mirror of
https://git.yoctoproject.org/poky
synced 2026-02-15 21:23:04 +01:00
Compare commits
397 Commits
yocto-2.5.
...
dizzy-12.0
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
b38454c2e3 | ||
|
|
19f07a31a6 | ||
|
|
03666c8a74 | ||
|
|
85f6cf736b | ||
|
|
a01280b7ab | ||
|
|
800a3dc9b0 | ||
|
|
bdfee8758e | ||
|
|
915498e230 | ||
|
|
8897773fe4 | ||
|
|
2e6494e55a | ||
|
|
55fbde1fde | ||
|
|
3a2725e5d9 | ||
|
|
adcc476412 | ||
|
|
ab4cc02bf8 | ||
|
|
01c1167336 | ||
|
|
c1803b774a | ||
|
|
d526b3f9ac | ||
|
|
e74c4a5ff4 | ||
|
|
1a99652a88 | ||
|
|
20db29fb4d | ||
|
|
f7b041121e | ||
|
|
7a263b2e60 | ||
|
|
117d9b2f45 | ||
|
|
a4162fa9fa | ||
|
|
5a3899981c | ||
|
|
db031c40bb | ||
|
|
b64eae5767 | ||
|
|
0e6473ad75 | ||
|
|
27fc73496c | ||
|
|
012e1a4431 | ||
|
|
137f52ac3a | ||
|
|
ebe3096910 | ||
|
|
f1c45d15c2 | ||
|
|
fd35017edf | ||
|
|
e07aa344ee | ||
|
|
112839bebe | ||
|
|
f48d1a75e1 | ||
|
|
4d41954e94 | ||
|
|
53b0be3761 | ||
|
|
ca052426a6 | ||
|
|
540b92736c | ||
|
|
a93005e6d0 | ||
|
|
cfc5952b11 | ||
|
|
1b492dfcdd | ||
|
|
bf3ee430a4 | ||
|
|
abd315bc05 | ||
|
|
1e6d987374 | ||
|
|
38a334ad84 | ||
|
|
00fce45b55 | ||
|
|
fcd25c6d2e | ||
|
|
9f363a9c8a | ||
|
|
19bce8f5c6 | ||
|
|
1d909fb8da | ||
|
|
d19d976bf5 | ||
|
|
ea2e7dbcd7 | ||
|
|
215c4d948d | ||
|
|
9ae261263a | ||
|
|
22690105da | ||
|
|
3054c73445 | ||
|
|
c5a583e8bd | ||
|
|
7113efd02d | ||
|
|
b469799103 | ||
|
|
0891b8789d | ||
|
|
b8b7df8304 | ||
|
|
0c1c0877e8 | ||
|
|
c930052636 | ||
|
|
6d307e9b0c | ||
|
|
d0315a6cdf | ||
|
|
5f0d25152b | ||
|
|
9c4ff467f6 | ||
|
|
6adbd2deb9 | ||
|
|
9fd145d27e | ||
|
|
29812e6173 | ||
|
|
80bc382c62 | ||
|
|
0dc2a530df | ||
|
|
6579836d82 | ||
|
|
3037db60f7 | ||
|
|
46f73593c0 | ||
|
|
f460fd853b | ||
|
|
d098f7ed05 | ||
|
|
192a9e1031 | ||
|
|
c4ebd5d28b | ||
|
|
15892013ce | ||
|
|
489df6edb8 | ||
|
|
3251b84c20 | ||
|
|
1f994e8171 | ||
|
|
433ec67686 | ||
|
|
f77133783e | ||
|
|
29855df01e | ||
|
|
7bd5bf8947 | ||
|
|
d03e94ef47 | ||
|
|
bf6f9f44ad | ||
|
|
54e3c92279 | ||
|
|
c6b0ce743f | ||
|
|
6923ef6f94 | ||
|
|
9bbe7473a9 | ||
|
|
9c2e4e50a8 | ||
|
|
e8a260c9b8 | ||
|
|
8e7d7e5c3a | ||
|
|
5ed8733bac | ||
|
|
ff71dd264a | ||
|
|
12f3536d36 | ||
|
|
94e96643db | ||
|
|
b6cc30adf4 | ||
|
|
feaf9a98df | ||
|
|
9bdf737982 | ||
|
|
c316df044a | ||
|
|
4cf1a6af8e | ||
|
|
35e54baa51 | ||
|
|
4ac156de84 | ||
|
|
0143d3a6a9 | ||
|
|
fecee8ffdc | ||
|
|
67cabcd94f | ||
|
|
96852794bc | ||
|
|
c59e3bd26d | ||
|
|
c18e52c0c8 | ||
|
|
8e64c535af | ||
|
|
763bff1f22 | ||
|
|
0d1f75b9d6 | ||
|
|
542d9770f2 | ||
|
|
13cb1aea8c | ||
|
|
55303f7a38 | ||
|
|
8a00b63e43 | ||
|
|
ec75238f6c | ||
|
|
b90dd7944e | ||
|
|
82c8438428 | ||
|
|
0fecd492b2 | ||
|
|
f2a6123ba3 | ||
|
|
ff2621b86c | ||
|
|
2a3805a666 | ||
|
|
4c6ceb07f0 | ||
|
|
1f718df76e | ||
|
|
93e3df91aa | ||
|
|
dea47b2715 | ||
|
|
6e9632e979 | ||
|
|
59a85d3a95 | ||
|
|
b630f2f536 | ||
|
|
b91ca2c5fd | ||
|
|
5db1e07e1c | ||
|
|
f5d869d9d6 | ||
|
|
1c34a41ad2 | ||
|
|
9bef9b9ddd | ||
|
|
016d607e23 | ||
|
|
42195a3ff5 | ||
|
|
15ff8423dc | ||
|
|
83767cbe90 | ||
|
|
8b3b21494f | ||
|
|
17b4994c5f | ||
|
|
d97f1c2697 | ||
|
|
a1f594881d | ||
|
|
991597a272 | ||
|
|
eebe97cd35 | ||
|
|
50572b0104 | ||
|
|
769fb519be | ||
|
|
8e02546ddd | ||
|
|
dc565377c6 | ||
|
|
8e11a94b90 | ||
|
|
cfdeaeeb77 | ||
|
|
51d5204084 | ||
|
|
909a80fe34 | ||
|
|
71164f126b | ||
|
|
76ba20f9c0 | ||
|
|
82c567748a | ||
|
|
d3953fcb40 | ||
|
|
6f79439ce4 | ||
|
|
00af07c6b6 | ||
|
|
f30d619a63 | ||
|
|
2f598a8318 | ||
|
|
d2c3e23af6 | ||
|
|
ceb5a66d0b | ||
|
|
620718b05d | ||
|
|
8b255bd491 | ||
|
|
33cda871d3 | ||
|
|
f7ba14a571 | ||
|
|
bf32370c5e | ||
|
|
2ec5a5473e | ||
|
|
dddb84aae0 | ||
|
|
6c3ccc8ae9 | ||
|
|
0cf128ca1b | ||
|
|
86da1430b7 | ||
|
|
2a53df980d | ||
|
|
a1a8857fa6 | ||
|
|
6a07977e76 | ||
|
|
0de0abd9e4 | ||
|
|
8010a0f2cf | ||
|
|
37d5b56cb6 | ||
|
|
d31f7ec85b | ||
|
|
ad9ba796fa | ||
|
|
f7fc59f2fd | ||
|
|
f70b8b393d | ||
|
|
72a43adb4d | ||
|
|
64090cf0d8 | ||
|
|
41cca6fbe7 | ||
|
|
de51204518 | ||
|
|
eed2260137 | ||
|
|
81b8da4c88 | ||
|
|
289ccaa24d | ||
|
|
646cd97d24 | ||
|
|
384863c7bc | ||
|
|
0e65f09580 | ||
|
|
43a04ddc7f | ||
|
|
8abe4b8b2a | ||
|
|
53b33d85de | ||
|
|
9fc095a439 | ||
|
|
e13f2681b7 | ||
|
|
6dd21a9f15 | ||
|
|
b6e41cf744 | ||
|
|
cc6d968241 | ||
|
|
74bb618474 | ||
|
|
ab5c5e3a0e | ||
|
|
8e354428a2 | ||
|
|
a6f2e49038 | ||
|
|
63c0b4a441 | ||
|
|
9d20b675dd | ||
|
|
39e09709bf | ||
|
|
36e42c0ddb | ||
|
|
446acfb5a4 | ||
|
|
d7c61053da | ||
|
|
b52e2f4f2e | ||
|
|
4b7d844d84 | ||
|
|
510c27ad8c | ||
|
|
9ffc238025 | ||
|
|
7461790c39 | ||
|
|
69df8dc63f | ||
|
|
2658acef69 | ||
|
|
f20e4c0cf6 | ||
|
|
d77ee86680 | ||
|
|
36576c7087 | ||
|
|
7cacecf444 | ||
|
|
0b8a386a68 | ||
|
|
87f7ca2613 | ||
|
|
068a9f5cbe | ||
|
|
27a34b69a0 | ||
|
|
ec321182bd | ||
|
|
6540ecdb37 | ||
|
|
84d0b6fd98 | ||
|
|
37ca92bb2a | ||
|
|
8dde9d4bd4 | ||
|
|
b0feb20abc | ||
|
|
6ede9224f8 | ||
|
|
112c10ac64 | ||
|
|
484b928531 | ||
|
|
0fb10cf659 | ||
|
|
f7fd58319c | ||
|
|
554962b380 | ||
|
|
6a2ff9b067 | ||
|
|
b48b07f1fb | ||
|
|
b268f7cc93 | ||
|
|
8e9950dbaa | ||
|
|
4eab67dda8 | ||
|
|
89398c3e07 | ||
|
|
c54b9fb2ed | ||
|
|
64271845dc | ||
|
|
0d65f6c16d | ||
|
|
f8adeb08f1 | ||
|
|
e0cb09c6ac | ||
|
|
d04fdd5f9e | ||
|
|
b30db74cd8 | ||
|
|
7526e8d006 | ||
|
|
fb760567a3 | ||
|
|
b6079e0c71 | ||
|
|
8d0600569b | ||
|
|
dfd5bbdfa9 | ||
|
|
49ece9bb51 | ||
|
|
10710d7a92 | ||
|
|
527574602a | ||
|
|
25cdadb86b | ||
|
|
6b3673db74 | ||
|
|
e7d461a473 | ||
|
|
358794f2fb | ||
|
|
3c76f85d5f | ||
|
|
7e9d8bcada | ||
|
|
08613cc339 | ||
|
|
5381289530 | ||
|
|
d57978aafc | ||
|
|
7fe785d692 | ||
|
|
b3e9e56756 | ||
|
|
5d7fe4a07b | ||
|
|
6062cbe8db | ||
|
|
9f41c7df9e | ||
|
|
4e0180b746 | ||
|
|
fa75856b4b | ||
|
|
8d8e8d0a8e | ||
|
|
4157aa7c0b | ||
|
|
b0811fe4a2 | ||
|
|
8f21845460 | ||
|
|
3d101b429d | ||
|
|
a4814ac1b0 | ||
|
|
9b0df21b87 | ||
|
|
2d51c7e62c | ||
|
|
22861f8031 | ||
|
|
74dec87ce2 | ||
|
|
2558a15919 | ||
|
|
2c13c5d3fe | ||
|
|
769c4ebb4f | ||
|
|
69767a27cc | ||
|
|
c9a9e0199b | ||
|
|
c458dde820 | ||
|
|
9393fdbd7e | ||
|
|
0cfc7dd0a5 | ||
|
|
04ffa0b961 | ||
|
|
fdf882c091 | ||
|
|
2d40d3228d | ||
|
|
a832f18ac2 | ||
|
|
a0d91bbdef | ||
|
|
68f431e850 | ||
|
|
e5c3c1501b | ||
|
|
bb6990e057 | ||
|
|
2f2b081589 | ||
|
|
9d4df89e5b | ||
|
|
a6d7512b5e | ||
|
|
637580101c | ||
|
|
673bb3cffc | ||
|
|
09f6349eeb | ||
|
|
31f39a91e6 | ||
|
|
b8ea994e11 | ||
|
|
3725cdf43a | ||
|
|
3244f4540c | ||
|
|
ec853e4eea | ||
|
|
07fdc5a275 | ||
|
|
dda084e13c | ||
|
|
044039dc8e | ||
|
|
0bc80a3850 | ||
|
|
1020bc3de3 | ||
|
|
a291eb108b | ||
|
|
d0c969eeab | ||
|
|
6af63cc898 | ||
|
|
5211fb73f0 | ||
|
|
c8279678d4 | ||
|
|
21b15bc6cd | ||
|
|
de6e6a5a62 | ||
|
|
5e7218e8b0 | ||
|
|
bc6651cb31 | ||
|
|
a16aa96a08 | ||
|
|
59c7cb37bc | ||
|
|
1eceece8f6 | ||
|
|
0d9dd1d3da | ||
|
|
f09b49dd64 | ||
|
|
b9304ab75c | ||
|
|
28c4a4976d | ||
|
|
a6f13fe42f | ||
|
|
e8404413fe | ||
|
|
d6cbbee29c | ||
|
|
d6e0ea59b2 | ||
|
|
be22ea0314 | ||
|
|
3fc8d29953 | ||
|
|
becb32bb30 | ||
|
|
fa34c42d19 | ||
|
|
942e35d651 | ||
|
|
c35cecebc6 | ||
|
|
c72d8913b3 | ||
|
|
e3743bbe94 | ||
|
|
02627ad3d9 | ||
|
|
ecf1e3d1b1 | ||
|
|
2310ca25ed | ||
|
|
0185dcd883 | ||
|
|
b9e61a3203 | ||
|
|
e111bb329c | ||
|
|
28f6830a49 | ||
|
|
c292340b7a | ||
|
|
118cf7bc86 | ||
|
|
4d1745feb5 | ||
|
|
d6751f2293 | ||
|
|
880e8b26ed | ||
|
|
8d5259d953 | ||
|
|
9e8bb32215 | ||
|
|
aa8bfdfa22 | ||
|
|
5c69d24f56 | ||
|
|
b70ef7b95a | ||
|
|
bd00bc3d0d | ||
|
|
e741ebf210 | ||
|
|
db012b429f | ||
|
|
90a03e9c9d | ||
|
|
b466e00cf6 | ||
|
|
00af5317eb | ||
|
|
db7f4f31c9 | ||
|
|
33e95afc83 | ||
|
|
9bfb78bff6 | ||
|
|
cccad8c33f | ||
|
|
2138890fa6 | ||
|
|
19750cac36 | ||
|
|
5deb78802a | ||
|
|
ffdef91586 | ||
|
|
09430c66b3 | ||
|
|
929d04b404 | ||
|
|
081fddd3e4 | ||
|
|
9fcd5826d9 | ||
|
|
df87cb27ef | ||
|
|
2eb659d765 | ||
|
|
f3a177cf04 | ||
|
|
58a629a1a0 | ||
|
|
b9b5aeffa6 | ||
|
|
ff5510b3fa | ||
|
|
9aff3a4ec0 | ||
|
|
16ddd45421 | ||
|
|
1a6c3a385c | ||
|
|
e95863cee0 |
18
.gitignore
vendored
18
.gitignore
vendored
@@ -1,31 +1,23 @@
|
||||
*.pyc
|
||||
*.pyo
|
||||
/*.patch
|
||||
/build*/
|
||||
build*/
|
||||
pyshtables.py
|
||||
pstage/
|
||||
scripts/oe-git-proxy-socks
|
||||
sources/
|
||||
meta-*/
|
||||
!meta-skeleton
|
||||
!meta-selftest
|
||||
!meta-hob
|
||||
hob-image-*.bb
|
||||
*.swp
|
||||
*.orig
|
||||
*.rej
|
||||
*~
|
||||
!meta-poky
|
||||
!meta-yocto
|
||||
!meta-yocto-bsp
|
||||
!meta-yocto-imported
|
||||
/documentation/*/eclipse/
|
||||
/documentation/*/*.html
|
||||
/documentation/*/*.pdf
|
||||
/documentation/*/*.tgz
|
||||
/bitbake/doc/bitbake-user-manual/bitbake-user-manual.html
|
||||
/bitbake/doc/bitbake-user-manual/bitbake-user-manual.pdf
|
||||
/bitbake/doc/bitbake-user-manual/bitbake-user-manual.tgz
|
||||
documentation/user-manual/user-manual.html
|
||||
documentation/user-manual/user-manual.pdf
|
||||
documentation/user-manual/user-manual.tgz
|
||||
pull-*/
|
||||
bitbake/lib/toaster/contrib/tts/backlog.txt
|
||||
bitbake/lib/toaster/contrib/tts/log/*
|
||||
bitbake/lib/toaster/contrib/tts/.cache/*
|
||||
@@ -1,2 +1,2 @@
|
||||
# Template settings
|
||||
TEMPLATECONF=${TEMPLATECONF:-meta-poky/conf}
|
||||
TEMPLATECONF=${TEMPLATECONF:-meta-yocto/conf}
|
||||
|
||||
49
README
Normal file
49
README
Normal file
@@ -0,0 +1,49 @@
|
||||
Poky
|
||||
====
|
||||
|
||||
Poky is an integration of various components to form a complete prepackaged
|
||||
build system and development environment. It features support for building
|
||||
customised embedded device style images. There are reference demo images
|
||||
featuring a X11/Matchbox/GTK themed UI called Sato. The system supports
|
||||
cross-architecture application development using QEMU emulation and a
|
||||
standalone toolchain and SDK with IDE integration.
