
|
||||
import bb.siggen
|
||||
|
||||
output = bb.siggen.dump_sigfile(sys.argv[1])
|
||||
if output:
|
||||
print '\n'.join(output)
|
||||
@@ -2,31 +2,14 @@
|
||||
|
||||
# This script has subcommands which operate against your bitbake layers, either
|
||||
# displaying useful information, or acting against them.
|
||||
# See the help output for details on available commands.
|
||||
|
||||
# Copyright (C) 2011 Mentor Graphics Corporation
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
# Currently, it only provides a show_appends command, which shows you what
|
||||
# bbappends are in effect, and warns you if you have appends which are not being
|
||||
# utilized.
|
||||
|
||||
import cmd
|
||||
import logging
|
||||
import os
|
||||
import os.path
|
||||
import sys
|
||||
import fnmatch
|
||||
from collections import defaultdict
|
||||
import re
|
||||
|
||||
bindir = os.path.dirname(__file__)
|
||||
topdir = os.path.dirname(bindir)
|
||||
@@ -35,686 +18,141 @@ sys.path[0:0] = [os.path.join(topdir, 'lib')]
|
||||
import bb.cache
|
||||
import bb.cooker
|
||||
import bb.providers
|
||||
import bb.utils
|
||||
import bb.tinfoil
|
||||
from bb.cooker import state
|
||||
from bb.server import none
|
||||
|
||||
|
||||
logger = logging.getLogger('BitBake')
|
||||
default_cmd = 'show_appends'
|
||||
|
||||
|
||||
def main(args):
|
||||
logging.basicConfig(format='%(levelname)s: %(message)s')
|
||||
bb.utils.clean_environment()
|
||||
|
||||
cmds = Commands()
|
||||
if args:
|
||||
# Allow user to specify e.g. show-layers instead of show_layers
|
||||
args = [args[0].replace('-', '_')] + args[1:]
|
||||
cmds.onecmd(' '.join(args))
|
||||
else:
|
||||
cmds.do_help('')
|
||||
cmds.onecmd(default_cmd)
|
||||
return cmds.returncode
|
||||
|
||||
|
||||
class Commands(cmd.Cmd):
|
||||
def __init__(self):
|
||||
cmd.Cmd.__init__(self)
|
||||
self.bbhandler = bb.tinfoil.Tinfoil()
|
||||
|
||||
self.returncode = 0
|
||||
self.bblayers = (self.bbhandler.config_data.getVar('BBLAYERS', True) or "").split()
|
||||
self.config = Config(parse_only=True)
|
||||
self.cooker = bb.cooker.BBCooker(self.config,
|
||||
bb.server.none)
|
||||
self.config_data = self.cooker.configuration.data
|
||||
bb.providers.logger.setLevel(logging.ERROR)
|
||||
self.prepare_cooker()
|
||||
|
||||
def default(self, line):
|
||||
"""Handle unrecognised commands"""
|
||||
sys.stderr.write("Unrecognised command or option\n")
|
||||
self.do_help('')
|
||||
def prepare_cooker(self):
|
||||
sys.stderr.write("Parsing recipes..")
|
||||
logger.setLevel(logging.ERROR)
|
||||
|
||||
def do_help(self, topic):
|
||||
"""display general help or help on a specified command"""
|
||||
if topic:
|
||||
sys.stdout.write('%s: ' % topic)
|
||||
cmd.Cmd.do_help(self, topic.replace('-', '_'))
|
||||
else:
|
||||
sys.stdout.write("usage: bitbake-layers <command> [arguments]\n\n")
|
||||
sys.stdout.write("Available commands:\n")
|
||||
procnames = list(set(self.get_names()))
|
||||
for procname in procnames:
|
||||
if procname[:3] == 'do_':
|
||||
sys.stdout.write(" %s\n" % procname[3:].replace('_', '-'))
|
||||
doc = getattr(self, procname).__doc__
|
||||
if doc:
|
||||
sys.stdout.write(" %s\n" % doc.splitlines()[0])
|
||||
try:
|
||||
while self.cooker.state in (state.initial, state.parsing):
|
||||
self.cooker.updateCache()
|
||||
except KeyboardInterrupt:
|
||||
self.cooker.shutdown()
|
||||
self.cooker.updateCache()
|
||||
sys.exit(2)
|
||||
|
||||
logger.setLevel(logging.INFO)
|
||||
sys.stderr.write("done.\n")
|
||||
|
||||
self.cooker_data = self.cooker.status
|
||||
self.cooker_data.appends = self.cooker.appendlist
|
||||
|
||||
def do_show_layers(self, args):
|
||||
"""show current configured layers"""
|
||||
self.bbhandler.prepare(config_only = True)
|
||||
logger.plain("%s %s %s" % ("layer".ljust(20), "path".ljust(40), "priority"))
|
||||
logger.plain('=' * 74)
|
||||
for layerdir in self.bblayers:
|
||||
layername = self.get_layer_name(layerdir)
|
||||
layerpri = 0
|
||||
for layer, _, regex, pri in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
|
||||
if regex.match(os.path.join(layerdir, 'test')):
|
||||
layerpri = pri
|
||||
break
|
||||
|
||||
logger.plain("%s %s %d" % (layername.ljust(20), layerdir.ljust(40), layerpri))
|
||||
|
||||
|
||||
def version_str(self, pe, pv, pr = None):
|
||||
verstr = "%s" % pv
|
||||
if pr:
|
||||
verstr = "%s-%s" % (verstr, pr)
|
||||
if pe:
|
||||
verstr = "%s:%s" % (pe, verstr)
|
||||
return verstr
|
||||
|
||||
|
||||
def do_show_overlayed(self, args):
|
||||
"""list overlayed recipes (where the same recipe exists in another layer)
|
||||
|
||||
usage: show-overlayed [-f] [-s]
|
||||
|
||||
Lists the names of overlayed recipes and the available versions in each
|
||||
layer, with the preferred version first. Note that skipped recipes that
|
||||
are overlayed will also be listed, with a " (skipped)" suffix.
|
||||
|
||||
Options:
|
||||
-f instead of the default formatting, list filenames of higher priority
|
||||
recipes with the ones they overlay indented underneath
|
||||
-s only list overlayed recipes where the version is the same
|
||||
"""
|
||||
self.bbhandler.prepare()
|
||||
|
||||
show_filenames = False
|
||||
show_same_ver_only = False
|
||||
for arg in args.split():
|
||||
if arg == '-f':
|
||||
show_filenames = True
|
||||
elif arg == '-s':
|
||||
show_same_ver_only = True
|
||||
else:
|
||||
sys.stderr.write("show-overlayed: invalid option %s\n" % arg)
|
||||
self.do_help('')
|
||||
return
|
||||
|
||||
items_listed = self.list_recipes('Overlayed recipes', None, True, show_same_ver_only, show_filenames, True)
|
||||
|
||||
# Check for overlayed .bbclass files
|
||||
classes = defaultdict(list)
|
||||
for layerdir in self.bblayers:
|
||||
classdir = os.path.join(layerdir, 'classes')
|
||||
if os.path.exists(classdir):
|
||||
for classfile in os.listdir(classdir):
|
||||
if os.path.splitext(classfile)[1] == '.bbclass':
|
||||
classes[classfile].append(classdir)
|
||||
|
||||
# Locating classes and other files is a bit more complicated than recipes -
|
||||
# layer priority is not a factor; instead BitBake uses the first matching
|
||||
# file in BBPATH, which is manipulated directly by each layer's
|
||||
# conf/layer.conf in turn, thus the order of layers in bblayers.conf is a
|
||||
# factor - however, each layer.conf is free to either prepend or append to
|
||||
# BBPATH (or indeed do crazy stuff with it). Thus the order in BBPATH might
|
||||
# not be exactly the order present in bblayers.conf either.
|
||||
bbpath = str(self.bbhandler.config_data.getVar('BBPATH', True))
|
||||
overlayed_class_found = False
|
||||
for (classfile, classdirs) in classes.items():
|
||||
if len(classdirs) > 1:
|
||||
if not overlayed_class_found:
|
||||
logger.plain('=== Overlayed classes ===')
|
||||
overlayed_class_found = True
|
||||
|
||||
mainfile = bb.utils.which(bbpath, os.path.join('classes', classfile))
|
||||
if show_filenames:
|
||||
logger.plain('%s' % mainfile)
|
||||
else:
|
||||
# We effectively have to guess the layer here
|
||||
logger.plain('%s:' % classfile)
|
||||
mainlayername = '?'
|
||||
for layerdir in self.bblayers:
|
||||
classdir = os.path.join(layerdir, 'classes')
|
||||
if mainfile.startswith(classdir):
|
||||
mainlayername = self.get_layer_name(layerdir)
|
||||
logger.plain(' %s' % mainlayername)
|
||||
for classdir in classdirs:
|
||||
fullpath = os.path.join(classdir, classfile)
|
||||
if fullpath != mainfile:
|
||||
if show_filenames:
|
||||
print(' %s' % fullpath)
|
||||
else:
|
||||
print(' %s' % self.get_layer_name(os.path.dirname(classdir)))
|
||||
|
||||
if overlayed_class_found:
|
||||
items_listed = True;
|
||||
|
||||
if not items_listed:
|
||||
logger.plain('No overlayed files found.')
|
||||
|
||||
|
||||
def do_show_recipes(self, args):
|
||||
"""list available recipes, showing the layer they are provided by
|
||||
|
||||
usage: show-recipes [-f] [-m] [pnspec]
|
||||
|
||||
Lists the names of overlayed recipes and the available versions in each
|
||||
layer, with the preferred version first. Optionally you may specify
|
||||
pnspec to match a specified recipe name (supports wildcards). Note that
|
||||
skipped recipes will also be listed, with a " (skipped)" suffix.
|
||||
|
||||
Options:
|
||||
-f instead of the default formatting, list filenames of higher priority
|
||||
recipes with other available recipes indented underneath
|
||||
-m only list where multiple recipes (in the same layer or different
|
||||
layers) exist for the same recipe name
|
||||
"""
|
||||
self.bbhandler.prepare()
|
||||
|
||||
show_filenames = False
|
||||
show_multi_provider_only = False
|
||||
pnspec = None
|
||||
title = 'Available recipes:'
|
||||
for arg in args.split():
|
||||
if arg == '-f':
|
||||
show_filenames = True
|
||||
elif arg == '-m':
|
||||
show_multi_provider_only = True
|
||||
elif not arg.startswith('-'):
|
||||
pnspec = arg
|
||||
title = 'Available recipes matching %s:' % pnspec
|
||||
else:
|
||||
sys.stderr.write("show-recipes: invalid option %s\n" % arg)
|
||||
self.do_help('')
|
||||
return
|
||||
self.list_recipes(title, pnspec, False, False, show_filenames, show_multi_provider_only)
|
||||
|
||||
|
||||
def list_recipes(self, title, pnspec, show_overlayed_only, show_same_ver_only, show_filenames, show_multi_provider_only):
|
||||
pkg_pn = self.bbhandler.cooker.recipecache.pkg_pn
|
||||
(latest_versions, preferred_versions) = bb.providers.findProviders(self.bbhandler.config_data, self.bbhandler.cooker.recipecache, pkg_pn)
|
||||
allproviders = bb.providers.allProviders(self.bbhandler.cooker.recipecache)
|
||||
|
||||
# Ensure we list skipped recipes
|
||||
# We are largely guessing about PN, PV and the preferred version here,
|
||||
# but we have no choice since skipped recipes are not fully parsed
|
||||
skiplist = self.bbhandler.cooker.skiplist.keys()
|
||||
skiplist.sort( key=lambda fileitem: self.bbhandler.cooker.collection.calc_bbfile_priority(fileitem) )
|
||||
skiplist.reverse()
|
||||
for fn in skiplist:
|
||||
recipe_parts = os.path.splitext(os.path.basename(fn))[0].split('_')
|
||||
p = recipe_parts[0]
|
||||
if len(recipe_parts) > 1:
|
||||
ver = (None, recipe_parts[1], None)
|
||||
else:
|
||||
ver = (None, 'unknown', None)
|
||||
allproviders[p].append((ver, fn))
|
||||
if not p in pkg_pn:
|
||||
pkg_pn[p] = 'dummy'
|
||||
preferred_versions[p] = (ver, fn)
|
||||
|
||||
def print_item(f, pn, ver, layer, ispref):
|
||||
if f in skiplist:
|
||||
skipped = ' (skipped)'
|
||||
else:
|
||||
skipped = ''
|
||||
if show_filenames:
|
||||
if ispref:
|
||||
logger.plain("%s%s", f, skipped)
|
||||
else:
|
||||
logger.plain(" %s%s", f, skipped)
|
||||
else:
|
||||
if ispref:
|
||||
logger.plain("%s:", pn)
|
||||
logger.plain(" %s %s%s", layer.ljust(20), ver, skipped)
|
||||
|
||||
preffiles = []
|
||||
items_listed = False
|
||||
for p in sorted(pkg_pn):
|
||||
if pnspec:
|
||||
if not fnmatch.fnmatch(p, pnspec):
|
||||
continue
|
||||
|
||||
if len(allproviders[p]) > 1 or not show_multi_provider_only:
|
||||
pref = preferred_versions[p]
|
||||
preffile = bb.cache.Cache.virtualfn2realfn(pref[1])[0]
|
||||
if preffile not in preffiles:
|
||||
preflayer = self.get_file_layer(preffile)
|
||||
multilayer = False
|
||||
same_ver = True
|
||||
provs = []
|
||||
for prov in allproviders[p]:
|
||||
provfile = bb.cache.Cache.virtualfn2realfn(prov[1])[0]
|
||||
provlayer = self.get_file_layer(provfile)
|
||||
provs.append((provfile, provlayer, prov[0]))
|
||||
if provlayer != preflayer:
|
||||
multilayer = True
|
||||
if prov[0] != pref[0]:
|
||||
same_ver = False
|
||||
|
||||
if (multilayer or not show_overlayed_only) and (same_ver or not show_same_ver_only):
|
||||
if not items_listed:
|
||||
logger.plain('=== %s ===' % title)
|
||||
items_listed = True
|
||||
print_item(preffile, p, self.version_str(pref[0][0], pref[0][1]), preflayer, True)
|
||||
for (provfile, provlayer, provver) in provs:
|
||||
if provfile != preffile:
|
||||
print_item(provfile, p, self.version_str(provver[0], provver[1]), provlayer, False)
|
||||
# Ensure we don't show two entries for BBCLASSEXTENDed recipes
|
||||
preffiles.append(preffile)
|
||||
|
||||
return items_listed
|
||||
|
||||
|
||||
def do_flatten(self, args):
|
||||
"""flattens layer configuration into a separate output directory.
|
||||
|
||||
usage: flatten [layer1 layer2 [layer3]...] <outputdir>
|
||||
|
||||
Takes the specified layers (or all layers in the current layer
|
||||
configuration if none are specified) and builds a "flattened" directory
|
||||
containing the contents of all layers, with any overlayed recipes removed
|
||||
and bbappends appended to the corresponding recipes. Note that some manual
|
||||
cleanup may still be necessary afterwards, in particular:
|
||||
|
||||
* where non-recipe files (such as patches) are overwritten (the flatten
|
||||
command will show a warning for these)
|
||||
* where anything beyond the normal layer setup has been added to
|
||||
layer.conf (only the lowest priority number layer's layer.conf is used)
|
||||
* overridden/appended items from bbappends will need to be tidied up
|
||||
* when the flattened layers do not have the same directory structure (the
|
||||
flatten command should show a warning when this will cause a problem)
|
||||
|
||||
Warning: if you flatten several layers where another layer is intended to
|
||||
be used "inbetween" them (in layer priority order) such that recipes /
|
||||
bbappends in the layers interact, and then attempt to use the new output
|
||||
layer together with that other layer, you may no longer get the same
|
||||
build results (as the layer priority order has effectively changed).
|
||||
"""
|
||||
arglist = args.split()
|
||||
if len(arglist) < 1:
|
||||
logger.error('Please specify an output directory')
|
||||
self.do_help('flatten')
|
||||
return
|
||||
|
||||
if len(arglist) == 2:
|
||||
logger.error('If you specify layers to flatten you must specify at least two')
|
||||
self.do_help('flatten')
|
||||
return
|
||||
|
||||
outputdir = arglist[-1]
|
||||
if os.path.exists(outputdir) and os.listdir(outputdir):
|
||||
logger.error('Directory %s exists and is non-empty, please clear it out first' % outputdir)
|
||||
return
|
||||
|
||||
self.bbhandler.prepare()
|
||||
layers = self.bblayers
|
||||
if len(arglist) > 2:
|
||||
layernames = arglist[:-1]
|
||||
found_layernames = []
|
||||
found_layerdirs = []
|
||||
for layerdir in layers:
|
||||
layername = self.get_layer_name(layerdir)
|
||||
if layername in layernames:
|
||||
found_layerdirs.append(layerdir)
|
||||
found_layernames.append(layername)
|
||||
|
||||
for layername in layernames:
|
||||
if not layername in found_layernames:
|
||||
logger.error('Unable to find layer %s in current configuration, please run "%s show-layers" to list configured layers' % (layername, os.path.basename(sys.argv[0])))
|
||||
return
|
||||
layers = found_layerdirs
|
||||
else:
|
||||
layernames = []
|
||||
|
||||
# Ensure a specified path matches our list of layers
|
||||
def layer_path_match(path):
|
||||
for layerdir in layers:
|
||||
if path.startswith(os.path.join(layerdir, '')):
|
||||
return layerdir
|
||||
return None
|
||||
|
||||
appended_recipes = []
|
||||
for layer in layers:
|
||||
overlayed = []
|
||||
for f in self.bbhandler.cooker.collection.overlayed.iterkeys():
|
||||
for of in self.bbhandler.cooker.collection.overlayed[f]:
|
||||
if of.startswith(layer):
|
||||
overlayed.append(of)
|
||||
|
||||
logger.plain('Copying files from %s...' % layer )
|
||||
for root, dirs, files in os.walk(layer):
|
||||
for f1 in files:
|
||||
f1full = os.sep.join([root, f1])
|
||||
if f1full in overlayed:
|
||||
logger.plain(' Skipping overlayed file %s' % f1full )
|
||||
else:
|
||||
ext = os.path.splitext(f1)[1]
|
||||
if ext != '.bbappend':
|
||||
fdest = f1full[len(layer):]
|
||||
fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
|
||||
bb.utils.mkdirhier(os.path.dirname(fdest))
|
||||
if os.path.exists(fdest):
|
||||
if f1 == 'layer.conf' and root.endswith('/conf'):
|
||||
logger.plain(' Skipping layer config file %s' % f1full )
|
||||
continue
|
||||
else:
|
||||
logger.warn('Overwriting file %s', fdest)
|
||||
bb.utils.copyfile(f1full, fdest)
|
||||
if ext == '.bb':
|
||||
if f1 in self.bbhandler.cooker.collection.appendlist:
|
||||
appends = self.bbhandler.cooker.collection.appendlist[f1]
|
||||
if appends:
|
||||
logger.plain(' Applying appends to %s' % fdest )
|
||||
for appendname in appends:
|
||||
if layer_path_match(appendname):
|
||||
self.apply_append(appendname, fdest)
|
||||
appended_recipes.append(f1)
|
||||
|
||||
# Take care of when some layers are excluded and yet we have included bbappends for those recipes
|
||||
for recipename in self.bbhandler.cooker.collection.appendlist.iterkeys():
|
||||
if recipename not in appended_recipes:
|
||||
appends = self.bbhandler.cooker.collection.appendlist[recipename]
|
||||
first_append = None
|
||||
for appendname in appends:
|
||||
layer = layer_path_match(appendname)
|
||||
if layer:
|
||||
if first_append:
|
||||
self.apply_append(appendname, first_append)
|
||||
else:
|
||||
fdest = appendname[len(layer):]
|
||||
fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
|
||||
bb.utils.mkdirhier(os.path.dirname(fdest))
|
||||
bb.utils.copyfile(appendname, fdest)
|
||||
first_append = fdest
|
||||
|
||||
# Get the regex for the first layer in our list (which is where the conf/layer.conf file will
|
||||
# have come from)
|
||||
first_regex = None
|
||||
layerdir = layers[0]
|
||||
for layername, pattern, regex, _ in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
|
||||
if regex.match(os.path.join(layerdir, 'test')):
|
||||
first_regex = regex
|
||||
break
|
||||
|
||||
if first_regex:
|
||||
# Find the BBFILES entries that match (which will have come from this conf/layer.conf file)
|
||||
bbfiles = str(self.bbhandler.config_data.getVar('BBFILES', True)).split()
|
||||
bbfiles_layer = []
|
||||
for item in bbfiles:
|
||||
if first_regex.match(item):
|
||||
newpath = os.path.join(outputdir, item[len(layerdir)+1:])
|
||||
bbfiles_layer.append(newpath)
|
||||
|
||||
if bbfiles_layer:
|
||||
# Check that all important layer files match BBFILES
|
||||
for root, dirs, files in os.walk(outputdir):
|
||||
for f1 in files:
|
||||
ext = os.path.splitext(f1)[1]
|
||||
if ext in ['.bb', '.bbappend']:
|
||||
f1full = os.sep.join([root, f1])
|
||||
entry_found = False
|
||||
for item in bbfiles_layer:
|
||||
if fnmatch.fnmatch(f1full, item):
|
||||
entry_found = True
|
||||
break
|
||||
if not entry_found:
|
||||
logger.warning("File %s does not match the flattened layer's BBFILES setting, you may need to edit conf/layer.conf or move the file elsewhere" % f1full)
|
||||
|
||||
def get_file_layer(self, filename):
|
||||
for layer, _, regex, _ in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
|
||||
if regex.match(filename):
|
||||
for layerdir in self.bblayers:
|
||||
if regex.match(os.path.join(layerdir, 'test')) and re.match(layerdir, filename):
|
||||
return self.get_layer_name(layerdir)
|
||||
return "?"
|
||||
|
||||
def get_file_layerdir(self, filename):
|
||||
for layer, _, regex, _ in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
|
||||
if regex.match(filename):
|
||||
for layerdir in self.bblayers:
|
||||
if regex.match(os.path.join(layerdir, 'test')) and re.match(layerdir, filename):
|
||||
return layerdir
|
||||
return "?"
|
||||
|
||||
def remove_layer_prefix(self, f):
|
||||
"""Remove the layer_dir prefix, e.g., f = /path/to/layer_dir/foo/blah, the
|
||||
return value will be: layer_dir/foo/blah"""
|
||||
f_layerdir = self.get_file_layerdir(f)
|
||||
prefix = os.path.join(os.path.dirname(f_layerdir), '')
|
||||
return f[len(prefix):] if f.startswith(prefix) else f
|
||||
|
||||
def get_layer_name(self, layerdir):
|
||||
return os.path.basename(layerdir.rstrip(os.sep))
|
||||
|
||||
def apply_append(self, appendname, recipename):
|
||||
appendfile = open(appendname, 'r')
|
||||
recipefile = open(recipename, 'a')
|
||||
recipefile.write('\n')
|
||||
recipefile.write('##### bbappended from %s #####\n' % self.get_file_layer(appendname))
|
||||
recipefile.writelines(appendfile.readlines())
|
||||
recipefile.close()
|
||||
appendfile.close()
|
||||
logger.info(str(self.config_data.getVar('BBLAYERS', True)))
|
||||
|
||||
def do_show_appends(self, args):
|
||||
"""list bbappend files and recipe files they apply to
|
||||
|
||||
usage: show-appends
|
||||
|
||||
Recipes are listed with the bbappends that apply to them as subitems.
|
||||
"""
|
||||
self.bbhandler.prepare()
|
||||
if not self.bbhandler.cooker.collection.appendlist:
|
||||
logger.plain('No append files found')
|
||||
if not self.cooker_data.appends:
|
||||
logger.info('No append files found')
|
||||
return
|
||||
|
||||
logger.plain('=== Appended recipes ===')
|
||||
logger.info('State of append files:')
|
||||
|
||||
pnlist = list(self.bbhandler.cooker_data.pkg_pn.keys())
|
||||
pnlist.sort()
|
||||
for pn in pnlist:
|
||||
for pn in self.cooker_data.pkg_pn:
|
||||
self.show_appends_for_pn(pn)
|
||||
|
||||
self.show_appends_for_skipped()
|
||||
self.show_appends_with_no_recipes()
|
||||
|
||||
def show_appends_for_pn(self, pn):
|
||||
filenames = self.bbhandler.cooker_data.pkg_pn[pn]
|
||||
filenames = self.cooker_data.pkg_pn[pn]
|
||||
|
||||
best = bb.providers.findBestProvider(pn,
|
||||
self.bbhandler.config_data,
|
||||
self.bbhandler.cooker_data,
|
||||
self.bbhandler.cooker_data.pkg_pn)
|
||||
self.cooker.configuration.data,
|
||||
self.cooker_data,
|
||||
self.cooker_data.pkg_pn)
|
||||
best_filename = os.path.basename(best[3])
|
||||
|
||||
self.show_appends_output(filenames, best_filename)
|
||||
|
||||
def show_appends_for_skipped(self):
|
||||
filenames = [os.path.basename(f)
|
||||
for f in self.bbhandler.cooker.skiplist.iterkeys()]
|
||||
self.show_appends_output(filenames, None, " (skipped)")
|
||||
|
||||
def show_appends_output(self, filenames, best_filename, name_suffix = ''):
|
||||
appended, missing = self.get_appends_for_files(filenames)
|
||||
if appended:
|
||||
for basename, appends in appended:
|
||||
logger.plain('%s%s:', basename, name_suffix)
|
||||
logger.info('%s:', basename)
|
||||
for append in appends:
|
||||
logger.plain(' %s', append)
|
||||
|
||||
if best_filename:
|
||||
if best_filename in missing:
|
||||
logger.warn('%s: missing append for preferred version',
|
||||
best_filename)
|
||||
self.returncode |= 1
|
||||
logger.info(' %s', append)
|
||||
|
||||
if best_filename in missing:
|
||||
logger.warn('%s: missing append for preferred version',
|
||||
best_filename)
|
||||
self.returncode |= 1
|
||||
|
||||
def get_appends_for_files(self, filenames):
|
||||
appended, notappended = [], []
|
||||
appended, notappended = set(), set()
|
||||
for filename in filenames:
|
||||
_, cls = bb.cache.Cache.virtualfn2realfn(filename)
|
||||
if cls:
|
||||
continue
|
||||
|
||||
basename = os.path.basename(filename)
|
||||
appends = self.bbhandler.cooker.collection.appendlist.get(basename)
|
||||
appends = self.cooker_data.appends.get(basename)
|
||||
if appends:
|
||||
appended.append((basename, list(appends)))
|
||||
appended.add((basename, frozenset(appends)))
|
||||
else:
|
||||
notappended.append(basename)
|
||||
notappended.add(basename)
|
||||
return appended, notappended
|
||||
|
||||
def do_show_cross_depends(self, args):
|
||||
"""figure out the dependency between recipes that crosses a layer boundary.
|
||||
def show_appends_with_no_recipes(self):
|
||||
recipes = set(os.path.basename(f)
|
||||
for f in self.cooker_data.pkg_fn.iterkeys())
|
||||
appended_recipes = self.cooker_data.appends.iterkeys()
|
||||
appends_without_recipes = [self.cooker_data.appends[recipe]
|
||||
for recipe in appended_recipes
|
||||
if recipe not in recipes]
|
||||
if appends_without_recipes:
|
||||
appendlines = (' %s' % append
|
||||
for appends in appends_without_recipes
|
||||
for append in appends)
|
||||
logger.warn('No recipes available for:\n%s',
|
||||
'\n'.join(appendlines))
|
||||
self.returncode |= 4
|
||||
|
||||
usage: show-cross-depends [-f]
|
||||
def do_EOF(self, line):
|
||||
return True
|
||||
|
||||
Figure out the dependency between recipes that crosses a layer boundary.
|
||||
|
||||
Options:
|
||||
-f show full file path
|
||||
class Config(object):
|
||||
def __init__(self, **options):
|
||||
self.pkgs_to_build = []
|
||||
self.debug_domains = []
|
||||
self.extra_assume_provided = []
|
||||
self.file = []
|
||||
self.debug = 0
|
||||
self.__dict__.update(options)
|
||||
|
||||
NOTE:
|
||||
The .bbappend file can impact the dependency.
|
||||
"""
|
||||
self.bbhandler.prepare()
|
||||
def __getattr__(self, attribute):
|
||||
try:
|
||||
return super(Config, self).__getattribute__(attribute)
|
||||
except AttributeError:
|
||||
return None
|
||||
|
||||
show_filenames = False
|
||||
for arg in args.split():
|
||||
if arg == '-f':
|
||||
show_filenames = True
|
||||
else:
|
||||
sys.stderr.write("show-cross-depends: invalid option %s\n" % arg)
|
||||
self.do_help('')
|
||||
return
|
||||
|
||||
pkg_fn = self.bbhandler.cooker_data.pkg_fn
|
||||
bbpath = str(self.bbhandler.config_data.getVar('BBPATH', True))
|
||||
self.require_re = re.compile(r"require\s+(.+)")
|
||||
self.include_re = re.compile(r"include\s+(.+)")
|
||||
self.inherit_re = re.compile(r"inherit\s+(.+)")
|
||||
|
||||
# The bb's DEPENDS and RDEPENDS
|
||||
for f in pkg_fn:
|
||||
f = bb.cache.Cache.virtualfn2realfn(f)[0]
|
||||
# Get the layername that the file is in
|
||||
layername = self.get_file_layer(f)
|
||||
|
||||
# The DEPENDS
|
||||
deps = self.bbhandler.cooker_data.deps[f]
|
||||
for pn in deps:
|
||||
if pn in self.bbhandler.cooker_data.pkg_pn:
|
||||
best = bb.providers.findBestProvider(pn,
|
||||
self.bbhandler.config_data,
|
||||
self.bbhandler.cooker_data,
|
||||
self.bbhandler.cooker_data.pkg_pn)
|
||||
self.check_cross_depends("DEPENDS", layername, f, best[3], show_filenames)
|
||||
|
||||
# The RDPENDS
|
||||
all_rdeps = self.bbhandler.cooker_data.rundeps[f].values()
|
||||
# Remove the duplicated or null one.
|
||||
sorted_rdeps = {}
|
||||
# The all_rdeps is the list in list, so we need two for loops
|
||||
for k1 in all_rdeps:
|
||||
for k2 in k1:
|
||||
sorted_rdeps[k2] = 1
|
||||
all_rdeps = sorted_rdeps.keys()
|
||||
for rdep in all_rdeps:
|
||||
all_p = bb.providers.getRuntimeProviders(self.bbhandler.cooker_data, rdep)
|
||||
if all_p:
|
||||
best = bb.providers.filterProvidersRunTime(all_p, rdep,
|
||||
self.bbhandler.config_data,
|
||||
self.bbhandler.cooker_data)[0][0]
|
||||
self.check_cross_depends("RDEPENDS", layername, f, best, show_filenames)
|
||||
|
||||
# The inherit class
|
||||
cls_re = re.compile('classes/')
|
||||
if f in self.bbhandler.cooker_data.inherits:
|
||||
inherits = self.bbhandler.cooker_data.inherits[f]
|
||||
for cls in inherits:
|
||||
# The inherits' format is [classes/cls, /path/to/classes/cls]
|
||||
# ignore the classes/cls.
|
||||
if not cls_re.match(cls):
|
||||
inherit_layername = self.get_file_layer(cls)
|
||||
if inherit_layername != layername:
|
||||
if not show_filenames:
|
||||
f_short = self.remove_layer_prefix(f)
|
||||
cls = self.remove_layer_prefix(cls)
|
||||
else:
|
||||
f_short = f
|
||||
logger.plain("%s inherits %s" % (f_short, cls))
|
||||
|
||||
# The 'require/include xxx' in the bb file
|
||||
pv_re = re.compile(r"\${PV}")
|
||||
fnfile = open(f, 'r')
|
||||
line = fnfile.readline()
|
||||
while line:
|
||||
m, keyword = self.match_require_include(line)
|
||||
# Found the 'require/include xxxx'
|
||||
if m:
|
||||
needed_file = m.group(1)
|
||||
# Replace the ${PV} with the real PV
|
||||
if pv_re.search(needed_file) and f in self.bbhandler.cooker_data.pkg_pepvpr:
|
||||
pv = self.bbhandler.cooker_data.pkg_pepvpr[f][1]
|
||||
needed_file = re.sub(r"\${PV}", pv, needed_file)
|
||||
self.print_cross_files(bbpath, keyword, layername, f, needed_file, show_filenames)
|
||||
line = fnfile.readline()
|
||||
fnfile.close()
|
||||
|
||||
# The "require/include xxx" in conf/machine/*.conf, .inc and .bbclass
|
||||
conf_re = re.compile(".*/conf/machine/[^\/]*\.conf$")
|
||||
inc_re = re.compile(".*\.inc$")
|
||||
# The "inherit xxx" in .bbclass
|
||||
bbclass_re = re.compile(".*\.bbclass$")
|
||||
for layerdir in self.bblayers:
|
||||
layername = self.get_layer_name(layerdir)
|
||||
for dirpath, dirnames, filenames in os.walk(layerdir):
|
||||
for name in filenames:
|
||||
f = os.path.join(dirpath, name)
|
||||
s = conf_re.match(f) or inc_re.match(f) or bbclass_re.match(f)
|
||||
if s:
|
||||
ffile = open(f, 'r')
|
||||
line = ffile.readline()
|
||||
while line:
|
||||
m, keyword = self.match_require_include(line)
|
||||
# Only bbclass has the "inherit xxx" here.
|
||||
bbclass=""
|
||||
if not m and f.endswith(".bbclass"):
|
||||
m, keyword = self.match_inherit(line)
|
||||
bbclass=".bbclass"
|
||||
# Find a 'require/include xxxx'
|
||||
if m:
|
||||
self.print_cross_files(bbpath, keyword, layername, f, m.group(1) + bbclass, show_filenames)
|
||||
line = ffile.readline()
|
||||
ffile.close()
|
||||
|
||||
def print_cross_files(self, bbpath, keyword, layername, f, needed_filename, show_filenames):
|
||||
"""Print the depends that crosses a layer boundary"""
|
||||
needed_file = bb.utils.which(bbpath, needed_filename)
|
||||
if needed_file:
|
||||
# Which layer is this file from
|
||||
needed_layername = self.get_file_layer(needed_file)
|
||||
if needed_layername != layername:
|
||||
if not show_filenames:
|
||||
f = self.remove_layer_prefix(f)
|
||||
needed_file = self.remove_layer_prefix(needed_file)
|
||||
logger.plain("%s %s %s" %(f, keyword, needed_file))
|
||||
def match_inherit(self, line):
|
||||
"""Match the inherit xxx line"""
|
||||
return (self.inherit_re.match(line), "inherits")
|
||||
|
||||
def match_require_include(self, line):
|
||||
"""Match the require/include xxx line"""
|
||||
m = self.require_re.match(line)
|
||||
keyword = "requires"
|
||||
if not m:
|
||||
m = self.include_re.match(line)
|
||||
keyword = "includes"
|
||||
return (m, keyword)
|
||||
|
||||
def check_cross_depends(self, keyword, layername, f, needed_file, show_filenames):
|
||||
"""Print the DEPENDS/RDEPENDS file that crosses a layer boundary"""
|
||||
best_realfn = bb.cache.Cache.virtualfn2realfn(needed_file)[0]
|
||||
needed_layername = self.get_file_layer(best_realfn)
|
||||
if needed_layername != layername:
|
||||
if not show_filenames:
|
||||
f = self.remove_layer_prefix(f)
|
||||
best_realfn = self.remove_layer_prefix(best_realfn)
|
||||
|
||||
logger.plain("%s %s %s" % (f, keyword, best_realfn))
|
||||
|
||||
if __name__ == '__main__':
|
||||
sys.exit(main(sys.argv[1:]) or 0)
|
||||
|
||||
@@ -1,55 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
import os
|
||||
import sys,logging
|
||||
import optparse
|
||||
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)),'lib'))
|
||||
|
||||
import prserv
|
||||
import prserv.serv
|
||||
|
||||
__version__="1.0.0"
|
||||
|
||||
PRHOST_DEFAULT='0.0.0.0'
|
||||
PRPORT_DEFAULT=8585
|
||||
|
||||
def main():
|
||||
parser = optparse.OptionParser(
|
||||
version="Bitbake PR Service Core version %s, %%prog version %s" % (prserv.__version__, __version__),
|
||||
usage = "%prog < --start | --stop > [options]")
|
||||
|
||||
parser.add_option("-f", "--file", help="database filename(default: prserv.sqlite3)", action="store",
|
||||
dest="dbfile", type="string", default="prserv.sqlite3")
|
||||
parser.add_option("-l", "--log", help="log filename(default: prserv.log)", action="store",
|
||||
dest="logfile", type="string", default="prserv.log")
|
||||
parser.add_option("--loglevel", help="logging level, i.e. CRITICAL, ERROR, WARNING, INFO, DEBUG",
|
||||
action = "store", type="string", dest="loglevel", default = "INFO")
|
||||
parser.add_option("--start", help="start daemon",
|
||||
action="store_true", dest="start")
|
||||
parser.add_option("--stop", help="stop daemon",
|
||||
action="store_true", dest="stop")
|
||||
parser.add_option("--host", help="ip address to bind", action="store",
|
||||
dest="host", type="string", default=PRHOST_DEFAULT)
|
||||
parser.add_option("--port", help="port number(default: 8585)", action="store",
|
||||
dest="port", type="int", default=PRPORT_DEFAULT)
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
prserv.init_logger(os.path.abspath(options.logfile),options.loglevel)
|
||||
|
||||
if options.start:
|
||||
ret=prserv.serv.start_daemon(options.dbfile, options.host, options.port,os.path.abspath(options.logfile))
|
||||
elif options.stop:
|
||||
ret=prserv.serv.stop_daemon(options.host, options.port)
|
||||
else:
|
||||
ret=parser.print_help()
|
||||
return ret
|
||||
|
||||
if __name__ == "__main__":
|
||||
try:
|
||||
ret = main()
|
||||
except Exception:
|
||||
ret = 1
|
||||
import traceback
|
||||
traceback.print_exc(5)
|
||||
sys.exit(ret)
|
||||
|
||||
120
bitbake/bin/bitbake-runtask
Executable file
120
bitbake/bin/bitbake-runtask
Executable file
@@ -0,0 +1,120 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
bb.msg.note(1, bb.msg.domain.Cache, "Importing cPickle failed. Falling back to a very slow implementation.")
|
||||
|
||||
class BBConfiguration(object):
|
||||
"""
|
||||
Manages build options and configurations for one run
|
||||
"""
|
||||
|
||||
def __init__(self, debug, debug_domains):
|
||||
setattr(self, "data", {})
|
||||
setattr(self, "file", [])
|
||||
setattr(self, "cmd", None)
|
||||
setattr(self, "dump_signatures", True)
|
||||
setattr(self, "debug", debug)
|
||||
setattr(self, "debug_domains", debug_domains)
|
||||
|
||||
_warnings_showwarning = warnings.showwarning
|
||||
def _showwarning(message, category, filename, lineno, file=None, line=None):
|
||||
"""Display python warning messages using bb.msg"""
|
||||
if file is not None:
|
||||
if _warnings_showwarning is not None:
|
||||
_warnings_showwarning(message, category, filename, lineno, file, line)
|
||||
else:
|
||||
s = warnings.formatwarning(message, category, filename, lineno)
|
||||
s = s.split("\n")[0]
|
||||
bb.msg.warn(None, s)
|
||||
|
||||
warnings.showwarning = _showwarning
|
||||
warnings.simplefilter("ignore", DeprecationWarning)
|
||||
|
||||
import bb.event
|
||||
|
||||
# Need to map our I/O correctly. stdout is a pipe to the server expecting
|
||||
# events. We save this and then map stdout to stderr.
|
||||
|
||||
eventfd = os.dup(sys.stdout.fileno())
|
||||
bb.event.worker_pipe = os.fdopen(eventfd, 'w', 0)
|
||||
|
||||
# map stdout to stderr
|
||||
os.dup2(sys.stderr.fileno(), sys.stdout.fileno())
|
||||
|
||||
# Replace those fds with our own
|
||||
#logout = data.expand("${TMPDIR}/log/stdout.%s" % os.getpid(), self.cfgData, True)
|
||||
#mkdirhier(os.path.dirname(logout))
|
||||
#newso = open("/tmp/stdout.%s" % os.getpid(), 'w')
|
||||
#os.dup2(newso.fileno(), sys.stdout.fileno())
|
||||
#os.dup2(newso.fileno(), sys.stderr.fileno())
|
||||
|
||||
# Don't read from stdin from the parent
|
||||
si = file("/dev/null", 'r')
|
||||
os.dup2(si.fileno( ), sys.stdin.fileno( ))
|
||||
|
||||
# We don't want to see signals to our parent, e.g. Ctrl+C
|
||||
os.setpgrp()
|
||||
|
||||
# Save out the PID so that the event can include it the
|
||||
# events
|
||||
bb.event.worker_pid = os.getpid()
|
||||
bb.event.useStdout = False
|
||||
|
||||
hashfile = sys.argv[1]
|
||||
buildfile = sys.argv[2]
|
||||
taskname = sys.argv[3]
|
||||
|
||||
import bb.cooker
|
||||
|
||||
p = pickle.Unpickler(file(hashfile, "rb"))
|
||||
hashdata = p.load()
|
||||
|
||||
debug = hashdata["msg-debug"]
|
||||
debug_domains = hashdata["msg-debug-domains"]
|
||||
verbose = hashdata["verbose"]
|
||||
|
||||
bb.utils.init_logger(bb.msg, verbose, debug, debug_domains)
|
||||
|
||||
cooker = bb.cooker.BBCooker(BBConfiguration(debug, debug_domains), None)
|
||||
cooker.parseConfiguration()
|
||||
|
||||
cooker.bb_cache = bb.cache.init(cooker)
|
||||
cooker.status = bb.cache.CacheData()
|
||||
|
||||
(fn, cls) = cooker.bb_cache.virtualfn2realfn(buildfile)
|
||||
buildfile = cooker.matchFile(fn)
|
||||
fn = cooker.bb_cache.realfn2virtual(buildfile, cls)
|
||||
|
||||
cooker.buildSetVars()
|
||||
|
||||
# Load data into the cache for fn and parse the loaded cache data
|
||||
the_data = cooker.bb_cache.loadDataFull(fn, cooker.get_file_appends(fn), cooker.configuration.data)
|
||||
cooker.bb_cache.setData(fn, buildfile, the_data)
|
||||
cooker.bb_cache.handle_data(fn, cooker.status)
|
||||
|
||||
#exportlist = bb.utils.preserved_envvars_export_list()
|
||||
#bb.utils.filter_environment(exportlist)
|
||||
|
||||
if taskname.endswith("_setscene"):
|
||||
the_data.setVarFlag(taskname, "quieterrors", "1")
|
||||
|
||||
bb.parse.siggen.set_taskdata(hashdata["hashes"], hashdata["deps"])
|
||||
|
||||
for h in hashdata["hashes"]:
|
||||
bb.data.setVar("BBHASH_%s" % h, hashdata["hashes"][h], the_data)
|
||||
for h in hashdata["deps"]:
|
||||
bb.data.setVar("BBHASHDEPS_%s" % h, hashdata["deps"][h], the_data)
|
||||
|
||||
ret = 0
|
||||
if sys.argv[4] != "True":
|
||||
ret = bb.build.exec_task(fn, taskname, the_data)
|
||||
sys.exit(ret)
|
||||
|
||||
@@ -1,38 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys, logging
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)), 'lib'))
|
||||
|
||||
import unittest
|
||||
try:
|
||||
import bb
|
||||
except RuntimeError as exc:
|
||||
sys.exit(str(exc))
|
||||
|
||||
tests = ["bb.tests.codeparser",
|
||||
"bb.tests.cow",
|
||||
"bb.tests.data",
|
||||
"bb.tests.fetch",
|
||||
"bb.tests.utils"]
|
||||
|
||||
for t in tests:
|
||||
__import__(t)
|
||||
|
||||
unittest.main(argv=["bitbake-selftest"] + tests)
|
||||
|
||||
@@ -1,361 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
|
||||
from bb import fetch2
|
||||
import logging
|
||||
import bb
|
||||
import select
|
||||
import errno
|
||||
import signal
|
||||
|
||||
# Users shouldn't be running this code directly
|
||||
if len(sys.argv) != 2 or sys.argv[1] != "decafbad":
|
||||
print("bitbake-worker is meant for internal execution by bitbake itself, please don't use it standalone.")
|
||||
sys.exit(1)
|
||||
|
||||
logger = logging.getLogger("BitBake")
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
bb.msg.note(1, bb.msg.domain.Cache, "Importing cPickle failed. Falling back to a very slow implementation.")
|
||||
|
||||
|
||||
worker_pipe = sys.stdout.fileno()
|
||||
bb.utils.nonblockingfd(worker_pipe)
|
||||
|
||||
handler = bb.event.LogHandler()
|
||||
logger.addHandler(handler)
|
||||
|
||||
if 0:
|
||||
# Code to write out a log file of all events passing through the worker
|
||||
logfilename = "/tmp/workerlogfile"
|
||||
format_str = "%(levelname)s: %(message)s"
|
||||
conlogformat = bb.msg.BBLogFormatter(format_str)
|
||||
consolelog = logging.FileHandler(logfilename)
|
||||
bb.msg.addDefaultlogFilter(consolelog)
|
||||
consolelog.setFormatter(conlogformat)
|
||||
logger.addHandler(consolelog)
|
||||
|
||||
worker_queue = ""
|
||||
|
||||
def worker_fire(event, d):
|
||||
data = "<event>" + pickle.dumps(event) + "</event>"
|
||||
worker_fire_prepickled(data)
|
||||
|
||||
def worker_fire_prepickled(event):
|
||||
global worker_queue
|
||||
|
||||
worker_queue = worker_queue + event
|
||||
worker_flush()
|
||||
|
||||
def worker_flush():
|
||||
global worker_queue, worker_pipe
|
||||
|
||||
if not worker_queue:
|
||||
return
|
||||
|
||||
try:
|
||||
written = os.write(worker_pipe, worker_queue)
|
||||
worker_queue = worker_queue[written:]
|
||||
except (IOError, OSError) as e:
|
||||
if e.errno != errno.EAGAIN:
|
||||
raise
|
||||
|
||||
def worker_child_fire(event, d):
|
||||
global worker_pipe
|
||||
|
||||
data = "<event>" + pickle.dumps(event) + "</event>"
|
||||
worker_pipe.write(data)
|
||||
|
||||
bb.event.worker_fire = worker_fire
|
||||
|
||||
lf = None
|
||||
#lf = open("/tmp/workercommandlog", "w+")
|
||||
def workerlog_write(msg):
|
||||
if lf:
|
||||
lf.write(msg)
|
||||
lf.flush()
|
||||
|
||||
def fork_off_task(cfg, data, workerdata, fn, task, taskname, appends, quieterrors=False):
|
||||
# We need to setup the environment BEFORE the fork, since
|
||||
# a fork() or exec*() activates PSEUDO...
|
||||
|
||||
envbackup = {}
|
||||
fakeenv = {}
|
||||
umask = None
|
||||
|
||||
taskdep = workerdata["taskdeps"][fn]
|
||||
if 'umask' in taskdep and taskname in taskdep['umask']:
|
||||
# umask might come in as a number or text string..
|
||||
try:
|
||||
umask = int(taskdep['umask'][taskname],8)
|
||||
except TypeError:
|
||||
umask = taskdep['umask'][taskname]
|
||||
|
||||
if 'fakeroot' in taskdep and taskname in taskdep['fakeroot']:
|
||||
envvars = (workerdata["fakerootenv"][fn] or "").split()
|
||||
for key, value in (var.split('=') for var in envvars):
|
||||
envbackup[key] = os.environ.get(key)
|
||||
os.environ[key] = value
|
||||
fakeenv[key] = value
|
||||
|
||||
fakedirs = (workerdata["fakerootdirs"][fn] or "").split()
|
||||
for p in fakedirs:
|
||||
bb.utils.mkdirhier(p)
|
||||
logger.debug(2, 'Running %s:%s under fakeroot, fakedirs: %s' %
|
||||
(fn, taskname, ', '.join(fakedirs)))
|
||||
else:
|
||||
envvars = (workerdata["fakerootnoenv"][fn] or "").split()
|
||||
for key, value in (var.split('=') for var in envvars):
|
||||
envbackup[key] = os.environ.get(key)
|
||||
os.environ[key] = value
|
||||
fakeenv[key] = value
|
||||
|
||||
sys.stdout.flush()
|
||||
sys.stderr.flush()
|
||||
|
||||
try:
|
||||
pipein, pipeout = os.pipe()
|
||||
pipein = os.fdopen(pipein, 'rb', 4096)
|
||||
pipeout = os.fdopen(pipeout, 'wb', 0)
|
||||
pid = os.fork()
|
||||
except OSError as e:
|
||||
bb.msg.fatal("RunQueue", "fork failed: %d (%s)" % (e.errno, e.strerror))
|
||||
|
||||
if pid == 0:
|
||||
global worker_pipe
|
||||
pipein.close()
|
||||
|
||||
# Save out the PID so that the event can include it the
|
||||
# events
|
||||
bb.event.worker_pid = os.getpid()
|
||||
bb.event.worker_fire = worker_child_fire
|
||||
worker_pipe = pipeout
|
||||
|
||||
# Make the child the process group leader
|
||||
os.setpgid(0, 0)
|
||||
# No stdin
|
||||
newsi = os.open(os.devnull, os.O_RDWR)
|
||||
os.dup2(newsi, sys.stdin.fileno())
|
||||
|
||||
if umask:
|
||||
os.umask(umask)
|
||||
|
||||
data.setVar("BB_WORKERCONTEXT", "1")
|
||||
data.setVar("BUILDNAME", workerdata["buildname"])
|
||||
bb.parse.siggen.set_taskdata(workerdata["hashes"], workerdata["hash_deps"], workerdata["sigchecksums"])
|
||||
ret = 0
|
||||
try:
|
||||
the_data = bb.cache.Cache.loadDataFull(fn, appends, data)
|
||||
the_data.setVar('BB_TASKHASH', workerdata["runq_hash"][task])
|
||||
for h in workerdata["hashes"]:
|
||||
the_data.setVar("BBHASH_%s" % h, workerdata["hashes"][h])
|
||||
for h in workerdata["hash_deps"]:
|
||||
the_data.setVar("BBHASHDEPS_%s" % h, workerdata["hash_deps"][h])
|
||||
|
||||
# exported_vars() returns a generator which *cannot* be passed to os.environ.update()
|
||||
# successfully. We also need to unset anything from the environment which shouldn't be there
|
||||
exports = bb.data.exported_vars(the_data)
|
||||
bb.utils.empty_environment()
|
||||
for e, v in exports:
|
||||
os.environ[e] = v
|
||||
for e in fakeenv:
|
||||
os.environ[e] = fakeenv[e]
|
||||
the_data.setVar(e, fakeenv[e])
|
||||
the_data.setVarFlag(e, 'export', "1")
|
||||
|
||||
if quieterrors:
|
||||
the_data.setVarFlag(taskname, "quieterrors", "1")
|
||||
|
||||
except Exception as exc:
|
||||
if not quieterrors:
|
||||
logger.critical(str(exc))
|
||||
os._exit(1)
|
||||
try:
|
||||
if not cfg.dry_run:
|
||||
ret = bb.build.exec_task(fn, taskname, the_data, cfg.profile)
|
||||
os._exit(ret)
|
||||
except:
|
||||
os._exit(1)
|
||||
else:
|
||||
for key, value in envbackup.iteritems():
|
||||
if value is None:
|
||||
del os.environ[key]
|
||||
else:
|
||||
os.environ[key] = value
|
||||
|
||||
return pid, pipein, pipeout
|
||||
|
||||
class runQueueWorkerPipe():
|
||||
"""
|
||||
Abstraction for a pipe between a worker thread and the worker server
|
||||
"""
|
||||
def __init__(self, pipein, pipeout):
|
||||
self.input = pipein
|
||||
if pipeout:
|
||||
pipeout.close()
|
||||
bb.utils.nonblockingfd(self.input)
|
||||
self.queue = ""
|
||||
|
||||
def read(self):
|
||||
start = len(self.queue)
|
||||
try:
|
||||
self.queue = self.queue + self.input.read(102400)
|
||||
except (OSError, IOError) as e:
|
||||
if e.errno != errno.EAGAIN:
|
||||
raise
|
||||
|
||||
end = len(self.queue)
|
||||
index = self.queue.find("</event>")
|
||||
while index != -1:
|
||||
worker_fire_prepickled(self.queue[:index+8])
|
||||
self.queue = self.queue[index+8:]
|
||||
index = self.queue.find("</event>")
|
||||
return (end > start)
|
||||
|
||||
def close(self):
|
||||
while self.read():
|
||||
continue
|
||||
if len(self.queue) > 0:
|
||||
print("Warning, worker child left partial message: %s" % self.queue)
|
||||
self.input.close()
|
||||
|
||||
normalexit = False
|
||||
|
||||
class BitbakeWorker(object):
|
||||
def __init__(self, din):
|
||||
self.input = din
|
||||
bb.utils.nonblockingfd(self.input)
|
||||
self.queue = ""
|
||||
self.cookercfg = None
|
||||
self.databuilder = None
|
||||
self.data = None
|
||||
self.build_pids = {}
|
||||
self.build_pipes = {}
|
||||
|
||||
def serve(self):
|
||||
while True:
|
||||
(ready, _, _) = select.select([self.input] + [i.input for i in self.build_pipes.values()], [] , [], 1)
|
||||
if self.input in ready or len(self.queue):
|
||||
start = len(self.queue)
|
||||
try:
|
||||
self.queue = self.queue + self.input.read()
|
||||
except (OSError, IOError):
|
||||
pass
|
||||
end = len(self.queue)
|
||||
self.handle_item("cookerconfig", self.handle_cookercfg)
|
||||
self.handle_item("workerdata", self.handle_workerdata)
|
||||
self.handle_item("runtask", self.handle_runtask)
|
||||
self.handle_item("finishnow", self.handle_finishnow)
|
||||
self.handle_item("ping", self.handle_ping)
|
||||
self.handle_item("quit", self.handle_quit)
|
||||
|
||||
for pipe in self.build_pipes:
|
||||
self.build_pipes[pipe].read()
|
||||
if len(self.build_pids):
|
||||
self.process_waitpid()
|
||||
worker_flush()
|
||||
|
||||
|
||||
def handle_item(self, item, func):
|
||||
if self.queue.startswith("<" + item + ">"):
|
||||
index = self.queue.find("</" + item + ">")
|
||||
while index != -1:
|
||||
func(self.queue[(len(item) + 2):index])
|
||||
self.queue = self.queue[(index + len(item) + 3):]
|
||||
index = self.queue.find("</" + item + ">")
|
||||
|
||||
def handle_cookercfg(self, data):
|
||||
self.cookercfg = pickle.loads(data)
|
||||
self.databuilder = bb.cookerdata.CookerDataBuilder(self.cookercfg, worker=True)
|
||||
self.databuilder.parseBaseConfiguration()
|
||||
self.data = self.databuilder.data
|
||||
|
||||
def handle_workerdata(self, data):
|
||||
self.workerdata = pickle.loads(data)
|
||||
bb.msg.loggerDefaultDebugLevel = self.workerdata["logdefaultdebug"]
|
||||
bb.msg.loggerDefaultVerbose = self.workerdata["logdefaultverbose"]
|
||||
bb.msg.loggerVerboseLogs = self.workerdata["logdefaultverboselogs"]
|
||||
bb.msg.loggerDefaultDomains = self.workerdata["logdefaultdomain"]
|
||||
self.data.setVar("PRSERV_HOST", self.workerdata["prhost"])
|
||||
|
||||
def handle_ping(self, _):
|
||||
workerlog_write("Handling ping\n")
|
||||
|
||||
logger.warn("Pong from bitbake-worker!")
|
||||
|
||||
def handle_quit(self, data):
|
||||
workerlog_write("Handling quit\n")
|
||||
|
||||
global normalexit
|
||||
normalexit = True
|
||||
sys.exit(0)
|
||||
|
||||
def handle_runtask(self, data):
|
||||
fn, task, taskname, quieterrors, appends = pickle.loads(data)
|
||||
workerlog_write("Handling runtask %s %s %s\n" % (task, fn, taskname))
|
||||
|
||||
pid, pipein, pipeout = fork_off_task(self.cookercfg, self.data, self.workerdata, fn, task, taskname, appends, quieterrors)
|
||||
|
||||
self.build_pids[pid] = task
|
||||
self.build_pipes[pid] = runQueueWorkerPipe(pipein, pipeout)
|
||||
|
||||
def process_waitpid(self):
|
||||
"""
|
||||
Return none is there are no processes awaiting result collection, otherwise
|
||||
collect the process exit codes and close the information pipe.
|
||||
"""
|
||||
try:
|
||||
pid, status = os.waitpid(-1, os.WNOHANG)
|
||||
if pid == 0 or os.WIFSTOPPED(status):
|
||||
return None
|
||||
except OSError:
|
||||
return None
|
||||
|
||||
workerlog_write("Exit code of %s for pid %s\n" % (status, pid))
|
||||
|
||||
if os.WIFEXITED(status):
|
||||
status = os.WEXITSTATUS(status)
|
||||
elif os.WIFSIGNALED(status):
|
||||
# Per shell conventions for $?, when a process exits due to
|
||||
# a signal, we return an exit code of 128 + SIGNUM
|
||||
status = 128 + os.WTERMSIG(status)
|
||||
|
||||
task = self.build_pids[pid]
|
||||
del self.build_pids[pid]
|
||||
|
||||
self.build_pipes[pid].close()
|
||||
del self.build_pipes[pid]
|
||||
|
||||
worker_fire_prepickled("<exitcode>" + pickle.dumps((task, status)) + "</exitcode>")
|
||||
|
||||
def handle_finishnow(self, _):
|
||||
if self.build_pids:
|
||||
logger.info("Sending SIGTERM to remaining %s tasks", len(self.build_pids))
|
||||
for k, v in self.build_pids.iteritems():
|
||||
try:
|
||||
os.kill(-k, signal.SIGTERM)
|
||||
os.waitpid(-1, 0)
|
||||
except:
|
||||
pass
|
||||
for pipe in self.build_pipes:
|
||||
self.build_pipes[pipe].read()
|
||||
|
||||
try:
|
||||
worker = BitbakeWorker(sys.stdin)
|
||||
worker.serve()
|
||||
except BaseException as e:
|
||||
if not normalexit:
|
||||
import traceback
|
||||
sys.stderr.write(traceback.format_exc())
|
||||
sys.stderr.write(str(e))
|
||||
while len(worker_queue):
|
||||
worker_flush()
|
||||
workerlog_write("exitting")
|
||||
sys.exit(0)
|
||||
|
||||
@@ -430,8 +430,9 @@ Create a set of html pages (documentation) for a bitbake.conf....
|
||||
action = "store_true", dest = "verbose", default = False )
|
||||
|
||||
options, args = parser.parse_args( sys.argv )
|
||||
|
||||
bb.msg.init_msgconfig(options.verbose, options.debug)
|
||||
|
||||
if options.debug:
|
||||
bb.msg.set_debug_level(options.debug)
|
||||
|
||||
return options.config, options.output
|
||||
|
||||
@@ -462,7 +463,7 @@ def main():
|
||||
state_group = 2
|
||||
|
||||
for key in bb.data.keys(documentation):
|
||||
data = documentation.getVarFlag(key, "doc")
|
||||
data = bb.data.getVarFlag(key, "doc", documentation)
|
||||
if not data:
|
||||
continue
|
||||
|
||||
|
||||
@@ -1,122 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright (c) 2012 Wind River Systems, Inc.
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
|
||||
# See the GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License
|
||||
# along with this program; if not, write to the Free Software
|
||||
# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
||||
|
||||
import os
|
||||
import sys
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname( \
|
||||
os.path.abspath(__file__))), 'lib'))
|
||||
try:
|
||||
import bb
|
||||
except RuntimeError as exc:
|
||||
sys.exit(str(exc))
|
||||
|
||||
import gtk
|
||||
import optparse
|
||||
import pygtk
|
||||
|
||||
from bb.ui.crumbs.hobwidget import HobAltButton, HobButton
|
||||
from bb.ui.crumbs.hig.crumbsmessagedialog import CrumbsMessageDialog
|
||||
from bb.ui.crumbs.hig.deployimagedialog import DeployImageDialog
|
||||
from bb.ui.crumbs.hig.imageselectiondialog import ImageSelectionDialog
|
||||
|
||||
# I put all the fs bitbake supported here. Need more test.
|
||||
DEPLOYABLE_IMAGE_TYPES = ["jffs2", "cramfs", "ext2", "ext3", "btrfs", "squashfs", "ubi", "vmdk"]
|
||||
Title = "USB Image Writer"
|
||||
|
||||
class DeployWindow(gtk.Window):
|
||||
def __init__(self, image_path=''):
|
||||
super(DeployWindow, self).__init__()
|
||||
|
||||
if len(image_path) > 0:
|
||||
valid = True
|
||||
if not os.path.exists(image_path):
|
||||
valid = False
|
||||
lbl = "<b>Invalid image file path: %s.</b>\nPress <b>Select Image</b> to select an image." % image_path
|
||||
else:
|
||||
image_path = os.path.abspath(image_path)
|
||||
extend_name = os.path.splitext(image_path)[1][1:]
|
||||
if extend_name not in DEPLOYABLE_IMAGE_TYPES:
|
||||
valid = False
|
||||
lbl = "<b>Undeployable imge type: %s</b>\nPress <b>Select Image</b> to select an image." % extend_name
|
||||
|
||||
if not valid:
|
||||
image_path = ''
|
||||
crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
|
||||
button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
|
||||
HobButton.style_button(button)
|
||||
crumbs_dialog.run()
|
||||
crumbs_dialog.destroy()
|
||||
|
||||
self.deploy_dialog = DeployImageDialog(Title, image_path, self,
|
||||
gtk.DIALOG_MODAL | gtk.DIALOG_DESTROY_WITH_PARENT
|
||||
| gtk.DIALOG_NO_SEPARATOR, None, standalone=True)
|
||||
close_button = self.deploy_dialog.add_button("Close", gtk.RESPONSE_NO)
|
||||
HobAltButton.style_button(close_button)
|
||||
close_button.connect('clicked', gtk.main_quit)
|
||||
|
||||
write_button = self.deploy_dialog.add_button("Write USB image", gtk.RESPONSE_YES)
|
||||
HobAltButton.style_button(write_button)
|
||||
|
||||
self.deploy_dialog.connect('select_image_clicked', self.select_image_clicked_cb)
|
||||
self.deploy_dialog.connect('destroy', gtk.main_quit)
|
||||
response = self.deploy_dialog.show()
|
||||
|
||||
def select_image_clicked_cb(self, dialog):
|
||||
cwd = os.getcwd()
|
||||
dialog = ImageSelectionDialog(cwd, DEPLOYABLE_IMAGE_TYPES, Title, self, gtk.FILE_CHOOSER_ACTION_SAVE )
|
||||
button = dialog.add_button("Cancel", gtk.RESPONSE_NO)
|
||||
HobAltButton.style_button(button)
|
||||
button = dialog.add_button("Open", gtk.RESPONSE_YES)
|
||||
HobAltButton.style_button(button)
|
||||
response = dialog.run()
|
||||
|
||||
if response == gtk.RESPONSE_YES:
|
||||
if not dialog.image_names:
|
||||
lbl = "<b>No selections made</b>\nClicked the radio button to select a image."
|
||||
crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
|
||||
button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
|
||||
HobButton.style_button(button)
|
||||
crumbs_dialog.run()
|
||||
crumbs_dialog.destroy()
|
||||
dialog.destroy()
|
||||
return
|
||||
|
||||
# get the full path of image
|
||||
image_path = os.path.join(dialog.image_folder, dialog.image_names[0])
|
||||
self.deploy_dialog.set_image_text_buffer(image_path)
|
||||
self.deploy_dialog.set_image_path(image_path)
|
||||
|
||||
dialog.destroy()
|
||||
|
||||
def main():
|
||||
parser = optparse.OptionParser(
|
||||
usage = """%prog [-h] [image_file]
|
||||
|
||||
%prog writes bootable images to USB devices. You can
|
||||
provide the image file on the command line or select it using the GUI.""")
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
image_file = args[1] if len(args) > 1 else ''
|
||||
dw = DeployWindow(image_file)
|
||||
|
||||
if __name__ == '__main__':
|
||||
try:
|
||||
main()
|
||||
gtk.main()
|
||||
except Exception:
|
||||
import traceback
|
||||
traceback.print_exc(3)
|
||||
@@ -1,68 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Copyright (C) 2012 Wind River Systems, Inc.
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
#
|
||||
# This is used for dumping the bb_cache.dat, the output format is:
|
||||
# recipe_path PN PV PACKAGES
|
||||
#
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
|
||||
# For importing bb.cache
|
||||
sys.path.insert(0, os.path.join(os.path.abspath(os.path.dirname(sys.argv[0])), '../lib'))
|
||||
from bb.cache import CoreRecipeInfo
|
||||
|
||||
import cPickle as pickle
|
||||
|
||||
def main(argv=None):
|
||||
"""
|
||||
Get the mapping for the target recipe.
|
||||
"""
|
||||
if len(argv) != 1:
|
||||
print >>sys.stderr, "Error, need one argument!"
|
||||
return 2
|
||||
|
||||
cachefile = argv[0]
|
||||
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
while cachefile:
|
||||
try:
|
||||
key = pickled.load()
|
||||
val = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
if isinstance(val, CoreRecipeInfo) and (not val.skipped):
|
||||
pn = val.pn
|
||||
# Filter out the native recipes.
|
||||
if key.startswith('virtual:native:') or pn.endswith("-native"):
|
||||
continue
|
||||
|
||||
# 1.0 is the default version for a no PV recipe.
|
||||
if val.__dict__.has_key("pv"):
|
||||
pv = val.pv
|
||||
else:
|
||||
pv = "1.0"
|
||||
|
||||
print("%s %s %s %s" % (key, pn, pv, ' '.join(val.packages)))
|
||||
|
||||
if __name__ == "__main__":
|
||||
sys.exit(main(sys.argv[1:]))
|
||||
|
||||
@@ -10,8 +10,8 @@ if &compatible || version < 600
|
||||
finish
|
||||
endif
|
||||
|
||||
" .bb, .bbappend and .bbclass
|
||||
au BufNewFile,BufRead *.{bb,bbappend,bbclass} set filetype=bitbake
|
||||
" .bb and .bbclass
|
||||
au BufNewFile,BufRead *.b{b,bclass} set filetype=bitbake
|
||||
|
||||
" .inc
|
||||
au BufNewFile,BufRead *.inc set filetype=bitbake
|
||||
|
||||
@@ -52,8 +52,8 @@ syn match bbExport "^export" nextgroup=bbIdentifier skipwhite
|
||||
syn keyword bbExportFlag export contained nextgroup=bbIdentifier skipwhite
|
||||
syn match bbIdentifier "[a-zA-Z0-9\-_\.\/\+]\+" display contained
|
||||
syn match bbVarDeref "${[a-zA-Z0-9\-_\.\/\+]\+}" contained
|
||||
syn match bbVarEq "\(:=\|+=\|=+\|\.=\|=\.\|?=\|??=\|=\)" contained nextgroup=bbVarValue
|
||||
syn match bbVarDef "^\(export\s*\)\?\([a-zA-Z0-9\-_\.\/\+]\+\(_[${}a-zA-Z0-9\-_\.\/\+]\+\)\?\)\s*\(:=\|+=\|=+\|\.=\|=\.\|?=\|??=\|=\)\@=" contains=bbExportFlag,bbIdentifier,bbVarDeref nextgroup=bbVarEq
|
||||
syn match bbVarEq "\(:=\|+=\|=+\|\.=\|=\.\|?=\|=\)" contained nextgroup=bbVarValue
|
||||
syn match bbVarDef "^\(export\s*\)\?\([a-zA-Z0-9\-_\.\/\+]\+\(_[${}a-zA-Z0-9\-_\.\/\+]\+\)\?\)\s*\(:=\|+=\|=+\|\.=\|=\.\|?=\|=\)\@=" contains=bbExportFlag,bbIdentifier,bbVarDeref nextgroup=bbVarEq
|
||||
syn match bbVarValue ".*$" contained contains=bbString,bbVarDeref,bbVarPyValue
|
||||
syn region bbVarPyValue start=+${@+ skip=+\\$+ excludenl end=+}+ contained contains=@python
|
||||
|
||||
|
||||
@@ -85,6 +85,9 @@ don't execute, just go through the motions
|
||||
.B \-p, \-\-parse-only
|
||||
quit after parsing the BB files (developers only)
|
||||
.TP
|
||||
.B \-d, \-\-disable-psyco
|
||||
disable using the psyco just-in-time compiler (not recommended)
|
||||
.TP
|
||||
.B \-s, \-\-show-versions
|
||||
show current and preferred versions of all packages
|
||||
.TP
|
||||
@@ -104,30 +107,6 @@ Show debug logging for the specified logging domains
|
||||
.B \-P, \-\-profile
|
||||
profile the command and print a report
|
||||
.TP
|
||||
.B \-uUI, \-\-ui=UI
|
||||
User interface to use. Currently, hob, depexp, goggle or ncurses can be specified as UI.
|
||||
.TP
|
||||
.B \-tSERVERTYPE, \-\-servertype=SERVERTYPE
|
||||
Choose which server to use, none, process or xmlrpc.
|
||||
.TP
|
||||
.B \-\-revisions-changed
|
||||
Set the exit code depending on whether upstream floating revisions have changed or not.
|
||||
.TP
|
||||
.B \-\-server-only
|
||||
Run bitbake without UI, the frontend can connect with bitbake server itself.
|
||||
.TP
|
||||
.B \-BBIND, \-\-bind=BIND
|
||||
The name/address for the bitbake server to bind to.
|
||||
.TP
|
||||
.B \-\-no\-setscene
|
||||
Do not run any setscene tasks, forces builds.
|
||||
|
||||
.SH ENVIRONMENT VARIABLES
|
||||
bitbake uses the following environment variables to control its
|
||||
operation:
|
||||
.TP
|
||||
.B BITBAKE_UI
|
||||
The bitbake user interface; overridden by the \fB-u\fP commandline option.
|
||||
|
||||
.SH AUTHORS
|
||||
BitBake was written by
|
||||
|
||||
@@ -12,10 +12,9 @@
|
||||
<corpauthor>BitBake Team</corpauthor>
|
||||
</authorgroup>
|
||||
<copyright>
|
||||
<year>2004, 2005, 2006, 2011</year>
|
||||
<year>2004, 2005, 2006</year>
|
||||
<holder>Chris Larson</holder>
|
||||
<holder>Phil Blundell</holder>
|
||||
<holder>Richard Purdie</holder>
|
||||
</copyright>
|
||||
<legalnotice>
|
||||
<para>This work is licensed under the Creative Commons Attribution License. To view a copy of this license, visit <ulink url="http://creativecommons.org/licenses/by/2.5/">http://creativecommons.org/licenses/by/2.5/</ulink> or send a letter to Creative Commons, 559 Nathan Abbott Way, Stanford, California 94305, USA.</para>
|
||||
@@ -27,10 +26,10 @@
|
||||
<title>Overview</title>
|
||||
<para>BitBake is, at its simplest, a tool for executing
|
||||
tasks and managing metadata. As such, its similarities to GNU make and other
|
||||
build tools are readily apparent. It was inspired by Portage, the package management system used by the Gentoo Linux distribution. BitBake is the basis of the <ulink url="http://www.openembedded.org/">OpenEmbedded</ulink> project, which is being used to build and maintain a number of embedded Linux distributions/projects such as Angstrom and the Yocto project.</para>
|
||||
build tools are readily apparent. It was inspired by Portage, the package management system used by the Gentoo Linux distribution. BitBake is the basis of the <ulink url="http://www.openembedded.org/">OpenEmbedded</ulink> project, which is being used to build and maintain a number of embedded Linux distributions, including OpenZaurus and Familiar.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Background and goals</title>
|
||||
<title>Background and Goals</title>
|
||||
<para>Prior to BitBake, no other build tool adequately met
|
||||
the needs of an aspiring embedded Linux distribution. All of the
|
||||
buildsystems used by traditional desktop Linux distributions lacked
|
||||
@@ -38,14 +37,14 @@ important functionality, and none of the ad-hoc
|
||||
<emphasis>buildroot</emphasis> systems, prevalent in the
|
||||
embedded space, were scalable or maintainable.</para>
|
||||
|
||||
<para>Some important original goals for BitBake were:
|
||||
<para>Some important goals for BitBake were:
|
||||
<itemizedlist>
|
||||
<listitem><para>Handle crosscompilation.</para></listitem>
|
||||
<listitem><para>Handle interpackage dependencies (build time on target architecture, build time on native architecture, and runtime).</para></listitem>
|
||||
<listitem><para>Support running any number of tasks within a given package, including, but not limited to, fetching upstream sources, unpacking them, patching them, configuring them, et cetera.</para></listitem>
|
||||
<listitem><para>Must be Linux distribution agnostic (both build and target).</para></listitem>
|
||||
<listitem><para>Must be linux distribution agnostic (both build and target).</para></listitem>
|
||||
<listitem><para>Must be architecture agnostic</para></listitem>
|
||||
<listitem><para>Must support multiple build and target operating systems (including Cygwin, the BSDs, etc).</para></listitem>
|
||||
<listitem><para>Must support multiple build and target operating systems (including cygwin, the BSDs, etc).</para></listitem>
|
||||
<listitem><para>Must be able to be self contained, rather than tightly integrated into the build machine's root filesystem.</para></listitem>
|
||||
<listitem><para>There must be a way to handle conditional metadata (on target architecture, operating system, distribution, machine).</para></listitem>
|
||||
<listitem><para>It must be easy for the person using the tools to supply their own local metadata and packages to operate against.</para></listitem>
|
||||
@@ -54,18 +53,10 @@ between multiple projects using BitBake for their
|
||||
builds.</para></listitem>
|
||||
<listitem><para>Should provide an inheritance mechanism to
|
||||
share common metadata between many packages.</para></listitem>
|
||||
<listitem><para>Et cetera...</para></listitem>
|
||||
</itemizedlist>
|
||||
</para>
|
||||
<para>Over time it has become apparent that some further requirements were necessary:
|
||||
<itemizedlist>
|
||||
<listitem><para>Handle variants of a base recipe (native, sdk, multilib).</para></listitem>
|
||||
<listitem><para>Able to split metadata into layers and allow layers to override each other.</para></listitem>
|
||||
<listitem><para>Allow representation of a given set of input variables to a task as a checksum.</para></listitem>
|
||||
<listitem><para>based on that checksum, allow acceleration of builds with prebuilt components.</para></listitem>
|
||||
</itemizedlist>
|
||||
</para>
|
||||
|
||||
<para>BitBake satisfies all the original requirements and many more with extensions being made to the basic functionality to reflect the additionl requirements. Flexibility and power have always been the priorities. It is highly extensible, supporting embedded Python code and execution of any arbitrary tasks.</para>
|
||||
<para>BitBake satisfies all these and many more. Flexibility and power have always been the priorities. It is highly extensible, supporting embedded Python code and execution of any arbitrary tasks.</para>
|
||||
</section>
|
||||
</chapter>
|
||||
<chapter>
|
||||
@@ -100,13 +91,13 @@ share common metadata between many packages.</para></listitem>
|
||||
<section>
|
||||
<title>Setting a default value (?=)</title>
|
||||
<para><screen><varname>A</varname> ?= "aval"</screen></para>
|
||||
<para>If <varname>A</varname> is set before the above is called, it will retain its previous value. If <varname>A</varname> is unset prior to the above call, <varname>A</varname> will be set to <literal>aval</literal>. Note that this assignment is immediate, so if there are multiple ?= assignments to a single variable, the first of those will be used.</para>
|
||||
<para>If <varname>A</varname> is set before the above is called, it will retain it's previous value. If <varname>A</varname> is unset prior to the above call, <varname>A</varname> will be set to <literal>aval</literal>. Note that this assignment is immediate, so if there are multiple ?= assignments to a single variable, the first of those will be used.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Setting a weak default value (??=)</title>
|
||||
<para><screen><varname>A</varname> ??= "somevalue"
|
||||
<varname>A</varname> ??= "someothervalue"</screen></para>
|
||||
<para>If <varname>A</varname> is set before the above, it will retain that value. If <varname>A</varname> is unset prior to the above, <varname>A</varname> will be set to <literal>someothervalue</literal>. This is a lazy/weak assignment in that the assignment does not occur until the end of the parsing process, so that the last, rather than the first, ??= assignment to a given variable will be used. Any other setting of A using = or ?= will however override the value set with ??=</para>
|
||||
<title>Setting a default value (??=)</title>
|
||||
<para><screen><varname>A</varname> ??= "somevalue"</screen></para>
|
||||
<para><screen><varname>A</varname> ??= "someothervalue"</screen></para>
|
||||
<para>If <varname>A</varname> is set before the above, it will retain that value. If <varname>A</varname> is unset prior to the above, <varname>A</varname> will be set to <literal>someothervalue</literal>. This is a lazy version of ?=, in that the assignment does not occur until the end of the parsing process, so that the last, rather than the first, ??= assignment to a given variable will be used.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Immediate variable expansion (:=)</title>
|
||||
@@ -134,7 +125,7 @@ share common metadata between many packages.</para></listitem>
|
||||
<varname>B</varname> .= "additionaldata"
|
||||
<varname>C</varname> = "cval"
|
||||
<varname>C</varname> =. "test"</screen></para>
|
||||
<para>In this example, <varname>B</varname> is now <literal>bvaladditionaldata</literal> and <varname>C</varname> is <literal>testcval</literal>. In contrast to the above appending and prepending operators, no additional space
|
||||
<para>In this example, <varname>B</varname> is now <literal>bvaladditionaldata</literal> and <varname>C</varname> is <literal>testcval</literal>. In contrast to the above Appending and Prepending operators no additional space
|
||||
will be introduced.</para>
|
||||
</section>
|
||||
<section>
|
||||
@@ -156,12 +147,12 @@ will be introduced.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Inclusion</title>
|
||||
<para>Next, there is the <literal>include</literal> directive, which causes BitBake to parse whatever file you specify, and insert it at that location, which is not unlike <command>make</command>. However, if the path specified on the <literal>include</literal> line is a relative path, BitBake will locate the first one it can find within <envar>BBPATH</envar>.</para>
|
||||
<para>Next, there is the <literal>include</literal> directive, which causes BitBake to parse in whatever file you specify, and insert it at that location, which is not unlike <command>make</command>. However, if the path specified on the <literal>include</literal> line is a relative path, BitBake will locate the first one it can find within <envar>BBPATH</envar>.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Requiring inclusion</title>
|
||||
<title>Requiring Inclusion</title>
|
||||
<para>In contrast to the <literal>include</literal> directive, <literal>require</literal> will
|
||||
raise an ParseError if the file to be included cannot be found. Otherwise it will behave just like the <literal>
|
||||
raise an ParseError if the to be included file can not be found. Otherwise it will behave just like the <literal>
|
||||
include</literal> directive.</para>
|
||||
</section>
|
||||
<section>
|
||||
@@ -180,13 +171,13 @@ include</literal> directive.</para>
|
||||
import time
|
||||
print time.strftime('%Y%m%d', time.gmtime())
|
||||
}</screen></para>
|
||||
<para>This is the similar to the previous, but flags it as Python so that BitBake knows it is Python code.</para>
|
||||
<para>This is the similar to the previous, but flags it as python so that BitBake knows it is python code.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Defining Python functions into the global Python namespace</title>
|
||||
<title>Defining python functions into the global python namespace</title>
|
||||
<para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
|
||||
<para><screen>def get_depends(bb, d):
|
||||
if d.getVar('SOMECONDITION', True):
|
||||
if bb.data.getVar('SOMECONDITION', d, True):
|
||||
return "dependencywithcond"
|
||||
else:
|
||||
return "dependency"
|
||||
@@ -196,45 +187,32 @@ include</literal> directive.</para>
|
||||
<para>This would result in <varname>DEPENDS</varname> containing <literal>dependencywithcond</literal>.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Variable flags</title>
|
||||
<para>Variables can have associated flags which provide a way of tagging extra information onto a variable. Several flags are used internally by BitBake but they can be used externally too if needed. The standard operations mentioned above also work on flags.</para>
|
||||
<title>Variable Flags</title>
|
||||
<para>Variables can have associated flags which provide a way of tagging extra information onto a variable. Several flags are used internally by bitbake but they can be used externally too if needed. The standard operations mentioned above also work on flags.</para>
|
||||
<para><screen><varname>VARIABLE</varname>[<varname>SOMEFLAG</varname>] = "value"</screen></para>
|
||||
<para>In this example, <varname>VARIABLE</varname> has a flag, <varname>SOMEFLAG</varname> which is set to <literal>value</literal>.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Inheritance</title>
|
||||
<para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
|
||||
<para>The <literal>inherit</literal> directive is a means of specifying what classes of functionality your .bb requires. It is a rudimentary form of inheritance. For example, you can easily abstract out the tasks involved in building a package that uses autoconf and automake, and put that into a bbclass for your packages to make use of. A given bbclass is located by searching for classes/filename.bbclass in <envar>BBPATH</envar>, where filename is what you inherited.</para>
|
||||
<para>The <literal>inherit</literal> directive is a means of specifying what classes of functionality your .bb requires. It is a rudimentary form of inheritance. For example, you can easily abstract out the tasks involved in building a package that uses autoconf and automake, and put that into a bbclass for your packages to make use of. A given bbclass is located by searching for classes/filename.oeclass in <envar>BBPATH</envar>, where filename is what you inherited.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Tasks</title>
|
||||
<para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
|
||||
<para>In BitBake, each step that needs to be run for a given .bb is known as a task. There is a command <literal>addtask</literal> to add new tasks (must be a defined Python executable metadata and must start with <quote>do_</quote>) and describe intertask dependencies.</para>
|
||||
<para>In BitBake, each step that needs to be run for a given .bb is known as a task. There is a command <literal>addtask</literal> to add new tasks (must be a defined python executable metadata and must start with <quote>do_</quote>) and describe intertask dependencies.</para>
|
||||
<para><screen>python do_printdate () {
|
||||
import time
|
||||
print time.strftime('%Y%m%d', time.gmtime())
|
||||
}
|
||||
|
||||
addtask printdate before do_build</screen></para>
|
||||
<para>This defines the necessary Python function and adds it as a task which is now a dependency of do_build, the default task. If anyone executes the do_build task, that will result in do_printdate being run first.</para>
|
||||
<para>This defines the necessary python function and adds it as a task which is now a dependency of do_build (the default task). If anyone executes the do_build task, that will result in do_printdate being run first.</para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Task Flags</title>
|
||||
<para>Tasks support a number of flags which control various functionality of the task. These are as follows:</para>
|
||||
<para>'dirs' - directories which should be created before the task runs</para>
|
||||
<para>'cleandirs' - directories which should created before the task runs but should be empty</para>
|
||||
<para>'noexec' - marks the tasks as being empty and no execution required. These are used as dependency placeholders or used when added tasks need to be subsequently disabled.</para>
|
||||
<para>'nostamp' - don't generate a stamp file for a task. This means the task is always rexecuted.</para>
|
||||
<para>'fakeroot' - this task needs to be run in a fakeroot environment, obtained by adding the variables in FAKEROOTENV to the environment.</para>
|
||||
<para>'umask' - the umask to run the task under.</para>
|
||||
<para> For the 'deptask', 'rdeptask', 'depends', 'rdepends' and 'recrdeptask' flags please see the dependencies section.</para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Events</title>
|
||||
<para><emphasis>NOTE:</emphasis> This is only supported in .bb and .bbclass files.</para>
|
||||
<para>BitBake allows installation of event handlers. Events are triggered at certain points during operation, such as the beginning of operation against a given .bb, the start of a given task, task failure, task success, et cetera. The intent is to make it easy to do things like email notification on build failure.</para>
|
||||
<para>BitBake allows to install event handlers. Events are triggered at certain points during operation, such as, the beginning of operation against a given .bb, the start of a given task, task failure, task success, et cetera. The intent was to make it easy to do things like email notifications on build failure.</para>
|
||||
<para><screen>addhandler myclass_eventhandler
|
||||
python myclass_eventhandler() {
|
||||
from bb.event import getName
|
||||
@@ -250,149 +228,85 @@ of the event and the content of the <varname>FILE</varname> variable.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Variants</title>
|
||||
<para>Two BitBake features exist to facilitate the creation of multiple buildable incarnations from a single recipe file.</para>
|
||||
<para>The first is <varname>BBCLASSEXTEND</varname>. This variable is a space separated list of classes used to "extend" the recipe for each variant. As an example, setting <screen>BBCLASSEXTEND = "native"</screen> results in a second incarnation of the current recipe being available. This second incarnation will have the "native" class inherited.</para>
|
||||
<para>The second feature is <varname>BBVERSIONS</varname>. This variable allows a single recipe to build multiple versions of a project from a single recipe file, and allows you to specify conditional metadata (using the <varname>OVERRIDES</varname> mechanism) for a single version, or an optionally named range of versions:</para>
|
||||
<para>Two Bitbake features exist to facilitate the creation of multiple buildable incarnations from a single recipe file.</para>
|
||||
<para>The first is <varname>BBCLASSEXTEND</varname>. This variable is a space separated list of classes to utilize to "extend" the recipe for each variant. As an example, setting <screen>BBCLASSEXTEND = "native"</screen> results in a second incarnation of the current recipe being available. This second incarantion will have the "native" class inherited.</para>
|
||||
<para>The second feature is <varname>BBVERSIONS</varname>. This variable allows a single recipe to be able to build multiple versions of a project from a single recipe file, and allows you to specify conditional metadata (using the <varname>OVERRIDES</varname> mechanism) for a single version, or an optionally named range of versions:</para>
|
||||
<para><screen>BBVERSIONS = "1.0 2.0 git"
|
||||
SRC_URI_git = "git://someurl/somepath.git"</screen></para>
|
||||
<para><screen>BBVERSIONS = "1.0.[0-6]:1.0.0+ \
|
||||
1.0.[7-9]:1.0.7+"
|
||||
SRC_URI_append_1.0.7+ = "file://some_patch_which_the_new_versions_need.patch;patch=1"</screen></para>
|
||||
<para>Note that the name of the range will default to the original version of the recipe, so given OE, a recipe file of foo_1.0.0+.bb will default the name of its versions to 1.0.0+. This is useful, as the range name is not only placed into overrides; it's also made available for the metadata to use in the form of the <varname>BPV</varname> variable, for use in file:// search paths (<varname>FILESPATH</varname>).</para>
|
||||
<para>Note that the name of the range will default to the original version of the recipe, so given OE, a recipe file of foo_1.0.0+.bb will default the name of its versions to 1.0.0+. This is useful, as the range name is not only placed into overrides, it's also made available for the metadata to use in the form of the <varname>BPV</varname> variable, for use in file:// search paths (<varname>FILESPATH</varname>).</para>
|
||||
</section>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Variable interaction: Worked Examples</title>
|
||||
<para>Despite the documentation of the different forms of variable definition above, it can be hard to work out what happens when variable operators are combined. This section documents some common questions people have regarding the way variables interact.</para>
|
||||
|
||||
<section>
|
||||
<title>Override and append ordering</title>
|
||||
|
||||
<para>There is often confusion about which order overrides and the various append operators take effect.</para>
|
||||
|
||||
<para><screen><varname>OVERRIDES</varname> = "foo"
|
||||
<varname>A_foo_append</varname> = "X"</screen></para>
|
||||
<para>In this case, X is unconditionally appended to the variable <varname>A_foo</varname>. Since foo is an override, A_foo would then replace <varname>A</varname>.</para>
|
||||
|
||||
<para><screen><varname>OVERRIDES</varname> = "foo"
|
||||
<varname>A</varname> = "X"
|
||||
<varname>A_append_foo</varname> = "Y"</screen></para>
|
||||
<para>In this case, only when foo is in OVERRIDES, Y is appended to the variable <varname>A</varname> so the value of <varname>A</varname> would become XY (NB: no spaces are appended).</para>
|
||||
|
||||
<para><screen><varname>OVERRIDES</varname> = "foo"
|
||||
<varname>A_foo_append</varname> = "X"
|
||||
<varname>A_foo_append</varname> += "Y"</screen></para>
|
||||
<para>This behaves as per the first case above, but the value of <varname>A</varname> would be "X Y" instead of just "X".</para>
|
||||
|
||||
<para><screen><varname>A</varname> = "1"
|
||||
<varname>A_append</varname> = "2"
|
||||
<varname>A_append</varname> = "3"
|
||||
<varname>A</varname> += "4"
|
||||
<varname>A</varname> .= "5"</screen></para>
|
||||
|
||||
<para>Would ultimately result in <varname>A</varname> taking the value "1 4523" since the _append operator executes at the same time as the expansion of other overrides.</para>
|
||||
|
||||
</section>
|
||||
<section>
|
||||
<title>Key Expansion</title>
|
||||
|
||||
<para>Key expansion happens at the data store finalisation time just before overrides are expanded.</para>
|
||||
|
||||
<para><screen><varname>A${B}</varname> = "X"
|
||||
<varname>B</varname> = "2"
|
||||
<varname>A2</varname> = "Y"</screen></para>
|
||||
<para>So in this case <varname>A2</varname> would take the value of "X".</para>
|
||||
</section>
|
||||
|
||||
</section>
|
||||
<section>
|
||||
<title>Dependency handling</title>
|
||||
<para>BitBake handles dependencies at the task level since to allow for efficient operation with multiple processed executing in parallel. A robust method of specifying task dependencies is therefore needed. </para>
|
||||
<title>Dependency Handling</title>
|
||||
<para>Bitbake 1.7.x onwards works with the metadata at the task level since this is optimal when dealing with multiple threads of execution. A robust method of specifing task dependencies is therefore needed. </para>
|
||||
<section>
|
||||
<title>Dependencies internal to the .bb file</title>
|
||||
<para>Where the dependencies are internal to a given .bb file, the dependencies are handled by the previously detailed addtask directive.</para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Build Dependencies</title>
|
||||
<para>DEPENDS lists build time dependencies. The 'deptask' flag for tasks is used to signify the task of each item listed in DEPENDS which must have completed before that task can be executed.</para>
|
||||
<title>DEPENDS</title>
|
||||
<para>DEPENDS is taken to specify build time dependencies. The 'deptask' flag for tasks is used to signify the task of each DEPENDS which must have completed before that task can be executed.</para>
|
||||
<para><screen>do_configure[deptask] = "do_populate_staging"</screen></para>
|
||||
<para>means the do_populate_staging task of each item in DEPENDS must have completed before do_configure can execute.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Runtime Dependencies</title>
|
||||
<para>The PACKAGES variable lists runtime packages and each of these can have RDEPENDS and RRECOMMENDS runtime dependencies. The 'rdeptask' flag for tasks is used to signify the task of each item runtime dependency which must have completed before that task can be executed.</para>
|
||||
<title>RDEPENDS</title>
|
||||
<para>RDEPENDS is taken to specify runtime dependencies. The 'rdeptask' flag for tasks is used to signify the task of each RDEPENDS which must have completed before that task can be executed.</para>
|
||||
<para><screen>do_package_write[rdeptask] = "do_package"</screen></para>
|
||||
<para>means the do_package task of each item in RDEPENDS must have completed before do_package_write can execute.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Recursive Dependencies</title>
|
||||
<para>These are specified with the 'recrdeptask' flag which is used signify the task(s) of dependencies which must have completed before that task can be executed. It works by looking though the build and runtime dependencies of the current recipe as well as any inter-task dependencies the task has, then adding a dependency on the listed task. It will then recurse through the dependencies of those tasks and so on.</para>
|
||||
<para>It may be desireable to recurse not just through the dependencies of those tasks but through the build and runtime dependencies of dependent tasks too. If that is the case, the taskname itself should be referenced in the task list, e.g. do_a[recrdeptask] = "do_a do_b".</para>
|
||||
<title>Recursive DEPENDS</title>
|
||||
<para>These are specified with the 'recdeptask' flag and is used signify the task(s) of each DEPENDS which must have completed before that task can be executed. It applies recursively so also, the DEPENDS of each item in the original DEPENDS must be met and so on.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Inter task</title>
|
||||
<para>The 'depends' flag for tasks is a more generic form of which allows an interdependency on specific tasks rather than specifying the data in DEPENDS.</para>
|
||||
<title>Recursive RDEPENDS</title>
|
||||
<para>These are specified with the 'recrdeptask' flag and is used signify the task(s) of each RDEPENDS which must have completed before that task can be executed. It applies recursively so also, the RDEPENDS of each item in the original RDEPENDS must be met and so on. It also runs all DEPENDS first too.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Inter Task</title>
|
||||
<para>The 'depends' flag for tasks is a more generic form of which allows an interdependency on specific tasks rather than specifying the data in DEPENDS or RDEPENDS.</para>
|
||||
<para><screen>do_patch[depends] = "quilt-native:do_populate_staging"</screen></para>
|
||||
<para>means the do_populate_staging task of the target quilt-native must have completed before the do_patch can execute.</para>
|
||||
<para>The 'rdepends' flag works in a similar way but takes targets in the runtime namespace instead of the build time dependency namespace.</para>
|
||||
</section>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Parsing</title>
|
||||
<section>
|
||||
<title>Configuration files</title>
|
||||
<para>The first kind of metadata in BitBake is configuration metadata. This metadata is global, and therefore affects <emphasis>all</emphasis> packages and tasks which are executed.</para>
|
||||
<para>BitBake will first search the current working directory for an optional "conf/bblayers.conf" configuration file. This file is expected to contain a BBLAYERS variable which is a space delimited list of 'layer' directories. For each directory in this list, a "conf/layer.conf" file will be searched for and parsed with the LAYERDIR variable being set to the directory where the layer was found. The idea is these files will setup BBPATH and other variables correctly for a given build directory automatically for the user.</para>
|
||||
<para>BitBake will then expect to find 'conf/bitbake.conf' somewhere in the user specified <envar>BBPATH</envar>. That configuration file generally has include directives to pull in any other metadata (generally files specific to architecture, machine, <emphasis>local</emphasis> and so on).</para>
|
||||
<title>Configuration Files</title>
|
||||
<para>The first of the classifications of metadata in BitBake is configuration metadata. This metadata is global, and therefore affects <emphasis>all</emphasis> packages and tasks which are executed.</para>
|
||||
<para>Bitbake will first search the current working directory for an optional "conf/bblayers.conf" configuration file. This file is expected to contain a BBLAYERS variable which is a space delimited list of 'layer' directories. For each directory in this list a "conf/layer.conf" file will be searched for and parsed with the LAYERDIR variable being set to the directory where the layer was found. The idea is these files will setup BBPATH and other variables correctly for a given build directory automatically for the user.</para>
|
||||
<para>Bitbake will then expect to find 'conf/bitbake.conf' somewhere in the user specified <envar>BBPATH</envar>. That configuration file generally has include directives to pull in any other metadata (generally files specific to architecture, machine, <emphasis>local</emphasis> and so on.</para>
|
||||
<para>Only variable definitions and include directives are allowed in .conf files.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Classes</title>
|
||||
<para>BitBake classes are our rudimentary inheritance mechanism. As briefly mentioned in the metadata introduction, they're parsed when an <literal>inherit</literal> directive is encountered, and they are located in classes/ relative to the directories in <envar>BBPATH</envar>.</para>
|
||||
<para>BitBake classes are our rudimentary inheritance mechanism. As briefly mentioned in the metadata introduction, they're parsed when an <literal>inherit</literal> directive is encountered, and they are located in classes/ relative to the dirs in <envar>BBPATH</envar>.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>.bb files</title>
|
||||
<title>.bb Files</title>
|
||||
<para>A BitBake (.bb) file is a logical unit of tasks to be executed. Normally this is a package to be built. Inter-.bb dependencies are obeyed. The files themselves are located via the <varname>BBFILES</varname> variable, which is set to a space separated list of .bb files, and does handle wildcards.</para>
|
||||
</section>
|
||||
</section>
|
||||
</chapter>
|
||||
|
||||
<chapter>
|
||||
<title>File download support</title>
|
||||
<title>File Download support</title>
|
||||
<section>
|
||||
<title>Overview</title>
|
||||
<para>BitBake provides support to download files this procedure is called fetching and it handled by the fetch and fetch2 modules. At this point the original fetch code is considered to be replaced by fetch2 and this manual only related to the fetch2 codebase.</para>
|
||||
|
||||
<para>The SRC_URI is normally used to tell BitBake which files to fetch. The next sections will describe the available fetchers and their options. Each fetcher honors a set of variables and per URI parameters separated by a <quote>;</quote> consisting of a key and a value. The semantics of the variables and parameters are defined by the fetcher. BitBake tries to have consistent semantics between the different fetchers.
|
||||
<para>BitBake provides support to download files this procedure is called fetching. The SRC_URI is normally used to indicate BitBake which files to fetch. The next sections will describe th available fetchers and the options they have. Each Fetcher honors a set of Variables and
|
||||
a per URI parameters separated by a <quote>;</quote> consisting of a key and a value. The semantic of the Variables and Parameters are defined by the Fetcher. BitBakes tries to have a consistent semantic between the different Fetchers.
|
||||
</para>
|
||||
|
||||
<para>The overall fetch process is that first, fetches are attempted from PREMIRRORS. If those don't work, the original SRC_URI is attempted and if that fails, BitBake will fall back to MIRRORS. Cross urls are supported, so its possible to mirror a git repository on an http server as a tarball for example. Some example commonly used mirror definitions are:</para>
|
||||
|
||||
<para><screen><varname>PREMIRRORS</varname> ?= "\
|
||||
bzr://.*/.* http://somemirror.org/sources/ \n \
|
||||
cvs://.*/.* http://somemirror.org/sources/ \n \
|
||||
git://.*/.* http://somemirror.org/sources/ \n \
|
||||
hg://.*/.* http://somemirror.org/sources/ \n \
|
||||
osc://.*/.* http://somemirror.org/sources/ \n \
|
||||
p4://.*/.* http://somemirror.org/sources/ \n \
|
||||
svk://.*/.* http://somemirror.org/sources/ \n \
|
||||
svn://.*/.* http://somemirror.org/sources/ \n"
|
||||
|
||||
<varname>MIRRORS</varname> =+ "\
|
||||
ftp://.*/.* http://somemirror.org/sources/ \n \
|
||||
http://.*/.* http://somemirror.org/sources/ \n \
|
||||
https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
|
||||
<para>Non-local downloaded output is placed into the directory specified by the <varname>DL_DIR</varname>. For non local archive downloads the code can verify sha256 and md5 checksums for the download to ensure the file has been downloaded correctly. These may be specified either in the form <varname>SRC_URI[md5sum]</varname> for the md5 checksum and <varname>SRC_URI[sha256sum]</varname> for the sha256 checksum or as parameters on the SRC_URI such as SRC_URI="http://example.com/foobar.tar.bz2;md5sum=4a8e0f237e961fd7785d19d07fdb994d". If <varname>BB_STRICT_CHECKSUM</varname> is set, any download without a checksum will trigger an error message. In cases where multiple files are listed in SRC_URI, the name parameter is used assign names to the urls and these are then specified in the checksums in the form SRC_URI[name.sha256sum].</para>
|
||||
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>Local file fetcher</title>
|
||||
<para>The URN for the local file fetcher is <emphasis>file</emphasis>. The filename can be either absolute or relative. If the filename is relative, <varname>FILESPATH</varname> and failing that <varname>FILESDIR</varname> will be used to find the appropriate relative file. The metadata usually extend these variables to include variations of the values in <varname>OVERRIDES</varname>. Single files and complete directories can be specified.
|
||||
<title>Local File Fetcher</title>
|
||||
<para>The URN for the Local File Fetcher is <emphasis>file</emphasis>. The filename can be either absolute or relative. If the filename is relative <varname>FILESPATH</varname> and <varname>FILESDIR</varname> will be used to find the appropriate relative file depending on the <varname>OVERRIDES</varname>. Single files and complete directories can be specified.
|
||||
<screen><varname>SRC_URI</varname>= "file://relativefile.patch"
|
||||
<varname>SRC_URI</varname>= "file://relativefile.patch;this=ignored"
|
||||
<varname>SRC_URI</varname>= "file:///Users/ich/very_important_software"
|
||||
@@ -401,11 +315,10 @@ https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>CVS fetcher</title>
|
||||
<para>The URN for the CVS fetcher is <emphasis>cvs</emphasis>. This fetcher honors the variables <varname>CVSDIR</varname>, <varname>SRCDATE</varname>, <varname>FETCHCOMMAND_cvs</varname>, <varname>UPDATECOMMAND_cvs</varname>. <varname>DL_DIR</varname> specifies where a temporary checkout is saved. <varname>SRCDATE</varname> specifies which date to use when doing the fetching (the special value of "now" will cause the checkout to be updated on every build). <varname>FETCHCOMMAND</varname> and <varname>UPDATECOMMAND</varname> specify which executables to use for the CVS checkout or update.
|
||||
<title>CVS File Fetcher</title>
|
||||
<para>The URN for the CVS Fetcher is <emphasis>cvs</emphasis>. This Fetcher honors the variables <varname>DL_DIR</varname>, <varname>SRCDATE</varname>, <varname>FETCHCOMMAND_cvs</varname>, <varname>UPDATECOMMAND_cvs</varname>. <varname>DL_DIR</varname> specifies where a temporary checkout is saved, <varname>SRCDATE</varname> specifies which date to use when doing the fetching (the special value of "now" will cause the checkout to be updated on every build), <varname>FETCHCOMMAND</varname> and <varname>UPDATECOMMAND</varname> specify which executables should be used when doing the CVS checkout or update.
|
||||
</para>
|
||||
<para>The supported parameters are <varname>module</varname>, <varname>tag</varname>, <varname>date</varname>, <varname>method</varname>, <varname>localdir</varname>, <varname>rsh</varname> and <varname>scmdata</varname>. The <varname>module</varname> specifies which module to check out, the <varname>tag</varname> describes which CVS TAG should be used for the checkout. By default the TAG is empty. A <varname>date</varname> can be specified to override the SRCDATE of the configuration to checkout a specific date. The special value of "now" will cause the checkout to be updated on every build.<varname>method</varname> is by default <emphasis>pserver</emphasis>. If <emphasis>ext</emphasis> is used the <varname>rsh</varname> parameter will be evaluated and <varname>CVS_RSH</varname> will be set. Finally, <varname>localdir</varname> is used to checkout into a special directory relative to <varname>CVSDIR</varname>.
|
||||
|
||||
<para>The supported Parameters are <varname>module</varname>, <varname>tag</varname>, <varname>date</varname>, <varname>method</varname>, <varname>localdir</varname>, <varname>rsh</varname> and <varname>scmdata</varname>. The <varname>module</varname> specifies which module to check out, the <varname>tag</varname> describes which CVS TAG should be used for the checkout. By default the TAG is empty. A <varname>date</varname> can be specified to override the SRCDATE of the configuration to checkout a specific date. The special value of "now" will cause the checkout to be updated on every build.<varname>method</varname> is by default <emphasis>pserver</emphasis>, if <emphasis>ext</emphasis> is used the <varname>rsh</varname> parameter will be evaluated and <varname>CVS_RSH</varname> will be set. Finally <varname>localdir</varname> is used to checkout into a special directory relative to <varname>CVSDIR</varname>. If <varname>scmdata</varname> is set to <quote>keep</quote>
|
||||
<screen><varname>SRC_URI</varname> = "cvs://CVSROOT;module=mymodule;tag=some-version;method=ext"
|
||||
<varname>SRC_URI</varname> = "cvs://CVSROOT;module=mymodule;date=20060126;localdir=usethat"
|
||||
</screen>
|
||||
@@ -413,22 +326,32 @@ https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>HTTP/FTP fetcher</title>
|
||||
<para>The URNs for the HTTP/FTP fetcher are <emphasis>http</emphasis>, <emphasis>https</emphasis> and <emphasis>ftp</emphasis>. This fetcher honors the variables <varname>FETCHCOMMAND_wget</varname>. <varname>FETCHCOMMAND</varname> contains the command used for fetching. <quote>${URI}</quote> and <quote>${FILES}</quote> will be replaced by the URI and basename of the file to be fetched.
|
||||
<title>HTTP/FTP Fetcher</title>
|
||||
<para>The URNs for the HTTP/FTP are <emphasis>http</emphasis>, <emphasis>https</emphasis> and <emphasis>ftp</emphasis>. This Fetcher honors the variables <varname>DL_DIR</varname>, <varname>FETCHCOMMAND_wget</varname>, <varname>PREMIRRORS</varname>, <varname>MIRRORS</varname>. The <varname>DL_DIR</varname> defines where to store the fetched file, <varname>FETCHCOMMAND</varname> contains the command used for fetching. <quote>${URI}</quote> and <quote>${FILES}</quote> will be replaced by the uri and basename of the to be fetched file. <varname>PREMIRRORS</varname>
|
||||
will be tried first when fetching a file if that fails the actual file will be tried and finally all <varname>MIRRORS</varname> will be tried.
|
||||
</para>
|
||||
<para><screen><varname>SRC_URI</varname> = "http://oe.handhelds.org/not_there.aac"
|
||||
<varname>SRC_URI</varname> = "ftp://oe.handhelds.org/not_there_as_well.aac"
|
||||
<varname>SRC_URI</varname> = "ftp://you@oe.handheld.sorg/home/you/secret.plan"
|
||||
<para>The only supported Parameter is <varname>md5sum</varname>. After a fetch the <varname>md5sum</varname> of the file will be calculated and the two sums will be compared.
|
||||
</para>
|
||||
<para><screen><varname>SRC_URI</varname> = "http://oe.handhelds.org/not_there.aac;md5sum=12343"
|
||||
<varname>SRC_URI</varname> = "ftp://oe.handhelds.org/not_there_as_well.aac;md5sum=1234"
|
||||
<varname>SRC_URI</varname> = "ftp://you@oe.handheld.sorg/home/you/secret.plan;md5sum=1234"
|
||||
</screen></para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>SVN fetcher</title>
|
||||
<para>The URN for the SVN fetcher is <emphasis>svn</emphasis>.
|
||||
<title>SVK Fetcher</title>
|
||||
<para>
|
||||
<emphasis>Currently NOT supported</emphasis>
|
||||
</para>
|
||||
<para>This fetcher honors the variables <varname>FETCHCOMMAND_svn</varname>, <varname>SVNDIR</varname>, <varname>SRCREV</varname>. <varname>FETCHCOMMAND</varname> contains the subversion command. <varname>SRCREV</varname> specifies which revision to use when doing the fetching.