|
||||
|
||||
Additional information on the specifics of hardware that Poky supports
|
||||
is available in README.hardware. Further hardware support can easily be added
|
||||
in the form of layers which extend the systems capabilities in a modular way.
|
||||
|
||||
As an integration layer Poky consists of several upstream projects such as
|
||||
BitBake, OpenEmbedded-Core, Yocto documentation and various sources of information
|
||||
e.g. for the hardware support. Poky is in turn a component of the Yocto Project.
|
||||
|
||||
The Yocto Project has extensive documentation about the system including a
|
||||
reference manual which can be found at:
|
||||
http://yoctoproject.org/documentation
|
||||
|
||||
OpenEmbedded-Core is a layer containing the core metadata for current versions
|
||||
of OpenEmbedded. It is distro-less (can build a functional image with
|
||||
DISTRO = "nodistro") and contains only emulated machine support.
|
||||
|
||||
For information about OpenEmbedded, see the OpenEmbedded website:
|
||||
http://www.openembedded.org/
|
||||
|
||||
Where to Send Patches
|
||||
=====================
|
||||
|
||||
As Poky is an integration repository, patches against the various components
|
||||
should be sent to their respective upstreams.
|
||||
|
||||
bitbake:
|
||||
bitbake-devel@lists.openembedded.org
|
||||
|
||||
meta-yocto:
|
||||
poky@yoctoproject.org
|
||||
|
||||
Most everything else should be sent to the OpenEmbedded Core mailing list. If
|
||||
in doubt, check the oe-core git repository for the content you intend to modify.
|
||||
Before sending, be sure the patches apply cleanly to the current oe-core git
|
||||
repository.
|
||||
openembedded-core@lists.openembedded.org
|
||||
|
||||
Note: The scripts directory should be treated with extra care as it is a mix
|
||||
of oe-core and poky-specific files.
|
||||
26
README.LSB
26
README.LSB
@@ -1,26 +0,0 @@
|
||||
OE-Core aims to be able to provide basic LSB compatible images. There
|
||||
are some challenges for OE as LSB isn't always 100% relevant to its
|
||||
target embedded and IoT audiences.
|
||||
|
||||
One challenge is that the LSB spec is no longer being actively
|
||||
developed [https://github.com/LinuxStandardBase/lsb] and has
|
||||
components which are end of life or significantly dated. OE
|
||||
therefore provides compatibility with the following caveats:
|
||||
|
||||
* Qt4 is provided by the separate meta-qt4 layer. Its noted that Qt4
|
||||
is end of life and this isn't something the core project regularly
|
||||
tests any longer. Users are recommended to group together to support
|
||||
maintenance of that layer. [http://git.yoctoproject.org/cgit/cgit.cgi/meta-qt4/]
|
||||
|
||||
* mailx has been dropped since its no longer being developed upstream
|
||||
and there are better, more modern replacements such as s-nail
|
||||
(http://sdaoden.eu/code.html) or mailutils (http://mailutils.org/).
|
||||
|
||||
* A few perl modules that were required by LSB 4.x aren't provided:
|
||||
libclass-isa, libenv, libdumpvalue, libfile-checktree,
|
||||
libi18n-collate, libpod-plainer.
|
||||
|
||||
* libpng 1.2 isn't provided; oe-core includes the latest release of libpng
|
||||
instead.
|
||||
|
||||
* pax (POSIX standard archive) tool is not provided.
|
||||
@@ -1 +0,0 @@
|
||||
meta-yocto-bsp/README.hardware
|
||||
499
README.hardware
Normal file
499
README.hardware
Normal file
@@ -0,0 +1,499 @@
|
||||
Poky Hardware README
|
||||
====================
|
||||
|
||||
This file gives details about using Poky with the reference machines
|
||||
supported out of the box. A full list of supported reference target machines
|
||||
can be found by looking in the following directories:
|
||||
|
||||
meta/conf/machine/
|
||||
meta-yocto-bsp/conf/machine/
|
||||
|
||||
If you are in doubt about using Poky/OpenEmbedded with your hardware, consult
|
||||
the documentation for your board/device.
|
||||
|
||||
Support for additional devices is normally added by creating BSP layers - for
|
||||
more information please see the Yocto Board Support Package (BSP) Developer's
|
||||
Guide - documentation source is in documentation/bspguide or download the PDF
|
||||
from:
|
||||
|
||||
http://yoctoproject.org/documentation
|
||||
|
||||
Support for physical reference hardware has now been split out into a
|
||||
meta-yocto-bsp layer which can be removed separately from other layers if not
|
||||
needed.
|
||||
|
||||
|
||||
QEMU Emulation Targets
|
||||
======================
|
||||
|
||||
To simplify development, the build system supports building images to
|
||||
work with the QEMU emulator in system emulation mode. Several architectures
|
||||
are currently supported:
|
||||
|
||||
* ARM (qemuarm)
|
||||
* x86 (qemux86)
|
||||
* x86-64 (qemux86-64)
|
||||
* PowerPC (qemuppc)
|
||||
* MIPS (qemumips)
|
||||
|
||||
Use of the QEMU images is covered in the Yocto Project Reference Manual.
|
||||
The appropriate MACHINE variable value corresponding to the target is given
|
||||
in brackets.
|
||||
|
||||
|
||||
Hardware Reference Boards
|
||||
=========================
|
||||
|
||||
The following boards are supported by the meta-yocto-bsp layer:
|
||||
|
||||
* Texas Instruments Beaglebone (beaglebone)
|
||||
* Freescale MPC8315E-RDB (mpc8315e-rdb)
|
||||
|
||||
For more information see the board's section below. The appropriate MACHINE
|
||||
variable value corresponding to the board is given in brackets.
|
||||
|
||||
Reference Board Maintenance
|
||||
===========================
|
||||
|
||||
Send pull requests, patches, comments or questions about meta-yocto-bsps to poky@yoctoproject.org
|
||||
|
||||
Maintainers: Kevin Hao <kexin.hao@windriver.com>
|
||||
Bruce Ashfield <bruce.ashfield@windriver.com>
|
||||
|
||||
Consumer Devices
|
||||
================
|
||||
|
||||
The following consumer devices are supported by the meta-yocto-bsp layer:
|
||||
|
||||
* Intel x86 based PCs and devices (genericx86)
|
||||
* Ubiquiti Networks EdgeRouter Lite (edgerouter)
|
||||
|
||||
For more information see the device's section below. The appropriate MACHINE
|
||||
variable value corresponding to the device is given in brackets.
|
||||
|
||||
|
||||
|
||||
Specific Hardware Documentation
|
||||
===============================
|
||||
|
||||
|
||||
Intel x86 based PCs and devices (genericx86)
|
||||
==========================================
|
||||
|
||||
The genericx86 MACHINE is tested on the following platforms:
|
||||
|
||||
Intel Xeon/Core i-Series:
|
||||
+ Intel Romley Server: Sandy Bridge Xeon processor, C600 PCH (Patsburg), (Canoe Pass CRB)
|
||||
+ Intel Romley Server: Ivy Bridge Xeon processor, C600 PCH (Patsburg), (Intel SDP S2R3)
|
||||
+ Intel Crystal Forest Server: Sandy Bridge Xeon processor, DH89xx PCH (Cave Creek), (Stargo CRB)
|
||||
+ Intel Chief River Mobile: Ivy Bridge Mobile processor, QM77 PCH (Panther Point-M), (Emerald Lake II CRB, Sabino Canyon CRB)
|
||||
+ Intel Huron River Mobile: Sandy Bridge processor, QM67 PCH (Cougar Point), (Emerald Lake CRB, EVOC EC7-1817LNAR board)
|
||||
+ Intel Calpella Platform: Core i7 processor, QM57 PCH (Ibex Peak-M), (Red Fort CRB, Emerson MATXM CORE-411-B)
|
||||
+ Intel Nehalem/Westmere-EP Server: Xeon 56xx/55xx processors, 5520 chipset, ICH10R IOH (82801), (Hanlan Creek CRB)
|
||||
+ Intel Nehalem Workstation: Xeon 56xx/55xx processors, System SC5650SCWS (Greencity CRB)
|
||||
+ Intel Picket Post Server: Xeon 56xx/55xx processors (Jasper Forest), 3420 chipset (Ibex Peak), (Osage CRB)
|
||||
+ Intel Storage Platform: Sandy Bridge Xeon processor, C600 PCH (Patsburg), (Oak Creek Canyon CRB)
|
||||
+ Intel Shark Bay Client Platform: Haswell processor, LynxPoint PCH, (Walnut Canyon CRB, Lava Canyon CRB, Basking Ridge CRB, Flathead Creek CRB)
|
||||
+ Intel Shark Bay Ultrabook Platform: Haswell ULT processor, Lynx Point-LP PCH, (WhiteTip Mountain 1 CRB)
|
||||
|
||||
Intel Atom platforms:
|
||||
+ Intel embedded Menlow: Intel Atom Z510/530 CPU, System Controller Hub US15W (Portwell NANO-8044)
|
||||
+ Intel Luna Pier: Intel Atom N4xx/D5xx series CPU (aka: Pineview-D & -M), 82801HM I/O Hub (ICH8M), (Advantech AIMB-212, Moon Creek CRB)
|
||||
+ Intel Queens Bay platform: Intel Atom E6xx CPU (aka: Tunnel Creek), Topcliff EG20T I/O Hub (Emerson NITX-315, Crown Bay CRB, Minnow Board)
|
||||
+ Intel Fish River Island platform: Intel Atom E6xx CPU (aka: Tunnel Creek), Topcliff EG20T I/O Hub (Kontron KM2M806)
|
||||
+ Intel Cedar Trail platform: Intel Atom N2000 & D2000 series CPU (aka: Cedarview), NM10 Express Chipset (Norco kit BIS-6630, Cedar Rock CRB)
|
||||
|
||||
and is likely to work on many unlisted Atom/Core/Xeon based devices. The MACHINE
|
||||
type supports ethernet, wifi, sound, and Intel/vesa graphics by default in
|
||||
addition to common PC input devices, busses, and so on. Note that it does not
|
||||
included the binary-only graphic drivers used on some Atom platforms, for
|
||||
accelerated graphics on these machines please refer to meta-intel.
|
||||
|
||||
Depending on the device, it can boot from a traditional hard-disk, a USB device,
|
||||
or over the network. Writing generated images to physical media is
|
||||
straightforward with a caveat for USB devices. The following examples assume the
|
||||
target boot device is /dev/sdb, be sure to verify this and use the correct
|
||||
device as the following commands are run as root and are not reversable.
|
||||
|
||||
USB Device:
|
||||
1. Build a live image. This image type consists of a simple filesystem
|
||||
without a partition table, which is suitable for USB keys, and with the
|
||||
default setup for the genericx86 machine, this image type is built
|
||||
automatically for any image you build. For example:
|
||||
|
||||
$ bitbake core-image-minimal
|
||||
|
||||
2. Use the "dd" utility to write the image to the raw block device. For
|
||||
example:
|
||||
|
||||
# dd if=core-image-minimal-genericx86.hddimg of=/dev/sdb
|
||||
|
||||
If the device fails to boot with "Boot error" displayed, or apparently
|
||||
stops just after the SYSLINUX version banner, it is likely the BIOS cannot
|
||||
understand the physical layout of the disk (or rather it expects a
|
||||
particular layout and cannot handle anything else). There are two possible
|
||||
solutions to this problem:
|
||||
|
||||
1. Change the BIOS USB Device setting to HDD mode. The label will vary by
|
||||
device, but the idea is to force BIOS to read the Cylinder/Head/Sector
|
||||
geometry from the device.
|
||||
|
||||
2. Without such an option, the BIOS generally boots the device in USB-ZIP
|
||||
mode. To write an image to a USB device that will be bootable in
|
||||
USB-ZIP mode, carry out the following actions:
|
||||
|
||||
a. Determine the geometry of your USB device using fdisk:
|
||||
|
||||
# fdisk /dev/sdb
|
||||
Command (m for help): p
|
||||
|
||||
Disk /dev/sdb: 4011 MB, 4011491328 bytes
|
||||
124 heads, 62 sectors/track, 1019 cylinders, total 7834944 sectors
|
||||
...
|
||||
|
||||
Command (m for help): q
|
||||
|
||||
b. Configure the USB device for USB-ZIP mode:
|
||||
|
||||
# mkdiskimage -4 /dev/sdb 1019 124 62
|
||||
|
||||
Where 1019, 124 and 62 are the cylinder, head and sectors/track counts
|
||||
as reported by fdisk (substitute the values reported for your device).
|
||||
When the operation has finished and the access LED (if any) on the
|
||||
device stops flashing, remove and reinsert the device to allow the
|
||||
kernel to detect the new partition layout.
|
||||
|
||||
c. Copy the contents of the image to the USB-ZIP mode device:
|
||||
|
||||
# mkdir /tmp/image
|
||||
# mkdir /tmp/usbkey
|
||||
# mount -o loop core-image-minimal-genericx86.hddimg /tmp/image
|
||||
# mount /dev/sdb4 /tmp/usbkey
|
||||
# cp -rf /tmp/image/* /tmp/usbkey
|
||||
|
||||
d. Install the syslinux boot loader:
|
||||
|
||||
# syslinux /dev/sdb4
|
||||
|
||||
e. Unmount everything:
|
||||
|
||||
# umount /tmp/image
|
||||
# umount /tmp/usbkey
|
||||
|
||||
Install the boot device in the target board and configure the BIOS to boot
|
||||
from it.