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>SVN Fetcher</title>
|
||||
<para>The URN for the SVN Fetcher is <emphasis>svn</emphasis>.
|
||||
</para>
|
||||
<para>The supported parameters are <varname>proto</varname>, <varname>rev</varname> and <varname>scmdata</varname>. <varname>proto</varname> is the Subversion protocol, <varname>rev</varname> is the Subversion revision. If <varname>scmdata</varname> is set to <quote>keep</quote>, the <quote>.svn</quote> directories will be available during compile-time.
|
||||
<para>This Fetcher honors the variables <varname>FETCHCOMMAND_svn</varname>, <varname>DL_DIR</varname>, <varname>SRCDATE</varname>. <varname>FETCHCOMMAND</varname> contains the subversion command, <varname>DL_DIR</varname> is the directory where tarballs will be saved, <varname>SRCDATE</varname> specifies which date to use when doing the fetching (the special value of "now" will cause the checkout to be updated on every build).
|
||||
</para>
|
||||
<para>The supported Parameters are <varname>proto</varname>, <varname>rev</varname> and <varname>scmdata</varname>. <varname>proto</varname> is the subversion protocol, <varname>rev</varname> is the subversion revision. If <varname>scmdata</varname> is set to <quote>keep</quote>, the <quote>.svn</quote> directories will be available during compile-time.
|
||||
</para>
|
||||
<para><screen><varname>SRC_URI</varname> = "svn://svn.oe.handhelds.org/svn;module=vip;proto=http;rev=667"
|
||||
<varname>SRC_URI</varname> = "svn://svn.oe.handhelds.org/svn/;module=opie;proto=svn+ssh;date=20060126"
|
||||
@@ -436,12 +359,12 @@ https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
</section>
|
||||
|
||||
<section>
|
||||
<title>GIT fetcher</title>
|
||||
<title>GIT Fetcher</title>
|
||||
<para>The URN for the GIT Fetcher is <emphasis>git</emphasis>.
|
||||
</para>
|
||||
<para>The variable <varname>GITDIR</varname> will be used as the base directory where the git tree is cloned to.
|
||||
<para>The Variables <varname>DL_DIR</varname>, <varname>GITDIR</varname> are used. <varname>DL_DIR</varname> will be used to store the checkedout version. <varname>GITDIR</varname> will be used as the base directory where the git tree is cloned to.
|
||||
</para>
|
||||
<para>The parameters are <emphasis>tag</emphasis>, <emphasis>protocol</emphasis> and <emphasis>scmdata</emphasis>. <emphasis>tag</emphasis> is a Git tag, the default is <quote>master</quote>. <emphasis>protocol</emphasis> is the Git protocol to use and defaults to <quote>git</quote> if a hostname is set, otherwise its <quote>file</quote>. If <emphasis>scmdata</emphasis> is set to <quote>keep</quote>, the <quote>.git</quote> directory will be available during compile-time.
|
||||
<para>The Parameters are <emphasis>tag</emphasis>, <emphasis>protocol</emphasis> and <emphasis>scmdata</emphasis>. <emphasis>tag</emphasis> is a git tag, the default is <quote>master</quote>. <emphasis>protocol</emphasis> is the git protocol to use and defaults to <quote>rsync</quote>. If <emphasis>scmdata</emphasis> is set to <quote>keep</quote>, the <quote>.git</quote> directory will be available during compile-time.
|
||||
</para>
|
||||
<para><screen><varname>SRC_URI</varname> = "git://git.oe.handhelds.org/git/vip.git;tag=version-1"
|
||||
<varname>SRC_URI</varname> = "git://git.oe.handhelds.org/git/vip.git;protocol=http"
|
||||
@@ -452,13 +375,13 @@ https://.*/.* http://somemirror.org/sources/ \n"</screen></para>
|
||||
|
||||
|
||||
<chapter>
|
||||
<title>The BitBake command</title>
|
||||
<title>The bitbake command</title>
|
||||
<section>
|
||||
<title>Introduction</title>
|
||||
<para>bitbake is the primary command in the system. It facilitates executing tasks in a single .bb file, or executing a given task on a set of multiple .bb files, accounting for interdependencies amongst them.</para>
|
||||
</section>
|
||||
<section>
|
||||
<title>Usage and syntax</title>
|
||||
<title>Usage and Syntax</title>
|
||||
<para>
|
||||
<screen><prompt>$ </prompt>bitbake --help
|
||||
usage: bitbake [options] [package ...]
|
||||
@@ -494,6 +417,8 @@ options:
|
||||
than once.
|
||||
-n, --dry-run don't execute, just go through the motions
|
||||
-p, --parse-only quit after parsing the BB files (developers only)
|
||||
-d, --disable-psyco disable using the psyco just-in-time compiler (not
|
||||
recommended)
|
||||
-s, --show-versions show current and preferred versions of all packages
|
||||
-e, --environment show the global or per-package environment (this is
|
||||
what used to be bbread)
|
||||
@@ -513,7 +438,7 @@ options:
|
||||
<para>
|
||||
<example>
|
||||
<title>Executing a task against a single .bb</title>
|
||||
<para>Executing tasks for a single file is relatively simple. You specify the file in question, and BitBake parses it and executes the specified task (or <quote>build</quote> by default). It obeys intertask dependencies when doing so.</para>
|
||||
<para>Executing tasks for a single file is relatively simple. You specify the file in question, and bitbake parses it and executes the specified task (or <quote>build</quote> by default). It obeys intertask dependencies when doing so.</para>
|
||||
<para><quote>clean</quote> task:</para>
|
||||
<para><screen><prompt>$ </prompt>bitbake -b blah_1.0.bb -c clean</screen></para>
|
||||
<para><quote>build</quote> task:</para>
|
||||
@@ -523,8 +448,8 @@ options:
|
||||
<para>
|
||||
<example>
|
||||
<title>Executing tasks against a set of .bb files</title>
|
||||
<para>There are a number of additional complexities introduced when one wants to manage multiple .bb files. Clearly there needs to be a way to tell BitBake what files are available, and of those, which we want to execute at this time. There also needs to be a way for each .bb to express its dependencies, both for build time and runtime. There must be a way for the user to express their preferences when multiple .bb's provide the same functionality, or when there are multiple versions of a .bb.</para>
|
||||
<para>The next section, Metadata, outlines how to specify such things.</para>
|
||||
<para>There are a number of additional complexities introduced when one wants to manage multiple .bb files. Clearly there needs to be a way to tell bitbake what files are available, and of those, which we want to execute at this time. There also needs to be a way for each .bb to express its dependencies, both for build time and runtime. There must be a way for the user to express their preferences when multiple .bb's provide the same functionality, or when there are multiple versions of a .bb.</para>
|
||||
<para>The next section, Metadata, outlines how one goes about specifying such things.</para>
|
||||
<para>Note that the bitbake command, when not using --buildfile, accepts a <varname>PROVIDER</varname>, not a filename or anything else. By default, a .bb generally PROVIDES its packagename, packagename-version, and packagename-version-revision.</para>
|
||||
<screen><prompt>$ </prompt>bitbake blah</screen>
|
||||
<screen><prompt>$ </prompt>bitbake blah-1.0</screen>
|
||||
@@ -536,8 +461,8 @@ options:
|
||||
<example>
|
||||
<title>Generating dependency graphs</title>
|
||||
<para>BitBake is able to generate dependency graphs using the dot syntax. These graphs can be converted
|
||||
to images using the <application>dot</application> application from <ulink url="http://www.graphviz.org">Graphviz</ulink>.
|
||||
Two files will be written into the current working directory, <emphasis>depends.dot</emphasis> containing dependency information at the package level and <emphasis>task-depends.dot</emphasis> containing a breakdown of the dependencies at the task level. To stop depending on common depends, one can use the <prompt>-I depend</prompt> to omit these from the graph. This can lead to more readable graphs. This way, <varname>DEPENDS</varname> from inherited classes such as base.bbclass can be removed from the graph.</para>
|
||||
to images using the <application>dot</application> application from <ulink url="http://www.graphviz.org">graphviz</ulink>.
|
||||
Two files will be written into the current working directory, <emphasis>depends.dot</emphasis> containing dependency information at the package level and <emphasis>task-depends.dot</emphasis> containing a breakdown of the dependencies at the task level. To stop depending on common depends one can use the <prompt>-I depend</prompt> to omit these from the graph. This can lead to more readable graphs. E.g. this way <varname>DEPENDS</varname> from inherited classes, e.g. base.bbclass, can be removed from the graph.</para>
|
||||
<screen><prompt>$ </prompt>bitbake -g blah</screen>
|
||||
<screen><prompt>$ </prompt>bitbake -g -I virtual/whatever -I bloom blah</screen>
|
||||
</example>
|
||||
@@ -545,20 +470,20 @@ Two files will be written into the current working directory, <emphasis>depends.
|
||||
</section>
|
||||
<section>
|
||||
<title>Special variables</title>
|
||||
<para>Certain variables affect BitBake operation:</para>
|
||||
<para>Certain variables affect bitbake operation:</para>
|
||||
<section>
|
||||
<title><varname>BB_NUMBER_THREADS</varname></title>
|
||||
<para> The number of threads BitBake should run at once (default: 1).</para>
|
||||
<para> The number of threads bitbake should run at once (default: 1).</para>
|
||||
</section>
|
||||
</section>
|
||||
<section>
|
||||
<title>Metadata</title>
|
||||
<para>As you may have seen in the usage information, or in the information about .bb files, the <varname>BBFILES</varname> variable is how the BitBake tool locates its files. This variable is a space separated list of files that are available, and supports wildcards.
|
||||
<para>As you may have seen in the usage information, or in the information about .bb files, the BBFILES variable is how the bitbake tool locates its files. This variable is a space separated list of files that are available, and supports wildcards.
|
||||
<example>
|
||||
<title>Setting BBFILES</title>
|
||||
<programlisting><varname>BBFILES</varname> = "/path/to/bbfiles/*.bb"</programlisting>
|
||||
</example></para>
|
||||
<para>With regard to dependencies, it expects the .bb to define a <varname>DEPENDS</varname> variable, which contains a space separated list of <quote>package names</quote>, which themselves are the <varname>PN</varname> variable. The <varname>PN</varname> variable is, in general, set to a component of the .bb filename by default.</para>
|
||||
<para>With regard to dependencies, it expects the .bb to define a <varname>DEPENDS</varname> variable, which contains a space separated list of <quote>package names</quote>, which themselves are the <varname>PN</varname> variable. The <varname>PN</varname> variable is, in general, by default, set to a component of the .bb filename.</para>
|
||||
<example>
|
||||
<title>Depending on another .bb</title>
|
||||
<para>a.bb:
|
||||
@@ -571,7 +496,7 @@ DEPENDS += "package-b"</screen>
|
||||
</example>
|
||||
<example>
|
||||
<title>Using PROVIDES</title>
|
||||
<para>This example shows the usage of the <varname>PROVIDES</varname> variable, which allows a given .bb to specify what functionality it provides.</para>
|
||||
<para>This example shows the usage of the PROVIDES variable, which allows a given .bb to specify what functionality it provides.</para>
|
||||
<para>package1.bb:
|
||||
<screen>PROVIDES += "virtual/package"</screen>
|
||||
</para>
|
||||
@@ -581,16 +506,16 @@ DEPENDS += "package-b"</screen>
|
||||
<para>package3.bb:
|
||||
<screen>PROVIDES += "virtual/package"</screen>
|
||||
</para>
|
||||
<para>As you can see, we have two different .bb's that provide the same functionality (virtual/package). Clearly, there needs to be a way for the person running BitBake to control which of those providers gets used. There is, indeed, such a way.</para>
|
||||
<para>As you can see, here there are two different .bb's that provide the same functionality (virtual/package). Clearly, there needs to be a way for the person running bitbake to control which of those providers gets used. There is, indeed, such a way.</para>
|
||||
<para>The following would go into a .conf file, to select package1:
|
||||
<screen>PREFERRED_PROVIDER_virtual/package = "package1"</screen>
|
||||
</para>
|
||||
</example>
|
||||
<example>
|
||||
<title>Specifying version preference</title>
|
||||
<para>When there are multiple <quote>versions</quote> of a given package, BitBake defaults to selecting the most recent version, unless otherwise specified. If the .bb in question has a <varname>DEFAULT_PREFERENCE</varname> set lower than the other .bb's (default is 0), then it will not be selected. This allows the person or persons maintaining the repository of .bb files to specify their preference for the default selected version. In addition, the user can specify their preferred version.</para>
|
||||
<para>When there are multiple <quote>versions</quote> of a given package, bitbake defaults to selecting the most recent version, unless otherwise specified. If the .bb in question has a <varname>DEFAULT_PREFERENCE</varname> set lower than the other .bb's (default is 0), then it will not be selected. This allows the person or persons maintaining the repository of .bb files to specify their preferences for the default selected version. In addition, the user can specify their preferences with regard to version.</para>
|
||||
<para>If the first .bb is named <filename>a_1.1.bb</filename>, then the <varname>PN</varname> variable will be set to <quote>a</quote>, and the <varname>PV</varname> variable will be set to 1.1.</para>
|
||||
<para>If we then have an <filename>a_1.2.bb</filename>, BitBake will choose 1.2 by default. However, if we define the following variable in a .conf that BitBake parses, we can change that.
|
||||
<para>If we then have an <filename>a_1.2.bb</filename>, bitbake will choose 1.2 by default. However, if we define the following variable in a .conf that bitbake parses, we can change that.
|
||||
<screen>PREFERRED_VERSION_a = "1.1"</screen>
|
||||
</para>
|
||||
</example>
|
||||
|
||||
@@ -21,27 +21,15 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
__version__ = "1.19.1"
|
||||
__version__ = "1.11.0"
|
||||
|
||||
import sys
|
||||
if sys.version_info < (2, 7, 3):
|
||||
raise RuntimeError("Sorry, python 2.7.3 or later is required for this version of bitbake")
|
||||
|
||||
|
||||
class BBHandledException(Exception):
|
||||
"""
|
||||
The big dilemma for generic bitbake code is what information to give the user
|
||||
when an exception occurs. Any exception inheriting this base exception class
|
||||
has already provided information to the user via some 'fired' message type such as
|
||||
an explicitly fired event using bb.fire, or a bb.error message. If bitbake
|
||||
encounters an exception derived from this class, no backtrace or other information
|
||||
will be given to the user, its assumed the earlier event provided the relevant information.
|
||||
"""
|
||||
pass
|
||||
if sys.version_info < (2, 6, 0):
|
||||
raise RuntimeError("Sorry, python 2.6.0 or later is required for this version of bitbake")
|
||||
|
||||
import os
|
||||
import logging
|
||||
|
||||
import traceback
|
||||
|
||||
class NullHandler(logging.Handler):
|
||||
def emit(self, record):
|
||||
@@ -63,29 +51,34 @@ class BBLogger(Logger):
|
||||
def verbose(self, msg, *args, **kwargs):
|
||||
return self.log(logging.INFO - 1, msg, *args, **kwargs)
|
||||
|
||||
def exception(self, msg, *args, **kwargs):
|
||||
return self.critical("%s\n%s" % (msg, traceback.format_exc()), *args, **kwargs)
|
||||
|
||||
logging.raiseExceptions = False
|
||||
logging.setLoggerClass(BBLogger)
|
||||
|
||||
logger = logging.getLogger("BitBake")
|
||||
logger.addHandler(NullHandler())
|
||||
logger.setLevel(logging.DEBUG - 2)
|
||||
logger.setLevel(logging.INFO)
|
||||
|
||||
# This has to be imported after the setLoggerClass, as the import of bb.msg
|
||||
# can result in construction of the various loggers.
|
||||
import bb.msg
|
||||
|
||||
from bb import fetch2 as fetch
|
||||
sys.modules['bb.fetch'] = sys.modules['bb.fetch2']
|
||||
if "BBDEBUG" in os.environ:
|
||||
level = int(os.environ["BBDEBUG"])
|
||||
if level:
|
||||
bb.msg.set_debug_level(level)
|
||||
|
||||
if True or os.environ.get("BBFETCH2"):
|
||||
from bb import fetch2 as fetch
|
||||
sys.modules['bb.fetch'] = sys.modules['bb.fetch2']
|
||||
|
||||
# Messaging convenience functions
|
||||
def plain(*args):
|
||||
logger.plain(''.join(args))
|
||||
|
||||
def debug(lvl, *args):
|
||||
if isinstance(lvl, basestring):
|
||||
logger.warn("Passed invalid debug level '%s' to bb.debug", lvl)
|
||||
args = (lvl,) + args
|
||||
lvl = 1
|
||||
logger.debug(lvl, ''.join(args))
|
||||
|
||||
def note(*args):
|
||||
@@ -102,7 +95,7 @@ def fatal(*args):
|
||||
sys.exit(1)
|
||||
|
||||
|
||||
def deprecated(func, name=None, advice=""):
|
||||
def deprecated(func, name = None, advice = ""):
|
||||
"""This is a decorator which can be used to mark functions
|
||||
as deprecated. It will result in a warning being emmitted
|
||||
when the function is used."""
|
||||
@@ -116,8 +109,8 @@ def deprecated(func, name=None, advice=""):
|
||||
def newFunc(*args, **kwargs):
|
||||
warnings.warn("Call to deprecated function %s%s." % (name,
|
||||
advice),
|
||||
category=DeprecationWarning,
|
||||
stacklevel=2)
|
||||
category = PendingDeprecationWarning,
|
||||
stacklevel = 2)
|
||||
return func(*args, **kwargs)
|
||||
newFunc.__name__ = func.__name__
|
||||
newFunc.__doc__ = func.__doc__
|
||||
|
||||
@@ -28,13 +28,11 @@
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import shlex
|
||||
import glob
|
||||
import bb
|
||||
import bb.msg
|
||||
import bb.process
|
||||
from contextlib import nested
|
||||
from bb import event, utils
|
||||
from bb import data, event, mkdirhier, utils
|
||||
|
||||
bblogger = logging.getLogger('BitBake')
|
||||
logger = logging.getLogger('BitBake.Build')
|
||||
@@ -54,13 +52,13 @@ class FuncFailed(Exception):
|
||||
self.logfile = logfile
|
||||
self.name = name
|
||||
if name:
|
||||
self.msg = 'Function failed: %s' % name
|
||||
self.msg = "Function '%s' failed" % name
|
||||
else:
|
||||
self.msg = "Function failed"
|
||||
|
||||
def __str__(self):
|
||||
if self.logfile and os.path.exists(self.logfile):
|
||||
msg = ("%s (log file is located at %s)" %
|
||||
msg = ("%s (see %s for further information)" %
|
||||
(self.msg, self.logfile))
|
||||
else:
|
||||
msg = self.msg
|
||||
@@ -71,9 +69,9 @@ class TaskBase(event.Event):
|
||||
|
||||
def __init__(self, t, d ):
|
||||
self._task = t
|
||||
self._package = d.getVar("PF", True)
|
||||
self._package = bb.data.getVar("PF", d, 1)
|
||||
event.Event.__init__(self)
|
||||
self._message = "recipe %s: task %s: %s" % (d.getVar("PF", True), t, self.getDisplayName())
|
||||
self._message = "package %s: task %s: %s" % (bb.data.getVar("PF", d, 1), t, bb.event.getName(self)[4:])
|
||||
|
||||
def getTask(self):
|
||||
return self._task
|
||||
@@ -81,9 +79,6 @@ class TaskBase(event.Event):
|
||||
def setTask(self, task):
|
||||
self._task = task
|
||||
|
||||
def getDisplayName(self):
|
||||
return bb.event.getName(self)[4:]
|
||||
|
||||
task = property(getTask, setTask, None, "task property")
|
||||
|
||||
class TaskStarted(TaskBase):
|
||||
@@ -95,20 +90,9 @@ class TaskSucceeded(TaskBase):
|
||||
class TaskFailed(TaskBase):
|
||||
"""Task execution failed"""
|
||||
|
||||
def __init__(self, task, logfile, metadata, errprinted = False):
|
||||
self.logfile = logfile
|
||||
self.errprinted = errprinted
|
||||
super(TaskFailed, self).__init__(task, metadata)
|
||||
|
||||
class TaskFailedSilent(TaskBase):
|
||||
"""Task execution failed (silently)"""
|
||||
def __init__(self, task, logfile, metadata):
|
||||
self.logfile = logfile
|
||||
super(TaskFailedSilent, self).__init__(task, metadata)
|
||||
|
||||
def getDisplayName(self):
|
||||
# Don't need to tell the user it was silent
|
||||
return "Failed"
|
||||
super(TaskFailed, self).__init__(task, metadata)
|
||||
|
||||
class TaskInvalid(TaskBase):
|
||||
|
||||
@@ -136,73 +120,49 @@ class LogTee(object):
|
||||
|
||||
def __repr__(self):
|
||||
return '<LogTee {0}>'.format(self.name)
|
||||
def flush(self):
|
||||
self.outfile.flush()
|
||||
|
||||
|
||||
def exec_func(func, d, dirs = None):
|
||||
"""Execute an BB 'function'"""
|
||||
|
||||
body = d.getVar(func)
|
||||
body = data.getVar(func, d)
|
||||
if not body:
|
||||
if body is None:
|
||||
logger.warn("Function %s doesn't exist", func)
|
||||
return
|
||||
|
||||
flags = d.getVarFlags(func)
|
||||
flags = data.getVarFlags(func, d)
|
||||
cleandirs = flags.get('cleandirs')
|
||||
if cleandirs:
|
||||
for cdir in d.expand(cleandirs).split():
|
||||
for cdir in data.expand(cleandirs, d).split():
|
||||
bb.utils.remove(cdir, True)
|
||||
|
||||
if dirs is None:
|
||||
dirs = flags.get('dirs')
|
||||
if dirs:
|
||||
dirs = d.expand(dirs).split()
|
||||
dirs = data.expand(dirs, d).split()
|
||||
|
||||
if dirs:
|
||||
for adir in dirs:
|
||||
bb.utils.mkdirhier(adir)
|
||||
adir = dirs[-1]
|
||||
else:
|
||||
adir = d.getVar('B', True)
|
||||
bb.utils.mkdirhier(adir)
|
||||
adir = data.getVar('B', d, 1)
|
||||
if not os.path.exists(adir):
|
||||
adir = None
|
||||
|
||||
ispython = flags.get('python')
|
||||
if flags.get('fakeroot') and not flags.get('task'):
|
||||
bb.fatal("Function %s specifies fakeroot but isn't a task?!" % func)
|
||||
|
||||
lockflag = flags.get('lockfiles')
|
||||
if lockflag:
|
||||
lockfiles = [d.expand(f) for f in lockflag.split()]
|
||||
lockfiles = [data.expand(f, d) for f in lockflag.split()]
|
||||
else:
|
||||
lockfiles = None
|
||||
|
||||
tempdir = d.getVar('T', True)
|
||||
|
||||
# or func allows items to be executed outside of the normal
|
||||
# task set, such as buildhistory
|
||||
task = d.getVar('BB_RUNTASK', True) or func
|
||||
if task == func:
|
||||
taskfunc = task
|
||||
else:
|
||||
taskfunc = "%s.%s" % (task, func)
|
||||
|
||||
runfmt = d.getVar('BB_RUNFMT', True) or "run.{func}.{pid}"
|
||||
runfn = runfmt.format(taskfunc=taskfunc, task=task, func=func, pid=os.getpid())
|
||||
runfile = os.path.join(tempdir, runfn)
|
||||
bb.utils.mkdirhier(os.path.dirname(runfile))
|
||||
|
||||
# Setup the courtesy link to the runfn, only for tasks
|
||||
# we create the link 'just' before the run script is created
|
||||
# if we create it after, and if the run script fails, then the
|
||||
# link won't be created as an exception would be fired.
|
||||
if task == func:
|
||||
runlink = os.path.join(tempdir, 'run.{0}'.format(task))
|
||||
if runlink:
|
||||
bb.utils.remove(runlink)
|
||||
|
||||
try:
|
||||
os.symlink(runfn, runlink)
|
||||
except OSError:
|
||||
pass
|
||||
tempdir = data.getVar('T', d, 1)
|
||||
runfile = os.path.join(tempdir, 'run.{0}.{1}'.format(func, os.getpid()))
|
||||
|
||||
with bb.utils.fileslocked(lockfiles):
|
||||
if ispython:
|
||||
@@ -221,20 +181,18 @@ def exec_func_python(func, d, runfile, cwd=None):
|
||||
"""Execute a python BB 'function'"""
|
||||
|
||||
bbfile = d.getVar('FILE', True)
|
||||
try:
|
||||
olddir = os.getcwd()
|
||||
except OSError:
|
||||
olddir = None
|
||||
code = _functionfmt.format(function=func, body=d.getVar(func, True))
|
||||
bb.utils.mkdirhier(os.path.dirname(runfile))
|
||||
with open(runfile, 'w') as script:
|
||||
script.write(code)
|
||||
|
||||
if cwd:
|
||||
try:
|
||||
olddir = os.getcwd()
|
||||
except OSError:
|
||||
olddir = None
|
||||
os.chdir(cwd)
|
||||
|
||||
bb.debug(2, "Executing python function %s" % func)
|
||||
|
||||
try:
|
||||
comp = utils.better_compile(code, func, bbfile)
|
||||
utils.better_exec(comp, {"d": d}, code, bbfile)
|
||||
@@ -244,15 +202,10 @@ def exec_func_python(func, d, runfile, cwd=None):
|
||||
|
||||
raise FuncFailed(func, None)
|
||||
finally:
|
||||
bb.debug(2, "Python function %s finished" % func)
|
||||
if olddir:
|
||||
os.chdir(olddir)
|
||||
|
||||
if cwd and olddir:
|
||||
try:
|
||||
os.chdir(olddir)
|
||||
except OSError:
|
||||
pass
|
||||
|
||||
def exec_func_shell(func, d, runfile, cwd=None):
|
||||
def exec_func_shell(function, d, runfile, cwd=None):
|
||||
"""Execute a shell function from the metadata
|
||||
|
||||
Note on directory behavior. The 'dirs' varflag should contain a list
|
||||
@@ -264,70 +217,41 @@ def exec_func_shell(func, d, runfile, cwd=None):
|
||||
d.delVarFlag('PWD', 'export')
|
||||
|
||||
with open(runfile, 'w') as script:
|
||||
script.write('''#!/bin/sh\n
|
||||
# Emit a useful diagnostic if something fails:
|
||||
bb_exit_handler() {
|
||||
ret=$?
|
||||
case $ret in
|
||||
0) ;;
|
||||
*) case $BASH_VERSION in
|
||||
"") echo "WARNING: exit code $ret from a shell command.";;
|
||||
*) echo "WARNING: ${BASH_SOURCE[0]}:${BASH_LINENO[0]} exit $ret from
|
||||
\"$BASH_COMMAND\"";;
|
||||
esac
|
||||
exit $ret
|
||||
esac
|
||||
}
|
||||
trap 'bb_exit_handler' 0
|
||||
set -e
|
||||
''')
|
||||
|
||||
bb.data.emit_func(func, script, d)
|
||||
|
||||
if bb.msg.loggerVerboseLogs:
|
||||
script.write('#!/bin/sh -e\n')
|
||||
if logger.isEnabledFor(logging.DEBUG):
|
||||
script.write("set -x\n")
|
||||
data.emit_func(function, script, d)
|
||||
if cwd:
|
||||
script.write("cd %s\n" % cwd)
|
||||
script.write("%s\n" % func)
|
||||
script.write('''
|
||||
# cleanup
|
||||
ret=$?
|
||||
trap '' 0
|
||||
exit $?
|
||||
''')
|
||||
script.write("%s\n" % function)
|
||||
os.fchmod(script.fileno(), 0775)
|
||||
|
||||
os.chmod(runfile, 0775)
|
||||
env = {
|
||||
'PATH': d.getVar('PATH', True),
|
||||
'LC_ALL': 'C',
|
||||
}
|
||||
|
||||
cmd = runfile
|
||||
if d.getVarFlag(func, 'fakeroot'):
|
||||
fakerootcmd = d.getVar('FAKEROOT', True)
|
||||
if fakerootcmd:
|
||||
cmd = [fakerootcmd, runfile]
|
||||
|
||||
if bb.msg.loggerDefaultVerbose:
|
||||
if logger.isEnabledFor(logging.DEBUG):
|
||||
logfile = LogTee(logger, sys.stdout)
|
||||
else:
|
||||
logfile = sys.stdout
|
||||
|
||||
bb.debug(2, "Executing shell function %s" % func)
|
||||
|
||||
try:
|
||||
with open(os.devnull, 'r+') as stdin:
|
||||
bb.process.run(cmd, shell=False, stdin=stdin, log=logfile)
|
||||
bb.process.run(cmd, env=env, shell=False, stdin=NULL, log=logfile)
|
||||
except bb.process.CmdError:
|
||||
logfn = d.getVar('BB_LOGFILE', True)
|
||||
raise FuncFailed(func, logfn)
|
||||
|
||||
bb.debug(2, "Shell function %s finished" % func)
|
||||
raise FuncFailed(function, logfn)
|
||||
|
||||
def _task_data(fn, task, d):
|
||||
localdata = bb.data.createCopy(d)
|
||||
localdata = data.createCopy(d)
|
||||
localdata.setVar('BB_FILENAME', fn)
|
||||
localdata.setVar('BB_CURRENTTASK', task[3:])
|
||||
localdata.setVar('OVERRIDES', 'task-%s:%s' %
|
||||
(task[3:], d.getVar('OVERRIDES', False)))
|
||||
localdata.finalize()
|
||||
bb.data.expandKeys(localdata)
|
||||
data.expandKeys(localdata)
|
||||
return localdata
|
||||
|
||||
def _exec_task(fn, task, d, quieterr):
|
||||
@@ -336,7 +260,7 @@ def _exec_task(fn, task, d, quieterr):
|
||||
Execution of a task involves a bit more setup than executing a function,
|
||||
running it with its own local metadata, and with some useful variables set.
|
||||
"""
|
||||
if not d.getVarFlag(task, 'task'):
|
||||
if not data.getVarFlag(task, 'task', d):
|
||||
event.fire(TaskInvalid(task, d), d)
|
||||
logger.error("No such task: %s" % task)
|
||||
return 1
|
||||
@@ -349,46 +273,23 @@ def _exec_task(fn, task, d, quieterr):
|
||||
bb.fatal("T variable not set, unable to build")
|
||||
|
||||
bb.utils.mkdirhier(tempdir)
|
||||
|
||||
# Determine the logfile to generate
|
||||
logfmt = localdata.getVar('BB_LOGFMT', True) or 'log.{task}.{pid}'
|
||||
logbase = logfmt.format(task=task, pid=os.getpid())
|
||||
|
||||
# Document the order of the tasks...
|
||||
logorder = os.path.join(tempdir, 'log.task_order')
|
||||
try:
|
||||
with open(logorder, 'a') as logorderfile:
|
||||
logorderfile.write('{0} ({1}): {2}\n'.format(task, os.getpid(), logbase))
|
||||
except OSError:
|
||||
logger.exception("Opening log file '%s'", logorder)
|
||||
pass
|
||||
|
||||
# Setup the courtesy link to the logfn
|
||||
loglink = os.path.join(tempdir, 'log.{0}'.format(task))
|
||||
logfn = os.path.join(tempdir, logbase)
|
||||
logfn = os.path.join(tempdir, 'log.{0}.{1}'.format(task, os.getpid()))
|
||||
if loglink:
|
||||
bb.utils.remove(loglink)
|
||||
|
||||
try:
|
||||
os.symlink(logbase, loglink)
|
||||
os.symlink(logfn, loglink)
|
||||
except OSError:
|
||||
pass
|
||||
|
||||
prefuncs = localdata.getVarFlag(task, 'prefuncs', expand=True)
|
||||
postfuncs = localdata.getVarFlag(task, 'postfuncs', expand=True)
|
||||
|
||||
class ErrorCheckHandler(logging.Handler):
|
||||
def __init__(self):
|
||||
self.triggered = False
|
||||
logging.Handler.__init__(self, logging.ERROR)
|
||||
def emit(self, record):
|
||||
self.triggered = True
|
||||
|
||||
# Handle logfiles
|
||||
si = open('/dev/null', 'r')
|
||||
si = file('/dev/null', 'r')
|
||||
try:
|
||||
bb.utils.mkdirhier(os.path.dirname(logfn))
|
||||
logfile = open(logfn, 'w')
|
||||
logfile = file(logfn, 'w')
|
||||
except OSError:
|
||||
logger.exception("Opening log file '%s'", logfn)
|
||||
pass
|
||||
@@ -406,15 +307,9 @@ def _exec_task(fn, task, d, quieterr):
|
||||
# Ensure python logging goes to the logfile
|
||||
handler = logging.StreamHandler(logfile)
|
||||
handler.setFormatter(logformatter)
|
||||
# Always enable full debug output into task logfiles
|
||||
handler.setLevel(logging.DEBUG - 2)
|
||||
bblogger.addHandler(handler)
|
||||
|
||||
errchk = ErrorCheckHandler()
|
||||
bblogger.addHandler(errchk)
|
||||
|
||||
localdata.setVar('BB_LOGFILE', logfn)
|
||||
localdata.setVar('BB_RUNTASK', task)
|
||||
|
||||
event.fire(TaskStarted(task, localdata), localdata)
|
||||
try:
|
||||
@@ -424,12 +319,9 @@ def _exec_task(fn, task, d, quieterr):
|
||||
for func in (postfuncs or '').split():
|
||||
exec_func(func, localdata)
|
||||
except FuncFailed as exc:
|
||||
if quieterr:
|
||||
event.fire(TaskFailedSilent(task, logfn, localdata), localdata)
|
||||
else:
|
||||
errprinted = errchk.triggered
|
||||
if not quieterr:
|
||||
logger.error(str(exc))
|
||||
event.fire(TaskFailed(task, logfn, localdata, errprinted), localdata)
|
||||
event.fire(TaskFailed(task, logfn, localdata), localdata)
|
||||
return 1
|
||||
finally:
|
||||
sys.stdout.flush()
|
||||
@@ -460,33 +352,19 @@ def _exec_task(fn, task, d, quieterr):
|
||||
|
||||
return 0
|
||||
|
||||
def exec_task(fn, task, d, profile = False):
|
||||
def exec_task(fn, task, d):
|
||||
try:
|
||||
quieterr = False
|
||||
if d.getVarFlag(task, "quieterrors") is not None:
|
||||
quieterr = True
|
||||
|
||||
if profile:
|
||||
profname = "profile-%s.log" % (d.getVar("PN", True) + "-" + task)
|
||||
try:
|
||||
import cProfile as profile
|
||||
except:
|
||||
import profile
|
||||
prof = profile.Profile()
|
||||
ret = profile.Profile.runcall(prof, _exec_task, fn, task, d, quieterr)
|
||||
prof.dump_stats(profname)
|
||||
bb.utils.process_profilelog(profname)
|
||||
|
||||
return ret
|
||||
else:
|
||||
return _exec_task(fn, task, d, quieterr)
|
||||
|
||||
return _exec_task(fn, task, d, quieterr)
|
||||
except Exception:
|
||||
from traceback import format_exc
|
||||
if not quieterr:
|
||||
logger.error("Build of %s failed" % (task))
|
||||
logger.error(format_exc())
|
||||
failedevent = TaskFailed(task, None, d, True)
|
||||
failedevent = TaskFailed(task, None, d)
|
||||
event.fire(failedevent, d)
|
||||
return 1
|
||||
|
||||
@@ -504,10 +382,10 @@ def stamp_internal(taskname, d, file_name):
|
||||
taskflagname = taskname.replace("_setscene", "")
|
||||
|
||||
if file_name:
|
||||
stamp = d.stamp_base[file_name].get(taskflagname) or d.stamp[file_name]
|
||||
stamp = d.stamp[file_name]
|
||||
extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
|
||||
else:
|
||||
stamp = d.getVarFlag(taskflagname, 'stamp-base', True) or d.getVar('STAMP', True)
|
||||
stamp = d.getVar('STAMP', True)
|
||||
file_name = d.getVar('BB_FILENAME', True)
|
||||
extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
|
||||
|
||||
@@ -516,67 +394,22 @@ def stamp_internal(taskname, d, file_name):
|
||||
|
||||
stamp = bb.parse.siggen.stampfile(stamp, file_name, taskname, extrainfo)
|
||||
|
||||
stampdir = os.path.dirname(stamp)
|
||||
if bb.parse.cached_mtime_noerror(stampdir) == 0:
|
||||
bb.utils.mkdirhier(stampdir)
|
||||
bb.utils.mkdirhier(os.path.dirname(stamp))
|
||||
|
||||
return stamp
|
||||
|
||||
def stamp_cleanmask_internal(taskname, d, file_name):
|
||||
"""
|
||||
Internal stamp helper function to generate stamp cleaning mask
|
||||
Returns the stamp path+filename
|
||||
|
||||
In the bitbake core, d can be a CacheData and file_name will be set.
|
||||
When called in task context, d will be a data store, file_name will not be set
|
||||
"""
|
||||
taskflagname = taskname
|
||||
if taskname.endswith("_setscene") and taskname != "do_setscene":
|
||||
taskflagname = taskname.replace("_setscene", "")
|
||||
|
||||
if file_name:
|
||||
stamp = d.stamp_base_clean[file_name].get(taskflagname) or d.stampclean[file_name]
|
||||
extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
|
||||
else:
|
||||
stamp = d.getVarFlag(taskflagname, 'stamp-base-clean', True) or d.getVar('STAMPCLEAN', True)
|
||||
file_name = d.getVar('BB_FILENAME', True)
|
||||
extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
|
||||
|
||||
if not stamp:
|
||||
return []
|
||||
|
||||
cleanmask = bb.parse.siggen.stampcleanmask(stamp, file_name, taskname, extrainfo)
|
||||
|
||||
return [cleanmask, cleanmask.replace(taskflagname, taskflagname + "_setscene")]
|
||||
|
||||
def make_stamp(task, d, file_name = None):
|
||||
"""
|
||||
Creates/updates a stamp for a given task
|
||||
(d can be a data dict or dataCache)
|
||||
"""
|
||||
cleanmask = stamp_cleanmask_internal(task, d, file_name)
|
||||
for mask in cleanmask:
|
||||
for name in glob.glob(mask):
|
||||
# Preserve sigdata files in the stamps directory
|
||||
if "sigdata" in name:
|
||||
continue
|
||||
# Preserve taint files in the stamps directory
|
||||
if name.endswith('.taint'):
|
||||
continue
|
||||
os.unlink(name)
|
||||
|
||||
stamp = stamp_internal(task, d, file_name)
|
||||
# Remove the file and recreate to force timestamp
|
||||
# change on broken NFS filesystems
|
||||
if stamp:
|
||||
bb.utils.remove(stamp)
|
||||
open(stamp, "w").close()
|
||||
|
||||
# If we're in task context, write out a signature file for each task
|
||||
# as it completes
|
||||
if not task.endswith("_setscene") and task != "do_setscene" and not file_name:
|
||||
file_name = d.getVar('BB_FILENAME', True)
|
||||
bb.parse.siggen.dump_sigtask(file_name, task, d.getVar('STAMP', True), True)
|
||||
f = open(stamp, "w")
|
||||
f.close()
|
||||
|
||||
def del_stamp(task, d, file_name = None):
|
||||
"""
|
||||
@@ -586,24 +419,6 @@ def del_stamp(task, d, file_name = None):
|
||||
stamp = stamp_internal(task, d, file_name)
|
||||
bb.utils.remove(stamp)
|
||||
|
||||
def write_taint(task, d, file_name = None):
|
||||
"""
|
||||
Creates a "taint" file which will force the specified task and its
|
||||
dependents to be re-run the next time by influencing the value of its
|
||||
taskhash.
|
||||
(d can be a data dict or dataCache)
|
||||
"""
|
||||
import uuid
|
||||
if file_name:
|
||||
taintfn = d.stamp[file_name] + '.' + task + '.taint'
|
||||
else:
|
||||
taintfn = d.getVar('STAMP', True) + '.' + task + '.taint'
|
||||
bb.utils.mkdirhier(os.path.dirname(taintfn))
|
||||
# The specific content of the taint file is not really important,
|
||||
# we just need it to be random, so a random UUID is used
|
||||
with open(taintfn, 'w') as taintf:
|
||||
taintf.write(str(uuid.uuid4()))
|
||||
|
||||
def stampfile(taskname, d, file_name = None):
|
||||
"""
|
||||
Return the stamp for a given task
|
||||
@@ -612,7 +427,7 @@ def stampfile(taskname, d, file_name = None):
|
||||
return stamp_internal(taskname, d, file_name)
|
||||
|
||||
def add_tasks(tasklist, d):
|
||||
task_deps = d.getVar('_task_deps')
|
||||
task_deps = data.getVar('_task_deps', d)
|
||||
if not task_deps:
|
||||
task_deps = {}
|
||||
if not 'tasks' in task_deps:
|
||||
@@ -621,41 +436,37 @@ def add_tasks(tasklist, d):
|
||||
task_deps['parents'] = {}
|
||||
|
||||
for task in tasklist:
|
||||
task = d.expand(task)
|
||||
d.setVarFlag(task, 'task', 1)
|
||||
task = data.expand(task, d)
|
||||
data.setVarFlag(task, 'task', 1, d)
|
||||
|
||||
if not task in task_deps['tasks']:
|
||||
task_deps['tasks'].append(task)
|
||||
|
||||
flags = d.getVarFlags(task)
|
||||
flags = data.getVarFlags(task, d)
|
||||
def getTask(name):
|
||||
if not name in task_deps:
|
||||
task_deps[name] = {}
|
||||
if name in flags:
|
||||
deptask = d.expand(flags[name])
|
||||
deptask = data.expand(flags[name], d)
|
||||
task_deps[name][task] = deptask
|
||||
getTask('depends')
|
||||
getTask('rdepends')
|
||||
getTask('deptask')
|
||||
getTask('rdeptask')
|
||||
getTask('recrdeptask')
|
||||
getTask('recideptask')
|
||||
getTask('nostamp')
|
||||
getTask('fakeroot')
|
||||
getTask('noexec')
|
||||
getTask('umask')
|
||||
task_deps['parents'][task] = []
|
||||
if 'deps' in flags:
|
||||
for dep in flags['deps']:
|
||||
dep = d.expand(dep)
|
||||
task_deps['parents'][task].append(dep)
|
||||
for dep in flags['deps']:
|
||||
dep = data.expand(dep, d)
|
||||
task_deps['parents'][task].append(dep)
|
||||
|
||||
# don't assume holding a reference
|
||||
d.setVar('_task_deps', task_deps)
|
||||
data.setVar('_task_deps', task_deps, d)
|
||||
|
||||
def remove_task(task, kill, d):
|
||||
"""Remove an BB 'task'.
|
||||
|
||||
If kill is 1, also remove tasks that depend on this task."""
|
||||
|
||||
d.delVarFlag(task, 'task')
|
||||
data.delVarFlag(task, 'task', d)
|
||||
|
||||
@@ -1,12 +1,11 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# BitBake Cache implementation
|
||||
# BitBake 'Event' implementation
|
||||
#
|
||||
# Caching of bitbake variables before task execution
|
||||
|
||||
# Copyright (C) 2006 Richard Purdie
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
|
||||
# but small sections based on code from bin/bitbake:
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
@@ -31,7 +30,8 @@
|
||||
|
||||
import os
|
||||
import logging
|
||||
from collections import defaultdict
|
||||
from collections import defaultdict, namedtuple
|
||||
import bb.data
|
||||
import bb.utils
|
||||
|
||||
logger = logging.getLogger("BitBake.Cache")
|
||||
@@ -43,15 +43,48 @@ except ImportError:
|
||||
logger.info("Importing cPickle failed. "
|
||||
"Falling back to a very slow implementation.")
|
||||
|
||||
__cache_version__ = "146"
|
||||
__cache_version__ = "138"
|
||||
|
||||
def getCacheFile(path, filename, data_hash):
|
||||
return os.path.join(path, filename + "." + data_hash)
|
||||
recipe_fields = (
|
||||
'pn',
|
||||
'pv',
|
||||
'pr',
|
||||
'pe',
|
||||
'defaultpref',
|
||||
'depends',
|
||||
'provides',
|
||||
'task_deps',
|
||||
'stamp',
|
||||
'stamp_extrainfo',
|
||||
'broken',
|
||||
'not_world',
|
||||
'skipped',
|
||||
'timestamp',
|
||||
'packages',
|
||||
'packages_dynamic',
|
||||
'rdepends',
|
||||
'rdepends_pkg',
|
||||
'rprovides',
|
||||
'rprovides_pkg',
|
||||
'rrecommends',
|
||||
'rrecommends_pkg',
|
||||
'nocache',
|
||||
'variants',
|
||||
'file_depends',
|
||||
'tasks',
|
||||
'basetaskhashes',
|
||||
'hashfilename',
|
||||
'inherits',
|
||||
'summary',
|
||||
'license',
|
||||
'section',
|
||||
'fakerootenv',
|
||||
'fakerootdirs'
|
||||
)
|
||||
|
||||
# RecipeInfoCommon defines common data retrieving methods
|
||||
# from meta data for caches. CoreRecipeInfo as well as other
|
||||
# Extra RecipeInfo needs to inherit this class
|
||||
class RecipeInfoCommon(object):
|
||||
|
||||
class RecipeInfo(namedtuple('RecipeInfo', recipe_fields)):
|
||||
__slots__ = ()
|
||||
|
||||
@classmethod
|
||||
def listvar(cls, var, metadata):
|
||||
@@ -76,180 +109,74 @@ class RecipeInfoCommon(object):
|
||||
for task in tasks)
|
||||
|
||||
@classmethod
|
||||
def flaglist(cls, flag, varlist, metadata, squash=False):
|
||||
out_dict = dict((var, metadata.getVarFlag(var, flag, True))
|
||||
def flaglist(cls, flag, varlist, metadata):
|
||||
return dict((var, metadata.getVarFlag(var, flag, True))
|
||||
for var in varlist)
|
||||
if squash:
|
||||
return dict((k,v) for (k,v) in out_dict.iteritems() if v)
|
||||
else:
|
||||
return out_dict
|
||||
|
||||
@classmethod
|
||||
def getvar(cls, var, metadata):
|
||||
return metadata.getVar(var, True) or ''
|
||||
|
||||
|
||||
class CoreRecipeInfo(RecipeInfoCommon):
|
||||
__slots__ = ()
|
||||
|
||||
cachefile = "bb_cache.dat"
|
||||
|
||||
def __init__(self, filename, metadata):
|
||||
self.file_depends = metadata.getVar('__depends', False)
|
||||
self.timestamp = bb.parse.cached_mtime(filename)
|
||||
self.variants = self.listvar('__VARIANTS', metadata) + ['']
|
||||
self.appends = self.listvar('__BBAPPEND', metadata)
|
||||
self.nocache = self.getvar('__BB_DONT_CACHE', metadata)
|
||||
|
||||
self.skipreason = self.getvar('__SKIPPED', metadata)
|
||||
if self.skipreason:
|
||||
self.pn = self.getvar('PN', metadata) or bb.parse.BBHandler.vars_from_file(filename,metadata)[0]
|
||||
self.skipped = True
|
||||
self.provides = self.depvar('PROVIDES', metadata)
|
||||
self.rprovides = self.depvar('RPROVIDES', metadata)
|
||||
return
|
||||
|
||||
self.tasks = metadata.getVar('__BBTASKS', False)
|
||||
|
||||
self.pn = self.getvar('PN', metadata)
|
||||
self.packages = self.listvar('PACKAGES', metadata)
|
||||
if not self.pn in self.packages:
|
||||
self.packages.append(self.pn)
|
||||
|
||||
self.basetaskhashes = self.taskvar('BB_BASEHASH', self.tasks, metadata)
|
||||
self.hashfilename = self.getvar('BB_HASHFILENAME', metadata)
|
||||
|
||||
self.task_deps = metadata.getVar('_task_deps', False) or {'tasks': [], 'parents': {}}
|
||||
|
||||
self.skipped = False
|
||||
self.pe = self.getvar('PE', metadata)
|
||||
self.pv = self.getvar('PV', metadata)
|
||||
self.pr = self.getvar('PR', metadata)
|
||||
self.defaultpref = self.intvar('DEFAULT_PREFERENCE', metadata)
|
||||
self.not_world = self.getvar('EXCLUDE_FROM_WORLD', metadata)
|
||||
self.stamp = self.getvar('STAMP', metadata)
|
||||
self.stampclean = self.getvar('STAMPCLEAN', metadata)
|
||||
self.stamp_base = self.flaglist('stamp-base', self.tasks, metadata)
|
||||
self.stamp_base_clean = self.flaglist('stamp-base-clean', self.tasks, metadata)
|
||||
self.stamp_extrainfo = self.flaglist('stamp-extra-info', self.tasks, metadata)
|
||||
self.file_checksums = self.flaglist('file-checksums', self.tasks, metadata, True)
|
||||
self.packages_dynamic = self.listvar('PACKAGES_DYNAMIC', metadata)
|
||||
self.depends = self.depvar('DEPENDS', metadata)
|
||||
self.provides = self.depvar('PROVIDES', metadata)
|
||||
self.rdepends = self.depvar('RDEPENDS', metadata)
|
||||
self.rprovides = self.depvar('RPROVIDES', metadata)
|
||||
self.rrecommends = self.depvar('RRECOMMENDS', metadata)
|
||||
self.rprovides_pkg = self.pkgvar('RPROVIDES', self.packages, metadata)
|
||||
self.rdepends_pkg = self.pkgvar('RDEPENDS', self.packages, metadata)
|
||||
self.rrecommends_pkg = self.pkgvar('RRECOMMENDS', self.packages, metadata)
|
||||
self.inherits = self.getvar('__inherit_cache', metadata)
|
||||
self.fakerootenv = self.getvar('FAKEROOTENV', metadata)
|
||||
self.fakerootdirs = self.getvar('FAKEROOTDIRS', metadata)
|
||||
self.fakerootnoenv = self.getvar('FAKEROOTNOENV', metadata)
|
||||
@classmethod
|
||||
def make_optional(cls, default=None, **kwargs):
|
||||
"""Construct the namedtuple from the specified keyword arguments,
|
||||
with every value considered optional, using the default value if
|
||||
it was not specified."""
|
||||
for field in cls._fields:
|
||||
kwargs[field] = kwargs.get(field, default)
|
||||
return cls(**kwargs)
|
||||
|
||||
@classmethod
|
||||
def init_cacheData(cls, cachedata):
|
||||
# CacheData in Core RecipeInfo Class
|
||||
cachedata.task_deps = {}
|
||||
cachedata.pkg_fn = {}
|
||||
cachedata.pkg_pn = defaultdict(list)
|
||||
cachedata.pkg_pepvpr = {}
|
||||
cachedata.pkg_dp = {}
|
||||
def from_metadata(cls, filename, metadata):
|
||||
if cls.getvar('__SKIPPED', metadata):
|
||||
return cls.make_optional(skipped=True)
|
||||
|
||||
cachedata.stamp = {}
|
||||
cachedata.stampclean = {}
|
||||
cachedata.stamp_base = {}
|
||||
cachedata.stamp_base_clean = {}
|
||||
cachedata.stamp_extrainfo = {}
|
||||
cachedata.file_checksums = {}
|
||||
cachedata.fn_provides = {}
|
||||
cachedata.pn_provides = defaultdict(list)
|
||||
cachedata.all_depends = []
|
||||
tasks = metadata.getVar('__BBTASKS', False)
|
||||
|
||||
cachedata.deps = defaultdict(list)
|
||||
cachedata.packages = defaultdict(list)
|
||||
cachedata.providers = defaultdict(list)
|
||||
cachedata.rproviders = defaultdict(list)
|
||||
cachedata.packages_dynamic = defaultdict(list)
|
||||
pn = cls.getvar('PN', metadata)
|
||||
packages = cls.listvar('PACKAGES', metadata)
|
||||
if not pn in packages:
|
||||
packages.append(pn)
|
||||
|
||||
cachedata.rundeps = defaultdict(lambda: defaultdict(list))
|
||||
cachedata.runrecs = defaultdict(lambda: defaultdict(list))
|
||||
cachedata.possible_world = []
|
||||
cachedata.universe_target = []
|
||||
cachedata.hashfn = {}
|
||||
return RecipeInfo(
|
||||
tasks = tasks,
|
||||
basetaskhashes = cls.taskvar('BB_BASEHASH', tasks, metadata),
|
||||
hashfilename = cls.getvar('BB_HASHFILENAME', metadata),
|
||||
|
||||
cachedata.basetaskhash = {}
|
||||
cachedata.inherits = {}
|
||||
cachedata.fakerootenv = {}
|
||||
cachedata.fakerootnoenv = {}
|
||||
cachedata.fakerootdirs = {}
|
||||
|
||||
def add_cacheData(self, cachedata, fn):
|
||||
cachedata.task_deps[fn] = self.task_deps
|
||||
cachedata.pkg_fn[fn] = self.pn
|
||||
cachedata.pkg_pn[self.pn].append(fn)
|
||||
cachedata.pkg_pepvpr[fn] = (self.pe, self.pv, self.pr)
|
||||
cachedata.pkg_dp[fn] = self.defaultpref
|
||||
cachedata.stamp[fn] = self.stamp
|
||||
cachedata.stampclean[fn] = self.stampclean
|
||||
cachedata.stamp_base[fn] = self.stamp_base
|
||||
cachedata.stamp_base_clean[fn] = self.stamp_base_clean
|
||||
cachedata.stamp_extrainfo[fn] = self.stamp_extrainfo
|
||||
cachedata.file_checksums[fn] = self.file_checksums
|
||||
|
||||
provides = [self.pn]
|
||||
for provide in self.provides:
|
||||
if provide not in provides:
|
||||
provides.append(provide)
|
||||
cachedata.fn_provides[fn] = provides
|
||||
|
||||
for provide in provides:
|
||||
cachedata.providers[provide].append(fn)
|
||||
if provide not in cachedata.pn_provides[self.pn]:
|
||||
cachedata.pn_provides[self.pn].append(provide)
|
||||
|
||||
for dep in self.depends:
|
||||
if dep not in cachedata.deps[fn]:
|
||||
cachedata.deps[fn].append(dep)
|
||||
if dep not in cachedata.all_depends:
|
||||
cachedata.all_depends.append(dep)
|
||||
|
||||
rprovides = self.rprovides
|
||||
for package in self.packages:
|
||||
cachedata.packages[package].append(fn)
|
||||
rprovides += self.rprovides_pkg[package]
|
||||
|
||||
for rprovide in rprovides:
|
||||
cachedata.rproviders[rprovide].append(fn)
|
||||
|
||||
for package in self.packages_dynamic:
|
||||
cachedata.packages_dynamic[package].append(fn)
|
||||
|
||||
# Build hash of runtime depends and rececommends
|
||||
for package in self.packages + [self.pn]:
|
||||
cachedata.rundeps[fn][package] = list(self.rdepends) + self.rdepends_pkg[package]
|
||||
cachedata.runrecs[fn][package] = list(self.rrecommends) + self.rrecommends_pkg[package]
|
||||
|
||||
# Collect files we may need for possible world-dep
|
||||
# calculations
|
||||
if not self.not_world:
|
||||
cachedata.possible_world.append(fn)
|
||||
|
||||
# create a collection of all targets for sanity checking
|
||||
# tasks, such as upstream versions, license, and tools for
|
||||
# task and image creation.
|
||||
cachedata.universe_target.append(self.pn)
|
||||
|
||||
cachedata.hashfn[fn] = self.hashfilename
|
||||
for task, taskhash in self.basetaskhashes.iteritems():
|
||||
identifier = '%s.%s' % (fn, task)
|
||||
cachedata.basetaskhash[identifier] = taskhash
|
||||
|
||||
cachedata.inherits[fn] = self.inherits
|
||||
cachedata.fakerootenv[fn] = self.fakerootenv
|
||||
cachedata.fakerootnoenv[fn] = self.fakerootnoenv
|
||||
cachedata.fakerootdirs[fn] = self.fakerootdirs
|
||||
file_depends = metadata.getVar('__depends', False),
|
||||
task_deps = metadata.getVar('_task_deps', False) or
|
||||
{'tasks': [], 'parents': {}},
|
||||
variants = cls.listvar('__VARIANTS', metadata) + [''],
|
||||
|
||||
skipped = False,
|
||||
timestamp = bb.parse.cached_mtime(filename),
|
||||
packages = cls.listvar('PACKAGES', metadata),
|
||||
pn = pn,
|
||||
pe = cls.getvar('PE', metadata),
|
||||
pv = cls.getvar('PV', metadata),
|
||||
pr = cls.getvar('PR', metadata),
|
||||
nocache = cls.getvar('__BB_DONT_CACHE', metadata),
|
||||
defaultpref = cls.intvar('DEFAULT_PREFERENCE', metadata),
|
||||
broken = cls.getvar('BROKEN', metadata),
|
||||
not_world = cls.getvar('EXCLUDE_FROM_WORLD', metadata),
|
||||
stamp = cls.getvar('STAMP', metadata),
|
||||
stamp_extrainfo = cls.flaglist('stamp-extra-info', tasks, metadata),
|
||||
packages_dynamic = cls.listvar('PACKAGES_DYNAMIC', metadata),
|
||||
depends = cls.depvar('DEPENDS', metadata),
|
||||
provides = cls.depvar('PROVIDES', metadata),
|
||||
rdepends = cls.depvar('RDEPENDS', metadata),
|
||||
rprovides = cls.depvar('RPROVIDES', metadata),
|
||||
rrecommends = cls.depvar('RRECOMMENDS', metadata),
|
||||
rprovides_pkg = cls.pkgvar('RPROVIDES', packages, metadata),
|
||||
rdepends_pkg = cls.pkgvar('RDEPENDS', packages, metadata),
|
||||
rrecommends_pkg = cls.pkgvar('RRECOMMENDS', packages, metadata),
|
||||
inherits = cls.getvar('__inherit_cache', metadata),
|
||||
summary = cls.getvar('SUMMARY', metadata),
|
||||
license = cls.getvar('LICENSE', metadata),
|
||||
section = cls.getvar('SECTION', metadata),
|
||||
fakerootenv = cls.getvar('FAKEROOTENV', metadata),
|
||||
fakerootdirs = cls.getvar('FAKEROOTDIRS', metadata),
|
||||
)
|
||||
|
||||
|
||||
class Cache(object):
|
||||
@@ -257,19 +184,14 @@ class Cache(object):
|
||||
BitBake Cache implementation
|
||||
"""
|
||||
|
||||
def __init__(self, data, data_hash, caches_array):
|
||||
# Pass caches_array information into Cache Constructor
|
||||
# It will be used in later for deciding whether we
|
||||
# need extra cache file dump/load support
|
||||
self.caches_array = caches_array
|
||||
self.cachedir = data.getVar("CACHE", True)
|
||||
def __init__(self, data):
|
||||
self.cachedir = bb.data.getVar("CACHE", data, True)
|
||||
self.clean = set()
|
||||
self.checked = set()
|
||||
self.depends_cache = {}
|
||||
self.data = None
|
||||
self.data_fn = None
|
||||
self.cacheclean = True
|
||||
self.data_hash = data_hash
|
||||
|
||||
if self.cachedir in [None, '']:
|
||||
self.has_cache = False
|
||||
@@ -278,26 +200,26 @@ class Cache(object):
|
||||
return
|
||||
|
||||
self.has_cache = True
|
||||
self.cachefile = getCacheFile(self.cachedir, "bb_cache.dat", self.data_hash)
|
||||
self.cachefile = os.path.join(self.cachedir, "bb_cache.dat")
|
||||
|
||||
logger.debug(1, "Using cache in '%s'", self.cachedir)
|
||||
bb.utils.mkdirhier(self.cachedir)
|
||||
|
||||
cache_ok = True
|
||||
if self.caches_array:
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
cache_ok = cache_ok and os.path.exists(cachefile)
|
||||
cache_class.init_cacheData(self)
|
||||
if cache_ok:
|
||||
# If any of configuration.data's dependencies are newer than the
|
||||
# cache there isn't even any point in loading it...
|
||||
newest_mtime = 0
|
||||
deps = bb.data.getVar("__base_depends", data)
|
||||
|
||||
old_mtimes = [old_mtime for _, old_mtime in deps]
|
||||
old_mtimes.append(newest_mtime)
|
||||
newest_mtime = max(old_mtimes)
|
||||
|
||||
if bb.parse.cached_mtime_noerror(self.cachefile) >= newest_mtime:
|
||||
self.load_cachefile()
|
||||
elif os.path.isfile(self.cachefile):
|
||||
logger.info("Out of date cache found, rebuilding...")
|
||||
|
||||
def load_cachefile(self):
|
||||
# Firstly, using core cache file information for
|
||||
# valid checking
|
||||
with open(self.cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
try:
|
||||
@@ -314,52 +236,31 @@ class Cache(object):
|
||||
logger.info('Bitbake version mismatch, rebuilding...')
|
||||
return
|
||||
|
||||
cachesize = os.fstat(cachefile.fileno()).st_size
|
||||
bb.event.fire(bb.event.CacheLoadStarted(cachesize), self.data)
|
||||
|
||||
cachesize = 0
|
||||
previous_progress = 0
|
||||
previous_percent = 0
|
||||
previous_percent = 0
|
||||
while cachefile:
|
||||
try:
|
||||
key = pickled.load()
|
||||
value = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
|
||||
# Calculate the correct cachesize of all those cache files
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
cachesize += os.fstat(cachefile.fileno()).st_size
|
||||
self.depends_cache[key] = value
|
||||
|
||||
bb.event.fire(bb.event.CacheLoadStarted(cachesize), self.data)
|
||||
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
while cachefile:
|
||||
try:
|
||||
key = pickled.load()
|
||||
value = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
if self.depends_cache.has_key(key):
|
||||
self.depends_cache[key].append(value)
|
||||
else:
|
||||
self.depends_cache[key] = [value]
|
||||
# only fire events on even percentage boundaries
|
||||
current_progress = cachefile.tell() + previous_progress
|
||||
current_percent = 100 * current_progress / cachesize
|
||||
if current_percent > previous_percent:
|
||||
previous_percent = current_percent
|
||||
bb.event.fire(bb.event.CacheLoadProgress(current_progress, cachesize),
|
||||
self.data)
|
||||
# only fire events on even percentage boundaries
|
||||
current_progress = cachefile.tell()
|
||||
current_percent = 100 * current_progress / cachesize
|
||||
if current_percent > previous_percent:
|
||||
previous_percent = current_percent
|
||||
bb.event.fire(bb.event.CacheLoadProgress(current_progress),
|
||||
self.data)
|
||||
|
||||
previous_progress += current_progress
|
||||
bb.event.fire(bb.event.CacheLoadCompleted(cachesize,
|
||||
len(self.depends_cache)),
|
||||
self.data)
|
||||
|
||||
# Note: depends cache number is corresponding to the parsing file numbers.
|
||||
# The same file has several caches, still regarded as one item in the cache
|
||||
bb.event.fire(bb.event.CacheLoadCompleted(cachesize,
|
||||
len(self.depends_cache)),
|
||||
self.data)
|
||||
|
||||
|
||||
@staticmethod
|
||||
def virtualfn2realfn(virtualfn):
|
||||
"""
|
||||
@@ -369,9 +270,8 @@ class Cache(object):
|
||||
fn = virtualfn
|
||||
cls = ""
|
||||
if virtualfn.startswith('virtual:'):
|
||||
elems = virtualfn.split(':')
|
||||
cls = ":".join(elems[1:-1])
|
||||
fn = elems[-1]
|
||||
cls = virtualfn.split(':', 2)[1]
|
||||
fn = virtualfn.replace('virtual:' + cls + ':', '')
|
||||
return (fn, cls)
|
||||
|
||||
@staticmethod
|
||||
@@ -394,31 +294,24 @@ class Cache(object):
|
||||
|
||||
logger.debug(1, "Parsing %s (full)", fn)
|
||||
|
||||
cfgData.setVar("__ONLYFINALISE", virtual or "default")
|
||||
bb_data = cls.load_bbfile(fn, appends, cfgData)
|
||||
return bb_data[virtual]
|
||||
|
||||
@classmethod
|
||||
def parse(cls, filename, appends, configdata, caches_array):
|
||||
def parse(cls, filename, appends, configdata):
|
||||
"""Parse the specified filename, returning the recipe information"""
|
||||
infos = []
|
||||
datastores = cls.load_bbfile(filename, appends, configdata)
|
||||
depends = []
|
||||
depends = set()
|
||||
for variant, data in sorted(datastores.iteritems(),
|
||||
key=lambda i: i[0],
|
||||
reverse=True):
|
||||
virtualfn = cls.realfn2virtual(filename, variant)
|
||||
depends = depends + (data.getVar("__depends", False) or [])
|
||||
depends |= (data.getVar("__depends", False) or set())
|
||||
if depends and not variant:
|
||||
data.setVar("__depends", depends)
|
||||
|
||||
info_array = []
|
||||
for cache_class in caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
info = cache_class(filename, data)
|
||||
info_array.append(info)
|
||||
infos.append((virtualfn, info_array))
|
||||
|
||||
info = RecipeInfo.from_metadata(filename, data)
|
||||
infos.append((virtualfn, info))
|
||||
return infos
|
||||
|
||||
def load(self, filename, appends, configdata):
|
||||
@@ -429,17 +322,16 @@ class Cache(object):
|
||||
automatically add the information to the cache or to your
|
||||
CacheData. Use the add or add_info method to do so after
|
||||
running this, or use loadData instead."""
|
||||
cached = self.cacheValid(filename, appends)
|
||||
cached = self.cacheValid(filename)
|
||||
if cached:
|
||||
infos = []
|
||||
# info_array item is a list of [CoreRecipeInfo, XXXRecipeInfo]
|
||||
info_array = self.depends_cache[filename]
|
||||
for variant in info_array[0].variants:
|
||||
info = self.depends_cache[filename]
|
||||
for variant in info.variants:
|
||||
virtualfn = self.realfn2virtual(filename, variant)
|
||||
infos.append((virtualfn, self.depends_cache[virtualfn]))
|
||||
else:
|
||||
logger.debug(1, "Parsing %s", filename)
|
||||
return self.parse(filename, appends, configdata, self.caches_array)
|
||||
return self.parse(filename, appends, configdata)
|
||||
|
||||
return cached, infos
|
||||
|
||||
@@ -450,23 +342,23 @@ class Cache(object):
|
||||
skipped, virtuals = 0, 0
|
||||
|
||||
cached, infos = self.load(fn, appends, cfgData)
|
||||
for virtualfn, info_array in infos:
|
||||
if info_array[0].skipped:
|
||||
logger.debug(1, "Skipping %s: %s", virtualfn, info_array[0].skipreason)
|
||||
for virtualfn, info in infos:
|
||||
if info.skipped:
|
||||
logger.debug(1, "Skipping %s", virtualfn)
|
||||
skipped += 1
|
||||
else:
|
||||
self.add_info(virtualfn, info_array, cacheData, not cached)
|
||||
self.add_info(virtualfn, info, cacheData, not cached)
|
||||
virtuals += 1
|
||||
|
||||
return cached, skipped, virtuals
|
||||
|
||||
def cacheValid(self, fn, appends):
|
||||
def cacheValid(self, fn):
|
||||
"""
|
||||
Is the cache valid for fn?
|
||||
Fast version, no timestamps checked.
|
||||
"""
|
||||
if fn not in self.checked:
|
||||
self.cacheValidUpdate(fn, appends)
|
||||
self.cacheValidUpdate(fn)
|
||||
|
||||
# Is cache enabled?
|
||||
if not self.has_cache:
|
||||
@@ -475,7 +367,7 @@ class Cache(object):
|
||||
return True
|
||||
return False
|
||||
|
||||
def cacheValidUpdate(self, fn, appends):
|
||||
def cacheValidUpdate(self, fn):
|
||||
"""
|
||||
Is the cache valid for fn?
|
||||
Make thorough (slower) checks including timestamps.
|
||||
@@ -499,15 +391,15 @@ class Cache(object):
|
||||
self.remove(fn)
|
||||
return False
|
||||
|
||||
info_array = self.depends_cache[fn]
|
||||
info = self.depends_cache[fn]
|
||||
# Check the file's timestamp
|
||||
if mtime != info_array[0].timestamp:
|
||||
if mtime != info.timestamp:
|
||||
logger.debug(2, "Cache: %s changed", fn)
|
||||
self.remove(fn)
|
||||
return False
|
||||
|
||||
# Check dependencies are still valid
|
||||
depends = info_array[0].file_depends
|
||||
depends = info.file_depends
|
||||
if depends:
|
||||
for f, old_mtime in depends:
|
||||
fmtime = bb.parse.cached_mtime_noerror(f)
|
||||
@@ -524,23 +416,8 @@ class Cache(object):
|
||||
self.remove(fn)
|
||||
return False
|
||||
|
||||
if hasattr(info_array[0], 'file_checksums'):
|
||||
for _, fl in info_array[0].file_checksums.items():
|
||||
for f in fl.split():
|
||||
if not os.path.exists(f):
|
||||
logger.debug(2, "Cache: %s's file checksum list file %s was removed",
|
||||
fn, f)
|
||||
self.remove(fn)
|
||||
return False
|
||||
|
||||
if appends != info_array[0].appends:
|
||||
logger.debug(2, "Cache: appends for %s changed", fn)
|
||||
logger.debug(2, "%s to %s" % (str(appends), str(info_array[0].appends)))
|
||||
self.remove(fn)
|
||||
return False
|
||||
|
||||
invalid = False
|
||||
for cls in info_array[0].variants:
|
||||
for cls in info.variants:
|
||||
virtualfn = self.realfn2virtual(fn, cls)
|
||||
self.clean.add(virtualfn)
|
||||
if virtualfn not in self.depends_cache:
|
||||
@@ -549,7 +426,7 @@ class Cache(object):
|
||||
|
||||
# If any one of the variants is not present, mark as invalid for all
|
||||
if invalid:
|
||||
for cls in info_array[0].variants:
|
||||
for cls in info.variants:
|
||||
virtualfn = self.realfn2virtual(fn, cls)
|
||||
if virtualfn in self.clean:
|
||||
logger.debug(2, "Cache: Removing %s from cache", virtualfn)
|
||||
@@ -587,30 +464,13 @@ class Cache(object):
|
||||
logger.debug(2, "Cache is clean, not saving.")
|
||||
return
|
||||
|
||||
file_dict = {}
|
||||
pickler_dict = {}
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cache_class_name = cache_class.__name__
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
file_dict[cache_class_name] = open(cachefile, "wb")
|
||||
pickler_dict[cache_class_name] = pickle.Pickler(file_dict[cache_class_name], pickle.HIGHEST_PROTOCOL)
|
||||
|
||||
pickler_dict['CoreRecipeInfo'].dump(__cache_version__)
|
||||
pickler_dict['CoreRecipeInfo'].dump(bb.__version__)
|
||||
|
||||
try:
|
||||
for key, info_array in self.depends_cache.iteritems():
|
||||
for info in info_array:
|
||||
if isinstance(info, RecipeInfoCommon):
|
||||
cache_class_name = info.__class__.__name__
|
||||
pickler_dict[cache_class_name].dump(key)
|
||||
pickler_dict[cache_class_name].dump(info)
|
||||
finally:
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cache_class_name = cache_class.__name__
|
||||
file_dict[cache_class_name].close()
|
||||
with open(self.cachefile, "wb") as cachefile:
|
||||
pickler = pickle.Pickler(cachefile, pickle.HIGHEST_PROTOCOL)
|
||||
pickler.dump(__cache_version__)
|
||||
pickler.dump(bb.__version__)
|
||||
for key, value in self.depends_cache.iteritems():
|
||||
pickler.dump(key)
|
||||
pickler.dump(value)
|
||||
|
||||
del self.depends_cache
|
||||
|
||||
@@ -618,17 +478,15 @@ class Cache(object):
|
||||
def mtime(cachefile):
|
||||
return bb.parse.cached_mtime_noerror(cachefile)
|
||||
|
||||
def add_info(self, filename, info_array, cacheData, parsed=None):
|
||||
if isinstance(info_array[0], CoreRecipeInfo) and (not info_array[0].skipped):
|
||||
cacheData.add_from_recipeinfo(filename, info_array)
|
||||
|
||||
def add_info(self, filename, info, cacheData, parsed=None):
|
||||
cacheData.add_from_recipeinfo(filename, info)
|
||||
if not self.has_cache:
|
||||
return
|
||||
|
||||
if (info_array[0].skipped or 'SRCREVINACTION' not in info_array[0].pv) and not info_array[0].nocache:
|
||||
if 'SRCREVINACTION' not in info.pv and not info.nocache:
|
||||
if parsed:
|
||||
self.cacheclean = False
|
||||
self.depends_cache[filename] = info_array
|
||||
self.depends_cache[filename] = info
|
||||
|
||||
def add(self, file_name, data, cacheData, parsed=None):
|
||||
"""
|
||||
@@ -636,12 +494,8 @@ class Cache(object):
|
||||
"""
|
||||
|
||||
realfn = self.virtualfn2realfn(file_name)[0]
|
||||
|
||||
info_array = []
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
info_array.append(cache_class(realfn, data))
|
||||
self.add_info(file_name, info_array, cacheData, parsed)
|
||||
info = RecipeInfo.from_metadata(realfn, data)
|
||||
self.add_info(file_name, info, cacheData, parsed)
|
||||
|
||||
@staticmethod
|
||||
def load_bbfile(bbfile, appends, config):
|
||||
@@ -697,7 +551,7 @@ def init(cooker):
|
||||
Files causing parsing errors are evicted from the cache.
|
||||
|
||||
"""
|
||||
return Cache(cooker.configuration.data, cooker.configuration.data_hash)
|
||||
return Cache(cooker.configuration.data)
|
||||
|
||||
|
||||
class CacheData(object):
|
||||
@@ -705,143 +559,99 @@ class CacheData(object):
|
||||
The data structures we compile from the cached data
|
||||
"""
|
||||
|
||||
def __init__(self, caches_array):
|
||||
self.caches_array = caches_array
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cache_class.init_cacheData(self)
|
||||
|
||||
def __init__(self):
|
||||
# Direct cache variables
|
||||
self.providers = defaultdict(list)
|
||||
self.rproviders = defaultdict(list)
|
||||
self.packages = defaultdict(list)
|
||||
self.packages_dynamic = defaultdict(list)
|
||||
self.possible_world = []
|
||||
self.pkg_pn = defaultdict(list)
|
||||
self.pkg_fn = {}
|
||||
self.pkg_pepvpr = {}
|
||||
self.pkg_dp = {}
|
||||
self.pn_provides = defaultdict(list)
|
||||
self.fn_provides = {}
|
||||
self.all_depends = []
|
||||
self.deps = defaultdict(list)
|
||||
self.rundeps = defaultdict(lambda: defaultdict(list))
|
||||
self.runrecs = defaultdict(lambda: defaultdict(list))
|
||||
self.task_queues = {}
|
||||
self.task_deps = {}
|
||||
self.stamp = {}
|
||||
self.stamp_extrainfo = {}
|
||||
self.preferred = {}
|
||||
self.tasks = {}
|
||||
self.basetaskhash = {}
|
||||
self.hashfn = {}
|
||||
self.inherits = {}
|
||||
self.summary = {}
|
||||
self.license = {}
|
||||
self.section = {}
|
||||
self.fakerootenv = {}
|
||||
self.fakerootdirs = {}
|
||||
|
||||
# Indirect Cache variables (set elsewhere)
|
||||
self.ignored_dependencies = []
|
||||
self.world_target = set()
|
||||
self.bbfile_priority = {}
|
||||
self.bbfile_config_priorities = []
|
||||
|
||||
def add_from_recipeinfo(self, fn, info_array):
|
||||
for info in info_array:
|
||||
info.add_cacheData(self, fn)
|
||||
def add_from_recipeinfo(self, fn, info):
|
||||
self.task_deps[fn] = info.task_deps
|
||||
self.pkg_fn[fn] = info.pn
|
||||
self.pkg_pn[info.pn].append(fn)
|
||||
self.pkg_pepvpr[fn] = (info.pe, info.pv, info.pr)
|
||||
self.pkg_dp[fn] = info.defaultpref
|
||||
self.stamp[fn] = info.stamp
|
||||
self.stamp_extrainfo[fn] = info.stamp_extrainfo
|
||||
|
||||
class MultiProcessCache(object):
|
||||
"""
|
||||
BitBake multi-process cache implementation
|
||||
provides = [info.pn]
|
||||
for provide in info.provides:
|
||||
if provide not in provides:
|
||||
provides.append(provide)
|
||||
self.fn_provides[fn] = provides
|
||||
|
||||
Used by the codeparser & file checksum caches
|
||||
"""
|
||||
for provide in provides:
|
||||
self.providers[provide].append(fn)
|
||||
if provide not in self.pn_provides[info.pn]:
|
||||
self.pn_provides[info.pn].append(provide)
|
||||
|
||||
def __init__(self):
|
||||
self.cachefile = None
|
||||
self.cachedata = self.create_cachedata()
|
||||
self.cachedata_extras = self.create_cachedata()
|
||||
for dep in info.depends:
|
||||
if dep not in self.deps[fn]:
|
||||
self.deps[fn].append(dep)
|
||||
if dep not in self.all_depends:
|
||||
self.all_depends.append(dep)
|
||||
|
||||
def init_cache(self, d):
|
||||
cachedir = (d.getVar("PERSISTENT_DIR", True) or
|
||||
d.getVar("CACHE", True))
|
||||
if cachedir in [None, '']:
|
||||
return
|
||||
bb.utils.mkdirhier(cachedir)
|
||||
self.cachefile = os.path.join(cachedir, self.__class__.cache_file_name)
|
||||
logger.debug(1, "Using cache in '%s'", self.cachefile)
|
||||
rprovides = info.rprovides
|
||||
for package in info.packages:
|
||||
self.packages[package].append(fn)
|
||||
rprovides += info.rprovides_pkg[package]
|
||||
|
||||
glf = bb.utils.lockfile(self.cachefile + ".lock")
|
||||
for rprovide in rprovides:
|
||||
self.rproviders[rprovide].append(fn)
|
||||
|
||||
try:
|
||||
with open(self.cachefile, "rb") as f:
|
||||
p = pickle.Unpickler(f)
|
||||
data, version = p.load()
|
||||
except:
|
||||
bb.utils.unlockfile(glf)
|
||||
return
|
||||
for package in info.packages_dynamic:
|
||||
self.packages_dynamic[package].append(fn)
|
||||
|
||||
bb.utils.unlockfile(glf)
|
||||
# Build hash of runtime depends and rececommends
|
||||
for package in info.packages + [info.pn]:
|
||||
self.rundeps[fn][package] = list(info.rdepends) + info.rdepends_pkg[package]
|
||||
self.runrecs[fn][package] = list(info.rrecommends) + info.rrecommends_pkg[package]
|
||||
|
||||
if version != self.__class__.CACHE_VERSION:
|
||||
return
|
||||
# Collect files we may need for possible world-dep
|
||||
# calculations
|
||||
if not info.broken and not info.not_world:
|
||||
self.possible_world.append(fn)
|
||||
|
||||
self.cachedata = data
|
||||
|
||||
def internSet(self, items):
|
||||
new = set()
|
||||
for i in items:
|
||||
new.add(intern(i))
|
||||
return new
|
||||
|
||||
def compress_keys(self, data):
|
||||
# Override in subclasses if desired
|
||||
return
|
||||
|
||||
def create_cachedata(self):
|
||||
data = [{}]
|
||||
return data
|
||||
|
||||
def save_extras(self, d):
|
||||
if not self.cachefile:
|
||||
return
|
||||
|
||||
glf = bb.utils.lockfile(self.cachefile + ".lock", shared=True)
|
||||
|
||||
i = os.getpid()
|
||||
lf = None
|
||||
while not lf:
|
||||
lf = bb.utils.lockfile(self.cachefile + ".lock." + str(i), retry=False)
|
||||
if not lf or os.path.exists(self.cachefile + "-" + str(i)):
|
||||
if lf:
|
||||
bb.utils.unlockfile(lf)
|
||||
lf = None
|
||||
i = i + 1
|
||||
continue
|
||||
|
||||
with open(self.cachefile + "-" + str(i), "wb") as f:
|
||||
p = pickle.Pickler(f, -1)
|
||||
p.dump([self.cachedata_extras, self.__class__.CACHE_VERSION])
|
||||
|
||||
bb.utils.unlockfile(lf)
|
||||
bb.utils.unlockfile(glf)
|
||||
|
||||
def merge_data(self, source, dest):
|
||||
for j in range(0,len(dest)):
|
||||
for h in source[j]:
|
||||
if h not in dest[j]:
|
||||
dest[j][h] = source[j][h]
|
||||
|
||||
def save_merge(self, d):
|
||||
if not self.cachefile:
|
||||
return
|
||||
|
||||
glf = bb.utils.lockfile(self.cachefile + ".lock")
|
||||
|
||||
try:
|
||||
with open(self.cachefile, "rb") as f:
|
||||
p = pickle.Unpickler(f)
|
||||
data, version = p.load()
|
||||
except (IOError, EOFError):
|
||||
data, version = None, None
|
||||
|
||||
if version != self.__class__.CACHE_VERSION:
|
||||
data = self.create_cachedata()
|
||||
|
||||
for f in [y for y in os.listdir(os.path.dirname(self.cachefile)) if y.startswith(os.path.basename(self.cachefile) + '-')]:
|
||||
f = os.path.join(os.path.dirname(self.cachefile), f)
|
||||
try:
|
||||
with open(f, "rb") as fd:
|
||||
p = pickle.Unpickler(fd)
|
||||
extradata, version = p.load()
|
||||
except (IOError, EOFError):
|
||||
extradata, version = self.create_cachedata(), None
|
||||
|
||||
if version != self.__class__.CACHE_VERSION:
|
||||
continue
|
||||
|
||||
self.merge_data(extradata, data)
|
||||
os.unlink(f)
|
||||
|
||||
self.compress_keys(data)
|
||||
|
||||
with open(self.cachefile, "wb") as f:
|
||||
p = pickle.Pickler(f, -1)
|
||||
p.dump([data, self.__class__.CACHE_VERSION])
|
||||
|
||||
bb.utils.unlockfile(glf)
|
||||
self.hashfn[fn] = info.hashfilename
|
||||
for task, taskhash in info.basetaskhashes.iteritems():
|
||||
identifier = '%s.%s' % (fn, task)
|
||||
self.basetaskhash[identifier] = taskhash
|
||||
|
||||
self.inherits[fn] = info.inherits
|
||||
self.summary[fn] = info.summary
|
||||
self.license[fn] = info.license
|
||||
self.section[fn] = info.section
|
||||
self.fakerootenv[fn] = info.fakerootenv
|
||||
self.fakerootdirs[fn] = info.fakerootdirs
|
||||
|
||||
@@ -1,69 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Extra RecipeInfo will be all defined in this file. Currently,
|
||||
# Only Hob (Image Creator) Requests some extra fields. So
|
||||
# HobRecipeInfo is defined. It's named HobRecipeInfo because it
|
||||
# is introduced by 'hob'. Users could also introduce other
|
||||
# RecipeInfo or simply use those already defined RecipeInfo.
|
||||
# In the following patch, this newly defined new extra RecipeInfo
|
||||
# will be dynamically loaded and used for loading/saving the extra
|
||||
# cache fields
|
||||
|
||||
# Copyright (C) 2011, Intel Corporation. All rights reserved.
|
||||
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
from bb.cache import RecipeInfoCommon
|
||||
|
||||
class HobRecipeInfo(RecipeInfoCommon):
|
||||
__slots__ = ()
|
||||
|
||||
classname = "HobRecipeInfo"
|
||||
# please override this member with the correct data cache file
|
||||
# such as (bb_cache.dat, bb_extracache_hob.dat)
|
||||
cachefile = "bb_extracache_" + classname +".dat"
|
||||
|
||||
def __init__(self, filename, metadata):
|
||||
|
||||
self.summary = self.getvar('SUMMARY', metadata)
|
||||
self.license = self.getvar('LICENSE', metadata)
|
||||
self.section = self.getvar('SECTION', metadata)
|
||||
self.description = self.getvar('DESCRIPTION', metadata)
|
||||
self.homepage = self.getvar('HOMEPAGE', metadata)
|
||||
self.bugtracker = self.getvar('BUGTRACKER', metadata)
|
||||
self.prevision = self.getvar('PR', metadata)
|
||||
self.files_info = self.getvar('FILES_INFO', metadata)
|
||||
|
||||
@classmethod
|
||||
def init_cacheData(cls, cachedata):
|
||||
# CacheData in Hob RecipeInfo Class
|
||||
cachedata.summary = {}
|
||||
cachedata.license = {}
|
||||
cachedata.section = {}
|
||||
cachedata.description = {}
|
||||
cachedata.homepage = {}
|
||||
cachedata.bugtracker = {}
|
||||
cachedata.prevision = {}
|
||||
cachedata.files_info = {}
|
||||
|
||||
def add_cacheData(self, cachedata, fn):
|
||||
cachedata.summary[fn] = self.summary
|
||||
cachedata.license[fn] = self.license
|
||||
cachedata.section[fn] = self.section
|
||||
cachedata.description[fn] = self.description
|
||||
cachedata.homepage[fn] = self.homepage
|
||||
cachedata.bugtracker[fn] = self.bugtracker
|
||||
cachedata.prevision[fn] = self.prevision
|
||||
cachedata.files_info[fn] = self.files_info
|
||||
@@ -1,90 +0,0 @@
|
||||
# Local file checksum cache implementation
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import stat
|
||||
import bb.utils
|
||||
import logging
|
||||
from bb.cache import MultiProcessCache
|
||||
|
||||
logger = logging.getLogger("BitBake.Cache")
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
logger.info("Importing cPickle failed. "
|
||||
"Falling back to a very slow implementation.")
|
||||
|
||||
|
||||
# mtime cache (non-persistent)
|
||||
# based upon the assumption that files do not change during bitbake run
|
||||
class FileMtimeCache(object):
|
||||
cache = {}
|
||||
|
||||
def cached_mtime(self, f):
|
||||
if f not in self.cache:
|
||||
self.cache[f] = os.stat(f)[stat.ST_MTIME]
|
||||
return self.cache[f]
|
||||
|
||||
def cached_mtime_noerror(self, f):
|
||||
if f not in self.cache:
|
||||
try:
|
||||
self.cache[f] = os.stat(f)[stat.ST_MTIME]
|
||||
except OSError:
|
||||
return 0
|
||||
return self.cache[f]
|
||||
|
||||
def update_mtime(self, f):
|
||||
self.cache[f] = os.stat(f)[stat.ST_MTIME]
|
||||
return self.cache[f]
|
||||
|
||||
def clear(self):
|
||||
self.cache.clear()
|
||||
|
||||
# Checksum + mtime cache (persistent)
|
||||
class FileChecksumCache(MultiProcessCache):
|
||||
cache_file_name = "local_file_checksum_cache.dat"
|
||||
CACHE_VERSION = 1
|
||||
|
||||
def __init__(self):
|
||||
self.mtime_cache = FileMtimeCache()
|
||||
MultiProcessCache.__init__(self)
|
||||
|
||||
def get_checksum(self, f):
|
||||
entry = self.cachedata[0].get(f)
|
||||
cmtime = self.mtime_cache.cached_mtime(f)
|
||||
if entry:
|
||||
(mtime, hashval) = entry
|
||||
if cmtime == mtime:
|
||||
return hashval
|
||||
else:
|
||||
bb.debug(2, "file %s changed mtime, recompute checksum" % f)
|
||||
|
||||
hashval = bb.utils.md5_file(f)
|
||||
self.cachedata_extras[0][f] = (cmtime, hashval)
|
||||
return hashval
|
||||
|
||||
def merge_data(self, source, dest):
|
||||
for h in source[0]:
|
||||
if h in dest:
|
||||
(smtime, _) = source[0][h]
|
||||
(dmtime, _) = dest[0][h]
|
||||
if smtime > dmtime:
|
||||
dest[0][h] = source[0][h]
|
||||
else:
|
||||
dest[0][h] = source[0][h]
|
||||
@@ -5,10 +5,10 @@ import os.path
|
||||
import bb.utils, bb.data
|
||||
from itertools import chain
|
||||
from pysh import pyshyacc, pyshlex, sherrors
|
||||
from bb.cache import MultiProcessCache
|
||||
|
||||
|
||||
logger = logging.getLogger('BitBake.CodeParser')
|
||||
PARSERCACHE_VERSION = 2
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
@@ -21,177 +21,197 @@ def check_indent(codestr):
|
||||
"""If the code is indented, add a top level piece of code to 'remove' the indentation"""
|
||||
|
||||
i = 0
|
||||
while codestr[i] in ["\n", "\t", " "]:
|
||||
while codestr[i] in ["\n", " ", " "]:
|
||||
i = i + 1
|
||||
|
||||
if i == 0:
|
||||
return codestr
|
||||
|
||||
if codestr[i-1] == "\t" or codestr[i-1] == " ":
|
||||
if codestr[i-1] is " " or codestr[i-1] is " ":
|
||||
return "if 1:\n" + codestr
|
||||
|
||||
return codestr
|
||||
|
||||
pythonparsecache = {}
|
||||
shellparsecache = {}
|
||||
|
||||
class CodeParserCache(MultiProcessCache):
|
||||
cache_file_name = "bb_codeparser.dat"
|
||||
CACHE_VERSION = 3
|
||||
|
||||
def __init__(self):
|
||||
MultiProcessCache.__init__(self)
|
||||
self.pythoncache = self.cachedata[0]
|
||||
self.shellcache = self.cachedata[1]
|
||||
self.pythoncacheextras = self.cachedata_extras[0]
|
||||
self.shellcacheextras = self.cachedata_extras[1]
|
||||
|
||||
def init_cache(self, d):
|
||||
MultiProcessCache.init_cache(self, d)
|
||||
|
||||
# cachedata gets re-assigned in the parent
|
||||
self.pythoncache = self.cachedata[0]
|
||||
self.shellcache = self.cachedata[1]
|
||||
|
||||
def compress_keys(self, data):
|
||||
# When the dicts are originally created, python calls intern() on the set keys
|
||||
# which significantly improves memory usage. Sadly the pickle/unpickle process
|
||||
# doesn't call intern() on the keys and results in the same strings being duplicated
|
||||
# in memory. This also means pickle will save the same string multiple times in
|
||||
# the cache file. By interning the data here, the cache file shrinks dramatically
|
||||
# meaning faster load times and the reloaded cache files also consume much less
|
||||
# memory. This is worth any performance hit from this loops and the use of the
|
||||
# intern() data storage.
|
||||
# Python 3.x may behave better in this area
|
||||
for h in data[0]:
|
||||
data[0][h]["refs"] = self.internSet(data[0][h]["refs"])
|
||||
data[0][h]["execs"] = self.internSet(data[0][h]["execs"])
|
||||
for h in data[1]:
|
||||
data[1][h]["execs"] = self.internSet(data[1][h]["execs"])
|
||||
return
|
||||
|
||||
def create_cachedata(self):
|
||||
data = [{}, {}]
|
||||
return data
|
||||
|
||||
codeparsercache = CodeParserCache()
|
||||
def parser_cachefile(d):
|
||||
cachedir = (bb.data.getVar("PERSISTENT_DIR", d, True) or
|
||||
bb.data.getVar("CACHE", d, True))
|
||||
if cachedir in [None, '']:
|
||||
return None
|
||||
bb.utils.mkdirhier(cachedir)
|
||||
cachefile = os.path.join(cachedir, "bb_codeparser.dat")
|
||||
logger.debug(1, "Using cache in '%s' for codeparser cache", cachefile)
|
||||
return cachefile
|
||||
|
||||
def parser_cache_init(d):
|
||||
codeparsercache.init_cache(d)
|
||||
global pythonparsecache
|
||||
global shellparsecache
|
||||
|
||||
cachefile = parser_cachefile(d)
|
||||
if not cachefile:
|
||||
return
|
||||
|
||||
try:
|
||||
p = pickle.Unpickler(file(cachefile, "rb"))
|
||||
data, version = p.load()
|
||||
except:
|
||||
return
|
||||
|
||||
if version != PARSERCACHE_VERSION:
|
||||
return
|
||||
|
||||
pythonparsecache = data[0]
|
||||
shellparsecache = data[1]
|
||||
|
||||
def parser_cache_save(d):
|
||||
codeparsercache.save_extras(d)
|
||||
cachefile = parser_cachefile(d)
|
||||
if not cachefile:
|
||||
return
|
||||
|
||||
def parser_cache_savemerge(d):
|
||||
codeparsercache.save_merge(d)
|
||||
|
||||
Logger = logging.getLoggerClass()
|
||||
class BufferedLogger(Logger):
|
||||
def __init__(self, name, level=0, target=None):
|
||||
Logger.__init__(self, name)
|
||||
self.setLevel(level)
|
||||
self.buffer = []
|
||||
self.target = target
|
||||
|
||||
def handle(self, record):
|
||||
self.buffer.append(record)
|
||||
|
||||
def flush(self):
|
||||
for record in self.buffer:
|
||||
self.target.handle(record)
|
||||
self.buffer = []
|
||||
p = pickle.Pickler(file(cachefile, "wb"), -1)
|
||||
p.dump([[pythonparsecache, shellparsecache], PARSERCACHE_VERSION])
|
||||
|
||||
class PythonParser():
|
||||
getvars = ("d.getVar", "bb.data.getVar", "data.getVar", "d.appendVar", "d.prependVar")
|
||||
containsfuncs = ("bb.utils.contains", "base_contains", "oe.utils.contains")
|
||||
execfuncs = ("bb.build.exec_func", "bb.build.exec_task")
|
||||
|
||||
def warn(self, func, arg):
|
||||
"""Warn about calls of bitbake APIs which pass a non-literal
|
||||
argument for the variable name, as we're not able to track such
|
||||
a reference.
|
||||
class ValueVisitor():
|
||||
"""Visitor to traverse a python abstract syntax tree and obtain
|
||||
the variables referenced via bitbake metadata APIs, and the external
|
||||
functions called.
|
||||
"""
|
||||
|
||||
try:
|
||||
funcstr = codegen.to_source(func)
|
||||
argstr = codegen.to_source(arg)
|
||||
except TypeError:
|
||||
self.log.debug(2, 'Failed to convert function and argument to source form')
|
||||
else:
|
||||
self.log.debug(1, self.unhandled_message % (funcstr, argstr))
|
||||
getvars = ("d.getVar", "bb.data.getVar", "data.getVar")
|
||||
expands = ("d.expand", "bb.data.expand", "data.expand")
|
||||
execs = ("bb.build.exec_func", "bb.build.exec_task")
|
||||
|
||||
def visit_Call(self, node):
|
||||
name = self.called_node_name(node.func)
|
||||
if name in self.getvars or name in self.containsfuncs:
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.var_references.add(node.args[0].s)
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif name in self.execfuncs:
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.var_execs.add(node.args[0].s)
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif name and isinstance(node.func, (ast.Name, ast.Attribute)):
|
||||
self.execs.add(name)
|
||||
@classmethod
|
||||
def _compare_name(cls, strparts, node):
|
||||
"""Given a sequence of strings representing a python name,
|
||||
where the last component is the actual Name and the prior
|
||||
elements are Attribute nodes, determine if the supplied node
|
||||
matches.
|
||||
"""
|
||||
|
||||
def called_node_name(self, node):
|
||||
"""Given a called node, return its original string form"""
|
||||
components = []
|
||||
while node:
|
||||
if not strparts:
|
||||
return True
|
||||
|
||||
current, rest = strparts[0], strparts[1:]
|
||||
if isinstance(node, ast.Attribute):
|
||||
components.append(node.attr)
|
||||
node = node.value
|
||||
if current == node.attr:
|
||||
return cls._compare_name(rest, node.value)
|
||||
elif isinstance(node, ast.Name):
|
||||
components.append(node.id)
|
||||
return '.'.join(reversed(components))
|
||||
if current == node.id:
|
||||
return True
|
||||
return False
|
||||
|
||||
@classmethod
|
||||
def compare_name(cls, value, node):
|
||||
"""Convenience function for the _compare_node method, which
|
||||
can accept a string (which is split by '.' for you), or an
|
||||
iterable of strings, in which case it checks to see if any of
|
||||
them match, similar to isinstance.
|
||||
"""
|
||||
|
||||
if isinstance(value, basestring):
|
||||
return cls._compare_name(tuple(reversed(value.split("."))),
|
||||
node)
|
||||
else:
|
||||
break
|
||||
return any(cls.compare_name(item, node) for item in value)
|
||||
|
||||
def __init__(self, name, log):
|
||||
self.var_references = set()
|
||||
self.var_execs = set()
|
||||
def __init__(self, value):
|
||||
self.var_references = set()
|
||||
self.var_execs = set()
|
||||
self.direct_func_calls = set()
|
||||
self.var_expands = set()
|
||||
self.value = value
|
||||
|
||||
@classmethod
|
||||
def warn(cls, func, arg):
|
||||
"""Warn about calls of bitbake APIs which pass a non-literal
|
||||
argument for the variable name, as we're not able to track such
|
||||
a reference.
|
||||
"""
|
||||
|
||||
try:
|
||||
funcstr = codegen.to_source(func)
|
||||
argstr = codegen.to_source(arg)
|
||||
except TypeError:
|
||||
logger.debug(2, 'Failed to convert function and argument to source form')
|
||||
else:
|
||||
logger.debug(1, "Warning: in call to '%s', argument '%s' is "
|
||||
"not a literal", funcstr, argstr)
|
||||
|
||||
def visit_Call(self, node):
|
||||
if self.compare_name(self.getvars, node.func):
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.var_references.add(node.args[0].s)
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif self.compare_name(self.expands, node.func):
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.warn(node.func, node.args[0])
|
||||
self.var_expands.update(node.args[0].s)
|
||||
elif isinstance(node.args[0], ast.Call) and \
|
||||
self.compare_name(self.getvars, node.args[0].func):
|
||||
pass
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif self.compare_name(self.execs, node.func):
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.var_execs.add(node.args[0].s)
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif isinstance(node.func, ast.Name):
|
||||
self.direct_func_calls.add(node.func.id)
|
||||
elif isinstance(node.func, ast.Attribute):
|
||||
# We must have a qualified name. Therefore we need
|
||||
# to walk the chain of 'Attribute' nodes to determine
|
||||
# the qualification.
|
||||
attr_node = node.func.value
|
||||
identifier = node.func.attr
|
||||
while isinstance(attr_node, ast.Attribute):
|
||||
identifier = attr_node.attr + "." + identifier
|
||||
attr_node = attr_node.value
|
||||
if isinstance(attr_node, ast.Name):
|
||||
identifier = attr_node.id + "." + identifier
|
||||
self.direct_func_calls.add(identifier)
|
||||
|
||||
def __init__(self):
|
||||
#self.funcdefs = set()
|
||||
self.execs = set()
|
||||
#self.external_cmds = set()
|
||||
self.references = set()
|
||||
self.log = BufferedLogger('BitBake.Data.%s' % name, logging.DEBUG, log)
|
||||
|
||||
self.unhandled_message = "in call of %s, argument '%s' is not a string literal"
|
||||
self.unhandled_message = "while parsing %s, %s" % (name, self.unhandled_message)
|
||||
|
||||
def parse_python(self, node):
|
||||
|
||||
h = hash(str(node))
|
||||
|
||||
if h in codeparsercache.pythoncache:
|
||||
self.references = codeparsercache.pythoncache[h]["refs"]
|
||||
self.execs = codeparsercache.pythoncache[h]["execs"]
|
||||
if h in pythonparsecache:
|
||||
self.references = pythonparsecache[h]["refs"]
|
||||
self.execs = pythonparsecache[h]["execs"]
|
||||
return
|
||||
|
||||
if h in codeparsercache.pythoncacheextras:
|
||||
self.references = codeparsercache.pythoncacheextras[h]["refs"]
|
||||
self.execs = codeparsercache.pythoncacheextras[h]["execs"]
|
||||
return
|
||||
|
||||
|
||||
code = compile(check_indent(str(node)), "<string>", "exec",
|
||||
ast.PyCF_ONLY_AST)
|
||||
|
||||
visitor = self.ValueVisitor(code)
|
||||
for n in ast.walk(code):
|
||||
if n.__class__.__name__ == "Call":
|
||||
self.visit_Call(n)
|
||||
visitor.visit_Call(n)
|
||||
|
||||
self.references.update(self.var_references)
|
||||
self.references.update(self.var_execs)
|
||||
self.references.update(visitor.var_references)
|
||||
self.references.update(visitor.var_execs)
|
||||
self.execs = visitor.direct_func_calls
|
||||
|
||||
codeparsercache.pythoncacheextras[h] = {}
|
||||
codeparsercache.pythoncacheextras[h]["refs"] = self.references
|
||||
codeparsercache.pythoncacheextras[h]["execs"] = self.execs
|
||||
pythonparsecache[h] = {}
|
||||
pythonparsecache[h]["refs"] = self.references
|
||||
pythonparsecache[h]["execs"] = self.execs
|
||||
|
||||
class ShellParser():
|
||||
def __init__(self, name, log):
|
||||
def __init__(self):
|
||||
self.funcdefs = set()
|
||||
self.allexecs = set()
|
||||
self.execs = set()
|
||||
self.log = BufferedLogger('BitBake.Data.%s' % name, logging.DEBUG, log)
|
||||
self.unhandled_template = "unable to handle non-literal command '%s'"
|
||||
self.unhandled_template = "while parsing %s, %s" % (name, self.unhandled_template)
|
||||
|
||||
def parse_shell(self, value):
|
||||
"""Parse the supplied shell code in a string, returning the external
|
||||
@@ -200,12 +220,8 @@ class ShellParser():
|
||||
|
||||
h = hash(str(value))
|
||||
|
||||
if h in codeparsercache.shellcache:
|
||||
self.execs = codeparsercache.shellcache[h]["execs"]
|
||||
return self.execs
|
||||
|
||||
if h in codeparsercache.shellcacheextras:
|
||||
self.execs = codeparsercache.shellcacheextras[h]["execs"]
|
||||
if h in shellparsecache:
|
||||
self.execs = shellparsecache[h]["execs"]
|
||||
return self.execs
|
||||
|
||||
try:
|
||||
@@ -217,8 +233,8 @@ class ShellParser():
|
||||
self.process_tokens(token)
|
||||
self.execs = set(cmd for cmd in self.allexecs if cmd not in self.funcdefs)
|
||||
|
||||
codeparsercache.shellcacheextras[h] = {}
|
||||
codeparsercache.shellcacheextras[h]["execs"] = self.execs
|
||||
shellparsecache[h] = {}
|
||||
shellparsecache[h]["execs"] = self.execs
|
||||
|
||||
return self.execs
|
||||
|
||||
@@ -310,7 +326,8 @@ class ShellParser():
|
||||
|
||||
cmd = word[1]
|
||||
if cmd.startswith("$"):
|
||||
self.log.debug(1, self.unhandled_template % cmd)
|
||||
logger.debug(1, "Warning: execution of non-literal "
|
||||
"command '%s'", cmd)
|
||||
elif cmd == "eval":
|
||||
command = " ".join(word for _, word in words[1:])
|
||||
self.parse_shell(command)
|
||||
|
||||
@@ -30,6 +30,11 @@ Commands are queued in a CommandQueue
|
||||
|
||||
import bb.event
|
||||
import bb.cooker
|
||||
import bb.data
|
||||
|
||||
async_cmds = {}
|
||||
sync_cmds = {}
|
||||
|
||||
|
||||
class CommandCompleted(bb.event.Event):
|
||||
pass
|
||||
@@ -44,9 +49,6 @@ class CommandFailed(CommandExit):
|
||||
self.error = message
|
||||
CommandExit.__init__(self, 1)
|
||||
|
||||
class CommandError(Exception):
|
||||
pass
|
||||
|
||||
class Command:
|
||||
"""
|
||||
A queue of asynchronous commands for bitbake
|
||||
@@ -59,30 +61,32 @@ class Command:
|
||||
# FIXME Add lock for this
|
||||
self.currentAsyncCommand = None
|
||||
|
||||
def runCommand(self, commandline, ro_only = False):
|
||||
command = commandline.pop(0)
|
||||
if hasattr(CommandsSync, command):
|
||||
# Can run synchronous commands straight away
|
||||
command_method = getattr(self.cmds_sync, command)
|
||||
if ro_only:
|
||||
if not hasattr(command_method, 'readonly') or False == getattr(command_method, 'readonly'):
|
||||
return None, "Not able to execute not readonly commands in readonly mode"
|
||||
try:
|
||||
result = command_method(self, commandline)
|
||||
except CommandError as exc:
|
||||
return None, exc.args[0]
|
||||
except Exception:
|
||||
import traceback
|
||||
return None, traceback.format_exc()
|
||||
else:
|
||||
return result, None
|
||||
if self.currentAsyncCommand is not None:
|
||||
return None, "Busy (%s in progress)" % self.currentAsyncCommand[0]
|
||||
if command not in CommandsAsync.__dict__:
|
||||
return None, "No such command"
|
||||
self.currentAsyncCommand = (command, commandline)
|
||||
self.cooker.configuration.server_register_idlecallback(self.cooker.runCommands, self.cooker)
|
||||
return True, None
|
||||
for attr in CommandsSync.__dict__:
|
||||
command = attr[:].lower()
|
||||
method = getattr(CommandsSync, attr)
|
||||
sync_cmds[command] = (method)
|
||||
|
||||
for attr in CommandsAsync.__dict__:
|
||||
command = attr[:].lower()
|
||||
method = getattr(CommandsAsync, attr)
|
||||
async_cmds[command] = (method)
|
||||
|
||||
def runCommand(self, commandline):
|
||||
try:
|
||||
command = commandline.pop(0)
|
||||
if command in CommandsSync.__dict__:
|
||||
# Can run synchronous commands straight away
|
||||
return getattr(CommandsSync, command)(self.cmds_sync, self, commandline)
|
||||
if self.currentAsyncCommand is not None:
|
||||
return "Busy (%s in progress)" % self.currentAsyncCommand[0]
|
||||
if command not in CommandsAsync.__dict__:
|
||||
return "No such command"
|
||||
self.currentAsyncCommand = (command, commandline)
|
||||
self.cooker.server.register_idle_function(self.cooker.runCommands, self.cooker)
|
||||
return True
|
||||
except:
|
||||
import traceback
|
||||
return traceback.format_exc()
|
||||
|
||||
def runAsyncCommand(self):
|
||||
try:
|
||||
@@ -90,7 +94,8 @@ class Command:
|
||||
(command, options) = self.currentAsyncCommand
|
||||
commandmethod = getattr(CommandsAsync, command)
|
||||
needcache = getattr( commandmethod, "needcache" )
|
||||
if needcache and self.cooker.state != bb.cooker.state.running:
|
||||
if (needcache and self.cooker.state in
|
||||
(bb.cooker.state.initial, bb.cooker.state.parsing)):
|
||||
self.cooker.updateCache()
|
||||
return True
|
||||
else:
|
||||
@@ -108,21 +113,18 @@ class Command:
|
||||
else:
|
||||
self.finishAsyncCommand("Exited with %s" % arg)
|
||||
return False
|
||||
except Exception as exc:
|
||||
except Exception:
|
||||
import traceback
|
||||
if isinstance(exc, bb.BBHandledException):
|
||||
self.finishAsyncCommand("")
|
||||
else:
|
||||
self.finishAsyncCommand(traceback.format_exc())
|
||||
self.finishAsyncCommand(traceback.format_exc())
|
||||
return False
|
||||
|
||||
def finishAsyncCommand(self, msg=None, code=None):
|
||||
if msg:
|
||||
bb.event.fire(CommandFailed(msg), self.cooker.event_data)
|
||||
bb.event.fire(CommandFailed(msg), self.cooker.configuration.event_data)
|
||||
elif code:
|
||||
bb.event.fire(CommandExit(code), self.cooker.event_data)
|
||||
bb.event.fire(CommandExit(code), self.cooker.configuration.event_data)
|
||||
else:
|
||||
bb.event.fire(CommandCompleted(), self.cooker.event_data)
|
||||
bb.event.fire(CommandCompleted(), self.cooker.configuration.event_data)
|
||||
self.currentAsyncCommand = None
|
||||
|
||||
|
||||
@@ -145,106 +147,31 @@ class CommandsSync:
|
||||
"""
|
||||
command.cooker.stop()
|
||||
|
||||
def getCmdLineAction(self, command, params):
|
||||
"""
|
||||
Get any command parsed from the commandline
|
||||
"""
|
||||
return command.cooker.commandlineAction
|
||||
|
||||
def getVariable(self, command, params):
|
||||
"""
|
||||
Read the value of a variable from data
|
||||
Read the value of a variable from configuration.data
|
||||
"""
|
||||
varname = params[0]
|
||||
expand = True
|
||||
if len(params) > 1:
|
||||
expand = (params[1] == "True")
|
||||
expand = params[1]
|
||||
|
||||
return command.cooker.data.getVar(varname, expand)
|
||||
getVariable.readonly = True
|
||||
return bb.data.getVar(varname, command.cooker.configuration.data, expand)
|
||||
|
||||
def setVariable(self, command, params):
|
||||
"""
|
||||
Set the value of variable in data
|
||||
Set the value of variable in configuration.data
|
||||
"""
|
||||
varname = params[0]
|
||||
value = str(params[1])
|
||||
command.cooker.data.setVar(varname, value)
|
||||
value = params[1]
|
||||
bb.data.setVar(varname, value, command.cooker.configuration.data)
|
||||
|
||||
def setConfig(self, command, params):
|
||||
"""
|
||||
Set the value of variable in configuration
|
||||
"""
|
||||
varname = params[0]
|
||||
value = str(params[1])
|
||||
setattr(command.cooker.configuration, varname, value)
|
||||
|
||||
def enableDataTracking(self, command, params):
|
||||
"""
|
||||
Enable history tracking for variables
|
||||
"""
|
||||
command.cooker.enableDataTracking()
|
||||
|
||||
def disableDataTracking(self, command, params):
|
||||
"""
|
||||
Disable history tracking for variables
|
||||
"""
|
||||
command.cooker.disableDataTracking()
|
||||
|
||||
def initCooker(self, command, params):
|
||||
"""
|
||||
Init the cooker to initial state with nothing parsed
|
||||
"""
|
||||
command.cooker.initialize()
|
||||
|
||||
def resetCooker(self, command, params):
|
||||
"""
|
||||
Reset the cooker to its initial state, thus forcing a reparse for
|
||||
any async command that has the needcache property set to True
|
||||
"""
|
||||
command.cooker.reset()
|
||||
|
||||
def getCpuCount(self, command, params):
|
||||
"""
|
||||
Get the CPU count on the bitbake server
|
||||
"""
|
||||
return bb.utils.cpu_count()
|
||||
getCpuCount.readonly = True
|
||||
|
||||
def matchFile(self, command, params):
|
||||
fMatch = params[0]
|
||||
return command.cooker.matchFile(fMatch)
|
||||
|
||||
def generateNewImage(self, command, params):
|
||||
image = params[0]
|
||||
base_image = params[1]
|
||||
package_queue = params[2]
|
||||
timestamp = params[3]
|
||||
description = params[4]
|
||||
return command.cooker.generateNewImage(image, base_image,
|
||||
package_queue, timestamp, description)
|
||||
|
||||
def ensureDir(self, command, params):
|
||||
directory = params[0]
|
||||
bb.utils.mkdirhier(directory)
|
||||
|
||||
def setVarFile(self, command, params):
|
||||
"""
|
||||
Save a variable in a file; used for saving in a configuration file
|
||||
"""
|
||||
var = params[0]
|
||||
val = params[1]
|
||||
default_file = params[2]
|
||||
op = params[3]
|
||||
command.cooker.modifyConfigurationVar(var, val, default_file, op)
|
||||
|
||||
def createConfigFile(self, command, params):
|
||||
"""
|
||||
Create an extra configuration file
|
||||
"""
|
||||
name = params[0]
|
||||
command.cooker.createConfigFile(name)
|
||||
|
||||
def setEventMask(self, command, params):
|
||||
handlerNum = params[0]
|
||||
llevel = params[1]
|
||||
debug_domains = params[2]
|
||||
mask = params[3]
|
||||
return bb.event.set_UIHmask(handlerNum, llevel, debug_domains, mask)
|
||||
|
||||
class CommandsAsync:
|
||||
"""
|
||||
@@ -297,30 +224,14 @@ class CommandsAsync:
|
||||
|
||||
def generateTargetsTree(self, command, params):
|
||||
"""
|
||||
Generate a tree of buildable targets.
|
||||
If klass is provided ensure all recipes that inherit the class are
|
||||
included in the package list.
|
||||
If pkg_list provided use that list (plus any extras brought in by
|
||||
klass) rather than generating a tree for all packages.
|
||||
Generate a tree of all buildable targets.
|
||||
"""
|
||||
klass = params[0]
|
||||
pkg_list = params[1]
|
||||
|
||||
command.cooker.generateTargetsTree(klass, pkg_list)
|
||||
command.cooker.generateTargetsTree(klass)
|
||||
command.finishAsyncCommand()
|
||||
generateTargetsTree.needcache = True
|
||||
|
||||
def findCoreBaseFiles(self, command, params):
|
||||
"""
|
||||
Find certain files in COREBASE directory. i.e. Layers
|
||||
"""
|
||||
subdir = params[0]
|
||||
filename = params[1]
|
||||
|
||||
command.cooker.findCoreBaseFiles(subdir, filename)
|
||||
command.finishAsyncCommand()
|
||||
findCoreBaseFiles.needcache = False
|
||||
|
||||
def findConfigFiles(self, command, params):
|
||||
"""
|
||||
Find config files which provide appropriate values
|
||||
@@ -330,29 +241,7 @@ class CommandsAsync:
|
||||
|
||||
command.cooker.findConfigFiles(varname)
|
||||
command.finishAsyncCommand()
|
||||
findConfigFiles.needcache = False
|
||||
|
||||
def findFilesMatchingInDir(self, command, params):
|
||||
"""
|
||||
Find implementation files matching the specified pattern
|
||||
in the requested subdirectory of a BBPATH
|
||||
"""
|
||||
pattern = params[0]
|
||||
directory = params[1]
|
||||
|
||||
command.cooker.findFilesMatchingInDir(pattern, directory)
|
||||
command.finishAsyncCommand()
|
||||
findFilesMatchingInDir.needcache = False
|
||||
|
||||
def findConfigFilePath(self, command, params):
|
||||
"""
|
||||
Find the path of the requested configuration file
|
||||
"""
|
||||
configfile = params[0]
|
||||
|
||||
command.cooker.findConfigFilePath(configfile)
|
||||
command.finishAsyncCommand()
|
||||
findConfigFilePath.needcache = False
|
||||
findConfigFiles.needcache = True
|
||||
|
||||
def showVersions(self, command, params):
|
||||
"""
|
||||
@@ -396,30 +285,8 @@ class CommandsAsync:
|
||||
"""
|
||||
Parse the .bb files
|
||||
"""
|
||||
if bb.fetch.fetcher_compare_revisions(command.cooker.data):
|
||||
if bb.fetch.fetcher_compare_revisions(command.cooker.configuration.data):
|
||||
command.finishAsyncCommand(code=1)
|
||||
else:
|
||||
command.finishAsyncCommand()
|
||||
compareRevisions.needcache = True
|
||||
|
||||
def parseConfigurationFiles(self, command, params):
|
||||
"""
|
||||
Parse the configuration files
|
||||
"""
|
||||
prefiles = params[0].split()
|
||||
postfiles = params[1].split()
|
||||
command.cooker.configuration.prefile = prefiles
|
||||
command.cooker.configuration.postfile = postfiles
|
||||
command.cooker.loadConfigurationData()
|
||||
command.finishAsyncCommand()
|
||||
parseConfigurationFiles.needcache = False
|
||||
|
||||
def triggerEvent(self, command, params):
|
||||
"""
|
||||
Trigger a certain event
|
||||
"""
|
||||
event = params[0]
|
||||
bb.event.fire(eval(event), command.cooker.data)
|
||||
command.currentAsyncCommand = None
|
||||
triggerEvent.needcache = False
|
||||
|
||||
|
||||
@@ -1,6 +0,0 @@
|
||||
"""Code pulled from future python versions, here for compatibility"""
|
||||
|
||||
from collections import MutableMapping, KeysView, ValuesView, ItemsView, OrderedDict
|
||||
from functools import total_ordering
|
||||
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,305 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
# Copyright (C) 2003, 2004 Phil Blundell
|
||||
# Copyright (C) 2003 - 2005 Michael 'Mickey' Lauer
|
||||
# Copyright (C) 2005 Holger Hans Peter Freyther
|
||||
# Copyright (C) 2005 ROAD GmbH
|
||||
# Copyright (C) 2006 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os, sys
|
||||
from functools import wraps
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
import bb.parse
|
||||
|
||||
logger = logging.getLogger("BitBake")
|
||||
parselog = logging.getLogger("BitBake.Parsing")
|
||||
|
||||
class ConfigParameters(object):
|
||||
def __init__(self):
|
||||
self.options, targets = self.parseCommandLine()
|
||||
self.environment = self.parseEnvironment()
|
||||
|
||||
self.options.pkgs_to_build = targets or []
|
||||
|
||||
self.options.tracking = False
|
||||
if hasattr(self.options, "show_environment") and self.options.show_environment:
|
||||
self.options.tracking = True
|
||||
|
||||
for key, val in self.options.__dict__.items():
|
||||
setattr(self, key, val)
|
||||
|
||||
def parseCommandLine(self):
|
||||
raise Exception("Caller must implement commandline option parsing")
|
||||
|
||||
def parseEnvironment(self):
|
||||
return os.environ.copy()
|
||||
|
||||
def updateFromServer(self, server):
|
||||
if not self.options.cmd:
|
||||
defaulttask, error = server.runCommand(["getVariable", "BB_DEFAULT_TASK"])
|
||||
if error:
|
||||
raise Exception("Unable to get the value of BB_DEFAULT_TASK from the server: %s" % error)
|
||||
self.options.cmd = defaulttask or "build"
|
||||
_, error = server.runCommand(["setConfig", "cmd", self.options.cmd])
|
||||
if error:
|
||||
raise Exception("Unable to set configuration option 'cmd' on the server: %s" % error)
|
||||
|
||||
if not self.options.pkgs_to_build:
|
||||
bbpkgs, error = server.runCommand(["getVariable", "BBPKGS"])
|
||||
if error:
|
||||
raise Exception("Unable to get the value of BBPKGS from the server: %s" % error)
|
||||
if bbpkgs:
|
||||
self.options.pkgs_to_build.extend(bbpkgs.split())
|
||||
|
||||
def parseActions(self):
|
||||
# Parse any commandline into actions
|
||||
action = {'action':None, 'msg':None}
|
||||
if self.options.show_environment:
|
||||
if 'world' in self.options.pkgs_to_build:
|
||||
action['msg'] = "'world' is not a valid target for --environment."
|
||||
elif 'universe' in self.options.pkgs_to_build:
|
||||
action['msg'] = "'universe' is not a valid target for --environment."
|
||||
elif len(self.options.pkgs_to_build) > 1:
|
||||
action['msg'] = "Only one target can be used with the --environment option."
|
||||
elif self.options.buildfile and len(self.options.pkgs_to_build) > 0:
|
||||
action['msg'] = "No target should be used with the --environment and --buildfile options."
|
||||
elif len(self.options.pkgs_to_build) > 0:
|
||||
action['action'] = ["showEnvironmentTarget", self.options.pkgs_to_build]
|
||||
else:
|
||||
action['action'] = ["showEnvironment", self.options.buildfile]
|
||||
elif self.options.buildfile is not None:
|
||||
action['action'] = ["buildFile", self.options.buildfile, self.options.cmd]
|
||||
elif self.options.revisions_changed:
|
||||
action['action'] = ["compareRevisions"]
|
||||
elif self.options.show_versions:
|
||||
action['action'] = ["showVersions"]
|
||||
elif self.options.parse_only:
|
||||
action['action'] = ["parseFiles"]
|
||||
elif self.options.dot_graph:
|
||||
if self.options.pkgs_to_build:
|
||||
action['action'] = ["generateDotGraph", self.options.pkgs_to_build, self.options.cmd]
|
||||
else:
|
||||
action['msg'] = "Please specify a package name for dependency graph generation."
|
||||
else:
|
||||
if self.options.pkgs_to_build:
|
||||
action['action'] = ["buildTargets", self.options.pkgs_to_build, self.options.cmd]
|
||||
else:
|
||||
#action['msg'] = "Nothing to do. Use 'bitbake world' to build everything, or run 'bitbake --help' for usage information."
|
||||
action = None
|
||||
self.options.initialaction = action
|
||||
return action
|
||||
|
||||
class CookerConfiguration(object):
|
||||
"""
|
||||
Manages build options and configurations for one run
|
||||
"""
|
||||
|
||||
def __init__(self):
|
||||
self.debug_domains = []
|
||||
self.extra_assume_provided = []
|
||||
self.prefile = []
|
||||
self.postfile = []
|
||||
self.debug = 0
|
||||
self.cmd = None
|
||||
self.abort = True
|
||||
self.force = False
|
||||
self.profile = False
|
||||
self.nosetscene = False
|
||||
self.invalidate_stamp = False
|
||||
self.dump_signatures = False
|
||||
self.dry_run = False
|
||||
self.tracking = False
|
||||
self.extra_caches = []
|
||||
|
||||
self.env = {}
|
||||
|
||||
def setConfigParameters(self, parameters):
|
||||
for key in self.__dict__.keys():
|
||||
if key in parameters.options.__dict__:
|
||||
setattr(self, key, parameters.options.__dict__[key])
|
||||
self.env = parameters.environment.copy()
|
||||
self.tracking = parameters.tracking
|
||||
|
||||
def setServerRegIdleCallback(self, srcb):
|
||||
self.server_register_idlecallback = srcb
|
||||
|
||||
def __getstate__(self):
|
||||
state = {}
|
||||
for key in self.__dict__.keys():
|
||||
if key == "server_register_idlecallback":
|
||||
state[key] = None
|
||||
else:
|
||||
state[key] = getattr(self, key)
|
||||
return state
|
||||
|
||||
def __setstate__(self,state):
|
||||
for k in state:
|
||||
setattr(self, k, state[k])
|
||||
|
||||
|
||||
def catch_parse_error(func):
|
||||
"""Exception handling bits for our parsing"""
|
||||
@wraps(func)
|
||||
def wrapped(fn, *args):
|
||||
try:
|
||||
return func(fn, *args)
|
||||
except (IOError, bb.parse.ParseError, bb.data_smart.ExpansionError) as exc:
|
||||
import traceback
|
||||
parselog.critical( traceback.format_exc())
|
||||
parselog.critical("Unable to parse %s: %s" % (fn, exc))
|
||||
sys.exit(1)
|
||||
return wrapped
|
||||
|
||||
@catch_parse_error
|
||||
def parse_config_file(fn, data, include=True):
|
||||
return bb.parse.handle(fn, data, include)
|
||||
|
||||
@catch_parse_error
|
||||
def _inherit(bbclass, data):
|
||||
bb.parse.BBHandler.inherit(bbclass, "configuration INHERITs", 0, data)
|
||||
return data
|
||||
|
||||
def findConfigFile(configfile, data):
|
||||
search = []
|
||||
bbpath = data.getVar("BBPATH", True)
|
||||
if bbpath:
|
||||
for i in bbpath.split(":"):
|
||||
search.append(os.path.join(i, "conf", configfile))
|
||||
path = os.getcwd()
|
||||
while path != "/":
|
||||
search.append(os.path.join(path, "conf", configfile))
|
||||
path, _ = os.path.split(path)
|
||||
|
||||
for i in search:
|
||||
if os.path.exists(i):
|
||||
return i
|
||||
|
||||
return None
|
||||
|
||||
class CookerDataBuilder(object):
|
||||
|
||||
def __init__(self, cookercfg, worker = False):
|
||||
|
||||
self.prefiles = cookercfg.prefile
|
||||
self.postfiles = cookercfg.postfile
|
||||
self.tracking = cookercfg.tracking
|
||||
|
||||
bb.utils.set_context(bb.utils.clean_context())
|
||||
bb.event.set_class_handlers(bb.event.clean_class_handlers())
|
||||
self.data = bb.data.init()
|
||||
if self.tracking:
|
||||
self.data.enableTracking()
|
||||
|
||||
# Keep a datastore of the initial environment variables and their
|
||||
# values from when BitBake was launched to enable child processes
|
||||
# to use environment variables which have been cleaned from the
|
||||
# BitBake processes env
|
||||
self.savedenv = bb.data.init()
|
||||
for k in cookercfg.env:
|
||||
self.savedenv.setVar(k, cookercfg.env[k])
|
||||
|
||||
filtered_keys = bb.utils.approved_variables()
|
||||
bb.data.inheritFromOS(self.data, self.savedenv, filtered_keys)
|
||||
self.data.setVar("BB_ORIGENV", self.savedenv)
|
||||
|
||||
if worker:
|
||||
self.data.setVar("BB_WORKERCONTEXT", "1")
|
||||
|
||||
def parseBaseConfiguration(self):
|
||||
try:
|
||||
self.parseConfigurationFiles(self.prefiles, self.postfiles)
|
||||
except SyntaxError:
|
||||
sys.exit(1)
|
||||
except Exception:
|
||||
logger.exception("Error parsing configuration files")
|
||||
sys.exit(1)
|
||||
|
||||
def _findLayerConf(self, data):
|
||||
return findConfigFile("bblayers.conf", data)
|
||||
|
||||
def parseConfigurationFiles(self, prefiles, postfiles):
|
||||
data = self.data
|
||||
bb.parse.init_parser(data)
|
||||
|
||||
# Parse files for loading *before* bitbake.conf and any includes
|
||||
for f in prefiles:
|
||||
data = parse_config_file(f, data)
|
||||
|
||||
layerconf = self._findLayerConf(data)
|
||||
if layerconf:
|
||||
parselog.debug(2, "Found bblayers.conf (%s)", layerconf)
|
||||
# By definition bblayers.conf is in conf/ of TOPDIR.
|
||||
# We may have been called with cwd somewhere else so reset TOPDIR
|
||||
data.setVar("TOPDIR", os.path.dirname(os.path.dirname(layerconf)))
|
||||
data = parse_config_file(layerconf, data)
|
||||
|
||||
layers = (data.getVar('BBLAYERS', True) or "").split()
|
||||
|
||||
data = bb.data.createCopy(data)
|
||||
for layer in layers:
|
||||
parselog.debug(2, "Adding layer %s", layer)
|
||||
data.setVar('LAYERDIR', layer)
|
||||
data = parse_config_file(os.path.join(layer, "conf", "layer.conf"), data)
|
||||
data.expandVarref('LAYERDIR')
|
||||
|
||||
data.delVar('LAYERDIR')
|
||||
|
||||
if not data.getVar("BBPATH", True):
|
||||
msg = "The BBPATH variable is not set"
|
||||
if not layerconf:
|
||||
msg += (" and bitbake did not find a conf/bblayers.conf file in"
|
||||
" the expected location.\nMaybe you accidentally"
|
||||
" invoked bitbake from the wrong directory?")
|
||||
raise SystemExit(msg)
|
||||
|
||||
data = parse_config_file(os.path.join("conf", "bitbake.conf"), data)
|
||||
|
||||
# Parse files for loading *after* bitbake.conf and any includes
|
||||
for p in postfiles:
|
||||
data = parse_config_file(p, data)
|
||||
|
||||
# Handle any INHERITs and inherit the base class
|
||||
bbclasses = ["base"] + (data.getVar('INHERIT', True) or "").split()
|
||||
for bbclass in bbclasses:
|
||||
data = _inherit(bbclass, data)
|
||||
|
||||
# Nomally we only register event handlers at the end of parsing .bb files
|
||||
# We register any handlers we've found so far here...
|
||||
for var in data.getVar('__BBHANDLERS') or []:
|
||||
bb.event.register(var, data.getVar(var), (data.getVarFlag(var, "eventmask", True) or "").split())
|
||||
|
||||
if data.getVar("BB_WORKERCONTEXT", False) is None:
|
||||
bb.fetch.fetcher_init(data)
|
||||
bb.codeparser.parser_cache_init(data)
|
||||
bb.event.fire(bb.event.ConfigParsed(), data)
|
||||
|
||||
if data.getVar("BB_INVALIDCONF") is True:
|
||||
data.setVar("BB_INVALIDCONF", False)
|
||||
self.parseConfigurationFiles(self.prefiles, self.postfiles)
|
||||
return
|
||||
|
||||
bb.parse.init_parser(data)
|
||||
data.setVar('BBINCLUDED',bb.parse.get_file_depends(data))
|
||||
self.data = data
|
||||
self.data_hash = data.get_hash()
|
||||
|
||||
|
||||
|
||||
@@ -49,7 +49,6 @@ from bb import data_smart
|
||||
from bb import codeparser
|
||||
import bb
|
||||
|
||||
logger = data_smart.logger
|
||||
_dict_type = data_smart.DataSmart
|
||||
|
||||
def init():
|
||||
@@ -97,10 +96,6 @@ def delVar(var, d):
|
||||
"""Removes a variable from the data set"""
|
||||
d.delVar(var)
|
||||
|
||||
def appendVar(var, value, d):
|
||||
"""Append additional value to a variable"""
|
||||
d.appendVar(var, value)
|
||||
|
||||
def setVarFlag(var, flag, flagvalue, d):
|
||||
"""Set a flag for a given variable to a given value"""
|
||||
d.setVarFlag(var, flag, flagvalue)
|
||||
@@ -162,24 +157,18 @@ def expandKeys(alterdata, readdata = None):
|
||||
|
||||
for key in todolist:
|
||||
ekey = todolist[key]
|
||||
newval = alterdata.getVar(ekey, 0)
|
||||
if newval:
|
||||
val = alterdata.getVar(key, 0)
|
||||
if val is not None and newval is not None:
|
||||
bb.warn("Variable key %s (%s) replaces original key %s (%s)." % (key, val, ekey, newval))
|
||||
alterdata.renameVar(key, ekey)
|
||||
renameVar(key, ekey, alterdata)
|
||||
|
||||
def inheritFromOS(d, savedenv, permitted):
|
||||
"""Inherit variables from the initial environment."""
|
||||
def inheritFromOS(d):
|
||||
"""Inherit variables from the environment."""
|
||||
exportlist = bb.utils.preserved_envvars_exported()
|
||||
for s in savedenv.keys():
|
||||
if s in permitted:
|
||||
try:
|
||||
d.setVar(s, getVar(s, savedenv, True), op = 'from env')
|
||||
if s in exportlist:
|
||||
d.setVarFlag(s, "export", True, op = 'auto env export')
|
||||
except TypeError:
|
||||
pass
|
||||
for s in os.environ.keys():
|
||||
try:
|
||||
setVar(s, os.environ[s], d)
|
||||
if s in exportlist:
|
||||
setVarFlag(s, "export", True, d)
|
||||
except TypeError:
|
||||
pass
|
||||
|
||||
def emit_var(var, o=sys.__stdout__, d = init(), all=False):
|
||||
"""Emit a variable to be sourced by a shell."""
|
||||
@@ -198,12 +187,13 @@ def emit_var(var, o=sys.__stdout__, d = init(), all=False):
|
||||
val = getVar(var, d, 1)
|
||||
except (KeyboardInterrupt, bb.build.FuncFailed):
|
||||
raise
|
||||
except Exception as exc:
|
||||
except Exception, exc:
|
||||
o.write('# expansion of %s threw %s: %s\n' % (var, exc.__class__.__name__, str(exc)))
|
||||
return 0
|
||||
|
||||
if all:
|
||||
d.varhistory.emit(var, oval, val, o)
|
||||
commentVal = re.sub('\n', '\n#', str(oval))
|
||||
o.write('# %s=%s\n' % (var, commentVal))
|
||||
|
||||
if (var.find("-") != -1 or var.find(".") != -1 or var.find('{') != -1 or var.find('}') != -1 or var.find('+') != -1) and not all:
|
||||
return 0
|
||||
@@ -244,20 +234,25 @@ def emit_env(o=sys.__stdout__, d = init(), all=False):
|
||||
for key in keys:
|
||||
emit_var(key, o, d, all and not isfunc) and o.write('\n')
|
||||
|
||||
def exported_keys(d):
|
||||
return (key for key in d.keys() if not key.startswith('__') and
|
||||
d.getVarFlag(key, 'export') and
|
||||
not d.getVarFlag(key, 'unexport'))
|
||||
|
||||
def exported_vars(d):
|
||||
for key in exported_keys(d):
|
||||
def export_vars(d):
|
||||
keys = (key for key in d.keys() if d.getVarFlag(key, "export"))
|
||||
ret = {}
|
||||
for k in keys:
|
||||
try:
|
||||
value = d.getVar(key, True)
|
||||
except Exception:
|
||||
v = d.getVar(k, True)
|
||||
if v:
|
||||
ret[k] = v
|
||||
except (KeyboardInterrupt, bb.build.FuncFailed):
|
||||
raise
|
||||
except Exception, exc:
|
||||
pass
|
||||
return ret
|
||||
|
||||
if value is not None:
|
||||
yield key, str(value)
|
||||
def export_envvars(v, d):
|
||||
for s in os.environ.keys():
|
||||
if s not in v:
|
||||
v[s] = os.environ[s]
|
||||
return v
|
||||
|
||||
def emit_func(func, o=sys.__stdout__, d = init()):
|
||||
"""Emits all items in the data store in a format such that it can be sourced by a shell."""
|
||||
@@ -267,75 +262,48 @@ def emit_func(func, o=sys.__stdout__, d = init()):
|
||||
emit_var(key, o, d, False) and o.write('\n')
|
||||
|
||||
emit_var(func, o, d, False) and o.write('\n')
|
||||
newdeps = bb.codeparser.ShellParser(func, logger).parse_shell(d.getVar(func, True))
|
||||
newdeps |= set((d.getVarFlag(func, "vardeps", True) or "").split())
|
||||
newdeps = bb.codeparser.ShellParser().parse_shell(d.getVar(func, True))
|
||||
seen = set()
|
||||
while newdeps:
|
||||
deps = newdeps
|
||||
seen |= deps
|
||||
newdeps = set()
|
||||
for dep in deps:
|
||||
if d.getVarFlag(dep, "func"):
|
||||
if bb.data.getVarFlag(dep, "func", d):
|
||||
emit_var(dep, o, d, False) and o.write('\n')
|
||||
newdeps |= bb.codeparser.ShellParser(dep, logger).parse_shell(d.getVar(dep, True))
|
||||
newdeps |= set((d.getVarFlag(dep, "vardeps", True) or "").split())
|
||||
newdeps |= bb.codeparser.ShellParser().parse_shell(d.getVar(dep, True))
|
||||
newdeps -= seen
|
||||
|
||||
def update_data(d):
|
||||
"""Performs final steps upon the datastore, including application of overrides"""
|
||||
d.finalize(parent = True)
|
||||
d.finalize()
|
||||
|
||||
def build_dependencies(key, keys, shelldeps, vardepvals, d):
|
||||
def build_dependencies(key, keys, shelldeps, d):
|
||||
deps = set()
|
||||
vardeps = d.getVarFlag(key, "vardeps", True)
|
||||
try:
|
||||
if key[-1] == ']':
|
||||
vf = key[:-1].split('[')
|
||||
value = d.getVarFlag(vf[0], vf[1], False)
|
||||
else:
|
||||
value = d.getVar(key, False)
|
||||
|
||||
if key in vardepvals:
|
||||
value = d.getVarFlag(key, "vardepvalue", True)
|
||||
elif d.getVarFlag(key, "func"):
|
||||
if d.getVarFlag(key, "func"):
|
||||
if d.getVarFlag(key, "python"):
|
||||
parsedvar = d.expandWithRefs(value, key)
|
||||
parser = bb.codeparser.PythonParser(key, logger)
|
||||
if parsedvar.value and "\t" in parsedvar.value:
|
||||
logger.warn("Variable %s contains tabs, please remove these (%s)" % (key, d.getVar("FILE", True)))
|
||||
parsedvar = d.expandWithRefs(d.getVar(key, False), key)
|
||||
parser = bb.codeparser.PythonParser()
|
||||
parser.parse_python(parsedvar.value)
|
||||
deps = deps | parser.references
|
||||
else:
|
||||
parsedvar = d.expandWithRefs(value, key)
|
||||
parser = bb.codeparser.ShellParser(key, logger)
|
||||
parsedvar = d.expandWithRefs(d.getVar(key, False), key)
|
||||
parser = bb.codeparser.ShellParser()
|
||||
parser.parse_shell(parsedvar.value)
|
||||
deps = deps | shelldeps
|
||||
if vardeps is None:
|
||||
parser.log.flush()
|
||||
deps = deps | parsedvar.references
|
||||
deps = deps | (keys & parser.execs) | (keys & parsedvar.execs)
|
||||
else:
|
||||
parser = d.expandWithRefs(value, key)
|
||||
parser = d.expandWithRefs(d.getVar(key, False), key)
|
||||
deps |= parser.references
|
||||
deps = deps | (keys & parser.execs)
|
||||
|
||||
# Add varflags, assuming an exclusion list is set
|
||||
varflagsexcl = d.getVar('BB_SIGNATURE_EXCLUDE_FLAGS', True)
|
||||
if varflagsexcl:
|
||||
varfdeps = []
|
||||
varflags = d.getVarFlags(key)
|
||||
if varflags:
|
||||
for f in varflags:
|
||||
if f not in varflagsexcl:
|
||||
varfdeps.append('%s[%s]' % (key, f))
|
||||
if varfdeps:
|
||||
deps |= set(varfdeps)
|
||||
|
||||
deps |= set((vardeps or "").split())
|
||||
deps |= set((d.getVarFlag(key, "vardeps", True) or "").split())
|
||||
deps -= set((d.getVarFlag(key, "vardepsexclude", True) or "").split())
|
||||
except Exception as e:
|
||||
raise bb.data_smart.ExpansionError(key, None, e)
|
||||
return deps, value
|
||||
except:
|
||||
bb.note("Error expanding variable %s" % key)
|
||||
raise
|
||||
return deps
|
||||
#bb.note("Variable %s references %s and calls %s" % (key, str(deps), str(execs)))
|
||||
#d.setVarFlag(key, "vardeps", deps)
|
||||
|
||||
@@ -343,14 +311,12 @@ def generate_dependencies(d):
|
||||
|
||||
keys = set(key for key in d.keys() if not key.startswith("__"))
|
||||
shelldeps = set(key for key in keys if d.getVarFlag(key, "export") and not d.getVarFlag(key, "unexport"))
|
||||
vardepvals = set(key for key in keys if d.getVarFlag(key, "vardepvalue"))
|
||||
|
||||
deps = {}
|
||||
values = {}
|
||||
|
||||
tasklist = d.getVar('__BBTASKS') or []
|
||||
tasklist = bb.data.getVar('__BBTASKS', d) or []
|
||||
for task in tasklist:
|
||||
deps[task], values[task] = build_dependencies(task, keys, shelldeps, vardepvals, d)
|
||||
deps[task] = build_dependencies(task, keys, shelldeps, d)
|
||||
newdeps = deps[task]
|
||||
seen = set()
|
||||
while newdeps:
|
||||
@@ -359,16 +325,14 @@ def generate_dependencies(d):
|
||||
newdeps = set()
|
||||
for dep in nextdeps:
|
||||
if dep not in deps:
|
||||
deps[dep], values[dep] = build_dependencies(dep, keys, shelldeps, vardepvals, d)
|
||||
deps[dep] = build_dependencies(dep, keys, shelldeps, d)
|
||||
newdeps |= deps[dep]
|
||||
newdeps -= seen
|
||||
#print "For %s: %s" % (task, str(deps[task]))
|
||||
return tasklist, deps, values
|
||||
#print "For %s: %s" % (task, str(taskdeps[task]))
|
||||
return tasklist, deps
|
||||
|
||||
def inherits_class(klass, d):
|
||||
val = getVar('__inherit_cache', d) or []
|
||||
needle = os.path.join('classes', '%s.bbclass' % klass)
|
||||
for v in val:
|
||||
if v.endswith(needle):
|
||||
return True
|
||||
if os.path.join('classes', '%s.bbclass' % klass) in val:
|
||||
return True
|
||||
return False
|
||||
|
||||
@@ -28,57 +28,20 @@ BitBake build tools.
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import copy, re, sys, traceback
|
||||
import copy, re
|
||||
from collections import MutableMapping
|
||||
import logging
|
||||
import hashlib
|
||||
import bb, bb.codeparser
|
||||
from bb import utils
|
||||
from bb.COW import COWDictBase
|
||||
|
||||
logger = logging.getLogger("BitBake.Data")
|
||||
|
||||
__setvar_keyword__ = ["_append", "_prepend", "_remove"]
|
||||
__setvar_regexp__ = re.compile('(?P<base>.*?)(?P<keyword>_append|_prepend|_remove)(_(?P<add>.*))?$')
|
||||
__setvar_keyword__ = ["_append", "_prepend"]
|
||||
__setvar_regexp__ = re.compile('(?P<base>.*?)(?P<keyword>_append|_prepend)(_(?P<add>.*))?')
|
||||
__expand_var_regexp__ = re.compile(r"\${[^{}]+}")
|
||||
__expand_python_regexp__ = re.compile(r"\${@.+?}")
|
||||
|
||||
def infer_caller_details(loginfo, parent = False, varval = True):
|
||||
"""Save the caller the trouble of specifying everything."""
|
||||
# Save effort.
|
||||
if 'ignore' in loginfo and loginfo['ignore']:
|
||||
return
|
||||
# If nothing was provided, mark this as possibly unneeded.
|
||||
if not loginfo:
|
||||
loginfo['ignore'] = True
|
||||
return
|
||||
# Infer caller's likely values for variable (var) and value (value),
|
||||
# to reduce clutter in the rest of the code.
|
||||
if varval and ('variable' not in loginfo or 'detail' not in loginfo):
|
||||
try:
|
||||
raise Exception
|
||||
except Exception:
|
||||
tb = sys.exc_info()[2]
|
||||
if parent:
|
||||
above = tb.tb_frame.f_back.f_back
|
||||
else:
|
||||
above = tb.tb_frame.f_back
|
||||
lcls = above.f_locals.items()
|
||||
for k, v in lcls:
|
||||
if k == 'value' and 'detail' not in loginfo:
|
||||
loginfo['detail'] = v
|
||||
if k == 'var' and 'variable' not in loginfo:
|
||||
loginfo['variable'] = v
|
||||
# Infer file/line/function from traceback
|
||||
if 'file' not in loginfo:
|
||||
depth = 3
|
||||
if parent:
|
||||
depth = 4
|
||||
file, line, func, text = traceback.extract_stack(limit = depth)[0]
|
||||
loginfo['file'] = file
|
||||
loginfo['line'] = line
|
||||
if func not in loginfo:
|
||||
loginfo['func'] = func
|
||||
|
||||
class VariableParse:
|
||||
def __init__(self, varname, d, val = None):
|
||||
@@ -94,7 +57,7 @@ class VariableParse:
|
||||
if self.varname and key:
|
||||
if self.varname == key:
|
||||
raise Exception("variable %s references itself!" % self.varname)
|
||||
var = self.d.getVar(key, True)
|
||||
var = self.d.getVar(key, 1)
|
||||
if var is not None:
|
||||
self.references.add(key)
|
||||
return var
|
||||
@@ -105,14 +68,8 @@ class VariableParse:
|
||||
code = match.group()[3:-1]
|
||||
codeobj = compile(code.strip(), self.varname or "<expansion>", "eval")
|
||||
|
||||
parser = bb.codeparser.PythonParser(self.varname, logger)
|
||||
parser = bb.codeparser.PythonParser()
|
||||
parser.parse_python(code)
|
||||
if self.varname:
|
||||
vardeps = self.d.getVarFlag(self.varname, "vardeps", True)
|
||||
if vardeps is None:
|
||||
parser.log.flush()
|
||||
else:
|
||||
parser.log.flush()
|
||||
self.references |= parser.references
|
||||
self.execs |= parser.execs
|
||||
|
||||
@@ -138,169 +95,22 @@ class ExpansionError(Exception):
|
||||
self.expression = expression
|
||||
self.variablename = varname
|
||||
self.exception = exception
|
||||
if varname:
|
||||
if expression:
|
||||
self.msg = "Failure expanding variable %s, expression was %s which triggered exception %s: %s" % (varname, expression, type(exception).__name__, exception)
|
||||
else:
|
||||
self.msg = "Failure expanding variable %s: %s: %s" % (varname, type(exception).__name__, exception)
|
||||
else:
|
||||
self.msg = "Failure expanding expression %s which triggered exception %s: %s" % (expression, type(exception).__name__, exception)
|
||||
self.msg = "Failure expanding variable %s, expression was %s which triggered exception %s: %s" % (varname, expression, type(exception).__name__, exception)
|
||||
Exception.__init__(self, self.msg)
|
||||
self.args = (varname, expression, exception)
|
||||
def __str__(self):
|
||||
return self.msg
|
||||
|
||||
class IncludeHistory(object):
|
||||
def __init__(self, parent = None, filename = '[TOP LEVEL]'):
|
||||
self.parent = parent
|
||||
self.filename = filename
|
||||
self.children = []
|
||||
self.current = self
|
||||
|
||||
def copy(self):
|
||||
new = IncludeHistory(self.parent, self.filename)
|
||||
for c in self.children:
|
||||
new.children.append(c)
|
||||
return new
|
||||
|
||||
def include(self, filename):
|
||||
newfile = IncludeHistory(self.current, filename)
|
||||
self.current.children.append(newfile)
|
||||
self.current = newfile
|
||||
return self
|
||||
|
||||
def __enter__(self):
|
||||
pass
|
||||
|
||||
def __exit__(self, a, b, c):
|
||||
if self.current.parent:
|
||||
self.current = self.current.parent
|
||||
else:
|
||||
bb.warn("Include log: Tried to finish '%s' at top level." % filename)
|
||||
return False
|
||||
|
||||
def emit(self, o, level = 0):
|
||||
"""Emit an include history file, and its children."""
|
||||
if level:
|
||||
spaces = " " * (level - 1)
|
||||
o.write("# %s%s" % (spaces, self.filename))
|
||||
if len(self.children) > 0:
|
||||
o.write(" includes:")
|
||||
else:
|
||||
o.write("#\n# INCLUDE HISTORY:\n#")
|
||||
level = level + 1
|
||||
for child in self.children:
|
||||
o.write("\n")
|
||||
child.emit(o, level)
|
||||
|
||||
class VariableHistory(object):
|
||||
def __init__(self, dataroot):
|
||||
self.dataroot = dataroot
|
||||
self.variables = COWDictBase.copy()
|
||||
|
||||
def copy(self):
|
||||
new = VariableHistory(self.dataroot)
|
||||
new.variables = self.variables.copy()
|
||||
return new
|
||||
|
||||
def record(self, *kwonly, **loginfo):
|
||||
if not self.dataroot._tracking:
|
||||
return
|
||||
if len(kwonly) > 0:
|
||||
raise TypeError
|
||||
infer_caller_details(loginfo, parent = True)
|
||||
if 'ignore' in loginfo and loginfo['ignore']:
|
||||
return
|
||||
if 'op' not in loginfo or not loginfo['op']:
|
||||
loginfo['op'] = 'set'
|
||||
if 'detail' in loginfo:
|
||||
loginfo['detail'] = str(loginfo['detail'])
|
||||
if 'variable' not in loginfo or 'file' not in loginfo:
|
||||
raise ValueError("record() missing variable or file.")
|
||||
var = loginfo['variable']
|
||||
|
||||
if var not in self.variables:
|
||||
self.variables[var] = []
|
||||
self.variables[var].append(loginfo.copy())
|
||||
|
||||
def variable(self, var):
|
||||
if var in self.variables:
|
||||
return self.variables[var]
|
||||
else:
|
||||
return []
|
||||
|
||||
def emit(self, var, oval, val, o):
|
||||
history = self.variable(var)
|
||||
commentVal = re.sub('\n', '\n#', str(oval))
|
||||
if history:
|
||||
if len(history) == 1:
|
||||
o.write("#\n# $%s\n" % var)
|
||||
else:
|
||||
o.write("#\n# $%s [%d operations]\n" % (var, len(history)))
|
||||
for event in history:
|
||||
# o.write("# %s\n" % str(event))
|
||||
if 'func' in event:
|
||||
# If we have a function listed, this is internal
|
||||
# code, not an operation in a config file, and the
|
||||
# full path is distracting.
|
||||
event['file'] = re.sub('.*/', '', event['file'])
|
||||
display_func = ' [%s]' % event['func']
|
||||
else:
|
||||
display_func = ''
|
||||
if 'flag' in event:
|
||||
flag = '[%s] ' % (event['flag'])
|
||||
else:
|
||||
flag = ''
|
||||
o.write("# %s %s:%s%s\n# %s\"%s\"\n" % (event['op'], event['file'], event['line'], display_func, flag, re.sub('\n', '\n# ', event['detail'])))
|
||||
if len(history) > 1:
|
||||
o.write("# computed:\n")
|
||||
o.write('# "%s"\n' % (commentVal))
|
||||
else:
|
||||
o.write("#\n# $%s\n# [no history recorded]\n#\n" % var)
|
||||
o.write('# "%s"\n' % (commentVal))
|
||||
|
||||
def get_variable_files(self, var):
|
||||
"""Get the files where operations are made on a variable"""
|
||||
var_history = self.variable(var)
|
||||
files = []
|
||||
for event in var_history:
|
||||
files.append(event['file'])
|
||||
return files
|
||||
|
||||
def get_variable_lines(self, var, f):
|
||||
"""Get the line where a operation is made on a variable in file f"""
|
||||
var_history = self.variable(var)
|
||||
lines = []
|
||||
for event in var_history:
|
||||
if f== event['file']:
|
||||
line = event['line']
|
||||
lines.append(line)
|
||||
return lines
|
||||
|
||||
def del_var_history(self, var):
|
||||
if var in self.variables:
|
||||
self.variables[var] = []
|
||||
|
||||
class DataSmart(MutableMapping):
|
||||
def __init__(self, special = COWDictBase.copy(), seen = COWDictBase.copy() ):
|
||||
self.dict = {}
|
||||
|
||||
self.inchistory = IncludeHistory()
|
||||
self.varhistory = VariableHistory(self)
|
||||
self._tracking = False
|
||||
|
||||
# cookie monster tribute
|
||||
self._special_values = special
|
||||
self._seen_overrides = seen
|
||||
|
||||
self.expand_cache = {}
|
||||
|
||||
def enableTracking(self):
|
||||
self._tracking = True
|
||||
|
||||
def disableTracking(self):
|
||||
self._tracking = False
|
||||
|
||||
def expandWithRefs(self, s, varname):
|
||||
|
||||
if not isinstance(s, basestring): # sanity check
|
||||
@@ -320,8 +130,6 @@ class DataSmart(MutableMapping):
|
||||
break
|
||||
except ExpansionError:
|
||||
raise
|
||||
except bb.parse.SkipPackage:
|
||||
raise
|
||||
except Exception as exc:
|
||||
raise ExpansionError(varname, s, exc)
|
||||
|
||||
@@ -332,18 +140,14 @@ class DataSmart(MutableMapping):
|
||||
|
||||
return varparse
|
||||
|
||||
def expand(self, s, varname = None):
|
||||
def expand(self, s, varname):
|
||||
return self.expandWithRefs(s, varname).value
|
||||
|
||||
|
||||
def finalize(self, parent = False):
|
||||
def finalize(self):
|
||||
"""Performs final steps upon the datastore, including application of overrides"""
|
||||
|
||||
overrides = (self.getVar("OVERRIDES", True) or "").split(":") or []
|
||||
finalize_caller = {
|
||||
'op': 'finalize',
|
||||
}
|
||||
infer_caller_details(finalize_caller, parent = parent, varval = False)
|
||||
|
||||
#
|
||||
# Well let us see what breaks here. We used to iterate
|
||||
@@ -357,13 +161,9 @@ class DataSmart(MutableMapping):
|
||||
|
||||
#
|
||||
# First we apply all overrides
|
||||
# Then we will handle _append and _prepend and store the _remove
|
||||
# information for later.
|
||||
# Then we will handle _append and _prepend
|
||||
#
|
||||
|
||||
# We only want to report finalization once per variable overridden.
|
||||
finalizes_reported = {}
|
||||
|
||||
for o in overrides:
|
||||
# calculate '_'+override
|
||||
l = len(o) + 1
|
||||
@@ -372,60 +172,38 @@ class DataSmart(MutableMapping):
|
||||
if o not in self._seen_overrides:
|
||||
continue
|
||||
|
||||
vars = self._seen_overrides[o].copy()
|
||||
vars = self._seen_overrides[o]
|
||||
for var in vars:
|
||||
name = var[:-l]
|
||||
try:
|
||||
# Report only once, even if multiple changes.
|
||||
if name not in finalizes_reported:
|
||||
finalizes_reported[name] = True
|
||||
finalize_caller['variable'] = name
|
||||
finalize_caller['detail'] = 'was: ' + str(self.getVar(name, False))
|
||||
self.varhistory.record(**finalize_caller)
|
||||
# Copy history of the override over.
|
||||
for event in self.varhistory.variable(var):
|
||||
loginfo = event.copy()
|
||||
loginfo['variable'] = name
|
||||
loginfo['op'] = 'override[%s]:%s' % (o, loginfo['op'])
|
||||
self.varhistory.record(**loginfo)
|
||||
self.setVar(name, self.getVar(var, False), op = 'finalize', file = 'override[%s]' % o, line = '')
|
||||
self.delVar(var)
|
||||
self.setVar(name, self.getVar(var, False))
|
||||
except Exception:
|
||||
logger.info("Untracked delVar")
|
||||
|
||||
# now on to the appends and prepends, and stashing the removes
|
||||
# now on to the appends and prepends
|
||||
for op in __setvar_keyword__:
|
||||
if op in self._special_values:
|
||||
appends = self._special_values[op] or []
|
||||
for append in appends:
|
||||
keep = []
|
||||
for (a, o) in self.getVarFlag(append, op) or []:
|
||||
match = True
|
||||
if o:
|
||||
for o2 in o.split("_"):
|
||||
if not o2 in overrides:
|
||||
match = False
|
||||
if not match:
|
||||
if o and not o in overrides:
|
||||
keep.append((a ,o))
|
||||
continue
|
||||
|
||||
if op == "_append":
|
||||
if op is "_append":
|
||||
sval = self.getVar(append, False) or ""
|
||||
sval += a
|
||||
self.setVar(append, sval)
|
||||
elif op == "_prepend":
|
||||
elif op is "_prepend":
|
||||
sval = a + (self.getVar(append, False) or "")
|
||||
self.setVar(append, sval)
|
||||
elif op == "_remove":
|
||||
removes = self.getVarFlag(append, "_removeactive", False) or []
|
||||
removes.extend(a.split())
|
||||
self.setVarFlag(append, "_removeactive", removes, ignore=True)
|
||||
|
||||
# We save overrides that may be applied at some later stage
|
||||
if keep:
|
||||
self.setVarFlag(append, op, keep, ignore=True)
|
||||
self.setVarFlag(append, op, keep)
|
||||
else:
|
||||
self.delVarFlag(append, op, ignore=True)
|
||||
self.delVarFlag(append, op)
|
||||
|
||||
def initVar(self, var):
|
||||
self.expand_cache = {}
|
||||
@@ -453,11 +231,7 @@ class DataSmart(MutableMapping):
|
||||
else:
|
||||
self.initVar(var)
|
||||
|
||||
|
||||
def setVar(self, var, value, **loginfo):
|
||||
#print("var=" + str(var) + " val=" + str(value))
|
||||
if 'op' not in loginfo:
|
||||
loginfo['op'] = "set"
|
||||
def setVar(self, var, value):
|
||||
self.expand_cache = {}
|
||||
match = __setvar_regexp__.match(var)
|
||||
if match and match.group("keyword") in __setvar_keyword__:
|
||||
@@ -466,22 +240,15 @@ class DataSmart(MutableMapping):
|
||||
override = match.group('add')
|
||||
l = self.getVarFlag(base, keyword) or []
|
||||
l.append([value, override])
|
||||
self.setVarFlag(base, keyword, l, ignore=True)
|
||||
# And cause that to be recorded:
|
||||
loginfo['detail'] = value
|
||||
loginfo['variable'] = base
|
||||
if override:
|
||||
loginfo['op'] = '%s[%s]' % (keyword, override)
|
||||
else:
|
||||
loginfo['op'] = keyword
|
||||
self.varhistory.record(**loginfo)
|
||||
self.setVarFlag(base, keyword, l)
|
||||
|
||||
# todo make sure keyword is not __doc__ or __module__
|
||||
# pay the cookie monster
|
||||
try:
|
||||
self._special_values[keyword].add(base)
|
||||
self._special_values[keyword].add( base )
|
||||
except KeyError:
|
||||
self._special_values[keyword] = set()
|
||||
self._special_values[keyword].add(base)
|
||||
self._special_values[keyword].add( base )
|
||||
|
||||
return
|
||||
|
||||
@@ -490,111 +257,66 @@ class DataSmart(MutableMapping):
|
||||
|
||||
# more cookies for the cookie monster
|
||||
if '_' in var:
|
||||
self._setvar_update_overrides(var)
|
||||
|
||||
# setting var
|
||||
self.dict[var]["_content"] = value
|
||||
self.varhistory.record(**loginfo)
|
||||
|
||||
def _setvar_update_overrides(self, var):
|
||||
# aka pay the cookie monster
|
||||
override = var[var.rfind('_')+1:]
|
||||
if len(override) > 0:
|
||||
override = var[var.rfind('_')+1:]
|
||||
if override not in self._seen_overrides:
|
||||
self._seen_overrides[override] = set()
|
||||
self._seen_overrides[override].add( var )
|
||||
|
||||
def getVar(self, var, expand=False, noweakdefault=False):
|
||||
value = self.getVarFlag(var, "_content", False, noweakdefault)
|
||||
# setting var
|
||||
self.dict[var]["content"] = value
|
||||
|
||||
# Call expand() separately to make use of the expand cache
|
||||
if expand and value:
|
||||
def getVar(self, var, exp):
|
||||
value = self.getVarFlag(var, "content")
|
||||
|
||||
if exp and value:
|
||||
return self.expand(value, var)
|
||||
return value
|
||||
|
||||
def renameVar(self, key, newkey, **loginfo):
|
||||
def renameVar(self, key, newkey):
|
||||
"""
|
||||
Rename the variable key to newkey
|
||||
"""
|
||||
val = self.getVar(key, 0)
|
||||
if val is not None:
|
||||
loginfo['variable'] = newkey
|
||||
loginfo['op'] = 'rename from %s' % key
|
||||
loginfo['detail'] = val
|
||||
self.varhistory.record(**loginfo)
|
||||
self.setVar(newkey, val, ignore=True)
|
||||
self.setVar(newkey, val)
|
||||
|
||||
for i in (__setvar_keyword__):
|
||||
for i in ('_append', '_prepend'):
|
||||
src = self.getVarFlag(key, i)
|
||||
if src is None:
|
||||
continue
|
||||
|
||||
dest = self.getVarFlag(newkey, i) or []
|
||||
dest.extend(src)
|
||||
self.setVarFlag(newkey, i, dest, ignore=True)
|
||||
self.setVarFlag(newkey, i, dest)
|
||||
|
||||
if i in self._special_values and key in self._special_values[i]:
|
||||
self._special_values[i].remove(key)
|
||||
self._special_values[i].add(newkey)
|
||||
|
||||
loginfo['variable'] = key
|
||||
loginfo['op'] = 'rename (to)'
|
||||
loginfo['detail'] = newkey
|
||||
self.varhistory.record(**loginfo)
|
||||
self.delVar(key, ignore=True)
|
||||
self.delVar(key)
|
||||
|
||||
def appendVar(self, var, value, **loginfo):
|
||||
loginfo['op'] = 'append'
|
||||
self.varhistory.record(**loginfo)
|
||||
newvalue = (self.getVar(var, False) or "") + value
|
||||
self.setVar(var, newvalue, ignore=True)
|
||||
|
||||
def prependVar(self, var, value, **loginfo):
|
||||
loginfo['op'] = 'prepend'
|
||||
self.varhistory.record(**loginfo)
|
||||
newvalue = value + (self.getVar(var, False) or "")
|
||||
self.setVar(var, newvalue, ignore=True)
|
||||
|
||||
def delVar(self, var, **loginfo):
|
||||
loginfo['detail'] = ""
|
||||
loginfo['op'] = 'del'
|
||||
self.varhistory.record(**loginfo)
|
||||
def delVar(self, var):
|
||||
self.expand_cache = {}
|
||||
self.dict[var] = {}
|
||||
if '_' in var:
|
||||
override = var[var.rfind('_')+1:]
|
||||
if override and override in self._seen_overrides and var in self._seen_overrides[override]:
|
||||
self._seen_overrides[override].remove(var)
|
||||
|
||||
def setVarFlag(self, var, flag, value, **loginfo):
|
||||
if 'op' not in loginfo:
|
||||
loginfo['op'] = "set"
|
||||
loginfo['flag'] = flag
|
||||
self.varhistory.record(**loginfo)
|
||||
def setVarFlag(self, var, flag, flagvalue):
|
||||
if not var in self.dict:
|
||||
self._makeShadowCopy(var)
|
||||
self.dict[var][flag] = value
|
||||
self.dict[var][flag] = flagvalue
|
||||
|
||||
if flag == "defaultval" and '_' in var:
|
||||
self._setvar_update_overrides(var)
|
||||
|
||||
def getVarFlag(self, var, flag, expand=False, noweakdefault=False):
|
||||
def getVarFlag(self, var, flag, expand=False):
|
||||
local_var = self._findVar(var)
|
||||
value = None
|
||||
if local_var:
|
||||
if flag in local_var:
|
||||
value = copy.copy(local_var[flag])
|
||||
elif flag == "_content" and "defaultval" in local_var and not noweakdefault:
|
||||
elif flag == "content" and "defaultval" in local_var:
|
||||
value = copy.copy(local_var["defaultval"])
|
||||
if expand and value:
|
||||
value = self.expand(value, None)
|
||||
if value and flag == "_content" and local_var and "_removeactive" in local_var:
|
||||
filtered = filter(lambda v: v not in local_var["_removeactive"],
|
||||
value.split(" "))
|
||||
value = " ".join(filtered)
|
||||
return value
|
||||
|
||||
def delVarFlag(self, var, flag, **loginfo):
|
||||
def delVarFlag(self, var, flag):
|
||||
local_var = self._findVar(var)
|
||||
if not local_var:
|
||||
return
|
||||
@@ -602,38 +324,15 @@ class DataSmart(MutableMapping):
|
||||
self._makeShadowCopy(var)
|
||||
|
||||
if var in self.dict and flag in self.dict[var]:
|
||||
loginfo['detail'] = ""
|
||||
loginfo['op'] = 'delFlag'
|
||||
loginfo['flag'] = flag
|
||||
self.varhistory.record(**loginfo)
|
||||
|
||||
del self.dict[var][flag]
|
||||
|
||||
def appendVarFlag(self, var, flag, value, **loginfo):
|
||||
loginfo['op'] = 'append'
|
||||
loginfo['flag'] = flag
|
||||
self.varhistory.record(**loginfo)
|
||||
newvalue = (self.getVarFlag(var, flag, False) or "") + value
|
||||
self.setVarFlag(var, flag, newvalue, ignore=True)
|
||||
|
||||
def prependVarFlag(self, var, flag, value, **loginfo):
|
||||
loginfo['op'] = 'prepend'
|
||||
loginfo['flag'] = flag
|
||||
self.varhistory.record(**loginfo)
|
||||
newvalue = value + (self.getVarFlag(var, flag, False) or "")
|
||||
self.setVarFlag(var, flag, newvalue, ignore=True)
|
||||
|
||||
def setVarFlags(self, var, flags, **loginfo):
|
||||
infer_caller_details(loginfo)
|
||||
def setVarFlags(self, var, flags):
|
||||
if not var in self.dict:
|
||||
self._makeShadowCopy(var)
|
||||
|
||||
for i in flags:
|
||||
if i == "_content":
|
||||
if i == "content":
|
||||
continue
|
||||
loginfo['flag'] = i
|
||||
loginfo['detail'] = flags[i]
|
||||
self.varhistory.record(**loginfo)
|
||||
self.dict[var][i] = flags[i]
|
||||
|
||||
def getVarFlags(self, var):
|
||||
@@ -642,7 +341,7 @@ class DataSmart(MutableMapping):
|
||||
|
||||
if local_var:
|
||||
for i in local_var:
|
||||
if i.startswith("_"):
|
||||
if i == "content":
|
||||
continue
|
||||
flags[i] = local_var[i]
|
||||
|
||||
@@ -651,21 +350,18 @@ class DataSmart(MutableMapping):
|
||||
return flags
|
||||
|
||||
|
||||
def delVarFlags(self, var, **loginfo):
|
||||
def delVarFlags(self, var):
|
||||
if not var in self.dict:
|
||||
self._makeShadowCopy(var)
|
||||
|
||||
if var in self.dict:
|
||||
content = None
|
||||
|
||||
loginfo['op'] = 'delete flags'
|
||||
self.varhistory.record(**loginfo)
|
||||
|
||||
# try to save the content
|
||||
if "_content" in self.dict[var]:
|
||||
content = self.dict[var]["_content"]
|
||||
if "content" in self.dict[var]:
|
||||
content = self.dict[var]["content"]
|
||||
self.dict[var] = {}
|
||||
self.dict[var]["_content"] = content
|
||||
self.dict[var]["content"] = content
|
||||
else:
|
||||
del self.dict[var]
|
||||
|
||||
@@ -677,11 +373,6 @@ class DataSmart(MutableMapping):
|
||||
# we really want this to be a DataSmart...
|
||||
data = DataSmart(seen=self._seen_overrides.copy(), special=self._special_values.copy())
|
||||
data.dict["_data"] = self.dict
|
||||
data.varhistory = self.varhistory.copy()
|
||||
data.varhistory.datasmart = data
|
||||
data.inchistory = self.inchistory.copy()
|
||||
|
||||
data._tracking = self._tracking
|
||||
|
||||
return data
|
||||
|
||||
@@ -707,22 +398,18 @@ class DataSmart(MutableMapping):
|
||||
yield key
|
||||
|
||||
def __iter__(self):
|
||||
def keylist(d):
|
||||
klist = set()
|
||||
for key in d:
|
||||
if key == "_data":
|
||||
continue
|
||||
if not d[key]:
|
||||
continue
|
||||
klist.add(key)
|
||||
|
||||
seen = set()
|
||||
def _keys(d):
|
||||
if "_data" in d:
|
||||
klist |= keylist(d["_data"])
|
||||
for key in _keys(d["_data"]):
|
||||
yield key
|
||||
|
||||
return klist
|
||||
|
||||
for k in keylist(self.dict):
|
||||
yield k
|
||||
for key in d:
|
||||
if key != "_data":
|
||||
if not key in seen:
|
||||
seen.add(key)
|
||||
yield key
|
||||
return _keys(self.dict)
|
||||
|
||||
def __len__(self):
|
||||
return len(frozenset(self))
|
||||
@@ -739,36 +426,3 @@ class DataSmart(MutableMapping):
|
||||
|
||||
def __delitem__(self, var):
|
||||
self.delVar(var)
|
||||
|
||||
def get_hash(self):
|
||||
data = {}
|
||||
d = self.createCopy()
|
||||
bb.data.expandKeys(d)
|
||||
bb.data.update_data(d)
|
||||
|
||||
config_whitelist = set((d.getVar("BB_HASHCONFIG_WHITELIST", True) or "").split())
|
||||
keys = set(key for key in iter(d) if not key.startswith("__"))
|
||||
for key in keys:
|
||||
if key in config_whitelist:
|
||||
continue
|
||||
value = d.getVar(key, False) or ""
|
||||
data.update({key:value})
|
||||
|
||||
varflags = d.getVarFlags(key)
|
||||
if not varflags:
|
||||
continue
|
||||
for f in varflags:
|
||||
data.update({'%s[%s]' % (key, f):varflags[f]})
|
||||
|
||||
for key in ["__BBTASKS", "__BBANONFUNCS", "__BBHANDLERS"]:
|
||||
bb_list = d.getVar(key, False) or []
|
||||
bb_list.sort()
|
||||
data.update({key:str(bb_list)})
|
||||
|
||||
if key == "__BBANONFUNCS":
|
||||
for i in bb_list:
|
||||
value = d.getVar(i, True) or ""
|
||||
data.update({i:value})
|
||||
|
||||
data_str = str([(k, data[k]) for k in sorted(data.keys())])
|
||||
return hashlib.md5(data_str).hexdigest()
|
||||
|
||||
@@ -30,17 +30,12 @@ except ImportError:
|
||||
import pickle
|
||||
import logging
|
||||
import atexit
|
||||
import traceback
|
||||
import bb.utils
|
||||
import bb.compat
|
||||
import bb.exceptions
|
||||
|
||||
# This is the pid for which we should generate the event. This is set when
|
||||
# the runqueue forks off.
|
||||
worker_pid = 0
|
||||
worker_fire = None
|
||||
|
||||
logger = logging.getLogger('BitBake.Event')
|
||||
worker_pipe = None
|
||||
|
||||
class Event(object):
|
||||
"""Base class for events"""
|
||||
@@ -48,56 +43,38 @@ class Event(object):
|
||||
def __init__(self):
|
||||
self.pid = worker_pid
|
||||
|
||||
NotHandled = 0
|
||||
Handled = 1
|
||||
|
||||
Registered = 10
|
||||
AlreadyRegistered = 14
|
||||
|
||||
def get_class_handlers():
|
||||
return _handlers
|
||||
|
||||
def set_class_handlers(h):
|
||||
_handlers = h
|
||||
|
||||
def clean_class_handlers():
|
||||
return bb.compat.OrderedDict()
|
||||
|
||||
# Internal
|
||||
_handlers = clean_class_handlers()
|
||||
_handlers = {}
|
||||
_ui_handlers = {}
|
||||
_ui_logfilters = {}
|
||||
_ui_handler_seq = 0
|
||||
_event_handler_map = {}
|
||||
_catchall_handlers = {}
|
||||
|
||||
def execute_handler(name, handler, event, d):
|
||||
event.data = d
|
||||
try:
|
||||
ret = handler(event)
|
||||
except bb.parse.SkipPackage:
|
||||
raise
|
||||
except Exception:
|
||||
etype, value, tb = sys.exc_info()
|
||||
logger.error("Execution of event handler '%s' failed" % name,
|
||||
exc_info=(etype, value, tb.tb_next))
|
||||
raise
|
||||
except SystemExit as exc:
|
||||
if exc.code != 0:
|
||||
logger.error("Execution of event handler '%s' failed" % name)
|
||||
raise
|
||||
finally:
|
||||
del event.data
|
||||
# For compatibility
|
||||
bb.utils._context["NotHandled"] = NotHandled
|
||||
bb.utils._context["Handled"] = Handled
|
||||
|
||||
def fire_class_handlers(event, d):
|
||||
if isinstance(event, logging.LogRecord):
|
||||
return
|
||||
|
||||
eid = str(event.__class__)[8:-2]
|
||||
evt_hmap = _event_handler_map.get(eid, {})
|
||||
for name, handler in _handlers.iteritems():
|
||||
if name in _catchall_handlers or name in evt_hmap:
|
||||
try:
|
||||
execute_handler(name, handler, event, d)
|
||||
except Exception:
|
||||
continue
|
||||
for handler in _handlers:
|
||||
h = _handlers[handler]
|
||||
event.data = d
|
||||
if type(h).__name__ == "code":
|
||||
locals = {"e": event}
|
||||
bb.utils.simple_exec(h, locals)
|
||||
ret = bb.utils.better_eval("tmpHandler(e)", locals)
|
||||
if ret is not None:
|
||||
warnings.warn("Using Handled/NotHandled in event handlers is deprecated",
|
||||
DeprecationWarning, stacklevel = 2)
|
||||
else:
|
||||
h(event)
|
||||
del event.data
|
||||
|
||||
ui_queue = []
|
||||
@atexit.register
|
||||
@@ -110,19 +87,8 @@ def print_ui_queue():
|
||||
console = logging.StreamHandler(sys.stdout)
|
||||
console.setFormatter(BBLogFormatter("%(levelname)s: %(message)s"))
|
||||
logger.handlers = [console]
|
||||
|
||||
# First check to see if we have any proper messages
|
||||
msgprint = False
|
||||
for event in ui_queue:
|
||||
if isinstance(event, logging.LogRecord):
|
||||
if event.levelno > logging.DEBUG:
|
||||
logger.handle(event)
|
||||
msgprint = True
|
||||
if msgprint:
|
||||
return
|
||||
|
||||
# Nope, so just print all of the messages we have (including debug messages)
|
||||
for event in ui_queue:
|
||||
while ui_queue:
|
||||
event = ui_queue.pop()
|
||||
if isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
|
||||
@@ -136,15 +102,10 @@ def fire_ui_handlers(event, d):
|
||||
for h in _ui_handlers:
|
||||
#print "Sending event %s" % event
|
||||
try:
|
||||
if not _ui_logfilters[h].filter(event):
|
||||
continue
|
||||
# We use pickle here since it better handles object instances
|
||||
# which xmlrpc's marshaller does not. Events *must* be serializable
|
||||
# by pickle.
|
||||
if hasattr(_ui_handlers[h].event, "sendpickle"):
|
||||
_ui_handlers[h].event.sendpickle((pickle.dumps(event)))
|
||||
else:
|
||||
_ui_handlers[h].event.send(event)
|
||||
_ui_handlers[h].event.send((pickle.dumps(event)))
|
||||
except:
|
||||
errors.append(h)
|
||||
for h in errors:
|
||||
@@ -159,16 +120,23 @@ def fire(event, d):