|
||||
|
||||
For more details on the USB-ZIP scenario, see the syslinux documentation:
|
||||
http://git.kernel.org/?p=boot/syslinux/syslinux.git;a=blob_plain;f=doc/usbkey.txt;hb=HEAD
|
||||
|
||||
|
||||
Texas Instruments Beaglebone (beaglebone)
|
||||
=========================================
|
||||
|
||||
The Beaglebone is an ARM Cortex-A8 development board with USB, Ethernet, 2D/3D
|
||||
accelerated graphics, audio, serial, JTAG, and SD/MMC. The Black adds a faster
|
||||
CPU, more RAM, eMMC flash and a micro HDMI port. The beaglebone MACHINE is
|
||||
tested on the following platforms:
|
||||
|
||||
o Beaglebone Black A6
|
||||
o Beaglebone A6 (the original "White" model)
|
||||
|
||||
The Beaglebone Black has eMMC, while the White does not. Pressing the USER/BOOT
|
||||
button when powering on will temporarily change the boot order. But for the sake
|
||||
of simplicity, these instructions assume you have erased the eMMC on the Black,
|
||||
so its boot behavior matches that of the White and boots off of SD card. To do
|
||||
this, issue the following commands from the u-boot prompt:
|
||||
|
||||
# mmc dev 1
|
||||
# mmc erase 0 512
|
||||
|
||||
To further tailor these instructions for your board, please refer to the
|
||||
documentation at http://www.beagleboard.org/bone and http://www.beagleboard.org/black
|
||||
|
||||
From a Linux system with access to the image files perform the following steps
|
||||
as root, replacing mmcblk0* with the SD card device on your machine (such as sdc
|
||||
if used via a usb card reader):
|
||||
|
||||
1. Partition and format an SD card:
|
||||
# fdisk -lu /dev/mmcblk0
|
||||
|
||||
Disk /dev/mmcblk0: 3951 MB, 3951034368 bytes
|
||||
255 heads, 63 sectors/track, 480 cylinders, total 7716864 sectors
|
||||
Units = sectors of 1 * 512 = 512 bytes
|
||||
|
||||
Device Boot Start End Blocks Id System
|
||||
/dev/mmcblk0p1 * 63 144584 72261 c Win95 FAT32 (LBA)
|
||||
/dev/mmcblk0p2 144585 465884 160650 83 Linux
|
||||
|
||||
# mkfs.vfat -F 16 -n "boot" /dev/mmcblk0p1
|
||||
# mke2fs -j -L "root" /dev/mmcblk0p2
|
||||
|
||||
The following assumes the SD card partitions 1 and 2 are mounted at
|
||||
/media/boot and /media/root respectively. Removing the card and reinserting
|
||||
it will do just that on most modern Linux desktop environments.
|
||||
|
||||
The files referenced below are made available after the build in
|
||||
build/tmp/deploy/images.
|
||||
|
||||
2. Install the boot loaders
|
||||
# cp MLO-beaglebone /media/boot/MLO
|
||||
# cp u-boot-beaglebone.img /media/boot/u-boot.img
|
||||
|
||||
3. Install the root filesystem
|
||||
# tar x -C /media/root -f core-image-$IMAGE_TYPE-beaglebone.tar.bz2
|
||||
|
||||
4. If using core-image-base or core-image-sato images, the SD card is ready
|
||||
and rootfs already contains the kernel, modules and device tree (DTB)
|
||||
files necessary to be booted with U-boot's default configuration, so
|
||||
skip directly to step 8.
|
||||
For core-image-minimal, proceed through next steps.
|
||||
|
||||
5. If using core-image-minimal rootfs, install the modules
|
||||
# tar x -C /media/root -f modules-beaglebone.tgz
|
||||
|
||||
6. If using core-image-minimal rootfs, install the kernel uImage into /boot
|
||||
directory of rootfs
|
||||
# cp uImage-beaglebone.bin /media/root/boot/uImage
|
||||
|
||||
7. If using core-image-minimal rootfs, also install device tree (DTB) files
|
||||
into /boot directory of rootfs
|
||||
# cp uImage-am335x-bone.dtb /media/root/boot/am335x-bone.dtb
|
||||
# cp uImage-am335x-boneblack.dtb /media/root/boot/am335x-boneblack.dtb
|
||||
|
||||
8. Unmount the SD partitions, insert the SD card into the Beaglebone, and
|
||||
boot the Beaglebone
|
||||
|
||||
|
||||
Freescale MPC8315E-RDB (mpc8315e-rdb)
|
||||
=====================================
|
||||
|
||||
The MPC8315 PowerPC reference platform (MPC8315E-RDB) is aimed at hardware and
|
||||
software development of network attached storage (NAS) and digital media server
|
||||
applications. The MPC8315E-RDB features the PowerQUICC II Pro processor, which
|
||||
includes a built-in security accelerator.
|
||||
|
||||
(Note: you may find it easier to order MPC8315E-RDBA; this appears to be the
|
||||
same board in an enclosure with accessories. In any case it is fully
|
||||
compatible with the instructions given here.)
|
||||
|
||||
Setup instructions
|
||||
------------------
|
||||
|
||||
You will need the following:
|
||||
* NFS root setup on your workstation
|
||||
* TFTP server installed on your workstation
|
||||
* Straight-thru 9-conductor serial cable (DB9, M/F) connected from your
|
||||
PC to UART1
|
||||
* Ethernet connected to the first ethernet port on the board
|
||||
|
||||
--- Preparation ---
|
||||
|
||||
Note: if you have altered your board's ethernet MAC address(es) from the
|
||||
defaults, or you need to do so because you want multiple boards on the same
|
||||
network, then you will need to change the values in the dts file (patch
|
||||
linux/arch/powerpc/boot/dts/mpc8315erdb.dts within the kernel source). If
|
||||
you have left them at the factory default then you shouldn't need to do
|
||||
anything here.
|
||||
|
||||
--- Booting from NFS root ---
|
||||
|
||||
Load the kernel and dtb (device tree blob), and boot the system as follows:
|
||||
|
||||
1. Get the kernel (uImage-mpc8315e-rdb.bin) and dtb (uImage-mpc8315e-rdb.dtb)
|
||||
files from the tmp/deploy directory, and make them available on your TFTP
|
||||
server.
|
||||
|
||||
2. Connect the board's first serial port to your workstation and then start up
|
||||
your favourite serial terminal so that you will be able to interact with
|
||||
the serial console. If you don't have a favourite, picocom is suggested:
|
||||
|
||||
$ picocom /dev/ttyUSB0 -b 115200
|
||||
|
||||
3. Power up or reset the board and press a key on the terminal when prompted
|
||||
to get to the U-Boot command line
|
||||
|
||||
4. Set up the environment in U-Boot:
|
||||
|
||||
=> setenv ipaddr <board ip>
|
||||
=> setenv serverip <tftp server ip>
|
||||
=> setenv bootargs root=/dev/nfs rw nfsroot=<nfsroot ip>:<rootfs path> ip=<board ip>:<server ip>:<gateway ip>:255.255.255.0:mpc8315e:eth0:off console=ttyS0,115200
|
||||
|
||||
5. Download the kernel and dtb, and boot:
|
||||
|
||||
=> tftp 1000000 uImage-mpc8315e-rdb.bin
|
||||
=> tftp 2000000 uImage-mpc8315e-rdb.dtb
|
||||
=> bootm 1000000 - 2000000
|
||||
|
||||
--- Booting from JFFS2 root ---
|
||||
|
||||
1. First boot the board with NFS root.
|
||||
|
||||
2. Erase the MTD partition which will be used as root:
|
||||
|
||||
$ flash_eraseall /dev/mtd3
|
||||
|
||||
3. Copy the JFFS2 image to the MTD partition:
|
||||
|
||||
$ flashcp core-image-minimal-mpc8315e-rdb.jffs2 /dev/mtd3
|
||||
|
||||
4. Then reboot the board and set up the environment in U-Boot:
|
||||
|
||||
=> setenv bootargs root=/dev/mtdblock3 rootfstype=jffs2 console=ttyS0,115200
|
||||
|
||||
|
||||
Ubiquiti Networks EdgeRouter Lite (edgerouter)
|
||||
==============================================
|
||||
|
||||
The EdgeRouter Lite is part of the EdgeMax series. It is a MIPS64 router
|
||||
(based on the Cavium Octeon processor) with 512MB of RAM, which uses an
|
||||
internal USB pendrive for storage.
|
||||
|
||||
Setup instructions
|
||||
------------------
|
||||
|
||||
You will need the following:
|
||||
* NFS root setup on your workstation
|
||||
* TFTP server installed on your workstation
|
||||
* RJ45 -> serial ("rollover") cable connected from your PC to the CONSOLE
|
||||
port on the board
|
||||
* Ethernet connected to the first ethernet port on the board
|
||||
|
||||
--- Preparation ---
|
||||
|
||||
Build an image (e.g. core-image-minimal) using "edgerouter" as the MACHINE.
|
||||
In the following instruction it is based on core-image-minimal. Another target
|
||||
may be similiar with it.
|
||||
|
||||
--- Booting from NFS root ---
|
||||
|
||||
Load the kernel, and boot the system as follows:
|
||||
|
||||
1. Get the kernel (vmlinux) file from the tmp/deploy/images/edgerouter
|
||||
directory, and make them available on your TFTP server.
|
||||
|
||||
2. Connect the board's first serial port to your workstation and then start up
|
||||
your favourite serial terminal so that you will be able to interact with
|
||||
the serial console. If you don't have a favourite, picocom is suggested:
|
||||
|
||||
$ picocom /dev/ttyS0 -b 115200
|
||||
|
||||
3. Power up or reset the board and press a key on the terminal when prompted
|
||||
to get to the U-Boot command line
|
||||
|
||||
4. Set up the environment in U-Boot:
|
||||
|
||||
=> setenv ipaddr <board ip>
|
||||
=> setenv serverip <tftp server ip>
|
||||
|
||||
5. Download the kernel and boot:
|
||||
|
||||
=> tftp tftp $loadaddr vmlinux
|
||||
=> bootoctlinux $loadaddr coremask=0x3 root=/dev/nfs rw nfsroot=<nfsroot ip>:<rootfs path> ip=<board ip>:<server ip>:<gateway ip>:<netmask>:edgerouter:eth0:off mtdparts=phys_mapped_flash:512k(boot0),512k(boot1),64k@3072k(eeprom)
|
||||
|
||||
--- Booting from USB root ---
|
||||
|
||||
To boot from the USB disk, you either need to remove it from the edgerouter
|
||||
box and populate it from another computer, or use a previously booted NFS
|
||||
image and populate from the edgerouter itself.
|
||||
|
||||
Type 1: Mounted USB disk
|
||||
------------------------
|
||||
|
||||
To boot from the USB disk there are two available partitions on the factory
|
||||
USB storage. The rest of this guide assumes that these partitions are left
|
||||
intact. If you change the partition scheme, you must update your boot method
|
||||
appropriately.
|
||||
|
||||
The standard partitions are:
|
||||
|
||||
- 1: vfat partition containing factory kernels
|
||||
- 2: ext3 partition for the root filesystem.
|
||||
|
||||
You can place the kernel on either partition 1, or partition 2, but the roofs
|
||||
must go on partition 2 (due to its size).
|
||||
|
||||
Note: If you place the kernel on the ext3 partition, you must re-create the
|
||||
ext3 filesystem, since the factory u-boot can only handle 128 byte inodes and
|
||||
cannot read the partition otherwise.
|
||||
|
||||
Steps:
|
||||
|
||||
1. Remove the USB disk from the edgerouter and insert it into a computer
|
||||
that has access to your build artifacts.
|
||||
|
||||
2. Copy the kernel image to the USB storage (assuming discovered as 'sdb' on
|
||||
the development machine):
|
||||
|
||||
2a) if booting from vfat
|
||||
|
||||
# mount /dev/sdb1 /mnt
|
||||
# cp tmp/deploy/images/edgerouter/vmlinux /mnt
|
||||
# umount /mnt
|
||||
|
||||
2b) if booting from ext3
|
||||
|
||||
# mkfs.ext3 -I 128 /dev/sdb2
|
||||
# mount /dev/sdb2 /mnt
|
||||
# mkdir /mnt/boot
|
||||
# cp tmp/deploy/images/edgerouter/vmlinux /mnt/boot
|
||||
# umount /mnt
|
||||
|
||||
3. Extract the rootfs to the USB storage ext3 partition
|
||||
|
||||
# mount /dev/sdb2 /mnt
|
||||
# tar -xvjpf core-image-minimal-XXX.tar.bz2 -C /mnt
|
||||
# umount /mnt
|
||||
|
||||
4. Reboot the board and press a key on the terminal when prompted to get to the U-Boot
|
||||
command line:
|
||||
|
||||
5. Load the kernel and boot:
|
||||
|
||||
5a) vfat boot
|
||||
|
||||
=> fatload usb 0:1 $loadaddr vmlinux
|
||||
|
||||
5b) ext3 boot
|
||||
|
||||
=> ext2load usb 0:2 $loadaddr boot/vmlinux
|
||||
|
||||
=> bootoctlinux $loadaddr coremask=0x3 root=/dev/sda2 rw rootwait mtdparts=phys_mapped_flash:512k(boot0),512k(boot1),64k@3072k(eeprom)
|
||||
|
||||
|
||||
Type 2: NFS
|
||||
-----------
|
||||
|
||||
Note: If you place the kernel on the ext3 partition, you must re-create the
|
||||
ext3 filesystem, since the factory u-boot can only handle 128 byte inodes and
|
||||
cannot read the partition otherwise.
|
||||
|
||||
These boot instructions assume that you have recreated the ext3 filesystem with
|
||||
128 byte inodes, you have an updated uboot or you are running and image capable
|
||||
of making the filesystem on the board itself.
|
||||
|
||||
|
||||
1. Boot from NFS root
|
||||
|
||||
2. Mount the USB disk partition 2 and then extract the contents of
|
||||
tmp/deploy/core-image-XXXX.tar.bz2 into it.
|
||||
|
||||
Before starting, copy core-image-minimal-xxx.tar.bz2 and vmlinux into
|
||||
rootfs path on your workstation.
|
||||
|
||||
and then,
|
||||
|
||||
# mount /dev/sda2 /media/sda2
|
||||
# tar -xvjpf core-image-minimal-XXX.tar.bz2 -C /media/sda2
|
||||
# cp vmlinux /media/sda2/boot/vmlinux
|
||||
# umount /media/sda2
|
||||
# reboot
|
||||
|
||||
3. Reboot the board and press a key on the terminal when prompted to get to the U-Boot
|
||||
command line:
|
||||
|
||||
# reboot
|
||||
|
||||
4. Load the kernel and boot:
|
||||
|
||||
=> ext2load usb 0:2 $loadaddr boot/vmlinux
|
||||
=> bootoctlinux $loadaddr coremask=0x3 root=/dev/sda2 rw rootwait mtdparts=phys_mapped_flash:512k(boot0),512k(boot1),64k@3072k(eeprom)
|
||||
@@ -1 +0,0 @@
|
||||
meta-poky/README.poky
|
||||
15
README.qemu
15
README.qemu
@@ -1,15 +0,0 @@
|
||||
QEMU Emulation Targets
|
||||
======================
|
||||
|
||||
To simplify development, the build system supports building images to
|
||||
work with the QEMU emulator in system emulation mode. Several architectures
|
||||
are currently supported in 32 and 64 bit variants:
|
||||
|
||||
* ARM (qemuarm + qemuarm64)
|
||||
* x86 (qemux86 + qemux86-64)
|
||||
* PowerPC (qemuppc only)
|
||||
* MIPS (qemumips + qemumips64)
|
||||
|
||||
Use of the QEMU images is covered in the Yocto Project Reference Manual.
|
||||
The appropriate MACHINE variable value corresponding to the target is given
|
||||
in brackets.
|
||||
@@ -5,15 +5,6 @@ The following external components are distributed with this software:
|
||||
* The Toaster Simple UI application is based upon the Django project template, the files of which are covered by the BSD license and are copyright (c) Django Software
|
||||
Foundation and individual contributors.
|
||||
|
||||
* Twitter Bootstrap (including Glyphicons), redistributed under the MIT license
|
||||
* Twitter Bootstrap (including Glyphicons), redistributed under the Apache License 2.0.
|
||||
|
||||
* jQuery is redistributed under the MIT license.
|
||||
|
||||
* Twitter typeahead.js redistributed under the MIT license. Note that the JS source has one small modification, so the full unminified file is currently included to make it obvious where this is.
|
||||
|
||||
* jsrender is redistributed under the MIT license.
|
||||
|
||||
* QUnit is redistributed under the MIT license.
|
||||
|
||||
* Font Awesome fonts redistributed under the SIL Open Font License 1.1
|
||||
|
||||
* simplediff is distributed under the zlib license.
|
||||
|
||||
@@ -1,35 +0,0 @@
|
||||
Bitbake
|
||||
=======
|
||||
|
||||
BitBake is a generic task execution engine that allows shell and Python tasks to be run
|
||||
efficiently and in parallel while working within complex inter-task dependency constraints.