|
||||
# don't have a datastore so the datastore context isn't a problem.
|
||||
|
||||
fire_class_handlers(event, d)
|
||||
if worker_fire:
|
||||
if worker_pid != 0:
|
||||
worker_fire(event, d)
|
||||
else:
|
||||
fire_ui_handlers(event, d)
|
||||
|
||||
def worker_fire(event, d):
|
||||
data = "<event>" + pickle.dumps(event) + "</event>"
|
||||
worker_pipe.write(data)
|
||||
|
||||
def fire_from_worker(event, d):
|
||||
if not event.startswith("<event>") or not event.endswith("</event>"):
|
||||
print("Error, not an event %s" % event)
|
||||
return
|
||||
event = pickle.loads(event[7:-8])
|
||||
fire_ui_handlers(event, d)
|
||||
|
||||
noop = lambda _: None
|
||||
def register(name, handler, mask=[]):
|
||||
def register(name, handler):
|
||||
"""Register an Event handler"""
|
||||
|
||||
# already registered
|
||||
@@ -178,29 +146,12 @@ def register(name, handler, mask=[]):
|
||||
if handler is not None:
|
||||
# handle string containing python code
|
||||
if isinstance(handler, basestring):
|
||||
tmp = "def %s(e):\n%s" % (name, handler)
|
||||
try:
|
||||
code = compile(tmp, "%s(e)" % name, "exec")
|
||||
except SyntaxError:
|
||||
logger.error("Unable to register event handler '%s':\n%s", name,
|
||||
''.join(traceback.format_exc(limit=0)))
|
||||
_handlers[name] = noop
|
||||
return
|
||||
env = {}
|
||||
bb.utils.better_exec(code, env)
|
||||
func = bb.utils.better_eval(name, env)
|
||||
_handlers[name] = func
|
||||
tmp = "def tmpHandler(e):\n%s" % handler
|
||||
comp = bb.utils.better_compile(tmp, "tmpHandler(e)", "bb.event._registerCode")
|
||||
_handlers[name] = comp
|
||||
else:
|
||||
_handlers[name] = handler
|
||||
|
||||
if not mask or '*' in mask:
|
||||
_catchall_handlers[name] = True
|
||||
else:
|
||||
for m in mask:
|
||||
if _event_handler_map.get(m, None) is None:
|
||||
_event_handler_map[m] = {}
|
||||
_event_handler_map[m][name] = True
|
||||
|
||||
return Registered
|
||||
|
||||
def remove(name, handler):
|
||||
@@ -210,8 +161,6 @@ def remove(name, handler):
|
||||
def register_UIHhandler(handler):
|
||||
bb.event._ui_handler_seq = bb.event._ui_handler_seq + 1
|
||||
_ui_handlers[_ui_handler_seq] = handler
|
||||
level, debug_domains = bb.msg.constructLogOptions()
|
||||
_ui_logfilters[_ui_handler_seq] = UIEventFilter(level, debug_domains)
|
||||
return _ui_handler_seq
|
||||
|
||||
def unregister_UIHhandler(handlerNum):
|
||||
@@ -219,37 +168,6 @@ def unregister_UIHhandler(handlerNum):
|
||||
del _ui_handlers[handlerNum]
|
||||
return
|
||||
|
||||
# Class to allow filtering of events and specific filtering of LogRecords *before* we put them over the IPC
|
||||
class UIEventFilter(object):
|
||||
def __init__(self, level, debug_domains):
|
||||
self.update(None, level, debug_domains)
|
||||
|
||||
def update(self, eventmask, level, debug_domains):
|
||||
self.eventmask = eventmask
|
||||
self.stdlevel = level
|
||||
self.debug_domains = debug_domains
|
||||
|
||||
def filter(self, event):
|
||||
if isinstance(event, logging.LogRecord):
|
||||
if event.levelno >= self.stdlevel:
|
||||
return True
|
||||
if event.name in self.debug_domains and event.levelno >= self.debug_domains[event.name]:
|
||||
return True
|
||||
return False
|
||||
eid = str(event.__class__)[8:-2]
|
||||
if self.eventmask and eid not in self.eventmask:
|
||||
return False
|
||||
return True
|
||||
|
||||
def set_UIHmask(handlerNum, level, debug_domains, mask):
|
||||
if not handlerNum in _ui_handlers:
|
||||
return False
|
||||
if '*' in mask:
|
||||
_ui_logfilters[handlerNum].update(None, level, debug_domains)
|
||||
else:
|
||||
_ui_logfilters[handlerNum].update(mask, level, debug_domains)
|
||||
return True
|
||||
|
||||
def getName(e):
|
||||
"""Returns the name of a class or class instance"""
|
||||
if getattr(e, "__name__", None) == None:
|
||||
@@ -257,41 +175,16 @@ def getName(e):
|
||||
else:
|
||||
return e.__name__
|
||||
|
||||
class OperationStarted(Event):
|
||||
"""An operation has begun"""
|
||||
def __init__(self, msg = "Operation Started"):
|
||||
Event.__init__(self)
|
||||
self.msg = msg
|
||||
|
||||
class OperationCompleted(Event):
|
||||
"""An operation has completed"""
|
||||
def __init__(self, total, msg = "Operation Completed"):
|
||||
Event.__init__(self)
|
||||
self.total = total
|
||||
self.msg = msg
|
||||
|
||||
class OperationProgress(Event):
|
||||
"""An operation is in progress"""
|
||||
def __init__(self, current, total, msg = "Operation in Progress"):
|
||||
Event.__init__(self)
|
||||
self.current = current
|
||||
self.total = total
|
||||
self.msg = msg + ": %s/%s" % (current, total);
|
||||
|
||||
class ConfigParsed(Event):
|
||||
"""Configuration Parsing Complete"""
|
||||
|
||||
class RecipeEvent(Event):
|
||||
class RecipeParsed(Event):
|
||||
""" Recipe Parsing Complete """
|
||||
|
||||
def __init__(self, fn):
|
||||
self.fn = fn
|
||||
Event.__init__(self)
|
||||
|
||||
class RecipePreFinalise(RecipeEvent):
|
||||
""" Recipe Parsing Complete but not yet finialised"""
|
||||
|
||||
class RecipeParsed(RecipeEvent):
|
||||
""" Recipe Parsing Complete """
|
||||
|
||||
class StampUpdate(Event):
|
||||
"""Trigger for any adjustment of the stamp files to happen"""
|
||||
|
||||
@@ -350,40 +243,24 @@ class BuildBase(Event):
|
||||
|
||||
|
||||
|
||||
class BuildStarted(BuildBase, OperationStarted):
|
||||
class BuildStarted(BuildBase):
|
||||
"""bbmake build run started"""
|
||||
def __init__(self, n, p, failures = 0):
|
||||
OperationStarted.__init__(self, "Building Started")
|
||||
BuildBase.__init__(self, n, p, failures)
|
||||
|
||||
class BuildCompleted(BuildBase, OperationCompleted):
|
||||
|
||||
class BuildCompleted(BuildBase):
|
||||
"""bbmake build run completed"""
|
||||
def __init__(self, total, n, p, failures = 0):
|
||||
if not failures:
|
||||
OperationCompleted.__init__(self, total, "Building Succeeded")
|
||||
else:
|
||||
OperationCompleted.__init__(self, total, "Building Failed")
|
||||
BuildBase.__init__(self, n, p, failures)
|
||||
|
||||
class DiskFull(Event):
|
||||
"""Disk full case build aborted"""
|
||||
def __init__(self, dev, type, freespace, mountpoint):
|
||||
Event.__init__(self)
|
||||
self._dev = dev
|
||||
self._type = type
|
||||
self._free = freespace
|
||||
self._mountpoint = mountpoint
|
||||
|
||||
|
||||
|
||||
class NoProvider(Event):
|
||||
"""No Provider for an Event"""
|
||||
|
||||
def __init__(self, item, runtime=False, dependees=None, reasons=[], close_matches=[]):
|
||||
def __init__(self, item, runtime=False, dependees=None):
|
||||
Event.__init__(self)
|
||||
self._item = item
|
||||
self._runtime = runtime
|
||||
self._dependees = dependees
|
||||
self._reasons = reasons
|
||||
self._close_matches = close_matches
|
||||
|
||||
def getItem(self):
|
||||
return self._item
|
||||
@@ -418,16 +295,17 @@ class MultipleProviders(Event):
|
||||
"""
|
||||
return self._candidates
|
||||
|
||||
class ParseStarted(OperationStarted):
|
||||
class ParseStarted(Event):
|
||||
"""Recipe parsing for the runqueue has begun"""
|
||||
def __init__(self, total):
|
||||
OperationStarted.__init__(self, "Recipe parsing Started")
|
||||
Event.__init__(self)
|
||||
self.total = total
|
||||
|
||||
class ParseCompleted(OperationCompleted):
|
||||
class ParseCompleted(Event):
|
||||
"""Recipe parsing for the runqueue has completed"""
|
||||
|
||||
def __init__(self, cached, parsed, skipped, masked, virtuals, errors, total):
|
||||
OperationCompleted.__init__(self, total, "Recipe parsing Completed")
|
||||
Event.__init__(self)
|
||||
self.cached = cached
|
||||
self.parsed = parsed
|
||||
self.skipped = skipped
|
||||
@@ -435,44 +313,33 @@ class ParseCompleted(OperationCompleted):
|
||||
self.masked = masked
|
||||
self.errors = errors
|
||||
self.sofar = cached + parsed
|
||||
|
||||
class ParseProgress(OperationProgress):
|
||||
"""Recipe parsing progress"""
|
||||
def __init__(self, current, total):
|
||||
OperationProgress.__init__(self, current, total, "Recipe parsing")
|
||||
|
||||
|
||||
class CacheLoadStarted(OperationStarted):
|
||||
"""Loading of the dependency cache has begun"""
|
||||
def __init__(self, total):
|
||||
OperationStarted.__init__(self, "Loading cache Started")
|
||||
self.total = total
|
||||
|
||||
class CacheLoadProgress(OperationProgress):
|
||||
"""Cache loading progress"""
|
||||
def __init__(self, current, total):
|
||||
OperationProgress.__init__(self, current, total, "Loading cache")
|
||||
class ParseProgress(Event):
|
||||
"""Recipe parsing progress"""
|
||||
|
||||
class CacheLoadCompleted(OperationCompleted):
|
||||
def __init__(self, current):
|
||||
self.current = current
|
||||
|
||||
class CacheLoadStarted(Event):
|
||||
"""Loading of the dependency cache has begun"""
|
||||
def __init__(self, total):
|
||||
Event.__init__(self)
|
||||
self.total = total
|
||||
|
||||
class CacheLoadProgress(Event):
|
||||
"""Cache loading progress"""
|
||||
def __init__(self, current):
|
||||
Event.__init__(self)
|
||||
self.current = current
|
||||
|
||||
class CacheLoadCompleted(Event):
|
||||
"""Cache loading is complete"""
|
||||
def __init__(self, total, num_entries):
|
||||
OperationCompleted.__init__(self, total, "Loading cache Completed")
|
||||
Event.__init__(self)
|
||||
self.total = total
|
||||
self.num_entries = num_entries
|
||||
|
||||
class TreeDataPreparationStarted(OperationStarted):
|
||||
"""Tree data preparation started"""
|
||||
def __init__(self):
|
||||
OperationStarted.__init__(self, "Preparing tree data Started")
|
||||
|
||||
class TreeDataPreparationProgress(OperationProgress):
|
||||
"""Tree data preparation is in progress"""
|
||||
def __init__(self, current, total):
|
||||
OperationProgress.__init__(self, current, total, "Preparing tree data")
|
||||
|
||||
class TreeDataPreparationCompleted(OperationCompleted):
|
||||
"""Tree data preparation completed"""
|
||||
def __init__(self, total):
|
||||
OperationCompleted.__init__(self, total, "Preparing tree data Completed")
|
||||
|
||||
class DepTreeGenerated(Event):
|
||||
"""
|
||||
@@ -491,24 +358,6 @@ class TargetsTreeGenerated(Event):
|
||||
Event.__init__(self)
|
||||
self._model = model
|
||||
|
||||
class FilesMatchingFound(Event):
|
||||
"""
|
||||
Event when a list of files matching the supplied pattern has
|
||||
been generated
|
||||
"""
|
||||
def __init__(self, pattern, matches):
|
||||
Event.__init__(self)
|
||||
self._pattern = pattern
|
||||
self._matches = matches
|
||||
|
||||
class CoreBaseFilesFound(Event):
|
||||
"""
|
||||
Event when a list of appropriate config files has been generated
|
||||
"""
|
||||
def __init__(self, paths):
|
||||
Event.__init__(self)
|
||||
self._paths = paths
|
||||
|
||||
class ConfigFilesFound(Event):
|
||||
"""
|
||||
Event when a list of appropriate config files has been generated
|
||||
@@ -518,14 +367,6 @@ class ConfigFilesFound(Event):
|
||||
self._variable = variable
|
||||
self._values = values
|
||||
|
||||
class ConfigFilePathFound(Event):
|
||||
"""
|
||||
Event when a path for a config file has been found
|
||||
"""
|
||||
def __init__(self, path):
|
||||
Event.__init__(self)
|
||||
self._path = path
|
||||
|
||||
class MsgBase(Event):
|
||||
"""Base class for messages"""
|
||||
|
||||
@@ -551,75 +392,12 @@ class MsgFatal(MsgBase):
|
||||
class MsgPlain(MsgBase):
|
||||
"""General output"""
|
||||
|
||||
class LogExecTTY(Event):
|
||||
"""Send event containing program to spawn on tty of the logger"""
|
||||
def __init__(self, msg, prog, sleep_delay, retries):
|
||||
Event.__init__(self)
|
||||
self.msg = msg
|
||||
self.prog = prog
|
||||
self.sleep_delay = sleep_delay
|
||||
self.retries = retries
|
||||
|
||||
class LogHandler(logging.Handler):
|
||||
"""Dispatch logging messages as bitbake events"""
|
||||
|
||||
def emit(self, record):
|
||||
if record.exc_info:
|
||||
etype, value, tb = record.exc_info
|
||||
if hasattr(tb, 'tb_next'):
|
||||
tb = list(bb.exceptions.extract_traceback(tb, context=3))
|
||||
record.bb_exc_info = (etype, value, tb)
|
||||
record.exc_info = None
|
||||
fire(record, None)
|
||||
|
||||
def filter(self, record):
|
||||
record.taskpid = worker_pid
|
||||
return True
|
||||
|
||||
class RequestPackageInfo(Event):
|
||||
"""
|
||||
Event to request package information
|
||||
"""
|
||||
|
||||
class PackageInfo(Event):
|
||||
"""
|
||||
Package information for GUI
|
||||
"""
|
||||
def __init__(self, pkginfolist):
|
||||
Event.__init__(self)
|
||||
self._pkginfolist = pkginfolist
|
||||
|
||||
class SanityCheck(Event):
|
||||
"""
|
||||
Event to issue sanity check
|
||||
"""
|
||||
|
||||
class SanityCheckPassed(Event):
|
||||
"""
|
||||
Event to indicate sanity check is passed
|
||||
"""
|
||||
|
||||
class SanityCheckFailed(Event):
|
||||
"""
|
||||
Event to indicate sanity check has failed
|
||||
"""
|
||||
def __init__(self, msg, network_error=False):
|
||||
Event.__init__(self)
|
||||
self._msg = msg
|
||||
self._network_error = network_error
|
||||
|
||||
class NetworkTest(Event):
|
||||
"""
|
||||
Event to start network test
|
||||
"""
|
||||
|
||||
class NetworkTestPassed(Event):
|
||||
"""
|
||||
Event to indicate network test has passed
|
||||
"""
|
||||
|
||||
class NetworkTestFailed(Event):
|
||||
"""
|
||||
Event to indicate network test has failed
|
||||
"""
|
||||
|
||||
|
||||
@@ -1,91 +0,0 @@
|
||||
from __future__ import absolute_import
|
||||
import inspect
|
||||
import traceback
|
||||
import bb.namedtuple_with_abc
|
||||
from collections import namedtuple
|
||||
|
||||
|
||||
class TracebackEntry(namedtuple.abc):
|
||||
"""Pickleable representation of a traceback entry"""
|
||||
_fields = 'filename lineno function args code_context index'
|
||||
_header = ' File "{0.filename}", line {0.lineno}, in {0.function}{0.args}'
|
||||
|
||||
def format(self, formatter=None):
|
||||
if not self.code_context:
|
||||
return self._header.format(self) + '\n'
|
||||
|
||||
formatted = [self._header.format(self) + ':\n']
|
||||
|
||||
for lineindex, line in enumerate(self.code_context):
|
||||
if formatter:
|
||||
line = formatter(line)
|
||||
|
||||
if lineindex == self.index:
|
||||
formatted.append(' >%s' % line)
|
||||
else:
|
||||
formatted.append(' %s' % line)
|
||||
return formatted
|
||||
|
||||
def __str__(self):
|
||||
return ''.join(self.format())
|
||||
|
||||
def _get_frame_args(frame):
|
||||
"""Get the formatted arguments and class (if available) for a frame"""
|
||||
arginfo = inspect.getargvalues(frame)
|
||||
|
||||
try:
|
||||
if not arginfo.args:
|
||||
return '', None
|
||||
# There have been reports from the field of python 2.6 which doesn't
|
||||
# return a namedtuple here but simply a tuple so fallback gracefully if
|
||||
# args isn't present.
|
||||
except AttributeError:
|
||||
return '', None
|
||||
|
||||
firstarg = arginfo.args[0]
|
||||
if firstarg == 'self':
|
||||
self = arginfo.locals['self']
|
||||
cls = self.__class__.__name__
|
||||
|
||||
arginfo.args.pop(0)
|
||||
del arginfo.locals['self']
|
||||
else:
|
||||
cls = None
|
||||
|
||||
formatted = inspect.formatargvalues(*arginfo)
|
||||
return formatted, cls
|
||||
|
||||
def extract_traceback(tb, context=1):
|
||||
frames = inspect.getinnerframes(tb, context)
|
||||
for frame, filename, lineno, function, code_context, index in frames:
|
||||
formatted_args, cls = _get_frame_args(frame)
|
||||
if cls:
|
||||
function = '%s.%s' % (cls, function)
|
||||
yield TracebackEntry(filename, lineno, function, formatted_args,
|
||||
code_context, index)
|
||||
|
||||
def format_extracted(extracted, formatter=None, limit=None):
|
||||
if limit:
|
||||
extracted = extracted[-limit:]
|
||||
|
||||
formatted = []
|
||||
for tracebackinfo in extracted:
|
||||
formatted.extend(tracebackinfo.format(formatter))
|
||||
return formatted
|
||||
|
||||
|
||||
def format_exception(etype, value, tb, context=1, limit=None, formatter=None):
|
||||
formatted = ['Traceback (most recent call last):\n']
|
||||
|
||||
if hasattr(tb, 'tb_next'):
|
||||
tb = extract_traceback(tb, context)
|
||||
|
||||
formatted.extend(format_extracted(tb, formatter, limit))
|
||||
formatted.extend(traceback.format_exception_only(etype, value))
|
||||
return formatted
|
||||
|
||||
def to_string(exc):
|
||||
if isinstance(exc, SystemExit):
|
||||
if not isinstance(exc.code, basestring):
|
||||
return 'Exited with "%d"' % exc.code
|
||||
return str(exc)
|
||||
836
bitbake/lib/bb/fetch/__init__.py
Normal file
836
bitbake/lib/bb/fetch/__init__.py
Normal file
@@ -0,0 +1,836 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
from __future__ import absolute_import
|
||||
from __future__ import print_function
|
||||
import os, re
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb import persist_data
|
||||
from bb import utils
|
||||
|
||||
__version__ = "1"
|
||||
|
||||
logger = logging.getLogger("BitBake.Fetch")
|
||||
|
||||
class MalformedUrl(Exception):
|
||||
"""Exception raised when encountering an invalid url"""
|
||||
|
||||
class FetchError(Exception):
|
||||
"""Exception raised when a download fails"""
|
||||
|
||||
class NoMethodError(Exception):
|
||||
"""Exception raised when there is no method to obtain a supplied url or set of urls"""
|
||||
|
||||
class MissingParameterError(Exception):
|
||||
"""Exception raised when a fetch method is missing a critical parameter in the url"""
|
||||
|
||||
class ParameterError(Exception):
|
||||
"""Exception raised when a url cannot be proccessed due to invalid parameters."""
|
||||
|
||||
class MD5SumError(Exception):
|
||||
"""Exception raised when a MD5SUM of a file does not match the expected one"""
|
||||
|
||||
class InvalidSRCREV(Exception):
|
||||
"""Exception raised when an invalid SRCREV is encountered"""
|
||||
|
||||
def decodeurl(url):
|
||||
"""Decodes an URL into the tokens (scheme, network location, path,
|
||||
user, password, parameters).
|
||||
"""
|
||||
|
||||
m = re.compile('(?P<type>[^:]*)://((?P<user>.+)@)?(?P<location>[^;]+)(;(?P<parm>.*))?').match(url)
|
||||
if not m:
|
||||
raise MalformedUrl(url)
|
||||
|
||||
type = m.group('type')
|
||||
location = m.group('location')
|
||||
if not location:
|
||||
raise MalformedUrl(url)
|
||||
user = m.group('user')
|
||||
parm = m.group('parm')
|
||||
|
||||
locidx = location.find('/')
|
||||
if locidx != -1 and type.lower() != 'file':
|
||||
host = location[:locidx]
|
||||
path = location[locidx:]
|
||||
else:
|
||||
host = ""
|
||||
path = location
|
||||
if user:
|
||||
m = re.compile('(?P<user>[^:]+)(:?(?P<pswd>.*))').match(user)
|
||||
if m:
|
||||
user = m.group('user')
|
||||
pswd = m.group('pswd')
|
||||
else:
|
||||
user = ''
|
||||
pswd = ''
|
||||
|
||||
p = {}
|
||||
if parm:
|
||||
for s in parm.split(';'):
|
||||
s1, s2 = s.split('=')
|
||||
p[s1] = s2
|
||||
|
||||
return (type, host, path, user, pswd, p)
|
||||
|
||||
def encodeurl(decoded):
|
||||
"""Encodes a URL from tokens (scheme, network location, path,
|
||||
user, password, parameters).
|
||||
"""
|
||||
|
||||
(type, host, path, user, pswd, p) = decoded
|
||||
|
||||
if not type or not path:
|
||||
raise MissingParameterError("Type or path url components missing when encoding %s" % decoded)
|
||||
url = '%s://' % type
|
||||
if user:
|
||||
url += "%s" % user
|
||||
if pswd:
|
||||
url += ":%s" % pswd
|
||||
url += "@"
|
||||
if host:
|
||||
url += "%s" % host
|
||||
url += "%s" % path
|
||||
if p:
|
||||
for parm in p:
|
||||
url += ";%s=%s" % (parm, p[parm])
|
||||
|
||||
return url
|
||||
|
||||
def uri_replace(uri, uri_find, uri_replace, d):
|
||||
if not uri or not uri_find or not uri_replace:
|
||||
logger.debug(1, "uri_replace: passed an undefined value, not replacing")
|
||||
uri_decoded = list(decodeurl(uri))
|
||||
uri_find_decoded = list(decodeurl(uri_find))
|
||||
uri_replace_decoded = list(decodeurl(uri_replace))
|
||||
result_decoded = ['', '', '', '', '', {}]
|
||||
for i in uri_find_decoded:
|
||||
loc = uri_find_decoded.index(i)
|
||||
result_decoded[loc] = uri_decoded[loc]
|
||||
if isinstance(i, basestring):
|
||||
if (re.match(i, uri_decoded[loc])):
|
||||
result_decoded[loc] = re.sub(i, uri_replace_decoded[loc], uri_decoded[loc])
|
||||
if uri_find_decoded.index(i) == 2:
|
||||
if d:
|
||||
localfn = bb.fetch.localpath(uri, d)
|
||||
if localfn:
|
||||
result_decoded[loc] = os.path.join(os.path.dirname(result_decoded[loc]), os.path.basename(bb.fetch.localpath(uri, d)))
|
||||
else:
|
||||
return uri
|
||||
return encodeurl(result_decoded)
|
||||
|
||||
methods = []
|
||||
urldata_cache = {}
|
||||
saved_headrevs = {}
|
||||
|
||||
def fetcher_init(d):
|
||||
"""
|
||||
Called to initialize the fetchers once the configuration data is known.
|
||||
Calls before this must not hit the cache.
|
||||
"""
|
||||
pd = persist_data.persist(d)
|
||||
# When to drop SCM head revisions controlled by user policy
|
||||
srcrev_policy = bb.data.getVar('BB_SRCREV_POLICY', d, 1) or "clear"
|
||||
if srcrev_policy == "cache":
|
||||
logger.debug(1, "Keeping SRCREV cache due to cache policy of: %s", srcrev_policy)
|
||||
elif srcrev_policy == "clear":
|
||||
logger.debug(1, "Clearing SRCREV cache due to cache policy of: %s", srcrev_policy)
|
||||
try:
|
||||
bb.fetch.saved_headrevs = pd['BB_URI_HEADREVS'].items()
|
||||
except:
|
||||
pass
|
||||
del pd['BB_URI_HEADREVS']
|
||||
else:
|
||||
raise FetchError("Invalid SRCREV cache policy of: %s" % srcrev_policy)
|
||||
|
||||
for m in methods:
|
||||
if hasattr(m, "init"):
|
||||
m.init(d)
|
||||
|
||||
def fetcher_compare_revisions(d):
|
||||
"""
|
||||
Compare the revisions in the persistant cache with current values and
|
||||
return true/false on whether they've changed.
|
||||
"""
|
||||
|
||||
pd = persist_data.persist(d)
|
||||
data = pd['BB_URI_HEADREVS'].items()
|
||||
data2 = bb.fetch.saved_headrevs
|
||||
|
||||
changed = False
|
||||
for key in data:
|
||||
if key not in data2 or data2[key] != data[key]:
|
||||
logger.debug(1, "%s changed", key)
|
||||
changed = True
|
||||
return True
|
||||
else:
|
||||
logger.debug(2, "%s did not change", key)
|
||||
return False
|
||||
|
||||
# Function call order is usually:
|
||||
# 1. init
|
||||
# 2. go
|
||||
# 3. localpaths
|
||||
# localpath can be called at any time
|
||||
|
||||
def init(urls, d, setup = True):
|
||||
urldata = {}
|
||||
|
||||
fn = bb.data.getVar('FILE', d, 1)
|
||||
if fn in urldata_cache:
|
||||
urldata = urldata_cache[fn]
|
||||
|
||||
for url in urls:
|
||||
if url not in urldata:
|
||||
urldata[url] = FetchData(url, d)
|
||||
|
||||
if setup:
|
||||
for url in urldata:
|
||||
if not urldata[url].setup:
|
||||
urldata[url].setup_localpath(d)
|
||||
|
||||
urldata_cache[fn] = urldata
|
||||
return urldata
|
||||
|
||||
def mirror_from_string(data):
|
||||
return [ i.split() for i in (data or "").replace('\\n','\n').split('\n') if i ]
|
||||
|
||||
def verify_checksum(u, ud, d):
|
||||
"""
|
||||
verify the MD5 and SHA256 checksum for downloaded src
|
||||
|
||||
return value:
|
||||
- True: checksum matched
|
||||
- False: checksum unmatched
|
||||
|
||||
if checksum is missing in recipes file, "BB_STRICT_CHECKSUM" decide the return value.
|
||||
if BB_STRICT_CHECKSUM = "1" then return false as unmatched, otherwise return true as
|
||||
matched
|
||||
"""
|
||||
|
||||
if not ud.type in ["http", "https", "ftp", "ftps"]:
|
||||
return
|
||||
|
||||
md5data = bb.utils.md5_file(ud.localpath)
|
||||
sha256data = bb.utils.sha256_file(ud.localpath)
|
||||
|
||||
if (ud.md5_expected == None or ud.sha256_expected == None):
|
||||
logger.warn('Missing SRC_URI checksum for %s, consider adding to the recipe:\n'
|
||||
'SRC_URI[%s] = "%s"\nSRC_URI[%s] = "%s"',
|
||||
ud.localpath, ud.md5_name, md5data,
|
||||
ud.sha256_name, sha256data)
|
||||
if bb.data.getVar("BB_STRICT_CHECKSUM", d, True) == "1":
|
||||
raise FetchError("No checksum specified for %s." % u)
|
||||
return
|
||||
|
||||
if (ud.md5_expected != md5data or ud.sha256_expected != sha256data):
|
||||
logger.error('The checksums for "%s" did not match.\n'
|
||||
' MD5: expected "%s", got "%s"\n'
|
||||
' SHA256: expected "%s", got "%s"\n',
|
||||
ud.localpath, ud.md5_expected, md5data,
|
||||
ud.sha256_expected, sha256data)
|
||||
raise FetchError("%s checksum mismatch." % u)
|
||||
|
||||
def go(d, urls = None):
|
||||
"""
|
||||
Fetch all urls
|
||||
init must have previously been called
|
||||
"""
|
||||
if not urls:
|
||||
urls = d.getVar("SRC_URI", 1).split()
|
||||
urldata = init(urls, d, True)
|
||||
|
||||
for u in urls:
|
||||
ud = urldata[u]
|
||||
m = ud.method
|
||||
localpath = ""
|
||||
|
||||
if not ud.localfile:
|
||||
continue
|
||||
|
||||
lf = bb.utils.lockfile(ud.lockfile)
|
||||
|
||||
if m.try_premirror(u, ud, d):
|
||||
# First try fetching uri, u, from PREMIRRORS
|
||||
mirrors = mirror_from_string(bb.data.getVar('PREMIRRORS', d, True))
|
||||
localpath = try_mirrors(d, u, mirrors, False, m.forcefetch(u, ud, d))
|
||||
elif os.path.exists(ud.localfile):
|
||||
localpath = ud.localfile
|
||||
|
||||
# Need to re-test forcefetch() which will return true if our copy is too old
|
||||
if m.forcefetch(u, ud, d) or not localpath:
|
||||
# Next try fetching from the original uri, u
|
||||
try:
|
||||
m.go(u, ud, d)
|
||||
localpath = ud.localpath
|
||||
except FetchError:
|
||||
# Remove any incomplete file
|
||||
bb.utils.remove(ud.localpath)
|
||||
# Finally, try fetching uri, u, from MIRRORS
|
||||
mirrors = mirror_from_string(bb.data.getVar('MIRRORS', d, True))
|
||||
localpath = try_mirrors (d, u, mirrors)
|
||||
if not localpath or not os.path.exists(localpath):
|
||||
raise FetchError("Unable to fetch URL %s from any source." % u)
|
||||
|
||||
ud.localpath = localpath
|
||||
|
||||
if os.path.exists(ud.md5):
|
||||
# Touch the md5 file to show active use of the download
|
||||
try:
|
||||
os.utime(ud.md5, None)
|
||||
except:
|
||||
# Errors aren't fatal here
|
||||
pass
|
||||
else:
|
||||
# Only check the checksums if we've not seen this item before
|
||||
verify_checksum(u, ud, d)
|
||||
Fetch.write_md5sum(u, ud, d)
|
||||
|
||||
bb.utils.unlockfile(lf)
|
||||
|
||||
def checkstatus(d, urls = None):
|
||||
"""
|
||||
Check all urls exist upstream
|
||||
init must have previously been called
|
||||
"""
|
||||
urldata = init([], d, True)
|
||||
|
||||
if not urls:
|
||||
urls = urldata
|
||||
|
||||
for u in urls:
|
||||
ud = urldata[u]
|
||||
m = ud.method
|
||||
logger.debug(1, "Testing URL %s", u)
|
||||
# First try checking uri, u, from PREMIRRORS
|
||||
mirrors = mirror_from_string(bb.data.getVar('PREMIRRORS', d, True))
|
||||
ret = try_mirrors(d, u, mirrors, True)
|
||||
if not ret:
|
||||
# Next try checking from the original uri, u
|
||||
try:
|
||||
ret = m.checkstatus(u, ud, d)
|
||||
except:
|
||||
# Finally, try checking uri, u, from MIRRORS
|
||||
mirrors = mirror_from_string(bb.data.getVar('MIRRORS', d, True))
|
||||
ret = try_mirrors (d, u, mirrors, True)
|
||||
|
||||
if not ret:
|
||||
raise FetchError("URL %s doesn't work" % u)
|
||||
|
||||
def localpaths(d):
|
||||
"""
|
||||
Return a list of the local filenames, assuming successful fetch
|
||||
"""
|
||||
local = []
|
||||
urldata = init([], d, True)
|
||||
|
||||
for u in urldata:
|
||||
ud = urldata[u]
|
||||
local.append(ud.localpath)
|
||||
|
||||
return local
|
||||
|
||||
srcrev_internal_call = False
|
||||
|
||||
def get_autorev(d):
|
||||
return get_srcrev(d)
|
||||
|
||||
def get_srcrev(d):
|
||||
"""
|
||||
Return the version string for the current package
|
||||
(usually to be used as PV)
|
||||
Most packages usually only have one SCM so we just pass on the call.
|
||||
In the multi SCM case, we build a value based on SRCREV_FORMAT which must
|
||||
have been set.
|
||||
"""
|
||||
|
||||
#
|
||||
# Ugly code alert. localpath in the fetchers will try to evaluate SRCREV which
|
||||
# could translate into a call to here. If it does, we need to catch this
|
||||
# and provide some way so it knows get_srcrev is active instead of being
|
||||
# some number etc. hence the srcrev_internal_call tracking and the magic
|
||||
# "SRCREVINACTION" return value.
|
||||
#
|
||||
# Neater solutions welcome!
|
||||
#
|
||||
if bb.fetch.srcrev_internal_call:
|
||||
return "SRCREVINACTION"
|
||||
|
||||
scms = []
|
||||
|
||||
# Only call setup_localpath on URIs which supports_srcrev()
|
||||
urldata = init(bb.data.getVar('SRC_URI', d, 1).split(), d, False)
|
||||
for u in urldata:
|
||||
ud = urldata[u]
|
||||
if ud.method.supports_srcrev():
|
||||
if not ud.setup:
|
||||
ud.setup_localpath(d)
|
||||
scms.append(u)
|
||||
|
||||
if len(scms) == 0:
|
||||
logger.error("SRCREV was used yet no valid SCM was found in SRC_URI")
|
||||
raise ParameterError
|
||||
|
||||
if bb.data.getVar('BB_SRCREV_POLICY', d, True) != "cache":
|
||||
bb.data.setVar('__BB_DONT_CACHE', '1', d)
|
||||
|
||||
if len(scms) == 1:
|
||||
return urldata[scms[0]].method.sortable_revision(scms[0], urldata[scms[0]], d)
|
||||
|
||||
#
|
||||
# Mutiple SCMs are in SRC_URI so we resort to SRCREV_FORMAT
|
||||
#
|
||||
format = bb.data.getVar('SRCREV_FORMAT', d, 1)
|
||||
if not format:
|
||||
logger.error("The SRCREV_FORMAT variable must be set when multiple SCMs are used.")
|
||||
raise ParameterError
|
||||
|
||||
for scm in scms:
|
||||
if 'name' in urldata[scm].parm:
|
||||
name = urldata[scm].parm["name"]
|
||||
rev = urldata[scm].method.sortable_revision(scm, urldata[scm], d)
|
||||
format = format.replace(name, rev)
|
||||
|
||||
return format
|
||||
|
||||
def localpath(url, d, cache = True):
|
||||
"""
|
||||
Called from the parser with cache=False since the cache isn't ready
|
||||
at this point. Also called from classed in OE e.g. patch.bbclass
|
||||
"""
|
||||
ud = init([url], d)
|
||||
if ud[url].method:
|
||||
return ud[url].localpath
|
||||
return url
|
||||
|
||||
def runfetchcmd(cmd, d, quiet = False):
|
||||
"""
|
||||
Run cmd returning the command output
|
||||
Raise an error if interrupted or cmd fails
|
||||
Optionally echo command output to stdout
|
||||
"""
|
||||
|
||||
# Need to export PATH as binary could be in metadata paths
|
||||
# rather than host provided
|
||||
# Also include some other variables.
|
||||
# FIXME: Should really include all export varaiables?
|
||||
exportvars = ['PATH', 'GIT_PROXY_COMMAND', 'GIT_PROXY_HOST',
|
||||
'GIT_PROXY_PORT', 'GIT_CONFIG', 'http_proxy', 'ftp_proxy',
|
||||
'https_proxy', 'no_proxy', 'ALL_PROXY', 'all_proxy',
|
||||
'KRB5CCNAME', 'SSH_AUTH_SOCK', 'SSH_AGENT_PID', 'HOME']
|
||||
|
||||
for var in exportvars:
|
||||
val = data.getVar(var, d, True)
|
||||
if val:
|
||||
cmd = 'export ' + var + '=\"%s\"; %s' % (val, cmd)
|
||||
|
||||
logger.debug(1, "Running %s", cmd)
|
||||
|
||||
# redirect stderr to stdout
|
||||
stdout_handle = os.popen(cmd + " 2>&1", "r")
|
||||
output = ""
|
||||
|
||||
while True:
|
||||
line = stdout_handle.readline()
|
||||
if not line:
|
||||
break
|
||||
if not quiet:
|
||||
print(line, end=' ')
|
||||
output += line
|
||||
|
||||
status = stdout_handle.close() or 0
|
||||
signal = status >> 8
|
||||
exitstatus = status & 0xff
|
||||
|
||||
if signal:
|
||||
raise FetchError("Fetch command %s failed with signal %s, output:\n%s" % (cmd, signal, output))
|
||||
elif status != 0:
|
||||
raise FetchError("Fetch command %s failed with exit code %s, output:\n%s" % (cmd, status, output))
|
||||
|
||||
return output
|
||||
|
||||
def try_mirrors(d, uri, mirrors, check = False, force = False):
|
||||
"""
|
||||
Try to use a mirrored version of the sources.
|
||||
This method will be automatically called before the fetchers go.
|
||||
|
||||
d Is a bb.data instance
|
||||
uri is the original uri we're trying to download
|
||||
mirrors is the list of mirrors we're going to try
|
||||
"""
|
||||
fpath = os.path.join(data.getVar("DL_DIR", d, 1), os.path.basename(uri))
|
||||
if not check and os.access(fpath, os.R_OK) and not force:
|
||||
logger.debug(1, "%s already exists, skipping checkout.", fpath)
|
||||
return fpath
|
||||
|
||||
ld = d.createCopy()
|
||||
for (find, replace) in mirrors:
|
||||
newuri = uri_replace(uri, find, replace, ld)
|
||||
if newuri != uri:
|
||||
try:
|
||||
ud = FetchData(newuri, ld)
|
||||
except bb.fetch.NoMethodError:
|
||||
logger.debug(1, "No method for %s", uri)
|
||||
continue
|
||||
|
||||
ud.setup_localpath(ld)
|
||||
|
||||
try:
|
||||
if check:
|
||||
found = ud.method.checkstatus(newuri, ud, ld)
|
||||
if found:
|
||||
return found
|
||||
else:
|
||||
ud.method.go(newuri, ud, ld)
|
||||
return ud.localpath
|
||||
except (bb.fetch.MissingParameterError,
|
||||
bb.fetch.FetchError,
|
||||
bb.fetch.MD5SumError):
|
||||
import sys
|
||||
(type, value, traceback) = sys.exc_info()
|
||||
logger.debug(2, "Mirror fetch failure: %s", value)
|
||||
bb.utils.remove(ud.localpath)
|
||||
continue
|
||||
return None
|
||||
|
||||
|
||||
class FetchData(object):
|
||||
"""
|
||||
A class which represents the fetcher state for a given URI.
|
||||
"""
|
||||
def __init__(self, url, d):
|
||||
self.localfile = ""
|
||||
(self.type, self.host, self.path, self.user, self.pswd, self.parm) = decodeurl(data.expand(url, d))
|
||||
self.date = Fetch.getSRCDate(self, d)
|
||||
self.url = url
|
||||
if not self.user and "user" in self.parm:
|
||||
self.user = self.parm["user"]
|
||||
if not self.pswd and "pswd" in self.parm:
|
||||
self.pswd = self.parm["pswd"]
|
||||
self.setup = False
|
||||
|
||||
if "name" in self.parm:
|
||||
self.md5_name = "%s.md5sum" % self.parm["name"]
|
||||
self.sha256_name = "%s.sha256sum" % self.parm["name"]
|
||||
else:
|
||||
self.md5_name = "md5sum"
|
||||
self.sha256_name = "sha256sum"
|
||||
self.md5_expected = bb.data.getVarFlag("SRC_URI", self.md5_name, d)
|
||||
self.sha256_expected = bb.data.getVarFlag("SRC_URI", self.sha256_name, d)
|
||||
|
||||
for m in methods:
|
||||
if m.supports(url, self, d):
|
||||
self.method = m
|
||||
return
|
||||
raise NoMethodError("Missing implementation for url %s" % url)
|
||||
|
||||
def setup_localpath(self, d):
|
||||
self.setup = True
|
||||
if "localpath" in self.parm:
|
||||
# if user sets localpath for file, use it instead.
|
||||
self.localpath = self.parm["localpath"]
|
||||
self.basename = os.path.basename(self.localpath)
|
||||
else:
|
||||
premirrors = bb.data.getVar('PREMIRRORS', d, True)
|
||||
local = ""
|
||||
if premirrors and self.url:
|
||||
aurl = self.url.split(";")[0]
|
||||
mirrors = mirror_from_string(premirrors)
|
||||
for (find, replace) in mirrors:
|
||||
if replace.startswith("file://"):
|
||||
path = aurl.split("://")[1]
|
||||
path = path.split(";")[0]
|
||||
local = replace.split("://")[1] + os.path.basename(path)
|
||||
if local == aurl or not os.path.exists(local) or os.path.isdir(local):
|
||||
local = ""
|
||||
self.localpath = local
|
||||
if not local:
|
||||
try:
|
||||
bb.fetch.srcrev_internal_call = True
|
||||
self.localpath = self.method.localpath(self.url, self, d)
|
||||
finally:
|
||||
bb.fetch.srcrev_internal_call = False
|
||||
# We have to clear data's internal caches since the cached value of SRCREV is now wrong.
|
||||
# Horrible...
|
||||
bb.data.delVar("ISHOULDNEVEREXIST", d)
|
||||
|
||||
if self.localpath is not None:
|
||||
# Note: These files should always be in DL_DIR whereas localpath may not be.
|
||||
basepath = bb.data.expand("${DL_DIR}/%s" % os.path.basename(self.localpath), d)
|
||||
self.md5 = basepath + '.md5'
|
||||
self.lockfile = basepath + '.lock'
|
||||
|
||||
|
||||
class Fetch(object):
|
||||
"""Base class for 'fetch'ing data"""
|
||||
|
||||
def __init__(self, urls = []):
|
||||
self.urls = []
|
||||
|
||||
def supports(self, url, urldata, d):
|
||||
"""
|
||||
Check to see if this fetch class supports a given url.
|
||||
"""
|
||||
return 0
|
||||
|
||||
def localpath(self, url, urldata, d):
|
||||
"""
|
||||
Return the local filename of a given url assuming a successful fetch.
|
||||
Can also setup variables in urldata for use in go (saving code duplication
|
||||
and duplicate code execution)
|
||||
"""
|
||||
return url
|
||||
def _strip_leading_slashes(self, relpath):
|
||||
"""
|
||||
Remove leading slash as os.path.join can't cope
|
||||
"""
|
||||
while os.path.isabs(relpath):
|
||||
relpath = relpath[1:]
|
||||
return relpath
|
||||
|
||||
def setUrls(self, urls):
|
||||
self.__urls = urls
|
||||
|
||||
def getUrls(self):
|
||||
return self.__urls
|
||||
|
||||
urls = property(getUrls, setUrls, None, "Urls property")
|
||||
|
||||
def forcefetch(self, url, urldata, d):
|
||||
"""
|
||||
Force a fetch, even if localpath exists?
|
||||
"""
|
||||
return False
|
||||
|
||||
def supports_srcrev(self):
|
||||
"""
|
||||
The fetcher supports auto source revisions (SRCREV)
|
||||
"""
|
||||
return False
|
||||
|
||||
def go(self, url, urldata, d):
|
||||
"""
|
||||
Fetch urls
|
||||
Assumes localpath was called first
|
||||
"""
|
||||
raise NoMethodError("Missing implementation for url")
|
||||
|
||||
def try_premirror(self, url, urldata, d):
|
||||
"""
|
||||
Should premirrors be used?
|
||||
"""
|
||||
if urldata.method.forcefetch(url, urldata, d):
|
||||
return True
|
||||
elif os.path.exists(urldata.md5) and os.path.exists(urldata.localfile):
|
||||
return False
|
||||
else:
|
||||
return True
|
||||
|
||||
def checkstatus(self, url, urldata, d):
|
||||
"""
|
||||
Check the status of a URL
|
||||
Assumes localpath was called first
|
||||
"""
|
||||
logger.info("URL %s could not be checked for status since no method exists.", url)
|
||||
return True
|
||||
|
||||
def getSRCDate(urldata, d):
|
||||
"""
|
||||
Return the SRC Date for the component
|
||||
|
||||
d the bb.data module
|
||||
"""
|
||||
if "srcdate" in urldata.parm:
|
||||
return urldata.parm['srcdate']
|
||||
|
||||
pn = data.getVar("PN", d, 1)
|
||||
|
||||
if pn:
|
||||
return data.getVar("SRCDATE_%s" % pn, d, 1) or data.getVar("CVSDATE_%s" % pn, d, 1) or data.getVar("SRCDATE", d, 1) or data.getVar("CVSDATE", d, 1) or data.getVar("DATE", d, 1)
|
||||
|
||||
return data.getVar("SRCDATE", d, 1) or data.getVar("CVSDATE", d, 1) or data.getVar("DATE", d, 1)
|
||||
getSRCDate = staticmethod(getSRCDate)
|
||||
|
||||
def srcrev_internal_helper(ud, d):
|
||||
"""
|
||||
Return:
|
||||
a) a source revision if specified
|
||||
b) True if auto srcrev is in action
|
||||
c) False otherwise
|
||||
"""
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
return ud.parm['rev']
|
||||
|
||||
if 'tag' in ud.parm:
|
||||
return ud.parm['tag']
|
||||
|
||||
rev = None
|
||||
if 'name' in ud.parm:
|
||||
pn = data.getVar("PN", d, 1)
|
||||
rev = data.getVar("SRCREV_%s_pn-%s" % (ud.parm['name'], pn), d, 1)
|
||||
if not rev:
|
||||
rev = data.getVar("SRCREV_pn-%s_%s" % (pn, ud.parm['name']), d, 1)
|
||||
if not rev:
|
||||
rev = data.getVar("SRCREV_%s" % (ud.parm['name']), d, 1)
|
||||
if not rev:
|
||||
rev = data.getVar("SRCREV", d, 1)
|
||||
if rev == "INVALID":
|
||||
raise InvalidSRCREV("Please set SRCREV to a valid value")
|
||||
if not rev:
|
||||
return False
|
||||
if rev == "SRCREVINACTION":
|
||||
return True
|
||||
return rev
|
||||
|
||||
srcrev_internal_helper = staticmethod(srcrev_internal_helper)
|
||||
|
||||
def localcount_internal_helper(ud, d):
|
||||
"""
|
||||
Return:
|
||||
a) a locked localcount if specified
|
||||
b) None otherwise
|
||||
"""
|
||||
|
||||
localcount = None
|
||||
if 'name' in ud.parm:
|
||||
pn = data.getVar("PN", d, 1)
|
||||
localcount = data.getVar("LOCALCOUNT_" + ud.parm['name'], d, 1)
|
||||
if not localcount:
|
||||
localcount = data.getVar("LOCALCOUNT", d, 1)
|
||||
return localcount
|
||||
|
||||
localcount_internal_helper = staticmethod(localcount_internal_helper)
|
||||
|
||||
def verify_md5sum(ud, got_sum):
|
||||
"""
|
||||
Verify the md5sum we wanted with the one we got
|
||||
"""
|
||||
wanted_sum = ud.parm.get('md5sum')
|
||||
if not wanted_sum:
|
||||
return True
|
||||
|
||||
return wanted_sum == got_sum
|
||||
verify_md5sum = staticmethod(verify_md5sum)
|
||||
|
||||
def write_md5sum(url, ud, d):
|
||||
md5data = bb.utils.md5_file(ud.localpath)
|
||||
# verify the md5sum
|
||||
if not Fetch.verify_md5sum(ud, md5data):
|
||||
raise MD5SumError(url)
|
||||
|
||||
md5out = file(ud.md5, 'w')
|
||||
md5out.write(md5data)
|
||||
md5out.close()
|
||||
write_md5sum = staticmethod(write_md5sum)
|
||||
|
||||
def latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Look in the cache for the latest revision, if not present ask the SCM.
|
||||
"""
|
||||
if not hasattr(self, "_latest_revision"):
|
||||
raise ParameterError
|
||||
|
||||
pd = persist_data.persist(d)
|
||||
revs = pd['BB_URI_HEADREVS']
|
||||
key = self.generate_revision_key(url, ud, d)
|
||||
rev = revs[key]
|
||||
if rev != None:
|
||||
return str(rev)
|
||||
|
||||
revs[key] = rev = self._latest_revision(url, ud, d)
|
||||
return rev
|
||||
|
||||
def sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
|
||||
"""
|
||||
if hasattr(self, "_sortable_revision"):
|
||||
return self._sortable_revision(url, ud, d)
|
||||
|
||||
pd = persist_data.persist(d)
|
||||
localcounts = pd['BB_URI_LOCALCOUNT']
|
||||
key = self.generate_revision_key(url, ud, d)
|
||||
|
||||
latest_rev = self._build_revision(url, ud, d)
|
||||
last_rev = localcounts[key + '_rev']
|
||||
uselocalcount = bb.data.getVar("BB_LOCALCOUNT_OVERRIDE", d, True) or False
|
||||
count = None
|
||||
if uselocalcount:
|
||||
count = Fetch.localcount_internal_helper(ud, d)
|
||||
if count is None:
|
||||
count = localcounts[key + '_count']
|
||||
|
||||
if last_rev == latest_rev:
|
||||
return str(count + "+" + latest_rev)
|
||||
|
||||
buildindex_provided = hasattr(self, "_sortable_buildindex")
|
||||
if buildindex_provided:
|
||||
count = self._sortable_buildindex(url, ud, d, latest_rev)
|
||||
|
||||
if count is None:
|
||||
count = "0"
|
||||
elif uselocalcount or buildindex_provided:
|
||||
count = str(count)
|
||||
else:
|
||||
count = str(int(count) + 1)
|
||||
|
||||
localcounts[key + '_rev'] = latest_rev
|
||||
localcounts[key + '_count'] = count
|
||||
|
||||
return str(count + "+" + latest_rev)
|
||||
|
||||
def generate_revision_key(self, url, ud, d):
|
||||
key = self._revision_key(url, ud, d)
|
||||
return "%s-%s" % (key, bb.data.getVar("PN", d, True) or "")
|
||||
|
||||
from . import cvs
|
||||
from . import git
|
||||
from . import local
|
||||
from . import svn
|
||||
from . import wget
|
||||
from . import svk
|
||||
from . import ssh
|
||||
from . import perforce
|
||||
from . import bzr
|
||||
from . import hg
|
||||
from . import osc
|
||||
from . import repo
|
||||
|
||||
methods.append(local.Local())
|
||||
methods.append(wget.Wget())
|
||||
methods.append(svn.Svn())
|
||||
methods.append(git.Git())
|
||||
methods.append(cvs.Cvs())
|
||||
methods.append(svk.Svk())
|
||||
methods.append(ssh.SSH())
|
||||
methods.append(perforce.Perforce())
|
||||
methods.append(bzr.Bzr())
|
||||
methods.append(hg.Hg())
|
||||
methods.append(osc.Osc())
|
||||
methods.append(repo.Repo())
|
||||
148
bitbake/lib/bb/fetch/bzr.py
Normal file
148
bitbake/lib/bb/fetch/bzr.py
Normal file
@@ -0,0 +1,148 @@
|
||||
"""
|
||||
BitBake 'Fetch' implementation for bzr.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2007 Ross Burton
|
||||
# Copyright (C) 2007 Richard Purdie
|
||||
#
|
||||
# Classes for obtaining upstream sources for the
|
||||
# BitBake build tools.
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch, FetchError, runfetchcmd, logger
|
||||
|
||||
class Bzr(Fetch):
|
||||
def supports(self, url, ud, d):
|
||||
return ud.type in ['bzr']
|
||||
|
||||
def localpath (self, url, ud, d):
|
||||
|
||||
# Create paths to bzr checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(data.expand('${BZRDIR}', d), ud.host, relpath)
|
||||
|
||||
revision = Fetch.srcrev_internal_helper(ud, d)
|
||||
if revision is True:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
elif revision:
|
||||
ud.revision = revision
|
||||
|
||||
if not ud.revision:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
|
||||
ud.localfile = data.expand('bzr_%s_%s_%s.tar.gz' % (ud.host, ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def _buildbzrcommand(self, ud, d, command):
|
||||
"""
|
||||
Build up an bzr commandline based on ud
|
||||
command is "fetch", "update", "revno"
|
||||
"""
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_bzr}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'http')
|
||||
|
||||
bzrroot = ud.host + ud.path
|
||||
|
||||
options = []
|
||||
|
||||
if command is "revno":
|
||||
bzrcmd = "%s revno %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
else:
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
if command is "fetch":
|
||||
bzrcmd = "%s co %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
elif command is "update":
|
||||
bzrcmd = "%s pull %s --overwrite" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid bzr command %s" % command)
|
||||
|
||||
return bzrcmd
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
if os.access(os.path.join(ud.pkgdir, os.path.basename(ud.pkgdir), '.bzr'), os.R_OK):
|
||||
bzrcmd = self._buildbzrcommand(ud, d, "update")
|
||||
logger.debug(1, "BZR Update %s", loc)
|
||||
os.chdir(os.path.join (ud.pkgdir, os.path.basename(ud.path)))
|
||||
runfetchcmd(bzrcmd, d)
|
||||
else:
|
||||
bb.utils.remove(os.path.join(ud.pkgdir, os.path.basename(ud.pkgdir)), True)
|
||||
bzrcmd = self._buildbzrcommand(ud, d, "fetch")
|
||||
logger.debug(1, "BZR Checkout %s", loc)
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", bzrcmd)
|
||||
runfetchcmd(bzrcmd, d)
|
||||
|
||||
os.chdir(ud.pkgdir)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude '.bzr' --exclude '.bzrtags'"
|
||||
|
||||
# tar them up to a defined filename
|
||||
try:
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(ud.pkgdir)), d)
|
||||
except:
|
||||
t, v, tb = sys.exc_info()
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise t, v, tb
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
def _revision_key(self, url, ud, d):
|
||||
"""
|
||||
Return a unique key for the url
|
||||
"""
|
||||
return "bzr:" + ud.pkgdir
|
||||
|
||||
def _latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Return the latest upstream revision number
|
||||
"""
|
||||
logger.debug(2, "BZR fetcher hitting network for %s", url)
|
||||
|
||||
output = runfetchcmd(self._buildbzrcommand(ud, d, "revno"), d, True)
|
||||
|
||||
return output.strip()
|
||||
|
||||
def _sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
Return a sortable revision number which in our case is the revision number
|
||||
"""
|
||||
|
||||
return self._build_revision(url, ud, d)
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
172
bitbake/lib/bb/fetch/cvs.py
Normal file
172
bitbake/lib/bb/fetch/cvs.py
Normal file
@@ -0,0 +1,172 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
#Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
#
|
||||
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch, FetchError, MissingParameterError, logger
|
||||
|
||||
class Cvs(Fetch):
|
||||
"""
|
||||
Class to fetch a module or modules from cvs repositories
|
||||
"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with cvs.
|
||||
"""
|
||||
return ud.type in ['cvs']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("cvs method needs a 'module' parameter")
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
ud.tag = ud.parm.get('tag', "")
|
||||
|
||||
# Override the default date in certain cases
|
||||
if 'date' in ud.parm:
|
||||
ud.date = ud.parm['date']
|
||||
elif ud.tag:
|
||||
ud.date = ""
|
||||
|
||||
norecurse = ''
|
||||
if 'norecurse' in ud.parm:
|
||||
norecurse = '_norecurse'
|
||||
|
||||
fullpath = ''
|
||||
if 'fullpath' in ud.parm:
|
||||
fullpath = '_fullpath'
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def forcefetch(self, url, ud, d):
|
||||
if (ud.date == "now"):
|
||||
return True
|
||||
return False
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
|
||||
method = ud.parm.get('method', 'pserver')
|
||||
localdir = ud.parm.get('localdir', ud.module)
|
||||
cvs_port = ud.parm.get('port', '')
|
||||
|
||||
cvs_rsh = None
|
||||
if method == "ext":
|
||||
if "rsh" in ud.parm:
|
||||
cvs_rsh = ud.parm["rsh"]
|
||||
|
||||
if method == "dir":
|
||||
cvsroot = ud.path
|
||||
else:
|
||||
cvsroot = ":" + method
|
||||
cvsproxyhost = data.getVar('CVS_PROXY_HOST', d, True)
|
||||
if cvsproxyhost:
|
||||
cvsroot += ";proxy=" + cvsproxyhost
|
||||
cvsproxyport = data.getVar('CVS_PROXY_PORT', d, True)
|
||||
if cvsproxyport:
|
||||
cvsroot += ";proxyport=" + cvsproxyport
|
||||
cvsroot += ":" + ud.user
|
||||
if ud.pswd:
|
||||
cvsroot += ":" + ud.pswd
|
||||
cvsroot += "@" + ud.host + ":" + cvs_port + ud.path
|
||||
|
||||
options = []
|
||||
if 'norecurse' in ud.parm:
|
||||
options.append("-l")
|
||||
if ud.date:
|
||||
# treat YYYYMMDDHHMM specially for CVS
|
||||
if len(ud.date) == 12:
|
||||
options.append("-D \"%s %s:%s UTC\"" % (ud.date[0:8], ud.date[8:10], ud.date[10:12]))
|
||||
else:
|
||||
options.append("-D \"%s UTC\"" % ud.date)
|
||||
if ud.tag:
|
||||
options.append("-r %s" % ud.tag)
|
||||
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "cvs:%s" % data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
data.setVar('CVSROOT', cvsroot, localdata)
|
||||
data.setVar('CVSCOOPTS', " ".join(options), localdata)
|
||||
data.setVar('CVSMODULE', ud.module, localdata)
|
||||
cvscmd = data.getVar('FETCHCOMMAND', localdata, 1)
|
||||
cvsupdatecmd = data.getVar('UPDATECOMMAND', localdata, 1)
|
||||
|
||||
if cvs_rsh:
|
||||
cvscmd = "CVS_RSH=\"%s\" %s" % (cvs_rsh, cvscmd)
|
||||
cvsupdatecmd = "CVS_RSH=\"%s\" %s" % (cvs_rsh, cvsupdatecmd)
|
||||
|
||||
# create module directory
|
||||
logger.debug(2, "Fetch: checking for module directory")
|
||||
pkg = data.expand('${PN}', d)
|
||||
pkgdir = os.path.join(data.expand('${CVSDIR}', localdata), pkg)
|
||||
moddir = os.path.join(pkgdir, localdir)
|
||||
if os.access(os.path.join(moddir, 'CVS'), os.R_OK):
|
||||
logger.info("Update " + loc)
|
||||
# update sources there
|
||||
os.chdir(moddir)
|
||||
myret = os.system(cvsupdatecmd)
|
||||
else:
|
||||
logger.info("Fetch " + loc)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(pkgdir)
|
||||
os.chdir(pkgdir)
|
||||
logger.debug(1, "Running %s", cvscmd)
|
||||
myret = os.system(cvscmd)
|
||||
|
||||
if myret != 0 or not os.access(moddir, os.R_OK):
|
||||
try:
|
||||
os.rmdir(moddir)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(ud.module)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude 'CVS'"
|
||||
|
||||
# tar them up to a defined filename
|
||||
if 'fullpath' in ud.parm:
|
||||
os.chdir(pkgdir)
|
||||
myret = os.system("tar %s -czf %s %s" % (tar_flags, ud.localpath, localdir))
|
||||
else:
|
||||
os.chdir(moddir)
|
||||
os.chdir('..')
|
||||
myret = os.system("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(moddir)))
|
||||
|
||||
if myret != 0:
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(ud.module)
|
||||
339
bitbake/lib/bb/fetch/git.py
Normal file
339
bitbake/lib/bb/fetch/git.py
Normal file
@@ -0,0 +1,339 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' git implementation
|
||||
|
||||
"""
|
||||
|
||||
#Copyright (C) 2005 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import bb
|
||||
import bb.persist_data
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import runfetchcmd
|
||||
from bb.fetch import logger
|
||||
|
||||
class Git(Fetch):
|
||||
"""Class to fetch a module or modules from git repositories"""
|
||||
def init(self, d):
|
||||
#
|
||||
# Only enable _sortable revision if the key is set
|
||||
#
|
||||
if bb.data.getVar("BB_GIT_CLONE_FOR_SRCREV", d, True):
|
||||
self._sortable_buildindex = self._sortable_buildindex_disabled
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with git.
|
||||
"""
|
||||
return ud.type in ['git']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
|
||||
if 'protocol' in ud.parm:
|
||||
ud.proto = ud.parm['protocol']
|
||||
elif not ud.host:
|
||||
ud.proto = 'file'
|
||||
else:
|
||||
ud.proto = "rsync"
|
||||
|
||||
ud.branch = ud.parm.get("branch", "master")
|
||||
|
||||
gitsrcname = '%s%s' % (ud.host, ud.path.replace('/', '.'))
|
||||
ud.mirrortarball = 'git_%s.tar.gz' % (gitsrcname)
|
||||
ud.clonedir = os.path.join(data.expand('${GITDIR}', d), gitsrcname)
|
||||
|
||||
tag = Fetch.srcrev_internal_helper(ud, d)
|
||||
if tag is True:
|
||||
ud.tag = self.latest_revision(url, ud, d)
|
||||
elif tag:
|
||||
ud.tag = tag
|
||||
|
||||
if not ud.tag or ud.tag == "master":
|
||||
ud.tag = self.latest_revision(url, ud, d)
|
||||
|
||||
subdir = ud.parm.get("subpath", "")
|
||||
if subdir != "":
|
||||
if subdir.endswith("/"):
|
||||
subdir = subdir[:-1]
|
||||
subdirpath = os.path.join(ud.path, subdir);
|
||||
else:
|
||||
subdirpath = ud.path;
|
||||
|
||||
if 'fullclone' in ud.parm:
|
||||
ud.localfile = ud.mirrortarball
|
||||
else:
|
||||
ud.localfile = data.expand('git_%s%s_%s.tar.gz' % (ud.host, subdirpath.replace('/', '.'), ud.tag), d)
|
||||
|
||||
ud.basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
|
||||
if 'noclone' in ud.parm:
|
||||
ud.localfile = None
|
||||
return None
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def forcefetch(self, url, ud, d):
|
||||
if 'fullclone' in ud.parm:
|
||||
return True
|
||||
if 'noclone' in ud.parm:
|
||||
return False
|
||||
if os.path.exists(ud.localpath):
|
||||
return False
|
||||
if not self._contains_ref(ud.tag, d):
|
||||
return True
|
||||
return False
|
||||
|
||||
def try_premirror(self, u, ud, d):
|
||||
if 'noclone' in ud.parm:
|
||||
return False
|
||||
if os.path.exists(ud.clonedir):
|
||||
return False
|
||||
if os.path.exists(ud.localpath):
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
if ud.user:
|
||||
username = ud.user + '@'
|
||||
else:
|
||||
username = ""
|
||||
|
||||
repofile = os.path.join(data.getVar("DL_DIR", d, 1), ud.mirrortarball)
|
||||
|
||||
|
||||
coname = '%s' % (ud.tag)
|
||||
codir = os.path.join(ud.clonedir, coname)
|
||||
|
||||
# If we have no existing clone and no mirror tarball, try and obtain one
|
||||
if not os.path.exists(ud.clonedir) and not os.path.exists(repofile):
|
||||
try:
|
||||
Fetch.try_mirrors(ud.mirrortarball)
|
||||
except:
|
||||
pass
|
||||
|
||||
# If the checkout doesn't exist and the mirror tarball does, extract it
|
||||
if not os.path.exists(ud.clonedir) and os.path.exists(repofile):
|
||||
bb.utils.mkdirhier(ud.clonedir)
|
||||
os.chdir(ud.clonedir)
|
||||
runfetchcmd("tar -xzf %s" % (repofile), d)
|
||||
|
||||
# If the repo still doesn't exist, fallback to cloning it
|
||||
if not os.path.exists(ud.clonedir):
|
||||
runfetchcmd("%s clone -n %s://%s%s%s %s" % (ud.basecmd, ud.proto, username, ud.host, ud.path, ud.clonedir), d)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
# Update the checkout if needed
|
||||
if not self._contains_ref(ud.tag, d) or 'fullclone' in ud.parm:
|
||||
# Remove all but the .git directory
|
||||
runfetchcmd("rm * -Rf", d)
|
||||
if 'fullclone' in ud.parm:
|
||||
runfetchcmd("%s fetch --all" % (ud.basecmd), d)
|
||||
else:
|
||||
runfetchcmd("%s fetch %s://%s%s%s %s" % (ud.basecmd, ud.proto, username, ud.host, ud.path, ud.branch), d)
|
||||
runfetchcmd("%s fetch --tags %s://%s%s%s" % (ud.basecmd, ud.proto, username, ud.host, ud.path), d)
|
||||
runfetchcmd("%s prune-packed" % ud.basecmd, d)
|
||||
runfetchcmd("%s pack-redundant --all | xargs -r rm" % ud.basecmd, d)
|
||||
|
||||
# Generate a mirror tarball if needed
|
||||
os.chdir(ud.clonedir)
|
||||
mirror_tarballs = data.getVar("BB_GENERATE_MIRROR_TARBALLS", d, True)
|
||||
if mirror_tarballs != "0" or 'fullclone' in ud.parm:
|
||||
logger.info("Creating tarball of git repository")
|
||||
runfetchcmd("tar -czf %s %s" % (repofile, os.path.join(".", ".git", "*") ), d)
|
||||
|
||||
if 'fullclone' in ud.parm:
|
||||
return
|
||||
|
||||
if os.path.exists(codir):
|
||||
bb.utils.prunedir(codir)
|
||||
|
||||
subdir = ud.parm.get("subpath", "")
|
||||
if subdir != "":
|
||||
if subdir.endswith("/"):
|
||||
subdirbase = os.path.basename(subdir[:-1])
|
||||
else:
|
||||
subdirbase = os.path.basename(subdir)
|
||||
else:
|
||||
subdirbase = ""
|
||||
|
||||
if subdir != "":
|
||||
readpathspec = ":%s" % (subdir)
|
||||
codir = os.path.join(codir, "git")
|
||||
coprefix = os.path.join(codir, subdirbase, "")
|
||||
else:
|
||||
readpathspec = ""
|
||||
coprefix = os.path.join(codir, "git", "")
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
runfetchcmd("%s clone -n %s %s" % (ud.basecmd, ud.clonedir, coprefix), d)
|
||||
os.chdir(coprefix)
|
||||
runfetchcmd("%s checkout -q -f %s%s" % (ud.basecmd, ud.tag, readpathspec), d)
|
||||
else:
|
||||
bb.utils.mkdirhier(codir)
|
||||
os.chdir(ud.clonedir)
|
||||
runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.tag, readpathspec), d)
|
||||
runfetchcmd("%s checkout-index -q -f --prefix=%s -a" % (ud.basecmd, coprefix), d)
|
||||
|
||||
os.chdir(codir)
|
||||
logger.info("Creating tarball of git checkout")
|
||||
runfetchcmd("tar -czf %s %s" % (ud.localpath, os.path.join(".", "*") ), d)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
bb.utils.prunedir(codir)
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
def _contains_ref(self, tag, d):
|
||||
basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
output = runfetchcmd("%s log --pretty=oneline -n 1 %s -- 2> /dev/null | wc -l" % (basecmd, tag), d, quiet=True)
|
||||
return output.split()[0] != "0"
|
||||
|
||||
def _revision_key(self, url, ud, d, branch=False):
|
||||
"""
|
||||
Return a unique key for the url
|
||||
"""
|
||||
key = 'git:' + ud.host + ud.path.replace('/', '.')
|
||||
if branch:
|
||||
return key + ud.branch
|
||||
else:
|
||||
return key
|
||||
|
||||
def generate_revision_key(self, url, ud, d, branch=False):
|
||||
key = self._revision_key(url, ud, d, branch)
|
||||
return "%s-%s" % (key, bb.data.getVar("PN", d, True) or "")
|
||||
|
||||
def _latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Compute the HEAD revision for the url
|
||||
"""
|
||||
if ud.user:
|
||||
username = ud.user + '@'
|
||||
else:
|
||||
username = ""
|
||||
|
||||
basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
cmd = "%s ls-remote %s://%s%s%s %s" % (basecmd, ud.proto, username, ud.host, ud.path, ud.branch)
|
||||
output = runfetchcmd(cmd, d, True)
|
||||
if not output:
|
||||
raise bb.fetch.FetchError("Fetch command %s gave empty output\n" % (cmd))
|
||||
return output.split()[0]
|
||||
|
||||
def latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Look in the cache for the latest revision, if not present ask the SCM.
|
||||
"""
|
||||
persisted = bb.persist_data.persist(d)
|
||||
revs = persisted['BB_URI_HEADREVS']
|
||||
|
||||
key = self.generate_revision_key(url, ud, d, branch=True)
|
||||
rev = revs[key]
|
||||
if rev is None:
|
||||
# Compatibility with old key format, no branch included
|
||||
oldkey = self.generate_revision_key(url, ud, d, branch=False)
|
||||
rev = revs[oldkey]
|
||||
if rev is not None:
|
||||
del revs[oldkey]
|
||||
else:
|
||||
rev = self._latest_revision(url, ud, d)
|
||||
revs[key] = rev
|
||||
|
||||
return str(rev)
|
||||
|
||||
def sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
|
||||
"""
|
||||
pd = bb.persist_data.persist(d)
|
||||
localcounts = pd['BB_URI_LOCALCOUNT']
|
||||
key = self.generate_revision_key(url, ud, d, branch=True)
|
||||
oldkey = self.generate_revision_key(url, ud, d, branch=False)
|
||||
|
||||
latest_rev = self._build_revision(url, ud, d)
|
||||
last_rev = localcounts[key + '_rev']
|
||||
if last_rev is None:
|
||||
last_rev = localcounts[oldkey + '_rev']
|
||||
if last_rev is not None:
|
||||
del localcounts[oldkey + '_rev']
|
||||
localcounts[key + '_rev'] = last_rev
|
||||
|
||||
uselocalcount = bb.data.getVar("BB_LOCALCOUNT_OVERRIDE", d, True) or False
|
||||
count = None
|
||||
if uselocalcount:
|
||||
count = Fetch.localcount_internal_helper(ud, d)
|
||||
if count is None:
|
||||
count = localcounts[key + '_count']
|
||||
if count is None:
|
||||
count = localcounts[oldkey + '_count']
|
||||
if count is not None:
|
||||
del localcounts[oldkey + '_count']
|
||||
localcounts[key + '_count'] = count
|
||||
|
||||
if last_rev == latest_rev:
|
||||
return str(count + "+" + latest_rev)
|
||||
|
||||
buildindex_provided = hasattr(self, "_sortable_buildindex")
|
||||
if buildindex_provided:
|
||||
count = self._sortable_buildindex(url, ud, d, latest_rev)
|
||||
if count is None:
|
||||
count = "0"
|
||||
elif uselocalcount or buildindex_provided:
|
||||
count = str(count)
|
||||
else:
|
||||
count = str(int(count) + 1)
|
||||
|
||||
localcounts[key + '_rev'] = latest_rev
|
||||
localcounts[key + '_count'] = count
|
||||
|
||||
return str(count + "+" + latest_rev)
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.tag
|
||||
|
||||
def _sortable_buildindex_disabled(self, url, ud, d, rev):
|
||||
"""
|
||||
Return a suitable buildindex for the revision specified. This is done by counting revisions
|
||||
using "git rev-list" which may or may not work in different circumstances.
|
||||
"""
|
||||
|
||||
cwd = os.getcwd()
|
||||
|
||||
# Check if we have the rev already
|
||||
|
||||
if not os.path.exists(ud.clonedir):
|
||||
print("no repo")
|
||||
self.go(None, ud, d)
|
||||
if not os.path.exists(ud.clonedir):
|
||||
logger.error("GIT repository for %s doesn't exist in %s, cannot get sortable buildnumber, using old value", url, ud.clonedir)
|
||||
return None
|
||||
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
if not self._contains_ref(rev, d):
|
||||
self.go(None, ud, d)
|
||||
|
||||
output = runfetchcmd("%s rev-list %s -- 2> /dev/null | wc -l" % (ud.basecmd, rev), d, quiet=True)
|
||||
os.chdir(cwd)
|
||||
|
||||
buildindex = "%s" % output.split()[0]
|
||||
logger.debug(1, "GIT repository for %s in %s is returning %s revisions in rev-list before %s", url, ud.clonedir, buildindex, rev)
|
||||
return buildindex
|
||||
180
bitbake/lib/bb/fetch/hg.py
Normal file
180
bitbake/lib/bb/fetch/hg.py
Normal file
@@ -0,0 +1,180 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementation for mercurial DRCS (hg).
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
# Copyright (C) 2004 Marcin Juszkiewicz
|
||||
# Copyright (C) 2007 Robert Schuster
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import MissingParameterError
|
||||
from bb.fetch import runfetchcmd
|
||||
from bb.fetch import logger
|
||||
|
||||
class Hg(Fetch):
|
||||
"""Class to fetch from mercurial repositories"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with mercurial.
|
||||
"""
|
||||
return ud.type in ['hg']
|
||||
|
||||
def forcefetch(self, url, ud, d):
|
||||
revTag = ud.parm.get('rev', 'tip')
|
||||
return revTag == "tip"
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("hg method needs a 'module' parameter")
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
# Create paths to mercurial checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(data.expand('${HGDIR}', d), ud.host, relpath)
|
||||
ud.moddir = os.path.join(ud.pkgdir, ud.module)
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
ud.revision = ud.parm['rev']
|
||||
else:
|
||||
tag = Fetch.srcrev_internal_helper(ud, d)
|
||||
if tag is True:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
elif tag:
|
||||
ud.revision = tag
|
||||
else:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def _buildhgcommand(self, ud, d, command):
|
||||
"""
|
||||
Build up an hg commandline based on ud
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_hg}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'http')
|
||||
|
||||
host = ud.host
|
||||
if proto == "file":
|
||||
host = "/"
|
||||
ud.host = "localhost"
|
||||
|
||||
if not ud.user:
|
||||
hgroot = host + ud.path
|
||||
else:
|
||||
hgroot = ud.user + "@" + host + ud.path
|
||||
|
||||
if command is "info":
|
||||
return "%s identify -i %s://%s/%s" % (basecmd, proto, hgroot, ud.module)
|
||||
|
||||
options = [];
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
if command is "fetch":
|
||||
cmd = "%s clone %s %s://%s/%s %s" % (basecmd, " ".join(options), proto, hgroot, ud.module, ud.module)
|
||||
elif command is "pull":
|
||||
# do not pass options list; limiting pull to rev causes the local
|
||||
# repo not to contain it and immediately following "update" command
|
||||
# will crash
|
||||
cmd = "%s pull" % (basecmd)
|
||||
elif command is "update":
|
||||
cmd = "%s update -C %s" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid hg command %s" % command)
|
||||
|
||||
return cmd
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
|
||||
|
||||
if os.access(os.path.join(ud.moddir, '.hg'), os.R_OK):
|
||||
updatecmd = self._buildhgcommand(ud, d, "pull")
|
||||
logger.info("Update " + loc)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", updatecmd)
|
||||
runfetchcmd(updatecmd, d)
|
||||
|
||||
else:
|
||||
fetchcmd = self._buildhgcommand(ud, d, "fetch")
|
||||
logger.info("Fetch " + loc)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", fetchcmd)
|
||||
runfetchcmd(fetchcmd, d)
|
||||
|
||||
# Even when we clone (fetch), we still need to update as hg's clone
|
||||
# won't checkout the specified revision if its on a branch
|
||||
updatecmd = self._buildhgcommand(ud, d, "update")
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", updatecmd)
|
||||
runfetchcmd(updatecmd, d)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude '.hg' --exclude '.hgrags'"
|
||||
|
||||
os.chdir(ud.pkgdir)
|
||||
try:
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d)
|
||||
except:
|
||||
t, v, tb = sys.exc_info()
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise t, v, tb
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
def _latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Compute tip revision for the url
|
||||
"""
|
||||
output = runfetchcmd(self._buildhgcommand(ud, d, "info"), d)
|
||||
return output.strip()
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
|
||||
def _revision_key(self, url, ud, d):
|
||||
"""
|
||||
Return a unique key for the url
|
||||
"""
|
||||
return "hg:" + ud.moddir
|
||||
73
bitbake/lib/bb/fetch/local.py
Normal file
73
bitbake/lib/bb/fetch/local.py
Normal file
@@ -0,0 +1,73 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import bb
|
||||
import bb.utils
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
|
||||
class Local(Fetch):
|
||||
def supports(self, url, urldata, d):
|
||||
"""
|
||||
Check to see if a given url represents a local fetch.
|
||||
"""
|
||||
return urldata.type in ['file']
|
||||
|
||||
def localpath(self, url, urldata, d):
|
||||
"""
|
||||
Return the local filename of a given url assuming a successful fetch.
|
||||
"""
|
||||
path = url.split("://")[1]
|
||||
path = path.split(";")[0]
|
||||
newpath = path
|
||||
if path[0] != "/":
|
||||
filespath = data.getVar('FILESPATH', d, 1)
|
||||
if filespath:
|
||||
newpath = bb.utils.which(filespath, path)
|
||||
if not newpath:
|
||||
filesdir = data.getVar('FILESDIR', d, 1)
|
||||
if filesdir:
|
||||
newpath = os.path.join(filesdir, path)
|
||||
# We don't set localfile as for this fetcher the file is already local!
|
||||
return newpath
|
||||
|
||||
def go(self, url, urldata, d):
|
||||
"""Fetch urls (no-op for Local method)"""
|
||||
# no need to fetch local files, we'll deal with them in place.
|
||||
return 1
|
||||
|
||||
def checkstatus(self, url, urldata, d):
|
||||
"""
|
||||
Check the status of the url
|
||||
"""
|
||||
if urldata.localpath.find("*") != -1:
|
||||
logger.info("URL %s looks like a glob and was therefore not checked.", url)
|
||||
return True
|
||||
if os.path.exists(urldata.localpath):
|
||||
return True
|
||||
return False
|
||||
143
bitbake/lib/bb/fetch/osc.py
Normal file
143
bitbake/lib/bb/fetch/osc.py
Normal file
@@ -0,0 +1,143 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
Bitbake "Fetch" implementation for osc (Opensuse build service client).
|
||||
Based on the svn "Fetch" implementation.
|
||||
|
||||
"""
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb import utils
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import MissingParameterError
|
||||
from bb.fetch import runfetchcmd
|
||||
|
||||
class Osc(Fetch):
|
||||
"""Class to fetch a module or modules from Opensuse build server
|
||||
repositories."""
|
||||
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with osc.
|
||||
"""
|
||||
return ud.type in ['osc']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("osc method needs a 'module' parameter.")
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
# Create paths to osc checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(data.expand('${OSCDIR}', d), ud.host)
|
||||
ud.moddir = os.path.join(ud.pkgdir, relpath, ud.module)
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
ud.revision = ud.parm['rev']
|
||||
else:
|
||||
pv = data.getVar("PV", d, 0)
|
||||
rev = Fetch.srcrev_internal_helper(ud, d)
|
||||
if rev and rev != True:
|
||||
ud.revision = rev
|
||||
else:
|
||||
ud.revision = ""
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def _buildosccommand(self, ud, d, command):
|
||||
"""
|
||||
Build up an ocs commandline based on ud
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_osc}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'ocs')
|
||||
|
||||
options = []
|
||||
|
||||
config = "-c %s" % self.generate_config(ud, d)
|
||||
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
coroot = self._strip_leading_slashes(ud.path)
|
||||
|
||||
if command is "fetch":
|
||||
osccmd = "%s %s co %s/%s %s" % (basecmd, config, coroot, ud.module, " ".join(options))
|
||||
elif command is "update":
|
||||
osccmd = "%s %s up %s" % (basecmd, config, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid osc command %s" % command)
|
||||
|
||||
return osccmd
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""
|
||||
Fetch url
|
||||
"""
|
||||
|
||||
logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
|
||||
|
||||
if os.access(os.path.join(data.expand('${OSCDIR}', d), ud.path, ud.module), os.R_OK):
|
||||
oscupdatecmd = self._buildosccommand(ud, d, "update")
|
||||
logger.info("Update "+ loc)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", oscupdatecmd)
|
||||
runfetchcmd(oscupdatecmd, d)
|
||||
else:
|
||||
oscfetchcmd = self._buildosccommand(ud, d, "fetch")
|
||||
logger.info("Fetch " + loc)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", oscfetchcmd)
|
||||
runfetchcmd(oscfetchcmd, d)
|
||||
|
||||
os.chdir(os.path.join(ud.pkgdir + ud.path))
|
||||
# tar them up to a defined filename
|
||||
try:
|
||||
runfetchcmd("tar -czf %s %s" % (ud.localpath, ud.module), d)
|
||||
except:
|
||||
t, v, tb = sys.exc_info()
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise t, v, tb
|
||||
|
||||
def supports_srcrev(self):
|
||||
return False
|
||||
|
||||
def generate_config(self, ud, d):
|
||||
"""
|
||||
Generate a .oscrc to be used for this run.
|
||||
"""
|
||||
|
||||
config_path = os.path.join(data.expand('${OSCDIR}', d), "oscrc")
|
||||
bb.utils.remove(config_path)
|
||||
|
||||
f = open(config_path, 'w')
|
||||
f.write("[general]\n")
|
||||
f.write("apisrv = %s\n" % ud.host)
|
||||
f.write("scheme = http\n")
|
||||
f.write("su-wrapper = su -c\n")
|
||||
f.write("build-root = %s\n" % data.expand('${WORKDIR}', d))
|
||||
f.write("urllist = http://moblin-obs.jf.intel.com:8888/build/%(project)s/%(repository)s/%(buildarch)s/:full/%(name)s.rpm\n")
|
||||
f.write("extra-pkgs = gzip\n")
|
||||
f.write("\n")
|
||||
f.write("[%s]\n" % ud.host)
|
||||
f.write("user = %s\n" % ud.parm["user"])
|
||||
f.write("pass = %s\n" % ud.parm["pswd"])
|
||||
f.close()
|
||||
|
||||
return config_path
|
||||
206
bitbake/lib/bb/fetch/perforce.py
Normal file
206
bitbake/lib/bb/fetch/perforce.py
Normal file
@@ -0,0 +1,206 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
from future_builtins import zip
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import logger
|
||||
|
||||
class Perforce(Fetch):
|
||||
def supports(self, url, ud, d):
|
||||
return ud.type in ['p4']
|
||||
|
||||
def doparse(url, d):
|
||||
parm = {}
|
||||
path = url.split("://")[1]
|
||||
delim = path.find("@");
|
||||
if delim != -1:
|
||||
(user, pswd, host, port) = path.split('@')[0].split(":")
|
||||
path = path.split('@')[1]
|
||||
else:
|
||||
(host, port) = data.getVar('P4PORT', d).split(':')
|
||||
user = ""
|
||||
pswd = ""
|
||||
|
||||
if path.find(";") != -1:
|
||||
keys=[]
|
||||
values=[]
|
||||
plist = path.split(';')
|
||||
for item in plist:
|
||||
if item.count('='):
|
||||
(key, value) = item.split('=')
|
||||
keys.append(key)
|
||||
values.append(value)
|
||||
|
||||
parm = dict(zip(keys, values))
|
||||
path = "//" + path.split(';')[0]
|
||||
host += ":%s" % (port)
|
||||
parm["cset"] = Perforce.getcset(d, path, host, user, pswd, parm)
|
||||
|
||||
return host, path, user, pswd, parm
|
||||
doparse = staticmethod(doparse)
|
||||
|
||||
def getcset(d, depot, host, user, pswd, parm):
|
||||
p4opt = ""
|
||||
if "cset" in parm:
|
||||
return parm["cset"];
|
||||
if user:
|
||||
p4opt += " -u %s" % (user)
|
||||
if pswd:
|
||||
p4opt += " -P %s" % (pswd)
|
||||
if host:
|
||||
p4opt += " -p %s" % (host)
|
||||
|
||||
p4date = data.getVar("P4DATE", d, 1)
|
||||
if "revision" in parm:
|
||||
depot += "#%s" % (parm["revision"])
|
||||
elif "label" in parm:
|
||||
depot += "@%s" % (parm["label"])
|
||||
elif p4date:
|
||||
depot += "@%s" % (p4date)
|
||||
|
||||
p4cmd = data.getVar('FETCHCOMMAND_p4', d, 1)
|
||||
logger.debug(1, "Running %s%s changes -m 1 %s", p4cmd, p4opt, depot)
|
||||
p4file = os.popen("%s%s changes -m 1 %s" % (p4cmd, p4opt, depot))
|
||||
cset = p4file.readline().strip()
|
||||
logger.debug(1, "READ %s", cset)
|
||||
if not cset:
|
||||
return -1
|
||||
|
||||
return cset.split(' ')[1]
|
||||
getcset = staticmethod(getcset)
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
|
||||
(host, path, user, pswd, parm) = Perforce.doparse(url, d)
|
||||
|
||||
# If a label is specified, we use that as our filename
|
||||
|
||||
if "label" in parm:
|
||||
ud.localfile = "%s.tar.gz" % (parm["label"])
|
||||
return os.path.join(data.getVar("DL_DIR", d, 1), ud.localfile)
|
||||
|
||||
base = path
|
||||
which = path.find('/...')
|
||||
if which != -1:
|
||||
base = path[:which]
|
||||
|
||||
base = self._strip_leading_slashes(base)
|
||||
|
||||
cset = Perforce.getcset(d, path, host, user, pswd, parm)
|
||||
|
||||
ud.localfile = data.expand('%s+%s+%s.tar.gz' % (host, base.replace('/', '.'), cset), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, 1), ud.localfile)
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""
|
||||
Fetch urls
|
||||
"""
|
||||
|
||||
(host, depot, user, pswd, parm) = Perforce.doparse(loc, d)
|
||||
|
||||
if depot.find('/...') != -1:
|
||||
path = depot[:depot.find('/...')]
|
||||
else:
|
||||
path = depot
|
||||
|
||||
module = parm.get('module', os.path.basename(path))
|
||||
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "p4:%s" % data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
# Get the p4 command
|
||||
p4opt = ""
|
||||
if user:
|
||||
p4opt += " -u %s" % (user)
|
||||
|
||||
if pswd:
|
||||
p4opt += " -P %s" % (pswd)
|
||||
|
||||
if host:
|
||||
p4opt += " -p %s" % (host)
|
||||
|
||||
p4cmd = data.getVar('FETCHCOMMAND', localdata, 1)
|
||||
|
||||
# create temp directory
|
||||
logger.debug(2, "Fetch: creating temporary directory")
|
||||
bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
|
||||
data.setVar('TMPBASE', data.expand('${WORKDIR}/oep4.XXXXXX', localdata), localdata)
|
||||
tmppipe = os.popen(data.getVar('MKTEMPDIRCMD', localdata, 1) or "false")
|
||||
tmpfile = tmppipe.readline().strip()
|
||||
if not tmpfile:
|
||||
logger.error("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.")
|
||||
raise FetchError(module)
|
||||
|
||||
if "label" in parm:
|
||||
depot = "%s@%s" % (depot, parm["label"])
|
||||
else:
|
||||
cset = Perforce.getcset(d, depot, host, user, pswd, parm)
|
||||
depot = "%s@%s" % (depot, cset)
|
||||
|
||||
os.chdir(tmpfile)
|
||||
logger.info("Fetch " + loc)
|
||||
logger.info("%s%s files %s", p4cmd, p4opt, depot)
|
||||
p4file = os.popen("%s%s files %s" % (p4cmd, p4opt, depot))
|
||||
|
||||
if not p4file:
|
||||
logger.error("Fetch: unable to get the P4 files from %s", depot)
|
||||
raise FetchError(module)
|
||||
|
||||
count = 0
|
||||
|
||||
for file in p4file:
|
||||
list = file.split()
|
||||
|
||||
if list[2] == "delete":
|
||||
continue
|
||||
|
||||
dest = list[0][len(path)+1:]
|
||||
where = dest.find("#")
|
||||
|
||||
os.system("%s%s print -o %s/%s %s" % (p4cmd, p4opt, module, dest[:where], list[0]))
|
||||
count = count + 1
|
||||
|
||||
if count == 0:
|
||||
logger.error("Fetch: No files gathered from the P4 fetch")
|
||||
raise FetchError(module)
|
||||
|
||||
myret = os.system("tar -czf %s %s" % (ud.localpath, module))
|
||||
if myret != 0:
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(module)
|
||||
# cleanup
|
||||
bb.utils.prunedir(tmpfile)
|
||||
98
bitbake/lib/bb/fetch/repo.py
Normal file
98
bitbake/lib/bb/fetch/repo.py
Normal file
@@ -0,0 +1,98 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake "Fetch" repo (git) implementation
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2009 Tom Rini <trini@embeddedalley.com>
|
||||
#
|
||||
# Based on git.py which is:
|
||||
#Copyright (C) 2005 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import runfetchcmd
|
||||
|
||||
class Repo(Fetch):
|
||||
"""Class to fetch a module or modules from repo (git) repositories"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with repo.
|
||||
"""
|
||||
return ud.type in ["repo"]
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
"""
|
||||
We don"t care about the git rev of the manifests repository, but
|
||||
we do care about the manifest to use. The default is "default".
|
||||
We also care about the branch or tag to be used. The default is
|
||||
"master".
|
||||
"""
|
||||
|
||||
ud.proto = ud.parm.get('protocol', 'git')
|
||||
ud.branch = ud.parm.get('branch', 'master')
|
||||
ud.manifest = ud.parm.get('manifest', 'default.xml')
|
||||
if not ud.manifest.endswith('.xml'):
|
||||
ud.manifest += '.xml'
|
||||
|
||||
ud.localfile = data.expand("repo_%s%s_%s_%s.tar.gz" % (ud.host, ud.path.replace("/", "."), ud.manifest, ud.branch), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
if os.access(os.path.join(data.getVar("DL_DIR", d, True), ud.localfile), os.R_OK):
|
||||
logger.debug(1, "%s already exists (or was stashed). Skipping repo init / sync.", ud.localpath)
|
||||
return
|
||||
|
||||
gitsrcname = "%s%s" % (ud.host, ud.path.replace("/", "."))
|
||||
repodir = data.getVar("REPODIR", d, True) or os.path.join(data.getVar("DL_DIR", d, True), "repo")
|
||||
codir = os.path.join(repodir, gitsrcname, ud.manifest)
|
||||
|
||||
if ud.user:
|
||||
username = ud.user + "@"
|
||||
else:
|
||||
username = ""
|
||||
|
||||
bb.utils.mkdirhier(os.path.join(codir, "repo"))
|
||||
os.chdir(os.path.join(codir, "repo"))
|
||||
if not os.path.exists(os.path.join(codir, "repo", ".repo")):
|
||||
runfetchcmd("repo init -m %s -b %s -u %s://%s%s%s" % (ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), d)
|
||||
|
||||
runfetchcmd("repo sync", d)
|
||||
os.chdir(codir)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude '.repo' --exclude '.git'"
|
||||
|
||||
# Create a cache
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.join(".", "*") ), d)
|
||||
|
||||
def supports_srcrev(self):
|
||||
return False
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.manifest
|
||||
|
||||
def _want_sortable_revision(self, url, ud, d):
|
||||
return False
|
||||
118
bitbake/lib/bb/fetch/ssh.py
Normal file
118
bitbake/lib/bb/fetch/ssh.py
Normal file
@@ -0,0 +1,118 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
'''
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
This implementation is for Secure Shell (SSH), and attempts to comply with the
|
||||
IETF secsh internet draft:
|
||||
http://tools.ietf.org/wg/secsh/draft-ietf-secsh-scp-sftp-ssh-uri/
|
||||
|
||||
Currently does not support the sftp parameters, as this uses scp
|
||||
Also does not support the 'fingerprint' connection parameter.
|
||||
|
||||
'''
|
||||
|
||||
# Copyright (C) 2006 OpenedHand Ltd.
|
||||
#
|
||||
#
|
||||
# Based in part on svk.py:
|
||||
# Copyright (C) 2006 Holger Hans Peter Freyther
|
||||
# Based on svn.py:
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
# Based on functions from the base bb module:
|
||||
# Copyright 2003 Holger Schurig
|
||||
#
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import re, os
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
|
||||
|
||||
__pattern__ = re.compile(r'''
|
||||
\s* # Skip leading whitespace
|
||||
ssh:// # scheme
|
||||
( # Optional username/password block
|
||||
(?P<user>\S+) # username
|
||||
(:(?P<pass>\S+))? # colon followed by the password (optional)
|
||||
)?
|
||||
(?P<cparam>(;[^;]+)*)? # connection parameters block (optional)
|
||||
@
|
||||
(?P<host>\S+?) # non-greedy match of the host
|
||||
(:(?P<port>[0-9]+))? # colon followed by the port (optional)
|
||||
/
|
||||
(?P<path>[^;]+) # path on the remote system, may be absolute or relative,
|
||||
# and may include the use of '~' to reference the remote home
|
||||
# directory
|
||||
(?P<sparam>(;[^;]+)*)? # parameters block (optional)
|
||||
$
|
||||
''', re.VERBOSE)
|
||||
|
||||
class SSH(Fetch):
|
||||
'''Class to fetch a module or modules via Secure Shell'''
|
||||
|
||||
def supports(self, url, urldata, d):
|
||||
return __pattern__.match(url) != None
|
||||
|
||||
def localpath(self, url, urldata, d):
|
||||
m = __pattern__.match(url)
|
||||
path = m.group('path')
|
||||
host = m.group('host')
|
||||
lpath = os.path.join(data.getVar('DL_DIR', d, True), host, os.path.basename(path))
|
||||
return lpath
|
||||
|
||||
def go(self, url, urldata, d):
|
||||
dldir = data.getVar('DL_DIR', d, 1)
|
||||
|
||||
m = __pattern__.match(url)
|
||||
path = m.group('path')
|
||||
host = m.group('host')
|
||||
port = m.group('port')
|
||||
user = m.group('user')
|
||||
password = m.group('pass')
|
||||
|
||||
ldir = os.path.join(dldir, host)
|
||||
lpath = os.path.join(ldir, os.path.basename(path))
|
||||
|
||||
if not os.path.exists(ldir):
|
||||
os.makedirs(ldir)
|
||||
|
||||
if port:
|
||||
port = '-P %s' % port
|
||||
else:
|
||||
port = ''
|
||||
|
||||
if user:
|
||||
fr = user
|
||||
if password:
|
||||
fr += ':%s' % password
|
||||
fr += '@%s' % host
|
||||
else:
|
||||
fr = host
|
||||
fr += ':%s' % path
|
||||
|
||||
|
||||
import commands
|
||||
cmd = 'scp -B -r %s %s %s/' % (
|
||||
port,
|
||||
commands.mkarg(fr),
|
||||
commands.mkarg(ldir)
|
||||
)
|
||||
|
||||
(exitstatus, output) = commands.getstatusoutput(cmd)
|
||||
if exitstatus != 0:
|
||||
print(output)
|
||||
raise FetchError('Unable to fetch %s' % url)
|
||||
104
bitbake/lib/bb/fetch/svk.py
Normal file
104
bitbake/lib/bb/fetch/svk.py
Normal file
@@ -0,0 +1,104 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
This implementation is for svk. It is based on the svn implementation
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2006 Holger Hans Peter Freyther
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import MissingParameterError
|
||||
from bb.fetch import logger
|
||||
|
||||
class Svk(Fetch):
|
||||
"""Class to fetch a module or modules from svk repositories"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with svk.
|
||||
"""
|
||||
return ud.type in ['svk']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("svk method needs a 'module' parameter")
|
||||
else:
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
ud.revision = ud.parm.get('rev', "")
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision, ud.date), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def forcefetch(self, url, ud, d):
|
||||
return ud.date == "now"
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch urls"""
|
||||
|
||||
svkroot = ud.host + ud.path
|
||||
|
||||
svkcmd = "svk co -r {%s} %s/%s" % (ud.date, svkroot, ud.module)
|
||||
|
||||
if ud.revision:
|
||||
svkcmd = "svk co -r %s %s/%s" % (ud.revision, svkroot, ud.module)
|
||||
|
||||
# create temp directory
|
||||
localdata = data.createCopy(d)
|
||||
data.update_data(localdata)
|
||||
logger.debug(2, "Fetch: creating temporary directory")
|
||||
bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
|
||||
data.setVar('TMPBASE', data.expand('${WORKDIR}/oesvk.XXXXXX', localdata), localdata)
|
||||
tmppipe = os.popen(data.getVar('MKTEMPDIRCMD', localdata, 1) or "false")
|
||||
tmpfile = tmppipe.readline().strip()
|
||||
if not tmpfile:
|
||||
logger.error("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.")
|
||||
raise FetchError(ud.module)
|
||||
|
||||
# check out sources there
|
||||
os.chdir(tmpfile)
|
||||
logger.info("Fetch " + loc)
|
||||
logger.debug(1, "Running %s", svkcmd)
|
||||
myret = os.system(svkcmd)
|
||||
if myret != 0:
|
||||
try:
|
||||
os.rmdir(tmpfile)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(ud.module)
|
||||
|
||||
os.chdir(os.path.join(tmpfile, os.path.dirname(ud.module)))
|
||||
# tar them up to a defined filename
|
||||
myret = os.system("tar -czf %s %s" % (ud.localpath, os.path.basename(ud.module)))
|
||||
if myret != 0:
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise FetchError(ud.module)
|
||||
# cleanup
|
||||
bb.utils.prunedir(tmpfile)
|
||||
204
bitbake/lib/bb/fetch/svn.py
Normal file
204
bitbake/lib/bb/fetch/svn.py
Normal file
@@ -0,0 +1,204 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementation for svn.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
# Copyright (C) 2004 Marcin Juszkiewicz
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch import Fetch
|
||||
from bb.fetch import FetchError
|
||||
from bb.fetch import MissingParameterError
|
||||
from bb.fetch import runfetchcmd
|
||||
from bb.fetch import logger
|
||||
|
||||
class Svn(Fetch):
|
||||
"""Class to fetch a module or modules from svn repositories"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with svn.
|
||||
"""
|
||||
return ud.type in ['svn']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError("svn method needs a 'module' parameter")
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
# Create paths to svn checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(data.expand('${SVNDIR}', d), ud.host, relpath)
|
||||
ud.moddir = os.path.join(ud.pkgdir, ud.module)
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
ud.date = ""
|
||||
ud.revision = ud.parm['rev']
|
||||
elif 'date' in ud.date:
|
||||
ud.date = ud.parm['date']
|
||||
ud.revision = ""
|
||||
else:
|
||||
#
|
||||
# ***Nasty hack***
|
||||
# If DATE in unexpanded PV, use ud.date (which is set from SRCDATE)
|
||||
# Should warn people to switch to SRCREV here
|
||||
#
|
||||
pv = data.getVar("PV", d, 0)
|
||||
if "DATE" in pv:
|
||||
ud.revision = ""
|
||||
else:
|
||||
rev = Fetch.srcrev_internal_helper(ud, d)
|
||||
if rev is True:
|
||||
ud.revision = self.latest_revision(url, ud, d)
|
||||
ud.date = ""
|
||||
elif rev:
|
||||
ud.revision = rev
|
||||
ud.date = ""
|
||||
else:
|
||||
ud.revision = ""
|
||||
|
||||
ud.localfile = data.expand('%s_%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision, ud.date), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def _buildsvncommand(self, ud, d, command):
|
||||
"""
|
||||
Build up an svn commandline based on ud
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_svn}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'svn')
|
||||
|
||||
svn_rsh = None
|
||||
if proto == "svn+ssh" and "rsh" in ud.parm:
|
||||
svn_rsh = ud.parm["rsh"]
|
||||
|
||||
svnroot = ud.host + ud.path
|
||||
|
||||
# either use the revision, or SRCDATE in braces,
|
||||
options = []
|
||||
|
||||
if ud.user:
|
||||
options.append("--username %s" % ud.user)
|
||||
|
||||
if ud.pswd:
|
||||
options.append("--password %s" % ud.pswd)
|
||||
|
||||
if command is "info":
|
||||
svncmd = "%s info %s %s://%s/%s/" % (basecmd, " ".join(options), proto, svnroot, ud.module)
|
||||
else:
|
||||
suffix = ""
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
suffix = "@%s" % (ud.revision)
|
||||
elif ud.date:
|
||||
options.append("-r {%s}" % ud.date)
|
||||
|
||||
if command is "fetch":
|
||||
svncmd = "%s co %s %s://%s/%s%s %s" % (basecmd, " ".join(options), proto, svnroot, ud.module, suffix, ud.module)
|
||||
elif command is "update":
|
||||
svncmd = "%s update %s" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid svn command %s" % command)
|
||||
|
||||
if svn_rsh:
|
||||
svncmd = "svn_RSH=\"%s\" %s" % (svn_rsh, svncmd)
|
||||
|
||||
return svncmd
|
||||
|
||||
def go(self, loc, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
|
||||
|
||||
if os.access(os.path.join(ud.moddir, '.svn'), os.R_OK):
|
||||
svnupdatecmd = self._buildsvncommand(ud, d, "update")
|
||||
logger.info("Update " + loc)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", svnupdatecmd)
|
||||
runfetchcmd(svnupdatecmd, d)
|
||||
else:
|
||||
svnfetchcmd = self._buildsvncommand(ud, d, "fetch")
|
||||
logger.info("Fetch " + loc)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", svnfetchcmd)
|
||||
runfetchcmd(svnfetchcmd, d)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude '.svn'"
|
||||
|
||||
os.chdir(ud.pkgdir)
|
||||
# tar them up to a defined filename
|
||||
try:
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d)
|
||||
except:
|
||||
t, v, tb = sys.exc_info()
|
||||
try:
|
||||
os.unlink(ud.localpath)
|
||||
except OSError:
|
||||
pass
|
||||
raise t, v, tb
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
def _revision_key(self, url, ud, d):
|
||||
"""
|
||||
Return a unique key for the url
|
||||
"""
|
||||
return "svn:" + ud.moddir
|
||||
|
||||
def _latest_revision(self, url, ud, d):
|
||||
"""
|
||||
Return the latest upstream revision number
|
||||
"""
|
||||
logger.debug(2, "SVN fetcher hitting network for %s", url)
|
||||
|
||||
output = runfetchcmd("LANG=C LC_ALL=C " + self._buildsvncommand(ud, d, "info"), d, True)
|
||||
|
||||
revision = None
|
||||
for line in output.splitlines():
|
||||
if "Last Changed Rev" in line:
|
||||
revision = line.split(":")[1].strip()
|
||||
|
||||
return revision
|
||||
|
||||
def _sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
Return a sortable revision number which in our case is the revision number
|
||||
"""
|
||||
|
||||
return self._build_revision(url, ud, d)
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
93
bitbake/lib/bb/fetch/wget.py
Normal file
93
bitbake/lib/bb/fetch/wget.py
Normal file
@@ -0,0 +1,93 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
import urllib
|
||||
from bb import data
|
||||
from bb.fetch import Fetch, FetchError, encodeurl, decodeurl, logger, runfetchcmd
|
||||
|
||||
class Wget(Fetch):
|
||||
"""Class to fetch urls via 'wget'"""
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with wget.
|
||||
"""
|
||||
return ud.type in ['http', 'https', 'ftp']
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
|
||||
url = encodeurl([ud.type, ud.host, ud.path, ud.user, ud.pswd, {}])
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
ud.localfile = data.expand(urllib.unquote(ud.basename), d)
|
||||
|
||||
return os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def go(self, uri, ud, d, checkonly = False):
|
||||
"""Fetch urls"""
|
||||
|
||||
def fetch_uri(uri, ud, d):
|
||||
if checkonly:
|
||||
fetchcmd = data.getVar("CHECKCOMMAND", d, 1)
|
||||
elif os.path.exists(ud.localpath):
|
||||
# file exists, but we didnt complete it.. trying again..
|
||||
fetchcmd = data.getVar("RESUMECOMMAND", d, 1)
|
||||
else:
|
||||
fetchcmd = data.getVar("FETCHCOMMAND", d, 1)
|
||||
|
||||
uri = uri.split(";")[0]
|
||||
uri_decoded = list(decodeurl(uri))
|
||||
uri_type = uri_decoded[0]
|
||||
uri_host = uri_decoded[1]
|
||||
|
||||
fetchcmd = fetchcmd.replace("${URI}", uri.split(";")[0])
|
||||
fetchcmd = fetchcmd.replace("${FILE}", ud.basename)
|
||||
logger.info("fetch " + uri)
|
||||
logger.debug(2, "executing " + fetchcmd)
|
||||
runfetchcmd(fetchcmd, d)
|
||||
|
||||
# Sanity check since wget can pretend it succeed when it didn't
|
||||
# Also, this used to happen if sourceforge sent us to the mirror page
|
||||
if not os.path.exists(ud.localpath) and not checkonly:
|
||||
logger.debug(2, "The fetch command for %s returned success but %s doesn't exist?...", uri, ud.localpath)
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "wget:" + data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
if fetch_uri(uri, ud, localdata):
|
||||
return True
|
||||
|
||||
raise FetchError(uri)
|
||||
|
||||
|
||||
def checkstatus(self, uri, ud, d):
|
||||
return self.go(uri, ud, d, True)
|
||||
File diff suppressed because it is too large
Load Diff
@@ -60,21 +60,21 @@ class Bzr(FetchMethod):
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_bzr}', d)
|
||||
|
||||
proto = ud.parm.get('protocol', 'http')
|
||||
proto = ud.parm.get('proto', 'http')
|
||||
|
||||
bzrroot = ud.host + ud.path
|
||||
|
||||
options = []
|
||||
|
||||
if command == "revno":
|
||||
if command is "revno":
|
||||
bzrcmd = "%s revno %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
else:
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
if command == "fetch":
|
||||
bzrcmd = "%s branch %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
elif command == "update":
|
||||
if command is "fetch":
|
||||
bzrcmd = "%s co %s %s://%s" % (basecmd, " ".join(options), proto, bzrroot)
|
||||
elif command is "update":
|
||||
bzrcmd = "%s pull %s --overwrite" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid bzr command %s" % command, ud.url)
|
||||
@@ -132,12 +132,12 @@ class Bzr(FetchMethod):
|
||||
|
||||
return output.strip()
|
||||
|
||||
def sortable_revision(self, url, ud, d, name):
|
||||
def _sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
Return a sortable revision number which in our case is the revision number
|
||||
"""
|
||||
|
||||
return False, self._build_revision(url, ud, d)
|
||||
return self._build_revision(url, ud, d)
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
|
||||
@@ -29,6 +29,7 @@ BitBake build tools.
|
||||
import os
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod, FetchError, MissingParameterError, logger
|
||||
from bb.fetch2 import runfetchcmd
|
||||
|
||||
@@ -63,7 +64,7 @@ class Cvs(FetchMethod):
|
||||
if 'fullpath' in ud.parm:
|
||||
fullpath = '_fullpath'
|
||||
|
||||
ud.localfile = bb.data.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath), d)
|
||||
ud.localfile = data.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath), d)
|
||||
|
||||
def need_update(self, url, ud, d):
|
||||
if (ud.date == "now"):
|
||||
@@ -87,10 +88,10 @@ class Cvs(FetchMethod):
|
||||
cvsroot = ud.path
|
||||
else:
|
||||
cvsroot = ":" + method
|
||||
cvsproxyhost = d.getVar('CVS_PROXY_HOST', True)
|
||||
cvsproxyhost = data.getVar('CVS_PROXY_HOST', d, True)
|
||||
if cvsproxyhost:
|
||||
cvsroot += ";proxy=" + cvsproxyhost
|
||||
cvsproxyport = d.getVar('CVS_PROXY_PORT', True)
|
||||
cvsproxyport = data.getVar('CVS_PROXY_PORT', d, True)
|
||||
if cvsproxyport:
|
||||
cvsroot += ";proxyport=" + cvsproxyport
|
||||
cvsroot += ":" + ud.user
|
||||
@@ -110,9 +111,15 @@ class Cvs(FetchMethod):
|
||||
if ud.tag:
|
||||
options.append("-r %s" % ud.tag)
|
||||
|
||||
cvsbasecmd = d.getVar("FETCHCMD_cvs", True)
|
||||
cvscmd = cvsbasecmd + " '-d" + cvsroot + "' co " + " ".join(options) + " " + ud.module
|
||||
cvsupdatecmd = cvsbasecmd + " '-d" + cvsroot + "' update -d -P " + " ".join(options)
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "cvs:%s" % data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
data.setVar('CVSROOT', cvsroot, localdata)
|
||||
data.setVar('CVSCOOPTS', " ".join(options), localdata)
|
||||
data.setVar('CVSMODULE', ud.module, localdata)
|
||||
cvscmd = data.getVar('FETCHCOMMAND', localdata, True)
|
||||
cvsupdatecmd = data.getVar('UPDATECOMMAND', localdata, True)
|
||||
|
||||
if cvs_rsh:
|
||||
cvscmd = "CVS_RSH=\"%s\" %s" % (cvs_rsh, cvscmd)
|
||||
@@ -120,8 +127,8 @@ class Cvs(FetchMethod):
|
||||
|
||||
# create module directory
|
||||
logger.debug(2, "Fetch: checking for module directory")
|
||||
pkg = d.getVar('PN', True)
|
||||
pkgdir = os.path.join(d.getVar('CVSDIR', True), pkg)
|
||||
pkg = data.expand('${PN}', d)
|
||||
pkgdir = os.path.join(data.expand('${CVSDIR}', localdata), pkg)
|
||||
moddir = os.path.join(pkgdir, localdir)
|
||||
if os.access(os.path.join(moddir, 'CVS'), os.R_OK):
|
||||
logger.info("Update " + loc)
|
||||
@@ -162,9 +169,12 @@ class Cvs(FetchMethod):
|
||||
|
||||
def clean(self, ud, d):
|
||||
""" Clean CVS Files and tarballs """
|
||||
|
||||
pkg = d.getVar('PN', True)
|
||||
pkgdir = os.path.join(d.getVar("CVSDIR", True), pkg)
|
||||
|
||||
pkg = data.expand('${PN}', d)
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "cvs:%s" % data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
pkgdir = os.path.join(data.expand('${CVSDIR}', localdata), pkg)
|
||||
|
||||
bb.utils.remove(pkgdir, True)
|
||||
bb.utils.remove(ud.localpath)
|
||||
|
||||
@@ -3,47 +3,6 @@
|
||||
"""
|
||||
BitBake 'Fetch' git implementation
|
||||
|
||||
git fetcher support the SRC_URI with format of:
|
||||
SRC_URI = "git://some.host/somepath;OptionA=xxx;OptionB=xxx;..."
|
||||
|
||||
Supported SRC_URI options are:
|
||||
|
||||
- branch
|
||||
The git branch to retrieve from. The default is "master"
|
||||
|
||||
This option also supports multiple branch fetching, with branches
|
||||
separated by commas. In multiple branches case, the name option
|
||||
must have the same number of names to match the branches, which is
|
||||
used to specify the SRC_REV for the branch
|
||||
e.g:
|
||||
SRC_URI="git://some.host/somepath;branch=branchX,branchY;name=nameX,nameY"
|
||||
SRCREV_nameX = "xxxxxxxxxxxxxxxxxxxx"
|
||||
SRCREV_nameY = "YYYYYYYYYYYYYYYYYYYY"
|
||||
|
||||
- tag
|
||||
The git tag to retrieve. The default is "master"
|
||||
|
||||
- protocol
|
||||
The method to use to access the repository. Common options are "git",
|
||||
"http", "https", "file", "ssh" and "rsync". The default is "git".
|
||||
|
||||
- rebaseable
|
||||
rebaseable indicates that the upstream git repo may rebase in the future,
|
||||
and current revision may disappear from upstream repo. This option will
|
||||
remind fetcher to preserve local cache carefully for future use.
|
||||
The default value is "0", set rebaseable=1 for rebaseable git repo.
|
||||
|
||||
- nocheckout
|
||||
Don't checkout source code when unpacking. set this option for the recipe
|
||||
who has its own routine to checkout code.
|
||||
The default is "0", set nocheckout=1 if needed.
|
||||
|
||||
- bareclone
|
||||
Create a bare clone of the source code and don't checkout the source code
|
||||
when unpacking. Set this option for the recipe who has its own routine to
|
||||
checkout code and tracking branch requirements.
|
||||
The default is "0", set bareclone=1 if needed.
|
||||
|
||||
"""
|
||||
|
||||
#Copyright (C) 2005 Richard Purdie
|
||||
@@ -71,17 +30,17 @@ from bb.fetch2 import logger
|
||||
class Git(FetchMethod):
|
||||
"""Class to fetch a module or modules from git repositories"""
|
||||
def init(self, d):
|
||||
pass
|
||||
|
||||
#
|
||||
# Only enable _sortable revision if the key is set
|
||||
#
|
||||
if bb.data.getVar("BB_GIT_CLONE_FOR_SRCREV", d, True):
|
||||
self._sortable_buildindex = self._sortable_buildindex_disabled
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with git.
|
||||
"""
|
||||
return ud.type in ['git']
|
||||
|
||||
def supports_checksum(self, urldata):
|
||||
return False
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
"""
|
||||
init git specific variable within url data
|
||||
@@ -92,20 +51,12 @@ class Git(FetchMethod):
|
||||
elif not ud.host:
|
||||
ud.proto = 'file'
|
||||
else:
|
||||
ud.proto = "git"
|
||||
ud.proto = "rsync"
|
||||
|
||||
if not ud.proto in ('git', 'file', 'ssh', 'http', 'https', 'rsync'):
|
||||
raise bb.fetch2.ParameterError("Invalid protocol type", ud.url)
|
||||
ud.nocheckout = False
|
||||
if 'nocheckout' in ud.parm:
|
||||
ud.nocheckout = True
|
||||
|
||||
ud.nocheckout = ud.parm.get("nocheckout","0") == "1"
|
||||
|
||||
ud.rebaseable = ud.parm.get("rebaseable","0") == "1"
|
||||
|
||||
# bareclone implies nocheckout
|
||||
ud.bareclone = ud.parm.get("bareclone","0") == "1"
|
||||
if ud.bareclone:
|
||||
ud.nocheckout = 1
|
||||
|
||||
branches = ud.parm.get("branch", "master").split(',')
|
||||
if len(branches) != len(ud.names):
|
||||
raise bb.fetch2.ParameterError("The number of name and branch parameters is not balanced", ud.url)
|
||||
@@ -114,34 +65,25 @@ class Git(FetchMethod):
|
||||
branch = branches[ud.names.index(name)]
|
||||
ud.branches[name] = branch
|
||||
|
||||
gitsrcname = '%s%s' % (ud.host, ud.path.replace('/', '.'))
|
||||
ud.mirrortarball = 'git2_%s.tar.gz' % (gitsrcname)
|
||||
ud.fullmirror = os.path.join(data.getVar("DL_DIR", d, True), ud.mirrortarball)
|
||||
ud.clonedir = os.path.join(data.expand('${GITDIR}', d), gitsrcname)
|
||||
|
||||
ud.basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
|
||||
ud.write_tarballs = ((data.getVar("BB_GENERATE_MIRROR_TARBALLS", d, True) or "0") != "0") or ud.rebaseable
|
||||
ud.write_tarballs = (data.getVar("BB_GENERATE_MIRROR_TARBALLS", d, True) or "0") != "0"
|
||||
|
||||
ud.localfile = ud.clonedir
|
||||
|
||||
ud.setup_revisons(d)
|
||||
|
||||
for name in ud.names:
|
||||
# Ensure anything that doesn't look like a sha256 checksum/revision is translated into one
|
||||
if not ud.revisions[name] or len(ud.revisions[name]) != 40 or (False in [c in "abcdef0123456789" for c in ud.revisions[name]]):
|
||||
if ud.revisions[name]:
|
||||
ud.branches[name] = ud.revisions[name]
|
||||
ud.branches[name] = ud.revisions[name]
|
||||
ud.revisions[name] = self.latest_revision(ud.url, ud, d, name)
|
||||
|
||||
gitsrcname = '%s%s' % (ud.host.replace(':','.'), ud.path.replace('/', '.').replace('*', '.'))
|
||||
# for rebaseable git repo, it is necessary to keep mirror tar ball
|
||||
# per revision, so that even the revision disappears from the
|
||||
# upstream repo in the future, the mirror will remain intact and still
|
||||
# contains the revision
|
||||
if ud.rebaseable:
|
||||
for name in ud.names:
|
||||
gitsrcname = gitsrcname + '_' + ud.revisions[name]
|
||||
ud.mirrortarball = 'git2_%s.tar.gz' % (gitsrcname)
|
||||
ud.fullmirror = os.path.join(d.getVar("DL_DIR", True), ud.mirrortarball)
|
||||
gitdir = d.getVar("GITDIR", True) or (d.getVar("DL_DIR", True) + "/git2/")
|
||||
ud.clonedir = os.path.join(gitdir, gitsrcname)
|
||||
|
||||
ud.localfile = ud.clonedir
|
||||
|
||||
def localpath(self, url, ud, d):
|
||||
return ud.clonedir
|
||||
|
||||
@@ -159,7 +101,7 @@ class Git(FetchMethod):
|
||||
def try_premirror(self, u, ud, d):
|
||||
# If we don't do this, updating an existing checkout with only premirrors
|
||||
# is not possible
|
||||
if d.getVar("BB_FETCH_PREMIRRORONLY", True) is not None:
|
||||
if bb.data.getVar("BB_FETCH_PREMIRRORONLY", d, True) is not None:
|
||||
return True
|
||||
if os.path.exists(ud.clonedir):
|
||||
return False
|
||||
@@ -181,17 +123,10 @@ class Git(FetchMethod):
|
||||
os.chdir(ud.clonedir)
|
||||
runfetchcmd("tar -xzf %s" % (ud.fullmirror), d)
|
||||
|
||||
repourl = "%s://%s%s%s" % (ud.proto, username, ud.host, ud.path)
|
||||
|
||||
# If the repo still doesn't exist, fallback to cloning it
|
||||
if not os.path.exists(ud.clonedir):
|
||||
# We do this since git will use a "-l" option automatically for local urls where possible
|
||||
if repourl.startswith("file://"):
|
||||
repourl = repourl[7:]
|
||||
clone_cmd = "%s clone --bare --mirror %s %s" % (ud.basecmd, repourl, ud.clonedir)
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, clone_cmd)
|
||||
runfetchcmd(clone_cmd, d)
|
||||
bb.fetch2.check_network_access(d, "git clone --bare %s%s" % (ud.host, ud.path))
|
||||
runfetchcmd("%s clone --bare %s://%s%s%s %s" % (ud.basecmd, ud.proto, username, ud.host, ud.path, ud.clonedir), d)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
# Update the checkout if needed
|
||||
@@ -200,16 +135,15 @@ class Git(FetchMethod):
|
||||
if not self._contains_ref(ud.revisions[name], d):
|
||||
needupdate = True
|
||||
if needupdate:
|
||||
bb.fetch2.check_network_access(d, "git fetch %s%s" % (ud.host, ud.path), ud.url)
|
||||
try:
|
||||
runfetchcmd("%s remote prune origin" % ud.basecmd, d)
|
||||
runfetchcmd("%s remote rm origin" % ud.basecmd, d)
|
||||
except bb.fetch2.FetchError:
|
||||
logger.debug(1, "No Origin")
|
||||
|
||||
runfetchcmd("%s remote add --mirror=fetch origin %s" % (ud.basecmd, repourl), d)
|
||||
fetch_cmd = "%s fetch -f --prune %s refs/*:refs/*" % (ud.basecmd, repourl)
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, fetch_cmd, ud.url)
|
||||
runfetchcmd(fetch_cmd, d)
|
||||
|
||||
runfetchcmd("%s remote add origin %s://%s%s%s" % (ud.basecmd, ud.proto, username, ud.host, ud.path), d)
|
||||
runfetchcmd("%s fetch --all -t" % ud.basecmd, d)
|
||||
runfetchcmd("%s prune-packed" % ud.basecmd, d)
|
||||
runfetchcmd("%s pack-redundant --all | xargs -r rm" % ud.basecmd, d)
|
||||
ud.repochanged = True
|
||||
@@ -217,14 +151,9 @@ class Git(FetchMethod):
|
||||
def build_mirror_data(self, url, ud, d):
|
||||
# Generate a mirror tarball if needed
|
||||
if ud.write_tarballs and (ud.repochanged or not os.path.exists(ud.fullmirror)):
|
||||
# it's possible that this symlink points to read-only filesystem with PREMIRROR
|
||||
if os.path.islink(ud.fullmirror):
|
||||
os.unlink(ud.fullmirror)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
logger.info("Creating tarball of git repository")
|
||||
runfetchcmd("tar -czf %s %s" % (ud.fullmirror, os.path.join(".") ), d)
|
||||
runfetchcmd("touch %s.done" % (ud.fullmirror), d)
|
||||
|
||||
def unpack(self, ud, destdir, d):
|
||||
""" unpack the downloaded src to destdir"""
|
||||
@@ -232,44 +161,18 @@ class Git(FetchMethod):
|
||||
subdir = ud.parm.get("subpath", "")
|
||||
if subdir != "":
|
||||
readpathspec = ":%s" % (subdir)
|
||||
def_destsuffix = "%s/" % os.path.basename(subdir)
|
||||
else:
|
||||
readpathspec = ""
|
||||
def_destsuffix = "git/"
|
||||
|
||||
destsuffix = ud.parm.get("destsuffix", def_destsuffix)
|
||||
destdir = ud.destdir = os.path.join(destdir, destsuffix)
|
||||
destdir = os.path.join(destdir, "git/")
|
||||
if os.path.exists(destdir):
|
||||
bb.utils.prunedir(destdir)
|
||||
|
||||
cloneflags = "-s -n"
|
||||
if ud.bareclone:
|
||||
cloneflags += " --mirror"
|
||||
|
||||
# Versions of git prior to 1.7.9.2 have issues where foo.git and foo get confused
|
||||
# and you end up with some horrible union of the two when you attempt to clone it
|
||||
# The least invasive workaround seems to be a symlink to the real directory to
|
||||
# fool git into ignoring any .git version that may also be present.
|
||||
#
|
||||
# The issue is fixed in more recent versions of git so we can drop this hack in future
|
||||
# when that version becomes common enough.
|
||||
clonedir = ud.clonedir
|
||||
if not ud.path.endswith(".git"):
|
||||
indirectiondir = destdir[:-1] + ".indirectionsymlink"
|
||||
if os.path.exists(indirectiondir):
|
||||
os.remove(indirectiondir)
|
||||
bb.utils.mkdirhier(os.path.dirname(indirectiondir))
|
||||
os.symlink(ud.clonedir, indirectiondir)
|
||||
clonedir = indirectiondir
|
||||
|
||||
runfetchcmd("git clone %s %s/ %s" % (cloneflags, clonedir, destdir), d)
|
||||
runfetchcmd("git clone -s -n %s %s" % (ud.clonedir, destdir), d)
|
||||
if not ud.nocheckout:
|
||||
os.chdir(destdir)
|
||||
if subdir != "":
|
||||
runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.revisions[ud.names[0]], readpathspec), d)
|
||||
runfetchcmd("%s checkout-index -q -f -a" % ud.basecmd, d)
|
||||
else:
|
||||
runfetchcmd("%s checkout %s" % (ud.basecmd, ud.revisions[ud.names[0]]), d)
|
||||
runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.revisions[ud.names[0]], readpathspec), d)
|
||||
runfetchcmd("%s checkout-index -q -f -a" % ud.basecmd, d)
|
||||
return True
|
||||
|
||||
def clean(self, ud, d):
|
||||
@@ -283,10 +186,7 @@ class Git(FetchMethod):
|
||||
|
||||
def _contains_ref(self, tag, d):
|
||||
basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
cmd = "%s log --pretty=oneline -n 1 %s -- 2> /dev/null | wc -l" % (basecmd, tag)
|
||||
output = runfetchcmd(cmd, d, quiet=True)
|
||||
if len(output.split()) > 1:
|
||||
raise bb.fetch2.FetchError("The command '%s' gave output with more then 1 line unexpectedly, output: '%s'" % (cmd, output))
|
||||
output = runfetchcmd("%s log --pretty=oneline -n 1 %s -- 2> /dev/null | wc -l" % (basecmd, tag), d, quiet=True)
|
||||
return output.split()[0] != "0"
|
||||
|
||||
def _revision_key(self, url, ud, d, name):
|
||||
@@ -304,11 +204,9 @@ class Git(FetchMethod):
|
||||
else:
|
||||
username = ""
|
||||
|
||||
bb.fetch2.check_network_access(d, "git ls-remote %s%s %s" % (ud.host, ud.path, ud.branches[name]))
|
||||
basecmd = data.getVar("FETCHCMD_git", d, True) or "git"
|
||||
cmd = "%s ls-remote %s://%s%s%s %s" % \
|
||||
(basecmd, ud.proto, username, ud.host, ud.path, ud.branches[name])
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, cmd)
|
||||
cmd = "%s ls-remote %s://%s%s%s %s" % (basecmd, ud.proto, username, ud.host, ud.path, ud.branches[name])
|
||||
output = runfetchcmd(cmd, d, True)
|
||||
if not output:
|
||||
raise bb.fetch2.FetchError("The command %s gave empty output unexpectedly" % cmd, url)
|
||||
@@ -317,10 +215,31 @@ class Git(FetchMethod):
|
||||
def _build_revision(self, url, ud, d, name):
|
||||
return ud.revisions[name]
|
||||
|
||||
def checkstatus(self, uri, ud, d):
|
||||
fetchcmd = "%s ls-remote %s" % (ud.basecmd, uri)
|
||||
try:
|
||||
runfetchcmd(fetchcmd, d, quiet=True)
|
||||
return True
|
||||
except FetchError:
|
||||
return False
|
||||
def _sortable_buildindex_disabled(self, url, ud, d, rev):
|
||||
"""
|
||||
Return a suitable buildindex for the revision specified. This is done by counting revisions
|
||||
using "git rev-list" which may or may not work in different circumstances.
|
||||
"""
|
||||
|
||||
cwd = os.getcwd()
|
||||
|
||||
# Check if we have the rev already
|
||||
|
||||
if not os.path.exists(ud.clonedir):
|
||||
print("no repo")
|
||||
self.download(None, ud, d)
|
||||
if not os.path.exists(ud.clonedir):
|
||||
logger.error("GIT repository for %s doesn't exist in %s, cannot get sortable buildnumber, using old value", url, ud.clonedir)
|
||||
return None
|
||||
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
if not self._contains_ref(rev, d):
|
||||
self.download(None, ud, d)
|
||||
|
||||
output = runfetchcmd("%s rev-list %s -- 2> /dev/null | wc -l" % (ud.basecmd, rev), d, quiet=True)
|
||||
os.chdir(cwd)
|
||||
|
||||
buildindex = "%s" % output.split()[0]
|
||||
logger.debug(1, "GIT repository for %s in %s is returning %s revisions in rev-list before %s", url, ud.clonedir, buildindex, rev)
|
||||
return buildindex
|
||||
|
||||
@@ -1,78 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' git submodules implementation
|
||||
"""
|
||||
|
||||
# Copyright (C) 2013 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2.git import Git
|
||||
from bb.fetch2 import runfetchcmd
|
||||
from bb.fetch2 import logger
|
||||
|
||||
class GitSM(Git):
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with git.
|
||||
"""
|
||||
return ud.type in ['gitsm']
|
||||
|
||||
def uses_submodules(self, ud, d):
|
||||
for name in ud.names:
|
||||
try:
|
||||
runfetchcmd("%s show %s:.gitmodules" % (ud.basecmd, ud.revisions[name]), d, quiet=True)
|
||||
return True
|
||||
except bb.fetch.FetchError:
|
||||
pass
|
||||
return False
|
||||
|
||||
def update_submodules(self, u, ud, d):
|
||||
# We have to convert bare -> full repo, do the submodule bit, then convert back
|
||||
tmpclonedir = ud.clonedir + ".tmp"
|
||||
gitdir = tmpclonedir + os.sep + ".git"
|
||||
bb.utils.remove(tmpclonedir, True)
|
||||
os.mkdir(tmpclonedir)
|
||||
os.rename(ud.clonedir, gitdir)
|
||||
runfetchcmd("sed " + gitdir + "/config -i -e 's/bare.*=.*true/bare = false/'", d)
|
||||
os.chdir(tmpclonedir)
|
||||
runfetchcmd("git reset --hard", d)
|
||||
runfetchcmd("git submodule init", d)
|
||||
runfetchcmd("git submodule update", d)
|
||||
runfetchcmd("sed " + gitdir + "/config -i -e 's/bare.*=.*false/bare = true/'", d)
|
||||
os.rename(gitdir, ud.clonedir,)
|
||||
bb.utils.remove(tmpclonedir, True)
|
||||
|
||||
def download(self, loc, ud, d):
|
||||
Git.download(self, loc, ud, d)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
submodules = self.uses_submodules(ud, d)
|
||||
if submodules:
|
||||
self.update_submodules(loc, ud, d)
|
||||
|
||||
def unpack(self, ud, destdir, d):
|
||||
Git.unpack(self, ud, destdir, d)
|
||||
|
||||
os.chdir(ud.destdir)
|
||||
submodules = self.uses_submodules(ud, d)
|
||||
if submodules:
|
||||
runfetchcmd("cp -r " + ud.clonedir + "/modules " + ud.destdir + "/.git/", d)
|
||||
runfetchcmd("git submodule init", d)
|
||||
runfetchcmd("git submodule update", d)
|
||||
|
||||
@@ -82,7 +82,7 @@ class Hg(FetchMethod):
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_hg}', d)
|
||||
|
||||
proto = ud.parm.get('protocol', 'http')
|
||||
proto = ud.parm.get('proto', 'http')
|
||||
|
||||
host = ud.host
|
||||
if proto == "file":
|
||||
@@ -94,26 +94,21 @@ class Hg(FetchMethod):
|
||||
else:
|
||||
hgroot = ud.user + "@" + host + ud.path
|
||||
|
||||
if command == "info":
|
||||
if command is "info":
|
||||
return "%s identify -i %s://%s/%s" % (basecmd, proto, hgroot, ud.module)
|
||||
|
||||
options = [];
|
||||
|
||||
# Don't specify revision for the fetch; clone the entire repo.
|
||||
# This avoids an issue if the specified revision is a tag, because
|
||||
# the tag actually exists in the specified revision + 1, so it won't
|
||||
# be available when used in any successive commands.
|
||||
if ud.revision and command != "fetch":
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
|
||||
if command == "fetch":
|
||||
if command is "fetch":
|
||||
cmd = "%s clone %s %s://%s/%s %s" % (basecmd, " ".join(options), proto, hgroot, ud.module, ud.module)
|
||||
elif command == "pull":
|
||||
elif command is "pull":
|
||||
# do not pass options list; limiting pull to rev causes the local
|
||||
# repo not to contain it and immediately following "update" command
|
||||
# will crash
|
||||
cmd = "%s pull" % (basecmd)
|
||||
elif command == "update":
|
||||
elif command is "update":
|
||||
cmd = "%s update -C %s" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid hg command %s" % command, ud.url)
|
||||
@@ -171,7 +166,7 @@ class Hg(FetchMethod):
|
||||
output = runfetchcmd(self._buildhgcommand(ud, d, "info"), d)
|
||||
return output.strip()
|
||||
|
||||
def _build_revision(self, url, ud, d, name):
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
|
||||
def _revision_key(self, url, ud, d, name):
|
||||
|
||||
@@ -26,12 +26,10 @@ BitBake build tools.
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import urllib
|
||||
import bb
|
||||
import bb.utils
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod, FetchError
|
||||
from bb.fetch2 import logger
|
||||
from bb.fetch2 import FetchMethod
|
||||
|
||||
class Local(FetchMethod):
|
||||
def supports(self, url, urldata, d):
|
||||
@@ -42,37 +40,29 @@ class Local(FetchMethod):
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
# We don't set localfile as for this fetcher the file is already local!
|
||||
ud.decodedurl = urllib.unquote(ud.url.split("://")[1].split(";")[0])
|
||||
ud.basename = os.path.basename(ud.decodedurl)
|
||||
ud.basepath = ud.decodedurl
|
||||
ud.basename = os.path.basename(ud.url.split("://")[1].split(";")[0])
|
||||
return
|
||||
|
||||
def localpath(self, url, urldata, d):
|
||||
"""
|
||||
Return the local filename of a given url assuming a successful fetch.
|
||||
"""
|
||||
path = urldata.decodedurl
|
||||
path = url.split("://")[1]
|
||||
path = path.split(";")[0]
|
||||
newpath = path
|
||||
dldirfile = os.path.join(data.getVar("DL_DIR", d, True), os.path.basename(path))
|
||||
if os.path.exists(dldirfile):
|
||||
return dldirfile
|
||||
if path[0] != "/":
|
||||
filespath = data.getVar('FILESPATH', d, True)
|
||||
if filespath:
|
||||
logger.debug(2, "Searching for %s in paths: \n%s" % (path, "\n ".join(filespath.split(":"))))
|
||||
newpath = bb.utils.which(filespath, path)
|
||||
if not newpath:
|
||||
filesdir = data.getVar('FILESDIR', d, True)
|
||||
if filesdir:
|
||||
logger.debug(2, "Searching for %s in path: %s" % (path, filesdir))
|
||||
newpath = os.path.join(filesdir, path)
|
||||
if (not newpath or not os.path.exists(newpath)) and path.find("*") != -1:
|
||||
# For expressions using '*', best we can do is take the first directory in FILESPATH that exists
|
||||
newpath = bb.utils.which(filespath, ".")
|
||||
logger.debug(2, "Searching for %s in path: %s" % (path, newpath))
|
||||
return newpath
|
||||
if not os.path.exists(newpath):
|
||||
dldirfile = os.path.join(d.getVar("DL_DIR", True), path)
|
||||
logger.debug(2, "Defaulting to %s for %s" % (dldirfile, path))
|
||||
bb.utils.mkdirhier(os.path.dirname(dldirfile))
|
||||
return dldirfile
|
||||
if not os.path.exists(newpath) and path.find("*") == -1:
|
||||
return dldirfile
|
||||
return newpath
|
||||
|
||||
def need_update(self, url, ud, d):
|
||||
@@ -85,20 +75,7 @@ class Local(FetchMethod):
|
||||
def download(self, url, urldata, d):
|
||||
"""Fetch urls (no-op for Local method)"""
|
||||
# no need to fetch local files, we'll deal with them in place.
|
||||
if self.supports_checksum(urldata) and not os.path.exists(urldata.localpath):
|
||||
locations = []
|
||||
filespath = data.getVar('FILESPATH', d, True)
|
||||
if filespath:
|
||||
locations = filespath.split(":")
|
||||
filesdir = data.getVar('FILESDIR', d, True)
|
||||
if filesdir:
|
||||
locations.append(filesdir)
|
||||
locations.append(d.getVar("DL_DIR", True))
|
||||
|
||||
msg = "Unable to find file " + url + " anywhere. The paths that were searched were:\n " + "\n ".join(locations)
|
||||
raise FetchError(msg)
|
||||
|
||||
return True
|
||||
return 1
|
||||
|
||||
def checkstatus(self, url, urldata, d):
|
||||
"""
|
||||
|
||||
@@ -57,7 +57,7 @@ class Osc(FetchMethod):
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_osc}', d)
|
||||
|
||||
proto = ud.parm.get('protocol', 'ocs')
|
||||
proto = ud.parm.get('proto', 'ocs')
|
||||
|
||||
options = []
|
||||
|
||||
@@ -68,9 +68,9 @@ class Osc(FetchMethod):
|
||||
|
||||
coroot = self._strip_leading_slashes(ud.path)
|
||||
|
||||
if command == "fetch":
|
||||
if command is "fetch":
|
||||
osccmd = "%s %s co %s/%s %s" % (basecmd, config, coroot, ud.module, " ".join(options))
|
||||
elif command == "update":
|
||||
elif command is "update":
|
||||
osccmd = "%s %s up %s" % (basecmd, config, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid osc command %s" % command, ud.url)
|
||||
|
||||
@@ -27,7 +27,6 @@ BitBake build tools.
|
||||
|
||||
from future_builtins import zip
|
||||
import os
|
||||
import subprocess
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
@@ -91,8 +90,8 @@ class Perforce(FetchMethod):
|
||||
|
||||
p4cmd = data.getVar('FETCHCOMMAND_p4', d, True)
|
||||
logger.debug(1, "Running %s%s changes -m 1 %s", p4cmd, p4opt, depot)
|
||||
p4file, errors = bb.process.run("%s%s changes -m 1 %s" % (p4cmd, p4opt, depot))
|
||||
cset = p4file.strip()
|
||||
p4file = os.popen("%s%s changes -m 1 %s" % (p4cmd, p4opt, depot))
|
||||
cset = p4file.readline().strip()
|
||||
logger.debug(1, "READ %s", cset)
|
||||
if not cset:
|
||||
return -1
|
||||
@@ -155,8 +154,8 @@ class Perforce(FetchMethod):
|
||||
logger.debug(2, "Fetch: creating temporary directory")
|
||||
bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
|
||||
data.setVar('TMPBASE', data.expand('${WORKDIR}/oep4.XXXXXX', localdata), localdata)
|
||||
tmpfile, errors = bb.process.run(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
|
||||
tmpfile = tmpfile.strip()
|
||||
tmppipe = os.popen(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
|
||||
tmpfile = tmppipe.readline().strip()
|
||||
if not tmpfile:
|
||||
raise FetchError("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.", loc)
|
||||
|
||||
@@ -169,8 +168,7 @@ class Perforce(FetchMethod):
|
||||
os.chdir(tmpfile)
|
||||
logger.info("Fetch " + loc)
|
||||
logger.info("%s%s files %s", p4cmd, p4opt, depot)
|
||||
p4file, errors = bb.process.run("%s%s files %s" % (p4cmd, p4opt, depot))
|
||||
p4file = [f.rstrip() for f in p4file.splitlines()]
|
||||
p4file = os.popen("%s%s files %s" % (p4cmd, p4opt, depot))
|
||||
|
||||
if not p4file:
|
||||
raise FetchError("Fetch: unable to get the P4 files from %s" % depot, loc)
|
||||
@@ -186,7 +184,7 @@ class Perforce(FetchMethod):
|
||||
dest = list[0][len(path)+1:]
|
||||
where = dest.find("#")
|
||||
|
||||
subprocess.call("%s%s print -o %s/%s %s" % (p4cmd, p4opt, module, dest[:where], list[0]), shell=True)
|
||||
os.system("%s%s print -o %s/%s %s" % (p4cmd, p4opt, module, dest[:where], list[0]))
|
||||
count = count + 1
|
||||
|
||||
if count == 0:
|
||||
|
||||
@@ -1,129 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake SFTP Fetch implementation
|
||||
|
||||
Class for fetching files via SFTP. It tries to adhere to the (now
|
||||
expired) IETF Internet Draft for "Uniform Resource Identifier (URI)
|
||||
Scheme for Secure File Transfer Protocol (SFTP) and Secure Shell
|
||||
(SSH)" (SECSH URI).
|
||||
|
||||
It uses SFTP (as to adhere to the SECSH URI specification). It only
|
||||
supports key based authentication, not password. This class, unlike
|
||||
the SSH fetcher, does not support fetching a directory tree from the
|
||||
remote.
|
||||
|
||||
http://tools.ietf.org/html/draft-ietf-secsh-scp-sftp-ssh-uri-04
|
||||
https://www.iana.org/assignments/uri-schemes/prov/sftp
|
||||
https://tools.ietf.org/html/draft-ietf-secsh-filexfer-13
|
||||
|
||||
Please note that '/' is used as host path seperator, and not ":"
|
||||
as you may be used to from the scp/sftp commands. You can use a
|
||||
~ (tilde) to specify a path relative to your home directory.
|
||||
(The /~user/ syntax, for specyfing a path relative to another
|
||||
user's home directory is not supported.) Note that the tilde must
|
||||
still follow the host path seperator ("/"). See exampels below.
|
||||
|
||||
Example SRC_URIs:
|
||||
|
||||
SRC_URI = "sftp://host.example.com/dir/path.file.txt"
|
||||
|
||||
A path relative to your home directory.
|
||||
|
||||
SRC_URI = "sftp://host.example.com/~/dir/path.file.txt"
|
||||
|
||||
You can also specify a username (specyfing password in the
|
||||
URI is not supported, use SSH keys to authenticate):
|
||||
|
||||
SRC_URI = "sftp://user@host.example.com/dir/path.file.txt"
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2013, Olof Johansson <olof.johansson@axis.com>
|
||||
#
|
||||
# Based in part on bb.fetch2.wget:
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import bb
|
||||
import urllib
|
||||
import commands
|
||||
from bb import data
|
||||
from bb.fetch2 import URI
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import runfetchcmd
|
||||
|
||||
|
||||
class SFTP(FetchMethod):
|
||||
"""Class to fetch urls via 'sftp'"""
|
||||
|
||||
def supports(self, url, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with sftp.
|
||||
"""
|
||||
return ud.type in ['sftp']
|
||||
|
||||
def recommends_checksum(self, urldata):
|
||||
return True
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
if 'protocol' in ud.parm and ud.parm['protocol'] == 'git':
|
||||
raise bb.fetch2.ParameterError(
|
||||
"Invalid protocol - if you wish to fetch from a " +
|
||||
"git repository using ssh, you need to use the " +
|
||||
"git:// prefix with protocol=ssh", ud.url)
|
||||
|
||||
if 'downloadfilename' in ud.parm:
|
||||
ud.basename = ud.parm['downloadfilename']
|
||||
else:
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
|
||||
ud.localfile = data.expand(urllib.unquote(ud.basename), d)
|
||||
|
||||
def download(self, uri, ud, d):
|
||||
"""Fetch urls"""
|
||||
|
||||
urlo = URI(uri)
|
||||
basecmd = 'sftp -oPasswordAuthentication=no'
|
||||
port = ''
|
||||
if urlo.port:
|
||||
port = '-P %d' % urlo.port
|
||||
urlo.port = None
|
||||
|
||||
dldir = data.getVar('DL_DIR', d, True)
|
||||
lpath = os.path.join(dldir, ud.localfile)
|
||||
|
||||
user = ''
|
||||
if urlo.userinfo:
|
||||
user = urlo.userinfo + '@'
|
||||
|
||||
path = urlo.path
|
||||
|
||||
# Supoprt URIs relative to the user's home directory, with
|
||||
# the tilde syntax. (E.g. <sftp://example.com/~/foo.diff>).
|
||||
if path[:3] == '/~/':
|
||||
path = path[3:]
|
||||
|
||||
remote = '%s%s:%s' % (user, urlo.hostname, path)
|
||||
|
||||
cmd = '%s %s %s %s' % (basecmd, port, commands.mkarg(remote),
|
||||
commands.mkarg(lpath))
|
||||
|
||||
bb.fetch2.check_network_access(d, cmd, uri)
|
||||
runfetchcmd(cmd, d)
|
||||
return True
|
||||
@@ -10,12 +10,6 @@ IETF secsh internet draft:
|
||||
Currently does not support the sftp parameters, as this uses scp
|
||||
Also does not support the 'fingerprint' connection parameter.
|
||||
|
||||
Please note that '/' is used as host, path separator not ':' as you may
|
||||
be used to, also '~' can be used to specify user HOME, but again after '/'
|
||||
|
||||
Example SRC_URI:
|
||||
SRC_URI = "ssh://user@host.example.com/dir/path/file.txt"
|
||||
SRC_URI = "ssh://user@host.example.com/~/file.txt"
|
||||
'''
|
||||
|
||||
# Copyright (C) 2006 OpenedHand Ltd.
|
||||
@@ -75,22 +69,15 @@ class SSH(FetchMethod):
|
||||
def supports(self, url, urldata, d):
|
||||
return __pattern__.match(url) != None
|
||||
|
||||
def supports_checksum(self, urldata):
|
||||
return False
|
||||
|
||||
def urldata_init(self, urldata, d):
|
||||
if 'protocol' in urldata.parm and urldata.parm['protocol'] == 'git':
|
||||
raise bb.fetch2.ParameterError(
|
||||
"Invalid protocol - if you wish to fetch from a git " +
|
||||
"repository using ssh, you need to use " +
|
||||
"git:// prefix with protocol=ssh", urldata.url)
|
||||
def localpath(self, url, urldata, d):
|
||||
m = __pattern__.match(urldata.url)
|
||||
path = m.group('path')
|
||||
host = m.group('host')
|
||||
urldata.localpath = os.path.join(d.getVar('DL_DIR', True), os.path.basename(path))
|
||||
lpath = os.path.join(data.getVar('DL_DIR', d, True), host, os.path.basename(path))
|
||||
return lpath
|
||||
|
||||
def download(self, url, urldata, d):
|
||||
dldir = d.getVar('DL_DIR', True)
|
||||
dldir = data.getVar('DL_DIR', d, True)
|
||||
|
||||
m = __pattern__.match(url)
|
||||
path = m.group('path')
|
||||
@@ -99,10 +86,16 @@ class SSH(FetchMethod):
|
||||
user = m.group('user')
|
||||
password = m.group('pass')
|
||||
|
||||
ldir = os.path.join(dldir, host)
|
||||
lpath = os.path.join(ldir, os.path.basename(path))
|
||||
|
||||
if not os.path.exists(ldir):
|
||||
os.makedirs(ldir)
|
||||
|
||||
if port:
|
||||
portarg = '-P %s' % port
|
||||
port = '-P %s' % port
|
||||
else:
|
||||
portarg = ''
|
||||
port = ''
|
||||
|
||||
if user:
|
||||
fr = user
|
||||
@@ -116,9 +109,9 @@ class SSH(FetchMethod):
|
||||
|
||||
import commands
|
||||
cmd = 'scp -B -r %s %s %s/' % (
|
||||
portarg,
|
||||
port,
|
||||
commands.mkarg(fr),
|
||||
commands.mkarg(dldir)
|
||||
commands.mkarg(ldir)
|
||||
)
|
||||
|
||||
bb.fetch2.check_network_access(d, cmd, urldata.url)
|
||||
|
||||
@@ -77,8 +77,8 @@ class Svk(FetchMethod):
|
||||
logger.debug(2, "Fetch: creating temporary directory")
|
||||
bb.utils.mkdirhier(data.expand('${WORKDIR}', localdata))
|
||||
data.setVar('TMPBASE', data.expand('${WORKDIR}/oesvk.XXXXXX', localdata), localdata)
|
||||
tmpfile, errors = bb.process.run(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
|
||||
tmpfile = tmpfile.strip()
|
||||
tmppipe = os.popen(data.getVar('MKTEMPDIRCMD', localdata, True) or "false")
|
||||
tmpfile = tmppipe.readline().strip()
|
||||
if not tmpfile:
|
||||
logger.error()
|
||||
raise FetchError("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.", loc)
|
||||
|
||||
@@ -49,8 +49,6 @@ class Svn(FetchMethod):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError('module', ud.url)
|
||||
|
||||
ud.basecmd = d.getVar('FETCHCMD_svn', True)
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
# Create paths to svn checkouts
|
||||
@@ -71,7 +69,9 @@ class Svn(FetchMethod):
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
proto = ud.parm.get('protocol', 'svn')
|
||||
basecmd = data.expand('${FETCHCMD_svn}', d)
|
||||
|
||||
proto = ud.parm.get('proto', 'svn')
|
||||
|
||||
svn_rsh = None
|
||||
if proto == "svn+ssh" and "rsh" in ud.parm:
|
||||
@@ -81,26 +81,24 @@ class Svn(FetchMethod):
|
||||
|
||||
options = []
|
||||
|
||||
options.append("--no-auth-cache")
|
||||
|
||||
if ud.user:
|
||||
options.append("--username %s" % ud.user)
|
||||
|
||||
if ud.pswd:
|
||||
options.append("--password %s" % ud.pswd)
|
||||
|
||||
if command == "info":
|
||||
svncmd = "%s info %s %s://%s/%s/" % (ud.basecmd, " ".join(options), proto, svnroot, ud.module)
|
||||
if command is "info":
|
||||
svncmd = "%s info %s %s://%s/%s/" % (basecmd, " ".join(options), proto, svnroot, ud.module)
|
||||
else:
|
||||
suffix = ""
|
||||
if ud.revision:
|
||||
options.append("-r %s" % ud.revision)
|
||||
suffix = "@%s" % (ud.revision)
|
||||
|
||||
if command == "fetch":
|
||||
svncmd = "%s co %s %s://%s/%s%s %s" % (ud.basecmd, " ".join(options), proto, svnroot, ud.module, suffix, ud.module)
|
||||
elif command == "update":
|
||||
svncmd = "%s update %s" % (ud.basecmd, " ".join(options))
|
||||
if command is "fetch":
|
||||
svncmd = "%s co %s %s://%s/%s%s %s" % (basecmd, " ".join(options), proto, svnroot, ud.module, suffix, ud.module)
|
||||
elif command is "update":
|
||||
svncmd = "%s update %s" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid svn command %s" % command, ud.url)
|
||||
|
||||
@@ -119,11 +117,6 @@ class Svn(FetchMethod):
|
||||
logger.info("Update " + loc)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
# We need to attempt to run svn upgrade first in case its an older working format
|
||||
try:
|
||||
runfetchcmd(ud.basecmd + " upgrade", d)
|
||||
except FetchError:
|
||||
pass
|
||||
logger.debug(1, "Running %s", svnupdatecmd)
|
||||
bb.fetch2.check_network_access(d, svnupdatecmd, ud.url)
|
||||
runfetchcmd(svnupdatecmd, d)
|
||||
@@ -178,12 +171,12 @@ class Svn(FetchMethod):
|
||||
|
||||
return revision
|
||||
|
||||
def sortable_revision(self, url, ud, d, name):
|
||||
def _sortable_revision(self, url, ud, d):
|
||||
"""
|
||||
Return a sortable revision number which in our case is the revision number
|
||||
"""
|
||||
|
||||
return False, self._build_revision(url, ud, d)
|
||||
return self._build_revision(url, ud, d)
|
||||
|
||||
def _build_revision(self, url, ud, d):
|
||||
return ud.revision
|
||||
|
||||
@@ -32,6 +32,8 @@ import urllib
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import encodeurl
|
||||
from bb.fetch2 import decodeurl
|
||||
from bb.fetch2 import logger
|
||||
from bb.fetch2 import runfetchcmd
|
||||
|
||||
@@ -43,54 +45,46 @@ class Wget(FetchMethod):
|
||||
"""
|
||||
return ud.type in ['http', 'https', 'ftp']
|
||||
|
||||
def recommends_checksum(self, urldata):
|
||||
return True
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
if 'protocol' in ud.parm:
|
||||
if ud.parm['protocol'] == 'git':
|
||||
raise bb.fetch2.ParameterError("Invalid protocol - if you wish to fetch from a git repository using http, you need to instead use the git:// prefix with protocol=http", ud.url)
|
||||
|
||||
if 'downloadfilename' in ud.parm:
|
||||
ud.basename = ud.parm['downloadfilename']
|
||||
else:
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
ud.localfile = data.expand(urllib.unquote(ud.basename), d)
|
||||
|
||||
def download(self, uri, ud, d, checkonly = False):
|
||||
"""Fetch urls"""
|
||||
|
||||
basecmd = d.getVar("FETCHCMD_wget", True) or "/usr/bin/env wget -t 2 -T 30 -nv --passive-ftp --no-check-certificate"
|
||||
def fetch_uri(uri, ud, d):
|
||||
if checkonly:
|
||||
fetchcmd = data.getVar("CHECKCOMMAND", d, True)
|
||||
elif os.path.exists(ud.localpath):
|
||||
# file exists, but we didnt complete it.. trying again..
|
||||
fetchcmd = data.getVar("RESUMECOMMAND", d, True)
|
||||
else:
|
||||
fetchcmd = data.getVar("FETCHCOMMAND", d, True)
|
||||
|
||||
if not checkonly and 'downloadfilename' in ud.parm:
|
||||
dldir = d.getVar("DL_DIR", True)
|
||||
bb.utils.mkdirhier(os.path.dirname(dldir + os.sep + ud.localfile))
|
||||
basecmd += " -O " + dldir + os.sep + ud.localfile
|
||||
uri = uri.split(";")[0]
|
||||
uri_decoded = list(decodeurl(uri))
|
||||
uri_type = uri_decoded[0]
|
||||
uri_host = uri_decoded[1]
|
||||
|
||||
if checkonly:
|
||||
fetchcmd = d.getVar("CHECKCOMMAND_wget", True) or d.expand(basecmd + " --spider '${URI}'")
|
||||
elif os.path.exists(ud.localpath):
|
||||
# file exists, but we didnt complete it.. trying again..
|
||||
fetchcmd = d.getVar("RESUMECOMMAND_wget", True) or d.expand(basecmd + " -c -P ${DL_DIR} '${URI}'")
|
||||
else:
|
||||
fetchcmd = d.getVar("FETCHCOMMAND_wget", True) or d.expand(basecmd + " -P ${DL_DIR} '${URI}'")
|
||||
|
||||
uri = uri.split(";")[0]
|
||||
|
||||
fetchcmd = fetchcmd.replace("${URI}", uri.split(";")[0])
|
||||
fetchcmd = fetchcmd.replace("${FILE}", ud.basename)
|
||||
if not checkonly:
|
||||
fetchcmd = fetchcmd.replace("${URI}", uri.split(";")[0])
|
||||
fetchcmd = fetchcmd.replace("${FILE}", ud.basename)
|
||||
logger.info("fetch " + uri)
|
||||
logger.debug(2, "executing " + fetchcmd)
|
||||
bb.fetch2.check_network_access(d, fetchcmd)
|
||||
runfetchcmd(fetchcmd, d, quiet=checkonly)
|
||||
bb.fetch2.check_network_access(d, fetchcmd)
|
||||
runfetchcmd(fetchcmd, d)
|
||||
|
||||
# Sanity check since wget can pretend it succeed when it didn't
|
||||
# Also, this used to happen if sourceforge sent us to the mirror page
|
||||
if not os.path.exists(ud.localpath) and not checkonly:
|
||||
raise FetchError("The fetch command returned success for url %s but %s doesn't exist?!" % (uri, ud.localpath), uri)
|
||||
# Sanity check since wget can pretend it succeed when it didn't
|
||||
# Also, this used to happen if sourceforge sent us to the mirror page
|
||||
if not os.path.exists(ud.localpath) and not checkonly:
|
||||
raise FetchError("The fetch command returned success for url %s but %s doesn't exist?!" % (uri, ud.localpath), uri)
|
||||
|
||||
localdata = data.createCopy(d)
|
||||
data.setVar('OVERRIDES', "wget:" + data.getVar('OVERRIDES', localdata), localdata)
|
||||
data.update_data(localdata)
|
||||
|
||||
fetch_uri(uri, ud, localdata)
|
||||
|
||||
return True
|
||||
|
||||
def checkstatus(self, uri, ud, d):
|
||||
|
||||
@@ -17,7 +17,26 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
|
||||
"""
|
||||
What is a method pool?
|
||||
|
||||
BitBake has a global method scope where .bb, .inc and .bbclass
|
||||
files can install methods. These methods are parsed from strings.
|
||||
To avoid recompiling and executing these string we introduce
|
||||
a method pool to do this task.
|
||||
|
||||
This pool will be used to compile and execute the functions. It
|
||||
will be smart enough to
|
||||
"""
|
||||
|
||||
from bb.utils import better_compile, better_exec
|
||||
from bb import error
|
||||
|
||||
# A dict of modules we have handled
|
||||
# it is the number of .bbclasses + x in size
|
||||
_parsed_methods = { }
|
||||
_parsed_fns = { }
|
||||
|
||||
def insert_method(modulename, code, fn):
|
||||
"""
|
||||
@@ -27,3 +46,39 @@ def insert_method(modulename, code, fn):
|
||||
comp = better_compile(code, modulename, fn )
|
||||
better_exec(comp, None, code, fn)
|
||||
|
||||
# now some instrumentation
|
||||
code = comp.co_names
|
||||
for name in code:
|
||||
if name in ['None', 'False']:
|
||||
continue
|
||||
elif name in _parsed_fns and not _parsed_fns[name] == modulename:
|
||||
error( "Error Method already seen: %s in' %s' now in '%s'" % (name, _parsed_fns[name], modulename))
|
||||
else:
|
||||
_parsed_fns[name] = modulename
|
||||
|
||||
def check_insert_method(modulename, code, fn):
|
||||
"""
|
||||
Add the code if it wasnt added before. The module
|
||||
name will be used for that
|
||||
|
||||
Variables:
|
||||
@modulename a short name e.g. base.bbclass
|
||||
@code The actual python code
|
||||
@fn The filename from the outer file
|
||||
"""
|
||||
if not modulename in _parsed_methods:
|
||||
return insert_method(modulename, code, fn)
|
||||
_parsed_methods[modulename] = 1
|
||||
|
||||
def parsed_module(modulename):
|
||||
"""
|
||||
Inform me file xyz was parsed
|
||||
"""
|
||||
return modulename in _parsed_methods
|
||||
|
||||
|
||||
def get_parsed_dict():
|
||||
"""
|
||||
shortcut
|
||||
"""
|
||||
return _parsed_methods
|
||||
|
||||
@@ -1,265 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Copyright (C) 2012 Robert Yang
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os, logging, re, sys
|
||||
import bb
|
||||
logger = logging.getLogger("BitBake.Monitor")
|
||||
|
||||
def printErr(info):
|
||||
logger.error("%s\n Disk space monitor will NOT be enabled" % info)
|
||||
|
||||
def convertGMK(unit):
|
||||
|
||||
""" Convert the space unit G, M, K, the unit is case-insensitive """
|
||||
|
||||
unitG = re.match('([1-9][0-9]*)[gG]\s?$', unit)
|
||||
if unitG:
|
||||
return int(unitG.group(1)) * (1024 ** 3)
|
||||
unitM = re.match('([1-9][0-9]*)[mM]\s?$', unit)
|
||||
if unitM:
|
||||
return int(unitM.group(1)) * (1024 ** 2)
|
||||
unitK = re.match('([1-9][0-9]*)[kK]\s?$', unit)
|
||||
if unitK:
|
||||
return int(unitK.group(1)) * 1024
|
||||
unitN = re.match('([1-9][0-9]*)\s?$', unit)
|
||||
if unitN:
|
||||
return int(unitN.group(1))
|
||||
else:
|
||||
return None
|
||||
|
||||
def getMountedDev(path):
|
||||
|
||||
""" Get the device mounted at the path, uses /proc/mounts """
|
||||
|
||||
# Get the mount point of the filesystem containing path
|
||||
# st_dev is the ID of device containing file
|
||||
parentDev = os.stat(path).st_dev
|
||||
currentDev = parentDev
|
||||
# When the current directory's device is different from the
|
||||
# parrent's, then the current directory is a mount point
|
||||
while parentDev == currentDev:
|
||||
mountPoint = path
|
||||
# Use dirname to get the parrent's directory
|
||||
path = os.path.dirname(path)
|
||||
# Reach the "/"
|
||||
if path == mountPoint:
|
||||
break
|
||||
parentDev= os.stat(path).st_dev
|
||||
|
||||
try:
|
||||
with open("/proc/mounts", "r") as ifp:
|
||||
for line in ifp:
|
||||
procLines = line.rstrip('\n').split()
|
||||
if procLines[1] == mountPoint:
|
||||
return procLines[0]
|
||||
except EnvironmentError:
|
||||
pass
|
||||
return None
|
||||
|
||||
def getDiskData(BBDirs, configuration):
|
||||
|
||||
"""Prepare disk data for disk space monitor"""
|
||||
|
||||
# Save the device IDs, need the ID to be unique (the dictionary's key is
|
||||
# unique), so that when more than one directories are located in the same
|
||||
# device, we just monitor it once
|
||||
devDict = {}
|
||||
for pathSpaceInode in BBDirs.split():
|
||||
# The input format is: "dir,space,inode", dir is a must, space
|
||||
# and inode are optional
|
||||
pathSpaceInodeRe = re.match('([^,]*),([^,]*),([^,]*),?(.*)', pathSpaceInode)
|
||||
if not pathSpaceInodeRe:
|
||||
printErr("Invalid value in BB_DISKMON_DIRS: %s" % pathSpaceInode)
|
||||
return None
|
||||
|
||||
action = pathSpaceInodeRe.group(1)
|
||||
if action not in ("ABORT", "STOPTASKS", "WARN"):
|
||||
printErr("Unknown disk space monitor action: %s" % action)
|
||||
return None
|
||||
|
||||
path = os.path.realpath(pathSpaceInodeRe.group(2))
|
||||
if not path:
|
||||
printErr("Invalid path value in BB_DISKMON_DIRS: %s" % pathSpaceInode)
|
||||
return None
|
||||
|
||||
# The disk space or inode is optional, but it should have a correct
|
||||
# value once it is specified
|
||||
minSpace = pathSpaceInodeRe.group(3)
|
||||
if minSpace:
|
||||
minSpace = convertGMK(minSpace)
|
||||
if not minSpace:
|
||||
printErr("Invalid disk space value in BB_DISKMON_DIRS: %s" % pathSpaceInodeRe.group(3))
|
||||
return None
|
||||
else:
|
||||
# None means that it is not specified
|
||||
minSpace = None
|
||||
|
||||
minInode = pathSpaceInodeRe.group(4)
|
||||
if minInode:
|
||||
minInode = convertGMK(minInode)
|
||||
if not minInode:
|
||||
printErr("Invalid inode value in BB_DISKMON_DIRS: %s" % pathSpaceInodeRe.group(4))
|
||||
return None
|
||||
else:
|
||||
# None means that it is not specified
|
||||
minInode = None
|
||||
|
||||
if minSpace is None and minInode is None:
|
||||
printErr("No disk space or inode value in found BB_DISKMON_DIRS: %s" % pathSpaceInode)
|
||||
return None
|
||||
# mkdir for the directory since it may not exist, for example the
|
||||
# DL_DIR may not exist at the very beginning
|
||||
if not os.path.exists(path):
|
||||
bb.utils.mkdirhier(path)
|
||||
dev = getMountedDev(path)
|
||||
# Use path/action as the key
|
||||
devDict[os.path.join(path, action)] = [dev, minSpace, minInode]
|
||||
|
||||
return devDict
|
||||
|
||||
def getInterval(configuration):
|
||||
|
||||
""" Get the disk space interval """
|
||||
|
||||
# The default value is 50M and 5K.
|
||||
spaceDefault = 50 * 1024 * 1024
|
||||
inodeDefault = 5 * 1024
|
||||
|
||||
interval = configuration.getVar("BB_DISKMON_WARNINTERVAL", True)
|
||||
if not interval:
|
||||
return spaceDefault, inodeDefault
|
||||
else:
|
||||
# The disk space or inode interval is optional, but it should
|
||||
# have a correct value once it is specified
|
||||
intervalRe = re.match('([^,]*),?\s*(.*)', interval)
|
||||
if intervalRe:
|
||||
intervalSpace = intervalRe.group(1)
|
||||
if intervalSpace:
|
||||
intervalSpace = convertGMK(intervalSpace)
|
||||
if not intervalSpace:
|
||||
printErr("Invalid disk space interval value in BB_DISKMON_WARNINTERVAL: %s" % intervalRe.group(1))
|
||||
return None, None
|
||||
else:
|
||||
intervalSpace = spaceDefault
|
||||
intervalInode = intervalRe.group(2)
|
||||
if intervalInode:
|
||||
intervalInode = convertGMK(intervalInode)
|
||||
if not intervalInode:
|
||||
printErr("Invalid disk inode interval value in BB_DISKMON_WARNINTERVAL: %s" % intervalRe.group(2))
|
||||
return None, None
|
||||
else:
|
||||
intervalInode = inodeDefault
|
||||
return intervalSpace, intervalInode
|
||||
else:
|
||||
printErr("Invalid interval value in BB_DISKMON_WARNINTERVAL: %s" % interval)
|
||||
return None, None
|
||||
|
||||
class diskMonitor:
|
||||
|
||||
"""Prepare the disk space monitor data"""
|
||||
|
||||
def __init__(self, configuration):
|
||||
|
||||
self.enableMonitor = False
|
||||
self.configuration = configuration
|
||||
|
||||
BBDirs = configuration.getVar("BB_DISKMON_DIRS", True) or None
|
||||
if BBDirs:
|
||||
self.devDict = getDiskData(BBDirs, configuration)
|
||||
if self.devDict:
|
||||
self.spaceInterval, self.inodeInterval = getInterval(configuration)
|
||||
if self.spaceInterval and self.inodeInterval:
|
||||
self.enableMonitor = True
|
||||
# These are for saving the previous disk free space and inode, we
|
||||
# use them to avoid print too many warning messages
|
||||
self.preFreeS = {}
|
||||
self.preFreeI = {}
|
||||
# This is for STOPTASKS and ABORT, to avoid print the message repeatly
|
||||
# during waiting the tasks to finish
|
||||
self.checked = {}
|
||||
for k in self.devDict:
|
||||
self.preFreeS[k] = 0
|
||||
self.preFreeI[k] = 0
|
||||
self.checked[k] = False
|
||||
if self.spaceInterval is None and self.inodeInterval is None:
|
||||
self.enableMonitor = False
|
||||
|
||||
def check(self, rq):
|
||||
|
||||
""" Take action for the monitor """
|
||||
|
||||
if self.enableMonitor:
|
||||
for k in self.devDict:
|
||||
path = os.path.dirname(k)
|
||||
action = os.path.basename(k)
|
||||
dev = self.devDict[k][0]
|
||||
minSpace = self.devDict[k][1]
|
||||
minInode = self.devDict[k][2]
|
||||
|
||||
st = os.statvfs(path)
|
||||
|
||||
# The free space, float point number
|
||||
freeSpace = st.f_bavail * st.f_frsize
|
||||
|
||||
if minSpace and freeSpace < minSpace:
|
||||
# Always show warning, the self.checked would always be False if the action is WARN
|
||||
if self.preFreeS[k] == 0 or self.preFreeS[k] - freeSpace > self.spaceInterval and not self.checked[k]:
|
||||
logger.warn("The free space of %s (%s) is running low (%.3fGB left)" % \
|
||||
(path, dev, freeSpace / 1024 / 1024 / 1024.0))
|
||||
self.preFreeS[k] = freeSpace
|
||||
|
||||
if action == "STOPTASKS" and not self.checked[k]:
|
||||
logger.error("No new tasks can be excuted since the disk space monitor action is \"STOPTASKS\"!")
|
||||
self.checked[k] = True
|
||||
rq.finish_runqueue(False)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'disk', freeSpace, path), self.configuration)
|
||||
elif action == "ABORT" and not self.checked[k]:
|
||||
logger.error("Immediately abort since the disk space monitor action is \"ABORT\"!")
|
||||
self.checked[k] = True
|
||||
rq.finish_runqueue(True)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'disk', freeSpace, path), self.configuration)
|
||||
|
||||
# The free inodes, float point number
|
||||
freeInode = st.f_favail
|
||||
|
||||
if minInode and freeInode < minInode:
|
||||
# Some fs formats' (e.g., btrfs) statvfs.f_files (inodes) is
|
||||
# zero, this is a feature of the fs, we disable the inode
|
||||
# checking for such a fs.
|
||||
if st.f_files == 0:
|
||||
logger.warn("Inode check for %s is unavaliable, will remove it from disk monitor" % path)
|
||||
self.devDict[k][2] = None
|
||||
continue
|
||||
# Always show warning, the self.checked would always be False if the action is WARN
|
||||
if self.preFreeI[k] == 0 or self.preFreeI[k] - freeInode > self.inodeInterval and not self.checked[k]:
|
||||
logger.warn("The free inode of %s (%s) is running low (%.3fK left)" % \
|
||||
(path, dev, freeInode / 1024.0))
|
||||
self.preFreeI[k] = freeInode
|
||||
|
||||
if action == "STOPTASKS" and not self.checked[k]:
|
||||
logger.error("No new tasks can be excuted since the disk space monitor action is \"STOPTASKS\"!")
|
||||
self.checked[k] = True
|
||||
rq.finish_runqueue(False)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'inode', freeInode, path), self.configuration)
|
||||
elif action == "ABORT" and not self.checked[k]:
|
||||
logger.error("Immediately abort since the disk space monitor action is \"ABORT\"!")
|
||||
self.checked[k] = True
|
||||
rq.finish_runqueue(True)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'inode', freeInode, path), self.configuration)
|
||||
return
|
||||
@@ -23,7 +23,6 @@ Message handling infrastructure for bitbake
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import sys
|
||||
import copy
|
||||
import logging
|
||||
import collections
|
||||
from itertools import groupby
|
||||
@@ -56,25 +55,6 @@ class BBLogFormatter(logging.Formatter):
|
||||
CRITICAL: 'ERROR',
|
||||
}
|
||||
|
||||
color_enabled = False
|
||||
BASECOLOR, BLACK, RED, GREEN, YELLOW, BLUE, MAGENTA, CYAN, WHITE = range(29,38)
|
||||
|
||||
COLORS = {
|
||||
DEBUG3 : CYAN,
|
||||
DEBUG2 : CYAN,
|
||||
DEBUG : CYAN,
|
||||
VERBOSE : BASECOLOR,
|
||||
NOTE : BASECOLOR,
|
||||
PLAIN : BASECOLOR,
|
||||
WARNING : YELLOW,
|
||||
ERROR : RED,
|
||||
CRITICAL: RED,
|
||||
}
|
||||
|
||||
BLD = '\033[1;%dm'
|
||||
STD = '\033[%dm'
|
||||
RST = '\033[0m'
|
||||
|
||||
def getLevelName(self, levelno):
|
||||
try:
|
||||
return self.levelnames[levelno]
|
||||
@@ -85,98 +65,136 @@ class BBLogFormatter(logging.Formatter):
|
||||
def format(self, record):
|
||||
record.levelname = self.getLevelName(record.levelno)
|
||||
if record.levelno == self.PLAIN:
|
||||
msg = record.getMessage()
|
||||
return record.getMessage()
|
||||
else:
|
||||
if self.color_enabled:
|
||||
record = self.colorize(record)
|
||||
msg = logging.Formatter.format(self, record)
|
||||
return logging.Formatter.format(self, record)
|
||||
|
||||
if hasattr(record, 'bb_exc_info'):
|
||||
etype, value, tb = record.bb_exc_info
|
||||
formatted = bb.exceptions.format_exception(etype, value, tb, limit=5)
|
||||
msg += '\n' + ''.join(formatted)
|
||||
return msg
|
||||
class Loggers(dict):
|
||||
def __getitem__(self, key):
|
||||
if key in self:
|
||||
return dict.__getitem__(self, key)
|
||||
else:
|
||||
log = logging.getLogger("BitBake.%s" % domain._fields[key])
|
||||
dict.__setitem__(self, key, log)
|
||||
return log
|
||||
|
||||
def colorize(self, record):
|
||||
color = self.COLORS[record.levelno]
|
||||
if self.color_enabled and color is not None:
|
||||
record = copy.copy(record)
|
||||
record.levelname = "".join([self.BLD % color, record.levelname, self.RST])
|
||||
record.msg = "".join([self.STD % color, record.msg, self.RST])
|
||||
return record
|
||||
|
||||
def enable_color(self):
|
||||
self.color_enabled = True
|
||||
|
||||
class BBLogFilter(object):
|
||||
def __init__(self, handler, level, debug_domains):
|
||||
self.stdlevel = level
|
||||
self.debug_domains = debug_domains
|
||||
loglevel = level
|
||||
for domain in debug_domains:
|
||||
if debug_domains[domain] < loglevel:
|
||||
loglevel = debug_domains[domain]
|
||||
handler.setLevel(loglevel)
|
||||
handler.addFilter(self)
|
||||
|
||||
def filter(self, record):
|
||||
if record.levelno >= self.stdlevel:
|
||||
return True
|
||||
if record.name in self.debug_domains and record.levelno >= self.debug_domains[record.name]:
|
||||
return True
|
||||
return False
|
||||
class DebugLevel(dict):
|
||||
def __getitem__(self, key):
|
||||
if key == "default":
|
||||
key = domain.Default
|
||||
return get_debug_level(key)
|
||||
|
||||
def _NamedTuple(name, fields):
|
||||
Tuple = collections.namedtuple(name, " ".join(fields))
|
||||
return Tuple(*range(len(fields)))
|
||||
|
||||
domain = _NamedTuple("Domain", (
|
||||
"Default",
|
||||
"Build",
|
||||
"Cache",
|
||||
"Collection",
|
||||
"Data",
|
||||
"Depends",
|
||||
"Fetcher",
|
||||
"Parsing",
|
||||
"PersistData",
|
||||
"Provider",
|
||||
"RunQueue",
|
||||
"TaskData",
|
||||
"Util"))
|
||||
logger = logging.getLogger("BitBake")
|
||||
loggers = Loggers()
|
||||
debug_level = DebugLevel()
|
||||
|
||||
# Message control functions
|
||||
#
|
||||
|
||||
loggerDefaultDebugLevel = 0
|
||||
loggerDefaultVerbose = False
|
||||
loggerVerboseLogs = False
|
||||
loggerDefaultDomains = []
|
||||
def set_debug_level(level):
|
||||
for log in loggers.itervalues():
|
||||
log.setLevel(logging.NOTSET)
|
||||
|
||||
def init_msgconfig(verbose, debug, debug_domains = []):
|
||||
"""
|
||||
Set default verbosity and debug levels config the logger
|
||||
"""
|
||||
bb.msg.loggerDefaultDebugLevel = debug
|
||||
bb.msg.loggerDefaultVerbose = verbose
|
||||
if verbose:
|
||||
bb.msg.loggerVerboseLogs = True
|
||||
bb.msg.loggerDefaultDomains = debug_domains
|
||||
|
||||
def constructLogOptions():
|
||||
debug = loggerDefaultDebugLevel
|
||||
verbose = loggerDefaultVerbose
|
||||
domains = loggerDefaultDomains
|
||||
|
||||
if debug:
|
||||
level = BBLogFormatter.DEBUG - debug + 1
|
||||
elif verbose:
|
||||
level = BBLogFormatter.VERBOSE
|
||||
if level:
|
||||
logger.setLevel(logging.DEBUG - level + 1)
|
||||
else:
|
||||
level = BBLogFormatter.NOTE
|
||||
logger.setLevel(logging.INFO)
|
||||
|
||||
debug_domains = {}
|
||||
for (domainarg, iterator) in groupby(domains):
|
||||
dlevel = len(tuple(iterator))
|
||||
debug_domains["BitBake.%s" % domainarg] = logging.DEBUG - dlevel + 1
|
||||
return level, debug_domains
|
||||
def get_debug_level(msgdomain = domain.Default):
|
||||
if not msgdomain:
|
||||
level = logger.getEffectiveLevel()
|
||||
else:
|
||||
level = loggers[msgdomain].getEffectiveLevel()
|
||||
return max(0, logging.DEBUG - level + 1)
|
||||
|
||||
def addDefaultlogFilter(handler):
|
||||
level, debug_domains = constructLogOptions()
|
||||
def set_verbose(level):
|
||||
if level:
|
||||
logger.setLevel(BBLogFormatter.VERBOSE)
|
||||
else:
|
||||
logger.setLevel(BBLogFormatter.INFO)
|
||||
|
||||
BBLogFilter(handler, level, debug_domains)
|
||||
def set_debug_domains(domainargs):
|
||||
for (domainarg, iterator) in groupby(domainargs):
|
||||
for index, msgdomain in enumerate(domain._fields):
|
||||
if msgdomain == domainarg:
|
||||
level = len(tuple(iterator))
|
||||
if level:
|
||||
loggers[index].setLevel(logging.DEBUG - level + 1)
|
||||
break
|
||||
else:
|
||||
warn(None, "Logging domain %s is not valid, ignoring" % domainarg)
|
||||
|
||||
#
|
||||
# Message handling functions
|
||||
#
|
||||
|
||||
def fatal(msgdomain, msg):
|
||||
if msgdomain:
|
||||
logger = logging.getLogger("BitBake.%s" % msgdomain)
|
||||
def debug(level, msgdomain, msg):
|
||||
warnings.warn("bb.msg.debug will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
level = logging.DEBUG - (level - 1)
|
||||
if not msgdomain:
|
||||
logger.debug(level, msg)
|
||||
else:
|
||||
logger = logging.getLogger("BitBake")
|
||||
logger.critical(msg)
|
||||
loggers[msgdomain].debug(level, msg)
|
||||
|
||||
def plain(msg):
|
||||
warnings.warn("bb.msg.plain will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
logger.plain(msg)
|
||||
|
||||
def note(level, msgdomain, msg):
|
||||
warnings.warn("bb.msg.note will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
if level > 1:
|
||||
if msgdomain:
|
||||
logger.verbose(msg)
|
||||
else:
|
||||
loggers[msgdomain].verbose(msg)
|
||||
else:
|
||||
if msgdomain:
|
||||
logger.info(msg)
|
||||
else:
|
||||
loggers[msgdomain].info(msg)
|
||||
|
||||
def warn(msgdomain, msg):
|
||||
warnings.warn("bb.msg.warn will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
if not msgdomain:
|
||||
logger.warn(msg)
|
||||
else:
|
||||
loggers[msgdomain].warn(msg)
|
||||
|
||||
def error(msgdomain, msg):
|
||||
warnings.warn("bb.msg.error will soon be deprecated in favor of the python 'logging' module",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
if not msgdomain:
|
||||
logger.error(msg)
|
||||
else:
|
||||
loggers[msgdomain].error(msg)
|
||||
|
||||
def fatal(msgdomain, msg):
|
||||
warnings.warn("bb.msg.fatal will soon be deprecated in favor of raising appropriate exceptions",
|
||||
PendingDeprecationWarning, stacklevel=2)
|
||||
if not msgdomain:
|
||||
logger.critical(msg)
|
||||
else:
|
||||
loggers[msgdomain].critical(msg)
|
||||
sys.exit(1)
|
||||
|
||||
@@ -1,255 +0,0 @@
|
||||
# http://code.activestate.com/recipes/577629-namedtupleabc-abstract-base-class-mix-in-for-named/
|
||||
#!/usr/bin/env python
|
||||
# Copyright (c) 2011 Jan Kaliszewski (zuo). Available under the MIT License.
|
||||
|
||||
"""
|
||||
namedtuple_with_abc.py:
|
||||
* named tuple mix-in + ABC (abstract base class) recipe,
|
||||
* works under Python 2.6, 2.7 as well as 3.x.
|
||||
|
||||
Import this module to patch collections.namedtuple() factory function
|
||||
-- enriching it with the 'abc' attribute (an abstract base class + mix-in
|
||||
for named tuples) and decorating it with a wrapper that registers each
|
||||
newly created named tuple as a subclass of namedtuple.abc.
|
||||
|
||||
How to import:
|
||||
import collections, namedtuple_with_abc
|
||||
or:
|
||||
import namedtuple_with_abc
|
||||
from collections import namedtuple
|
||||
# ^ in this variant you must import namedtuple function
|
||||
# *after* importing namedtuple_with_abc module
|
||||
or simply:
|
||||
from namedtuple_with_abc import namedtuple
|
||||
|
||||
Simple usage example:
|
||||
class Credentials(namedtuple.abc):
|
||||
_fields = 'username password'
|
||||
def __str__(self):
|
||||
return ('{0.__class__.__name__}'
|
||||
'(username={0.username}, password=...)'.format(self))
|
||||
print(Credentials("alice", "Alice's password"))
|
||||
|
||||
For more advanced examples -- see below the "if __name__ == '__main__':".
|
||||
"""
|
||||
|
||||
import collections
|
||||
from abc import ABCMeta, abstractproperty
|
||||
from functools import wraps
|
||||
from sys import version_info
|
||||
|
||||
__all__ = ('namedtuple',)
|
||||
_namedtuple = collections.namedtuple
|
||||
|
||||
|
||||
class _NamedTupleABCMeta(ABCMeta):
|
||||
'''The metaclass for the abstract base class + mix-in for named tuples.'''
|
||||
def __new__(mcls, name, bases, namespace):
|
||||
fields = namespace.get('_fields')
|
||||
for base in bases:
|
||||
if fields is not None:
|
||||
break
|
||||
fields = getattr(base, '_fields', None)
|
||||
if not isinstance(fields, abstractproperty):
|
||||
basetuple = _namedtuple(name, fields)
|
||||
bases = (basetuple,) + bases
|
||||
namespace.pop('_fields', None)
|
||||
namespace.setdefault('__doc__', basetuple.__doc__)
|
||||
namespace.setdefault('__slots__', ())
|
||||
return ABCMeta.__new__(mcls, name, bases, namespace)
|
||||
|
||||
|
||||
exec(
|
||||
# Python 2.x metaclass declaration syntax
|
||||
"""class _NamedTupleABC(object):
|
||||
'''The abstract base class + mix-in for named tuples.'''
|
||||
__metaclass__ = _NamedTupleABCMeta
|
||||
_fields = abstractproperty()""" if version_info[0] < 3 else
|
||||
# Python 3.x metaclass declaration syntax
|
||||
"""class _NamedTupleABC(metaclass=_NamedTupleABCMeta):
|
||||
'''The abstract base class + mix-in for named tuples.'''
|
||||
_fields = abstractproperty()"""
|
||||
)
|
||||
|
||||
|
||||
_namedtuple.abc = _NamedTupleABC
|
||||
#_NamedTupleABC.register(type(version_info)) # (and similar, in the future...)
|
||||
|
||||
@wraps(_namedtuple)
|
||||
def namedtuple(*args, **kwargs):
|
||||
'''Named tuple factory with namedtuple.abc subclass registration.'''
|
||||
cls = _namedtuple(*args, **kwargs)
|
||||
_NamedTupleABC.register(cls)
|
||||
return cls
|
||||
|
||||
collections.namedtuple = namedtuple
|
||||
|
||||
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
|
||||
'''Examples and explanations'''
|
||||
|
||||
# Simple usage
|
||||
|
||||
class MyRecord(namedtuple.abc):
|
||||
_fields = 'x y z' # such form will be transformed into ('x', 'y', 'z')
|
||||
def _my_custom_method(self):
|
||||
return list(self._asdict().items())
|
||||
# (the '_fields' attribute belongs to the named tuple public API anyway)
|
||||
|
||||
rec = MyRecord(1, 2, 3)
|
||||
print(rec)
|
||||
print(rec._my_custom_method())
|
||||
print(rec._replace(y=222))
|
||||
print(rec._replace(y=222)._my_custom_method())
|
||||
|
||||
# Custom abstract classes...
|
||||
|
||||
class MyAbstractRecord(namedtuple.abc):
|
||||
def _my_custom_method(self):
|
||||
return list(self._asdict().items())
|
||||
|
||||
try:
|
||||
MyAbstractRecord() # (abstract classes cannot be instantiated)
|
||||
except TypeError as exc:
|
||||
print(exc)
|
||||
|
||||
class AnotherAbstractRecord(MyAbstractRecord):
|
||||
def __str__(self):
|
||||
return '<<<{0}>>>'.format(super(AnotherAbstractRecord,
|
||||
self).__str__())
|
||||
|
||||
# ...and their non-abstract subclasses
|
||||
|
||||
class MyRecord2(MyAbstractRecord):
|
||||
_fields = 'a, b'
|
||||
|
||||
class MyRecord3(AnotherAbstractRecord):
|
||||
_fields = 'p', 'q', 'r'
|
||||
|
||||
rec2 = MyRecord2('foo', 'bar')
|
||||
print(rec2)
|
||||
print(rec2._my_custom_method())
|
||||
print(rec2._replace(b=222))
|
||||
print(rec2._replace(b=222)._my_custom_method())
|
||||
|
||||
rec3 = MyRecord3('foo', 'bar', 'baz')
|
||||
print(rec3)
|
||||
print(rec3._my_custom_method())
|
||||
print(rec3._replace(q=222))
|
||||
print(rec3._replace(q=222)._my_custom_method())
|
||||
|
||||
# You can also subclass non-abstract ones...
|
||||
|
||||
class MyRecord33(MyRecord3):
|
||||
def __str__(self):
|
||||
return '< {0!r}, ..., {0!r} >'.format(self.p, self.r)
|
||||
|
||||
rec33 = MyRecord33('foo', 'bar', 'baz')
|
||||
print(rec33)
|
||||
print(rec33._my_custom_method())
|
||||
print(rec33._replace(q=222))
|
||||
print(rec33._replace(q=222)._my_custom_method())
|
||||
|
||||
# ...and even override the magic '_fields' attribute again
|
||||
|
||||
class MyRecord345(MyRecord3):
|
||||
_fields = 'e f g h i j k'
|
||||
|
||||
rec345 = MyRecord345(1, 2, 3, 4, 3, 2, 1)
|
||||
print(rec345)
|
||||
print(rec345._my_custom_method())
|
||||
print(rec345._replace(f=222))
|
||||
print(rec345._replace(f=222)._my_custom_method())
|
||||
|
||||
# Mixing-in some other classes is also possible:
|
||||
|
||||
class MyMixIn(object):
|
||||
def method(self):
|
||||
return "MyMixIn.method() called"
|
||||
def _my_custom_method(self):
|
||||
return "MyMixIn._my_custom_method() called"
|
||||
def count(self, item):
|
||||
return "MyMixIn.count({0}) called".format(item)
|
||||
def _asdict(self): # (cannot override a namedtuple method, see below)
|
||||
return "MyMixIn._asdict() called"
|
||||
|
||||
class MyRecord4(MyRecord33, MyMixIn): # mix-in on the right
|
||||
_fields = 'j k l x'
|
||||
|
||||
class MyRecord5(MyMixIn, MyRecord33): # mix-in on the left
|
||||
_fields = 'j k l x y'
|
||||
|
||||
rec4 = MyRecord4(1, 2, 3, 2)
|
||||
print(rec4)
|
||||
print(rec4.method())
|
||||
print(rec4._my_custom_method()) # MyRecord33's
|
||||
print(rec4.count(2)) # tuple's
|
||||
print(rec4._replace(k=222))
|
||||
print(rec4._replace(k=222).method())
|
||||
print(rec4._replace(k=222)._my_custom_method()) # MyRecord33's
|
||||
print(rec4._replace(k=222).count(8)) # tuple's
|
||||
|
||||
rec5 = MyRecord5(1, 2, 3, 2, 1)
|
||||
print(rec5)
|
||||
print(rec5.method())
|
||||
print(rec5._my_custom_method()) # MyMixIn's
|
||||
print(rec5.count(2)) # MyMixIn's
|
||||
print(rec5._replace(k=222))
|
||||
print(rec5._replace(k=222).method())
|
||||
print(rec5._replace(k=222)._my_custom_method()) # MyMixIn's
|
||||
print(rec5._replace(k=222).count(2)) # MyMixIn's
|
||||
|
||||
# None that behavior: the standard namedtuple methods cannot be
|
||||
# overriden by a foreign mix-in -- even if the mix-in is declared
|
||||
# as the leftmost base class (but, obviously, you can override them
|
||||
# in the defined class or its subclasses):
|
||||
|
||||
print(rec4._asdict()) # (returns a dict, not "MyMixIn._asdict() called")
|
||||
print(rec5._asdict()) # (returns a dict, not "MyMixIn._asdict() called")
|
||||
|
||||
class MyRecord6(MyRecord33):
|
||||
_fields = 'j k l x y z'
|
||||
def _asdict(self):
|
||||
return "MyRecord6._asdict() called"
|
||||
rec6 = MyRecord6(1, 2, 3, 1, 2, 3)
|
||||
print(rec6._asdict()) # (this returns "MyRecord6._asdict() called")
|
||||
|
||||
# All that record classes are real subclasses of namedtuple.abc:
|
||||
|
||||
assert issubclass(MyRecord, namedtuple.abc)
|
||||
assert issubclass(MyAbstractRecord, namedtuple.abc)
|
||||
assert issubclass(AnotherAbstractRecord, namedtuple.abc)
|
||||
assert issubclass(MyRecord2, namedtuple.abc)
|
||||
assert issubclass(MyRecord3, namedtuple.abc)
|
||||
assert issubclass(MyRecord33, namedtuple.abc)
|
||||
assert issubclass(MyRecord345, namedtuple.abc)
|
||||
assert issubclass(MyRecord4, namedtuple.abc)
|
||||
assert issubclass(MyRecord5, namedtuple.abc)
|
||||
assert issubclass(MyRecord6, namedtuple.abc)
|
||||
|
||||
# ...but abstract ones are not subclasses of tuple
|
||||
# (and this is what you probably want):
|
||||
|
||||
assert not issubclass(MyAbstractRecord, tuple)
|
||||
assert not issubclass(AnotherAbstractRecord, tuple)
|
||||
|
||||
assert issubclass(MyRecord, tuple)
|
||||
assert issubclass(MyRecord2, tuple)
|
||||
assert issubclass(MyRecord3, tuple)
|
||||
assert issubclass(MyRecord33, tuple)
|
||||
assert issubclass(MyRecord345, tuple)
|
||||
assert issubclass(MyRecord4, tuple)
|
||||
assert issubclass(MyRecord5, tuple)
|
||||
assert issubclass(MyRecord6, tuple)
|
||||
|
||||
# Named tuple classes created with namedtuple() factory function
|
||||
# (in the "traditional" way) are registered as "virtual" subclasses
|
||||
# of namedtuple.abc:
|
||||
|
||||
MyTuple = namedtuple('MyTuple', 'a b c')
|
||||
mt = MyTuple(1, 2, 3)
|
||||
assert issubclass(MyTuple, namedtuple.abc)
|
||||
assert isinstance(mt, namedtuple.abc)
|
||||
@@ -37,17 +37,6 @@ logger = logging.getLogger("BitBake.Parsing")
|
||||
|
||||
class ParseError(Exception):
|
||||
"""Exception raised when parsing fails"""
|
||||
def __init__(self, msg, filename, lineno=0):
|
||||
self.msg = msg
|
||||
self.filename = filename
|
||||
self.lineno = lineno
|
||||
Exception.__init__(self, msg, filename, lineno)
|
||||
|
||||
def __str__(self):
|
||||
if self.lineno:
|
||||
return "ParseError at %s:%d: %s" % (self.filename, self.lineno, self.msg)
|
||||
else:
|
||||
return "ParseError in %s: %s" % (self.filename, self.msg)
|
||||
|
||||
class SkipPackage(Exception):
|
||||
"""Exception raised to skip this package"""
|
||||
@@ -73,8 +62,9 @@ def update_mtime(f):
|
||||
def mark_dependency(d, f):
|
||||
if f.startswith('./'):
|
||||
f = "%s/%s" % (os.getcwd(), f[2:])
|
||||
deps = (d.getVar('__depends') or []) + [(f, cached_mtime(f))]
|
||||
d.setVar('__depends', deps)
|
||||
deps = bb.data.getVar('__depends', d) or set()
|
||||
deps.update([(f, cached_mtime(f))])
|
||||
bb.data.setVar('__depends', deps, d)
|
||||
|
||||
def supports(fn, data):
|
||||
"""Returns true if we have a handler for this file, false otherwise"""
|
||||
@@ -87,9 +77,8 @@ def handle(fn, data, include = 0):
|
||||
"""Call the handler that is appropriate for this file"""
|
||||
for h in handlers:
|
||||
if h['supports'](fn, data):
|
||||
with data.inchistory.include(fn):
|
||||
return h['handle'](fn, data, include)
|
||||
raise ParseError("not a BitBake file", fn)
|
||||
return h['handle'](fn, data, include)
|
||||
raise ParseError("%s is not a BitBake file" % fn)
|
||||
|
||||
def init(fn, data):
|
||||
for h in handlers:
|
||||
@@ -101,15 +90,12 @@ def init_parser(d):
|
||||
|
||||
def resolve_file(fn, d):
|
||||
if not os.path.isabs(fn):
|
||||
bbpath = d.getVar("BBPATH", True)
|
||||
bbpath = bb.data.getVar("BBPATH", d, True)
|
||||
newfn = bb.utils.which(bbpath, fn)
|
||||
if not newfn:
|
||||
raise IOError("file %s not found in %s" % (fn, bbpath))
|
||||
fn = newfn
|
||||
|
||||
if not os.path.isfile(fn):
|
||||
raise IOError("file %s not found" % fn)
|
||||
|
||||
logger.debug(2, "LOAD %s", fn)
|
||||
return fn
|
||||
|
||||
@@ -125,7 +111,7 @@ def vars_from_file(mypkg, d):
|
||||
parts = myfile[0].split('_')
|
||||
__pkgsplit_cache__[mypkg] = parts
|
||||
if len(parts) > 3:
|
||||
raise ParseError("Unable to generate default variables from filename (too many underscores)", mypkg)
|
||||
raise ParseError("Unable to generate default variables from the filename: %s (too many underscores)" % mypkg)
|
||||
exp = 3 - len(parts)
|
||||
tmplist = []
|
||||
while exp != 0:
|
||||
@@ -134,13 +120,4 @@ def vars_from_file(mypkg, d):
|
||||
parts.extend(tmplist)
|
||||
return parts
|
||||
|
||||
def get_file_depends(d):
|
||||
'''Return the dependent files'''
|
||||
dep_files = []
|
||||
depends = d.getVar('__base_depends', True) or []
|
||||
depends = depends + (d.getVar('__depends', True) or [])
|
||||
for (fn, _) in depends:
|
||||
dep_files.append(os.path.abspath(fn))
|
||||
return " ".join(dep_files)
|
||||
|
||||
from bb.parse.parse_py import __version__, ConfHandler, BBHandler
|
||||
|
||||
@@ -31,6 +31,7 @@ import itertools
|
||||
from bb import methodpool
|
||||
from bb.parse import logger
|
||||
|
||||
__parsed_methods__ = bb.methodpool.get_parsed_dict()
|
||||
_bbversions_re = re.compile(r"\[(?P<from>[0-9]+)-(?P<to>[0-9]+)\]")
|
||||
|
||||
class StatementGroup(list):
|
||||
@@ -53,14 +54,14 @@ class IncludeNode(AstNode):
|
||||
"""
|
||||
Include the file and evaluate the statements
|
||||
"""
|
||||
s = data.expand(self.what_file)
|
||||
s = bb.data.expand(self.what_file, data)
|
||||
logger.debug(2, "CONF %s:%s: including %s", self.filename, self.lineno, s)
|
||||
|
||||
# TODO: Cache those includes... maybe not here though
|
||||
if self.force:
|
||||
bb.parse.ConfHandler.include(self.filename, s, self.lineno, data, "include required")
|
||||
bb.parse.ConfHandler.include(self.filename, s, data, "include required")
|
||||
else:
|
||||
bb.parse.ConfHandler.include(self.filename, s, self.lineno, data, False)
|
||||
bb.parse.ConfHandler.include(self.filename, s, data, False)
|
||||
|
||||
class ExportNode(AstNode):
|
||||
def __init__(self, filename, lineno, var):
|
||||
@@ -68,7 +69,7 @@ class ExportNode(AstNode):
|
||||
self.var = var
|
||||
|
||||
def eval(self, data):
|
||||
data.setVarFlag(self.var, "export", 1, op = 'exported')
|
||||
bb.data.setVarFlag(self.var, "export", 1, data)
|
||||
|
||||
class DataNode(AstNode):
|
||||
"""
|
||||
@@ -83,60 +84,40 @@ class DataNode(AstNode):
|
||||
|
||||
def getFunc(self, key, data):
|
||||
if 'flag' in self.groupd and self.groupd['flag'] != None:
|
||||
return data.getVarFlag(key, self.groupd['flag'], noweakdefault=True)
|
||||
return bb.data.getVarFlag(key, self.groupd['flag'], data)
|
||||
else:
|
||||
return data.getVar(key, noweakdefault=True)
|
||||
return bb.data.getVar(key, data)
|
||||
|
||||
def eval(self, data):
|
||||
groupd = self.groupd
|
||||
key = groupd["var"]
|
||||
loginfo = {
|
||||
'variable': key,
|
||||
'file': self.filename,
|
||||
'line': self.lineno,
|
||||
}
|
||||
if "exp" in groupd and groupd["exp"] != None:
|
||||
data.setVarFlag(key, "export", 1, op = 'exported', **loginfo)
|
||||
|
||||
op = "set"
|
||||
bb.data.setVarFlag(key, "export", 1, data)
|
||||
if "ques" in groupd and groupd["ques"] != None:
|
||||
val = self.getFunc(key, data)
|
||||
op = "set?"