|
||||
One of BitBake's main users, OpenEmbedded, takes this core and builds embedded Linux software
|
||||
stacks using a task-oriented approach.
|
||||
|
||||
For information about Bitbake, see the OpenEmbedded website:
|
||||
http://www.openembedded.org/
|
||||
|
||||
Bitbake plain documentation can be found under the doc directory or its integrated
|
||||
html version at the Yocto Project website:
|
||||
http://yoctoproject.org/documentation
|
||||
|
||||
Contributing
|
||||
------------
|
||||
|
||||
Please refer to
|
||||
http://www.openembedded.org/wiki/How_to_submit_a_patch_to_OpenEmbedded
|
||||
for guidelines on how to submit patches, just note that the latter documentation is intended
|
||||
for OpenEmbedded (and its core) not bitbake patches (bitbake-devel@lists.openembedded.org)
|
||||
but in general main guidelines apply. Once the commit(s) have been created, the way to send
|
||||
the patch is through git-send-email. For example, to send the last commit (HEAD) on current
|
||||
branch, type:
|
||||
|
||||
git send-email -M -1 --to bitbake-devel@lists.openembedded.org
|
||||
|
||||
Mailing list:
|
||||
|
||||
http://lists.openembedded.org/mailman/listinfo/bitbake-devel
|
||||
|
||||
Source code:
|
||||
|
||||
http://git.openembedded.org/bitbake/
|
||||
@@ -1,4 +1,4 @@
|
||||
#!/usr/bin/env python3
|
||||
#!/usr/bin/env python
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
@@ -23,34 +23,369 @@
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys
|
||||
|
||||
import sys, logging
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)),
|
||||
'lib'))
|
||||
|
||||
import optparse
|
||||
import warnings
|
||||
from traceback import format_exception
|
||||
try:
|
||||
import bb
|
||||
except RuntimeError as exc:
|
||||
sys.exit(str(exc))
|
||||
|
||||
from bb import event
|
||||
import bb.msg
|
||||
from bb import cooker
|
||||
from bb import ui
|
||||
from bb import server
|
||||
from bb import cookerdata
|
||||
from bb.main import bitbake_main, BitBakeConfigParameters, BBMainException
|
||||
|
||||
if sys.getfilesystemencoding() != "utf-8":
|
||||
sys.exit("Please use a locale setting which supports UTF-8 (such as LANG=en_US.UTF-8).\nPython can't change the filesystem locale after loading so we need a UTF-8 when Python starts or things won't work.")
|
||||
__version__ = "1.24.0"
|
||||
logger = logging.getLogger("BitBake")
|
||||
|
||||
__version__ = "1.38.0"
|
||||
# Python multiprocessing requires /dev/shm
|
||||
if not os.access('/dev/shm', os.W_OK | os.X_OK):
|
||||
sys.exit("FATAL: /dev/shm does not exist or is not writable")
|
||||
|
||||
# Unbuffer stdout to avoid log truncation in the event
|
||||
# of an unorderly exit as well as to provide timely
|
||||
# updates to log files for use with tail
|
||||
try:
|
||||
if sys.stdout.name == '<stdout>':
|
||||
sys.stdout = os.fdopen(sys.stdout.fileno(), 'w', 0)
|
||||
except:
|
||||
pass
|
||||
|
||||
|
||||
def get_ui(config):
|
||||
if not config.ui:
|
||||
# modify 'ui' attribute because it is also read by cooker
|
||||
config.ui = os.environ.get('BITBAKE_UI', 'knotty')
|
||||
|
||||
interface = config.ui
|
||||
|
||||
try:
|
||||
# Dynamically load the UI based on the ui name. Although we
|
||||
# suggest a fixed set this allows you to have flexibility in which
|
||||
# ones are available.
|
||||
module = __import__("bb.ui", fromlist = [interface])
|
||||
return getattr(module, interface)
|
||||
except AttributeError:
|
||||
sys.exit("FATAL: Invalid user interface '%s' specified.\n"
|
||||
"Valid interfaces: depexp, goggle, ncurses, hob, knotty [default]." % interface)
|
||||
|
||||
|
||||
# Display bitbake/OE warnings via the BitBake.Warnings logger, ignoring others"""
|
||||
warnlog = logging.getLogger("BitBake.Warnings")
|
||||
_warnings_showwarning = warnings.showwarning
|
||||
def _showwarning(message, category, filename, lineno, file=None, line=None):
|
||||
if file is not None:
|
||||
if _warnings_showwarning is not None:
|
||||
_warnings_showwarning(message, category, filename, lineno, file, line)
|
||||
else:
|
||||
s = warnings.formatwarning(message, category, filename, lineno)
|
||||
warnlog.warn(s)
|
||||
|
||||
warnings.showwarning = _showwarning
|
||||
warnings.filterwarnings("ignore")
|
||||
warnings.filterwarnings("default", module="(<string>$|(oe|bb)\.)")
|
||||
warnings.filterwarnings("ignore", category=PendingDeprecationWarning)
|
||||
warnings.filterwarnings("ignore", category=ImportWarning)
|
||||
warnings.filterwarnings("ignore", category=DeprecationWarning, module="<string>$")
|
||||
warnings.filterwarnings("ignore", message="With-statements now directly support multiple context managers")
|
||||
|
||||
class BitBakeConfigParameters(cookerdata.ConfigParameters):
|
||||
|
||||
def parseCommandLine(self):
|
||||
parser = optparse.OptionParser(
|
||||
version = "BitBake Build Tool Core version %s, %%prog version %s" % (bb.__version__, __version__),
|
||||
usage = """%prog [options] [recipename/target ...]
|
||||
|
||||
Executes the specified task (default is 'build') for a given set of target recipes (.bb files).
|
||||
It is assumed there is a conf/bblayers.conf available in cwd or in BBPATH which
|
||||
will provide the layer, BBFILES and other configuration information.""")
|
||||
|
||||
parser.add_option("-b", "--buildfile", help = "Execute tasks from a specific .bb recipe directly. WARNING: Does not handle any dependencies from other recipes.",
|
||||
action = "store", dest = "buildfile", default = None)
|
||||
|
||||
parser.add_option("-k", "--continue", help = "Continue as much as possible after an error. While the target that failed and anything depending on it cannot be built, as much as possible will be built before stopping.",
|
||||
action = "store_false", dest = "abort", default = True)
|
||||
|
||||
parser.add_option("-a", "--tryaltconfigs", help = "Continue with builds by trying to use alternative providers where possible.",
|
||||
action = "store_true", dest = "tryaltconfigs", default = False)
|
||||
|
||||
parser.add_option("-f", "--force", help = "Force the specified targets/task to run (invalidating any existing stamp file).",
|
||||
action = "store_true", dest = "force", default = False)
|
||||
|
||||
parser.add_option("-c", "--cmd", help = "Specify the task to execute. The exact options available depend on the metadata. Some examples might be 'compile' or 'populate_sysroot' or 'listtasks' may give a list of the tasks available.",
|
||||
action = "store", dest = "cmd")
|
||||
|
||||
parser.add_option("-C", "--clear-stamp", help = "Invalidate the stamp for the specified task such as 'compile' and then run the default task for the specified target(s).",
|
||||
action = "store", dest = "invalidate_stamp")
|
||||
|
||||
parser.add_option("-r", "--read", help = "Read the specified file before bitbake.conf.",
|
||||
action = "append", dest = "prefile", default = [])
|
||||
|
||||
parser.add_option("-R", "--postread", help = "Read the specified file after bitbake.conf.",
|
||||
action = "append", dest = "postfile", default = [])
|
||||
|
||||
parser.add_option("-v", "--verbose", help = "Output more log message data to the terminal.",
|
||||
action = "store_true", dest = "verbose", default = False)
|
||||
|
||||
parser.add_option("-D", "--debug", help = "Increase the debug level. You can specify this more than once.",
|
||||
action = "count", dest="debug", default = 0)
|
||||
|
||||
parser.add_option("-n", "--dry-run", help = "Don't execute, just go through the motions.",
|
||||
action = "store_true", dest = "dry_run", default = False)
|
||||
|
||||
parser.add_option("-S", "--dump-signatures", help = "Dump out the signature construction information, with no task execution. The SIGNATURE_HANDLER parameter is passed to the handler. Two common values are none and printdiff but the handler may define more/less. none means only dump the signature, printdiff means compare the dumped signature with the cached one.",
|
||||
action = "append", dest = "dump_signatures", default = [], metavar="SIGNATURE_HANDLER")
|
||||
|
||||
parser.add_option("-p", "--parse-only", help = "Quit after parsing the BB recipes.",
|
||||
action = "store_true", dest = "parse_only", default = False)
|
||||
|
||||
parser.add_option("-s", "--show-versions", help = "Show current and preferred versions of all recipes.",
|
||||
action = "store_true", dest = "show_versions", default = False)
|
||||
|
||||
parser.add_option("-e", "--environment", help = "Show the global or per-recipe environment complete with information about where variables were set/changed.",
|
||||
action = "store_true", dest = "show_environment", default = False)
|
||||
|
||||
parser.add_option("-g", "--graphviz", help = "Save dependency tree information for the specified targets in the dot syntax.",
|
||||
action = "store_true", dest = "dot_graph", default = False)
|
||||
|
||||
parser.add_option("-I", "--ignore-deps", help = """Assume these dependencies don't exist and are already provided (equivalent to ASSUME_PROVIDED). Useful to make dependency graphs more appealing""",
|
||||
action = "append", dest = "extra_assume_provided", default = [])
|
||||
|
||||
parser.add_option("-l", "--log-domains", help = """Show debug logging for the specified logging domains""",
|
||||
action = "append", dest = "debug_domains", default = [])
|
||||
|
||||
parser.add_option("-P", "--profile", help = "Profile the command and save reports.",
|
||||
action = "store_true", dest = "profile", default = False)
|
||||
|
||||
parser.add_option("-u", "--ui", help = "The user interface to use (e.g. knotty, hob, depexp).",
|
||||
action = "store", dest = "ui")
|
||||
|
||||
parser.add_option("-t", "--servertype", help = "Choose which server to use, process or xmlrpc.",
|
||||
action = "store", dest = "servertype")
|
||||
|
||||
parser.add_option("", "--token", help = "Specify the connection token to be used when connecting to a remote server.",
|
||||
action = "store", dest = "xmlrpctoken")
|
||||
|
||||
parser.add_option("", "--revisions-changed", help = "Set the exit code depending on whether upstream floating revisions have changed or not.",
|
||||
action = "store_true", dest = "revisions_changed", default = False)
|
||||
|
||||
parser.add_option("", "--server-only", help = "Run bitbake without a UI, only starting a server (cooker) process.",
|
||||
action = "store_true", dest = "server_only", default = False)
|
||||
|
||||
parser.add_option("-B", "--bind", help = "The name/address for the bitbake server to bind to.",
|
||||
action = "store", dest = "bind", default = False)
|
||||
|
||||
parser.add_option("", "--no-setscene", help = "Do not run any setscene tasks. sstate will be ignored and everything needed, built.",
|
||||
action = "store_true", dest = "nosetscene", default = False)
|
||||
|
||||
parser.add_option("", "--remote-server", help = "Connect to the specified server.",
|
||||
action = "store", dest = "remote_server", default = False)
|
||||
|
||||
parser.add_option("-m", "--kill-server", help = "Terminate the remote server.",
|
||||
action = "store_true", dest = "kill_server", default = False)
|
||||
|
||||
parser.add_option("", "--observe-only", help = "Connect to a server as an observing-only client.",
|
||||
action = "store_true", dest = "observe_only", default = False)
|
||||
|
||||
parser.add_option("", "--status-only", help = "Check the status of the remote bitbake server.",
|
||||
action = "store_true", dest = "status_only", default = False)
|
||||
|
||||
options, targets = parser.parse_args(sys.argv)
|
||||
|
||||
# some environmental variables set also configuration options
|
||||
if "BBSERVER" in os.environ:
|
||||
options.servertype = "xmlrpc"
|
||||
options.remote_server = os.environ["BBSERVER"]
|
||||
|
||||
if "BBTOKEN" in os.environ:
|
||||
options.xmlrpctoken = os.environ["BBTOKEN"]
|
||||
|
||||
# if BBSERVER says to autodetect, let's do that
|
||||
if options.remote_server:
|
||||
[host, port] = options.remote_server.split(":", 2)
|
||||
port = int(port)
|
||||
# use automatic port if port set to -1, means read it from
|
||||
# the bitbake.lock file; this is a bit tricky, but we always expect
|
||||
# to be in the base of the build directory if we need to have a
|
||||
# chance to start the server later, anyway
|
||||
if port == -1:
|
||||
lock_location = "./bitbake.lock"
|
||||
# we try to read the address at all times; if the server is not started,
|
||||
# we'll try to start it after the first connect fails, below
|
||||
try:
|
||||
lf = open(lock_location, 'r')
|
||||
remotedef = lf.readline()
|
||||
[host, port] = remotedef.split(":")
|
||||
port = int(port)
|
||||
lf.close()
|
||||
options.remote_server = remotedef
|
||||
except Exception as e:
|
||||
sys.exit("Failed to read bitbake.lock (%s), invalid port" % str(e))
|
||||
|
||||
return options, targets[1:]
|
||||
|
||||
|
||||
def start_server(servermodule, configParams, configuration, features):
|
||||
server = servermodule.BitBakeServer()
|
||||
if configParams.bind:
|
||||
(host, port) = configParams.bind.split(':')
|
||||
server.initServer((host, int(port)))
|
||||
configuration.interface = [ server.serverImpl.host, server.serverImpl.port ]
|
||||
else:
|
||||
server.initServer()
|
||||
configuration.interface = []
|
||||
|
||||
try:
|
||||
configuration.setServerRegIdleCallback(server.getServerIdleCB())
|
||||
|
||||
cooker = bb.cooker.BBCooker(configuration, features)
|
||||
|
||||
server.addcooker(cooker)
|
||||
server.saveConnectionDetails()
|
||||
except Exception as e:
|
||||
exc_info = sys.exc_info()
|
||||
while hasattr(server, "event_queue"):
|
||||
try:
|
||||
import queue
|
||||
except ImportError:
|
||||
import Queue as queue
|
||||
try:
|
||||
event = server.event_queue.get(block=False)
|
||||
except (queue.Empty, IOError):
|
||||
break
|
||||
if isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
raise exc_info[1], None, exc_info[2]
|
||||
server.detach()
|
||||
cooker.lock.close()
|
||||
return server
|
||||
|
||||
|
||||
|
||||
def main():
|
||||
|
||||
configParams = BitBakeConfigParameters()
|
||||
configuration = cookerdata.CookerConfiguration()
|
||||
configuration.setConfigParameters(configParams)
|
||||
|
||||
ui_module = get_ui(configParams)
|
||||
|
||||
# Server type can be xmlrpc or process currently, if nothing is specified,
|
||||
# the default server is process
|
||||
if configParams.servertype:
|
||||
server_type = configParams.servertype
|
||||
else:
|
||||
server_type = 'process'
|
||||
|
||||
try:
|
||||
module = __import__("bb.server", fromlist = [server_type])
|
||||
servermodule = getattr(module, server_type)
|
||||
except AttributeError:
|
||||
sys.exit("FATAL: Invalid server type '%s' specified.\n"
|
||||
"Valid interfaces: xmlrpc, process [default]." % server_type)
|
||||
|
||||
if configParams.server_only:
|
||||
if configParams.servertype != "xmlrpc":
|
||||
sys.exit("FATAL: If '--server-only' is defined, we must set the servertype as 'xmlrpc'.\n")
|
||||
if not configParams.bind:
|
||||
sys.exit("FATAL: The '--server-only' option requires a name/address to bind to with the -B option.\n")
|
||||
if configParams.remote_server:
|
||||
sys.exit("FATAL: The '--server-only' option conflicts with %s.\n" %
|
||||
("the BBSERVER environment variable" if "BBSERVER" in os.environ else "the '--remote-server' option" ))
|
||||
|
||||
if configParams.bind and configParams.servertype != "xmlrpc":
|
||||
sys.exit("FATAL: If '-B' or '--bind' is defined, we must set the servertype as 'xmlrpc'.\n")
|
||||
|
||||
if configParams.remote_server and configParams.servertype != "xmlrpc":
|
||||
sys.exit("FATAL: If '--remote-server' is defined, we must set the servertype as 'xmlrpc'.\n")
|
||||
|
||||
if configParams.observe_only and (not configParams.remote_server or configParams.bind):
|
||||
sys.exit("FATAL: '--observe-only' can only be used by UI clients connecting to a server.\n")
|
||||
|
||||
if configParams.kill_server and not configParams.remote_server:
|
||||
sys.exit("FATAL: '--kill-server' can only be used to terminate a remote server")
|
||||
|
||||
if "BBDEBUG" in os.environ:
|
||||
level = int(os.environ["BBDEBUG"])
|
||||
if level > configuration.debug:
|
||||
configuration.debug = level
|
||||
|
||||
bb.msg.init_msgconfig(configParams.verbose, configuration.debug,
|
||||
configuration.debug_domains)
|
||||
|
||||
# Ensure logging messages get sent to the UI as events
|
||||
handler = bb.event.LogHandler()
|
||||
if not configParams.status_only:
|
||||
# In status only mode there are no logs and no UI
|
||||
logger.addHandler(handler)
|
||||
|
||||
# Clear away any spurious environment variables while we stoke up the cooker
|
||||
cleanedvars = bb.utils.clean_environment()
|
||||
|
||||
featureset = []
|
||||
if not configParams.server_only:
|
||||
# Collect the feature set for the UI
|
||||
featureset = getattr(ui_module, "featureSet", [])
|
||||
|
||||
if not configParams.remote_server:
|
||||
# we start a server with a given configuration
|
||||
server = start_server(servermodule, configParams, configuration, featureset)
|
||||
bb.event.ui_queue = []
|
||||
else:
|
||||
# we start a stub server that is actually a XMLRPClient that connects to a real server
|
||||
server = servermodule.BitBakeXMLRPCClient(configParams.observe_only, configParams.xmlrpctoken)
|
||||
server.saveConnectionDetails(configParams.remote_server)
|
||||
|
||||
|
||||
if not configParams.server_only:
|
||||
try:
|
||||
server_connection = server.establishConnection(featureset)
|
||||
except Exception as e:
|
||||
if configParams.kill_server:
|
||||
sys.exit(0)
|
||||
bb.fatal("Could not connect to server %s: %s" % (configParams.remote_server, str(e)))
|
||||
|
||||
# Restore the environment in case the UI needs it
|
||||
for k in cleanedvars:
|
||||
os.environ[k] = cleanedvars[k]
|
||||
|
||||
logger.removeHandler(handler)
|
||||
|
||||
|
||||
if configParams.status_only:
|
||||
server_connection.terminate()
|
||||
sys.exit(0)
|
||||
|
||||
if configParams.kill_server:
|
||||
server_connection.connection.terminateServer()
|
||||
bb.event.ui_queue = []
|
||||
sys.exit(0)
|
||||
|
||||
try:
|
||||
return ui_module.main(server_connection.connection, server_connection.events, configParams)
|
||||
finally:
|
||||
bb.event.ui_queue = []
|
||||
server_connection.terminate()
|
||||
else:
|
||||
print("server address: %s, server port: %s" % (server.serverImpl.host, server.serverImpl.port))
|
||||
return 0
|
||||
|
||||
return 1
|
||||
|
||||
if __name__ == "__main__":
|
||||
if __version__ != bb.__version__:
|
||||
sys.exit("Bitbake core version and program version mismatch!")