|
||||
if val == None:
|
||||
val = groupd["value"]
|
||||
elif "colon" in groupd and groupd["colon"] != None:
|
||||
e = data.createCopy()
|
||||
bb.data.update_data(e)
|
||||
op = "immediate"
|
||||
val = e.expand(groupd["value"], key + "[:=]")
|
||||
val = bb.data.expand(groupd["value"], e)
|
||||
elif "append" in groupd and groupd["append"] != None:
|
||||
op = "append"
|
||||
val = "%s %s" % ((self.getFunc(key, data) or ""), groupd["value"])
|
||||
elif "prepend" in groupd and groupd["prepend"] != None:
|
||||
op = "prepend"
|
||||
val = "%s %s" % (groupd["value"], (self.getFunc(key, data) or ""))
|
||||
elif "postdot" in groupd and groupd["postdot"] != None:
|
||||
op = "postdot"
|
||||
val = "%s%s" % ((self.getFunc(key, data) or ""), groupd["value"])
|
||||
elif "predot" in groupd and groupd["predot"] != None:
|
||||
op = "predot"
|
||||
val = "%s%s" % (groupd["value"], (self.getFunc(key, data) or ""))
|
||||
else:
|
||||
val = groupd["value"]
|
||||
|
||||
flag = None
|
||||
if 'flag' in groupd and groupd['flag'] != None:
|
||||
flag = groupd['flag']
|
||||
bb.data.setVarFlag(key, groupd['flag'], val, data)
|
||||
elif groupd["lazyques"]:
|
||||
flag = "defaultval"
|
||||
|
||||
loginfo['op'] = op
|
||||
loginfo['detail'] = groupd["value"]
|
||||
|
||||
if flag:
|
||||
data.setVarFlag(key, flag, val, **loginfo)
|
||||
bb.data.setVarFlag(key, "defaultval", val, data)
|
||||
else:
|
||||
data.setVar(key, val, **loginfo)
|
||||
bb.data.setVar(key, val, data)
|
||||
|
||||
class MethodNode(AstNode):
|
||||
def __init__(self, filename, lineno, func_name, body):
|
||||
@@ -145,24 +126,23 @@ class MethodNode(AstNode):
|
||||
self.body = body
|
||||
|
||||
def eval(self, data):
|
||||
text = '\n'.join(self.body)
|
||||
if self.func_name == "__anonymous":
|
||||
funcname = ("__anon_%s_%s" % (self.lineno, self.filename.translate(string.maketrans('/.+-@', '_____'))))
|
||||
text = "def %s(d):\n" % (funcname) + text
|
||||
bb.methodpool.insert_method(funcname, text, self.filename)
|
||||
anonfuncs = data.getVar('__BBANONFUNCS') or []
|
||||
funcname = ("__anon_%s_%s" % (self.lineno, self.filename.translate(string.maketrans('/.+-', '____'))))
|
||||
if not funcname in bb.methodpool._parsed_fns:
|
||||
text = "def %s(d):\n" % (funcname) + '\n'.join(self.body)
|
||||
bb.methodpool.insert_method(funcname, text, self.filename)
|
||||
anonfuncs = bb.data.getVar('__BBANONFUNCS', data) or []
|
||||
anonfuncs.append(funcname)
|
||||
data.setVar('__BBANONFUNCS', anonfuncs)
|
||||
data.setVar(funcname, text)
|
||||
bb.data.setVar('__BBANONFUNCS', anonfuncs, data)
|
||||
else:
|
||||
data.setVarFlag(self.func_name, "func", 1)
|
||||
data.setVar(self.func_name, text)
|
||||
bb.data.setVarFlag(self.func_name, "func", 1, data)
|
||||
bb.data.setVar(self.func_name, '\n'.join(self.body), data)
|
||||
|
||||
class PythonMethodNode(AstNode):
|
||||
def __init__(self, filename, lineno, function, modulename, body):
|
||||
def __init__(self, filename, lineno, function, define, body):
|
||||
AstNode.__init__(self, filename, lineno)
|
||||
self.function = function
|
||||
self.modulename = modulename
|
||||
self.define = define
|
||||
self.body = body
|
||||
|
||||
def eval(self, data):
|
||||
@@ -170,10 +150,11 @@ class PythonMethodNode(AstNode):
|
||||
# 'this' file. This means we will not parse methods from
|
||||
# bb classes twice
|
||||
text = '\n'.join(self.body)
|
||||
bb.methodpool.insert_method(self.modulename, text, self.filename)
|
||||
data.setVarFlag(self.function, "func", 1)
|
||||
data.setVarFlag(self.function, "python", 1)
|
||||
data.setVar(self.function, text)
|
||||
if not bb.methodpool.parsed_module(self.define):
|
||||
bb.methodpool.insert_method(self.define, text, self.filename)
|
||||
bb.data.setVarFlag(self.function, "func", 1, data)
|
||||
bb.data.setVarFlag(self.function, "python", 1, data)
|
||||
bb.data.setVar(self.function, text, data)
|
||||
|
||||
class MethodFlagsNode(AstNode):
|
||||
def __init__(self, filename, lineno, key, m):
|
||||
@@ -182,50 +163,59 @@ class MethodFlagsNode(AstNode):
|
||||
self.m = m
|
||||
|
||||
def eval(self, data):
|
||||
if data.getVar(self.key):
|
||||
if bb.data.getVar(self.key, data):
|
||||
# clean up old version of this piece of metadata, as its
|
||||
# flags could cause problems
|
||||
data.setVarFlag(self.key, 'python', None)
|
||||
data.setVarFlag(self.key, 'fakeroot', None)
|
||||
bb.data.setVarFlag(self.key, 'python', None, data)
|
||||
bb.data.setVarFlag(self.key, 'fakeroot', None, data)
|
||||
if self.m.group("py") is not None:
|
||||
data.setVarFlag(self.key, "python", "1")
|
||||
bb.data.setVarFlag(self.key, "python", "1", data)
|
||||
else:
|
||||
data.delVarFlag(self.key, "python")
|
||||
bb.data.delVarFlag(self.key, "python", data)
|
||||
if self.m.group("fr") is not None:
|
||||
data.setVarFlag(self.key, "fakeroot", "1")
|
||||
bb.data.setVarFlag(self.key, "fakeroot", "1", data)
|
||||
else:
|
||||
data.delVarFlag(self.key, "fakeroot")
|
||||
bb.data.delVarFlag(self.key, "fakeroot", data)
|
||||
|
||||
class ExportFuncsNode(AstNode):
|
||||
def __init__(self, filename, lineno, fns, classname):
|
||||
def __init__(self, filename, lineno, fns, classes):
|
||||
AstNode.__init__(self, filename, lineno)
|
||||
self.n = fns.split()
|
||||
self.classname = classname
|
||||
self.classes = classes
|
||||
|
||||
def eval(self, data):
|
||||
for f in self.n:
|
||||
allvars = []
|
||||
allvars.append(f)
|
||||
allvars.append(self.classes[-1] + "_" + f)
|
||||
|
||||
for func in self.n:
|
||||
calledfunc = self.classname + "_" + func
|
||||
vars = [[ allvars[0], allvars[1] ]]
|
||||
if len(self.classes) > 1 and self.classes[-2] is not None:
|
||||
allvars.append(self.classes[-2] + "_" + f)
|
||||
vars = []
|
||||
vars.append([allvars[2], allvars[1]])
|
||||
vars.append([allvars[0], allvars[2]])
|
||||
|
||||
if data.getVar(func) and not data.getVarFlag(func, 'export_func'):
|
||||
continue
|
||||
for (var, calledvar) in vars:
|
||||
if bb.data.getVar(var, data) and not bb.data.getVarFlag(var, 'export_func', data):
|
||||
continue
|
||||
|
||||
if data.getVar(func):
|
||||
data.setVarFlag(func, 'python', None)
|
||||
data.setVarFlag(func, 'func', None)
|
||||
if bb.data.getVar(var, data):
|
||||
bb.data.setVarFlag(var, 'python', None, data)
|
||||
bb.data.setVarFlag(var, 'func', None, data)
|
||||
|
||||
for flag in [ "func", "python" ]:
|
||||
if data.getVarFlag(calledfunc, flag):
|
||||
data.setVarFlag(func, flag, data.getVarFlag(calledfunc, flag))
|
||||
for flag in [ "dirs" ]:
|
||||
if data.getVarFlag(func, flag):
|
||||
data.setVarFlag(calledfunc, flag, data.getVarFlag(func, flag))
|
||||
for flag in [ "func", "python" ]:
|
||||
if bb.data.getVarFlag(calledvar, flag, data):
|
||||
bb.data.setVarFlag(var, flag, bb.data.getVarFlag(calledvar, flag, data), data)
|
||||
for flag in [ "dirs" ]:
|
||||
if bb.data.getVarFlag(var, flag, data):
|
||||
bb.data.setVarFlag(calledvar, flag, bb.data.getVarFlag(var, flag, data), data)
|
||||
|
||||
if data.getVarFlag(calledfunc, "python"):
|
||||
data.setVar(func, " bb.build.exec_func('" + calledfunc + "', d)\n")
|
||||
else:
|
||||
data.setVar(func, " " + calledfunc + "\n")
|
||||
data.setVarFlag(func, 'export_func', '1')
|
||||
if bb.data.getVarFlag(calledvar, "python", data):
|
||||
bb.data.setVar(var, "\tbb.build.exec_func('" + calledvar + "', d)\n", data)
|
||||
else:
|
||||
bb.data.setVar(var, "\t" + calledvar + "\n", data)
|
||||
bb.data.setVarFlag(var, 'export_func', '1', data)
|
||||
|
||||
class AddTaskNode(AstNode):
|
||||
def __init__(self, filename, lineno, func, before, after):
|
||||
@@ -239,25 +229,25 @@ class AddTaskNode(AstNode):
|
||||
if self.func[:3] != "do_":
|
||||
var = "do_" + self.func
|
||||
|
||||
data.setVarFlag(var, "task", 1)
|
||||
bbtasks = data.getVar('__BBTASKS') or []
|
||||
bb.data.setVarFlag(var, "task", 1, data)
|
||||
bbtasks = bb.data.getVar('__BBTASKS', data) or []
|
||||
if not var in bbtasks:
|
||||
bbtasks.append(var)
|
||||
data.setVar('__BBTASKS', bbtasks)
|
||||
bb.data.setVar('__BBTASKS', bbtasks, data)
|
||||
|
||||
existing = data.getVarFlag(var, "deps") or []
|
||||
existing = bb.data.getVarFlag(var, "deps", data) or []
|
||||
if self.after is not None:
|
||||
# set up deps for function
|
||||
for entry in self.after.split():
|
||||
if entry not in existing:
|
||||
existing.append(entry)
|
||||
data.setVarFlag(var, "deps", existing)
|
||||
bb.data.setVarFlag(var, "deps", existing, data)
|
||||
if self.before is not None:
|
||||
# set up things that depend on this func
|
||||
for entry in self.before.split():
|
||||
existing = data.getVarFlag(entry, "deps") or []
|
||||
existing = bb.data.getVarFlag(entry, "deps", data) or []
|
||||
if var not in existing:
|
||||
data.setVarFlag(entry, "deps", [var] + existing)
|
||||
bb.data.setVarFlag(entry, "deps", [var] + existing, data)
|
||||
|
||||
class BBHandlerNode(AstNode):
|
||||
def __init__(self, filename, lineno, fns):
|
||||
@@ -265,11 +255,11 @@ class BBHandlerNode(AstNode):
|
||||
self.hs = fns.split()
|
||||
|
||||
def eval(self, data):
|
||||
bbhands = data.getVar('__BBHANDLERS') or []
|
||||
bbhands = bb.data.getVar('__BBHANDLERS', data) or []
|
||||
for h in self.hs:
|
||||
bbhands.append(h)
|
||||
data.setVarFlag(h, "handler", 1)
|
||||
data.setVar('__BBHANDLERS', bbhands)
|
||||
bb.data.setVarFlag(h, "handler", 1, data)
|
||||
bb.data.setVar('__BBHANDLERS', bbhands, data)
|
||||
|
||||
class InheritNode(AstNode):
|
||||
def __init__(self, filename, lineno, classes):
|
||||
@@ -277,7 +267,7 @@ class InheritNode(AstNode):
|
||||
self.classes = classes
|
||||
|
||||
def eval(self, data):
|
||||
bb.parse.BBHandler.inherit(self.classes, self.filename, self.lineno, data)
|
||||
bb.parse.BBHandler.inherit(self.classes, data)
|
||||
|
||||
def handleInclude(statements, filename, lineno, m, force):
|
||||
statements.append(IncludeNode(filename, lineno, m.group(1), force))
|
||||
@@ -291,14 +281,14 @@ def handleData(statements, filename, lineno, groupd):
|
||||
def handleMethod(statements, filename, lineno, func_name, body):
|
||||
statements.append(MethodNode(filename, lineno, func_name, body))
|
||||
|
||||
def handlePythonMethod(statements, filename, lineno, funcname, modulename, body):
|
||||
statements.append(PythonMethodNode(filename, lineno, funcname, modulename, body))
|
||||
def handlePythonMethod(statements, filename, lineno, funcname, root, body):
|
||||
statements.append(PythonMethodNode(filename, lineno, funcname, root, body))
|
||||
|
||||
def handleMethodFlags(statements, filename, lineno, key, m):
|
||||
statements.append(MethodFlagsNode(filename, lineno, key, m))
|
||||
|
||||
def handleExportFuncs(statements, filename, lineno, m, classname):
|
||||
statements.append(ExportFuncsNode(filename, lineno, m.group(1), classname))
|
||||
def handleExportFuncs(statements, filename, lineno, m, classes):
|
||||
statements.append(ExportFuncsNode(filename, lineno, m.group(1), classes))
|
||||
|
||||
def handleAddTask(statements, filename, lineno, m):
|
||||
func = m.group("func")
|
||||
@@ -314,31 +304,28 @@ def handleBBHandlers(statements, filename, lineno, m):
|
||||
|
||||
def handleInherit(statements, filename, lineno, m):
|
||||
classes = m.group(1)
|
||||
statements.append(InheritNode(filename, lineno, classes))
|
||||
statements.append(InheritNode(filename, lineno, classes.split()))
|
||||
|
||||
def finalize(fn, d, variant = None):
|
||||
all_handlers = {}
|
||||
for var in d.getVar('__BBHANDLERS') or []:
|
||||
# try to add the handler
|
||||
bb.event.register(var, d.getVar(var), (d.getVarFlag(var, "eventmask", True) or "").split())
|
||||
|
||||
bb.event.fire(bb.event.RecipePreFinalise(fn), d)
|
||||
|
||||
bb.data.expandKeys(d)
|
||||
bb.data.update_data(d)
|
||||
code = []
|
||||
for funcname in d.getVar("__BBANONFUNCS") or []:
|
||||
for funcname in bb.data.getVar("__BBANONFUNCS", d) or []:
|
||||
code.append("%s(d)" % funcname)
|
||||
bb.utils.better_exec("\n".join(code), {"d": d})
|
||||
bb.utils.simple_exec("\n".join(code), {"d": d})
|
||||
bb.data.update_data(d)
|
||||
|
||||
tasklist = d.getVar('__BBTASKS') or []
|
||||
all_handlers = {}
|
||||
for var in bb.data.getVar('__BBHANDLERS', d) or []:
|
||||
# try to add the handler
|
||||
handler = bb.data.getVar(var, d)
|
||||
bb.event.register(var, handler)
|
||||
|
||||
tasklist = bb.data.getVar('__BBTASKS', d) or []
|
||||
bb.build.add_tasks(tasklist, d)
|
||||
|
||||
bb.parse.siggen.finalise(fn, d, variant)
|
||||
|
||||
d.setVar('BBINCLUDED', bb.parse.get_file_depends(d))
|
||||
|
||||
bb.event.fire(bb.event.RecipeParsed(fn), d)
|
||||
|
||||
def _create_variants(datastores, names, function):
|
||||
@@ -382,14 +369,12 @@ def multi_finalize(fn, d):
|
||||
logger.debug(2, "Appending .bbappend file %s to %s", append, fn)
|
||||
bb.parse.BBHandler.handle(append, d, True)
|
||||
|
||||
onlyfinalise = d.getVar("__ONLYFINALISE", False)
|
||||
|
||||
safe_d = d
|
||||
d = bb.data.createCopy(safe_d)
|
||||
try:
|
||||
finalize(fn, d)
|
||||
except bb.parse.SkipPackage as e:
|
||||
d.setVar("__SKIPPED", e.args[0])
|
||||
except bb.parse.SkipPackage:
|
||||
bb.data.setVar("__SKIPPED", True, d)
|
||||
datastores = {"": safe_d}
|
||||
|
||||
versions = (d.getVar("BBVERSIONS", True) or "").split()
|
||||
@@ -431,48 +416,27 @@ def multi_finalize(fn, d):
|
||||
verfunc(pv, d, safe_d)
|
||||
try:
|
||||
finalize(fn, d)
|
||||
except bb.parse.SkipPackage as e:
|
||||
d.setVar("__SKIPPED", e.args[0])
|
||||
except bb.parse.SkipPackage:
|
||||
bb.data.setVar("__SKIPPED", True, d)
|
||||
|
||||
_create_variants(datastores, versions, verfunc)
|
||||
|
||||
extended = d.getVar("BBCLASSEXTEND", True) or ""
|
||||
if extended:
|
||||
# the following is to support bbextends with arguments, for e.g. multilib
|
||||
# an example is as follows:
|
||||
# BBCLASSEXTEND = "multilib:lib32"
|
||||
# it will create foo-lib32, inheriting multilib.bbclass and set
|
||||
# BBEXTENDCURR to "multilib" and BBEXTENDVARIANT to "lib32"
|
||||
extendedmap = {}
|
||||
variantmap = {}
|
||||
|
||||
for ext in extended.split():
|
||||
eext = ext.split(':', 2)
|
||||
if len(eext) > 1:
|
||||
extendedmap[ext] = eext[0]
|
||||
variantmap[ext] = eext[1]
|
||||
else:
|
||||
extendedmap[ext] = ext
|
||||
|
||||
pn = d.getVar("PN", True)
|
||||
def extendfunc(name, d):
|
||||
if name != extendedmap[name]:
|
||||
d.setVar("BBEXTENDCURR", extendedmap[name])
|
||||
d.setVar("BBEXTENDVARIANT", variantmap[name])
|
||||
else:
|
||||
d.setVar("PN", "%s-%s" % (pn, name))
|
||||
bb.parse.BBHandler.inherit(extendedmap[name], fn, 0, d)
|
||||
d.setVar("PN", "%s-%s" % (pn, name))
|
||||
bb.parse.BBHandler.inherit([name], d)
|
||||
|
||||
safe_d.setVar("BBCLASSEXTEND", extended)
|
||||
_create_variants(datastores, extendedmap.keys(), extendfunc)
|
||||
_create_variants(datastores, extended.split(), extendfunc)
|
||||
|
||||
for variant, variant_d in datastores.iteritems():
|
||||
if variant:
|
||||
try:
|
||||
if not onlyfinalise or variant in onlyfinalise:
|
||||
finalize(fn, variant_d, variant)
|
||||
except bb.parse.SkipPackage as e:
|
||||
variant_d.setVar("__SKIPPED", e.args[0])
|
||||
finalize(fn, variant_d, variant)
|
||||
except bb.parse.SkipPackage:
|
||||
bb.data.setVar("__SKIPPED", True, variant_d)
|
||||
|
||||
if len(datastores) > 1:
|
||||
variants = filter(None, datastores.iterkeys())
|
||||
|
||||
@@ -51,6 +51,7 @@ __infunc__ = ""
|
||||
__inpython__ = False
|
||||
__body__ = []
|
||||
__classname__ = ""
|
||||
classes = [ None, ]
|
||||
|
||||
cached_statements = {}
|
||||
|
||||
@@ -67,26 +68,21 @@ def supports(fn, d):
|
||||
"""Return True if fn has a supported extension"""
|
||||
return os.path.splitext(fn)[-1] in [".bb", ".bbclass", ".inc"]
|
||||
|
||||
def inherit(files, fn, lineno, d):
|
||||
__inherit_cache = d.getVar('__inherit_cache') or []
|
||||
files = d.expand(files).split()
|
||||
def inherit(files, d):
|
||||
__inherit_cache = data.getVar('__inherit_cache', d) or []
|
||||
fn = ""
|
||||
lineno = 0
|
||||
for file in files:
|
||||
file = data.expand(file, d)
|
||||
if not os.path.isabs(file) and not file.endswith(".bbclass"):
|
||||
file = os.path.join('classes', '%s.bbclass' % file)
|
||||
|
||||
if not os.path.isabs(file):
|
||||
dname = os.path.dirname(fn)
|
||||
bbpath = "%s:%s" % (dname, d.getVar("BBPATH", True))
|
||||
abs_fn = bb.utils.which(bbpath, file)
|
||||
if abs_fn:
|
||||
file = abs_fn
|
||||
|
||||
if not file in __inherit_cache:
|
||||
logger.log(logging.DEBUG -1, "BB %s:%d: inheriting %s", fn, lineno, file)
|
||||
__inherit_cache.append( file )
|
||||
d.setVar('__inherit_cache', __inherit_cache)
|
||||
include(fn, file, lineno, d, "inherit")
|
||||
__inherit_cache = d.getVar('__inherit_cache') or []
|
||||
data.setVar('__inherit_cache', __inherit_cache, d)
|
||||
include(fn, file, d, "inherit")
|
||||
__inherit_cache = data.getVar('__inherit_cache', d) or []
|
||||
|
||||
def get_statements(filename, absolute_filename, base_name):
|
||||
global cached_statements
|
||||
@@ -104,7 +100,6 @@ def get_statements(filename, absolute_filename, base_name):
|
||||
if not s: break
|
||||
s = s.rstrip()
|
||||
feeder(lineno, s, filename, base_name, statements)
|
||||
file.close()
|
||||
if __inpython__:
|
||||
# add a blank line to close out any python definition
|
||||
feeder(IN_PYTHON_EOF, "", filename, base_name, statements)
|
||||
@@ -114,7 +109,7 @@ def get_statements(filename, absolute_filename, base_name):
|
||||
return statements
|
||||
|
||||
def handle(fn, d, include):
|
||||
global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __infunc__, __body__, __residue__, __classname__
|
||||
global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __infunc__, __body__, __residue__
|
||||
__body__ = []
|
||||
__infunc__ = ""
|
||||
__classname__ = ""
|
||||
@@ -132,13 +127,14 @@ def handle(fn, d, include):
|
||||
|
||||
if ext == ".bbclass":
|
||||
__classname__ = root
|
||||
__inherit_cache = d.getVar('__inherit_cache') or []
|
||||
classes.append(__classname__)
|
||||
__inherit_cache = data.getVar('__inherit_cache', d) or []
|
||||
if not fn in __inherit_cache:
|
||||
__inherit_cache.append(fn)
|
||||
d.setVar('__inherit_cache', __inherit_cache)
|
||||
data.setVar('__inherit_cache', __inherit_cache, d)
|
||||
|
||||
if include != 0:
|
||||
oldfile = d.getVar('FILE')
|
||||
oldfile = data.getVar('FILE', d)
|
||||
else:
|
||||
oldfile = None
|
||||
|
||||
@@ -152,25 +148,27 @@ def handle(fn, d, include):
|
||||
|
||||
# DONE WITH PARSING... time to evaluate
|
||||
if ext != ".bbclass":
|
||||
d.setVar('FILE', abs_fn)
|
||||
data.setVar('FILE', fn, d)
|
||||
|
||||
try:
|
||||
statements.eval(d)
|
||||
except bb.parse.SkipPackage:
|
||||
bb.data.setVar("__SKIPPED", True, d)
|
||||
statements.eval(d)
|
||||
|
||||
if ext == ".bbclass":
|
||||
classes.remove(__classname__)
|
||||
else:
|
||||
if include == 0:
|
||||
return { "" : d }
|
||||
|
||||
if ext != ".bbclass" and include == 0:
|
||||
return ast.multi_finalize(fn, d)
|
||||
return ast.multi_finalize(fn, d)
|
||||
|
||||
if oldfile:
|
||||
d.setVar("FILE", oldfile)
|
||||
bb.data.setVar("FILE", oldfile, d)
|
||||
|
||||
# we have parsed the bb class now
|
||||
if ext == ".bbclass" or ext == ".inc":
|
||||
bb.methodpool.get_parsed_dict()[base_name] = 1
|
||||
|
||||
return d
|
||||
|
||||
def feeder(lineno, s, fn, root, statements):
|
||||
global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __def_regexp__, __python_func_regexp__, __inpython__, __infunc__, __body__, bb, __residue__, __classname__
|
||||
global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __def_regexp__, __python_func_regexp__, __inpython__, __infunc__, __body__, classes, bb, __residue__
|
||||
if __infunc__:
|
||||
if s == '}':
|
||||
__body__.append('')
|
||||
@@ -195,24 +193,22 @@ def feeder(lineno, s, fn, root, statements):
|
||||
if lineno == IN_PYTHON_EOF:
|
||||
return
|
||||
|
||||
if s and s[0] == '#':
|
||||
|
||||
# Skip empty lines
|
||||
if s == '':
|
||||
return
|
||||
|
||||
if s[0] == '#':
|
||||
if len(__residue__) != 0 and __residue__[0][0] != "#":
|
||||
bb.fatal("There is a comment on line %s of file %s (%s) which is in the middle of a multiline expression.\nBitbake used to ignore these but no longer does so, please fix your metadata as errors are likely as a result of this change." % (lineno, fn, s))
|
||||
bb.error("There is a comment on line %s of file %s (%s) which is in the middle of a multiline expression.\nBitbake used to ignore these but no longer does so, please fix your metadata as errors are likely as a result of this change." % (lineno, fn, s))
|
||||
|
||||
if len(__residue__) != 0 and __residue__[0][0] == "#" and (not s or s[0] != "#"):
|
||||
bb.fatal("There is a confusing multiline, partially commented expression on line %s of file %s (%s).\nPlease clarify whether this is all a comment or should be parsed." % (lineno, fn, s))
|
||||
|
||||
if s and s[-1] == '\\':
|
||||
if s[-1] == '\\':
|
||||
__residue__.append(s[:-1])
|
||||
return
|
||||
|
||||
s = "".join(__residue__) + s
|
||||
__residue__ = []
|
||||
|
||||
# Skip empty lines
|
||||
if s == '':
|
||||
return
|
||||
|
||||
# Skip comments
|
||||
if s[0] == '#':
|
||||
return
|
||||
@@ -232,7 +228,7 @@ def feeder(lineno, s, fn, root, statements):
|
||||
|
||||
m = __export_func_regexp__.match(s)
|
||||
if m:
|
||||
ast.handleExportFuncs(statements, fn, lineno, m, __classname__)
|
||||
ast.handleExportFuncs(statements, fn, lineno, m, classes)
|
||||
return
|
||||
|
||||
m = __addtask_regexp__.match(s)
|
||||
|
||||
@@ -24,64 +24,41 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import re, os
|
||||
import re, bb.data, os
|
||||
import logging
|
||||
import bb.utils
|
||||
from bb.parse import ParseError, resolve_file, ast, logger
|
||||
|
||||
__config_regexp__ = re.compile( r"""
|
||||
^
|
||||
(?P<exp>export\s*)?
|
||||
(?P<var>[a-zA-Z0-9\-~_+.${}/]+?)
|
||||
(\[(?P<flag>[a-zA-Z0-9\-_+.]+)\])?
|
||||
|
||||
\s* (
|
||||
(?P<colon>:=) |
|
||||
(?P<lazyques>\?\?=) |
|
||||
(?P<ques>\?=) |
|
||||
(?P<append>\+=) |
|
||||
(?P<prepend>=\+) |
|
||||
(?P<predot>=\.) |
|
||||
(?P<postdot>\.=) |
|
||||
=
|
||||
) \s*
|
||||
|
||||
(?!'[^']*'[^']*'$)
|
||||
(?!\"[^\"]*\"[^\"]*\"$)
|
||||
(?P<apo>['\"])
|
||||
(?P<value>.*)
|
||||
(?P=apo)
|
||||
$
|
||||
""", re.X)
|
||||
#__config_regexp__ = re.compile( r"(?P<exp>export\s*)?(?P<var>[a-zA-Z0-9\-_+.${}]+)\s*(?P<colon>:)?(?P<ques>\?)?=\s*(?P<apo>['\"]?)(?P<value>.*)(?P=apo)$")
|
||||
__config_regexp__ = re.compile( r"(?P<exp>export\s*)?(?P<var>[a-zA-Z0-9\-_+.${}/]+)(\[(?P<flag>[a-zA-Z0-9\-_+.]+)\])?\s*((?P<colon>:=)|(?P<lazyques>\?\?=)|(?P<ques>\?=)|(?P<append>\+=)|(?P<prepend>=\+)|(?P<predot>=\.)|(?P<postdot>\.=)|=)\s*(?P<apo>['\"]?)(?P<value>.*)(?P=apo)$")
|
||||
__include_regexp__ = re.compile( r"include\s+(.+)" )
|
||||
__require_regexp__ = re.compile( r"require\s+(.+)" )
|
||||
__export_regexp__ = re.compile( r"export\s+([a-zA-Z0-9\-_+.${}/]+)$" )
|
||||
__export_regexp__ = re.compile( r"export\s+(.+)" )
|
||||
|
||||
def init(data):
|
||||
topdir = data.getVar('TOPDIR')
|
||||
topdir = bb.data.getVar('TOPDIR', data)
|
||||
if not topdir:
|
||||
data.setVar('TOPDIR', os.getcwd())
|
||||
bb.data.setVar('TOPDIR', os.getcwd(), data)
|
||||
|
||||
|
||||
def supports(fn, d):
|
||||
return fn[-5:] == ".conf"
|
||||
|
||||
def include(oldfn, fn, lineno, data, error_out):
|
||||
def include(oldfn, fn, data, error_out):
|
||||
"""
|
||||
error_out: A string indicating the verb (e.g. "include", "inherit") to be
|
||||
used in a ParseError that will be raised if the file to be included could
|
||||
not be included. Specify False to avoid raising an error in this case.
|
||||
error_out If True a ParseError will be raised if the to be included
|
||||
config-files could not be included.
|
||||
"""
|
||||
if oldfn == fn: # prevent infinite recursion
|
||||
return None
|
||||
|
||||
import bb
|
||||
fn = data.expand(fn)
|
||||
oldfn = data.expand(oldfn)
|
||||
fn = bb.data.expand(fn, data)
|
||||
oldfn = bb.data.expand(oldfn, data)
|
||||
|
||||
if not os.path.isabs(fn):
|
||||
dname = os.path.dirname(oldfn)
|
||||
bbpath = "%s:%s" % (dname, data.getVar("BBPATH", True))
|
||||
bbpath = "%s:%s" % (dname, bb.data.getVar("BBPATH", data, 1))
|
||||
abs_fn = bb.utils.which(bbpath, fn)
|
||||
if abs_fn:
|
||||
fn = abs_fn
|
||||
@@ -89,26 +66,18 @@ def include(oldfn, fn, lineno, data, error_out):
|
||||
from bb.parse import handle
|
||||
try:
|
||||
ret = handle(fn, data, True)
|
||||
except (IOError, OSError):
|
||||
except IOError:
|
||||
if error_out:
|
||||
raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
|
||||
raise ParseError("Could not %(error_out)s file %(fn)s" % vars() )
|
||||
logger.debug(2, "CONF file '%s' not found", fn)
|
||||
|
||||
# We have an issue where a UI might want to enforce particular settings such as
|
||||
# an empty DISTRO variable. If configuration files do something like assigning
|
||||
# a weak default, it turns out to be very difficult to filter out these changes,
|
||||
# particularly when the weak default might appear half way though parsing a chain
|
||||
# of configuration files. We therefore let the UIs hook into configuration file
|
||||
# parsing. This turns out to be a hard problem to solve any other way.
|
||||
confFilters = []
|
||||
|
||||
def handle(fn, data, include):
|
||||
init(data)
|
||||
|
||||
if include == 0:
|
||||
oldfile = None
|
||||
else:
|
||||
oldfile = data.getVar('FILE')
|
||||
oldfile = bb.data.getVar('FILE', data)
|
||||
|
||||
abs_fn = resolve_file(fn, data)
|
||||
f = open(abs_fn, 'r')
|
||||
@@ -121,34 +90,22 @@ def handle(fn, data, include):
|
||||
while True:
|
||||
lineno = lineno + 1
|
||||
s = f.readline()
|
||||
if not s:
|
||||
break
|
||||
if not s: break
|
||||
w = s.strip()
|
||||
# skip empty lines
|
||||
if not w:
|
||||
continue
|
||||
if not w: continue # skip empty lines
|
||||
s = s.rstrip()
|
||||
if s[0] == '#': continue # skip comments
|
||||
while s[-1] == '\\':
|
||||
s2 = f.readline().strip()
|
||||
s2 = f.readline()[:-1].strip()
|
||||
lineno = lineno + 1
|
||||
if (not s2 or s2 and s2[0] != "#") and s[0] == "#" :
|
||||
bb.fatal("There is a confusing multiline, partially commented expression on line %s of file %s (%s).\nPlease clarify whether this is all a comment or should be parsed." % (lineno, fn, s))
|
||||
s = s[:-1] + s2
|
||||
# skip comments
|
||||
if s[0] == '#':
|
||||
continue
|
||||
feeder(lineno, s, fn, statements)
|
||||
|
||||
# DONE WITH PARSING... time to evaluate
|
||||
data.setVar('FILE', abs_fn)
|
||||
bb.data.setVar('FILE', fn, data)
|
||||
statements.eval(data)
|
||||
if oldfile:
|
||||
data.setVar('FILE', oldfile)
|
||||
|
||||
f.close()
|
||||
|
||||
for f in confFilters:
|
||||
f(fn, data)
|
||||
bb.data.setVar('FILE', oldfile, data)
|
||||
|
||||
return data
|
||||
|
||||
@@ -174,7 +131,7 @@ def feeder(lineno, s, fn, statements):
|
||||
ast.handleExport(statements, fn, lineno, m)
|
||||
return
|
||||
|
||||
raise ParseError("unparsed line: '%s'" % s, fn, lineno);
|
||||
raise ParseError("%s:%d: unparsed line: '%s'" % (fn, lineno, s));
|
||||
|
||||
# Add us to the handlers list
|
||||
from bb.parse import handlers
|
||||
|
||||
@@ -26,8 +26,7 @@ import logging
|
||||
import os.path
|
||||
import sys
|
||||
import warnings
|
||||
from bb.compat import total_ordering
|
||||
from collections import Mapping
|
||||
import bb.msg, bb.data, bb.utils
|
||||
|
||||
try:
|
||||
import sqlite3
|
||||
@@ -40,20 +39,13 @@ if sqlversion[0] < 3 or (sqlversion[0] == 3 and sqlversion[1] < 3):
|
||||
|
||||
|
||||
logger = logging.getLogger("BitBake.PersistData")
|
||||
if hasattr(sqlite3, 'enable_shared_cache'):
|
||||
try:
|
||||
sqlite3.enable_shared_cache(True)
|
||||
except sqlite3.OperationalError:
|
||||
pass
|
||||
|
||||
|
||||
@total_ordering
|
||||
class SQLTable(collections.MutableMapping):
|
||||
"""Object representing a table/domain in the database"""
|
||||
def __init__(self, cachefile, table):
|
||||
self.cachefile = cachefile
|
||||
def __init__(self, cursor, table):
|
||||
self.cursor = cursor
|
||||
self.table = table
|
||||
self.cursor = connect(self.cachefile)
|
||||
|
||||
self._execute("CREATE TABLE IF NOT EXISTS %s(key TEXT, value TEXT);"
|
||||
% table)
|
||||
@@ -67,36 +59,19 @@ class SQLTable(collections.MutableMapping):
|
||||
except sqlite3.OperationalError as exc:
|
||||
if 'database is locked' in str(exc) and count < 500:
|
||||
count = count + 1
|
||||
self.cursor.close()
|
||||
self.cursor = connect(self.cachefile)
|
||||
continue
|
||||
raise
|
||||
|
||||
def __enter__(self):
|
||||
self.cursor.__enter__()
|
||||
return self
|
||||
|
||||
def __exit__(self, *excinfo):
|
||||
self.cursor.__exit__(*excinfo)
|
||||
|
||||
def __getitem__(self, key):
|
||||
data = self._execute("SELECT * from %s where key=?;" %
|
||||
self.table, [key])
|
||||
for row in data:
|
||||
return row[1]
|
||||
raise KeyError(key)
|
||||
|
||||
def __delitem__(self, key):
|
||||
if key not in self:
|
||||
raise KeyError(key)
|
||||
self._execute("DELETE from %s where key=?;" % self.table, [key])
|
||||
|
||||
def __setitem__(self, key, value):
|
||||
if not isinstance(key, basestring):
|
||||
raise TypeError('Only string keys are supported')
|
||||
elif not isinstance(value, basestring):
|
||||
raise TypeError('Only string values are supported')
|
||||
|
||||
data = self._execute("SELECT * from %s where key=?;" %
|
||||
self.table, [key])
|
||||
exists = len(list(data))
|
||||
@@ -117,45 +92,53 @@ class SQLTable(collections.MutableMapping):
|
||||
|
||||
def __iter__(self):
|
||||
data = self._execute("SELECT key FROM %s;" % self.table)
|
||||
return (row[0] for row in data)
|
||||
for row in data:
|
||||
yield row[0]
|
||||
|
||||
def __lt__(self, other):
|
||||
if not isinstance(other, Mapping):
|
||||
raise NotImplemented
|
||||
|
||||
return len(self) < len(other)
|
||||
|
||||
def get_by_pattern(self, pattern):
|
||||
data = self._execute("SELECT * FROM %s WHERE key LIKE ?;" %
|
||||
self.table, [pattern])
|
||||
return [row[1] for row in data]
|
||||
|
||||
def values(self):
|
||||
return list(self.itervalues())
|
||||
def iteritems(self):
|
||||
data = self._execute("SELECT * FROM %s;" % self.table)
|
||||
for row in data:
|
||||
yield row[0], row[1]
|
||||
|
||||
def itervalues(self):
|
||||
data = self._execute("SELECT value FROM %s;" % self.table)
|
||||
return (row[0] for row in data)
|
||||
for row in data:
|
||||
yield row[0]
|
||||
|
||||
def items(self):
|
||||
return list(self.iteritems())
|
||||
|
||||
def iteritems(self):
|
||||
return self._execute("SELECT * FROM %s;" % self.table)
|
||||
class SQLData(object):
|
||||
"""Object representing the persistent data"""
|
||||
def __init__(self, filename):
|
||||
bb.utils.mkdirhier(os.path.dirname(filename))
|
||||
|
||||
def clear(self):
|
||||
self._execute("DELETE FROM %s;" % self.table)
|
||||
self.filename = filename
|
||||
self.connection = sqlite3.connect(filename, timeout=30,
|
||||
isolation_level=None)
|
||||
self.cursor = self.connection.cursor()
|
||||
self._tables = {}
|
||||
|
||||
def has_key(self, key):
|
||||
return key in self
|
||||
def __getitem__(self, table):
|
||||
if not isinstance(table, basestring):
|
||||
raise TypeError("table argument must be a string, not '%s'" %
|
||||
type(table))
|
||||
|
||||
if table in self._tables:
|
||||
return self._tables[table]
|
||||
else:
|
||||
tableobj = self._tables[table] = SQLTable(self.cursor, table)
|
||||
return tableobj
|
||||
|
||||
def __delitem__(self, table):
|
||||
if table in self._tables:
|
||||
del self._tables[table]
|
||||
self.cursor.execute("DROP TABLE IF EXISTS %s;" % table)
|
||||
|
||||
|
||||
class PersistData(object):
|
||||
"""Deprecated representation of the bitbake persistent data store"""
|
||||
def __init__(self, d):
|
||||
warnings.warn("Use of PersistData is deprecated. Please use "
|
||||
"persist(domain, d) instead.",
|
||||
category=DeprecationWarning,
|
||||
warnings.warn("Use of PersistData will be deprecated in the future",
|
||||
category=PendingDeprecationWarning,
|
||||
stacklevel=2)
|
||||
|
||||
self.data = persist(d)
|
||||
@@ -198,18 +181,14 @@ class PersistData(object):
|
||||
"""
|
||||
del self.data[domain][key]
|
||||
|
||||
def connect(database):
|
||||
return sqlite3.connect(database, timeout=5, isolation_level=None)
|
||||
|
||||
def persist(domain, d):
|
||||
"""Convenience factory for SQLTable objects based upon metadata"""
|
||||
import bb.utils
|
||||
cachedir = (d.getVar("PERSISTENT_DIR", True) or
|
||||
d.getVar("CACHE", True))
|
||||
def persist(d):
|
||||
"""Convenience factory for construction of SQLData based upon metadata"""
|
||||
cachedir = (bb.data.getVar("PERSISTENT_DIR", d, True) or
|
||||
bb.data.getVar("CACHE", d, True))
|
||||
if not cachedir:
|
||||
logger.critical("Please set the 'PERSISTENT_DIR' or 'CACHE' variable")
|
||||
sys.exit(1)
|
||||
|
||||
bb.utils.mkdirhier(cachedir)
|
||||
cachefile = os.path.join(cachedir, "bb_persist_data.sqlite3")
|
||||
return SQLTable(cachefile, domain)
|
||||
return SQLData(cachefile)
|
||||
|
||||
@@ -1,8 +1,6 @@
|
||||
import logging
|
||||
import signal
|
||||
import subprocess
|
||||
import errno
|
||||
import select
|
||||
|
||||
logger = logging.getLogger('BitBake.Process')
|
||||
|
||||
@@ -70,42 +68,20 @@ def _logged_communicate(pipe, log, input):
|
||||
pipe.stdin.write(input)
|
||||
pipe.stdin.close()
|
||||
|
||||
bufsize = 512
|
||||
outdata, errdata = [], []
|
||||
rin = []
|
||||
while pipe.poll() is None:
|
||||
if pipe.stdout is not None:
|
||||
data = pipe.stdout.read(bufsize)
|
||||
if data is not None:
|
||||
outdata.append(data)
|
||||
log.write(data)
|
||||
|
||||
if pipe.stdout is not None:
|
||||
bb.utils.nonblockingfd(pipe.stdout.fileno())
|
||||
rin.append(pipe.stdout)
|
||||
if pipe.stderr is not None:
|
||||
bb.utils.nonblockingfd(pipe.stderr.fileno())
|
||||
rin.append(pipe.stderr)
|
||||
|
||||
try:
|
||||
while pipe.poll() is None:
|
||||
rlist = rin
|
||||
try:
|
||||
r,w,e = select.select (rlist, [], [])
|
||||
except OSError as e:
|
||||
if e.errno != errno.EINTR:
|
||||
raise
|
||||
|
||||
if pipe.stdout in r:
|
||||
data = pipe.stdout.read()
|
||||
if data is not None:
|
||||
outdata.append(data)
|
||||
log.write(data)
|
||||
|
||||
if pipe.stderr in r:
|
||||
data = pipe.stderr.read()
|
||||
if data is not None:
|
||||
errdata.append(data)
|
||||
log.write(data)
|
||||
finally:
|
||||
log.flush()
|
||||
if pipe.stdout is not None:
|
||||
pipe.stdout.close()
|
||||
if pipe.stderr is not None:
|
||||
pipe.stderr.close()
|
||||
if pipe.stderr is not None:
|
||||
data = pipe.stderr.read(bufsize)
|
||||
if data is not None:
|
||||
errdata.append(data)
|
||||
log.write(data)
|
||||
return ''.join(outdata), ''.join(errdata)
|
||||
|
||||
def run(cmd, input=None, log=None, **options):
|
||||
@@ -117,7 +93,7 @@ def run(cmd, input=None, log=None, **options):
|
||||
|
||||
try:
|
||||
pipe = Popen(cmd, **options)
|
||||
except OSError as exc:
|
||||
except OSError, exc:
|
||||
if exc.errno == 2:
|
||||
raise NotFoundError(cmd)
|
||||
else:
|
||||
|
||||
@@ -24,54 +24,16 @@
|
||||
import re
|
||||
import logging
|
||||
from bb import data, utils
|
||||
from collections import defaultdict
|
||||
import bb
|
||||
|
||||
logger = logging.getLogger("BitBake.Provider")
|
||||
|
||||
class NoProvider(bb.BBHandledException):
|
||||
class NoProvider(Exception):
|
||||
"""Exception raised when no provider of a build dependency can be found"""
|
||||
|
||||
class NoRProvider(bb.BBHandledException):
|
||||
class NoRProvider(Exception):
|
||||
"""Exception raised when no provider of a runtime dependency can be found"""
|
||||
|
||||
class MultipleRProvider(bb.BBHandledException):
|
||||
"""Exception raised when multiple providers of a runtime dependency can be found"""
|
||||
|
||||
def findProviders(cfgData, dataCache, pkg_pn = None):
|
||||
"""
|
||||
Convenience function to get latest and preferred providers in pkg_pn
|
||||
"""
|
||||
|
||||
if not pkg_pn:
|
||||
pkg_pn = dataCache.pkg_pn
|
||||
|
||||
# Need to ensure data store is expanded
|
||||
localdata = data.createCopy(cfgData)
|
||||
bb.data.update_data(localdata)
|
||||
bb.data.expandKeys(localdata)
|
||||
|
||||
preferred_versions = {}
|
||||
latest_versions = {}
|
||||
|
||||
for pn in pkg_pn:
|
||||
(last_ver, last_file, pref_ver, pref_file) = findBestProvider(pn, localdata, dataCache, pkg_pn)
|
||||
preferred_versions[pn] = (pref_ver, pref_file)
|
||||
latest_versions[pn] = (last_ver, last_file)
|
||||
|
||||
return (latest_versions, preferred_versions)
|
||||
|
||||
|
||||
def allProviders(dataCache):
|
||||
"""
|
||||
Find all providers for each pn
|
||||
"""
|
||||
all_providers = defaultdict(list)
|
||||
for (fn, pn) in dataCache.pkg_fn.items():
|
||||
ver = dataCache.pkg_pepvpr[fn]
|
||||
all_providers[pn].append((ver, fn))
|
||||
return all_providers
|
||||
|
||||
|
||||
def sortPriorities(pn, dataCache, pkg_pn = None):
|
||||
"""
|
||||
@@ -92,9 +54,9 @@ def sortPriorities(pn, dataCache, pkg_pn = None):
|
||||
priorities[priority][preference] = []
|
||||
priorities[priority][preference].append(f)
|
||||
tmp_pn = []
|
||||
for pri in sorted(priorities):
|
||||
for pri in sorted(priorities, lambda a, b: a - b):
|
||||
tmp_pref = []
|
||||
for pref in sorted(priorities[pri]):
|
||||
for pref in sorted(priorities[pri], lambda a, b: b - a):
|
||||
tmp_pref.extend(priorities[pri][pref])
|
||||
tmp_pn = [tmp_pref] + tmp_pn
|
||||
|
||||
@@ -122,15 +84,15 @@ def findPreferredProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
|
||||
preferred_ver = None
|
||||
|
||||
localdata = data.createCopy(cfgData)
|
||||
localdata.setVar('OVERRIDES', "%s:pn-%s:%s" % (data.getVar('OVERRIDES', localdata), pn, pn))
|
||||
bb.data.setVar('OVERRIDES', "pn-%s:%s:%s" % (pn, pn, data.getVar('OVERRIDES', localdata)), localdata)
|
||||
bb.data.update_data(localdata)
|
||||
|
||||
preferred_v = localdata.getVar('PREFERRED_VERSION', True)
|
||||
preferred_v = bb.data.getVar('PREFERRED_VERSION_%s' % pn, localdata, True)
|
||||
if preferred_v:
|
||||
m = re.match('(\d+:)*(.*)(_.*)*', preferred_v)
|
||||
if m:
|
||||
if m.group(1):
|
||||
preferred_e = m.group(1)[:-1]
|
||||
preferred_e = int(m.group(1)[:-1])
|
||||
else:
|
||||
preferred_e = None
|
||||
preferred_v = m.group(2)
|
||||
@@ -162,18 +124,6 @@ def findPreferredProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
|
||||
itemstr = " (for item %s)" % item
|
||||
if preferred_file is None:
|
||||
logger.info("preferred version %s of %s not available%s", pv_str, pn, itemstr)
|
||||
available_vers = []
|
||||
for file_set in pkg_pn:
|
||||
for f in file_set:
|
||||
pe, pv, pr = dataCache.pkg_pepvpr[f]
|
||||
ver_str = pv
|
||||
if pe:
|
||||
ver_str = "%s:%s" % (pe, ver_str)
|
||||
if not ver_str in available_vers:
|
||||
available_vers.append(ver_str)
|
||||
if available_vers:
|
||||
available_vers.sort()
|
||||
logger.info("versions of %s available: %s", pn, ' '.join(available_vers))
|
||||
else:
|
||||
logger.debug(1, "selecting %s as PREFERRED_VERSION %s of package %s%s", preferred_file, pv_str, pn, itemstr)
|
||||
|
||||
@@ -286,7 +236,7 @@ def filterProviders(providers, item, cfgData, dataCache):
|
||||
|
||||
eligible = _filterProviders(providers, item, cfgData, dataCache)
|
||||
|
||||
prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % item, True)
|
||||
prefervar = bb.data.getVar('PREFERRED_PROVIDER_%s' % item, cfgData, 1)
|
||||
if prefervar:
|
||||
dataCache.preferred[item] = prefervar
|
||||
|
||||
@@ -324,8 +274,8 @@ def filterProvidersRunTime(providers, item, cfgData, dataCache):
|
||||
pn = dataCache.pkg_fn[p]
|
||||
provides = dataCache.pn_provides[pn]
|
||||
for provide in provides:
|
||||
prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % provide, True)
|
||||
logger.debug(1, "checking PREFERRED_PROVIDER_%s (value %s) against %s", provide, prefervar, pns.keys())
|
||||
prefervar = bb.data.getVar('PREFERRED_PROVIDER_%s' % provide, cfgData, 1)
|
||||
logger.verbose("checking PREFERRED_PROVIDER_%s (value %s) against %s", provide, prefervar, pns.keys())
|
||||
if prefervar in pns and pns[prefervar] not in preferred:
|
||||
var = "PREFERRED_PROVIDER_%s = %s" % (provide, prefervar)
|
||||
logger.verbose("selecting %s to satisfy runtime %s due to %s", prefervar, item, var)
|
||||
@@ -376,6 +326,5 @@ def getRuntimeProviders(dataCache, rdepend):
|
||||
regexp_cache[pattern] = regexp
|
||||
if regexp.match(rdepend):
|
||||
rproviders += dataCache.packages_dynamic[pattern]
|
||||
logger.debug(1, "Assuming %s is a dynamic package, but it may not exist" % rdepend)
|
||||
|
||||
return rproviders
|
||||
|
||||
@@ -151,7 +151,7 @@ def builtin_trap(name, args, interp, env, stdin, stdout, stderr, debugflags):
|
||||
for sig in args[1:]:
|
||||
try:
|
||||
env.traps[sig] = action
|
||||
except Exception as e:
|
||||
except Exception, e:
|
||||
stderr.write('trap: %s\n' % str(e))
|
||||
return 0
|
||||
|
||||
@@ -214,7 +214,7 @@ def utility_cat(name, args, interp, env, stdin, stdout, stderr, debugflags):
|
||||
data = f.read()
|
||||
finally:
|
||||
f.close()
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
if e.errno != errno.ENOENT:
|
||||
raise
|
||||
status = 1
|
||||
@@ -433,7 +433,7 @@ def utility_mkdir(name, args, interp, env, stdin, stdout, stderr, debugflags):
|
||||
if option.has_p:
|
||||
try:
|
||||
os.makedirs(path)
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
if e.errno != errno.EEXIST:
|
||||
raise
|
||||
else:
|
||||
@@ -561,7 +561,7 @@ def utility_sort(name, args, interp, env, stdin, stdout, stderr, debugflags):
|
||||
lines = f.readlines()
|
||||
finally:
|
||||
f.close()
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
stderr.write(str(e) + '\n')
|
||||
return 1
|
||||
|
||||
@@ -679,7 +679,7 @@ def run_command(name, args, interp, env, stdin, stdout,
|
||||
p = subprocess.Popen([name] + args, cwd=env['PWD'], env=exec_env,
|
||||
stdin=stdin, stdout=subprocess.PIPE, stderr=subprocess.STDOUT)
|
||||
out, err = p.communicate()
|
||||
except WindowsError as e:
|
||||
except WindowsError, e:
|
||||
raise UtilityError(str(e))
|
||||
|
||||
if not unixoutput:
|
||||
|
||||
@@ -248,7 +248,7 @@ class Redirections:
|
||||
raise NotImplementedError('cannot open absolute path %s' % repr(filename))
|
||||
else:
|
||||
f = file(filename, mode+'b')
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
raise RedirectionError(str(e))
|
||||
|
||||
wrapper = None
|
||||
@@ -368,7 +368,7 @@ def resolve_shebang(path, ignoreshell=False):
|
||||
if arg is None:
|
||||
return [cmd, win32_to_unix_path(path)]
|
||||
return [cmd, arg, win32_to_unix_path(path)]
|
||||
except IOError as e:
|
||||
except IOError, e:
|
||||
if e.errno!=errno.ENOENT and \
|
||||
(e.errno!=errno.EPERM and not os.path.isdir(path)): # Opening a directory raises EPERM
|
||||
raise
|
||||
@@ -747,7 +747,7 @@ class Interpreter:
|
||||
for cmd in cmds:
|
||||
try:
|
||||
status = self.execute(cmd)
|
||||
except ExitSignal as e:
|
||||
except ExitSignal, e:
|
||||
if sourced:
|
||||
raise
|
||||
status = int(e.args[0])
|
||||
@@ -758,13 +758,13 @@ class Interpreter:
|
||||
if 'debug-utility' in self._debugflags or 'debug-cmd' in self._debugflags:
|
||||
self.log('returncode ' + str(status)+ '\n')
|
||||
return status
|
||||
except CommandNotFound as e:
|
||||
except CommandNotFound, e:
|
||||
print >>self._redirs.stderr, str(e)
|
||||
self._redirs.stderr.flush()
|
||||
# Command not found by non-interactive shell
|
||||
# return 127
|
||||
raise
|
||||
except RedirectionError as e:
|
||||
except RedirectionError, e:
|
||||
# TODO: should be handled depending on the utility status
|
||||
print >>self._redirs.stderr, str(e)
|
||||
self._redirs.stderr.flush()
|
||||
@@ -948,7 +948,7 @@ class Interpreter:
|
||||
status = self.execute(func, redirs)
|
||||
finally:
|
||||
redirs.close()
|
||||
except ReturnSignal as e:
|
||||
except ReturnSignal, e:
|
||||
status = int(e.args[0])
|
||||
env['?'] = status
|
||||
return status
|
||||
@@ -1044,7 +1044,7 @@ class Interpreter:
|
||||
|
||||
except ReturnSignal:
|
||||
raise
|
||||
except ShellError as e:
|
||||
except ShellError, e:
|
||||
if is_special or isinstance(e, (ExitSignal,
|
||||
ShellSyntaxError, ExpansionError)):
|
||||
raise e
|
||||
|
||||
@@ -292,7 +292,7 @@ class WordLexer:
|
||||
elif sep=='${':
|
||||
parsefunc = self._parse_parameter
|
||||
else:
|
||||
raise NotImplementedError(sep)
|
||||
raise NotImplementedError()
|
||||
|
||||
pos, closed = parsefunc(buf, result, eof)
|
||||
return pos, closed
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,96 +0,0 @@
|
||||
#
|
||||
# BitBake Base Server Code
|
||||
#
|
||||
# Copyright (C) 2006 - 2007 Michael 'Mickey' Lauer
|
||||
# Copyright (C) 2006 - 2008 Richard Purdie
|
||||
# Copyright (C) 2013 Alexandru Damian
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
""" Base code for Bitbake server process
|
||||
|
||||
Have a common base for that all Bitbake server classes ensures a consistent
|
||||
approach to the interface, and minimize risks associated with code duplication.
|
||||
|
||||
"""
|
||||
|
||||
""" BaseImplServer() the base class for all XXServer() implementations.
|
||||
|
||||
These classes contain the actual code that runs the server side, i.e.
|
||||
listens for the commands and executes them. Although these implementations
|
||||
contain all the data of the original bitbake command, i.e the cooker instance,
|
||||
they may well run on a different process or even machine.
|
||||
|
||||
"""
|
||||
|
||||
class BaseImplServer():
|
||||
def __init__(self):
|
||||
self._idlefuns = {}
|
||||
|
||||
def addcooker(self, cooker):
|
||||
self.cooker = cooker
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
"""Register a function to be called while the server is idle"""
|
||||
assert hasattr(function, '__call__')
|
||||
self._idlefuns[function] = data
|
||||
|
||||
|
||||
|
||||
""" BitBakeBaseServerConnection class is the common ancestor to all
|
||||
BitBakeServerConnection classes.
|
||||
|
||||
These classes control the remote server. The only command currently
|
||||
implemented is the terminate() command.
|
||||
|
||||
"""
|
||||
|
||||
class BitBakeBaseServerConnection():
|
||||
def __init__(self, serverImpl):
|
||||
pass
|
||||
|
||||
def terminate(self):
|
||||
pass
|
||||
|
||||
|
||||
""" BitBakeBaseServer class is the common ancestor to all Bitbake servers
|
||||
|
||||
Derive this class in order to implement a BitBakeServer which is the
|
||||
controlling stub for the actual server implementation
|
||||
|
||||
"""
|
||||
class BitBakeBaseServer(object):
|
||||
def initServer(self):
|
||||
self.serverImpl = None # we ensure a runtime crash if not overloaded
|
||||
self.connection = None
|
||||
return
|
||||
|
||||
def addcooker(self, cooker):
|
||||
self.cooker = cooker
|
||||
self.serverImpl.addcooker(cooker)
|
||||
|
||||
def getServerIdleCB(self):
|
||||
return self.serverImpl.register_idle_function
|
||||
|
||||
def saveConnectionDetails(self):
|
||||
return
|
||||
|
||||
def detach(self):
|
||||
return
|
||||
|
||||
def establishConnection(self):
|
||||
raise "Must redefine the %s.establishConnection()" % self.__class__.__name__
|
||||
|
||||
def endSession(self):
|
||||
self.connection.terminate()
|
||||
|
||||
191
bitbake/lib/bb/server/none.py
Normal file
191
bitbake/lib/bb/server/none.py
Normal file
@@ -0,0 +1,191 @@
|
||||
#
|
||||
# BitBake 'dummy' Passthrough Server
|
||||
#
|
||||
# Copyright (C) 2006 - 2007 Michael 'Mickey' Lauer
|
||||
# Copyright (C) 2006 - 2008 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
"""
|
||||
This module implements a passthrough server for BitBake.
|
||||
|
||||
Use register_idle_function() to add a function which the server
|
||||
calls from within idle_commands when no requests are pending. Make sure
|
||||
that those functions are non-blocking or else you will introduce latency
|
||||
in the server's main loop.
|
||||
"""
|
||||
|
||||
import time
|
||||
import bb
|
||||
import pickle
|
||||
import signal
|
||||
|
||||
DEBUG = False
|
||||
|
||||
import inspect, select
|
||||
|
||||
class BitBakeServerCommands():
|
||||
def __init__(self, server, cooker):
|
||||
self.cooker = cooker
|
||||
self.server = server
|
||||
|
||||
def runCommand(self, command):
|
||||
"""
|
||||
Run a cooker command on the server
|
||||
"""
|
||||
#print "Running Command %s" % command
|
||||
return self.cooker.command.runCommand(command)
|
||||
|
||||
def terminateServer(self):
|
||||
"""
|
||||
Trigger the server to quit
|
||||
"""
|
||||
self.server.server_exit()
|
||||
#print "Server (cooker) exitting"
|
||||
return
|
||||
|
||||
def ping(self):
|
||||
"""
|
||||
Dummy method which can be used to check the server is still alive
|
||||
"""
|
||||
return True
|
||||
|
||||
eventQueue = []
|
||||
|
||||
class BBUIEventQueue:
|
||||
class event:
|
||||
def __init__(self, parent):
|
||||
self.parent = parent
|
||||
@staticmethod
|
||||
def send(event):
|
||||
bb.server.none.eventQueue.append(pickle.loads(event))
|
||||
@staticmethod
|
||||
def quit():
|
||||
return
|
||||
|
||||
def __init__(self, BBServer):
|
||||
self.eventQueue = bb.server.none.eventQueue
|
||||
self.BBServer = BBServer
|
||||
self.EventHandle = bb.event.register_UIHhandler(self)
|
||||
|
||||
def __popEvent(self):
|
||||
if len(self.eventQueue) == 0:
|
||||
return None
|
||||
return self.eventQueue.pop(0)
|
||||
|
||||
def getEvent(self):
|
||||
if len(self.eventQueue) == 0:
|
||||
self.BBServer.idle_commands(0)
|
||||
return self.__popEvent()
|
||||
|
||||
def waitEvent(self, delay):
|
||||
event = self.__popEvent()
|
||||
if event:
|
||||
return event
|
||||
self.BBServer.idle_commands(delay)
|
||||
return self.__popEvent()
|
||||
|
||||
def queue_event(self, event):
|
||||
self.eventQueue.append(event)
|
||||
|
||||
def system_quit( self ):
|
||||
bb.event.unregister_UIHhandler(self.EventHandle)
|
||||
|
||||
# Dummy signal handler to ensure we break out of sleep upon SIGCHLD
|
||||
def chldhandler(signum, stackframe):
|
||||
pass
|
||||
|
||||
class BitBakeServer():
|
||||
# remove this when you're done with debugging
|
||||
# allow_reuse_address = True
|
||||
|
||||
def __init__(self, cooker):
|
||||
self._idlefuns = {}
|
||||
self.commands = BitBakeServerCommands(self, cooker)
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
"""Register a function to be called while the server is idle"""
|
||||
assert hasattr(function, '__call__')
|
||||
self._idlefuns[function] = data
|
||||
|
||||
def idle_commands(self, delay):
|
||||
#print "Idle queue length %s" % len(self._idlefuns)
|
||||
#print "Idle timeout, running idle functions"
|
||||
#if len(self._idlefuns) == 0:
|
||||
nextsleep = delay
|
||||
for function, data in self._idlefuns.items():
|
||||
try:
|
||||
retval = function(self, data, False)
|
||||
#print "Idle function returned %s" % (retval)
|
||||
if retval is False:
|
||||
del self._idlefuns[function]
|
||||
elif retval is True:
|
||||
nextsleep = None
|
||||
elif nextsleep is None:
|
||||
continue
|
||||
elif retval < nextsleep:
|
||||
nextsleep = retval
|
||||
except SystemExit:
|
||||
raise
|
||||
except:
|
||||
import traceback
|
||||
traceback.print_exc()
|
||||
self.commands.runCommand(["stateShutdown"])
|
||||
pass
|
||||
if nextsleep is not None:
|
||||
#print "Sleeping for %s (%s)" % (nextsleep, delay)
|
||||
signal.signal(signal.SIGCHLD, chldhandler)
|
||||
time.sleep(nextsleep)
|
||||
signal.signal(signal.SIGCHLD, signal.SIG_DFL)
|
||||
|
||||
def server_exit(self):
|
||||
# Tell idle functions we're exiting
|
||||
for function, data in self._idlefuns.items():
|
||||
try:
|
||||
retval = function(self, data, True)
|
||||
except:
|
||||
pass
|
||||
|
||||
class BitbakeServerInfo():
|
||||
def __init__(self, server):
|
||||
self.server = server
|
||||
self.commands = server.commands
|
||||
|
||||
class BitBakeServerFork():
|
||||
def __init__(self, cooker, server, serverinfo, logfile):
|
||||
serverinfo.logfile = logfile
|
||||
serverinfo.cooker = cooker
|
||||
serverinfo.server = server
|
||||
|
||||
class BitbakeUILauch():
|
||||
def launch(self, serverinfo, uifunc, *args):
|
||||
return bb.cooker.server_main(serverinfo.cooker, uifunc, *args)
|
||||
|
||||
class BitBakeServerConnection():
|
||||
def __init__(self, serverinfo):
|
||||
self.server = serverinfo.server
|
||||
self.connection = serverinfo.commands
|
||||
self.events = bb.server.none.BBUIEventQueue(self.server)
|
||||
for event in bb.event.ui_queue:
|
||||
self.events.queue_event(event)
|
||||
|
||||
def terminate(self):
|
||||
try:
|
||||
self.events.system_quit()
|
||||
except:
|
||||
pass
|
||||
try:
|
||||
self.connection.terminateServer()
|
||||
except:
|
||||
pass
|
||||
@@ -1,210 +0,0 @@
|
||||
#
|
||||
# BitBake Process based server.
|
||||
#
|
||||
# Copyright (C) 2010 Bob Foerster <robert@erafx.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
"""
|
||||
This module implements a multiprocessing.Process based server for bitbake.
|
||||
"""
|
||||
|
||||
import bb
|
||||
import bb.event
|
||||
import itertools
|
||||
import logging
|
||||
import multiprocessing
|
||||
import os
|
||||
import signal
|
||||
import sys
|
||||
import time
|
||||
import select
|
||||
from Queue import Empty
|
||||
from multiprocessing import Event, Process, util, Queue, Pipe, queues
|
||||
|
||||
from . import BitBakeBaseServer, BitBakeBaseServerConnection, BaseImplServer
|
||||
|
||||
logger = logging.getLogger('BitBake')
|
||||
|
||||
class ServerCommunicator():
|
||||
def __init__(self, connection, event_handle):
|
||||
self.connection = connection
|
||||
self.event_handle = event_handle
|
||||
|
||||
def runCommand(self, command):
|
||||
# @todo try/except
|
||||
self.connection.send(command)
|
||||
|
||||
while True:
|
||||
# don't let the user ctrl-c while we're waiting for a response
|
||||
try:
|
||||
if self.connection.poll(20):
|
||||
return self.connection.recv()
|
||||
else:
|
||||
bb.fatal("Timeout while attempting to communicate with bitbake server")
|
||||
except KeyboardInterrupt:
|
||||
pass
|
||||
|
||||
def getEventHandle(self):
|
||||
return self.event_handle.value
|
||||
|
||||
class EventAdapter():
|
||||
"""
|
||||
Adapter to wrap our event queue since the caller (bb.event) expects to
|
||||
call a send() method, but our actual queue only has put()
|
||||
"""
|
||||
def __init__(self, queue):
|
||||
self.queue = queue
|
||||
|
||||
def send(self, event):
|
||||
try:
|
||||
self.queue.put(event)
|
||||
except Exception as err:
|
||||
print("EventAdapter puked: %s" % str(err))
|
||||
|
||||
|
||||
class ProcessServer(Process, BaseImplServer):
|
||||
profile_filename = "profile.log"
|
||||
profile_processed_filename = "profile.log.processed"
|
||||
|
||||
def __init__(self, command_channel, event_queue):
|
||||
BaseImplServer.__init__(self)
|
||||
Process.__init__(self)
|
||||
self.command_channel = command_channel
|
||||
self.event_queue = event_queue
|
||||
self.event = EventAdapter(event_queue)
|
||||
self.quit = False
|
||||
|
||||
self.keep_running = Event()
|
||||
self.keep_running.set()
|
||||
self.event_handle = multiprocessing.Value("i")
|
||||
|
||||
def run(self):
|
||||
for event in bb.event.ui_queue:
|
||||
self.event_queue.put(event)
|
||||
self.event_handle.value = bb.event.register_UIHhandler(self)
|
||||
bb.cooker.server_main(self.cooker, self.main)
|
||||
|
||||
def main(self):
|
||||
# Ignore SIGINT within the server, as all SIGINT handling is done by
|
||||
# the UI and communicated to us
|
||||
signal.signal(signal.SIGINT, signal.SIG_IGN)
|
||||
while self.keep_running.is_set():
|
||||
try:
|
||||
if self.command_channel.poll():
|
||||
command = self.command_channel.recv()
|
||||
self.runCommand(command)
|
||||
|
||||
self.idle_commands(.1, [self.event_queue._reader, self.command_channel])
|
||||
except Exception:
|
||||
logger.exception('Running command %s', command)
|
||||
|
||||
self.event_queue.close()
|
||||
bb.event.unregister_UIHhandler(self.event_handle.value)
|
||||
self.command_channel.close()
|
||||
self.cooker.stop()
|
||||
self.idle_commands(.1)
|
||||
|
||||
def idle_commands(self, delay, fds = []):
|
||||
nextsleep = delay
|
||||
|
||||
for function, data in self._idlefuns.items():
|
||||
try:
|
||||
retval = function(self, data, False)
|
||||
if retval is False:
|
||||
del self._idlefuns[function]
|
||||
elif retval is True:
|
||||
nextsleep = None
|
||||
elif nextsleep is None:
|
||||
continue
|
||||
else:
|
||||
fds = fds + retval
|
||||
except SystemExit:
|
||||
raise
|
||||
except Exception:
|
||||
logger.exception('Running idle function')
|
||||
|
||||
if nextsleep is not None:
|
||||
select.select(fds,[],[],nextsleep)
|
||||
|
||||
def runCommand(self, command):
|
||||
"""
|
||||
Run a cooker command on the server
|
||||
"""
|
||||
self.command_channel.send(self.cooker.command.runCommand(command))
|
||||
|
||||
def stop(self):
|
||||
self.keep_running.clear()
|
||||
|
||||
class BitBakeProcessServerConnection(BitBakeBaseServerConnection):
|
||||
def __init__(self, serverImpl, ui_channel, event_queue):
|
||||
self.procserver = serverImpl
|
||||
self.ui_channel = ui_channel
|
||||
self.event_queue = event_queue
|
||||
self.connection = ServerCommunicator(self.ui_channel, self.procserver.event_handle)
|
||||
self.events = self.event_queue
|
||||
|
||||
def terminate(self):
|
||||
def flushevents():
|
||||
while True:
|
||||
try:
|
||||
event = self.event_queue.get(block=False)
|
||||
except (Empty, IOError):
|
||||
break
|
||||
if isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
|
||||
signal.signal(signal.SIGINT, signal.SIG_IGN)
|
||||
self.procserver.stop()
|
||||
|
||||
while self.procserver.is_alive():
|
||||
flushevents()
|
||||
self.procserver.join(0.1)
|
||||
|
||||
self.ui_channel.close()
|
||||
self.event_queue.close()
|
||||
|
||||
# Wrap Queue to provide API which isn't server implementation specific
|
||||
class ProcessEventQueue(multiprocessing.queues.Queue):
|
||||
def waitEvent(self, timeout):
|
||||
try:
|
||||
return self.get(True, timeout)
|
||||
except Empty:
|
||||
return None
|
||||
|
||||
def getEvent(self):
|
||||
try:
|
||||
return self.get(False)
|
||||
except Empty:
|
||||
return None
|
||||
|
||||
|
||||
class BitBakeServer(BitBakeBaseServer):
|
||||
def initServer(self):
|
||||
# establish communication channels. We use bidirectional pipes for
|
||||
# ui <--> server command/response pairs
|
||||
# and a queue for server -> ui event notifications
|
||||
#
|
||||
self.ui_channel, self.server_channel = Pipe()
|
||||
self.event_queue = ProcessEventQueue(0)
|
||||
self.serverImpl = ProcessServer(self.server_channel, self.event_queue)
|
||||
|
||||
def detach(self):
|
||||
self.serverImpl.start()
|
||||
return
|
||||
|
||||
def establishConnection(self):
|
||||
self.connection = BitBakeProcessServerConnection(self.serverImpl, self.ui_channel, self.event_queue)
|
||||
signal.signal(signal.SIGTERM, lambda i, s: self.connection.terminate())
|
||||
return self.connection
|
||||
@@ -35,68 +35,104 @@ import bb
|
||||
import xmlrpclib, sys
|
||||
from bb import daemonize
|
||||
from bb.ui import uievent
|
||||
import hashlib, time
|
||||
import socket
|
||||
import os, signal
|
||||
import threading
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
|
||||
DEBUG = False
|
||||
|
||||
from SimpleXMLRPCServer import SimpleXMLRPCServer, SimpleXMLRPCRequestHandler
|
||||
import inspect, select, httplib
|
||||
import inspect, select
|
||||
|
||||
from . import BitBakeBaseServer, BitBakeBaseServerConnection, BaseImplServer
|
||||
if sys.hexversion < 0x020600F0:
|
||||
print("Sorry, python 2.6 or later is required for bitbake's XMLRPC mode")
|
||||
sys.exit(1)
|
||||
|
||||
##
|
||||
# The xmlrpclib.Transport class has undergone various changes in Python 2.7
|
||||
# which break BitBake's XMLRPC implementation.
|
||||
# To work around this we subclass Transport and have a copy/paste of method
|
||||
# implementations from Python 2.6.6's xmlrpclib.
|
||||
#
|
||||
# Upstream Python bug is #8194 (http://bugs.python.org/issue8194)
|
||||
# This bug is relevant for Python 2.7.0 and 2.7.1 but was fixed for
|
||||
# Python > 2.7.2
|
||||
##
|
||||
|
||||
class BBTransport(xmlrpclib.Transport):
|
||||
def __init__(self, timeout):
|
||||
self.timeout = timeout
|
||||
self.connection_token = None
|
||||
xmlrpclib.Transport.__init__(self)
|
||||
def request(self, host, handler, request_body, verbose=0):
|
||||
h = self.make_connection(host)
|
||||
if verbose:
|
||||
h.set_debuglevel(1)
|
||||
|
||||
self.send_request(h, handler, request_body)
|
||||
self.send_host(h, host)
|
||||
self.send_user_agent(h)
|
||||
self.send_content(h, request_body)
|
||||
|
||||
errcode, errmsg, headers = h.getreply()
|
||||
|
||||
if errcode != 200:
|
||||
raise ProtocolError(
|
||||
host + handler,
|
||||
errcode, errmsg,
|
||||
headers
|
||||
)
|
||||
|
||||
self.verbose = verbose
|
||||
|
||||
try:
|
||||
sock = h._conn.sock
|
||||
except AttributeError:
|
||||
sock = None
|
||||
|
||||
return self._parse_response(h.getfile(), sock)
|
||||
|
||||
# Modified from default to pass timeout to HTTPConnection
|
||||
def make_connection(self, host):
|
||||
#return an existing connection if possible. This allows
|
||||
#HTTP/1.1 keep-alive.
|
||||
if self._connection and host == self._connection[0]:
|
||||
return self._connection[1]
|
||||
import httplib
|
||||
host, extra_headers, x509 = self.get_host_info(host)
|
||||
return httplib.HTTP(host)
|
||||
|
||||
# create a HTTP connection object from a host descriptor
|
||||
chost, self._extra_headers, x509 = self.get_host_info(host)
|
||||
#store the host argument along with the connection object
|
||||
self._connection = host, httplib.HTTPConnection(chost, timeout=self.timeout)
|
||||
return self._connection[1]
|
||||
def _parse_response(self, file, sock):
|
||||
p, u = self.getparser()
|
||||
|
||||
def set_connection_token(self, token):
|
||||
self.connection_token = token
|
||||
while 1:
|
||||
if sock:
|
||||
response = sock.recv(1024)
|
||||
else:
|
||||
response = file.read(1024)
|
||||
if not response:
|
||||
break
|
||||
if self.verbose:
|
||||
print "body:", repr(response)
|
||||
p.feed(response)
|
||||
|
||||
def send_content(self, h, body):
|
||||
if self.connection_token:
|
||||
h.putheader("Bitbake-token", self.connection_token)
|
||||
xmlrpclib.Transport.send_content(self, h, body)
|
||||
file.close()
|
||||
p.close()
|
||||
|
||||
def _create_server(host, port, timeout = 60):
|
||||
t = BBTransport(timeout)
|
||||
s = xmlrpclib.Server("http://%s:%d/" % (host, port), transport=t, allow_none=True)
|
||||
return s, t
|
||||
return u.close()
|
||||
|
||||
def _create_server(host, port):
|
||||
# Python 2.7.0 and 2.7.1 have a buggy Transport implementation
|
||||
# For those versions of Python, and only those versions, use our
|
||||
# own copy/paste BBTransport class.
|
||||
if (2, 7, 0) <= sys.version_info < (2, 7, 2):
|
||||
t = BBTransport()
|
||||
s = xmlrpclib.Server("http://%s:%d/" % (host, port), transport=t, allow_none=True)
|
||||
else:
|
||||
s = xmlrpclib.Server("http://%s:%d/" % (host, port), allow_none=True)
|
||||
|
||||
return s
|
||||
|
||||
class BitBakeServerCommands():
|
||||
|
||||
def __init__(self, server):
|
||||
def __init__(self, server, cooker):
|
||||
self.cooker = cooker
|
||||
self.server = server
|
||||
self.has_client = False
|
||||
|
||||
def registerEventHandler(self, host, port):
|
||||
"""
|
||||
Register a remote UI Event Handler
|
||||
"""
|
||||
s, t = _create_server(host, port)
|
||||
s = _create_server(host, port)
|
||||
|
||||
self.event_handle = bb.event.register_UIHhandler(s)
|
||||
return self.event_handle
|
||||
return bb.event.register_UIHhandler(s)
|
||||
|
||||
def unregisterEventHandler(self, handlerNum):
|
||||
"""
|
||||
@@ -108,146 +144,39 @@ class BitBakeServerCommands():
|
||||
"""
|
||||
Run a cooker command on the server
|
||||
"""
|
||||
return self.cooker.command.runCommand(command, self.server.readonly)
|
||||
|
||||
def getEventHandle(self):
|
||||
return self.event_handle
|
||||
return self.cooker.command.runCommand(command)
|
||||
|
||||
def terminateServer(self):
|
||||
"""
|
||||
Trigger the server to quit
|
||||
"""
|
||||
self.server.quit = True
|
||||
print("Server (cooker) exiting")
|
||||
print("Server (cooker) exitting")
|
||||
return
|
||||
|
||||
def addClient(self):
|
||||
if self.has_client:
|
||||
return None
|
||||
token = hashlib.md5(str(time.time())).hexdigest()
|
||||
self.server.set_connection_token(token)
|
||||
self.has_client = True
|
||||
return token
|
||||
|
||||
def removeClient(self):
|
||||
if self.has_client:
|
||||
self.server.set_connection_token(None)
|
||||
self.has_client = False
|
||||
if self.server.single_use:
|
||||
self.server.quit = True
|
||||
|
||||
# This request handler checks if the request has a "Bitbake-token" header
|
||||
# field (this comes from the client side) and compares it with its internal
|
||||
# "Bitbake-token" field (this comes from the server). If the two are not
|
||||
# equal, it is assumed that a client is trying to connect to the server
|
||||
# while another client is connected to the server. In this case, a 503 error
|
||||
# ("service unavailable") is returned to the client.
|
||||
class BitBakeXMLRPCRequestHandler(SimpleXMLRPCRequestHandler):
|
||||
def __init__(self, request, client_address, server):
|
||||
self.server = server
|
||||
SimpleXMLRPCRequestHandler.__init__(self, request, client_address, server)
|
||||
|
||||
def do_POST(self):
|
||||
try:
|
||||
remote_token = self.headers["Bitbake-token"]
|
||||
except:
|
||||
remote_token = None
|
||||
if remote_token != self.server.connection_token and remote_token != "observer":
|
||||
self.report_503()
|
||||
else:
|
||||
if remote_token == "observer":
|
||||
self.server.readonly = True
|
||||
else:
|
||||
self.server.readonly = False
|
||||
SimpleXMLRPCRequestHandler.do_POST(self)
|
||||
|
||||
def report_503(self):
|
||||
self.send_response(503)
|
||||
response = 'No more client allowed'
|
||||
self.send_header("Content-type", "text/plain")
|
||||
self.send_header("Content-length", str(len(response)))
|
||||
self.end_headers()
|
||||
self.wfile.write(response)
|
||||
|
||||
class BitBakeUIEventServer(threading.Thread):
|
||||
class EventAdapter():
|
||||
def ping(self):
|
||||
"""
|
||||
Adapter to wrap our event queue since the caller (bb.event) expects to
|
||||
call a send() method, but our actual queue only has put()
|
||||
Dummy method which can be used to check the server is still alive
|
||||
"""
|
||||
def __init__(self, notify):
|
||||
self.queue = []
|
||||
self.notify = notify
|
||||
self.qlock = threading.Lock()
|
||||
return True
|
||||
|
||||
def send(self, event):
|
||||
self.qlock.acquire()
|
||||
self.queue.append(event)
|
||||
self.qlock.release()
|
||||
self.notify.set()
|
||||
|
||||
def get(self):
|
||||
self.qlock.acquire()
|
||||
if len(self.queue) == 0:
|
||||
self.qlock.release()
|
||||
return None
|
||||
e = self.queue.pop(0)
|
||||
if len(self.queue) == 0:
|
||||
self.notify.clear()
|
||||
self.qlock.release()
|
||||
return e
|
||||
|
||||
def __init__(self, connection):
|
||||
self.connection = connection
|
||||
self.notify = threading.Event()
|
||||
self.event = BitBakeUIEventServer.EventAdapter(self.notify)
|
||||
self.quit = False
|
||||
threading.Thread.__init__(self)
|
||||
|
||||
def terminateServer(self):
|
||||
self.quit = True
|
||||
|
||||
def run(self):
|
||||
while not self.quit:
|
||||
self.notify.wait(0.1)
|
||||
evt = self.event.get()
|
||||
if evt:
|
||||
self.connection.event.sendpickle(pickle.dumps(evt))
|
||||
|
||||
|
||||
class XMLRPCProxyServer(BaseImplServer):
|
||||
""" not a real working server, but a stub for a proxy server connection
|
||||
|
||||
"""
|
||||
def __init__(self, host, port):
|
||||
self.host = host
|
||||
self.port = port
|
||||
|
||||
class XMLRPCServer(SimpleXMLRPCServer, BaseImplServer):
|
||||
class BitBakeServer(SimpleXMLRPCServer):
|
||||
# remove this when you're done with debugging
|
||||
# allow_reuse_address = True
|
||||
|
||||
def __init__(self, interface):
|
||||
def __init__(self, cooker, interface = ("localhost", 0)):
|
||||
"""
|
||||
Constructor
|
||||
"""
|
||||
BaseImplServer.__init__(self)
|
||||
SimpleXMLRPCServer.__init__(self, interface,
|
||||
requestHandler=BitBakeXMLRPCRequestHandler,
|
||||
requestHandler=SimpleXMLRPCRequestHandler,
|
||||
logRequests=False, allow_none=True)
|
||||
self._idlefuns = {}
|
||||
self.host, self.port = self.socket.getsockname()
|
||||
self.connection_token = None
|
||||
#self.register_introspection_functions()
|
||||
self.commands = BitBakeServerCommands(self)
|
||||
self.autoregister_all_functions(self.commands, "")
|
||||
self.interface = interface
|
||||
self.single_use = False
|
||||
if (interface[1] == 0): # anonymous port, not getting reused
|
||||
self.single_use = True
|
||||
|
||||
def addcooker(self, cooker):
|
||||
BaseImplServer.addcooker(self, cooker)
|
||||
self.commands.cooker = cooker
|
||||
commands = BitBakeServerCommands(self, cooker)
|
||||
self.autoregister_all_functions(commands, "")
|
||||
self.cooker = cooker
|
||||
|
||||
def autoregister_all_functions(self, context, prefix):
|
||||
"""
|
||||
@@ -259,9 +188,12 @@ class XMLRPCServer(SimpleXMLRPCServer, BaseImplServer):
|
||||
if name.startswith(prefix):
|
||||
self.register_function(method, name[len(prefix):])
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
"""Register a function to be called while the server is idle"""
|
||||
assert hasattr(function, '__call__')
|
||||
self._idlefuns[function] = data
|
||||
|
||||
def serve_forever(self):
|
||||
# Start the actual XMLRPC server
|
||||
bb.cooker.server_main(self.cooker, self._serve_forever)
|
||||
|
||||
def _serve_forever(self):
|
||||
@@ -269,9 +201,12 @@ class XMLRPCServer(SimpleXMLRPCServer, BaseImplServer):
|
||||
Serve Requests. Overloaded to honor a quit command
|
||||
"""
|
||||
self.quit = False
|
||||
self.timeout = 0 # Run Idle calls for our first callback
|
||||
while not self.quit:
|
||||
fds = [self]
|
||||
nextsleep = 0.1
|
||||
#print "Idle queue length %s" % len(self._idlefuns)
|
||||
self.handle_request()
|
||||
#print "Idle timeout, running idle functions"
|
||||
nextsleep = None
|
||||
for function, data in self._idlefuns.items():
|
||||
try:
|
||||
retval = function(self, data, False)
|
||||
@@ -279,57 +214,50 @@ class XMLRPCServer(SimpleXMLRPCServer, BaseImplServer):
|
||||
del self._idlefuns[function]
|
||||
elif retval is True:
|
||||
nextsleep = 0
|
||||
else:
|
||||
fds = fds + retval
|
||||
elif nextsleep is 0:
|
||||
continue
|
||||
elif nextsleep is None:
|
||||
nextsleep = retval
|
||||
elif retval < nextsleep:
|
||||
nextsleep = retval
|
||||
except SystemExit:
|
||||
raise
|
||||
except:
|
||||
import traceback
|
||||
traceback.print_exc()
|
||||
pass
|
||||
|
||||
socktimeout = self.socket.gettimeout() or nextsleep
|
||||
socktimeout = min(socktimeout, nextsleep)
|
||||
# Mirror what BaseServer handle_request would do
|
||||
fd_sets = select.select(fds, [], [], socktimeout)
|
||||
if fd_sets[0] and self in fd_sets[0]:
|
||||
self._handle_request_noblock()
|
||||
|
||||
if nextsleep is None and len(self._idlefuns) > 0:
|
||||
nextsleep = 0
|
||||
self.timeout = nextsleep
|
||||
# Tell idle functions we're exiting
|
||||
for function, data in self._idlefuns.items():
|
||||
try:
|
||||
retval = function(self, data, True)
|
||||
except:
|
||||
pass
|
||||
|
||||
self.server_close()
|
||||
return
|
||||
|
||||
def set_connection_token(self, token):
|
||||
self.connection_token = token
|
||||
class BitbakeServerInfo():
|
||||
def __init__(self, server):
|
||||
self.host = server.host
|
||||
self.port = server.port
|
||||
|
||||
class BitBakeXMLRPCServerConnection(BitBakeBaseServerConnection):
|
||||
def __init__(self, serverImpl, clientinfo=("localhost", 0), observer_only = False):
|
||||
self.connection, self.transport = _create_server(serverImpl.host, serverImpl.port)
|
||||
self.clientinfo = clientinfo
|
||||
self.serverImpl = serverImpl
|
||||
self.observer_only = observer_only
|
||||
class BitBakeServerFork():
|
||||
def __init__(self, cooker, server, serverinfo, logfile):
|
||||
daemonize.createDaemon(server.serve_forever, logfile)
|
||||
|
||||
def connect(self):
|
||||
if not self.observer_only:
|
||||
token = self.connection.addClient()
|
||||
else:
|
||||
token = "observer"
|
||||
if token is None:
|
||||
return None
|
||||
self.transport.set_connection_token(token)
|
||||
self.events = uievent.BBUIEventQueue(self.connection, self.clientinfo)
|
||||
class BitbakeUILauch():
|
||||
def launch(self, serverinfo, uifunc, *args):
|
||||
return uifunc(*args)
|
||||
|
||||
class BitBakeServerConnection():
|
||||
def __init__(self, serverinfo):
|
||||
self.connection = _create_server(serverinfo.host, serverinfo.port)
|
||||
self.events = uievent.BBUIEventQueue(self.connection)
|
||||
for event in bb.event.ui_queue:
|
||||
self.events.queue_event(event)
|
||||
return self
|
||||
|
||||
def removeClient(self):
|
||||
if not self.observer_only:
|
||||
self.connection.removeClient()
|
||||
|
||||
def terminate(self):
|
||||
# Don't wait for server indefinitely
|
||||
@@ -340,53 +268,6 @@ class BitBakeXMLRPCServerConnection(BitBakeBaseServerConnection):
|
||||
except:
|
||||
pass
|
||||
try:
|
||||
self.connection.removeClient()
|
||||
self.connection.terminateServer()
|
||||
except:
|
||||
pass
|
||||
|
||||
class BitBakeServer(BitBakeBaseServer):
|
||||
def initServer(self, interface = ("localhost", 0)):
|
||||
self.serverImpl = XMLRPCServer(interface)
|
||||
|
||||
def detach(self):
|
||||
daemonize.createDaemon(self.serverImpl.serve_forever, "bitbake-cookerdaemon.log")
|
||||
del self.cooker
|
||||
|
||||
def establishConnection(self):
|
||||
self.connection = BitBakeXMLRPCServerConnection(self.serverImpl)
|
||||
return self.connection.connect()
|
||||
|
||||
def set_connection_token(self, token):
|
||||
self.connection.transport.set_connection_token(token)
|
||||
|
||||
class BitBakeXMLRPCClient(BitBakeBaseServer):
|
||||
|
||||
def __init__(self, observer_only = False):
|
||||
self.observer_only = observer_only
|
||||
pass
|
||||
|
||||
def saveConnectionDetails(self, remote):
|
||||
self.remote = remote
|
||||
|
||||
def establishConnection(self):
|
||||
# The format of "remote" must be "server:port"
|
||||
try:
|
||||
[host, port] = self.remote.split(":")
|
||||
port = int(port)
|
||||
except:
|
||||
return None
|
||||
# We need our IP for the server connection. We get the IP
|
||||
# by trying to connect with the server
|
||||
try:
|
||||
s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)
|
||||
s.connect((host, port))
|
||||
ip = s.getsockname()[0]
|
||||
s.close()
|
||||
except:
|
||||
return None
|
||||
self.serverImpl = XMLRPCProxyServer(host, port)
|
||||
self.connection = BitBakeXMLRPCServerConnection(self.serverImpl, (ip, 0), self.observer_only)
|
||||
return self.connection.connect()
|
||||
|
||||
def endSession(self):
|
||||
self.connection.removeClient()
|
||||
|
||||
@@ -407,7 +407,7 @@ SRC_URI = ""
|
||||
|
||||
def parse( self, params ):
|
||||
"""(Re-)parse .bb files and calculate the dependency graph"""
|
||||
cooker.status = cache.CacheData(cooker.caches_array)
|
||||
cooker.status = cache.CacheData()
|
||||
ignore = data.getVar("ASSUME_PROVIDED", cooker.configuration.data, 1) or ""
|
||||
cooker.status.ignored_dependencies = set( ignore.split() )
|
||||
cooker.handleCollections( data.getVar("BBFILE_COLLECTIONS", cooker.configuration.data, 1) )
|
||||
|
||||
@@ -1,8 +1,6 @@
|
||||
import hashlib
|
||||
import logging
|
||||
import os
|
||||
import re
|
||||
import tempfile
|
||||
import bb.data
|
||||
|
||||
logger = logging.getLogger('BitBake.SigGen')
|
||||
@@ -17,14 +15,14 @@ def init(d):
|
||||
siggens = [obj for obj in globals().itervalues()
|
||||
if type(obj) is type and issubclass(obj, SignatureGenerator)]
|
||||
|
||||
desired = d.getVar("BB_SIGNATURE_HANDLER", True) or "noop"
|
||||
desired = bb.data.getVar("BB_SIGNATURE_HANDLER", d, True) or "noop"
|
||||
for sg in siggens:
|
||||
if desired == sg.name:
|
||||
return sg(d)
|
||||
break
|
||||
else:
|
||||
logger.error("Invalid signature generator '%s', using default 'noop'\n"
|
||||
"Available generators: %s", desired,
|
||||
"Available generators: %s",
|
||||
', '.join(obj.name for obj in siggens))
|
||||
return SignatureGenerator(d)
|
||||
|
||||
@@ -40,7 +38,7 @@ class SignatureGenerator(object):
|
||||
return
|
||||
|
||||
def get_taskhash(self, fn, task, deps, dataCache):
|
||||
return "0"
|
||||
return 0
|
||||
|
||||
def set_taskdata(self, hashes, deps):
|
||||
return
|
||||
@@ -48,16 +46,6 @@ class SignatureGenerator(object):
|
||||
def stampfile(self, stampbase, file_name, taskname, extrainfo):
|
||||
return ("%s.%s.%s" % (stampbase, taskname, extrainfo)).rstrip('.')