|
||||
try:
|
||||
sys.exit(bitbake_main(BitBakeConfigParameters(sys.argv),
|
||||
cookerdata.CookerConfiguration()))
|
||||
except BBMainException as err:
|
||||
sys.exit(err)
|
||||
ret = main()
|
||||
except bb.BBHandledException:
|
||||
sys.exit(1)
|
||||
ret = 1
|
||||
except Exception:
|
||||
ret = 1
|
||||
import traceback
|
||||
traceback.print_exc()
|
||||
sys.exit(1)
|
||||
sys.exit(ret)
|
||||
|
||||
|
||||
@@ -1,9 +1,9 @@
|
||||
#!/usr/bin/env python3
|
||||
#!/usr/bin/env python
|
||||
|
||||
# bitbake-diffsigs / bitbake-dumpsig
|
||||
# BitBake task signature data dump and comparison utility
|
||||
# bitbake-diffsigs
|
||||
# BitBake task signature data comparison utility
|
||||
#
|
||||
# Copyright (C) 2012-2013, 2017 Intel Corporation
|
||||
# Copyright (C) 2012-2013 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
@@ -21,188 +21,102 @@
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
import argparse
|
||||
import fnmatch
|
||||
import optparse
|
||||
import logging
|
||||
import pickle
|
||||
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
|
||||
|
||||
import bb.tinfoil
|
||||
import bb.siggen
|
||||
import bb.msg
|
||||
|
||||
myname = os.path.basename(sys.argv[0])
|
||||
logger = bb.msg.logger_create(myname)
|
||||
def logger_create(name, output=sys.stderr):
|
||||
logger = logging.getLogger(name)
|
||||
console = logging.StreamHandler(output)
|
||||
format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
|
||||
if output.isatty():
|
||||
format.enable_color()
|
||||
console.setFormatter(format)
|
||||
logger.addHandler(console)
|
||||
logger.setLevel(logging.INFO)
|
||||
return logger
|
||||
|
||||
is_dump = myname == 'bitbake-dumpsig'
|
||||
logger = logger_create('bitbake-diffsigs')
|
||||
|
||||
def find_siginfo(tinfoil, pn, taskname, sigs=None):
|
||||
result = None
|
||||
tinfoil.set_event_mask(['bb.event.FindSigInfoResult',
|
||||
'logging.LogRecord',
|
||||
'bb.command.CommandCompleted',
|
||||
'bb.command.CommandFailed'])
|
||||
ret = tinfoil.run_command('findSigInfo', pn, taskname, sigs)
|
||||
if ret:
|
||||
while True:
|
||||
event = tinfoil.wait_event(1)
|
||||
if event:
|
||||
if isinstance(event, bb.command.CommandCompleted):
|
||||
break
|
||||
elif isinstance(event, bb.command.CommandFailed):
|
||||
logger.error(str(event))
|
||||
sys.exit(2)
|
||||
elif isinstance(event, bb.event.FindSigInfoResult):
|
||||
result = event.result
|
||||
elif isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
else:
|
||||
logger.error('No result returned from findSigInfo command')
|
||||
sys.exit(2)
|
||||
return result
|
||||
def find_compare_task(bbhandler, pn, taskname):
|
||||
""" Find the most recent signature files for the specified PN/task and compare them """
|
||||
|
||||
def find_siginfo_task(bbhandler, pn, taskname, sig1=None, sig2=None):
|
||||
""" Find the most recent signature files for the specified PN/task """
|
||||
if not hasattr(bb.siggen, 'find_siginfo'):
|
||||
logger.error('Metadata does not support finding signature data files')
|
||||
sys.exit(1)
|
||||
|
||||
if not taskname.startswith('do_'):
|
||||
taskname = 'do_%s' % taskname
|
||||
|
||||
if sig1 and sig2:
|
||||
sigfiles = find_siginfo(bbhandler, pn, taskname, [sig1, sig2])
|
||||
if len(sigfiles) == 0:
|
||||
logger.error('No sigdata files found matching %s %s matching either %s or %s' % (pn, taskname, sig1, sig2))
|
||||
sys.exit(1)
|
||||
elif not sig1 in sigfiles:
|
||||
logger.error('No sigdata files found matching %s %s with signature %s' % (pn, taskname, sig1))
|
||||
sys.exit(1)
|
||||
elif not sig2 in sigfiles:
|
||||
logger.error('No sigdata files found matching %s %s with signature %s' % (pn, taskname, sig2))
|
||||
sys.exit(1)
|
||||
latestfiles = [sigfiles[sig1], sigfiles[sig2]]
|
||||
filedates = bb.siggen.find_siginfo(pn, taskname, None, bbhandler.config_data)
|
||||
latestfiles = sorted(filedates.keys(), key=lambda f: filedates[f])[-2:]
|
||||
if not latestfiles:
|
||||
logger.error('No sigdata files found matching %s %s' % (pn, taskname))
|
||||
sys.exit(1)
|
||||
elif len(latestfiles) < 2:
|
||||
logger.error('Only one matching sigdata file found for the specified task (%s %s)' % (pn, taskname))
|
||||
sys.exit(1)
|
||||
else:
|
||||
filedates = find_siginfo(bbhandler, pn, taskname)
|
||||
latestfiles = sorted(filedates.keys(), key=lambda f: filedates[f])[-2:]
|
||||
if not latestfiles:
|
||||
logger.error('No sigdata files found matching %s %s' % (pn, taskname))
|
||||
sys.exit(1)
|
||||
# Define recursion callback
|
||||
def recursecb(key, hash1, hash2):
|
||||
hashes = [hash1, hash2]
|
||||
hashfiles = bb.siggen.find_siginfo(key, None, hashes, bbhandler.config_data)
|
||||
|
||||
return latestfiles
|
||||
recout = []
|
||||
if len(hashfiles) == 2:
|
||||
out2 = bb.siggen.compare_sigfiles(hashfiles[hash1], hashfiles[hash2], recursecb)
|
||||
recout.extend(list(' ' + l for l in out2))
|
||||
else:
|
||||
recout.append("Unable to find matching sigdata for %s with hashes %s or %s" % (key, hash1, hash2))
|
||||
|
||||
return recout
|
||||
|
||||
# Recurse into signature comparison
|
||||
output = bb.siggen.compare_sigfiles(latestfiles[0], latestfiles[1], recursecb)
|
||||
if output:
|
||||
print '\n'.join(output)
|
||||
sys.exit(0)
|
||||
|
||||
|
||||
# Define recursion callback
|
||||
def recursecb(key, hash1, hash2):
|
||||
hashes = [hash1, hash2]
|
||||
hashfiles = find_siginfo(tinfoil, key, None, hashes)
|
||||
|
||||
recout = []
|
||||
if len(hashfiles) == 0:
|
||||
recout.append("Unable to find matching sigdata for %s with hashes %s or %s" % (key, hash1, hash2))
|
||||
elif not hash1 in hashfiles:
|
||||
recout.append("Unable to find matching sigdata for %s with hash %s" % (key, hash1))
|
||||
elif not hash2 in hashfiles:
|
||||
recout.append("Unable to find matching sigdata for %s with hash %s" % (key, hash2))
|
||||
else:
|
||||
out2 = bb.siggen.compare_sigfiles(hashfiles[hash1], hashfiles[hash2], recursecb, color=color)
|
||||
for change in out2:
|
||||
for line in change.splitlines():
|
||||
recout.append(' ' + line)
|
||||
parser = optparse.OptionParser(
|
||||
description = "Compares siginfo/sigdata files written out by BitBake",
|
||||
usage = """
|
||||
%prog -t recipename taskname
|
||||
%prog sigdatafile1 sigdatafile2
|
||||
%prog sigdatafile1""")
|
||||
|
||||
return recout
|
||||
parser.add_option("-t", "--task",
|
||||
help = "find the signature data files for last two runs of the specified task and compare them",
|
||||
action="store", dest="taskargs", nargs=2, metavar='recipename taskname')
|
||||
|
||||
|
||||
parser = argparse.ArgumentParser(
|
||||
description=("Dumps" if is_dump else "Compares") + " siginfo/sigdata files written out by BitBake")
|
||||
|
||||
parser.add_argument('-D', '--debug',
|
||||
help='Enable debug output',
|
||||
action='store_true')
|
||||
|
||||
if is_dump:
|
||||
parser.add_argument("-t", "--task",
|
||||
help="find the signature data file for the last run of the specified task",
|
||||
action="store", dest="taskargs", nargs=2, metavar=('recipename', 'taskname'))
|
||||
|
||||
parser.add_argument("sigdatafile1",
|
||||
help="Signature file to dump. Not used when using -t/--task.",
|
||||
action="store", nargs='?', metavar="sigdatafile")
|
||||
else:
|
||||
parser.add_argument('-c', '--color',
|
||||
help='Colorize the output (where %(metavar)s is %(choices)s)',
|
||||
choices=['auto', 'always', 'never'], default='auto', metavar='color')
|
||||
|
||||
parser.add_argument('-d', '--dump',
|
||||
help='Dump the last signature data instead of comparing (equivalent to using bitbake-dumpsig)',
|
||||
action='store_true')
|
||||
|
||||
parser.add_argument("-t", "--task",
|
||||
help="find the signature data files for the last two runs of the specified task and compare them",
|
||||
action="store", dest="taskargs", nargs=2, metavar=('recipename', 'taskname'))
|
||||
|
||||
parser.add_argument("-s", "--signature",
|
||||
help="With -t/--task, specify the signatures to look for instead of taking the last two",
|
||||
action="store", dest="sigargs", nargs=2, metavar=('fromsig', 'tosig'))
|
||||
|
||||
parser.add_argument("sigdatafile1",
|
||||
help="First signature file to compare (or signature file to dump, if second not specified). Not used when using -t/--task.",
|
||||
action="store", nargs='?')
|
||||
|
||||
parser.add_argument("sigdatafile2",
|
||||
help="Second signature file to compare",
|
||||
action="store", nargs='?')
|
||||
|
||||
options = parser.parse_args()
|
||||
if is_dump:
|
||||
options.color = 'never'
|
||||
options.dump = True
|
||||
options.sigdatafile2 = None
|
||||
options.sigargs = None
|
||||
|
||||
if options.debug:
|
||||
logger.setLevel(logging.DEBUG)
|
||||
|
||||
color = (options.color == 'always' or (options.color == 'auto' and sys.stdout.isatty()))
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
|
||||
if options.taskargs:
|
||||
with bb.tinfoil.Tinfoil() as tinfoil:
|
||||
tinfoil.prepare(config_only=True)
|
||||
if not options.dump and options.sigargs:
|
||||
files = find_siginfo_task(tinfoil, options.taskargs[0], options.taskargs[1], options.sigargs[0], options.sigargs[1])
|
||||
else:
|
||||
files = find_siginfo_task(tinfoil, options.taskargs[0], options.taskargs[1])
|
||||
|
||||
if options.dump:
|
||||
logger.debug("Signature file: %s" % files[-1])
|
||||
output = bb.siggen.dump_sigfile(files[-1])
|
||||
else:
|
||||
if len(files) < 2:
|
||||
logger.error('Only one matching sigdata file found for the specified task (%s %s)' % (options.taskargs[0], options.taskargs[1]))
|
||||
sys.exit(1)
|
||||
|
||||
# Recurse into signature comparison
|
||||
logger.debug("Signature file (previous): %s" % files[-2])
|
||||
logger.debug("Signature file (latest): %s" % files[-1])
|
||||
output = bb.siggen.compare_sigfiles(files[-2], files[-1], recursecb, color=color)
|
||||
tinfoil = bb.tinfoil.Tinfoil()
|
||||
tinfoil.prepare(config_only = True)
|
||||
find_compare_task(tinfoil, options.taskargs[0], options.taskargs[1])
|
||||
else:
|
||||
if options.sigargs:
|
||||
logger.error('-s/--signature can only be used together with -t/--task')
|
||||
sys.exit(1)
|
||||
try:
|
||||
if not options.dump and options.sigdatafile1 and options.sigdatafile2:
|
||||
with bb.tinfoil.Tinfoil() as tinfoil:
|
||||
tinfoil.prepare(config_only=True)
|
||||
output = bb.siggen.compare_sigfiles(options.sigdatafile1, options.sigdatafile2, recursecb, color=color)
|
||||
elif options.sigdatafile1:
|
||||
output = bb.siggen.dump_sigfile(options.sigdatafile1)
|
||||
else:
|
||||
logger.error('Must specify signature file(s) or -t/--task')
|
||||
parser.print_help()
|
||||
if len(args) == 1:
|
||||
parser.print_help()
|
||||
else:
|
||||
import cPickle
|
||||
try:
|
||||
if len(args) == 2:
|
||||
output = bb.siggen.dump_sigfile(sys.argv[1])
|
||||
else:
|
||||
output = bb.siggen.compare_sigfiles(sys.argv[1], sys.argv[2])
|
||||
except IOError as e:
|
||||
logger.error(str(e))
|
||||
sys.exit(1)
|
||||
except cPickle.UnpicklingError, EOFError:
|
||||
logger.error('Invalid signature data - ensure you are specifying sigdata/siginfo files')
|
||||
sys.exit(1)
|
||||
except IOError as e:
|
||||
logger.error(str(e))
|
||||
sys.exit(1)
|
||||
except (pickle.UnpicklingError, EOFError):
|
||||
logger.error('Invalid signature data - ensure you are specifying sigdata/siginfo files')
|
||||
sys.exit(1)
|
||||
|
||||
if output:
|
||||
print('\n'.join(output))
|
||||
if output:
|
||||
print '\n'.join(output)
|
||||
|
||||
@@ -1 +0,0 @@
|
||||
bitbake-diffsigs
|
||||
65
bitbake/bin/bitbake-dumpsig
Executable file
65
bitbake/bin/bitbake-dumpsig
Executable file
@@ -0,0 +1,65 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# bitbake-dumpsig
|
||||
# BitBake task signature dump utility
|
||||
#
|
||||
# Copyright (C) 2013 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys
|
||||
import warnings
|
||||
import optparse
|
||||
import logging
|
||||
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
|
||||
|
||||
import bb.siggen
|
||||
|
||||
def logger_create(name, output=sys.stderr):
|
||||
logger = logging.getLogger(name)
|
||||
console = logging.StreamHandler(output)
|
||||
format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
|
||||
if output.isatty():
|
||||
format.enable_color()
|
||||
console.setFormatter(format)
|
||||
logger.addHandler(console)
|
||||
logger.setLevel(logging.INFO)
|
||||
return logger
|
||||
|
||||
logger = logger_create('bitbake-dumpsig')
|
||||
|
||||
parser = optparse.OptionParser(
|
||||
description = "Dumps siginfo/sigdata files written out by BitBake",
|
||||
usage = """
|
||||
%prog sigdatafile""")
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
|
||||
if len(args) == 1:
|
||||
parser.print_help()
|
||||
else:
|
||||
import cPickle
|
||||
try:
|
||||
output = bb.siggen.dump_sigfile(args[1])
|
||||
except IOError as e:
|
||||
logger.error(str(e))
|
||||
sys.exit(1)
|
||||
except cPickle.UnpicklingError, EOFError:
|
||||
logger.error('Invalid signature data - ensure you are specifying a sigdata/siginfo file')
|
||||
sys.exit(1)
|
||||
|
||||
if output:
|
||||
print '\n'.join(output)
|
||||
@@ -1,11 +1,11 @@
|
||||
#!/usr/bin/env python3
|
||||
#!/usr/bin/env python
|
||||
|
||||
# This script has subcommands which operate against your bitbake layers, either
|
||||
# displaying useful information, or acting against them.
|
||||
# See the help output for details on available commands.
|
||||
|
||||
# Copyright (C) 2011 Mentor Graphics Corporation
|
||||
# Copyright (C) 2011-2015 Intel Corporation
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
@@ -20,91 +20,739 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import cmd
|
||||
import logging
|
||||
import os
|
||||
import sys
|
||||
import argparse
|
||||
import signal
|
||||
import fnmatch
|
||||
from collections import defaultdict
|
||||
import re
|
||||
|
||||
bindir = os.path.dirname(__file__)
|
||||
topdir = os.path.dirname(bindir)
|
||||
sys.path[0:0] = [os.path.join(topdir, 'lib')]
|
||||
|
||||
import bb.cache
|
||||
import bb.cooker
|
||||
import bb.providers
|
||||
import bb.utils
|
||||
import bb.tinfoil
|
||||
import bb.msg
|
||||
|
||||
logger = bb.msg.logger_create('bitbake-layers', sys.stdout)
|
||||
|
||||
def main():
|
||||
signal.signal(signal.SIGPIPE, signal.SIG_DFL)
|
||||
parser = argparse.ArgumentParser(
|
||||
description="BitBake layers utility",
|
||||
epilog="Use %(prog)s <subcommand> --help to get help on a specific command",
|
||||
add_help=False)
|
||||
parser.add_argument('-d', '--debug', help='Enable debug output', action='store_true')
|
||||
parser.add_argument('-q', '--quiet', help='Print only errors', action='store_true')
|
||||
parser.add_argument('-F', '--force', help='Force add without recipe parse verification', action='store_true')
|
||||
parser.add_argument('--color', choices=['auto', 'always', 'never'], default='auto', help='Colorize output (where %(metavar)s is %(choices)s)', metavar='COLOR')
|
||||
|
||||
global_args, unparsed_args = parser.parse_known_args()
|
||||
|
||||
# Help is added here rather than via add_help=True, as we don't want it to
|
||||
# be handled by parse_known_args()
|
||||
parser.add_argument('-h', '--help', action='help', default=argparse.SUPPRESS,
|
||||
help='show this help message and exit')
|
||||
subparsers = parser.add_subparsers(title='subcommands', metavar='<subcommand>')
|
||||
subparsers.required = True
|
||||
|
||||
if global_args.debug:
|
||||
logger.setLevel(logging.DEBUG)
|
||||
elif global_args.quiet:
|
||||
logger.setLevel(logging.ERROR)
|
||||
|
||||
# Need to re-run logger_create with color argument
|
||||
# (will be the same logger since it has the same name)
|
||||
bb.msg.logger_create('bitbake-layers', output=sys.stdout, color=global_args.color)
|
||||
|
||||
plugins = []
|
||||
tinfoil = bb.tinfoil.Tinfoil(tracking=True)
|
||||
tinfoil.logger.setLevel(logger.getEffectiveLevel())
|
||||
try:
|
||||
tinfoil.prepare(True)
|
||||
for path in ([topdir] +
|
||||
tinfoil.config_data.getVar('BBPATH').split(':')):
|
||||
pluginpath = os.path.join(path, 'lib', 'bblayers')
|
||||
bb.utils.load_plugins(logger, plugins, pluginpath)
|
||||
|
||||
registered = False
|
||||
for plugin in plugins:
|
||||
if hasattr(plugin, 'register_commands'):
|
||||
registered = True
|
||||
plugin.register_commands(subparsers)
|
||||
if hasattr(plugin, 'tinfoil_init'):
|
||||
plugin.tinfoil_init(tinfoil)
|
||||
|
||||
if not registered:
|
||||
logger.error("No commands registered - missing plugins?")
|
||||
sys.exit(1)
|
||||
|
||||
args = parser.parse_args(unparsed_args, namespace=global_args)
|
||||
|
||||
if getattr(args, 'parserecipes', False):
|
||||
tinfoil.config_data.disableTracking()
|
||||
tinfoil.parse_recipes()
|
||||
tinfoil.config_data.enableTracking()
|
||||
|
||||
return args.func(args)
|
||||
finally:
|
||||
tinfoil.shutdown()
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
try:
|
||||
ret = main()
|
||||
except bb.BBHandledException:
|
||||
ret = 1
|
||||
except Exception:
|
||||
ret = 1
|
||||
import traceback
|
||||
traceback.print_exc()
|
||||
sys.exit(ret)
|
||||
logger = logging.getLogger('BitBake')
|
||||
|
||||
|
||||
def main(args):
|
||||
cmds = Commands()
|
||||
if args:
|
||||
# Allow user to specify e.g. show-layers instead of show_layers
|
||||
args = [args[0].replace('-', '_')] + args[1:]
|
||||
cmds.onecmd(' '.join(args))
|
||||
else:
|
||||
cmds.do_help('')
|
||||
return cmds.returncode
|
||||
|
||||
|
||||
class Commands(cmd.Cmd):
|
||||
def __init__(self):
|
||||
self.bbhandler = None
|
||||
self.returncode = 0
|
||||
self.bblayers = []
|
||||
cmd.Cmd.__init__(self)
|
||||
|
||||
def init_bbhandler(self, config_only = False):
|
||||
if not self.bbhandler:
|
||||
self.bbhandler = bb.tinfoil.Tinfoil()
|
||||
self.bblayers = (self.bbhandler.config_data.getVar('BBLAYERS', True) or "").split()
|
||||
self.bbhandler.prepare(config_only)
|
||||
|
||||
def default(self, line):
|
||||
"""Handle unrecognised commands"""
|
||||
sys.stderr.write("Unrecognised command or option\n")
|
||||
self.do_help('')
|
||||
|
||||
def do_help(self, topic):
|
||||
"""display general help or help on a specified command"""
|
||||
if topic:
|
||||
sys.stdout.write('%s: ' % topic)
|
||||
cmd.Cmd.do_help(self, topic.replace('-', '_'))
|
||||
else:
|
||||
sys.stdout.write("usage: bitbake-layers <command> [arguments]\n\n")
|
||||
sys.stdout.write("Available commands:\n")
|
||||
procnames = list(set(self.get_names()))
|
||||
for procname in procnames:
|
||||
if procname[:3] == 'do_':
|
||||
sys.stdout.write(" %s\n" % procname[3:].replace('_', '-'))
|
||||
doc = getattr(self, procname).__doc__
|
||||
if doc:
|
||||
sys.stdout.write(" %s\n" % doc.splitlines()[0])
|
||||
|
||||
def do_show_layers(self, args):
|
||||
"""show current configured layers"""
|
||||
self.init_bbhandler(config_only = True)
|
||||
logger.plain("%s %s %s" % ("layer".ljust(20), "path".ljust(40), "priority"))
|
||||
logger.plain('=' * 74)
|
||||
for layerdir in self.bblayers:
|
||||
layername = self.get_layer_name(layerdir)
|
||||
layerpri = 0
|
||||
for layer, _, regex, pri in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
|
||||
if regex.match(os.path.join(layerdir, 'test')):
|
||||
layerpri = pri
|
||||
break
|
||||
|
||||
logger.plain("%s %s %d" % (layername.ljust(20), layerdir.ljust(40), layerpri))
|
||||
|
||||
|
||||
def version_str(self, pe, pv, pr = None):
|
||||
verstr = "%s" % pv
|
||||
if pr:
|
||||
verstr = "%s-%s" % (verstr, pr)
|
||||
if pe:
|
||||
verstr = "%s:%s" % (pe, verstr)
|
||||
return verstr
|
||||
|
||||
|
||||
def do_show_overlayed(self, args):
|
||||
"""list overlayed recipes (where the same recipe exists in another layer)
|
||||
|
||||
usage: show-overlayed [-f] [-s]
|
||||
|
||||
Lists the names of overlayed recipes and the available versions in each
|
||||
layer, with the preferred version first. Note that skipped recipes that
|
||||
are overlayed will also be listed, with a " (skipped)" suffix.
|
||||
|
||||
Options:
|
||||
-f instead of the default formatting, list filenames of higher priority
|
||||
recipes with the ones they overlay indented underneath
|
||||
-s only list overlayed recipes where the version is the same
|
||||
"""
|
||||
self.init_bbhandler()
|
||||
|
||||
show_filenames = False
|
||||
show_same_ver_only = False
|
||||
for arg in args.split():
|
||||
if arg == '-f':
|
||||
show_filenames = True
|
||||
elif arg == '-s':
|
||||
show_same_ver_only = True
|
||||
else:
|
||||
sys.stderr.write("show-overlayed: invalid option %s\n" % arg)
|
||||
self.do_help('')
|
||||
return
|
||||
|
||||
items_listed = self.list_recipes('Overlayed recipes', None, True, show_same_ver_only, show_filenames, True)
|
||||
|
||||
# Check for overlayed .bbclass files
|
||||
classes = defaultdict(list)
|
||||
for layerdir in self.bblayers:
|
||||
classdir = os.path.join(layerdir, 'classes')
|
||||
if os.path.exists(classdir):
|
||||
for classfile in os.listdir(classdir):
|
||||
if os.path.splitext(classfile)[1] == '.bbclass':
|
||||
classes[classfile].append(classdir)
|
||||
|
||||
# Locating classes and other files is a bit more complicated than recipes -
|
||||
# layer priority is not a factor; instead BitBake uses the first matching
|
||||
# file in BBPATH, which is manipulated directly by each layer's
|
||||
# conf/layer.conf in turn, thus the order of layers in bblayers.conf is a
|
||||
# factor - however, each layer.conf is free to either prepend or append to
|
||||
# BBPATH (or indeed do crazy stuff with it). Thus the order in BBPATH might
|
||||
# not be exactly the order present in bblayers.conf either.
|
||||
bbpath = str(self.bbhandler.config_data.getVar('BBPATH', True))
|
||||
overlayed_class_found = False
|
||||
for (classfile, classdirs) in classes.items():
|
||||
if len(classdirs) > 1:
|
||||
if not overlayed_class_found:
|
||||
logger.plain('=== Overlayed classes ===')
|
||||
overlayed_class_found = True
|
||||
|
||||
mainfile = bb.utils.which(bbpath, os.path.join('classes', classfile))
|
||||
if show_filenames:
|
||||
logger.plain('%s' % mainfile)
|
||||
else:
|
||||
# We effectively have to guess the layer here
|
||||
logger.plain('%s:' % classfile)
|
||||
mainlayername = '?'
|
||||
for layerdir in self.bblayers:
|
||||
classdir = os.path.join(layerdir, 'classes')
|
||||
if mainfile.startswith(classdir):
|
||||
mainlayername = self.get_layer_name(layerdir)
|
||||
logger.plain(' %s' % mainlayername)
|
||||
for classdir in classdirs:
|
||||
fullpath = os.path.join(classdir, classfile)
|
||||
if fullpath != mainfile:
|
||||
if show_filenames:
|
||||
print(' %s' % fullpath)
|
||||
else:
|
||||
print(' %s' % self.get_layer_name(os.path.dirname(classdir)))
|
||||
|
||||
if overlayed_class_found:
|
||||
items_listed = True;
|
||||
|
||||
if not items_listed:
|
||||
logger.plain('No overlayed files found.')
|
||||
|
||||
|
||||
def do_show_recipes(self, args):
|
||||
"""list available recipes, showing the layer they are provided by
|
||||
|
||||
usage: show-recipes [-f] [-m] [pnspec]
|
||||
|
||||
Lists the names of overlayed recipes and the available versions in each
|
||||
layer, with the preferred version first. Optionally you may specify
|
||||
pnspec to match a specified recipe name (supports wildcards). Note that
|
||||
skipped recipes will also be listed, with a " (skipped)" suffix.