|
||||
|
||||
def stampcleanmask(self, stampbase, file_name, taskname, extrainfo):
|
||||
return ("%s.%s.%s" % (stampbase, taskname, extrainfo)).rstrip('.')
|
||||
|
||||
def dump_sigtask(self, fn, task, stampbase, runtime):
|
||||
return
|
||||
|
||||
def invalidate_task(self, task, d, fn):
|
||||
bb.build.del_stamp(task, d, fn)
|
||||
|
||||
|
||||
class SignatureGeneratorBasic(SignatureGenerator):
|
||||
"""
|
||||
"""
|
||||
@@ -68,16 +56,11 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
self.taskhash = {}
|
||||
self.taskdeps = {}
|
||||
self.runtaskdeps = {}
|
||||
self.file_checksum_values = {}
|
||||
self.gendeps = {}
|
||||
self.lookupcache = {}
|
||||
self.pkgnameextract = re.compile("(?P<fn>.*)\..*")
|
||||
self.basewhitelist = set((data.getVar("BB_HASHBASE_WHITELIST", True) or "").split())
|
||||
self.taskwhitelist = None
|
||||
self.init_rundepcheck(data)
|
||||
|
||||
def init_rundepcheck(self, data):
|
||||
self.taskwhitelist = data.getVar("BB_HASHTASK_WHITELIST", True) or None
|
||||
|
||||
if self.taskwhitelist:
|
||||
self.twl = re.compile(self.taskwhitelist)
|
||||
else:
|
||||
@@ -85,20 +68,16 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
|
||||
def _build_data(self, fn, d):
|
||||
|
||||
tasklist, gendeps, lookupcache = bb.data.generate_dependencies(d)
|
||||
tasklist, gendeps = bb.data.generate_dependencies(d)
|
||||
|
||||
taskdeps = {}
|
||||
basehash = {}
|
||||
lookupcache = {}
|
||||
|
||||
for task in tasklist:
|
||||
data = d.getVar(task, False)
|
||||
lookupcache[task] = data
|
||||
|
||||
if data is None:
|
||||
bb.error("Task %s from %s seems to be empty?!" % (task, fn))
|
||||
data = ''
|
||||
|
||||
gendeps[task] -= self.basewhitelist
|
||||
newdeps = gendeps[task]
|
||||
seen = set()
|
||||
while newdeps:
|
||||
@@ -108,26 +87,23 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
for dep in nextdeps:
|
||||
if dep in self.basewhitelist:
|
||||
continue
|
||||
gendeps[dep] -= self.basewhitelist
|
||||
newdeps |= gendeps[dep]
|
||||
newdeps -= seen
|
||||
|
||||
alldeps = sorted(seen)
|
||||
for dep in alldeps:
|
||||
data = data + dep
|
||||
alldeps = seen - self.basewhitelist
|
||||
|
||||
for dep in sorted(alldeps):
|
||||
if dep in lookupcache:
|
||||
var = lookupcache[dep]
|
||||
elif dep[-1] == ']':
|
||||
vf = dep[:-1].split('[')
|
||||
var = d.getVarFlag(vf[0], vf[1], False)
|
||||
lookupcache[dep] = var
|
||||
else:
|
||||
var = d.getVar(dep, False)
|
||||
lookupcache[dep] = var
|
||||
if var:
|
||||
data = data + str(var)
|
||||
data = data + var
|
||||
if data is None:
|
||||
bb.error("Task %s from %s seems to be empty?!" % (task, fn))
|
||||
self.basehash[fn + "." + task] = hashlib.md5(data).hexdigest()
|
||||
taskdeps[task] = alldeps
|
||||
taskdeps[task] = sorted(alldeps)
|
||||
|
||||
self.taskdeps[fn] = taskdeps
|
||||
self.gendeps[fn] = gendeps
|
||||
@@ -140,11 +116,7 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
if variant:
|
||||
fn = "virtual:" + variant + ":" + fn
|
||||
|
||||
try:
|
||||
taskdeps = self._build_data(fn, d)
|
||||
except:
|
||||
bb.note("Error during finalise of %s" % fn)
|
||||
raise
|
||||
taskdeps = self._build_data(fn, d)
|
||||
|
||||
#Slow but can be useful for debugging mismatched basehashes
|
||||
#for task in self.taskdeps[fn]:
|
||||
@@ -153,64 +125,35 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
for task in taskdeps:
|
||||
d.setVar("BB_BASEHASH_task-%s" % task, self.basehash[fn + "." + task])
|
||||
|
||||
def rundep_check(self, fn, recipename, task, dep, depname, dataCache):
|
||||
# Return True if we should keep the dependency, False to drop it
|
||||
# We only manipulate the dependencies for packages not in the whitelist
|
||||
if self.twl and not self.twl.search(recipename):
|
||||
# then process the actual dependencies
|
||||
if self.twl.search(depname):
|
||||
return False
|
||||
return True
|
||||
|
||||
def read_taint(self, fn, task, stampbase):
|
||||
taint = None
|
||||
try:
|
||||
with open(stampbase + '.' + task + '.taint', 'r') as taintf:
|
||||
taint = taintf.read()
|
||||
except IOError:
|
||||
pass
|
||||
return taint
|
||||
|
||||
def get_taskhash(self, fn, task, deps, dataCache):
|
||||
k = fn + "." + task
|
||||
data = dataCache.basetaskhash[k]
|
||||
self.runtaskdeps[k] = []
|
||||
self.file_checksum_values[k] = {}
|
||||
recipename = dataCache.pkg_fn[fn]
|
||||
for dep in sorted(deps, key=clean_basepath):
|
||||
depname = dataCache.pkg_fn[self.pkgnameextract.search(dep).group('fn')]
|
||||
if not self.rundep_check(fn, recipename, task, dep, depname, dataCache):
|
||||
continue
|
||||
for dep in sorted(deps):
|
||||
# We only manipulate the dependencies for packages not in the whitelist
|
||||
if self.twl and not self.twl.search(dataCache.pkg_fn[fn]):
|
||||
# then process the actual dependencies
|
||||
dep_fn = re.search("(?P<fn>.*)\..*", dep).group('fn')
|
||||
if self.twl.search(dataCache.pkg_fn[dep_fn]):
|
||||
continue
|
||||
if dep not in self.taskhash:
|
||||
bb.fatal("%s is not in taskhash, caller isn't calling in dependency order?", dep)
|
||||
data = data + self.taskhash[dep]
|
||||
self.runtaskdeps[k].append(dep)
|
||||
|
||||
if task in dataCache.file_checksums[fn]:
|
||||
checksums = bb.fetch2.get_file_checksums(dataCache.file_checksums[fn][task], recipename)
|
||||
for (f,cs) in checksums:
|
||||
self.file_checksum_values[k][f] = cs
|
||||
data = data + cs
|
||||
|
||||
taint = self.read_taint(fn, task, dataCache.stamp[fn])
|
||||
if taint:
|
||||
data = data + taint
|
||||
|
||||
h = hashlib.md5(data).hexdigest()
|
||||
self.taskhash[k] = h
|
||||
#d.setVar("BB_TASKHASH_task-%s" % task, taskhash[task])
|
||||
return h
|
||||
|
||||
def set_taskdata(self, hashes, deps, checksums):
|
||||
def set_taskdata(self, hashes, deps):
|
||||
self.runtaskdeps = deps
|
||||
self.taskhash = hashes
|
||||
self.file_checksum_values = checksums
|
||||
|
||||
def dump_sigtask(self, fn, task, stampbase, runtime):
|
||||
k = fn + "." + task
|
||||
if runtime == "customfile":
|
||||
sigfile = stampbase
|
||||
elif runtime and k in self.taskhash:
|
||||
elif runtime:
|
||||
sigfile = stampbase + "." + task + ".sigdata" + "." + self.taskhash[k]
|
||||
else:
|
||||
sigfile = stampbase + "." + task + ".sigbasedata" + "." + self.basehash[k]
|
||||
@@ -231,31 +174,14 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
data['gendeps'][dep] = self.gendeps[fn][dep]
|
||||
data['varvals'][dep] = self.lookupcache[fn][dep]
|
||||
|
||||
if runtime and k in self.taskhash:
|
||||
if runtime:
|
||||
data['runtaskdeps'] = self.runtaskdeps[k]
|
||||
data['file_checksum_values'] = self.file_checksum_values[k]
|
||||
data['runtaskhashes'] = {}
|
||||
for dep in data['runtaskdeps']:
|
||||
data['runtaskhashes'][dep] = self.taskhash[dep]
|
||||
|
||||
taint = self.read_taint(fn, task, stampbase)
|
||||
if taint:
|
||||
data['taint'] = taint
|
||||
|
||||
fd, tmpfile = tempfile.mkstemp(dir=os.path.dirname(sigfile), prefix="sigtask.")
|
||||
try:
|
||||
with os.fdopen(fd, "wb") as stream:
|
||||
p = pickle.dump(data, stream, -1)
|
||||
stream.flush()
|
||||
os.fsync(fd)
|
||||
os.chmod(tmpfile, 0664)
|
||||
os.rename(tmpfile, sigfile)
|
||||
except (OSError, IOError) as err:
|
||||
try:
|
||||
os.unlink(tmpfile)
|
||||
except OSError:
|
||||
pass
|
||||
raise err
|
||||
p = pickle.Pickler(file(sigfile, "wb"), -1)
|
||||
p.dump(data)
|
||||
|
||||
def dump_sigs(self, dataCache):
|
||||
for fn in self.taskdeps:
|
||||
@@ -271,184 +197,102 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
|
||||
name = "basichash"
|
||||
|
||||
def stampfile(self, stampbase, fn, taskname, extrainfo, clean=False):
|
||||
def stampfile(self, stampbase, fn, taskname, extrainfo):
|
||||
if taskname != "do_setscene" and taskname.endswith("_setscene"):
|
||||
k = fn + "." + taskname[:-9]
|
||||
else:
|
||||
k = fn + "." + taskname
|
||||
if clean:
|
||||
h = "*"
|
||||
elif k in self.taskhash:
|
||||
h = self.taskhash[k]
|
||||
else:
|
||||
# If k is not in basehash, then error
|
||||
h = self.basehash[k]
|
||||
h = self.taskhash[k]
|
||||
return ("%s.%s.%s.%s" % (stampbase, taskname, h, extrainfo)).rstrip('.')
|
||||
|
||||
def stampcleanmask(self, stampbase, fn, taskname, extrainfo):
|
||||
return self.stampfile(stampbase, fn, taskname, extrainfo, clean=True)
|
||||
|
||||
def invalidate_task(self, task, d, fn):
|
||||
bb.note("Tainting hash to force rebuild of task %s, %s" % (fn, task))
|
||||
bb.build.write_taint(task, d, fn)
|
||||
|
||||
def dump_this_task(outfile, d):
|
||||
import bb.parse
|
||||
fn = d.getVar("BB_FILENAME", True)
|
||||
task = "do_" + d.getVar("BB_CURRENTTASK", True)
|
||||
bb.parse.siggen.dump_sigtask(fn, task, outfile, "customfile")
|
||||
|
||||
def clean_basepath(a):
|
||||
if a.startswith("virtual:"):
|
||||
b = a.rsplit(":", 1)[0] + ":" + a.rsplit("/", 1)[1]
|
||||
else:
|
||||
b = a.rsplit("/", 1)[1]
|
||||
return b
|
||||
|
||||
def clean_basepaths(a):
|
||||
b = {}
|
||||
for x in a:
|
||||
b[clean_basepath(x)] = a[x]
|
||||
return b
|
||||
|
||||
def compare_sigfiles(a, b, recursecb = None):
|
||||
output = []
|
||||
|
||||
p1 = pickle.Unpickler(open(a, "rb"))
|
||||
def compare_sigfiles(a, b):
|
||||
p1 = pickle.Unpickler(file(a, "rb"))
|
||||
a_data = p1.load()
|
||||
p2 = pickle.Unpickler(open(b, "rb"))
|
||||
p2 = pickle.Unpickler(file(b, "rb"))
|
||||
b_data = p2.load()
|
||||
|
||||
def dict_diff(a, b, whitelist=set()):
|
||||
def dict_diff(a, b):
|
||||
sa = set(a.keys())
|
||||
sb = set(b.keys())
|
||||
common = sa & sb
|
||||
changed = set()
|
||||
for i in common:
|
||||
if a[i] != b[i] and i not in whitelist:
|
||||
if a[i] != b[i]:
|
||||
changed.add(i)
|
||||
added = sa - sb
|
||||
removed = sb - sa
|
||||
return changed, added, removed
|
||||
|
||||
if 'basewhitelist' in a_data and a_data['basewhitelist'] != b_data['basewhitelist']:
|
||||
output.append("basewhitelist changed from '%s' to '%s'" % (a_data['basewhitelist'], b_data['basewhitelist']))
|
||||
if a_data['basewhitelist'] and b_data['basewhitelist']:
|
||||
output.append("changed items: %s" % a_data['basewhitelist'].symmetric_difference(b_data['basewhitelist']))
|
||||
print "basewhitelist changed from %s to %s" % (a_data['basewhitelist'], b_data['basewhitelist'])
|
||||
|
||||
if 'taskwhitelist' in a_data and a_data['taskwhitelist'] != b_data['taskwhitelist']:
|
||||
output.append("taskwhitelist changed from '%s' to '%s'" % (a_data['taskwhitelist'], b_data['taskwhitelist']))
|
||||
if a_data['taskwhitelist'] and b_data['taskwhitelist']:
|
||||
output.append("changed items: %s" % a_data['taskwhitelist'].symmetric_difference(b_data['taskwhitelist']))
|
||||
print "taskwhitelist changed from %s to %s" % (a_data['taskwhitelist'], b_data['taskwhitelist'])
|
||||
|
||||
if a_data['taskdeps'] != b_data['taskdeps']:
|
||||
output.append("Task dependencies changed from:\n%s\nto:\n%s" % (sorted(a_data['taskdeps']), sorted(b_data['taskdeps'])))
|
||||
print "Task dependencies changed from %s to %s" % (sorted(a_data['taskdeps']), sorted(b_data['taskdeps']))
|
||||
|
||||
if a_data['basehash'] != b_data['basehash']:
|
||||
output.append("basehash changed from %s to %s" % (a_data['basehash'], b_data['basehash']))
|
||||
print "basehash changed from %s to %s" % (a_data['basehash'], b_data['basehash'])
|
||||
|
||||
changed, added, removed = dict_diff(a_data['gendeps'], b_data['gendeps'], a_data['basewhitelist'] & b_data['basewhitelist'])
|
||||
changed, added, removed = dict_diff(a_data['gendeps'], b_data['gendeps'])
|
||||
if changed:
|
||||
for dep in changed:
|
||||
output.append("List of dependencies for variable %s changed from '%s' to '%s'" % (dep, a_data['gendeps'][dep], b_data['gendeps'][dep]))
|
||||
if a_data['gendeps'][dep] and b_data['gendeps'][dep]:
|
||||
output.append("changed items: %s" % a_data['gendeps'][dep].symmetric_difference(b_data['gendeps'][dep]))
|
||||
print "List of dependencies for variable %s changed from %s to %s" % (dep, a_data['gendeps'][dep], b_data['gendeps'][dep])
|
||||
if added:
|
||||
for dep in added:
|
||||
output.append("Dependency on variable %s was added" % (dep))
|
||||
print "Dependency on variable %s was added" % (dep)
|
||||
if removed:
|
||||
for dep in removed:
|
||||
output.append("Dependency on Variable %s was removed" % (dep))
|
||||
print "Dependency on Variable %s was removed" % (dep)
|
||||
|
||||
|
||||
changed, added, removed = dict_diff(a_data['varvals'], b_data['varvals'])
|
||||
if changed:
|
||||
for dep in changed:
|
||||
output.append("Variable %s value changed from '%s' to '%s'" % (dep, a_data['varvals'][dep], b_data['varvals'][dep]))
|
||||
|
||||
changed, added, removed = dict_diff(a_data['file_checksum_values'], b_data['file_checksum_values'])
|
||||
if changed:
|
||||
for f in changed:
|
||||
output.append("Checksum for file %s changed from %s to %s" % (f, a_data['file_checksum_values'][f], b_data['file_checksum_values'][f]))
|
||||
if added:
|
||||
for f in added:
|
||||
output.append("Dependency on checksum of file %s was added" % (f))
|
||||
if removed:
|
||||
for f in removed:
|
||||
output.append("Dependency on checksum of file %s was removed" % (f))
|
||||
|
||||
print "Variable %s value changed from %s to %s" % (dep, a_data['varvals'][dep], b_data['varvals'][dep])
|
||||
|
||||
if 'runtaskhashes' in a_data and 'runtaskhashes' in b_data:
|
||||
a = a_data['runtaskhashes']
|
||||
b = b_data['runtaskhashes']
|
||||
changed, added, removed = dict_diff(a, b)
|
||||
changed, added, removed = dict_diff(a_data['runtaskhashes'], b_data['runtaskhashes'])
|
||||
if added:
|
||||
for dep in added:
|
||||
bdep_found = False
|
||||
if removed:
|
||||
for bdep in removed:
|
||||
if a[dep] == b[bdep]:
|
||||
#output.append("Dependency on task %s was replaced by %s with same hash" % (dep, bdep))
|
||||
bdep_found = True
|
||||
if not bdep_found:
|
||||
output.append("Dependency on task %s was added with hash %s" % (clean_basepath(dep), a[dep]))
|
||||
print "Dependency on task %s was added" % (dep)
|
||||
if removed:
|
||||
for dep in removed:
|
||||
adep_found = False
|
||||
if added:
|
||||
for adep in added:
|
||||
if a[adep] == b[dep]:
|
||||
#output.append("Dependency on task %s was replaced by %s with same hash" % (adep, dep))
|
||||
adep_found = True
|
||||
if not adep_found:
|
||||
output.append("Dependency on task %s was removed with hash %s" % (clean_basepath(dep), b[dep]))
|
||||
print "Dependency on task %s was removed" % (dep)
|
||||
if changed:
|
||||
for dep in changed:
|
||||
output.append("Hash for dependent task %s changed from %s to %s" % (clean_basepath(dep), a[dep], b[dep]))
|
||||
if callable(recursecb):
|
||||
recout = recursecb(dep, a[dep], b[dep])
|
||||
if recout:
|
||||
output.extend(recout)
|
||||
|
||||
a_taint = a_data.get('taint', None)
|
||||
b_taint = b_data.get('taint', None)
|
||||
if a_taint != b_taint:
|
||||
output.append("Taint (by forced/invalidated task) changed from %s to %s" % (a_taint, b_taint))
|
||||
|
||||
return output
|
||||
|
||||
print "Hash for dependent task %s changed from %s to %s" % (dep, a_data['runtaskhashes'][dep], b_data['runtaskhashes'][dep])
|
||||
elif 'runtaskdeps' in a_data and 'runtaskdeps' in b_data and sorted(a_data['runtaskdeps']) != sorted(b_data['runtaskdeps']):
|
||||
print "Tasks this task depends on changed from %s to %s" % (sorted(a_data['runtaskdeps']), sorted(b_data['runtaskdeps']))
|
||||
|
||||
def dump_sigfile(a):
|
||||
output = []
|
||||
|
||||
p1 = pickle.Unpickler(open(a, "rb"))
|
||||
p1 = pickle.Unpickler(file(a, "rb"))
|
||||
a_data = p1.load()
|
||||
|
||||
output.append("basewhitelist: %s" % (a_data['basewhitelist']))
|
||||
print "basewhitelist: %s" % (a_data['basewhitelist'])
|
||||
|
||||
output.append("taskwhitelist: %s" % (a_data['taskwhitelist']))
|
||||
print "taskwhitelist: %s" % (a_data['taskwhitelist'])
|
||||
|
||||
output.append("Task dependencies: %s" % (sorted(a_data['taskdeps'])))
|
||||
print "Task dependencies: %s" % (sorted(a_data['taskdeps']))
|
||||
|
||||
output.append("basehash: %s" % (a_data['basehash']))
|
||||
print "basehash: %s" % (a_data['basehash'])
|
||||
|
||||
for dep in a_data['gendeps']:
|
||||
output.append("List of dependencies for variable %s is %s" % (dep, a_data['gendeps'][dep]))
|
||||
print "List of dependencies for variable %s is %s" % (dep, a_data['gendeps'][dep])
|
||||
|
||||
for dep in a_data['varvals']:
|
||||
output.append("Variable %s value is %s" % (dep, a_data['varvals'][dep]))
|
||||
print "Variable %s value is %s" % (dep, a_data['varvals'][dep])
|
||||
|
||||
if 'runtaskdeps' in a_data:
|
||||
output.append("Tasks this task depends on: %s" % (a_data['runtaskdeps']))
|
||||
|
||||
if 'file_checksum_values' in a_data:
|
||||
output.append("This task depends on the checksums of files: %s" % (a_data['file_checksum_values']))
|
||||
print "Tasks this task depends on: %s" % (a_data['runtaskdeps'])
|
||||
|
||||
if 'runtaskhashes' in a_data:
|
||||
for dep in a_data['runtaskhashes']:
|
||||
output.append("Hash for dependent task %s is %s" % (dep, a_data['runtaskhashes'][dep]))
|
||||
|
||||
if 'taint' in a_data:
|
||||
output.append("Tainted (by forced/invalidated task): %s" % a_data['taint'])
|
||||
|
||||
return output
|
||||
print "Hash for dependent task %s is %s" % (dep, a_data['runtaskhashes'][dep])
|
||||
|
||||
@@ -41,7 +41,7 @@ class TaskData:
|
||||
"""
|
||||
BitBake Task Data implementation
|
||||
"""
|
||||
def __init__(self, abort = True, tryaltconfigs = False, skiplist = None):
|
||||
def __init__(self, abort = True, tryaltconfigs = False):
|
||||
self.build_names_index = []
|
||||
self.run_names_index = []
|
||||
self.fn_index = []
|
||||
@@ -55,7 +55,6 @@ class TaskData:
|
||||
self.tasks_name = []
|
||||
self.tasks_tdepends = []
|
||||
self.tasks_idepends = []
|
||||
self.tasks_irdepends = []
|
||||
# Cache to speed up task ID lookups
|
||||
self.tasks_lookup = {}
|
||||
|
||||
@@ -71,8 +70,6 @@ class TaskData:
|
||||
self.abort = abort
|
||||
self.tryaltconfigs = tryaltconfigs
|
||||
|
||||
self.skiplist = skiplist
|
||||
|
||||
def getbuild_id(self, name):
|
||||
"""
|
||||
Return an ID number for the build target name.
|
||||
@@ -116,16 +113,6 @@ class TaskData:
|
||||
ids.append(self.tasks_lookup[fnid][task])
|
||||
return ids
|
||||
|
||||
def gettask_id_fromfnid(self, fnid, task):
|
||||
"""
|
||||
Return an ID number for the task matching fnid and task.
|
||||
"""
|
||||
if fnid in self.tasks_lookup:
|
||||
if task in self.tasks_lookup[fnid]:
|
||||
return self.tasks_lookup[fnid][task]
|
||||
|
||||
return None
|
||||
|
||||
def gettask_id(self, fn, task, create = True):
|
||||
"""
|
||||
Return an ID number for the task matching fn and task.
|
||||
@@ -145,7 +132,6 @@ class TaskData:
|
||||
self.tasks_fnid.append(fnid)
|
||||
self.tasks_tdepends.append([])
|
||||
self.tasks_idepends.append([])
|
||||
self.tasks_irdepends.append([])
|
||||
|
||||
listid = len(self.tasks_name) - 1
|
||||
|
||||
@@ -165,7 +151,7 @@ class TaskData:
|
||||
fnid = self.getfn_id(fn)
|
||||
|
||||
if fnid in self.failed_fnids:
|
||||
bb.msg.fatal("TaskData", "Trying to re-add a failed file? Something is broken...")
|
||||
bb.msg.fatal(bb.msg.domain.TaskData, "Trying to re-add a failed file? Something is broken...")
|
||||
|
||||
# Check if we've already seen this fn
|
||||
if fnid in self.tasks_fnid:
|
||||
@@ -176,9 +162,6 @@ class TaskData:
|
||||
# Work out task dependencies
|
||||
parentids = []
|
||||
for dep in task_deps['parents'][task]:
|
||||
if dep not in task_deps['tasks']:
|
||||
bb.debug(2, "Not adding dependeny of %s on %s since %s does not exist" % (task, dep, dep))
|
||||
continue
|
||||
parentid = self.gettask_id(fn, dep)
|
||||
parentids.append(parentid)
|
||||
taskid = self.gettask_id(fn, task)
|
||||
@@ -190,18 +173,9 @@ class TaskData:
|
||||
for dep in task_deps['depends'][task].split():
|
||||
if dep:
|
||||
if ":" not in dep:
|
||||
bb.msg.fatal("TaskData", "Error for %s, dependency %s does not contain ':' character\n. Task 'depends' should be specified in the form 'packagename:task'" % (fn, dep))
|
||||
bb.msg.fatal(bb.msg.domain.TaskData, "Error, dependency %s does not contain ':' character\n. Task 'depends' should be specified in the form 'packagename:task'" % (dep, fn))
|
||||
ids.append(((self.getbuild_id(dep.split(":")[0])), dep.split(":")[1]))
|
||||
self.tasks_idepends[taskid].extend(ids)
|
||||
if 'rdepends' in task_deps and task in task_deps['rdepends']:
|
||||
ids = []
|
||||
for dep in task_deps['rdepends'][task].split():
|
||||
if dep:
|
||||
if ":" not in dep:
|
||||
bb.msg.fatal("TaskData", "Error for %s, dependency %s does not contain ':' character\n. Task 'rdepends' should be specified in the form 'packagename:task'" % (fn, dep))
|
||||
ids.append(((self.getrun_id(dep.split(":")[0])), dep.split(":")[1]))
|
||||
self.tasks_irdepends[taskid].extend(ids)
|
||||
|
||||
|
||||
# Work out build dependencies
|
||||
if not fnid in self.depids:
|
||||
@@ -374,33 +348,6 @@ class TaskData:
|
||||
dependees.append(self.fn_index[fnid])
|
||||
return dependees
|
||||
|
||||
def get_reasons(self, item, runtime=False):
|
||||
"""
|
||||
Get the reason(s) for an item not being provided, if any
|
||||
"""
|
||||
reasons = []
|
||||
if self.skiplist:
|
||||
for fn in self.skiplist:
|
||||
skipitem = self.skiplist[fn]
|
||||
if skipitem.pn == item:
|
||||
reasons.append("%s was skipped: %s" % (skipitem.pn, skipitem.skipreason))
|
||||
elif runtime and item in skipitem.rprovides:
|
||||
reasons.append("%s RPROVIDES %s but was skipped: %s" % (skipitem.pn, item, skipitem.skipreason))
|
||||
elif not runtime and item in skipitem.provides:
|
||||
reasons.append("%s PROVIDES %s but was skipped: %s" % (skipitem.pn, item, skipitem.skipreason))
|
||||
return reasons
|
||||
|
||||
def get_close_matches(self, item, provider_list):
|
||||
import difflib
|
||||
if self.skiplist:
|
||||
skipped = []
|
||||
for fn in self.skiplist:
|
||||
skipped.append(self.skiplist[fn].pn)
|
||||
full_list = provider_list + skipped
|
||||
else:
|
||||
full_list = provider_list
|
||||
return difflib.get_close_matches(item, full_list, cutoff=0.7)
|
||||
|
||||
def add_provider(self, cfgData, dataCache, item):
|
||||
try:
|
||||
self.add_provider_internal(cfgData, dataCache, item)
|
||||
@@ -422,7 +369,7 @@ class TaskData:
|
||||
return
|
||||
|
||||
if not item in dataCache.providers:
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item), reasons=self.get_reasons(item), close_matches=self.get_close_matches(item, dataCache.providers.keys())), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_rdependees_str(item)), cfgData)
|
||||
raise bb.providers.NoProvider(item)
|
||||
|
||||
if self.have_build_target(item):
|
||||
@@ -434,7 +381,7 @@ class TaskData:
|
||||
eligible = [p for p in eligible if not self.getfn_id(p) in self.failed_fnids]
|
||||
|
||||
if not eligible:
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item), reasons=["No eligible PROVIDERs exist for '%s'" % item]), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item)), cfgData)
|
||||
raise bb.providers.NoProvider(item)
|
||||
|
||||
if len(eligible) > 1 and foundUnique == False:
|
||||
@@ -471,14 +418,14 @@ class TaskData:
|
||||
all_p = bb.providers.getRuntimeProviders(dataCache, item)
|
||||
|
||||
if not all_p:
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item), reasons=self.get_reasons(item, True)), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item)), cfgData)
|
||||
raise bb.providers.NoRProvider(item)
|
||||
|
||||
eligible, numberPreferred = bb.providers.filterProvidersRunTime(all_p, item, cfgData, dataCache)
|
||||
eligible = [p for p in eligible if not self.getfn_id(p) in self.failed_fnids]
|
||||
|
||||
if not eligible:
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item), reasons=["No eligible RPROVIDERs exist for '%s'" % item]), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item)), cfgData)
|
||||
raise bb.providers.NoRProvider(item)
|
||||
|
||||
if len(eligible) > 1 and numberPreferred == 0:
|
||||
@@ -496,7 +443,6 @@ class TaskData:
|
||||
providers_list.append(dataCache.pkg_fn[fn])
|
||||
bb.event.fire(bb.event.MultipleProviders(item, providers_list, runtime=True), cfgData)
|
||||
self.consider_msgs_cache.append(item)
|
||||
raise bb.providers.MultipleRProvider(item)
|
||||
|
||||
# run through the list until we find one that we can build
|
||||
for fn in eligible:
|
||||
@@ -569,11 +515,6 @@ class TaskData:
|
||||
dependees = self.get_rdependees(targetid)
|
||||
for fnid in dependees:
|
||||
self.fail_fnid(fnid, missing_list)
|
||||
for taskid in xrange(len(self.tasks_irdepends)):
|
||||
irdepends = self.tasks_irdepends[taskid]
|
||||
for (idependid, idependtask) in irdepends:
|
||||
if idependid == targetid:
|
||||
self.fail_fnid(self.tasks_fnid[taskid], missing_list)
|
||||
|
||||
def add_unresolved(self, cfgData, dataCache):
|
||||
"""
|
||||
@@ -595,7 +536,7 @@ class TaskData:
|
||||
try:
|
||||
self.add_rprovider(cfgData, dataCache, target)
|
||||
added = added + 1
|
||||
except (bb.providers.NoRProvider, bb.providers.MultipleRProvider):
|
||||
except bb.providers.NoRProvider:
|
||||
self.remove_runtarget(self.getrun_id(target))
|
||||
logger.debug(1, "Resolved " + str(added) + " extra dependencies")
|
||||
if added == 0:
|
||||
|
||||
@@ -1,374 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# BitBake Test for codeparser.py
|
||||
#
|
||||
# Copyright (C) 2010 Chris Larson
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import logging
|
||||
import bb
|
||||
|
||||
logger = logging.getLogger('BitBake.TestCodeParser')
|
||||
|
||||
# bb.data references bb.parse but can't directly import due to circular dependencies.
|
||||
# Hack around it for now :(
|
||||
import bb.parse
|
||||
import bb.data
|
||||
|
||||
class ReferenceTest(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
|
||||
def setEmptyVars(self, varlist):
|
||||
for k in varlist:
|
||||
self.d.setVar(k, "")
|
||||
|
||||
def setValues(self, values):
|
||||
for k, v in values.items():
|
||||
self.d.setVar(k, v)
|
||||
|
||||
def assertReferences(self, refs):
|
||||
self.assertEqual(self.references, refs)
|
||||
|
||||
def assertExecs(self, execs):
|
||||
self.assertEqual(self.execs, execs)
|
||||
|
||||
class VariableReferenceTest(ReferenceTest):
|
||||
|
||||
def parseExpression(self, exp):
|
||||
parsedvar = self.d.expandWithRefs(exp, None)
|
||||
self.references = parsedvar.references
|
||||
|
||||
def test_simple_reference(self):
|
||||
self.setEmptyVars(["FOO"])
|
||||
self.parseExpression("${FOO}")
|
||||
self.assertReferences(set(["FOO"]))
|
||||
|
||||
def test_nested_reference(self):
|
||||
self.setEmptyVars(["BAR"])
|
||||
self.d.setVar("FOO", "BAR")
|
||||
self.parseExpression("${${FOO}}")
|
||||
self.assertReferences(set(["FOO", "BAR"]))
|
||||
|
||||
def test_python_reference(self):
|
||||
self.setEmptyVars(["BAR"])
|
||||
self.parseExpression("${@bb.data.getVar('BAR', d, True) + 'foo'}")
|
||||
self.assertReferences(set(["BAR"]))
|
||||
|
||||
class ShellReferenceTest(ReferenceTest):
|
||||
|
||||
def parseExpression(self, exp):
|
||||
parsedvar = self.d.expandWithRefs(exp, None)
|
||||
parser = bb.codeparser.ShellParser("ParserTest", logger)
|
||||
parser.parse_shell(parsedvar.value)
|
||||
|
||||
self.references = parsedvar.references
|
||||
self.execs = parser.execs
|
||||
|
||||
def test_quotes_inside_assign(self):
|
||||
self.parseExpression('foo=foo"bar"baz')
|
||||
self.assertReferences(set([]))
|
||||
|
||||
def test_quotes_inside_arg(self):
|
||||
self.parseExpression('sed s#"bar baz"#"alpha beta"#g')
|
||||
self.assertExecs(set(["sed"]))
|
||||
|
||||
def test_arg_continuation(self):
|
||||
self.parseExpression("sed -i -e s,foo,bar,g \\\n *.pc")
|
||||
self.assertExecs(set(["sed"]))
|
||||
|
||||
def test_dollar_in_quoted(self):
|
||||
self.parseExpression('sed -i -e "foo$" *.pc')
|
||||
self.assertExecs(set(["sed"]))
|
||||
|
||||
def test_quotes_inside_arg_continuation(self):
|
||||
self.setEmptyVars(["bindir", "D", "libdir"])
|
||||
self.parseExpression("""
|
||||
sed -i -e s#"moc_location=.*$"#"moc_location=${bindir}/moc4"# \\
|
||||
-e s#"uic_location=.*$"#"uic_location=${bindir}/uic4"# \\
|
||||
${D}${libdir}/pkgconfig/*.pc
|
||||
""")
|
||||
self.assertReferences(set(["bindir", "D", "libdir"]))
|
||||
|
||||
def test_assign_subshell_expansion(self):
|
||||
self.parseExpression("foo=$(echo bar)")
|
||||
self.assertExecs(set(["echo"]))
|
||||
|
||||
def test_shell_unexpanded(self):
|
||||
self.setEmptyVars(["QT_BASE_NAME"])
|
||||
self.parseExpression('echo "${QT_BASE_NAME}"')
|
||||
self.assertExecs(set(["echo"]))
|
||||
self.assertReferences(set(["QT_BASE_NAME"]))
|
||||
|
||||
def test_incomplete_varexp_single_quotes(self):
|
||||
self.parseExpression("sed -i -e 's:IP{:I${:g' $pc")
|
||||
self.assertExecs(set(["sed"]))
|
||||
|
||||
|
||||
def test_until(self):
|
||||
self.parseExpression("until false; do echo true; done")
|
||||
self.assertExecs(set(["false", "echo"]))
|
||||
self.assertReferences(set())
|
||||
|
||||
def test_case(self):
|
||||
self.parseExpression("""
|
||||
case $foo in
|
||||
*)
|
||||
bar
|
||||
;;
|
||||
esac
|
||||
""")
|
||||
self.assertExecs(set(["bar"]))
|
||||
self.assertReferences(set())
|
||||
|
||||
def test_assign_exec(self):
|
||||
self.parseExpression("a=b c='foo bar' alpha 1 2 3")
|
||||
self.assertExecs(set(["alpha"]))
|
||||
|
||||
def test_redirect_to_file(self):
|
||||
self.setEmptyVars(["foo"])
|
||||
self.parseExpression("echo foo >${foo}/bar")
|
||||
self.assertExecs(set(["echo"]))
|
||||
self.assertReferences(set(["foo"]))
|
||||
|
||||
def test_heredoc(self):
|
||||
self.setEmptyVars(["theta"])
|
||||
self.parseExpression("""
|
||||
cat <<END
|
||||
alpha
|
||||
beta
|
||||
${theta}
|
||||
END
|
||||
""")
|
||||
self.assertReferences(set(["theta"]))
|
||||
|
||||
def test_redirect_from_heredoc(self):
|
||||
v = ["B", "SHADOW_MAILDIR", "SHADOW_MAILFILE", "SHADOW_UTMPDIR", "SHADOW_LOGDIR", "bindir"]
|
||||
self.setEmptyVars(v)
|
||||
self.parseExpression("""
|
||||
cat <<END >${B}/cachedpaths
|
||||
shadow_cv_maildir=${SHADOW_MAILDIR}
|
||||
shadow_cv_mailfile=${SHADOW_MAILFILE}
|
||||
shadow_cv_utmpdir=${SHADOW_UTMPDIR}
|
||||
shadow_cv_logdir=${SHADOW_LOGDIR}
|
||||
shadow_cv_passwd_dir=${bindir}
|
||||
END
|
||||
""")
|
||||
self.assertReferences(set(v))
|
||||
self.assertExecs(set(["cat"]))
|
||||
|
||||
# def test_incomplete_command_expansion(self):
|
||||
# self.assertRaises(reftracker.ShellSyntaxError, reftracker.execs,
|
||||
# bbvalue.shparse("cp foo`", self.d), self.d)
|
||||
|
||||
# def test_rogue_dollarsign(self):
|
||||
# self.setValues({"D" : "/tmp"})
|
||||
# self.parseExpression("install -d ${D}$")
|
||||
# self.assertReferences(set(["D"]))
|
||||
# self.assertExecs(set(["install"]))
|
||||
|
||||
|
||||
class PythonReferenceTest(ReferenceTest):
|
||||
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
if hasattr(bb.utils, "_context"):
|
||||
self.context = bb.utils._context
|
||||
else:
|
||||
import __builtin__
|
||||
self.context = __builtin__.__dict__
|
||||
|
||||
def parseExpression(self, exp):
|
||||
parsedvar = self.d.expandWithRefs(exp, None)
|
||||
parser = bb.codeparser.PythonParser("ParserTest", logger)
|
||||
parser.parse_python(parsedvar.value)
|
||||
|
||||
self.references = parsedvar.references | parser.references
|
||||
self.execs = parser.execs
|
||||
|
||||
@staticmethod
|
||||
def indent(value):
|
||||
"""Python Snippets have to be indented, python values don't have to
|
||||
be. These unit tests are testing snippets."""
|
||||
return " " + value
|
||||
|
||||
def test_getvar_reference(self):
|
||||
self.parseExpression("bb.data.getVar('foo', d, True)")
|
||||
self.assertReferences(set(["foo"]))
|
||||
self.assertExecs(set())
|
||||
|
||||
def test_getvar_computed_reference(self):
|
||||
self.parseExpression("bb.data.getVar('f' + 'o' + 'o', d, True)")
|
||||
self.assertReferences(set())
|
||||
self.assertExecs(set())
|
||||
|
||||
def test_getvar_exec_reference(self):
|
||||
self.parseExpression("eval('bb.data.getVar(\"foo\", d, True)')")
|
||||
self.assertReferences(set())
|
||||
self.assertExecs(set(["eval"]))
|
||||
|
||||
def test_var_reference(self):
|
||||
self.context["foo"] = lambda x: x
|
||||
self.setEmptyVars(["FOO"])
|
||||
self.parseExpression("foo('${FOO}')")
|
||||
self.assertReferences(set(["FOO"]))
|
||||
self.assertExecs(set(["foo"]))
|
||||
del self.context["foo"]
|
||||
|
||||
def test_var_exec(self):
|
||||
for etype in ("func", "task"):
|
||||
self.d.setVar("do_something", "echo 'hi mom! ${FOO}'")
|
||||
self.d.setVarFlag("do_something", etype, True)
|
||||
self.parseExpression("bb.build.exec_func('do_something', d)")
|
||||
self.assertReferences(set(["do_something"]))
|
||||
|
||||
def test_function_reference(self):
|
||||
self.context["testfunc"] = lambda msg: bb.msg.note(1, None, msg)
|
||||
self.d.setVar("FOO", "Hello, World!")
|
||||
self.parseExpression("testfunc('${FOO}')")
|
||||
self.assertReferences(set(["FOO"]))
|
||||
self.assertExecs(set(["testfunc"]))
|
||||
del self.context["testfunc"]
|
||||
|
||||
def test_qualified_function_reference(self):
|
||||
self.parseExpression("time.time()")
|
||||
self.assertExecs(set(["time.time"]))
|
||||
|
||||
def test_qualified_function_reference_2(self):
|
||||
self.parseExpression("os.path.dirname('/foo/bar')")
|
||||
self.assertExecs(set(["os.path.dirname"]))
|
||||
|
||||
def test_qualified_function_reference_nested(self):
|
||||
self.parseExpression("time.strftime('%Y%m%d',time.gmtime())")
|
||||
self.assertExecs(set(["time.strftime", "time.gmtime"]))
|
||||
|
||||
def test_function_reference_chained(self):
|
||||
self.context["testget"] = lambda: "\tstrip me "
|
||||
self.parseExpression("testget().strip()")
|
||||
self.assertExecs(set(["testget"]))
|
||||
del self.context["testget"]
|
||||
|
||||
|
||||
class DependencyReferenceTest(ReferenceTest):
|
||||
|
||||
pydata = """
|
||||
bb.data.getVar('somevar', d, True)
|
||||
def test(d):
|
||||
foo = 'bar %s' % 'foo'
|
||||
def test2(d):
|
||||
d.getVar(foo, True)
|
||||
d.getVar('bar', False)
|
||||
test2(d)
|
||||
|
||||
def a():
|
||||
\"\"\"some
|
||||
stuff
|
||||
\"\"\"
|
||||
return "heh"
|
||||
|
||||
test(d)
|
||||
|
||||
bb.data.expand(bb.data.getVar("something", False, d), d)
|
||||
bb.data.expand("${inexpand} somethingelse", d)
|
||||
bb.data.getVar(a(), d, False)
|
||||
"""
|
||||
|
||||
def test_python(self):
|
||||
self.d.setVar("FOO", self.pydata)
|
||||
self.setEmptyVars(["inexpand", "a", "test2", "test"])
|
||||
self.d.setVarFlags("FOO", {"func": True, "python": True})
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEquals(deps, set(["somevar", "bar", "something", "inexpand", "test", "test2", "a"]))
|
||||
|
||||
|
||||
shelldata = """
|
||||
foo () {
|
||||
bar
|
||||
}
|
||||
{
|
||||
echo baz
|
||||
$(heh)
|
||||
eval `moo`
|
||||
}
|
||||
a=b
|
||||
c=d
|
||||
(
|
||||
true && false
|
||||
test -f foo
|
||||
testval=something
|
||||
$testval
|
||||
) || aiee
|
||||
! inverted
|
||||
echo ${somevar}
|
||||
|
||||
case foo in
|
||||
bar)
|
||||
echo bar
|
||||
;;
|
||||
baz)
|
||||
echo baz
|
||||
;;
|
||||
foo*)
|
||||
echo foo
|
||||
;;
|
||||
esac
|
||||
"""
|
||||
|
||||
def test_shell(self):
|
||||
execs = ["bar", "echo", "heh", "moo", "true", "aiee"]
|
||||
self.d.setVar("somevar", "heh")
|
||||
self.d.setVar("inverted", "echo inverted...")
|
||||
self.d.setVarFlag("inverted", "func", True)
|
||||
self.d.setVar("FOO", self.shelldata)
|
||||
self.d.setVarFlags("FOO", {"func": True})
|
||||
self.setEmptyVars(execs)
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEquals(deps, set(["somevar", "inverted"] + execs))
|
||||
|
||||
|
||||
def test_vardeps(self):
|
||||
self.d.setVar("oe_libinstall", "echo test")
|
||||
self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
|
||||
self.d.setVarFlag("FOO", "vardeps", "oe_libinstall")
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEquals(deps, set(["oe_libinstall"]))
|
||||
|
||||
def test_vardeps_expand(self):
|
||||
self.d.setVar("oe_libinstall", "echo test")
|
||||
self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
|
||||
self.d.setVarFlag("FOO", "vardeps", "${@'oe_libinstall'}")
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEquals(deps, set(["oe_libinstall"]))
|
||||
|
||||
#Currently no wildcard support
|
||||
#def test_vardeps_wildcards(self):
|
||||
# self.d.setVar("oe_libinstall", "echo test")
|
||||
# self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
|
||||
# self.d.setVarFlag("FOO", "vardeps", "oe_*")
|
||||
# self.assertEquals(deps, set(["oe_libinstall"]))
|
||||
|
||||
|
||||
@@ -1,136 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# BitBake Tests for Copy-on-Write (cow.py)
|
||||
#
|
||||
# Copyright 2006 Holger Freyther <freyther@handhelds.org>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import os
|
||||
|
||||
class COWTestCase(unittest.TestCase):
|
||||
"""
|
||||
Test case for the COW module from mithro
|
||||
"""
|
||||
|
||||
def testGetSet(self):
|
||||
"""
|
||||
Test and set
|
||||
"""
|
||||
from bb.COW import COWDictBase
|
||||
a = COWDictBase.copy()
|
||||
|
||||
self.assertEquals(False, a.has_key('a'))
|
||||
|
||||
a['a'] = 'a'
|
||||
a['b'] = 'b'
|
||||
self.assertEquals(True, a.has_key('a'))
|
||||
self.assertEquals(True, a.has_key('b'))
|
||||
self.assertEquals('a', a['a'] )
|
||||
self.assertEquals('b', a['b'] )
|
||||
|
||||
def testCopyCopy(self):
|
||||
"""
|
||||
Test the copy of copies
|
||||
"""
|
||||
|
||||
from bb.COW import COWDictBase
|
||||
|
||||
# create two COW dict 'instances'
|
||||
b = COWDictBase.copy()
|
||||
c = COWDictBase.copy()
|
||||
|
||||
# assign some keys to one instance, some keys to another
|
||||
b['a'] = 10
|
||||
b['c'] = 20
|
||||
c['a'] = 30
|
||||
|
||||
# test separation of the two instances
|
||||
self.assertEquals(False, c.has_key('c'))
|
||||
self.assertEquals(30, c['a'])
|
||||
self.assertEquals(10, b['a'])
|
||||
|
||||
# test copy
|
||||
b_2 = b.copy()
|
||||
c_2 = c.copy()
|
||||
|
||||
self.assertEquals(False, c_2.has_key('c'))
|
||||
self.assertEquals(10, b_2['a'])
|
||||
|
||||
b_2['d'] = 40
|
||||
self.assertEquals(False, c_2.has_key('d'))
|
||||
self.assertEquals(True, b_2.has_key('d'))
|
||||
self.assertEquals(40, b_2['d'])
|
||||
self.assertEquals(False, b.has_key('d'))
|
||||
self.assertEquals(False, c.has_key('d'))
|
||||
|
||||
c_2['d'] = 30
|
||||
self.assertEquals(True, c_2.has_key('d'))
|
||||
self.assertEquals(True, b_2.has_key('d'))
|
||||
self.assertEquals(30, c_2['d'])
|
||||
self.assertEquals(40, b_2['d'])
|
||||
self.assertEquals(False, b.has_key('d'))
|
||||
self.assertEquals(False, c.has_key('d'))
|
||||
|
||||
# test copy of the copy
|
||||
c_3 = c_2.copy()
|
||||
b_3 = b_2.copy()
|
||||
b_3_2 = b_2.copy()
|
||||
|
||||
c_3['e'] = 4711
|
||||
self.assertEquals(4711, c_3['e'])
|
||||
self.assertEquals(False, c_2.has_key('e'))
|
||||
self.assertEquals(False, b_3.has_key('e'))
|
||||
self.assertEquals(False, b_3_2.has_key('e'))
|
||||
self.assertEquals(False, b_2.has_key('e'))
|
||||
|
||||
b_3['e'] = 'viel'
|
||||
self.assertEquals('viel', b_3['e'])
|
||||
self.assertEquals(4711, c_3['e'])
|
||||
self.assertEquals(False, c_2.has_key('e'))
|
||||
self.assertEquals(True, b_3.has_key('e'))
|
||||
self.assertEquals(False, b_3_2.has_key('e'))
|
||||
self.assertEquals(False, b_2.has_key('e'))
|
||||
|
||||
def testCow(self):
|
||||
from bb.COW import COWDictBase
|
||||
c = COWDictBase.copy()
|
||||
c['123'] = 1027
|
||||
c['other'] = 4711
|
||||
c['d'] = { 'abc' : 10, 'bcd' : 20 }
|
||||
|
||||
copy = c.copy()
|
||||
|
||||
self.assertEquals(1027, c['123'])
|
||||
self.assertEquals(4711, c['other'])
|
||||
self.assertEquals({'abc':10, 'bcd':20}, c['d'])
|
||||
self.assertEquals(1027, copy['123'])
|
||||
self.assertEquals(4711, copy['other'])
|
||||
self.assertEquals({'abc':10, 'bcd':20}, copy['d'])
|
||||
|
||||
# cow it now
|
||||
copy['123'] = 1028
|
||||
copy['other'] = 4712
|
||||
copy['d']['abc'] = 20
|
||||
|
||||
|
||||
self.assertEquals(1027, c['123'])
|
||||
self.assertEquals(4711, c['other'])
|
||||
self.assertEquals({'abc':10, 'bcd':20}, c['d'])
|
||||
self.assertEquals(1028, copy['123'])
|
||||
self.assertEquals(4712, copy['other'])
|
||||
self.assertEquals({'abc':20, 'bcd':20}, copy['d'])
|
||||
@@ -1,254 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# BitBake Tests for the Data Store (data.py/data_smart.py)
|
||||
#
|
||||
# Copyright (C) 2010 Chris Larson
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import bb
|
||||
import bb.data
|
||||
|
||||
class DataExpansions(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d["foo"] = "value of foo"
|
||||
self.d["bar"] = "value of bar"
|
||||
self.d["value of foo"] = "value of 'value of foo'"
|
||||
|
||||
def test_one_var(self):
|
||||
val = self.d.expand("${foo}")
|
||||
self.assertEqual(str(val), "value of foo")
|
||||
|
||||
def test_indirect_one_var(self):
|
||||
val = self.d.expand("${${foo}}")
|
||||
self.assertEqual(str(val), "value of 'value of foo'")
|
||||
|
||||
def test_indirect_and_another(self):
|
||||
val = self.d.expand("${${foo}} ${bar}")
|
||||
self.assertEqual(str(val), "value of 'value of foo' value of bar")
|
||||
|
||||
def test_python_snippet(self):
|
||||
val = self.d.expand("${@5*12}")
|
||||
self.assertEqual(str(val), "60")
|
||||
|
||||
def test_expand_in_python_snippet(self):
|
||||
val = self.d.expand("${@'boo ' + '${foo}'}")
|
||||
self.assertEqual(str(val), "boo value of foo")
|
||||
|
||||
def test_python_snippet_getvar(self):
|
||||
val = self.d.expand("${@d.getVar('foo', True) + ' ${bar}'}")
|
||||
self.assertEqual(str(val), "value of foo value of bar")
|
||||
|
||||
def test_python_snippet_syntax_error(self):
|
||||
self.d.setVar("FOO", "${@foo = 5}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_python_snippet_runtime_error(self):
|
||||
self.d.setVar("FOO", "${@int('test')}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_python_snippet_error_path(self):
|
||||
self.d.setVar("FOO", "foo value ${BAR}")
|
||||
self.d.setVar("BAR", "bar value ${@int('test')}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_value_containing_value(self):
|
||||
val = self.d.expand("${@d.getVar('foo', True) + ' ${bar}'}")
|
||||
self.assertEqual(str(val), "value of foo value of bar")
|
||||
|
||||
def test_reference_undefined_var(self):
|
||||
val = self.d.expand("${undefinedvar} meh")
|
||||
self.assertEqual(str(val), "${undefinedvar} meh")
|
||||
|
||||
def test_double_reference(self):
|
||||
self.d.setVar("BAR", "bar value")
|
||||
self.d.setVar("FOO", "${BAR} foo ${BAR}")
|
||||
val = self.d.getVar("FOO", True)
|
||||
self.assertEqual(str(val), "bar value foo bar value")
|
||||
|
||||
def test_direct_recursion(self):
|
||||
self.d.setVar("FOO", "${FOO}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_indirect_recursion(self):
|
||||
self.d.setVar("FOO", "${BAR}")
|
||||
self.d.setVar("BAR", "${BAZ}")
|
||||
self.d.setVar("BAZ", "${FOO}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_recursion_exception(self):
|
||||
self.d.setVar("FOO", "${BAR}")
|
||||
self.d.setVar("BAR", "${${@'FOO'}}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_incomplete_varexp_single_quotes(self):
|
||||
self.d.setVar("FOO", "sed -i -e 's:IP{:I${:g' $pc")
|
||||
val = self.d.getVar("FOO", True)
|
||||
self.assertEqual(str(val), "sed -i -e 's:IP{:I${:g' $pc")
|
||||
|
||||
def test_nonstring(self):
|
||||
self.d.setVar("TEST", 5)
|
||||
val = self.d.getVar("TEST", True)
|
||||
self.assertEqual(str(val), "5")
|
||||
|
||||
def test_rename(self):
|
||||
self.d.renameVar("foo", "newfoo")
|
||||
self.assertEqual(self.d.getVar("newfoo"), "value of foo")
|
||||
self.assertEqual(self.d.getVar("foo"), None)
|
||||
|
||||
def test_deletion(self):
|
||||
self.d.delVar("foo")
|
||||
self.assertEqual(self.d.getVar("foo"), None)
|
||||
|
||||
def test_keys(self):
|
||||
keys = self.d.keys()
|
||||
self.assertEqual(keys, ['value of foo', 'foo', 'bar'])
|
||||
|
||||
class TestNestedExpansions(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d["foo"] = "foo"
|
||||
self.d["bar"] = "bar"
|
||||
self.d["value of foobar"] = "187"
|
||||
|
||||
def test_refs(self):
|
||||
val = self.d.expand("${value of ${foo}${bar}}")
|
||||
self.assertEqual(str(val), "187")
|
||||
|
||||
#def test_python_refs(self):
|
||||
# val = self.d.expand("${@${@3}**2 + ${@4}**2}")
|
||||
# self.assertEqual(str(val), "25")
|
||||
|
||||
def test_ref_in_python_ref(self):
|
||||
val = self.d.expand("${@'${foo}' + 'bar'}")
|
||||
self.assertEqual(str(val), "foobar")
|
||||
|
||||
def test_python_ref_in_ref(self):
|
||||
val = self.d.expand("${${@'f'+'o'+'o'}}")
|
||||
self.assertEqual(str(val), "foo")
|
||||
|
||||
def test_deep_nesting(self):
|
||||
depth = 100
|
||||
val = self.d.expand("${" * depth + "foo" + "}" * depth)
|
||||
self.assertEqual(str(val), "foo")
|
||||
|
||||
#def test_deep_python_nesting(self):
|
||||
# depth = 50
|
||||
# val = self.d.expand("${@" * depth + "1" + "+1}" * depth)
|
||||
# self.assertEqual(str(val), str(depth + 1))
|
||||
|
||||
def test_mixed(self):
|
||||
val = self.d.expand("${value of ${@('${foo}'+'bar')[0:3]}${${@'BAR'.lower()}}}")
|
||||
self.assertEqual(str(val), "187")
|
||||
|
||||
def test_runtime(self):
|
||||
val = self.d.expand("${${@'value of' + ' f'+'o'+'o'+'b'+'a'+'r'}}")
|
||||
self.assertEqual(str(val), "187")
|
||||
|
||||
class TestMemoize(unittest.TestCase):
|
||||
def test_memoized(self):
|
||||
d = bb.data.init()
|
||||
d.setVar("FOO", "bar")
|
||||
self.assertTrue(d.getVar("FOO") is d.getVar("FOO"))
|
||||
|
||||
def test_not_memoized(self):
|
||||
d1 = bb.data.init()
|
||||
d2 = bb.data.init()
|
||||
d1.setVar("FOO", "bar")
|
||||
d2.setVar("FOO", "bar2")
|
||||
self.assertTrue(d1.getVar("FOO") is not d2.getVar("FOO"))
|
||||
|
||||
def test_changed_after_memoized(self):
|
||||
d = bb.data.init()
|
||||
d.setVar("foo", "value of foo")
|
||||
self.assertEqual(str(d.getVar("foo")), "value of foo")
|
||||
d.setVar("foo", "second value of foo")
|
||||
self.assertEqual(str(d.getVar("foo")), "second value of foo")
|
||||
|
||||
def test_same_value(self):
|
||||
d = bb.data.init()
|
||||
d.setVar("foo", "value of")
|
||||
d.setVar("bar", "value of")
|
||||
self.assertEqual(d.getVar("foo"),
|
||||
d.getVar("bar"))
|
||||
|
||||
class TestConcat(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d.setVar("FOO", "foo")
|
||||
self.d.setVar("VAL", "val")
|
||||
self.d.setVar("BAR", "bar")
|
||||
|
||||
def test_prepend(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.prependVar("TEST", "${FOO}:")
|
||||
self.assertEqual(self.d.getVar("TEST", True), "foo:val")
|
||||
|
||||
def test_append(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.appendVar("TEST", ":${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST", True), "val:bar")
|
||||
|
||||
def test_multiple_append(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.prependVar("TEST", "${FOO}:")
|
||||
self.d.appendVar("TEST", ":val2")
|
||||
self.d.appendVar("TEST", ":${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST", True), "foo:val:val2:bar")
|
||||
|
||||
class TestOverrides(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d.setVar("OVERRIDES", "foo:bar:local")
|
||||
self.d.setVar("TEST", "testvalue")
|
||||
|
||||
def test_no_override(self):
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "testvalue")
|
||||
|
||||
def test_one_override(self):
|
||||
self.d.setVar("TEST_bar", "testvalue2")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "testvalue2")
|
||||
|
||||
def test_multiple_override(self):
|
||||
self.d.setVar("TEST_bar", "testvalue2")
|
||||
self.d.setVar("TEST_local", "testvalue3")
|
||||
self.d.setVar("TEST_foo", "testvalue4")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "testvalue3")
|
||||
|
||||
|
||||
class TestFlags(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d.setVar("foo", "value of foo")
|
||||
self.d.setVarFlag("foo", "flag1", "value of flag1")
|
||||
self.d.setVarFlag("foo", "flag2", "value of flag2")
|
||||
|
||||
def test_setflag(self):
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag1"), "value of flag1")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag2"), "value of flag2")
|
||||
|
||||
def test_delflag(self):
|
||||
self.d.delVarFlag("foo", "flag2")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag1"), "value of flag1")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag2"), None)
|
||||
|
||||
|
||||
@@ -1,424 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# BitBake Tests for the Fetcher (fetch2/)
|
||||
#
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import tempfile
|
||||
import subprocess
|
||||
import os
|
||||
from bb.fetch2 import URI
|
||||
import bb
|
||||
|
||||
class URITest(unittest.TestCase):
|
||||
test_uris = {
|
||||
"http://www.google.com/index.html" : {
|
||||
'uri': 'http://www.google.com/index.html',
|
||||
'scheme': 'http',
|
||||
'hostname': 'www.google.com',
|
||||
'port': None,
|
||||
'hostport': 'www.google.com',
|
||||
'path': '/index.html',
|
||||
'userinfo': '',
|
||||
'username': '',
|
||||
'password': '',
|
||||
'params': {},
|
||||
'relative': False
|
||||
},
|
||||
"http://www.google.com/index.html;param1=value1" : {
|
||||
'uri': 'http://www.google.com/index.html;param1=value1',
|
||||
'scheme': 'http',
|
||||
'hostname': 'www.google.com',
|
||||
'port': None,
|
||||
'hostport': 'www.google.com',
|
||||
'path': '/index.html',
|
||||
'userinfo': '',
|
||||
'username': '',
|
||||
'password': '',
|
||||
'params': {
|
||||
'param1': 'value1'
|
||||
},
|
||||
'relative': False
|
||||
},
|
||||
"http://www.example.com:8080/index.html" : {
|
||||
'uri': 'http://www.example.com:8080/index.html',
|
||||
'scheme': 'http',
|
||||
'hostname': 'www.example.com',
|
||||
'port': 8080,
|
||||
'hostport': 'www.example.com:8080',
|
||||
'path': '/index.html',
|
||||
'userinfo': '',
|
||||
'username': '',
|
||||
'password': '',
|
||||
'params': {},
|
||||
'relative': False
|
||||
},
|
||||
"cvs://anoncvs@cvs.handhelds.org/cvs;module=familiar/dist/ipkg" : {
|
||||
'uri': 'cvs://anoncvs@cvs.handhelds.org/cvs;module=familiar/dist/ipkg',
|
||||
'scheme': 'cvs',
|
||||
'hostname': 'cvs.handhelds.org',
|
||||
'port': None,
|
||||
'hostport': 'cvs.handhelds.org',
|
||||
'path': '/cvs',
|
||||
'userinfo': 'anoncvs',
|
||||
'username': 'anoncvs',
|
||||
'password': '',
|
||||
'params': {
|
||||
'module': 'familiar/dist/ipkg'
|
||||
},
|
||||
'relative': False
|
||||
},
|
||||
"cvs://anoncvs:anonymous@cvs.handhelds.org/cvs;tag=V0-99-81;module=familiar/dist/ipkg": {
|
||||
'uri': 'cvs://anoncvs:anonymous@cvs.handhelds.org/cvs;tag=V0-99-81;module=familiar/dist/ipkg',
|
||||
'scheme': 'cvs',
|
||||
'hostname': 'cvs.handhelds.org',
|
||||
'port': None,
|
||||
'hostport': 'cvs.handhelds.org',
|
||||
'path': '/cvs',
|
||||
'userinfo': 'anoncvs:anonymous',
|
||||
'username': 'anoncvs',
|
||||
'password': 'anonymous',
|
||||
'params': {
|
||||
'tag': 'V0-99-81',
|
||||
'module': 'familiar/dist/ipkg'
|
||||
},
|
||||
'relative': False
|
||||
},
|
||||
"file://example.diff": { # NOTE: Not RFC compliant!
|
||||
'uri': 'file:example.diff',
|
||||
'scheme': 'file',
|
||||
'hostname': '',
|
||||
'port': None,
|
||||
'hostport': '',
|
||||
'path': 'example.diff',
|
||||
'userinfo': '',
|
||||
'username': '',
|
||||
'password': '',
|
||||
'params': {},
|
||||
'relative': True
|
||||
},
|
||||
"file:example.diff": { # NOTE: RFC compliant version of the former
|
||||
'uri': 'file:example.diff',
|
||||
'scheme': 'file',
|
||||
'hostname': '',
|
||||
'port': None,
|
||||
'hostport': '',
|
||||
'path': 'example.diff',
|
||||
'userinfo': '',
|
||||
'userinfo': '',
|
||||
'username': '',
|
||||
'password': '',
|
||||
'params': {},
|
||||
'relative': True
|
||||
},
|
||||
"file:///tmp/example.diff": {
|
||||
'uri': 'file:///tmp/example.diff',
|
||||
'scheme': 'file',
|
||||
'hostname': '',
|
||||
'port': None,
|
||||
'hostport': '',
|
||||
'path': '/tmp/example.diff',
|
||||
'userinfo': '',
|
||||
'userinfo': '',
|
||||
'username': '',
|
||||
'password': '',
|
||||
'params': {},
|
||||
'relative': False
|
||||
},
|
||||
"git:///path/example.git": {
|
||||
'uri': 'git:///path/example.git',
|
||||
'scheme': 'git',
|
||||
'hostname': '',
|
||||
'port': None,
|
||||
'hostport': '',
|
||||
'path': '/path/example.git',
|
||||
'userinfo': '',
|
||||
'userinfo': '',
|
||||
'username': '',
|
||||
'password': '',
|
||||
'params': {},
|
||||
'relative': False
|
||||
},
|
||||
"git:path/example.git": {
|
||||
'uri': 'git:path/example.git',
|
||||
'scheme': 'git',
|
||||
'hostname': '',
|
||||
'port': None,
|
||||
'hostport': '',
|
||||
'path': 'path/example.git',
|
||||
'userinfo': '',
|
||||
'userinfo': '',
|
||||
'username': '',
|
||||
'password': '',
|
||||
'params': {},
|
||||
'relative': True
|
||||
},
|
||||
"git://example.net/path/example.git": {
|
||||
'uri': 'git://example.net/path/example.git',
|
||||
'scheme': 'git',
|
||||
'hostname': 'example.net',
|
||||
'port': None,
|
||||
'hostport': 'example.net',
|
||||
'path': '/path/example.git',
|
||||
'userinfo': '',
|
||||
'userinfo': '',
|
||||
'username': '',
|
||||
'password': '',
|
||||
'params': {},
|
||||
'relative': False
|
||||
}
|
||||
}
|
||||
|
||||
def test_uri(self):
|
||||
for test_uri, ref in self.test_uris.items():
|
||||
uri = URI(test_uri)
|
||||
|
||||
self.assertEqual(str(uri), ref['uri'])
|
||||
|
||||
# expected attributes
|
||||
self.assertEqual(uri.scheme, ref['scheme'])
|
||||
|
||||
self.assertEqual(uri.userinfo, ref['userinfo'])
|
||||
self.assertEqual(uri.username, ref['username'])
|
||||
self.assertEqual(uri.password, ref['password'])
|
||||
|
||||
self.assertEqual(uri.hostname, ref['hostname'])
|
||||
self.assertEqual(uri.port, ref['port'])
|
||||
self.assertEqual(uri.hostport, ref['hostport'])
|
||||
|
||||
self.assertEqual(uri.path, ref['path'])
|
||||
self.assertEqual(uri.params, ref['params'])
|
||||
|
||||
self.assertEqual(uri.relative, ref['relative'])
|
||||
|
||||
def test_dict(self):
|
||||
for test in self.test_uris.values():
|
||||
uri = URI()
|
||||
|
||||
self.assertEqual(uri.scheme, '')
|
||||
self.assertEqual(uri.userinfo, '')
|
||||
self.assertEqual(uri.username, '')
|
||||
self.assertEqual(uri.password, '')
|
||||
self.assertEqual(uri.hostname, '')
|
||||
self.assertEqual(uri.port, None)
|
||||
self.assertEqual(uri.path, '')
|
||||
self.assertEqual(uri.params, {})
|
||||
|
||||
|
||||
uri.scheme = test['scheme']
|
||||
self.assertEqual(uri.scheme, test['scheme'])
|
||||
|
||||
uri.userinfo = test['userinfo']
|
||||
self.assertEqual(uri.userinfo, test['userinfo'])
|
||||
self.assertEqual(uri.username, test['username'])
|
||||
self.assertEqual(uri.password, test['password'])
|
||||
|
||||
uri.hostname = test['hostname']
|
||||
self.assertEqual(uri.hostname, test['hostname'])
|
||||
self.assertEqual(uri.hostport, test['hostname'])
|
||||
|
||||
uri.port = test['port']
|
||||
self.assertEqual(uri.port, test['port'])
|
||||
self.assertEqual(uri.hostport, test['hostport'])
|
||||
|
||||
uri.path = test['path']
|
||||
self.assertEqual(uri.path, test['path'])
|
||||
|
||||
uri.params = test['params']
|
||||
self.assertEqual(uri.params, test['params'])
|
||||
|
||||
self.assertEqual(str(uri)+str(uri.relative), str(test['uri'])+str(test['relative']))
|
||||
|
||||
self.assertEqual(str(uri), test['uri'])
|
||||
|
||||
uri.params = {}
|
||||
self.assertEqual(uri.params, {})
|
||||
self.assertEqual(str(uri), (str(uri).split(";"))[0])
|
||||
|
||||
class FetcherTest(unittest.TestCase):
|
||||
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.tempdir = tempfile.mkdtemp()
|
||||
self.dldir = os.path.join(self.tempdir, "download")
|
||||
os.mkdir(self.dldir)
|
||||
self.d.setVar("DL_DIR", self.dldir)
|
||||
self.unpackdir = os.path.join(self.tempdir, "unpacked")
|
||||
os.mkdir(self.unpackdir)
|
||||
persistdir = os.path.join(self.tempdir, "persistdata")
|
||||
self.d.setVar("PERSISTENT_DIR", persistdir)
|
||||
|
||||
def tearDown(self):
|
||||
bb.utils.prunedir(self.tempdir)
|
||||
|
||||
class MirrorUriTest(FetcherTest):
|
||||
|
||||
replaceuris = {
|
||||
("git://git.invalid.infradead.org/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "http://somewhere.org/somedir/")
|
||||
: "http://somewhere.org/somedir/git2_git.invalid.infradead.org.mtd-utils.git.tar.gz",
|
||||
("git://git.invalid.infradead.org/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/([^/]+/)*([^/]*)", "git://somewhere.org/somedir/\\2;protocol=http")
|
||||
: "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/([^/]+/)*([^/]*)", "git://somewhere.org/somedir/\\2;protocol=http")
|
||||
: "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/([^/]+/)*([^/]*)", "git://somewhere.org/\\2;protocol=http")
|
||||
: "git://somewhere.org/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://someserver.org/bitbake;tag=1234567890123456789012345678901234567890", "git://someserver.org/bitbake", "git://git.openembedded.org/bitbake")
|
||||
: "git://git.openembedded.org/bitbake;tag=1234567890123456789012345678901234567890",
|
||||
("file://sstate-xyz.tgz", "file://.*", "file:///somewhere/1234/sstate-cache")
|
||||
: "file:///somewhere/1234/sstate-cache/sstate-xyz.tgz",
|
||||
("file://sstate-xyz.tgz", "file://.*", "file:///somewhere/1234/sstate-cache/")
|
||||
: "file:///somewhere/1234/sstate-cache/sstate-xyz.tgz",
|
||||
("http://somewhere.org/somedir1/somedir2/somefile_1.2.3.tar.gz", "http://.*/.*", "http://somewhere2.org/somedir3")
|
||||
: "http://somewhere2.org/somedir3/somefile_1.2.3.tar.gz",
|
||||
("http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere2.org/somedir3/somefile_1.2.3.tar.gz")
|
||||
: "http://somewhere2.org/somedir3/somefile_1.2.3.tar.gz",
|
||||
("http://www.apache.org/dist/subversion/subversion-1.7.1.tar.bz2", "http://www.apache.org/dist", "http://archive.apache.org/dist")
|
||||
: "http://archive.apache.org/dist/subversion/subversion-1.7.1.tar.bz2",
|
||||
("http://www.apache.org/dist/subversion/subversion-1.7.1.tar.bz2", "http://.*/.*", "file:///somepath/downloads/")
|
||||
: "file:///somepath/downloads/subversion-1.7.1.tar.bz2",
|
||||
("git://git.invalid.infradead.org/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "git://somewhere.org/somedir/BASENAME;protocol=http")
|
||||
: "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "git://somewhere.org/somedir/BASENAME;protocol=http")
|
||||
: "git://somewhere.org/somedir/mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
("git://git.invalid.infradead.org/foo/mtd-utils.git;tag=1234567890123456789012345678901234567890", "git://.*/.*", "git://somewhere.org/somedir/MIRRORNAME;protocol=http")
|
||||
: "git://somewhere.org/somedir/git.invalid.infradead.org.foo.mtd-utils.git;tag=1234567890123456789012345678901234567890;protocol=http",
|
||||
|
||||
#Renaming files doesn't work
|
||||
#("http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere.org/somedir1/somefile_1.2.3.tar.gz", "http://somewhere2.org/somedir3/somefile_2.3.4.tar.gz") : "http://somewhere2.org/somedir3/somefile_2.3.4.tar.gz"
|
||||
#("file://sstate-xyz.tgz", "file://.*/.*", "file:///somewhere/1234/sstate-cache") : "file:///somewhere/1234/sstate-cache/sstate-xyz.tgz",
|
||||
}
|
||||
|
||||
mirrorvar = "http://.*/.* file:///somepath/downloads/ \n" \
|
||||
"git://someserver.org/bitbake git://git.openembedded.org/bitbake \n" \
|
||||
"https://.*/.* file:///someotherpath/downloads/ \n" \
|
||||
"http://.*/.* file:///someotherpath/downloads/ \n"
|
||||
|
||||
def test_urireplace(self):
|
||||
for k, v in self.replaceuris.items():
|
||||
ud = bb.fetch.FetchData(k[0], self.d)
|
||||
ud.setup_localpath(self.d)
|
||||
mirrors = bb.fetch2.mirror_from_string("%s %s" % (k[1], k[2]))
|
||||
newuris, uds = bb.fetch2.build_mirroruris(ud, mirrors, self.d)
|
||||
self.assertEqual([v], newuris)
|
||||
|
||||
def test_urilist1(self):
|
||||
fetcher = bb.fetch.FetchData("http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", self.d)
|
||||
mirrors = bb.fetch2.mirror_from_string(self.mirrorvar)
|
||||
uris, uds = bb.fetch2.build_mirroruris(fetcher, mirrors, self.d)
|
||||
self.assertEqual(uris, ['file:///somepath/downloads/bitbake-1.0.tar.gz', 'file:///someotherpath/downloads/bitbake-1.0.tar.gz'])
|
||||
|
||||
def test_urilist2(self):
|
||||
# Catch https:// -> files:// bug
|
||||
fetcher = bb.fetch.FetchData("https://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", self.d)
|
||||
mirrors = bb.fetch2.mirror_from_string(self.mirrorvar)
|
||||
uris, uds = bb.fetch2.build_mirroruris(fetcher, mirrors, self.d)
|
||||
self.assertEqual(uris, ['file:///someotherpath/downloads/bitbake-1.0.tar.gz'])
|
||||
|
||||
class FetcherNetworkTest(FetcherTest):
|
||||
|
||||
if os.environ.get("BB_SKIP_NETTESTS") == "yes":
|
||||
print("Unset BB_SKIP_NETTESTS to run network tests")
|
||||
else:
|
||||
def test_fetch(self):
|
||||
fetcher = bb.fetch.Fetch(["http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", "http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.1.tar.gz"], self.d)
|
||||
fetcher.download()
|
||||
self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.0.tar.gz"), 57749)
|
||||
self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.1.tar.gz"), 57892)
|
||||
self.d.setVar("BB_NO_NETWORK", "1")
|
||||
fetcher = bb.fetch.Fetch(["http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz", "http://downloads.yoctoproject.org/releases/bitbake/bitbake-1.1.tar.gz"], self.d)
|
||||
fetcher.download()
|
||||
fetcher.unpack(self.unpackdir)
|
||||
self.assertEqual(len(os.listdir(self.unpackdir + "/bitbake-1.0/")), 9)
|
||||
self.assertEqual(len(os.listdir(self.unpackdir + "/bitbake-1.1/")), 9)
|
||||
|
||||
def test_fetch_mirror(self):
|
||||
self.d.setVar("MIRRORS", "http://.*/.* http://downloads.yoctoproject.org/releases/bitbake")
|
||||
fetcher = bb.fetch.Fetch(["http://invalid.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz"], self.d)
|
||||
fetcher.download()
|
||||
self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.0.tar.gz"), 57749)
|
||||
|
||||
def test_fetch_premirror(self):
|
||||
self.d.setVar("PREMIRRORS", "http://.*/.* http://downloads.yoctoproject.org/releases/bitbake")
|
||||
fetcher = bb.fetch.Fetch(["http://invalid.yoctoproject.org/releases/bitbake/bitbake-1.0.tar.gz"], self.d)
|
||||
fetcher.download()
|
||||
self.assertEqual(os.path.getsize(self.dldir + "/bitbake-1.0.tar.gz"), 57749)
|
||||
|
||||
def gitfetcher(self, url1, url2):
|
||||
def checkrevision(self, fetcher):
|
||||
fetcher.unpack(self.unpackdir)
|
||||
revision = bb.process.run("git rev-parse HEAD", shell=True, cwd=self.unpackdir + "/git")[0].strip()
|
||||
self.assertEqual(revision, "270a05b0b4ba0959fe0624d2a4885d7b70426da5")
|
||||
|
||||
self.d.setVar("BB_GENERATE_MIRROR_TARBALLS", "1")
|
||||
self.d.setVar("SRCREV", "270a05b0b4ba0959fe0624d2a4885d7b70426da5")
|
||||
fetcher = bb.fetch.Fetch([url1], self.d)
|
||||
fetcher.download()
|
||||
checkrevision(self, fetcher)
|
||||
# Wipe out the dldir clone and the unpacked source, turn off the network and check mirror tarball works
|
||||
bb.utils.prunedir(self.dldir + "/git2/")
|
||||
bb.utils.prunedir(self.unpackdir)
|
||||
self.d.setVar("BB_NO_NETWORK", "1")
|
||||
fetcher = bb.fetch.Fetch([url2], self.d)
|
||||
fetcher.download()
|
||||
checkrevision(self, fetcher)
|
||||
|
||||
def test_gitfetch(self):
|
||||
url1 = url2 = "git://git.openembedded.org/bitbake"
|
||||
self.gitfetcher(url1, url2)
|
||||
|
||||
def test_gitfetch_premirror(self):
|
||||
url1 = "git://git.openembedded.org/bitbake"
|
||||
url2 = "git://someserver.org/bitbake"
|
||||
self.d.setVar("PREMIRRORS", "git://someserver.org/bitbake git://git.openembedded.org/bitbake \n")
|
||||
self.gitfetcher(url1, url2)
|
||||
|
||||
def test_gitfetch_premirror2(self):
|
||||
url1 = url2 = "git://someserver.org/bitbake"
|
||||
self.d.setVar("PREMIRRORS", "git://someserver.org/bitbake git://git.openembedded.org/bitbake \n")
|
||||
self.gitfetcher(url1, url2)
|
||||
|
||||
def test_gitfetch_premirror3(self):
|
||||
realurl = "git://git.openembedded.org/bitbake"
|
||||
dummyurl = "git://someserver.org/bitbake"
|
||||
self.sourcedir = self.unpackdir.replace("unpacked", "sourcemirror.git")
|
||||
os.chdir(self.tempdir)
|
||||
bb.process.run("git clone %s %s 2> /dev/null" % (realurl, self.sourcedir), shell=True)
|
||||
self.d.setVar("PREMIRRORS", "%s git://%s;protocol=file \n" % (dummyurl, self.sourcedir))
|
||||
self.gitfetcher(dummyurl, dummyurl)
|
||||
|
||||
class URLHandle(unittest.TestCase):
|
||||
|
||||
datatable = {
|
||||
"http://www.google.com/index.html" : ('http', 'www.google.com', '/index.html', '', '', {}),
|
||||
"cvs://anoncvs@cvs.handhelds.org/cvs;module=familiar/dist/ipkg" : ('cvs', 'cvs.handhelds.org', '/cvs', 'anoncvs', '', {'module': 'familiar/dist/ipkg'}),
|
||||
"cvs://anoncvs:anonymous@cvs.handhelds.org/cvs;tag=V0-99-81;module=familiar/dist/ipkg" : ('cvs', 'cvs.handhelds.org', '/cvs', 'anoncvs', 'anonymous', {'tag': 'V0-99-81', 'module': 'familiar/dist/ipkg'})
|
||||
}
|
||||
|
||||
def test_decodeurl(self):
|
||||
for k, v in self.datatable.items():
|
||||
result = bb.fetch.decodeurl(k)
|
||||
self.assertEqual(result, v)
|
||||
|
||||
def test_encodeurl(self):
|
||||
for k, v in self.datatable.items():
|
||||
result = bb.fetch.encodeurl(v)
|
||||
self.assertEqual(result, k)
|
||||
|
||||
|
||||
|
||||
@@ -1,53 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# BitBake Tests for utils.py
|
||||
#
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import bb
|
||||
|
||||
class VerCmpString(unittest.TestCase):
|
||||
|
||||
def test_vercmpstring(self):
|
||||
result = bb.utils.vercmp_string('1', '2')
|
||||
self.assertTrue(result < 0)
|
||||
result = bb.utils.vercmp_string('2', '1')
|
||||
self.assertTrue(result > 0)
|
||||
result = bb.utils.vercmp_string('1', '1.0')
|
||||
self.assertTrue(result < 0)
|
||||
result = bb.utils.vercmp_string('1', '1.1')
|
||||
self.assertTrue(result < 0)
|
||||
result = bb.utils.vercmp_string('1.1', '1_p2')
|
||||
self.assertTrue(result < 0)
|
||||
|
||||
def test_explode_dep_versions(self):
|
||||
correctresult = {"foo" : ["= 1.10"]}
|
||||
result = bb.utils.explode_dep_versions2("foo (= 1.10)")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo (=1.10)")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo ( = 1.10)")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo ( =1.10)")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo ( = 1.10 )")
|
||||
self.assertEqual(result, correctresult)
|
||||
result = bb.utils.explode_dep_versions2("foo ( =1.10 )")
|
||||
self.assertEqual(result, correctresult)
|
||||
|
||||
@@ -1,96 +0,0 @@
|
||||
# tinfoil: a simple wrapper around cooker for bitbake-based command-line utilities
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
# Copyright (C) 2011 Mentor Graphics Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import logging
|
||||
import warnings
|
||||
import os
|
||||
import sys
|
||||
|
||||
import bb.cache
|
||||
import bb.cooker
|
||||
import bb.providers
|
||||
import bb.utils
|
||||
from bb.cooker import state, BBCooker
|
||||
from bb.cookerdata import CookerConfiguration, ConfigParameters
|
||||
import bb.fetch2
|
||||
|
||||
class Tinfoil:
|
||||
def __init__(self, output=sys.stdout):
|
||||
# Needed to avoid deprecation warnings with python 2.6
|
||||
warnings.filterwarnings("ignore", category=DeprecationWarning)
|
||||
|
||||
# Set up logging
|
||||
self.logger = logging.getLogger('BitBake')
|
||||
console = logging.StreamHandler(output)
|
||||
bb.msg.addDefaultlogFilter(console)
|
||||
format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
|
||||
if output.isatty():
|
||||
format.enable_color()
|
||||
console.setFormatter(format)
|
||||
self.logger.addHandler(console)
|
||||
|
||||
self.config = CookerConfiguration()
|
||||
configparams = TinfoilConfigParameters(parse_only=True)
|
||||
self.config.setConfigParameters(configparams)
|
||||
self.config.setServerRegIdleCallback(self.register_idle_function)
|
||||
self.cooker = BBCooker(self.config)
|
||||
self.config_data = self.cooker.data
|
||||
bb.providers.logger.setLevel(logging.ERROR)
|
||||
self.cooker_data = None
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
pass
|
||||
|
||||
def parseRecipes(self):
|
||||
sys.stderr.write("Parsing recipes..")
|
||||
self.logger.setLevel(logging.WARNING)
|
||||
|
||||
try:
|
||||
while self.cooker.state in (state.initial, state.parsing):
|
||||
self.cooker.updateCache()
|
||||
except KeyboardInterrupt:
|
||||
self.cooker.shutdown()
|
||||
self.cooker.updateCache()
|
||||
sys.exit(2)
|
||||
|
||||
self.logger.setLevel(logging.INFO)
|
||||
sys.stderr.write("done.\n")
|
||||
|
||||
self.cooker_data = self.cooker.recipecache
|
||||
|
||||
def prepare(self, config_only = False):
|
||||
if not self.cooker_data:
|
||||
if config_only:
|
||||
self.cooker.parseConfiguration()
|
||||
self.cooker_data = self.cooker.recipecache
|
||||
else:
|
||||
self.parseRecipes()
|
||||
|
||||
class TinfoilConfigParameters(ConfigParameters):
|
||||
|
||||
def __init__(self, **options):
|
||||
self.initial_options = options
|
||||
super(TinfoilConfigParameters, self).__init__()
|
||||
|
||||
def parseCommandLine(self):
|
||||
class DummyOptions:
|
||||
def __init__(self, initial_options):
|
||||
for key, val in initial_options.items():
|
||||
setattr(self, key, val)
|
||||
|
||||
return DummyOptions(self.initial_options), None
|
||||
@@ -1,436 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import pango
|
||||
import gobject
|
||||
import bb.process
|
||||
from bb.ui.crumbs.progressbar import HobProgressBar
|
||||
from bb.ui.crumbs.hobwidget import hic, HobNotebook, HobAltButton, HobWarpCellRendererText, HobButton, HobInfoButton
|
||||
from bb.ui.crumbs.runningbuild import RunningBuildTreeView
|
||||
from bb.ui.crumbs.runningbuild import BuildFailureTreeView
|
||||
from bb.ui.crumbs.hobpages import HobPage
|
||||
from bb.ui.crumbs.hobcolor import HobColors
|
||||
|
||||
class BuildConfigurationTreeView(gtk.TreeView):
|
||||
def __init__ (self):
|
||||
gtk.TreeView.__init__(self)
|
||||
self.set_rules_hint(False)
|
||||
self.set_headers_visible(False)
|
||||
self.set_property("hover-expand", True)
|
||||
self.get_selection().set_mode(gtk.SELECTION_SINGLE)
|
||||
|
||||
# The icon that indicates whether we're building or failed.
|
||||
renderer0 = gtk.CellRendererText()
|
||||
renderer0.set_property('font-desc', pango.FontDescription('courier bold 12'))
|
||||
col0 = gtk.TreeViewColumn ("Name", renderer0, text=0)
|
||||
self.append_column (col0)
|
||||
|
||||
# The message of configuration.
|
||||
renderer1 = HobWarpCellRendererText(col_number=1)
|
||||
col1 = gtk.TreeViewColumn ("Values", renderer1, text=1)
|
||||
self.append_column (col1)
|
||||
|
||||
def set_vars(self, key="", var=[""]):
|
||||
d = {}
|
||||
if type(var) == str:
|
||||
d = {key: [var]}
|
||||
elif type(var) == list and len(var) > 1:
|
||||
#create the sub item line
|
||||
l = []
|
||||
text = ""
|
||||
for item in var:
|
||||
text = " - " + item
|
||||
l.append(text)
|
||||
d = {key: var}
|
||||
|
||||
return d
|
||||
|
||||
def set_config_model(self, show_vars):
|
||||
listmodel = gtk.TreeStore(gobject.TYPE_STRING, gobject.TYPE_STRING)
|
||||
parent = None
|
||||
for var in show_vars:
|
||||
for subitem in var.items():
|
||||
name = subitem[0]
|
||||
is_parent = True
|
||||
for value in subitem[1]:
|
||||
if is_parent:
|
||||
parent = listmodel.append(parent, (name, value))
|
||||
is_parent = False
|
||||
else:
|
||||
listmodel.append(parent, (None, value))
|
||||
name = " - "
|
||||
parent = None
|
||||
# renew the tree model after get the configuration messages
|
||||
self.set_model(listmodel)
|
||||
|
||||
def show(self, src_config_info, src_params):
|
||||
vars = []
|
||||
vars.append(self.set_vars("BB version:", src_params.bb_version))
|
||||
vars.append(self.set_vars("Target arch:", src_params.target_arch))
|
||||
vars.append(self.set_vars("Target OS:", src_params.target_os))
|
||||
vars.append(self.set_vars("Machine:", src_config_info.curr_mach))
|
||||
vars.append(self.set_vars("Distro:", src_config_info.curr_distro))
|
||||
vars.append(self.set_vars("Distro version:", src_params.distro_version))
|
||||
vars.append(self.set_vars("SDK machine:", src_config_info.curr_sdk_machine))
|
||||
vars.append(self.set_vars("Tune features:", src_params.tune_pkgarch))
|
||||
vars.append(self.set_vars("Layers:", src_config_info.layers))
|
||||
|
||||
for path in src_config_info.layers:
|
||||
import os, os.path
|
||||
if os.path.exists(path):
|
||||
branch = bb.process.run('cd %s; git branch | grep "^* " | tr -d "* "' % path)[0]
|
||||
if branch.startswith("fatal:"):
|
||||
branch = "(unknown)"
|
||||
if branch:
|
||||
branch = branch.strip('\n')
|
||||
vars.append(self.set_vars("Branch:", branch))
|
||||
break
|
||||
|
||||
self.set_config_model(vars)
|
||||
|
||||
def reset(self):
|
||||
self.set_model(None)
|
||||
|
||||
#
|
||||
# BuildDetailsPage
|
||||
#
|
||||
|
||||
class BuildDetailsPage (HobPage):
|
||||
|
||||
def __init__(self, builder):
|
||||
super(BuildDetailsPage, self).__init__(builder, "Building ...")
|
||||
|
||||
self.num_of_issues = 0
|
||||
self.endpath = (0,)
|
||||
# create visual elements
|
||||
self.create_visual_elements()
|
||||
|
||||
def create_visual_elements(self):
|
||||
# create visual elements
|
||||
self.vbox = gtk.VBox(False, 12)
|
||||
|
||||
self.progress_box = gtk.VBox(False, 12)
|
||||
self.task_status = gtk.Label("\n") # to ensure layout is correct
|
||||
self.task_status.set_alignment(0.0, 0.5)
|
||||
self.progress_box.pack_start(self.task_status, expand=False, fill=False)
|
||||
self.progress_hbox = gtk.HBox(False, 6)
|
||||
self.progress_box.pack_end(self.progress_hbox, expand=True, fill=True)
|
||||
self.progress_bar = HobProgressBar()
|
||||
self.progress_hbox.pack_start(self.progress_bar, expand=True, fill=True)
|
||||
self.stop_button = HobAltButton("Stop")
|
||||
self.stop_button.connect("clicked", self.stop_button_clicked_cb)
|
||||
self.stop_button.set_sensitive(False)
|
||||
self.progress_hbox.pack_end(self.stop_button, expand=False, fill=False)
|
||||
|
||||
self.notebook = HobNotebook()
|
||||
self.config_tv = BuildConfigurationTreeView()
|
||||
self.scrolled_view_config = gtk.ScrolledWindow ()
|
||||
self.scrolled_view_config.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
|
||||
self.scrolled_view_config.add(self.config_tv)
|
||||
self.notebook.append_page(self.scrolled_view_config, "Build configuration")
|
||||
|
||||
self.failure_tv = BuildFailureTreeView()
|
||||
self.failure_model = self.builder.handler.build.model.failure_model()
|
||||
self.failure_tv.set_model(self.failure_model)
|
||||
self.scrolled_view_failure = gtk.ScrolledWindow ()
|
||||
self.scrolled_view_failure.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
|
||||
self.scrolled_view_failure.add(self.failure_tv)
|
||||
self.notebook.append_page(self.scrolled_view_failure, "Issues")
|
||||
|
||||
self.build_tv = RunningBuildTreeView(readonly=True, hob=True)
|
||||
self.build_tv.set_model(self.builder.handler.build.model)
|
||||
self.scrolled_view_build = gtk.ScrolledWindow ()
|
||||
self.scrolled_view_build.set_policy(gtk.POLICY_NEVER, gtk.POLICY_ALWAYS)
|
||||
self.scrolled_view_build.add(self.build_tv)
|
||||
self.notebook.append_page(self.scrolled_view_build, "Log")
|
||||
|
||||
self.builder.handler.build.model.connect_after("row-changed", self.scroll_to_present_row, self.scrolled_view_build.get_vadjustment(), self.build_tv)
|
||||
|
||||
self.button_box = gtk.HBox(False, 6)
|
||||
self.back_button = HobAltButton('<< Back')
|
||||
self.back_button.connect("clicked", self.back_button_clicked_cb)
|
||||
self.button_box.pack_start(self.back_button, expand=False, fill=False)
|
||||
|
||||
def update_build_status(self, current, total, task):
|
||||
recipe_path, recipe_task = task.split(", ")
|
||||
recipe = os.path.basename(recipe_path).rstrip(".bb")
|
||||
tsk_msg = "<b>Running task %s of %s:</b> %s\n<b>Recipe:</b> %s" % (current, total, recipe_task, recipe)
|
||||
self.task_status.set_markup(tsk_msg)
|
||||
self.stop_button.set_sensitive(True)
|
||||
|
||||
def reset_build_status(self):
|
||||
self.task_status.set_markup("\n") # to ensure layout is correct
|
||||
self.endpath = (0,)
|
||||
|
||||
def show_issues(self):
|
||||
self.num_of_issues += 1
|
||||
self.notebook.show_indicator_icon("Issues", self.num_of_issues)
|
||||
|
||||
def reset_issues(self):
|
||||
self.num_of_issues = 0
|
||||
self.notebook.hide_indicator_icon("Issues")
|
||||
|
||||
def _remove_all_widget(self):
|
||||
children = self.vbox.get_children() or []
|
||||
for child in children:
|
||||
self.vbox.remove(child)
|
||||
children = self.box_group_area.get_children() or []
|
||||
for child in children:
|
||||
self.box_group_area.remove(child)
|
||||
children = self.get_children() or []
|
||||
for child in children:
|
||||
self.remove(child)
|
||||
|
||||
def add_build_fail_top_bar(self, actions, log_file=None):
|
||||
primary_action = "Edit %s" % actions
|
||||
|
||||
color = HobColors.ERROR
|
||||
build_fail_top = gtk.EventBox()
|
||||
#build_fail_top.set_size_request(-1, 200)
|
||||
build_fail_top.modify_bg(gtk.STATE_NORMAL, gtk.gdk.color_parse(color))
|
||||
|
||||
build_fail_tab = gtk.Table(14, 46, True)
|
||||
build_fail_top.add(build_fail_tab)
|
||||
|
||||
icon = gtk.Image()
|
||||
icon_pix_buffer = gtk.gdk.pixbuf_new_from_file(hic.ICON_INDI_ERROR_FILE)
|
||||
icon.set_from_pixbuf(icon_pix_buffer)
|
||||
build_fail_tab.attach(icon, 1, 4, 0, 6)
|
||||
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
label.set_markup("<span size='x-large'><b>%s</b></span>" % self.title)
|
||||
build_fail_tab.attach(label, 4, 26, 0, 6)
|
||||
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
# Ensure variable disk_full is defined
|
||||
if not hasattr(self.builder, 'disk_full'):
|
||||
self.builder.disk_full = False
|
||||
|
||||
if self.builder.disk_full:
|
||||
markup = "<span size='medium'>There is no disk space left, so Hob cannot finish building your image. Free up some disk space\n"
|
||||
markup += "and restart the build. Check the \"Issues\" tab for more details</span>"
|
||||
label.set_markup(markup)
|
||||
else:
|
||||
label.set_markup("<span size='medium'>Check the \"Issues\" information for more details</span>")
|
||||
build_fail_tab.attach(label, 4, 40, 4, 9)
|
||||
|
||||
# create button 'Edit packages'
|
||||
action_button = HobButton(primary_action)
|
||||
#action_button.set_size_request(-1, 40)
|
||||
action_button.set_tooltip_text("Edit the %s parameters" % actions)
|
||||
action_button.connect('clicked', self.failure_primary_action_button_clicked_cb, primary_action)
|
||||
|
||||
if log_file:
|
||||
open_log_button = HobAltButton("Open log")
|
||||
open_log_button.set_relief(gtk.RELIEF_HALF)
|
||||
open_log_button.set_tooltip_text("Open the build's log file")
|
||||
open_log_button.connect('clicked', self.open_log_button_clicked_cb, log_file)
|
||||
|
||||
attach_pos = (24 if log_file else 14)
|
||||
file_bug_button = HobAltButton('File a bug')
|
||||
file_bug_button.set_relief(gtk.RELIEF_HALF)
|
||||
file_bug_button.set_tooltip_text("Open the Yocto Project bug tracking website")
|
||||
file_bug_button.connect('clicked', self.failure_activate_file_bug_link_cb)
|
||||
|
||||
if not self.builder.disk_full:
|
||||
build_fail_tab.attach(action_button, 4, 13, 9, 12)
|
||||
if log_file:
|
||||
build_fail_tab.attach(open_log_button, 14, 23, 9, 12)
|
||||
build_fail_tab.attach(file_bug_button, attach_pos, attach_pos + 9, 9, 12)
|
||||
|
||||
else:
|
||||
restart_build = HobButton("Restart the build")
|
||||
restart_build.set_tooltip_text("Restart the build")
|
||||
restart_build.connect('clicked', self.restart_build_button_clicked_cb)
|
||||
|
||||
build_fail_tab.attach(restart_build, 4, 13, 9, 12)
|
||||
build_fail_tab.attach(action_button, 14, 23, 9, 12)
|
||||
if log_file:
|
||||
build_fail_tab.attach(open_log_button, attach_pos, attach_pos + 9, 9, 12)
|
||||
|
||||
self.builder.disk_full = False
|
||||
return build_fail_top
|
||||
|
||||
def show_fail_page(self, title):
|
||||
self._remove_all_widget()
|
||||
self.title = "Hob cannot build your %s" % title
|
||||
|
||||
self.build_fail_bar = self.add_build_fail_top_bar(title, self.builder.current_logfile)
|
||||
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
self.box_group_area.pack_start(self.build_fail_bar, expand=False, fill=False)
|
||||
self.box_group_area.pack_start(self.vbox, expand=True, fill=True)
|
||||
|
||||
self.vbox.pack_start(self.notebook, expand=True, fill=True)
|
||||
self.show_all()
|
||||
self.notebook.set_page("Issues")
|
||||
self.back_button.hide()
|
||||
|
||||
def add_build_stop_top_bar(self, action, log_file=None):
|
||||
color = HobColors.LIGHT_GRAY
|
||||
build_stop_top = gtk.EventBox()
|
||||
#build_stop_top.set_size_request(-1, 200)
|
||||
build_stop_top.modify_bg(gtk.STATE_NORMAL, gtk.gdk.color_parse(color))
|
||||
build_stop_top.set_flags(gtk.CAN_DEFAULT)
|
||||
build_stop_top.grab_default()
|
||||
|
||||
build_stop_tab = gtk.Table(11, 46, True)
|
||||
build_stop_top.add(build_stop_tab)
|
||||
|
||||
icon = gtk.Image()
|
||||
icon_pix_buffer = gtk.gdk.pixbuf_new_from_file(hic.ICON_INFO_HOVER_FILE)
|
||||
icon.set_from_pixbuf(icon_pix_buffer)
|
||||
build_stop_tab.attach(icon, 1, 4, 0, 6)
|
||||
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
label.set_markup("<span size='x-large'><b>%s</b></span>" % self.title)
|
||||
build_stop_tab.attach(label, 4, 26, 0, 6)
|
||||
|
||||
action_button = HobButton("Edit %s" % action)
|
||||
action_button.set_size_request(-1, 40)
|
||||
if action == "image":
|
||||
action_button.set_tooltip_text("Edit the image parameters")
|
||||
elif action == "recipes":
|
||||
action_button.set_tooltip_text("Edit the included recipes")
|
||||
elif action == "packages":
|
||||
action_button.set_tooltip_text("Edit the included packages")
|
||||
action_button.connect('clicked', self.stop_primary_action_button_clicked_cb, action)
|
||||
build_stop_tab.attach(action_button, 4, 13, 6, 9)
|
||||
|
||||
if log_file:
|
||||
open_log_button = HobAltButton("Open log")
|
||||
open_log_button.set_relief(gtk.RELIEF_HALF)
|
||||
open_log_button.set_tooltip_text("Open the build's log file")
|
||||
open_log_button.connect('clicked', self.open_log_button_clicked_cb, log_file)
|
||||
build_stop_tab.attach(open_log_button, 14, 23, 6, 9)
|
||||
|
||||
attach_pos = (24 if log_file else 14)
|
||||
build_button = HobAltButton("Build new image")
|
||||
#build_button.set_size_request(-1, 40)
|
||||
build_button.set_tooltip_text("Create a new image from scratch")
|
||||
build_button.connect('clicked', self.new_image_button_clicked_cb)
|
||||
build_stop_tab.attach(build_button, attach_pos, attach_pos + 9, 6, 9)
|
||||
|
||||
return build_stop_top, action_button
|
||||
|
||||
def show_stop_page(self, action):
|
||||
self._remove_all_widget()
|
||||
self.title = "Build stopped"
|
||||
self.build_stop_bar, action_button = self.add_build_stop_top_bar(action, self.builder.current_logfile)
|
||||
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
self.box_group_area.pack_start(self.build_stop_bar, expand=False, fill=False)
|
||||
self.box_group_area.pack_start(self.vbox, expand=True, fill=True)
|
||||
|
||||
self.vbox.pack_start(self.notebook, expand=True, fill=True)
|
||||
self.show_all()
|
||||
self.back_button.hide()
|
||||
return action_button
|
||||
|
||||
def show_page(self, step):
|
||||
self._remove_all_widget()
|
||||
if step == self.builder.PACKAGE_GENERATING or step == self.builder.FAST_IMAGE_GENERATING:
|
||||
self.title = "Building packages ..."