|
||||
|
||||
Options:
|
||||
-f instead of the default formatting, list filenames of higher priority
|
||||
recipes with other available recipes indented underneath
|
||||
-m only list where multiple recipes (in the same layer or different
|
||||
layers) exist for the same recipe name
|
||||
"""
|
||||
self.init_bbhandler()
|
||||
|
||||
show_filenames = False
|
||||
show_multi_provider_only = False
|
||||
pnspec = None
|
||||
title = 'Available recipes:'
|
||||
for arg in args.split():
|
||||
if arg == '-f':
|
||||
show_filenames = True
|
||||
elif arg == '-m':
|
||||
show_multi_provider_only = True
|
||||
elif not arg.startswith('-'):
|
||||
pnspec = arg
|
||||
title = 'Available recipes matching %s:' % pnspec
|
||||
else:
|
||||
sys.stderr.write("show-recipes: invalid option %s\n" % arg)
|
||||
self.do_help('')
|
||||
return
|
||||
self.list_recipes(title, pnspec, False, False, show_filenames, show_multi_provider_only)
|
||||
|
||||
|
||||
def list_recipes(self, title, pnspec, show_overlayed_only, show_same_ver_only, show_filenames, show_multi_provider_only):
|
||||
pkg_pn = self.bbhandler.cooker.recipecache.pkg_pn
|
||||
(latest_versions, preferred_versions) = bb.providers.findProviders(self.bbhandler.config_data, self.bbhandler.cooker.recipecache, pkg_pn)
|
||||
allproviders = bb.providers.allProviders(self.bbhandler.cooker.recipecache)
|
||||
|
||||
# Ensure we list skipped recipes
|
||||
# We are largely guessing about PN, PV and the preferred version here,
|
||||
# but we have no choice since skipped recipes are not fully parsed
|
||||
skiplist = self.bbhandler.cooker.skiplist.keys()
|
||||
skiplist.sort( key=lambda fileitem: self.bbhandler.cooker.collection.calc_bbfile_priority(fileitem) )
|
||||
skiplist.reverse()
|
||||
for fn in skiplist:
|
||||
recipe_parts = os.path.splitext(os.path.basename(fn))[0].split('_')
|
||||
p = recipe_parts[0]
|
||||
if len(recipe_parts) > 1:
|
||||
ver = (None, recipe_parts[1], None)
|
||||
else:
|
||||
ver = (None, 'unknown', None)
|
||||
allproviders[p].append((ver, fn))
|
||||
if not p in pkg_pn:
|
||||
pkg_pn[p] = 'dummy'
|
||||
preferred_versions[p] = (ver, fn)
|
||||
|
||||
def print_item(f, pn, ver, layer, ispref):
|
||||
if f in skiplist:
|
||||
skipped = ' (skipped)'
|
||||
else:
|
||||
skipped = ''
|
||||
if show_filenames:
|
||||
if ispref:
|
||||
logger.plain("%s%s", f, skipped)
|
||||
else:
|
||||
logger.plain(" %s%s", f, skipped)
|
||||
else:
|
||||
if ispref:
|
||||
logger.plain("%s:", pn)
|
||||
logger.plain(" %s %s%s", layer.ljust(20), ver, skipped)
|
||||
|
||||
preffiles = []
|
||||
items_listed = False
|
||||
for p in sorted(pkg_pn):
|
||||
if pnspec:
|
||||
if not fnmatch.fnmatch(p, pnspec):
|
||||
continue
|
||||
|
||||
if len(allproviders[p]) > 1 or not show_multi_provider_only:
|
||||
pref = preferred_versions[p]
|
||||
preffile = bb.cache.Cache.virtualfn2realfn(pref[1])[0]
|
||||
if preffile not in preffiles:
|
||||
preflayer = self.get_file_layer(preffile)
|
||||
multilayer = False
|
||||
same_ver = True
|
||||
provs = []
|
||||
for prov in allproviders[p]:
|
||||
provfile = bb.cache.Cache.virtualfn2realfn(prov[1])[0]
|
||||
provlayer = self.get_file_layer(provfile)
|
||||
provs.append((provfile, provlayer, prov[0]))
|
||||
if provlayer != preflayer:
|
||||
multilayer = True
|
||||
if prov[0] != pref[0]:
|
||||
same_ver = False
|
||||
|
||||
if (multilayer or not show_overlayed_only) and (same_ver or not show_same_ver_only):
|
||||
if not items_listed:
|
||||
logger.plain('=== %s ===' % title)
|
||||
items_listed = True
|
||||
print_item(preffile, p, self.version_str(pref[0][0], pref[0][1]), preflayer, True)
|
||||
for (provfile, provlayer, provver) in provs:
|
||||
if provfile != preffile:
|
||||
print_item(provfile, p, self.version_str(provver[0], provver[1]), provlayer, False)
|
||||
# Ensure we don't show two entries for BBCLASSEXTENDed recipes
|
||||
preffiles.append(preffile)
|
||||
|
||||
return items_listed
|
||||
|
||||
|
||||
def do_flatten(self, args):
|
||||
"""flattens layer configuration into a separate output directory.
|
||||
|
||||
usage: flatten [layer1 layer2 [layer3]...] <outputdir>
|
||||
|
||||
Takes the specified layers (or all layers in the current layer
|
||||
configuration if none are specified) and builds a "flattened" directory
|
||||
containing the contents of all layers, with any overlayed recipes removed
|
||||
and bbappends appended to the corresponding recipes. Note that some manual
|
||||
cleanup may still be necessary afterwards, in particular:
|
||||
|
||||
* where non-recipe files (such as patches) are overwritten (the flatten
|
||||
command will show a warning for these)
|
||||
* where anything beyond the normal layer setup has been added to
|
||||
layer.conf (only the lowest priority number layer's layer.conf is used)
|
||||
* overridden/appended items from bbappends will need to be tidied up
|
||||
* when the flattened layers do not have the same directory structure (the
|
||||
flatten command should show a warning when this will cause a problem)
|
||||
|
||||
Warning: if you flatten several layers where another layer is intended to
|
||||
be used "inbetween" them (in layer priority order) such that recipes /
|
||||
bbappends in the layers interact, and then attempt to use the new output
|
||||
layer together with that other layer, you may no longer get the same
|
||||
build results (as the layer priority order has effectively changed).
|
||||
"""
|
||||
arglist = args.split()
|
||||
if len(arglist) < 1:
|
||||
logger.error('Please specify an output directory')
|
||||
self.do_help('flatten')
|
||||
return
|
||||
|
||||
if len(arglist) == 2:
|
||||
logger.error('If you specify layers to flatten you must specify at least two')
|
||||
self.do_help('flatten')
|
||||
return
|
||||
|
||||
outputdir = arglist[-1]
|
||||
if os.path.exists(outputdir) and os.listdir(outputdir):
|
||||
logger.error('Directory %s exists and is non-empty, please clear it out first' % outputdir)
|
||||
return
|
||||
|
||||
self.init_bbhandler()
|
||||
layers = self.bblayers
|
||||
if len(arglist) > 2:
|
||||
layernames = arglist[:-1]
|
||||
found_layernames = []
|
||||
found_layerdirs = []
|
||||
for layerdir in layers:
|
||||
layername = self.get_layer_name(layerdir)
|
||||
if layername in layernames:
|
||||
found_layerdirs.append(layerdir)
|
||||
found_layernames.append(layername)
|
||||
|
||||
for layername in layernames:
|
||||
if not layername in found_layernames:
|
||||
logger.error('Unable to find layer %s in current configuration, please run "%s show-layers" to list configured layers' % (layername, os.path.basename(sys.argv[0])))
|
||||
return
|
||||
layers = found_layerdirs
|
||||
else:
|
||||
layernames = []
|
||||
|
||||
# Ensure a specified path matches our list of layers
|
||||
def layer_path_match(path):
|
||||
for layerdir in layers:
|
||||
if path.startswith(os.path.join(layerdir, '')):
|
||||
return layerdir
|
||||
return None
|
||||
|
||||
appended_recipes = []
|
||||
for layer in layers:
|
||||
overlayed = []
|
||||
for f in self.bbhandler.cooker.collection.overlayed.iterkeys():
|
||||
for of in self.bbhandler.cooker.collection.overlayed[f]:
|
||||
if of.startswith(layer):
|
||||
overlayed.append(of)
|
||||
|
||||
logger.plain('Copying files from %s...' % layer )
|
||||
for root, dirs, files in os.walk(layer):
|
||||
for f1 in files:
|
||||
f1full = os.sep.join([root, f1])
|
||||
if f1full in overlayed:
|
||||
logger.plain(' Skipping overlayed file %s' % f1full )
|
||||
else:
|
||||
ext = os.path.splitext(f1)[1]
|
||||
if ext != '.bbappend':
|
||||
fdest = f1full[len(layer):]
|
||||
fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
|
||||
bb.utils.mkdirhier(os.path.dirname(fdest))
|
||||
if os.path.exists(fdest):
|
||||
if f1 == 'layer.conf' and root.endswith('/conf'):
|
||||
logger.plain(' Skipping layer config file %s' % f1full )
|
||||
continue
|
||||
else:
|
||||
logger.warn('Overwriting file %s', fdest)
|
||||
bb.utils.copyfile(f1full, fdest)
|
||||
if ext == '.bb':
|
||||
if f1 in self.bbhandler.cooker.collection.appendlist:
|
||||
appends = self.bbhandler.cooker.collection.appendlist[f1]
|
||||
if appends:
|
||||
logger.plain(' Applying appends to %s' % fdest )
|
||||
for appendname in appends:
|
||||
if layer_path_match(appendname):
|
||||
self.apply_append(appendname, fdest)
|
||||
appended_recipes.append(f1)
|
||||
|
||||
# Take care of when some layers are excluded and yet we have included bbappends for those recipes
|
||||
for recipename in self.bbhandler.cooker.collection.appendlist.iterkeys():
|
||||
if recipename not in appended_recipes:
|
||||
appends = self.bbhandler.cooker.collection.appendlist[recipename]
|
||||
first_append = None
|
||||
for appendname in appends:
|
||||
layer = layer_path_match(appendname)
|
||||
if layer:
|
||||
if first_append:
|
||||
self.apply_append(appendname, first_append)
|
||||
else:
|
||||
fdest = appendname[len(layer):]
|
||||
fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
|
||||
bb.utils.mkdirhier(os.path.dirname(fdest))
|
||||
bb.utils.copyfile(appendname, fdest)
|
||||
first_append = fdest
|
||||
|
||||
# Get the regex for the first layer in our list (which is where the conf/layer.conf file will
|
||||
# have come from)
|
||||
first_regex = None
|
||||
layerdir = layers[0]
|
||||
for layername, pattern, regex, _ in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
|
||||
if regex.match(os.path.join(layerdir, 'test')):
|
||||
first_regex = regex
|
||||
break
|
||||
|
||||
if first_regex:
|
||||
# Find the BBFILES entries that match (which will have come from this conf/layer.conf file)
|
||||
bbfiles = str(self.bbhandler.config_data.getVar('BBFILES', True)).split()
|
||||
bbfiles_layer = []
|
||||
for item in bbfiles:
|
||||
if first_regex.match(item):
|
||||
newpath = os.path.join(outputdir, item[len(layerdir)+1:])
|
||||
bbfiles_layer.append(newpath)
|
||||
|
||||
if bbfiles_layer:
|
||||
# Check that all important layer files match BBFILES
|
||||
for root, dirs, files in os.walk(outputdir):
|
||||
for f1 in files:
|
||||
ext = os.path.splitext(f1)[1]
|
||||
if ext in ['.bb', '.bbappend']:
|
||||
f1full = os.sep.join([root, f1])
|
||||
entry_found = False
|
||||
for item in bbfiles_layer:
|
||||
if fnmatch.fnmatch(f1full, item):
|
||||
entry_found = True
|
||||
break
|
||||
if not entry_found:
|
||||
logger.warning("File %s does not match the flattened layer's BBFILES setting, you may need to edit conf/layer.conf or move the file elsewhere" % f1full)
|
||||
|
||||
def get_file_layer(self, filename):
|
||||
for layer, _, regex, _ in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
|
||||
if regex.match(filename):
|
||||
for layerdir in self.bblayers:
|
||||
if regex.match(os.path.join(layerdir, 'test')) and re.match(layerdir, filename):
|
||||
return self.get_layer_name(layerdir)
|
||||
return "?"
|
||||
|
||||
def get_file_layerdir(self, filename):
|
||||
for layer, _, regex, _ in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
|
||||
if regex.match(filename):
|
||||
for layerdir in self.bblayers:
|
||||
if regex.match(os.path.join(layerdir, 'test')) and re.match(layerdir, filename):
|
||||
return layerdir
|
||||
return "?"
|
||||
|
||||
def remove_layer_prefix(self, f):
|
||||
"""Remove the layer_dir prefix, e.g., f = /path/to/layer_dir/foo/blah, the
|
||||
return value will be: layer_dir/foo/blah"""
|
||||
f_layerdir = self.get_file_layerdir(f)
|
||||
prefix = os.path.join(os.path.dirname(f_layerdir), '')
|
||||
return f[len(prefix):] if f.startswith(prefix) else f
|
||||
|
||||
def get_layer_name(self, layerdir):
|
||||
return os.path.basename(layerdir.rstrip(os.sep))
|
||||
|
||||
def apply_append(self, appendname, recipename):
|
||||
appendfile = open(appendname, 'r')
|
||||
recipefile = open(recipename, 'a')
|
||||
recipefile.write('\n')
|
||||
recipefile.write('##### bbappended from %s #####\n' % self.get_file_layer(appendname))
|
||||
recipefile.writelines(appendfile.readlines())
|
||||
recipefile.close()
|
||||
appendfile.close()
|
||||
|
||||
def do_show_appends(self, args):
|
||||
"""list bbappend files and recipe files they apply to
|
||||
|
||||
usage: show-appends
|
||||
|
||||
Recipes are listed with the bbappends that apply to them as subitems.
|
||||
"""
|
||||
self.init_bbhandler()
|
||||
if not self.bbhandler.cooker.collection.appendlist:
|
||||
logger.plain('No append files found')
|
||||
return
|
||||
|
||||
logger.plain('=== Appended recipes ===')
|
||||
|
||||
pnlist = list(self.bbhandler.cooker_data.pkg_pn.keys())
|
||||
pnlist.sort()
|
||||
for pn in pnlist:
|
||||
self.show_appends_for_pn(pn)
|
||||
|
||||
self.show_appends_for_skipped()
|
||||
|
||||
def show_appends_for_pn(self, pn):
|
||||
filenames = self.bbhandler.cooker_data.pkg_pn[pn]
|
||||
|
||||
best = bb.providers.findBestProvider(pn,
|
||||
self.bbhandler.config_data,
|
||||
self.bbhandler.cooker_data,
|
||||
self.bbhandler.cooker_data.pkg_pn)
|
||||
best_filename = os.path.basename(best[3])
|
||||
|
||||
self.show_appends_output(filenames, best_filename)
|
||||
|
||||
def show_appends_for_skipped(self):
|
||||
filenames = [os.path.basename(f)
|
||||
for f in self.bbhandler.cooker.skiplist.iterkeys()]
|
||||
self.show_appends_output(filenames, None, " (skipped)")
|
||||
|
||||
def show_appends_output(self, filenames, best_filename, name_suffix = ''):
|
||||
appended, missing = self.get_appends_for_files(filenames)
|
||||
if appended:
|
||||
for basename, appends in appended:
|
||||
logger.plain('%s%s:', basename, name_suffix)
|
||||
for append in appends:
|
||||
logger.plain(' %s', append)
|
||||
|
||||
if best_filename:
|
||||
if best_filename in missing:
|
||||
logger.warn('%s: missing append for preferred version',
|
||||
best_filename)
|
||||
self.returncode |= 1
|
||||
|
||||
|
||||
def get_appends_for_files(self, filenames):
|
||||
appended, notappended = [], []
|
||||
for filename in filenames:
|
||||
_, cls = bb.cache.Cache.virtualfn2realfn(filename)
|
||||
if cls:
|
||||
continue
|
||||
|
||||
basename = os.path.basename(filename)
|
||||
appends = self.bbhandler.cooker.collection.get_file_appends(basename)
|
||||
if appends:
|
||||
appended.append((basename, list(appends)))
|
||||
else:
|
||||
notappended.append(basename)
|
||||
return appended, notappended
|
||||
|
||||
def do_show_cross_depends(self, args):
|
||||
"""figure out the dependency between recipes that crosses a layer boundary.
|
||||
|
||||
usage: show-cross-depends [-f] [-i layer1[,layer2[,layer3...]]]
|
||||
|
||||
Figure out the dependency between recipes that crosses a layer boundary.
|
||||
|
||||
Options:
|
||||
-f show full file path
|
||||
-i ignore dependencies on items in the specified layer(s)
|
||||
|
||||
NOTE:
|
||||
The .bbappend file can impact the dependency.
|
||||
"""
|
||||
import optparse
|
||||
|
||||
parser = optparse.OptionParser(usage="show-cross-depends [-f] [-i layer1[,layer2[,layer3...]]]")