|
||||
else:
|
||||
self.title = "Building image ..."
|
||||
self.build_details_top = self.add_onto_top_bar(None)
|
||||
self.pack_start(self.build_details_top, expand=False, fill=False)
|
||||
self.pack_start(self.group_align, expand=True, fill=True)
|
||||
|
||||
self.box_group_area.pack_start(self.vbox, expand=True, fill=True)
|
||||
|
||||
self.progress_bar.reset()
|
||||
self.config_tv.reset()
|
||||
self.vbox.pack_start(self.progress_box, expand=False, fill=False)
|
||||
|
||||
self.vbox.pack_start(self.notebook, expand=True, fill=True)
|
||||
|
||||
self.box_group_area.pack_end(self.button_box, expand=False, fill=False)
|
||||
self.show_all()
|
||||
self.notebook.set_page("Log")
|
||||
self.back_button.hide()
|
||||
|
||||
self.reset_build_status()
|
||||
self.reset_issues()
|
||||
|
||||
def update_progress_bar(self, title, fraction, status=None):
|
||||
self.progress_bar.update(fraction)
|
||||
self.progress_bar.set_title(title)
|
||||
self.progress_bar.set_rcstyle(status)
|
||||
|
||||
def back_button_clicked_cb(self, button):
|
||||
self.builder.show_configuration()
|
||||
|
||||
def new_image_button_clicked_cb(self, button):
|
||||
self.builder.reset()
|
||||
|
||||
def show_back_button(self):
|
||||
self.back_button.show()
|
||||
|
||||
def stop_button_clicked_cb(self, button):
|
||||
self.builder.stop_build()
|
||||
|
||||
def hide_stop_button(self):
|
||||
self.stop_button.set_sensitive(False)
|
||||
self.stop_button.hide()
|
||||
|
||||
def scroll_to_present_row(self, model, path, iter, v_adj, treeview):
|
||||
if treeview and v_adj:
|
||||
if path[0] > self.endpath[0]: # check the event is a new row append or not
|
||||
self.endpath = path
|
||||
# check the gtk.adjustment position is at end boundary or not
|
||||
if (v_adj.upper <= v_adj.page_size) or (v_adj.value == v_adj.upper - v_adj.page_size):
|
||||
treeview.scroll_to_cell(path)
|
||||
|
||||
def show_configurations(self, configurations, params):
|
||||
self.config_tv.show(configurations, params)
|
||||
|
||||
def failure_primary_action_button_clicked_cb(self, button, action):
|
||||
if "Edit recipes" in action:
|
||||
self.builder.show_recipes()
|
||||
elif "Edit packages" in action:
|
||||
self.builder.show_packages()
|
||||
elif "Edit image" in action:
|
||||
self.builder.show_configuration()
|
||||
|
||||
def restart_build_button_clicked_cb(self, button):
|
||||
self.builder.just_bake()
|
||||
|
||||
def stop_primary_action_button_clicked_cb(self, button, action):
|
||||
if "recipes" in action:
|
||||
self.builder.show_recipes()
|
||||
elif "packages" in action:
|
||||
self.builder.show_packages(ask=False)
|
||||
elif "image" in action:
|
||||
self.builder.show_configuration()
|
||||
|
||||
def open_log_button_clicked_cb(self, button, log_file):
|
||||
if log_file:
|
||||
log_file = "file:///" + log_file
|
||||
gtk.show_uri(screen=button.get_screen(), uri=log_file, timestamp=0)
|
||||
|
||||
def failure_activate_file_bug_link_cb(self, button):
|
||||
button.child.emit('activate-link', "http://bugzilla.yoctoproject.org")
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,337 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2012 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import hashlib
|
||||
from bb.ui.crumbs.hobwidget import HobInfoButton, HobButton
|
||||
from bb.ui.crumbs.progressbar import HobProgressBar
|
||||
from bb.ui.crumbs.hig.settingsuihelper import SettingsUIHelper
|
||||
from bb.ui.crumbs.hig.crumbsdialog import CrumbsDialog
|
||||
from bb.ui.crumbs.hig.crumbsmessagedialog import CrumbsMessageDialog
|
||||
from bb.ui.crumbs.hig.proxydetailsdialog import ProxyDetailsDialog
|
||||
|
||||
"""
|
||||
The following are convenience classes for implementing GNOME HIG compliant
|
||||
BitBake GUI's
|
||||
In summary: spacing = 12px, border-width = 6px
|
||||
"""
|
||||
|
||||
class AdvancedSettingsDialog (CrumbsDialog, SettingsUIHelper):
|
||||
|
||||
def details_cb(self, button, parent, protocol):
|
||||
dialog = ProxyDetailsDialog(title = protocol.upper() + " Proxy Details",
|
||||
user = self.configuration.proxies[protocol][1],
|
||||
passwd = self.configuration.proxies[protocol][2],
|
||||
parent = parent,
|
||||
flags = gtk.DIALOG_MODAL
|
||||
| gtk.DIALOG_DESTROY_WITH_PARENT
|
||||
| gtk.DIALOG_NO_SEPARATOR)
|
||||
dialog.add_button(gtk.STOCK_CLOSE, gtk.RESPONSE_OK)
|
||||
response = dialog.run()
|
||||
if response == gtk.RESPONSE_OK:
|
||||
self.configuration.proxies[protocol][1] = dialog.user
|
||||
self.configuration.proxies[protocol][2] = dialog.passwd
|
||||
self.refresh_proxy_components()
|
||||
dialog.destroy()
|
||||
|
||||
def set_save_button(self, button):
|
||||
self.save_button = button
|
||||
|
||||
def rootfs_combo_changed_cb(self, rootfs_combo, all_package_format, check_hbox):
|
||||
combo_item = self.rootfs_combo.get_active_text()
|
||||
modified = False
|
||||
for child in check_hbox.get_children():
|
||||
if isinstance(child, gtk.CheckButton):
|
||||
check_hbox.remove(child)
|
||||
modified = True
|
||||
for format in all_package_format:
|
||||
if format != combo_item:
|
||||
check_button = gtk.CheckButton(format)
|
||||
check_hbox.pack_start(check_button, expand=False, fill=False)
|
||||
modified = True
|
||||
if modified:
|
||||
check_hbox.remove(self.pkgfmt_info)
|
||||
check_hbox.pack_start(self.pkgfmt_info, expand=False, fill=False)
|
||||
check_hbox.show_all()
|
||||
|
||||
def gen_pkgfmt_widget(self, curr_package_format, all_package_format, tooltip_combo="", tooltip_extra=""):
|
||||
pkgfmt_vbox = gtk.VBox(False, 6)
|
||||
|
||||
label = self.gen_label_widget("Root file system package format")
|
||||
pkgfmt_vbox.pack_start(label, expand=False, fill=False)
|
||||
|
||||
rootfs_format = ""
|
||||
if curr_package_format:
|
||||
rootfs_format = curr_package_format.split()[0]
|
||||
|
||||
rootfs_format_widget, rootfs_combo = self.gen_combo_widget(rootfs_format, all_package_format, tooltip_combo)
|
||||
pkgfmt_vbox.pack_start(rootfs_format_widget, expand=False, fill=False)
|
||||
|
||||
label = self.gen_label_widget("Additional package formats")
|
||||
pkgfmt_vbox.pack_start(label, expand=False, fill=False)
|
||||
|
||||
check_hbox = gtk.HBox(False, 12)
|
||||
pkgfmt_vbox.pack_start(check_hbox, expand=False, fill=False)
|
||||
for format in all_package_format:
|
||||
if format != rootfs_format:
|
||||
check_button = gtk.CheckButton(format)
|
||||
is_active = (format in curr_package_format.split())
|
||||
check_button.set_active(is_active)
|
||||
check_hbox.pack_start(check_button, expand=False, fill=False)
|
||||
|
||||
self.pkgfmt_info = HobInfoButton(tooltip_extra, self)
|
||||
check_hbox.pack_start(self.pkgfmt_info, expand=False, fill=False)
|
||||
|
||||
rootfs_combo.connect("changed", self.rootfs_combo_changed_cb, all_package_format, check_hbox)
|
||||
|
||||
pkgfmt_vbox.show_all()
|
||||
|
||||
return pkgfmt_vbox, rootfs_combo, check_hbox
|
||||
|
||||
def __init__(self, title, configuration, all_image_types,
|
||||
all_package_formats, all_distros, all_sdk_machines,
|
||||
max_threads, parent, flags, buttons=None):
|
||||
super(AdvancedSettingsDialog, self).__init__(title, parent, flags, buttons)
|
||||
|
||||
# class members from other objects
|
||||
# bitbake settings from Builder.Configuration
|
||||
self.configuration = configuration
|
||||
self.image_types = all_image_types
|
||||
self.all_package_formats = all_package_formats
|
||||
self.all_distros = all_distros[:]
|
||||
self.all_sdk_machines = all_sdk_machines
|
||||
self.max_threads = max_threads
|
||||
|
||||
# class members for internal use
|
||||
self.distro_combo = None
|
||||
self.dldir_text = None
|
||||
self.sstatedir_text = None
|
||||
self.sstatemirror_text = None
|
||||
self.bb_spinner = None
|
||||
self.pmake_spinner = None
|
||||
self.rootfs_size_spinner = None
|
||||
self.extra_size_spinner = None
|
||||
self.gplv3_checkbox = None
|
||||
self.sdk_checkbox = None
|
||||
self.image_types_checkbuttons = {}
|
||||
|
||||
self.md5 = self.config_md5()
|
||||
self.settings_changed = False
|
||||
|
||||
# create visual elements on the dialog
|
||||
self.save_button = None
|
||||
self.create_visual_elements()
|
||||
self.connect("response", self.response_cb)
|
||||
|
||||
def _get_sorted_value(self, var):
|
||||
return " ".join(sorted(str(var).split())) + "\n"
|
||||
|
||||
def config_md5(self):
|
||||
data = ""
|
||||
data += ("PACKAGE_CLASSES: " + self.configuration.curr_package_format + '\n')
|
||||
data += ("DISTRO: " + self._get_sorted_value(self.configuration.curr_distro))
|
||||
data += ("IMAGE_ROOTFS_SIZE: " + self._get_sorted_value(self.configuration.image_rootfs_size))
|
||||
data += ("IMAGE_EXTRA_SIZE: " + self._get_sorted_value(self.configuration.image_extra_size))
|
||||
data += ("INCOMPATIBLE_LICENSE: " + self._get_sorted_value(self.configuration.incompat_license))
|
||||
data += ("SDK_MACHINE: " + self._get_sorted_value(self.configuration.curr_sdk_machine))
|
||||
data += ("TOOLCHAIN_BUILD: " + self._get_sorted_value(self.configuration.toolchain_build))
|
||||
data += ("IMAGE_FSTYPES: " + self._get_sorted_value(self.configuration.image_fstypes))
|
||||
return hashlib.md5(data).hexdigest()
|
||||
|
||||
def create_visual_elements(self):
|
||||
self.nb = gtk.Notebook()
|
||||
self.nb.set_show_tabs(True)
|
||||
self.nb.append_page(self.create_image_types_page(), gtk.Label("Image types"))
|
||||
self.nb.append_page(self.create_output_page(), gtk.Label("Output"))
|
||||
self.nb.set_current_page(0)
|
||||
self.vbox.pack_start(self.nb, expand=True, fill=True)
|
||||
self.vbox.pack_end(gtk.HSeparator(), expand=True, fill=True)
|
||||
|
||||
self.show_all()
|
||||
|
||||
def get_num_checked_image_types(self):
|
||||
total = 0
|
||||
for b in self.image_types_checkbuttons.values():
|
||||
if b.get_active():
|
||||
total = total + 1
|
||||
return total
|
||||
|
||||
def set_save_button_state(self):
|
||||
if self.save_button:
|
||||
self.save_button.set_sensitive(self.get_num_checked_image_types() > 0)
|
||||
|
||||
def image_type_checkbutton_clicked_cb(self, button):
|
||||
self.set_save_button_state()
|
||||
if self.get_num_checked_image_types() == 0:
|
||||
# Show an error dialog
|
||||
lbl = "<b>Select an image type</b>\n\nYou need to select at least one image type."
|
||||
dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_WARNING)
|
||||
button = dialog.add_button("OK", gtk.RESPONSE_OK)
|
||||
HobButton.style_button(button)
|
||||
response = dialog.run()
|
||||
dialog.destroy()
|
||||
|
||||
def create_image_types_page(self):
|
||||
main_vbox = gtk.VBox(False, 16)
|
||||
main_vbox.set_border_width(6)
|
||||
|
||||
advanced_vbox = gtk.VBox(False, 6)
|
||||
advanced_vbox.set_border_width(6)
|
||||
|
||||
distro_vbox = gtk.VBox(False, 6)
|
||||
label = self.gen_label_widget("Distro:")
|
||||
tooltip = "Selects the Yocto Project distribution you want"
|
||||
try:
|
||||
i = self.all_distros.index( "defaultsetup" )
|
||||
except ValueError:
|
||||
i = -1
|
||||
if i != -1:
|
||||
self.all_distros[ i ] = "Default"
|
||||
if self.configuration.curr_distro == "defaultsetup":
|
||||
self.configuration.curr_distro = "Default"
|
||||
distro_widget, self.distro_combo = self.gen_combo_widget(self.configuration.curr_distro, self.all_distros,"<b>Distro</b>" + "*" + tooltip)
|
||||
distro_vbox.pack_start(label, expand=False, fill=False)
|
||||
distro_vbox.pack_start(distro_widget, expand=False, fill=False)
|
||||
main_vbox.pack_start(distro_vbox, expand=False, fill=False)
|
||||
|
||||
|
||||
rows = (len(self.image_types)+1)/3
|
||||
table = gtk.Table(rows + 1, 10, True)
|
||||
advanced_vbox.pack_start(table, expand=False, fill=False)
|
||||
|
||||
tooltip = "Image file system types you want."
|
||||
info = HobInfoButton("<b>Image types</b>" + "*" + tooltip, self)
|
||||
label = self.gen_label_widget("Image types:")
|
||||
align = gtk.Alignment(0, 0.5, 0, 0)
|
||||
table.attach(align, 0, 4, 0, 1)
|
||||
align.add(label)
|
||||
table.attach(info, 4, 5, 0, 1)
|
||||
|
||||
i = 1
|
||||
j = 1
|
||||
for image_type in sorted(self.image_types):
|
||||
self.image_types_checkbuttons[image_type] = gtk.CheckButton(image_type)
|
||||
self.image_types_checkbuttons[image_type].connect("toggled", self.image_type_checkbutton_clicked_cb)
|
||||
article = ""
|
||||
if image_type.startswith(("a", "e", "i", "o", "u")):
|
||||
article = "n"
|
||||
self.image_types_checkbuttons[image_type].set_tooltip_text("Build a%s %s image" % (article, image_type))
|
||||
table.attach(self.image_types_checkbuttons[image_type], j - 1, j + 3, i, i + 1)
|
||||
if image_type in self.configuration.image_fstypes.split():
|
||||
self.image_types_checkbuttons[image_type].set_active(True)
|
||||
i += 1
|
||||
if i > rows:
|
||||
i = 1
|
||||
j = j + 4
|
||||
|
||||
main_vbox.pack_start(advanced_vbox, expand=False, fill=False)
|
||||
self.set_save_button_state()
|
||||
|
||||
return main_vbox
|
||||
|
||||
def create_output_page(self):
|
||||
advanced_vbox = gtk.VBox(False, 6)
|
||||
advanced_vbox.set_border_width(6)
|
||||
|
||||
advanced_vbox.pack_start(self.gen_label_widget('<span weight="bold">Package format</span>'), expand=False, fill=False)
|
||||
sub_vbox = gtk.VBox(False, 6)
|
||||
advanced_vbox.pack_start(sub_vbox, expand=False, fill=False)
|
||||
tooltip_combo = "Selects the package format used to generate rootfs."
|
||||
tooltip_extra = "Selects extra package formats to build"
|
||||
pkgfmt_widget, self.rootfs_combo, self.check_hbox = self.gen_pkgfmt_widget(self.configuration.curr_package_format, self.all_package_formats,"<b>Root file system package format</b>" + "*" + tooltip_combo,"<b>Additional package formats</b>" + "*" + tooltip_extra)
|
||||
sub_vbox.pack_start(pkgfmt_widget, expand=False, fill=False)
|
||||
|
||||
advanced_vbox.pack_start(self.gen_label_widget('<span weight="bold">Image size</span>'), expand=False, fill=False)
|
||||
sub_vbox = gtk.VBox(False, 6)
|
||||
advanced_vbox.pack_start(sub_vbox, expand=False, fill=False)
|
||||
label = self.gen_label_widget("Image basic size (in MB)")
|
||||
tooltip = "Defines the size for the generated image. The OpenEmbedded build system determines the final size for the generated image using an algorithm that takes into account the initial disk space used for the generated image, the Image basic size value, and the Additional free space value.\n\nFor more information, check the <a href=\"http://www.yoctoproject.org/docs/current/poky-ref-manual/poky-ref-manual.html#var-IMAGE_ROOTFS_SIZE\">Yocto Project Reference Manual</a>."
|
||||
rootfs_size_widget, self.rootfs_size_spinner = self.gen_spinner_widget(int(self.configuration.image_rootfs_size*1.0/1024), 0, 65536,"<b>Image basic size</b>" + "*" + tooltip)
|
||||
sub_vbox.pack_start(label, expand=False, fill=False)
|
||||
sub_vbox.pack_start(rootfs_size_widget, expand=False, fill=False)
|
||||
|
||||
sub_vbox = gtk.VBox(False, 6)
|
||||
advanced_vbox.pack_start(sub_vbox, expand=False, fill=False)
|
||||
label = self.gen_label_widget("Additional free space (in MB)")
|
||||
tooltip = "Sets extra free disk space to be added to the generated image. Use this variable when you want to ensure that a specific amount of free disk space is available on a device after an image is installed and running."
|
||||
extra_size_widget, self.extra_size_spinner = self.gen_spinner_widget(int(self.configuration.image_extra_size*1.0/1024), 0, 65536,"<b>Additional free space</b>" + "*" + tooltip)
|
||||
sub_vbox.pack_start(label, expand=False, fill=False)
|
||||
sub_vbox.pack_start(extra_size_widget, expand=False, fill=False)
|
||||
|
||||
advanced_vbox.pack_start(self.gen_label_widget('<span weight="bold">Licensing</span>'), expand=False, fill=False)
|
||||
self.gplv3_checkbox = gtk.CheckButton("Exclude GPLv3 packages")
|
||||
self.gplv3_checkbox.set_tooltip_text("Check this box to prevent GPLv3 packages from being included in your image")
|
||||
if "GPLv3" in self.configuration.incompat_license.split():
|
||||
self.gplv3_checkbox.set_active(True)
|
||||
else:
|
||||
self.gplv3_checkbox.set_active(False)
|
||||
advanced_vbox.pack_start(self.gplv3_checkbox, expand=False, fill=False)
|
||||
|
||||
advanced_vbox.pack_start(self.gen_label_widget('<span weight="bold">SDK</span>'), expand=False, fill=False)
|
||||
sub_hbox = gtk.HBox(False, 6)
|
||||
advanced_vbox.pack_start(sub_hbox, expand=False, fill=False)
|
||||
self.sdk_checkbox = gtk.CheckButton("Populate SDK")
|
||||
tooltip = "Check this box to generate an SDK tarball that consists of the cross-toolchain and a sysroot that contains development packages for your image."
|
||||
self.sdk_checkbox.set_tooltip_text(tooltip)
|
||||
self.sdk_checkbox.set_active(self.configuration.toolchain_build)
|
||||
sub_hbox.pack_start(self.sdk_checkbox, expand=False, fill=False)
|
||||
|
||||
tooltip = "Select the host platform for which you want to run the toolchain contained in the SDK tarball."
|
||||
sdk_machine_widget, self.sdk_machine_combo = self.gen_combo_widget(self.configuration.curr_sdk_machine, self.all_sdk_machines,"<b>Populate SDK</b>" + "*" + tooltip)
|
||||
sub_hbox.pack_start(sdk_machine_widget, expand=False, fill=False)
|
||||
|
||||
return advanced_vbox
|
||||
|
||||
def response_cb(self, dialog, response_id):
|
||||
package_format = []
|
||||
package_format.append(self.rootfs_combo.get_active_text())
|
||||
for child in self.check_hbox:
|
||||
if isinstance(child, gtk.CheckButton) and child.get_active():
|
||||
package_format.append(child.get_label())
|
||||
self.configuration.curr_package_format = " ".join(package_format)
|
||||
|
||||
distro = self.distro_combo.get_active_text()
|
||||
if distro == "Default":
|
||||
distro = "defaultsetup"
|
||||
self.configuration.curr_distro = distro
|
||||
self.configuration.image_rootfs_size = self.rootfs_size_spinner.get_value_as_int() * 1024
|
||||
self.configuration.image_extra_size = self.extra_size_spinner.get_value_as_int() * 1024
|
||||
|
||||
self.configuration.image_fstypes = ""
|
||||
for image_type in self.image_types:
|
||||
if self.image_types_checkbuttons[image_type].get_active():
|
||||
self.configuration.image_fstypes += (" " + image_type)
|
||||
self.configuration.image_fstypes.strip()
|
||||
|
||||
if self.gplv3_checkbox.get_active():
|
||||
if "GPLv3" not in self.configuration.incompat_license.split():
|
||||
self.configuration.incompat_license += " GPLv3"
|
||||
else:
|
||||
if "GPLv3" in self.configuration.incompat_license.split():
|
||||
self.configuration.incompat_license = self.configuration.incompat_license.split().remove("GPLv3")
|
||||
self.configuration.incompat_license = " ".join(self.configuration.incompat_license or [])
|
||||
self.configuration.incompat_license = self.configuration.incompat_license.strip()
|
||||
|
||||
self.configuration.toolchain_build = self.sdk_checkbox.get_active()
|
||||
self.configuration.curr_sdk_machine = self.sdk_machine_combo.get_active_text()
|
||||
md5 = self.config_md5()
|
||||
self.settings_changed = (self.md5 != md5)
|
||||
@@ -1,44 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2012 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
|
||||
"""
|
||||
The following are convenience classes for implementing GNOME HIG compliant
|
||||
BitBake GUI's
|
||||
In summary: spacing = 12px, border-width = 6px
|
||||
"""
|
||||
|
||||
class CrumbsDialog(gtk.Dialog):
|
||||
"""
|
||||
A GNOME HIG compliant dialog widget.
|
||||
Add buttons with gtk.Dialog.add_button or gtk.Dialog.add_buttons
|
||||
"""
|
||||
def __init__(self, title="", parent=None, flags=0, buttons=None):
|
||||
super(CrumbsDialog, self).__init__(title, parent, flags, buttons)
|
||||
|
||||
self.set_property("has-separator", False) # note: deprecated in 2.22
|
||||
|
||||
self.set_border_width(6)
|
||||
self.vbox.set_property("spacing", 12)
|
||||
self.action_area.set_property("spacing", 12)
|
||||
self.action_area.set_property("border-width", 6)
|
||||
@@ -1,95 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2012 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import glib
|
||||
import gtk
|
||||
from bb.ui.crumbs.hobwidget import HobIconChecker
|
||||
from bb.ui.crumbs.hig.crumbsdialog import CrumbsDialog
|
||||
|
||||
"""
|
||||
The following are convenience classes for implementing GNOME HIG compliant
|
||||
BitBake GUI's
|
||||
In summary: spacing = 12px, border-width = 6px
|
||||
"""
|
||||
|
||||
class CrumbsMessageDialog(CrumbsDialog):
|
||||
"""
|
||||
A GNOME HIG compliant dialog widget.
|
||||
Add buttons with gtk.Dialog.add_button or gtk.Dialog.add_buttons
|
||||
"""
|
||||
def __init__(self, parent=None, label="", icon=gtk.STOCK_INFO, msg=""):
|
||||
super(CrumbsMessageDialog, self).__init__("", parent, gtk.DIALOG_MODAL)
|
||||
|
||||
self.set_border_width(6)
|
||||
self.vbox.set_property("spacing", 12)
|
||||
self.action_area.set_property("spacing", 12)
|
||||
self.action_area.set_property("border-width", 6)
|
||||
|
||||
first_column = gtk.HBox(spacing=12)
|
||||
first_column.set_property("border-width", 6)
|
||||
first_column.show()
|
||||
self.vbox.add(first_column)
|
||||
|
||||
self.icon = gtk.Image()
|
||||
# We have our own Info icon which should be used in preference of the stock icon
|
||||
self.icon_chk = HobIconChecker()
|
||||
self.icon.set_from_stock(self.icon_chk.check_stock_icon(icon), gtk.ICON_SIZE_DIALOG)
|
||||
self.icon.set_property("yalign", 0.00)
|
||||
self.icon.show()
|
||||
first_column.pack_start(self.icon, expand=False, fill=True, padding=0)
|
||||
|
||||
if 0 <= len(msg) < 200:
|
||||
lbl = label + "%s" % glib.markup_escape_text(msg)
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_use_markup(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup(lbl)
|
||||
self.label_short.set_property("yalign", 0.00)
|
||||
self.label_short.show()
|
||||
first_column.add(self.label_short)
|
||||
else:
|
||||
second_row = gtk.VBox(spacing=12)
|
||||
second_row.set_property("border-width", 6)
|
||||
self.label_long = gtk.Label()
|
||||
self.label_long.set_use_markup(True)
|
||||
self.label_long.set_line_wrap(True)
|
||||
self.label_long.set_markup(label)
|
||||
self.label_long.set_alignment(0.0, 0.0)
|
||||
second_row.pack_start(self.label_long, expand=False, fill=False, padding=0)
|
||||
self.label_long.show()
|
||||
self.textWindow = gtk.ScrolledWindow()
|
||||
self.textWindow.set_shadow_type(gtk.SHADOW_IN)
|
||||
self.textWindow.set_policy(gtk.POLICY_AUTOMATIC, gtk.POLICY_AUTOMATIC)
|
||||
self.msgView = gtk.TextView()
|
||||
self.msgView.set_editable(False)
|
||||
self.msgView.set_wrap_mode(gtk.WRAP_WORD)
|
||||
self.msgView.set_cursor_visible(False)
|
||||
self.msgView.set_size_request(300, 300)
|
||||
self.buf = gtk.TextBuffer()
|
||||
self.buf.set_text(msg)
|
||||
self.msgView.set_buffer(self.buf)
|
||||
self.textWindow.add(self.msgView)
|
||||
self.msgView.show()
|
||||
second_row.add(self.textWindow)
|
||||
self.textWindow.show()
|
||||
first_column.add(second_row)
|
||||
second_row.show()
|
||||
@@ -1,215 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2012 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import glob
|
||||
import gtk
|
||||
import gobject
|
||||
import os
|
||||
import re
|
||||
import shlex
|
||||
import subprocess
|
||||
import tempfile
|
||||
from bb.ui.crumbs.hobwidget import hic, HobButton
|
||||
from bb.ui.crumbs.progressbar import HobProgressBar
|
||||
import bb.ui.crumbs.utils
|
||||
import bb.process
|
||||
from bb.ui.crumbs.hig.crumbsdialog import CrumbsDialog
|
||||
from bb.ui.crumbs.hig.crumbsmessagedialog import CrumbsMessageDialog
|
||||
|
||||
"""
|
||||
The following are convenience classes for implementing GNOME HIG compliant
|
||||
BitBake GUI's
|
||||
In summary: spacing = 12px, border-width = 6px
|
||||
"""
|
||||
|
||||
class DeployImageDialog (CrumbsDialog):
|
||||
|
||||
__dummy_usb__ = "--select a usb drive--"
|
||||
|
||||
def __init__(self, title, image_path, parent, flags, buttons=None, standalone=False):
|
||||
super(DeployImageDialog, self).__init__(title, parent, flags, buttons)
|
||||
|
||||
self.image_path = image_path
|
||||
self.standalone = standalone
|
||||
|
||||
self.create_visual_elements()
|
||||
self.connect("response", self.response_cb)
|
||||
|
||||
def create_visual_elements(self):
|
||||
self.set_size_request(600, 400)
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0.0, 0.5)
|
||||
markup = "<span font_desc='12'>The image to be written into usb drive:</span>"
|
||||
label.set_markup(markup)
|
||||
self.vbox.pack_start(label, expand=False, fill=False, padding=2)
|
||||
|
||||
table = gtk.Table(2, 10, False)
|
||||
table.set_col_spacings(5)
|
||||
table.set_row_spacings(5)
|
||||
self.vbox.pack_start(table, expand=True, fill=True)
|
||||
|
||||
scroll = gtk.ScrolledWindow()
|
||||
scroll.set_policy(gtk.POLICY_NEVER, gtk.POLICY_AUTOMATIC)
|
||||
scroll.set_shadow_type(gtk.SHADOW_IN)
|
||||
tv = gtk.TextView()
|
||||
tv.set_editable(False)
|
||||
tv.set_wrap_mode(gtk.WRAP_WORD)
|
||||
tv.set_cursor_visible(False)
|
||||
self.buf = gtk.TextBuffer()
|
||||
self.buf.set_text(self.image_path)
|
||||
tv.set_buffer(self.buf)
|
||||
scroll.add(tv)
|
||||
table.attach(scroll, 0, 10, 0, 1)
|
||||
|
||||
# There are 2 ways to use DeployImageDialog
|
||||
# One way is that called by HOB when the 'Deploy Image' button is clicked
|
||||
# The other way is that called by a standalone script.
|
||||
# Following block of codes handles the latter way. It adds a 'Select Image' button and
|
||||
# emit a signal when the button is clicked.
|
||||
if self.standalone:
|
||||
gobject.signal_new("select_image_clicked", self, gobject.SIGNAL_RUN_FIRST,
|
||||
gobject.TYPE_NONE, ())
|
||||
icon = gtk.Image()
|
||||
pix_buffer = gtk.gdk.pixbuf_new_from_file(hic.ICON_IMAGES_DISPLAY_FILE)
|
||||
icon.set_from_pixbuf(pix_buffer)
|
||||
button = gtk.Button("Select Image")
|
||||
button.set_image(icon)
|
||||
#button.set_size_request(140, 50)
|
||||
table.attach(button, 9, 10, 1, 2, gtk.FILL, 0, 0, 0)
|
||||
button.connect("clicked", self.select_image_button_clicked_cb)
|
||||
|
||||
separator = gtk.HSeparator()
|
||||
self.vbox.pack_start(separator, expand=False, fill=False, padding=10)
|
||||
|
||||
self.usb_desc = gtk.Label()
|
||||
self.usb_desc.set_alignment(0.0, 0.5)
|
||||
markup = "<span font_desc='12'>You haven't chosen any USB drive.</span>"
|
||||
self.usb_desc.set_markup(markup)
|
||||
|
||||
self.usb_combo = gtk.combo_box_new_text()
|
||||
self.usb_combo.connect("changed", self.usb_combo_changed_cb)
|
||||
model = self.usb_combo.get_model()
|
||||
model.clear()
|
||||
self.usb_combo.append_text(self.__dummy_usb__)
|
||||
for usb in self.find_all_usb_devices():
|
||||
self.usb_combo.append_text("/dev/" + usb)
|
||||
self.usb_combo.set_active(0)
|
||||
self.vbox.pack_start(self.usb_combo, expand=False, fill=False)
|
||||
self.vbox.pack_start(self.usb_desc, expand=False, fill=False, padding=2)
|
||||
|
||||
self.progress_bar = HobProgressBar()
|
||||
self.vbox.pack_start(self.progress_bar, expand=False, fill=False)
|
||||
separator = gtk.HSeparator()
|
||||
self.vbox.pack_start(separator, expand=False, fill=True, padding=10)
|
||||
|
||||
self.vbox.show_all()
|
||||
self.progress_bar.hide()
|
||||
|
||||
def set_image_text_buffer(self, image_path):
|
||||
self.buf.set_text(image_path)
|
||||
|
||||
def set_image_path(self, image_path):
|
||||
self.image_path = image_path
|
||||
|
||||
def popen_read(self, cmd):
|
||||
tmpout, errors = bb.process.run("%s" % cmd)
|
||||
return tmpout.strip()
|
||||
|
||||
def find_all_usb_devices(self):
|
||||
usb_devs = [ os.readlink(u)
|
||||
for u in glob.glob('/dev/disk/by-id/usb*')
|
||||
if not re.search(r'part\d+', u) ]
|
||||
return [ '%s' % u[u.rfind('/')+1:] for u in usb_devs ]
|
||||
|
||||
def get_usb_info(self, dev):
|
||||
return "%s %s" % \
|
||||
(self.popen_read('cat /sys/class/block/%s/device/vendor' % dev),
|
||||
self.popen_read('cat /sys/class/block/%s/device/model' % dev))
|
||||
|
||||
def select_image_button_clicked_cb(self, button):
|
||||
self.emit('select_image_clicked')
|
||||
|
||||
def usb_combo_changed_cb(self, usb_combo):
|
||||
combo_item = self.usb_combo.get_active_text()
|
||||
if not combo_item or combo_item == self.__dummy_usb__:
|
||||
markup = "<span font_desc='12'>You haven't chosen any USB drive.</span>"
|
||||
self.usb_desc.set_markup(markup)
|
||||
else:
|
||||
markup = "<span font_desc='12'>" + self.get_usb_info(combo_item.lstrip("/dev/")) + "</span>"
|
||||
self.usb_desc.set_markup(markup)
|
||||
|
||||
def response_cb(self, dialog, response_id):
|
||||
if response_id == gtk.RESPONSE_YES:
|
||||
lbl = ''
|
||||
combo_item = self.usb_combo.get_active_text()
|
||||
if combo_item and combo_item != self.__dummy_usb__ and self.image_path:
|
||||
cmdline = bb.ui.crumbs.utils.which_terminal()
|
||||
if cmdline:
|
||||
tmpfile = tempfile.NamedTemporaryFile()
|
||||
cmdline += "\"sudo dd if=" + self.image_path + \
|
||||
" of=" + combo_item + "; echo $? > " + tmpfile.name + "\""
|
||||
subprocess.call(shlex.split(cmdline))
|
||||
|
||||
if int(tmpfile.readline().strip()) == 0:
|
||||
lbl = "<b>Deploy image successfully.</b>"
|
||||
else:
|
||||
lbl = "<b>Failed to deploy image.</b>\nPlease check image <b>%s</b> exists and USB device <b>%s</b> is writable." % (self.image_path, combo_item)
|
||||
tmpfile.close()
|
||||
else:
|
||||
if not self.image_path:
|
||||
lbl = "<b>No selection made.</b>\nYou have not selected an image to deploy."
|
||||
else:
|
||||
lbl = "<b>No selection made.</b>\nYou have not selected a USB device."
|
||||
if len(lbl):
|
||||
crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
|
||||
button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
|
||||
HobButton.style_button(button)
|
||||
crumbs_dialog.run()
|
||||
crumbs_dialog.destroy()
|
||||
|
||||
def update_progress_bar(self, title, fraction, status=None):
|
||||
self.progress_bar.update(fraction)
|
||||
self.progress_bar.set_title(title)
|
||||
self.progress_bar.set_rcstyle(status)
|
||||
|
||||
def write_file(self, ifile, ofile):
|
||||
self.progress_bar.reset()
|
||||
self.progress_bar.show()
|
||||
|
||||
f_from = os.open(ifile, os.O_RDONLY)
|
||||
f_to = os.open(ofile, os.O_WRONLY)
|
||||
|
||||
total_size = os.stat(ifile).st_size
|
||||
written_size = 0
|
||||
|
||||
while True:
|
||||
buf = os.read(f_from, 1024*1024)
|
||||
if not buf:
|
||||
break
|
||||
os.write(f_to, buf)
|
||||
written_size += 1024*1024
|
||||
self.update_progress_bar("Writing to usb:", written_size * 1.0/total_size)
|
||||
|
||||
self.update_progress_bar("Writing completed:", 1.0)
|
||||
os.close(f_from)
|
||||
os.close(f_to)
|
||||
self.progress_bar.hide()
|
||||
@@ -1,172 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2012 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import gobject
|
||||
import os
|
||||
from bb.ui.crumbs.hobwidget import HobViewTable, HobInfoButton, HobButton, HobAltButton
|
||||
from bb.ui.crumbs.hig.crumbsdialog import CrumbsDialog
|
||||
from bb.ui.crumbs.hig.layerselectiondialog import LayerSelectionDialog
|
||||
|
||||
"""
|
||||
The following are convenience classes for implementing GNOME HIG compliant
|
||||
BitBake GUI's
|
||||
In summary: spacing = 12px, border-width = 6px
|
||||
"""
|
||||
|
||||
class ImageSelectionDialog (CrumbsDialog):
|
||||
|
||||
__columns__ = [{
|
||||
'col_name' : 'Image name',
|
||||
'col_id' : 0,
|
||||
'col_style': 'text',
|
||||
'col_min' : 400,
|
||||
'col_max' : 400
|
||||
}, {
|
||||
'col_name' : 'Select',
|
||||
'col_id' : 1,
|
||||
'col_style': 'radio toggle',
|
||||
'col_min' : 160,
|
||||
'col_max' : 160
|
||||
}]
|
||||
|
||||
|
||||
def __init__(self, image_folder, image_types, title, parent, flags, buttons=None, image_extension = {}):
|
||||
super(ImageSelectionDialog, self).__init__(title, parent, flags, buttons)
|
||||
self.connect("response", self.response_cb)
|
||||
|
||||
self.image_folder = image_folder
|
||||
self.image_types = image_types
|
||||
self.image_list = []
|
||||
self.image_names = []
|
||||
self.image_extension = image_extension
|
||||
|
||||
# create visual elements on the dialog
|
||||
self.create_visual_elements()
|
||||
|
||||
self.image_store = gtk.ListStore(gobject.TYPE_STRING, gobject.TYPE_BOOLEAN)
|
||||
self.fill_image_store()
|
||||
|
||||
def create_visual_elements(self):
|
||||
hbox = gtk.HBox(False, 6)
|
||||
|
||||
self.vbox.pack_start(hbox, expand=False, fill=False)
|
||||
|
||||
entry = gtk.Entry()
|
||||
entry.set_text(self.image_folder)
|
||||
table = gtk.Table(1, 10, True)
|
||||
table.set_size_request(560, -1)
|
||||
hbox.pack_start(table, expand=False, fill=False)
|
||||
table.attach(entry, 0, 9, 0, 1)
|
||||
image = gtk.Image()
|
||||
image.set_from_stock(gtk.STOCK_OPEN, gtk.ICON_SIZE_BUTTON)
|
||||
open_button = gtk.Button()
|
||||
open_button.set_image(image)
|
||||
open_button.connect("clicked", self.select_path_cb, self, entry)
|
||||
table.attach(open_button, 9, 10, 0, 1)
|
||||
|
||||
self.image_table = HobViewTable(self.__columns__, "Images")
|
||||
self.image_table.set_size_request(-1, 300)
|
||||
self.image_table.connect("toggled", self.toggled_cb)
|
||||
self.image_table.connect_group_selection(self.table_selected_cb)
|
||||
self.image_table.connect("row-activated", self.row_actived_cb)
|
||||
self.vbox.pack_start(self.image_table, expand=True, fill=True)
|
||||
|
||||
self.show_all()
|
||||
|
||||
def change_image_cb(self, model, path, columnid):
|
||||
if not model:
|
||||
return
|
||||
iter = model.get_iter_first()
|
||||
while iter:
|
||||
rowpath = model.get_path(iter)
|
||||
model[rowpath][columnid] = False
|
||||
iter = model.iter_next(iter)
|
||||
|
||||
model[path][columnid] = True
|
||||
|
||||
def toggled_cb(self, table, cell, path, columnid, tree):
|
||||
model = tree.get_model()
|
||||
self.change_image_cb(model, path, columnid)
|
||||
|
||||
def table_selected_cb(self, selection):
|
||||
model, paths = selection.get_selected_rows()
|
||||
if paths:
|
||||
self.change_image_cb(model, paths[0], 1)
|
||||
|
||||
def row_actived_cb(self, tab, model, path):
|
||||
self.change_image_cb(model, path, 1)
|
||||
self.emit('response', gtk.RESPONSE_YES)
|
||||
|
||||
def select_path_cb(self, action, parent, entry):
|
||||
dialog = gtk.FileChooserDialog("", parent,
|
||||
gtk.FILE_CHOOSER_ACTION_SELECT_FOLDER)
|
||||
text = entry.get_text()
|
||||
dialog.set_current_folder(text if len(text) > 0 else os.getcwd())
|
||||
button = dialog.add_button("Cancel", gtk.RESPONSE_NO)
|
||||
HobAltButton.style_button(button)
|
||||
button = dialog.add_button("Open", gtk.RESPONSE_YES)
|
||||
HobButton.style_button(button)
|
||||
response = dialog.run()
|
||||
if response == gtk.RESPONSE_YES:
|
||||
path = dialog.get_filename()
|
||||
entry.set_text(path)
|
||||
self.image_folder = path
|
||||
self.fill_image_store()
|
||||
|
||||
dialog.destroy()
|
||||
|
||||
def fill_image_store(self):
|
||||
self.image_list = []
|
||||
self.image_store.clear()
|
||||
imageset = set()
|
||||
for root, dirs, files in os.walk(self.image_folder):
|
||||
# ignore the sub directories
|
||||
dirs[:] = []
|
||||
for f in files:
|
||||
for image_type in self.image_types:
|
||||
if image_type in self.image_extension:
|
||||
real_types = self.image_extension[image_type]
|
||||
else:
|
||||
real_types = [image_type]
|
||||
for real_image_type in real_types:
|
||||
if f.endswith('.' + real_image_type):
|
||||
imageset.add(f.rsplit('.' + real_image_type)[0].rsplit('.rootfs')[0])
|
||||
self.image_list.append(f)
|
||||
|
||||
for image in imageset:
|
||||
self.image_store.set(self.image_store.append(), 0, image, 1, False)
|
||||
|
||||
self.image_table.set_model(self.image_store)
|
||||
|
||||
def response_cb(self, dialog, response_id):
|
||||
self.image_names = []
|
||||
if response_id == gtk.RESPONSE_YES:
|
||||
iter = self.image_store.get_iter_first()
|
||||
while iter:
|
||||
path = self.image_store.get_path(iter)
|
||||
if self.image_store[path][1]:
|
||||
for f in self.image_list:
|
||||
if f.startswith(self.image_store[path][0] + '.'):
|
||||
self.image_names.append(f)
|
||||
break
|
||||
iter = self.image_store.iter_next(iter)
|
||||
@@ -1,296 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2012 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import gobject
|
||||
import os
|
||||
import tempfile
|
||||
from bb.ui.crumbs.hobwidget import hic, HobButton, HobAltButton
|
||||
from bb.ui.crumbs.hig.crumbsdialog import CrumbsDialog
|
||||
from bb.ui.crumbs.hig.crumbsmessagedialog import CrumbsMessageDialog
|
||||
|
||||
"""
|
||||
The following are convenience classes for implementing GNOME HIG compliant
|
||||
BitBake GUI's
|
||||
In summary: spacing = 12px, border-width = 6px
|
||||
"""
|
||||
|
||||
class CellRendererPixbufActivatable(gtk.CellRendererPixbuf):
|
||||
"""
|
||||
A custom CellRenderer implementation which is activatable
|
||||
so that we can handle user clicks
|
||||
"""
|
||||
__gsignals__ = { 'clicked' : (gobject.SIGNAL_RUN_LAST,
|
||||
gobject.TYPE_NONE,
|
||||
(gobject.TYPE_STRING,)), }
|
||||
|
||||
def __init__(self):
|
||||
gtk.CellRendererPixbuf.__init__(self)
|
||||
self.set_property('mode', gtk.CELL_RENDERER_MODE_ACTIVATABLE)
|
||||
self.set_property('follow-state', True)
|
||||
|
||||
"""
|
||||
Respond to a user click on a cell
|
||||
"""
|
||||
def do_activate(self, even, widget, path, background_area, cell_area, flags):
|
||||
self.emit('clicked', path)
|
||||
|
||||
#
|
||||
# LayerSelectionDialog
|
||||
#
|
||||
class LayerSelectionDialog (CrumbsDialog):
|
||||
|
||||
TARGETS = [
|
||||
("MY_TREE_MODEL_ROW", gtk.TARGET_SAME_WIDGET, 0),
|
||||
("text/plain", 0, 1),
|
||||
("TEXT", 0, 2),
|
||||
("STRING", 0, 3),
|
||||
]
|
||||
|
||||
def gen_label_widget(self, content):
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0, 0)
|
||||
label.set_markup(content)
|
||||
label.show()
|
||||
return label
|
||||
|
||||
def layer_widget_toggled_cb(self, cell, path, layer_store):
|
||||
name = layer_store[path][0]
|
||||
toggle = not layer_store[path][1]
|
||||
layer_store[path][1] = toggle
|
||||
|
||||
def layer_widget_add_clicked_cb(self, action, layer_store, parent):
|
||||
dialog = gtk.FileChooserDialog("Add new layer", parent,
|
||||
gtk.FILE_CHOOSER_ACTION_SELECT_FOLDER)
|
||||
button = dialog.add_button("Cancel", gtk.RESPONSE_NO)
|
||||
HobAltButton.style_button(button)
|
||||
button = dialog.add_button("Open", gtk.RESPONSE_YES)
|
||||
HobButton.style_button(button)
|
||||
label = gtk.Label("Select the layer you wish to add")
|
||||
label.show()
|
||||
dialog.set_extra_widget(label)
|
||||
response = dialog.run()
|
||||
path = dialog.get_filename()
|
||||
dialog.destroy()
|
||||
|
||||
lbl = "<b>Error</b>\nUnable to load layer <i>%s</i> because " % path
|
||||
if response == gtk.RESPONSE_YES:
|
||||
import os
|
||||
import os.path
|
||||
layers = []
|
||||
it = layer_store.get_iter_first()
|
||||
while it:
|
||||
layers.append(layer_store.get_value(it, 0))
|
||||
it = layer_store.iter_next(it)
|
||||
|
||||
if not path:
|
||||
lbl += "it is an invalid path."
|
||||
elif not os.path.exists(path+"/conf/layer.conf"):
|
||||
lbl += "there is no layer.conf inside the directory."
|
||||
elif path in layers:
|
||||
lbl += "it is already in loaded layers."
|
||||
else:
|
||||
layer_store.append([path])
|
||||
return
|
||||
dialog = CrumbsMessageDialog(parent, lbl)
|
||||
dialog.add_button(gtk.STOCK_CLOSE, gtk.RESPONSE_OK)
|
||||
response = dialog.run()
|
||||
dialog.destroy()
|
||||
|
||||
def layer_widget_del_clicked_cb(self, action, tree_selection, layer_store):
|
||||
model, iter = tree_selection.get_selected()
|
||||
if iter:
|
||||
layer_store.remove(iter)
|
||||
|
||||
|
||||
def gen_layer_widget(self, layers, layers_avail, window, tooltip=""):
|
||||
hbox = gtk.HBox(False, 6)
|
||||
|
||||
layer_tv = gtk.TreeView()
|
||||
layer_tv.set_rules_hint(True)
|
||||
layer_tv.set_headers_visible(False)
|
||||
tree_selection = layer_tv.get_selection()
|
||||
tree_selection.set_mode(gtk.SELECTION_SINGLE)
|
||||
|
||||
# Allow enable drag and drop of rows including row move
|
||||
layer_tv.enable_model_drag_source( gtk.gdk.BUTTON1_MASK,
|
||||
self.TARGETS,
|
||||
gtk.gdk.ACTION_DEFAULT|
|
||||
gtk.gdk.ACTION_MOVE)
|
||||
layer_tv.enable_model_drag_dest(self.TARGETS,
|
||||
gtk.gdk.ACTION_DEFAULT)
|
||||
layer_tv.connect("drag_data_get", self.drag_data_get_cb)
|
||||
layer_tv.connect("drag_data_received", self.drag_data_received_cb)
|
||||
|
||||
col0= gtk.TreeViewColumn('Path')
|
||||
cell0 = gtk.CellRendererText()
|
||||
cell0.set_padding(5,2)
|
||||
col0.pack_start(cell0, True)
|
||||
col0.set_cell_data_func(cell0, self.draw_layer_path_cb)
|
||||
layer_tv.append_column(col0)
|
||||
|
||||
scroll = gtk.ScrolledWindow()
|
||||
scroll.set_policy(gtk.POLICY_NEVER, gtk.POLICY_AUTOMATIC)
|
||||
scroll.set_shadow_type(gtk.SHADOW_IN)
|
||||
scroll.add(layer_tv)
|
||||
|
||||
table_layer = gtk.Table(2, 10, False)
|
||||
hbox.pack_start(table_layer, expand=True, fill=True)
|
||||
|
||||
table_layer.attach(scroll, 0, 10, 0, 1)
|
||||
|
||||
layer_store = gtk.ListStore(gobject.TYPE_STRING)
|
||||
for layer in layers:
|
||||
layer_store.append([layer])
|
||||
|
||||
col1 = gtk.TreeViewColumn('Enabled')
|
||||
layer_tv.append_column(col1)
|
||||
|
||||
cell1 = CellRendererPixbufActivatable()
|
||||
cell1.set_fixed_size(-1,35)
|
||||
cell1.connect("clicked", self.del_cell_clicked_cb, layer_store)
|
||||
col1.pack_start(cell1, True)
|
||||
col1.set_cell_data_func(cell1, self.draw_delete_button_cb, layer_tv)
|
||||
|
||||
add_button = gtk.Button()
|
||||
add_button.set_relief(gtk.RELIEF_NONE)
|
||||
box = gtk.HBox(False, 6)
|
||||
box.show()
|
||||
add_button.add(box)
|
||||
add_button.connect("enter-notify-event", self.add_hover_cb)
|
||||
add_button.connect("leave-notify-event", self.add_leave_cb)
|
||||
self.im = gtk.Image()
|
||||
self.im.set_from_file(hic.ICON_INDI_ADD_FILE)
|
||||
self.im.show()
|
||||
box.pack_start(self.im, expand=False, fill=False, padding=6)
|
||||
lbl = gtk.Label("Add layer")
|
||||
lbl.set_alignment(0.0, 0.5)
|
||||
lbl.show()
|
||||
box.pack_start(lbl, expand=True, fill=True, padding=6)
|
||||
add_button.connect("clicked", self.layer_widget_add_clicked_cb, layer_store, window)
|
||||
table_layer.attach(add_button, 0, 10, 1, 2, gtk.EXPAND | gtk.FILL, 0, 0, 6)
|
||||
layer_tv.set_model(layer_store)
|
||||
|
||||
hbox.show_all()
|
||||
|
||||
return hbox, layer_store
|
||||
|
||||
def drag_data_get_cb(self, treeview, context, selection, target_id, etime):
|
||||
treeselection = treeview.get_selection()
|
||||
model, iter = treeselection.get_selected()
|
||||
data = model.get_value(iter, 0)
|
||||
selection.set(selection.target, 8, data)
|
||||
|
||||
def drag_data_received_cb(self, treeview, context, x, y, selection, info, etime):
|
||||
model = treeview.get_model()
|
||||
data = selection.data
|
||||
drop_info = treeview.get_dest_row_at_pos(x, y)
|
||||
if drop_info:
|
||||
path, position = drop_info
|
||||
iter = model.get_iter(path)
|
||||
if (position == gtk.TREE_VIEW_DROP_BEFORE or position == gtk.TREE_VIEW_DROP_INTO_OR_BEFORE):
|
||||
model.insert_before(iter, [data])
|
||||
else:
|
||||
model.insert_after(iter, [data])
|
||||
else:
|
||||
model.append([data])
|
||||
if context.action == gtk.gdk.ACTION_MOVE:
|
||||
context.finish(True, True, etime)
|
||||
return
|
||||
|
||||
def add_hover_cb(self, button, event):
|
||||
self.im.set_from_file(hic.ICON_INDI_ADD_HOVER_FILE)
|
||||
|
||||
def add_leave_cb(self, button, event):
|
||||
self.im.set_from_file(hic.ICON_INDI_ADD_FILE)
|
||||
|
||||
def __init__(self, title, layers, layers_non_removable, all_layers, parent, flags, buttons=None):
|
||||
super(LayerSelectionDialog, self).__init__(title, parent, flags, buttons)
|
||||
|
||||
# class members from other objects
|
||||
self.layers = layers
|
||||
self.layers_non_removable = layers_non_removable
|
||||
self.all_layers = all_layers
|
||||
self.layers_changed = False
|
||||
|
||||
# icon for remove button in TreeView
|
||||
im = gtk.Image()
|
||||
im.set_from_file(hic.ICON_INDI_REMOVE_FILE)
|
||||
self.rem_icon = im.get_pixbuf()
|
||||
|
||||
# class members for internal use
|
||||
self.layer_store = None
|
||||
|
||||
# create visual elements on the dialog
|
||||
self.create_visual_elements()
|
||||
self.connect("response", self.response_cb)
|
||||
|
||||
def create_visual_elements(self):
|
||||
layer_widget, self.layer_store = self.gen_layer_widget(self.layers, self.all_layers, self, None)
|
||||
layer_widget.set_size_request(450, 250)
|
||||
self.vbox.pack_start(layer_widget, expand=True, fill=True)
|
||||
self.show_all()
|
||||
|
||||
def response_cb(self, dialog, response_id):
|
||||
model = self.layer_store
|
||||
it = model.get_iter_first()
|
||||
layers = []
|
||||
while it:
|
||||
layers.append(model.get_value(it, 0))
|
||||
it = model.iter_next(it)
|
||||
|
||||
self.layers_changed = (self.layers != layers)
|
||||
self.layers = layers
|
||||
|
||||
"""
|
||||
A custom cell_data_func to draw a delete 'button' in the TreeView for layers
|
||||
other than the meta layer. The deletion of which is prevented so that the
|
||||
user can't shoot themselves in the foot too badly.
|
||||
"""
|
||||
def draw_delete_button_cb(self, col, cell, model, it, tv):
|
||||
path = model.get_value(it, 0)
|
||||
if path in self.layers_non_removable:
|
||||
cell.set_sensitive(False)
|
||||
cell.set_property('pixbuf', None)
|
||||
cell.set_property('mode', gtk.CELL_RENDERER_MODE_INERT)
|
||||
else:
|
||||
cell.set_property('pixbuf', self.rem_icon)
|
||||
cell.set_sensitive(True)
|
||||
cell.set_property('mode', gtk.CELL_RENDERER_MODE_ACTIVATABLE)
|
||||
|
||||
return True
|
||||
|
||||
"""
|
||||
A custom cell_data_func to write an extra message into the layer path cell
|
||||
for the meta layer. We should inform the user that they can't remove it for
|
||||
their own safety.
|
||||
"""
|
||||
def draw_layer_path_cb(self, col, cell, model, it):
|
||||
path = model.get_value(it, 0)
|
||||
if path in self.layers_non_removable:
|
||||
cell.set_property('markup', "<b>It cannot be removed</b>\n%s" % path)
|
||||
else:
|
||||
cell.set_property('text', path)
|
||||
|
||||
def del_cell_clicked_cb(self, cell, path, model):
|
||||
it = model.get_iter_from_string(path)
|
||||
model.remove(it)
|
||||
@@ -1,163 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2012 Intel Corporation
|
||||
#
|
||||
# Authored by Cristiana Voicu <cristiana.voicu@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import gobject
|
||||
from bb.ui.crumbs.hobwidget import HobAltButton
|
||||
from bb.ui.crumbs.hig.crumbsdialog import CrumbsDialog
|
||||
|
||||
"""
|
||||
The following are convenience classes for implementing GNOME HIG compliant
|
||||
BitBake GUI's
|
||||
In summary: spacing = 12px, border-width = 6px
|
||||
"""
|
||||
|
||||
#
|
||||
# ParsingWarningsDialog
|
||||
#
|
||||
class ParsingWarningsDialog (CrumbsDialog):
|
||||
|
||||
def __init__(self, title, warnings, parent, flags, buttons=None):
|
||||
super(ParsingWarningsDialog, self).__init__(title, parent, flags, buttons)
|
||||
|
||||
self.warnings = warnings
|
||||
self.warning_on = 0
|
||||
self.warn_nb = len(warnings)
|
||||
|
||||
# create visual elements on the dialog
|
||||
self.create_visual_elements()
|
||||
|
||||
def cancel_button_cb(self, button):
|
||||
self.destroy()
|
||||
|
||||
def previous_button_cb(self, button):
|
||||
self.warning_on = self.warning_on - 1
|
||||
self.refresh_components()
|
||||
|
||||
def next_button_cb(self, button):
|
||||
self.warning_on = self.warning_on + 1
|
||||
self.refresh_components()
|
||||
|
||||
def refresh_components(self):
|
||||
lbl = self.warnings[self.warning_on]
|
||||
#when the warning text has more than 400 chars, it uses a scroll bar
|
||||
if 0<= len(lbl) < 400:
|
||||
self.warning_label.set_size_request(320, 230)
|
||||
self.warning_label.set_use_markup(True)
|
||||
self.warning_label.set_line_wrap(True)
|
||||
self.warning_label.set_markup(lbl)
|
||||
self.warning_label.set_property("yalign", 0.00)
|
||||
else:
|
||||
self.textWindow.set_shadow_type(gtk.SHADOW_IN)
|
||||
self.textWindow.set_policy(gtk.POLICY_AUTOMATIC, gtk.POLICY_AUTOMATIC)
|
||||
self.msgView = gtk.TextView()
|
||||
self.msgView.set_editable(False)
|
||||
self.msgView.set_wrap_mode(gtk.WRAP_WORD)
|
||||
self.msgView.set_cursor_visible(False)
|
||||
self.msgView.set_size_request(320, 230)
|
||||
self.buf = gtk.TextBuffer()
|
||||
self.buf.set_text(lbl)
|
||||
self.msgView.set_buffer(self.buf)
|
||||
self.textWindow.add(self.msgView)
|
||||
self.msgView.show()
|
||||
|
||||
if self.warning_on==0:
|
||||
self.previous_button.set_sensitive(False)
|
||||
else:
|
||||
self.previous_button.set_sensitive(True)
|
||||
|
||||
if self.warning_on==self.warn_nb-1:
|
||||
self.next_button.set_sensitive(False)
|
||||
else:
|
||||
self.next_button.set_sensitive(True)
|
||||
|
||||
if self.warn_nb>1:
|
||||
self.heading = "Warning " + str(self.warning_on + 1) + " of " + str(self.warn_nb)
|
||||
self.heading_label.set_markup('<span weight="bold">%s</span>' % self.heading)
|
||||
else:
|
||||
self.heading = "Warning"
|
||||
self.heading_label.set_markup('<span weight="bold">%s</span>' % self.heading)
|
||||
|
||||
self.show_all()
|
||||
|
||||
if 0<= len(lbl) < 400:
|
||||
self.textWindow.hide()
|
||||
else:
|
||||
self.warning_label.hide()
|
||||
|
||||
def create_visual_elements(self):
|
||||
self.set_size_request(350, 350)
|
||||
self.heading_label = gtk.Label()
|
||||
self.heading_label.set_alignment(0, 0)
|
||||
self.warning_label = gtk.Label()
|
||||
self.warning_label.set_selectable(True)
|
||||
self.warning_label.set_alignment(0, 0)
|
||||
self.textWindow = gtk.ScrolledWindow()
|
||||
|
||||
table = gtk.Table(1, 10, False)
|
||||
|
||||
cancel_button = gtk.Button()
|
||||
cancel_button.set_label("Close")
|
||||
cancel_button.connect("clicked", self.cancel_button_cb)
|
||||
cancel_button.set_size_request(110, 30)
|
||||
|
||||
self.previous_button = gtk.Button()
|
||||
image1 = gtk.image_new_from_stock(gtk.STOCK_GO_BACK, gtk.ICON_SIZE_BUTTON)
|
||||
image1.show()
|
||||
box = gtk.HBox(False, 6)
|
||||
box.show()
|
||||
self.previous_button.add(box)
|
||||
lbl = gtk.Label("Previous")
|
||||
lbl.show()
|
||||
box.pack_start(image1, expand=False, fill=False, padding=3)
|
||||
box.pack_start(lbl, expand=True, fill=True, padding=3)
|
||||
self.previous_button.connect("clicked", self.previous_button_cb)
|
||||
self.previous_button.set_size_request(110, 30)
|
||||
|
||||
self.next_button = gtk.Button()
|
||||
image2 = gtk.image_new_from_stock(gtk.STOCK_GO_FORWARD, gtk.ICON_SIZE_BUTTON)
|
||||
image2.show()
|
||||
box = gtk.HBox(False, 6)
|
||||
box.show()
|
||||
self.next_button.add(box)
|
||||
lbl = gtk.Label("Next")
|
||||
lbl.show()
|
||||
box.pack_start(lbl, expand=True, fill=True, padding=3)
|
||||
box.pack_start(image2, expand=False, fill=False, padding=3)
|
||||
self.next_button.connect("clicked", self.next_button_cb)
|
||||
self.next_button.set_size_request(110, 30)
|
||||
|
||||
#when there more than one warning, we need "previous" and "next" button
|
||||
if self.warn_nb>1:
|
||||
self.vbox.pack_start(self.heading_label, expand=False, fill=False)
|
||||
self.vbox.pack_start(self.warning_label, expand=False, fill=False)
|
||||
self.vbox.pack_start(self.textWindow, expand=False, fill=False)
|
||||
table.attach(cancel_button, 6, 7, 0, 1, xoptions=gtk.SHRINK)
|
||||
table.attach(self.previous_button, 7, 8, 0, 1, xoptions=gtk.SHRINK)
|
||||
table.attach(self.next_button, 8, 9, 0, 1, xoptions=gtk.SHRINK)
|
||||
self.vbox.pack_end(table, expand=False, fill=False)
|
||||
else:
|
||||
self.vbox.pack_start(self.heading_label, expand=False, fill=False)
|
||||
self.vbox.pack_start(self.warning_label, expand=False, fill=False)
|
||||
self.vbox.pack_start(self.textWindow, expand=False, fill=False)
|
||||
cancel_button = self.add_button("Close", gtk.RESPONSE_CANCEL)
|
||||
HobAltButton.style_button(cancel_button)
|
||||
|
||||
self.refresh_components()
|
||||
@@ -1,451 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2013 Intel Corporation
|
||||
#
|
||||
# Authored by Andrei Dinu <andrei.adrianx.dinu@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import string
|
||||
import gtk
|
||||
import gobject
|
||||
import os
|
||||
import tempfile
|
||||
import glib
|
||||
from bb.ui.crumbs.hig.crumbsdialog import CrumbsDialog
|
||||
from bb.ui.crumbs.hig.settingsuihelper import SettingsUIHelper
|
||||
from bb.ui.crumbs.hig.crumbsmessagedialog import CrumbsMessageDialog
|
||||
from bb.ui.crumbs.hig.layerselectiondialog import LayerSelectionDialog
|
||||
|
||||
"""
|
||||
The following are convenience classes for implementing GNOME HIG compliant
|
||||
BitBake GUI's
|
||||
In summary: spacing = 12px, border-width = 6px
|
||||
"""
|
||||
|
||||
class PropertyDialog(CrumbsDialog):
|
||||
|
||||
def __init__(self, title, parent, information, flags, buttons=None):
|
||||
|
||||
super(PropertyDialog, self).__init__(title, parent, flags, buttons)
|
||||
|
||||
self.properties = information
|
||||
|
||||
if len(self.properties) == 10:
|
||||
self.create_recipe_visual_elements()
|
||||
elif len(self.properties) == 5:
|
||||
self.create_package_visual_elements()
|
||||
else:
|
||||
self.create_information_visual_elements()
|
||||
|
||||
|
||||
def create_information_visual_elements(self):
|
||||
|
||||
HOB_ICON_BASE_DIR = os.path.join(os.path.dirname(os.path.dirname(os.path.dirname(__file__))), ("icons/"))
|
||||
ICON_PACKAGES_DISPLAY_FILE = os.path.join(HOB_ICON_BASE_DIR, ('info/info_display.png'))
|
||||
|
||||
self.set_resizable(False)
|
||||
|
||||
self.table = gtk.Table(1,1,False)
|
||||
self.table.set_row_spacings(0)
|
||||
self.table.set_col_spacings(0)
|
||||
|
||||
self.image = gtk.Image()
|
||||
self.image.set_from_file(ICON_PACKAGES_DISPLAY_FILE)
|
||||
self.image.set_property("xalign",0)
|
||||
#self.vbox.add(self.image)
|
||||
|
||||
image_info = self.properties.split("*")[0]
|
||||
info = self.properties.split("*")[1]
|
||||
|
||||
vbox = gtk.VBox(True, spacing=30)
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_line_wrap(False)
|
||||
self.label_short.set_markup(image_info)
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.info_label = gtk.Label()
|
||||
self.info_label.set_line_wrap(True)
|
||||
self.info_label.set_markup(info)
|
||||
self.info_label.set_property("yalign", 0.5)
|
||||
|
||||
self.table.attach(self.image, 0,1,0,1, xoptions=gtk.FILL|gtk.EXPAND, yoptions=gtk.FILL,xpadding=5,ypadding=5)
|
||||
self.table.attach(self.label_short, 0,1,0,1, xoptions=gtk.FILL|gtk.EXPAND, yoptions=gtk.FILL,xpadding=40,ypadding=5)
|
||||
self.table.attach(self.info_label, 0,1,1,2, xoptions=gtk.FILL|gtk.EXPAND, yoptions=gtk.FILL,xpadding=40,ypadding=10)
|
||||
|
||||
self.vbox.add(self.table)
|
||||
self.connect('delete-event', lambda w, e: self.destroy() or True)
|
||||
|
||||
def treeViewTooltip( self, widget, e, tooltips, cell, emptyText="" ):
|
||||
try:
|
||||
(path,col,x,y) = widget.get_path_at_pos( int(e.x), int(e.y) )
|
||||
it = widget.get_model().get_iter(path)
|
||||
value = widget.get_model().get_value(it,cell)
|
||||
if value in self.tooltip_items:
|
||||
tooltips.set_tip(widget, self.tooltip_items[value])
|
||||
tooltips.enable()
|
||||
else:
|
||||
tooltips.set_tip(widget, emptyText)
|
||||
except:
|
||||
tooltips.set_tip(widget, emptyText)
|
||||
|
||||
|
||||
def create_package_visual_elements(self):
|
||||
|
||||
name = self.properties['name']
|
||||
binb = self.properties['binb']
|
||||
size = self.properties['size']
|
||||
recipe = self.properties['recipe']
|
||||
file_list = self.properties['files_list']
|
||||
|
||||
file_list = file_list.strip("{}'")
|
||||
files_temp = ''
|
||||
paths_temp = ''
|
||||
files_binb = []
|
||||
paths_binb = []
|
||||
|
||||
self.tooltip_items = {}
|
||||
|
||||
self.set_resizable(False)
|
||||
|
||||
#cleaning out the recipe variable
|
||||
recipe = recipe.split("+")[0]
|
||||
|
||||
vbox = gtk.VBox(True,spacing = 0)
|
||||
|
||||
###################################### NAME ROW + COL #################################
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_size_request(300,-1)
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Name: </span>" + name)
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
###################################### SIZE ROW + COL ######################################
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_size_request(300,-1)
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Size: </span>" + size)
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
##################################### RECIPE ROW + COL #########################################
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_size_request(300,-1)
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Recipe: </span>" + recipe)
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
##################################### BINB ROW + COL #######################################
|
||||
|
||||
if binb != '':
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Brought in by: </span>")
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.label_info = gtk.Label()
|
||||
self.label_info.set_size_request(300,-1)
|
||||
self.label_info.set_selectable(True)
|
||||
self.label_info.set_line_wrap(True)
|
||||
self.label_info.set_markup(binb)
|
||||
self.label_info.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
self.vbox.add(self.label_info)
|
||||
|
||||
#################################### FILES BROUGHT BY PACKAGES ###################################
|
||||
|
||||
if file_list != '':
|
||||
|
||||
self.textWindow = gtk.ScrolledWindow()
|
||||
self.textWindow.set_shadow_type(gtk.SHADOW_IN)
|
||||
self.textWindow.set_policy(gtk.POLICY_AUTOMATIC, gtk.POLICY_AUTOMATIC)
|
||||
self.textWindow.set_size_request(100, 170)
|
||||
|
||||
sstatemirrors_store = gtk.ListStore(str)
|
||||
|
||||
self.sstatemirrors_tv = gtk.TreeView()
|
||||
self.sstatemirrors_tv.set_rules_hint(True)
|
||||
self.sstatemirrors_tv.set_headers_visible(True)
|
||||
self.textWindow.add(self.sstatemirrors_tv)
|
||||
|
||||
self.cell1 = gtk.CellRendererText()
|
||||
col1 = gtk.TreeViewColumn('Package files', self.cell1)
|
||||
col1.set_cell_data_func(self.cell1, self.regex_field)
|
||||
self.sstatemirrors_tv.append_column(col1)
|
||||
|
||||
for items in file_list.split(']'):
|
||||
if len(items) > 1:
|
||||
paths_temp = items.split(":")[0]
|
||||
paths_binb.append(paths_temp.strip(" ,'"))
|
||||
files_temp = items.split(":")[1]
|
||||
files_binb.append(files_temp.strip(" ['"))
|
||||
|
||||
unsorted_list = []
|
||||
|
||||
for items in range(len(paths_binb)):
|
||||
if len(files_binb[items]) > 1:
|
||||
for aduse in (files_binb[items].split(",")):
|
||||
unsorted_list.append(paths_binb[items].split(name)[len(paths_binb[items].split(name))-1] + '/' + aduse.strip(" '"))
|
||||
|
||||
|
||||
unsorted_list.sort()
|
||||
for items in unsorted_list:
|
||||
temp = items
|
||||
while len(items) > 35:
|
||||
items = items[:len(items)/2] + "" + items[len(items)/2+1:]
|
||||
if len(items) == 35:
|
||||
items = items[:len(items)/2] + "..." + items[len(items)/2+3:]
|
||||
self.tooltip_items[items] = temp
|
||||
|
||||
sstatemirrors_store.append([str(items)])
|
||||
|
||||
|
||||
self.sstatemirrors_tv.set_model(sstatemirrors_store)
|
||||
|
||||
tips = gtk.Tooltips()
|
||||
tips.set_tip(self.sstatemirrors_tv, "")
|
||||
self.sstatemirrors_tv.connect("motion-notify-event", self.treeViewTooltip, tips, 0)
|
||||
self.sstatemirrors_tv.set_events(gtk.gdk.POINTER_MOTION_MASK)
|
||||
|
||||
self.vbox.add(self.textWindow)
|
||||
|
||||
self.vbox.show_all()
|
||||
|
||||
|
||||
def regex_field(self, column, cell, model, iter):
|
||||
cell.set_property('text', model.get_value(iter, 0))
|
||||
return
|
||||
|
||||
|
||||
def create_recipe_visual_elements(self):
|
||||
|
||||
summary = self.properties['summary']
|
||||
name = self.properties['name']
|
||||
version = self.properties['version']
|
||||
revision = self.properties['revision']
|
||||
binb = self.properties['binb']
|
||||
group = self.properties['group']
|
||||
license = self.properties['license']
|
||||
homepage = self.properties['homepage']
|
||||
bugtracker = self.properties['bugtracker']
|
||||
description = self.properties['description']
|
||||
|
||||
self.set_resizable(False)
|
||||
|
||||
#cleaning out the version variable and also the summary
|
||||
version = version.split(":")[1]
|
||||
if len(version) > 30:
|
||||
version = version.split("+")[0]
|
||||
else:
|
||||
version = version.split("-")[0]
|
||||
license = license.replace("&" , "and")
|
||||
if (homepage == ''):
|
||||
homepage = 'unknown'
|
||||
if (bugtracker == ''):
|
||||
bugtracker = 'unknown'
|
||||
summary = summary.split("+")[0]
|
||||
|
||||
#calculating the rows needed for the table
|
||||
binb_items_count = len(binb.split(','))
|
||||
binb_items = binb.split(',')
|
||||
|
||||
vbox = gtk.VBox(False,spacing = 0)
|
||||
|
||||
######################################## SUMMARY LABEL #########################################
|
||||
|
||||
if summary != '':
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_width_chars(37)
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<b>" + summary + "</b>")
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
########################################## NAME ROW + COL #######################################
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Name: </span>" + name)
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
####################################### VERSION ROW + COL ####################################
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Version: </span>" + version)
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
##################################### REVISION ROW + COL #####################################
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Revision: </span>" + revision)
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
################################## GROUP ROW + COL ############################################
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Group: </span>" + group)
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
################################# HOMEPAGE ROW + COL ############################################
|
||||
|
||||
if homepage != 'unknown':
|
||||
self.label_info = gtk.Label()
|
||||
self.label_info.set_selectable(True)
|
||||
self.label_info.set_line_wrap(True)
|
||||
if len(homepage) > 35:
|
||||
self.label_info.set_markup("<a href=\"" + homepage + "\">" + homepage[0:35] + "..." + "</a>")
|
||||
else:
|
||||
self.label_info.set_markup("<a href=\"" + homepage + "\">" + homepage[0:60] + "</a>")
|
||||
|
||||
self.label_info.set_property("xalign", 0)
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<b>Homepage: </b>")
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
self.vbox.add(self.label_info)
|
||||
|
||||
################################# BUGTRACKER ROW + COL ###########################################
|
||||
|
||||
if bugtracker != 'unknown':
|
||||
self.label_info = gtk.Label()
|
||||
self.label_info.set_selectable(True)
|
||||
self.label_info.set_line_wrap(True)
|
||||
if len(bugtracker) > 35:
|
||||
self.label_info.set_markup("<a href=\"" + bugtracker + "\">" + bugtracker[0:35] + "..." + "</a>")
|
||||
else:
|
||||
self.label_info.set_markup("<a href=\"" + bugtracker + "\">" + bugtracker[0:60] + "</a>")
|
||||
self.label_info.set_property("xalign", 0)
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<b>Bugtracker: </b>")
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
self.vbox.add(self.label_info)
|
||||
|
||||
################################# LICENSE ROW + COL ############################################
|
||||
|
||||
self.label_info = gtk.Label()
|
||||
self.label_info.set_selectable(True)
|
||||
self.label_info.set_line_wrap(True)
|
||||
self.label_info.set_markup(license)
|
||||
self.label_info.set_property("xalign", 0)
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">License: </span>")
|
||||
self.label_short.set_property("xalign", 0)
|
||||
|
||||
self.vbox.add(self.label_short)
|
||||
self.vbox.add(self.label_info)
|
||||
|
||||
################################### BINB ROW+COL #############################################
|
||||
|
||||
if binb != '':
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Brought in by: </span>")
|
||||
self.label_short.set_property("xalign", 0)
|
||||
self.vbox.add(self.label_short)
|
||||
self.label_info = gtk.Label()
|
||||
self.label_info.set_selectable(True)
|
||||
self.label_info.set_width_chars(36)
|
||||
if len(binb) > 200:
|
||||
scrolled_window = gtk.ScrolledWindow()
|
||||
scrolled_window.set_policy(gtk.POLICY_NEVER,gtk.POLICY_ALWAYS)
|
||||
scrolled_window.set_size_request(100,100)
|
||||
self.label_info.set_markup(binb)
|
||||
self.label_info.set_padding(6,6)
|
||||
self.label_info.set_alignment(0,0)
|
||||
self.label_info.set_line_wrap(True)
|
||||
scrolled_window.add_with_viewport(self.label_info)
|
||||
self.vbox.add(scrolled_window)
|
||||
else:
|
||||
self.label_info.set_markup(binb)
|
||||
self.label_info.set_property("xalign", 0)
|
||||
self.label_info.set_line_wrap(True)
|
||||
self.vbox.add(self.label_info)
|
||||
|
||||
################################ DESCRIPTION TAG ROW #################################################
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.label_short.set_markup("<span weight=\"bold\">Description </span>")
|
||||
self.label_short.set_property("xalign", 0)
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
################################ DESCRIPTION INFORMATION ROW ##########################################
|
||||
|
||||
hbox = gtk.HBox(True,spacing = 0)
|
||||
|
||||
self.label_short = gtk.Label()
|
||||
self.label_short.set_selectable(True)
|
||||
self.label_short.set_width_chars(36)
|
||||
if len(description) > 200:
|
||||
scrolled_window = gtk.ScrolledWindow()
|
||||
scrolled_window.set_policy(gtk.POLICY_NEVER,gtk.POLICY_ALWAYS)
|
||||
scrolled_window.set_size_request(100,100)
|
||||
self.label_short.set_markup(description)
|
||||
self.label_short.set_padding(6,6)
|
||||
self.label_short.set_alignment(0,0)
|
||||
self.label_short.set_line_wrap(True)
|
||||
scrolled_window.add_with_viewport(self.label_short)
|
||||
self.vbox.add(scrolled_window)
|
||||
else:
|
||||
self.label_short.set_markup(description)
|
||||
self.label_short.set_property("xalign", 0)
|
||||
self.label_short.set_line_wrap(True)
|
||||
self.vbox.add(self.label_short)
|
||||
|
||||
self.vbox.show_all()
|
||||
@@ -1,90 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2011-2012 Intel Corporation
|
||||
#
|
||||
# Authored by Joshua Lock <josh@linux.intel.com>
|
||||
# Authored by Dongxiao Xu <dongxiao.xu@intel.com>
|
||||
# Authored by Shane Wang <shane.wang@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
from bb.ui.crumbs.hig.crumbsdialog import CrumbsDialog
|
||||
|
||||
"""
|
||||
The following are convenience classes for implementing GNOME HIG compliant
|
||||
BitBake GUI's
|
||||
In summary: spacing = 12px, border-width = 6px
|
||||
"""
|
||||
|
||||
class ProxyDetailsDialog (CrumbsDialog):
|
||||
|
||||
def __init__(self, title, user, passwd, parent, flags, buttons=None):
|
||||
super(ProxyDetailsDialog, self).__init__(title, parent, flags, buttons)
|
||||
self.connect("response", self.response_cb)
|
||||
|
||||
self.auth = not (user == None or passwd == None or user == "")
|
||||
self.user = user or ""
|
||||
self.passwd = passwd or ""
|
||||
|
||||
# create visual elements on the dialog
|
||||
self.create_visual_elements()
|
||||
|
||||
def create_visual_elements(self):
|
||||
self.auth_checkbox = gtk.CheckButton("Use authentication")
|
||||
self.auth_checkbox.set_tooltip_text("Check this box to set the username and the password")
|
||||
self.auth_checkbox.set_active(self.auth)
|
||||
self.auth_checkbox.connect("toggled", self.auth_checkbox_toggled_cb)
|
||||
self.vbox.pack_start(self.auth_checkbox, expand=False, fill=False)
|
||||
|
||||
hbox = gtk.HBox(False, 6)
|
||||
self.user_label = gtk.Label("Username:")
|
||||
self.user_text = gtk.Entry()
|
||||
self.user_text.set_text(self.user)
|
||||
hbox.pack_start(self.user_label, expand=False, fill=False)
|
||||
hbox.pack_end(self.user_text, expand=False, fill=False)
|
||||
self.vbox.pack_start(hbox, expand=False, fill=False)
|
||||
|
||||
hbox = gtk.HBox(False, 6)
|
||||
self.passwd_label = gtk.Label("Password:")
|
||||
self.passwd_text = gtk.Entry()
|
||||
self.passwd_text.set_text(self.passwd)
|
||||
hbox.pack_start(self.passwd_label, expand=False, fill=False)
|
||||
hbox.pack_end(self.passwd_text, expand=False, fill=False)
|
||||
self.vbox.pack_start(hbox, expand=False, fill=False)
|
||||
|
||||
self.refresh_auth_components()
|
||||
self.show_all()
|
||||
|
||||
def refresh_auth_components(self):
|
||||
self.user_label.set_sensitive(self.auth)
|
||||
self.user_text.set_editable(self.auth)
|
||||
self.user_text.set_sensitive(self.auth)
|
||||
self.passwd_label.set_sensitive(self.auth)
|
||||
self.passwd_text.set_editable(self.auth)
|
||||
self.passwd_text.set_sensitive(self.auth)
|
||||
|
||||
def auth_checkbox_toggled_cb(self, button):
|
||||
self.auth = self.auth_checkbox.get_active()
|
||||
self.refresh_auth_components()
|
||||
|
||||
def response_cb(self, dialog, response_id):
|
||||
if response_id == gtk.RESPONSE_OK:
|
||||
if self.auth:
|
||||
self.user = self.user_text.get_text()
|
||||
self.passwd = self.passwd_text.get_text()
|
||||
else:
|
||||
self.user = None
|
||||
self.passwd = None
|
||||
@@ -1,51 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2013 Intel Corporation
|
||||
#
|
||||
# Authored by Cristiana Voicu <cristiana.voicu@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
|
||||
class RetrieveImageDialog (gtk.FileChooserDialog):
|
||||
"""
|
||||
This class is used to create a dialog that permits to retrieve
|
||||
a custom image saved previously from Hob.
|
||||
"""
|
||||
def __init__(self, directory,title, parent, flags, buttons=None):
|
||||
super(RetrieveImageDialog, self).__init__(title, None, gtk.FILE_CHOOSER_ACTION_OPEN,
|
||||
(gtk.STOCK_CANCEL, gtk.RESPONSE_CANCEL,gtk.STOCK_OPEN, gtk.RESPONSE_OK))
|
||||
self.directory = directory
|
||||
|
||||
# create visual elements on the dialog
|
||||
self.create_visual_elements()
|
||||
|
||||
def create_visual_elements(self):
|
||||
self.set_show_hidden(True)
|
||||
self.set_default_response(gtk.RESPONSE_OK)
|
||||
self.set_current_folder(self.directory)
|
||||
|
||||
vbox = self.get_children()[0].get_children()[0].get_children()[0]
|
||||
for child in vbox.get_children()[0].get_children()[0].get_children()[0].get_children():
|
||||
vbox.get_children()[0].get_children()[0].get_children()[0].remove(child)
|
||||
|
||||
label1 = gtk.Label()
|
||||
label1.set_text("File system" + self.directory)
|
||||
label1.show()
|
||||
vbox.get_children()[0].get_children()[0].get_children()[0].pack_start(label1, expand=False, fill=False, padding=0)
|
||||
vbox.get_children()[0].get_children()[1].get_children()[0].hide()
|
||||
|
||||
self.get_children()[0].get_children()[1].get_children()[0].set_label("Select")
|
||||
@@ -1,151 +0,0 @@
|
||||
#
|
||||
# BitBake Graphical GTK User Interface
|
||||
#
|
||||
# Copyright (C) 2013 Intel Corporation
|
||||
#
|
||||
# Authored by Cristiana Voicu <cristiana.voicu@intel.com>
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import gtk
|
||||
import glib
|
||||
from bb.ui.crumbs.hig.crumbsdialog import CrumbsDialog
|
||||
from bb.ui.crumbs.hig.crumbsmessagedialog import CrumbsMessageDialog
|
||||
from bb.ui.crumbs.hobwidget import HobButton
|
||||
|
||||
class SaveImageDialog (CrumbsDialog):
|
||||
"""
|
||||
This class is used to create a dialog that permits to save
|
||||
a custom image in a predefined directory.
|
||||
"""
|
||||
def __init__(self, directory, name, description, title, parent, flags, buttons=None):
|
||||
super(SaveImageDialog, self).__init__(title, parent, flags, buttons)
|
||||
self.directory = directory
|
||||
self.builder = parent
|
||||
self.name_field = name
|
||||
self.description_field = description
|
||||
|
||||
# create visual elements on the dialog
|
||||
self.create_visual_elements()
|
||||
|
||||
def create_visual_elements(self):
|
||||
self.set_default_response(gtk.RESPONSE_OK)
|
||||
self.vbox.set_border_width(6)
|
||||
|
||||
sub_vbox = gtk.VBox(False, 12)
|
||||
self.vbox.pack_start(sub_vbox, expand=False, fill=False)
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0, 0)
|
||||
label.set_markup("<b>Name</b>")
|
||||
sub_label = gtk.Label()
|
||||
sub_label.set_alignment(0, 0)
|
||||
content = "Image recipe names should be all lowercase and include only alphanumeric\n"
|
||||
content += "characters. The only special character you can use is the ASCII hyphen (-)."
|
||||
sub_label.set_markup(content)
|
||||
self.name_entry = gtk.Entry()
|
||||
self.name_entry.set_text(self.name_field)
|
||||
self.name_entry.set_size_request(350,30)
|
||||
self.name_entry.connect("changed", self.name_entry_changed)
|
||||
sub_vbox.pack_start(label, expand=False, fill=False)
|
||||
sub_vbox.pack_start(sub_label, expand=False, fill=False)
|
||||
sub_vbox.pack_start(self.name_entry, expand=False, fill=False)
|
||||
|
||||
sub_vbox = gtk.VBox(False, 12)
|
||||
self.vbox.pack_start(sub_vbox, expand=False, fill=False)
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0, 0)
|
||||
label.set_markup("<b>Description</b> (optional)")
|
||||
sub_label = gtk.Label()
|
||||
sub_label.set_alignment(0, 0)
|
||||
sub_label.set_markup("The description should be less than 150 characters long.")
|
||||
self.description_entry = gtk.TextView()
|
||||
self.description_entry.get_buffer().set_text(self.description_field)
|
||||
self.description_entry.set_wrap_mode(gtk.WRAP_WORD)
|
||||
self.description_entry.set_size_request(350,150)
|
||||
sub_vbox.pack_start(label, expand=False, fill=False)
|
||||
sub_vbox.pack_start(sub_label, expand=False, fill=False)
|
||||
sub_vbox.pack_start(self.description_entry, expand=False, fill=False)
|
||||
|
||||
sub_vbox = gtk.VBox(False, 12)
|
||||
self.vbox.pack_start(sub_vbox, expand=False, fill=False)
|
||||
label = gtk.Label()
|
||||
label.set_alignment(0, 0)
|
||||
label.set_markup("Your image recipe will be saved to:")
|
||||
sub_label = gtk.Label()
|
||||
sub_label.set_alignment(0, 0)
|
||||
sub_label.set_markup(self.directory)
|
||||
sub_vbox.pack_start(label, expand=False, fill=False)
|
||||
sub_vbox.pack_start(sub_label, expand=False, fill=False)
|
||||
|
||||
table = gtk.Table(1, 4, True)
|
||||
|
||||
cancel_button = gtk.Button()
|
||||
cancel_button.set_label("Cancel")
|
||||
cancel_button.connect("clicked", self.cancel_button_cb)
|
||||
cancel_button.set_size_request(110, 30)
|
||||
|
||||
self.save_button = gtk.Button()
|
||||
self.save_button.set_label("Save")
|
||||
self.save_button.connect("clicked", self.save_button_cb)
|
||||
self.save_button.set_size_request(110, 30)
|
||||
if self.name_entry.get_text() == '':
|
||||
self.save_button.set_sensitive(False)
|
||||
|
||||
table.attach(cancel_button, 2, 3, 0, 1)
|
||||
table.attach(self.save_button, 3, 4, 0, 1)
|
||||
self.vbox.pack_end(table, expand=False, fill=False)
|
||||
|
||||
self.show_all()
|
||||
|
||||
def name_entry_changed(self, entry):
|
||||
text = entry.get_text()
|
||||
if text == '':
|
||||
self.save_button.set_sensitive(False)
|
||||
else:
|
||||
self.save_button.set_sensitive(True)
|
||||
|
||||
def cancel_button_cb(self, button):
|
||||
self.destroy()
|
||||
|
||||
def save_button_cb(self, button):
|
||||
text = self.name_entry.get_text()
|
||||
new_text = text.replace("-","")
|
||||
description_buffer = self.description_entry.get_buffer()
|
||||
description = description_buffer.get_text(description_buffer.get_start_iter(),description_buffer.get_end_iter())
|
||||
if new_text.islower() and new_text.isalnum():
|
||||
self.builder.image_details_page.image_saved = True
|
||||
self.builder.customized = False
|
||||
self.builder.generate_new_image(self.directory+text, description)
|
||||
self.builder.recipe_model.set_in_list(text, description)
|
||||
self.builder.recipe_model.set_selected_image(text)
|
||||
self.builder.image_details_page.show_page(self.builder.IMAGE_GENERATED)
|
||||
self.builder.image_details_page.name_field_template = text
|
||||
self.builder.image_details_page.description_field_template = description
|
||||
self.destroy()
|
||||
else:
|
||||
self.show_invalid_input_error_dialog()
|
||||
|
||||
def show_invalid_input_error_dialog(self):
|
||||
lbl = "<b>Invalid characters in image recipe name</b>\n"
|
||||
msg = "Image recipe names should be all lowercase and\n"
|
||||
msg += "include only alphanumeric characters. The only\n"
|
||||
msg += "special character you can use is the ASCII hyphen (-)."
|
||||
lbl = lbl + "\n%s\n" % glib.markup_escape_text(msg)
|
||||
dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_ERROR)
|
||||
button = dialog.add_button("Close", gtk.RESPONSE_OK)
|
||||
HobButton.style_button(button)
|
||||
|
||||
res = dialog.run()
|
||||
self.name_entry.grab_focus()
|
||||
dialog.destroy()
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user