|
||||
parser.add_option("-f", "",
|
||||
action="store_true", dest="show_filenames")
|
||||
parser.add_option("-i", "",
|
||||
action="store", dest="ignore_layers", default="")
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
ignore_layers = options.ignore_layers.split(',')
|
||||
|
||||
self.init_bbhandler()
|
||||
|
||||
pkg_fn = self.bbhandler.cooker_data.pkg_fn
|
||||
bbpath = str(self.bbhandler.config_data.getVar('BBPATH', True))
|
||||
self.require_re = re.compile(r"require\s+(.+)")
|
||||
self.include_re = re.compile(r"include\s+(.+)")
|
||||
self.inherit_re = re.compile(r"inherit\s+(.+)")
|
||||
|
||||
global_inherit = (self.bbhandler.config_data.getVar('INHERIT', True) or "").split()
|
||||
|
||||
# The bb's DEPENDS and RDEPENDS
|
||||
for f in pkg_fn:
|
||||
f = bb.cache.Cache.virtualfn2realfn(f)[0]
|
||||
# Get the layername that the file is in
|
||||
layername = self.get_file_layer(f)
|
||||
|
||||
# The DEPENDS
|
||||
deps = self.bbhandler.cooker_data.deps[f]
|
||||
for pn in deps:
|
||||
if pn in self.bbhandler.cooker_data.pkg_pn:
|
||||
best = bb.providers.findBestProvider(pn,
|
||||
self.bbhandler.config_data,
|
||||
self.bbhandler.cooker_data,
|
||||
self.bbhandler.cooker_data.pkg_pn)
|
||||
self.check_cross_depends("DEPENDS", layername, f, best[3], options.show_filenames, ignore_layers)
|
||||
|
||||
# The RDPENDS
|
||||
all_rdeps = self.bbhandler.cooker_data.rundeps[f].values()
|
||||
# Remove the duplicated or null one.
|
||||
sorted_rdeps = {}
|
||||
# The all_rdeps is the list in list, so we need two for loops
|
||||
for k1 in all_rdeps:
|
||||
for k2 in k1:
|
||||
sorted_rdeps[k2] = 1
|
||||
all_rdeps = sorted_rdeps.keys()
|
||||
for rdep in all_rdeps:
|
||||
all_p = bb.providers.getRuntimeProviders(self.bbhandler.cooker_data, rdep)
|
||||
if all_p:
|
||||
if f in all_p:
|
||||
# The recipe provides this one itself, ignore
|
||||
continue
|
||||
best = bb.providers.filterProvidersRunTime(all_p, rdep,
|
||||
self.bbhandler.config_data,
|
||||
self.bbhandler.cooker_data)[0][0]
|
||||
self.check_cross_depends("RDEPENDS", layername, f, best, options.show_filenames, ignore_layers)
|
||||
|
||||
# The RRECOMMENDS
|
||||
all_rrecs = self.bbhandler.cooker_data.runrecs[f].values()
|
||||
# Remove the duplicated or null one.
|
||||
sorted_rrecs = {}
|
||||
# The all_rrecs is the list in list, so we need two for loops
|
||||
for k1 in all_rrecs:
|
||||
for k2 in k1:
|
||||
sorted_rrecs[k2] = 1
|
||||
all_rrecs = sorted_rrecs.keys()
|
||||
for rrec in all_rrecs:
|
||||
all_p = bb.providers.getRuntimeProviders(self.bbhandler.cooker_data, rrec)
|
||||
if all_p:
|
||||
if f in all_p:
|
||||
# The recipe provides this one itself, ignore
|
||||
continue
|
||||
best = bb.providers.filterProvidersRunTime(all_p, rrec,
|
||||
self.bbhandler.config_data,
|
||||
self.bbhandler.cooker_data)[0][0]
|
||||
self.check_cross_depends("RRECOMMENDS", layername, f, best, options.show_filenames, ignore_layers)
|
||||
|
||||
# The inherit class
|
||||
cls_re = re.compile('classes/')
|
||||
if f in self.bbhandler.cooker_data.inherits:
|
||||
inherits = self.bbhandler.cooker_data.inherits[f]
|
||||
for cls in inherits:
|
||||
# The inherits' format is [classes/cls, /path/to/classes/cls]
|
||||
# ignore the classes/cls.
|
||||
if not cls_re.match(cls):
|
||||
classname = os.path.splitext(os.path.basename(cls))[0]
|
||||
if classname in global_inherit:
|
||||
continue
|
||||
inherit_layername = self.get_file_layer(cls)
|
||||
if inherit_layername != layername and not inherit_layername in ignore_layers:
|
||||
if not options.show_filenames:
|
||||
f_short = self.remove_layer_prefix(f)
|
||||
cls = self.remove_layer_prefix(cls)
|
||||
else:
|
||||
f_short = f
|
||||
logger.plain("%s inherits %s" % (f_short, cls))
|
||||
|
||||
# The 'require/include xxx' in the bb file
|
||||
pv_re = re.compile(r"\${PV}")
|
||||
fnfile = open(f, 'r')
|
||||
line = fnfile.readline()
|
||||
while line:
|
||||
m, keyword = self.match_require_include(line)
|
||||
# Found the 'require/include xxxx'
|
||||
if m:
|
||||
needed_file = m.group(1)
|
||||
# Replace the ${PV} with the real PV
|
||||
if pv_re.search(needed_file) and f in self.bbhandler.cooker_data.pkg_pepvpr:
|
||||
pv = self.bbhandler.cooker_data.pkg_pepvpr[f][1]
|
||||
needed_file = re.sub(r"\${PV}", pv, needed_file)
|
||||
self.print_cross_files(bbpath, keyword, layername, f, needed_file, options.show_filenames, ignore_layers)
|
||||
line = fnfile.readline()
|
||||
fnfile.close()
|
||||
|
||||
# The "require/include xxx" in conf/machine/*.conf, .inc and .bbclass
|
||||
conf_re = re.compile(".*/conf/machine/[^\/]*\.conf$")
|
||||
inc_re = re.compile(".*\.inc$")
|
||||
# The "inherit xxx" in .bbclass
|
||||
bbclass_re = re.compile(".*\.bbclass$")
|
||||
for layerdir in self.bblayers:
|
||||
layername = self.get_layer_name(layerdir)
|
||||
for dirpath, dirnames, filenames in os.walk(layerdir):
|
||||
for name in filenames:
|
||||
f = os.path.join(dirpath, name)
|
||||
s = conf_re.match(f) or inc_re.match(f) or bbclass_re.match(f)
|
||||
if s:
|
||||
ffile = open(f, 'r')
|
||||
line = ffile.readline()
|
||||
while line:
|
||||
m, keyword = self.match_require_include(line)
|
||||
# Only bbclass has the "inherit xxx" here.
|
||||
bbclass=""
|
||||
if not m and f.endswith(".bbclass"):
|
||||
m, keyword = self.match_inherit(line)
|
||||
bbclass=".bbclass"
|
||||
# Find a 'require/include xxxx'
|
||||
if m:
|
||||
self.print_cross_files(bbpath, keyword, layername, f, m.group(1) + bbclass, options.show_filenames, ignore_layers)
|
||||
line = ffile.readline()
|
||||
ffile.close()
|
||||
|
||||
def print_cross_files(self, bbpath, keyword, layername, f, needed_filename, show_filenames, ignore_layers):
|
||||
"""Print the depends that crosses a layer boundary"""
|
||||
needed_file = bb.utils.which(bbpath, needed_filename)
|
||||
if needed_file:
|
||||
# Which layer is this file from
|
||||
needed_layername = self.get_file_layer(needed_file)
|
||||
if needed_layername != layername and not needed_layername in ignore_layers:
|
||||
if not show_filenames:
|
||||
f = self.remove_layer_prefix(f)
|
||||
needed_file = self.remove_layer_prefix(needed_file)
|
||||
logger.plain("%s %s %s" %(f, keyword, needed_file))
|
||||
|
||||
def match_inherit(self, line):
|
||||
"""Match the inherit xxx line"""
|
||||
return (self.inherit_re.match(line), "inherits")
|
||||
|
||||
def match_require_include(self, line):
|
||||
"""Match the require/include xxx line"""
|
||||
m = self.require_re.match(line)
|
||||
keyword = "requires"
|
||||
if not m:
|
||||
m = self.include_re.match(line)
|
||||
keyword = "includes"
|
||||
return (m, keyword)
|
||||
|
||||
def check_cross_depends(self, keyword, layername, f, needed_file, show_filenames, ignore_layers):
|
||||
"""Print the DEPENDS/RDEPENDS file that crosses a layer boundary"""
|
||||
best_realfn = bb.cache.Cache.virtualfn2realfn(needed_file)[0]
|
||||
needed_layername = self.get_file_layer(best_realfn)
|
||||
if needed_layername != layername and not needed_layername in ignore_layers:
|
||||
if not show_filenames:
|
||||
f = self.remove_layer_prefix(f)
|
||||
best_realfn = self.remove_layer_prefix(best_realfn)
|
||||
|
||||
logger.plain("%s %s %s" % (f, keyword, best_realfn))
|
||||
|
||||
if __name__ == '__main__':
|
||||
sys.exit(main(sys.argv[1:]) or 0)
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
#!/usr/bin/env python3
|
||||
#!/usr/bin/env python
|
||||
import os
|
||||
import sys,logging
|
||||
import optparse
|
||||
@@ -50,6 +50,6 @@ if __name__ == "__main__":
|
||||
except Exception:
|
||||
ret = 1
|
||||
import traceback
|
||||
traceback.print_exc()
|
||||
traceback.print_exc(5)
|
||||
sys.exit(ret)
|
||||
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
#!/usr/bin/env python3
|
||||
#!/usr/bin/env python
|
||||
#
|
||||
# Copyright (C) 2012 Richard Purdie
|
||||
#
|
||||
@@ -25,49 +25,25 @@ try:
|
||||
except RuntimeError as exc:
|
||||
sys.exit(str(exc))
|
||||
|
||||
tests = ["bb.tests.codeparser",
|
||||
"bb.tests.cow",
|
||||
"bb.tests.data",
|
||||
"bb.tests.event",
|
||||
"bb.tests.fetch",
|
||||
"bb.tests.parse",
|
||||
"bb.tests.utils"]
|
||||
def usage():
|
||||
print('usage: %s [testname1 [testname2]...]' % os.path.basename(sys.argv[0]))
|
||||
|
||||
if len(sys.argv) > 1:
|
||||
if '--help' in sys.argv[1:]:
|
||||
usage()
|
||||
sys.exit(0)
|
||||
|
||||
tests = sys.argv[1:]
|
||||
else:
|
||||
tests = ["bb.tests.codeparser",
|
||||
"bb.tests.cow",
|
||||
"bb.tests.data",
|
||||
"bb.tests.fetch",
|
||||
"bb.tests.utils"]
|
||||
|
||||
for t in tests:
|
||||
t = '.'.join(t.split('.')[:3])
|
||||
__import__(t)
|
||||
|
||||
unittest.main(argv=["bitbake-selftest"] + tests)
|
||||
|
||||
# Set-up logging
|
||||
class StdoutStreamHandler(logging.StreamHandler):
|
||||
"""Special handler so that unittest is able to capture stdout"""
|
||||
def __init__(self):
|
||||
# Override __init__() because we don't want to set self.stream here
|
||||
logging.Handler.__init__(self)
|
||||
|
||||
@property
|
||||
def stream(self):
|
||||
# We want to dynamically write wherever sys.stdout is pointing to
|
||||
return sys.stdout
|
||||
|
||||
|
||||
handler = StdoutStreamHandler()
|
||||
bb.logger.addHandler(handler)
|
||||
bb.logger.setLevel(logging.DEBUG)
|
||||
|
||||
|
||||
ENV_HELP = """\
|
||||
Environment variables:
|
||||
BB_SKIP_NETTESTS set to 'yes' in order to skip tests using network
|
||||
connection
|
||||
BB_TMPDIR_NOCLEAN set to 'yes' to preserve test tmp directories
|
||||
"""
|
||||
|
||||
class main(unittest.main):
|
||||
def _print_help(self, *args, **kwargs):
|
||||
super(main, self)._print_help(*args, **kwargs)
|
||||
print(ENV_HELP)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
main(defaultTest=tests, buffer=True)
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
#!/usr/bin/env python3
|
||||
#!/usr/bin/env python
|
||||
|
||||
import os
|
||||
import sys
|
||||
@@ -10,14 +10,6 @@ import bb
|
||||
import select
|
||||
import errno
|
||||
import signal
|
||||
import pickle
|
||||
import traceback
|
||||
import queue
|
||||
from multiprocessing import Lock
|
||||
from threading import Thread
|
||||
|
||||
if sys.getfilesystemencoding() != "utf-8":
|
||||
sys.exit("Please use a locale setting which supports UTF-8 (such as LANG=en_US.UTF-8).\nPython can't change the filesystem locale after loading so we need a UTF-8 when Python starts or things won't work.")
|
||||
|
||||
# Users shouldn't be running this code directly
|
||||
if len(sys.argv) != 2 or not sys.argv[1].startswith("decafbad"):
|
||||
@@ -25,33 +17,24 @@ if len(sys.argv) != 2 or not sys.argv[1].startswith("decafbad"):
|
||||
sys.exit(1)
|
||||
|
||||
profiling = False
|
||||
if sys.argv[1].startswith("decafbadbad"):
|
||||
if sys.argv[1] == "decafbadbad":
|
||||
profiling = True
|
||||
try:
|
||||
import cProfile as profile
|
||||
except:
|
||||
import profile
|
||||
|
||||
# Unbuffer stdout to avoid log truncation in the event
|
||||
# of an unorderly exit as well as to provide timely
|
||||
# updates to log files for use with tail
|
||||
try:
|
||||
if sys.stdout.name == '<stdout>':
|
||||
import fcntl
|
||||
fl = fcntl.fcntl(sys.stdout.fileno(), fcntl.F_GETFL)
|
||||
fl |= os.O_SYNC
|
||||
fcntl.fcntl(sys.stdout.fileno(), fcntl.F_SETFL, fl)
|
||||
#sys.stdout = os.fdopen(sys.stdout.fileno(), 'w', 0)
|
||||
except:
|
||||
pass
|
||||
|
||||
logger = logging.getLogger("BitBake")
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
bb.msg.note(1, bb.msg.domain.Cache, "Importing cPickle failed. Falling back to a very slow implementation.")
|
||||
|
||||
|
||||
worker_pipe = sys.stdout.fileno()
|
||||
bb.utils.nonblockingfd(worker_pipe)
|
||||
# Need to guard against multiprocessing being used in child processes
|
||||
# and multiple processes trying to write to the parent at the same time
|
||||
worker_pipe_lock = None
|
||||
|
||||
handler = bb.event.LogHandler()
|
||||
logger.addHandler(handler)
|
||||
@@ -66,61 +49,36 @@ if 0:
|
||||
consolelog.setFormatter(conlogformat)
|
||||
logger.addHandler(consolelog)
|
||||
|
||||
worker_queue = queue.Queue()
|
||||
worker_queue = ""
|
||||
|
||||
def worker_fire(event, d):
|
||||
data = b"<event>" + pickle.dumps(event) + b"</event>"
|
||||
data = "<event>" + pickle.dumps(event) + "</event>"
|
||||
worker_fire_prepickled(data)
|
||||
|
||||
def worker_fire_prepickled(event):
|
||||
global worker_queue
|
||||
|
||||
worker_queue.put(event)
|
||||
worker_queue = worker_queue + event
|
||||
worker_flush()
|
||||
|
||||
#
|
||||
# We can end up with write contention with the cooker, it can be trying to send commands
|
||||
# and we can be trying to send event data back. Therefore use a separate thread for writing
|
||||
# back data to cooker.
|
||||
#
|
||||
worker_thread_exit = False
|
||||
def worker_flush():
|
||||
global worker_queue, worker_pipe
|
||||
|
||||
def worker_flush(worker_queue):
|
||||
worker_queue_int = b""
|
||||
global worker_pipe, worker_thread_exit
|
||||
if not worker_queue:
|
||||
return
|
||||
|
||||
while True:
|
||||
try:
|
||||
worker_queue_int = worker_queue_int + worker_queue.get(True, 1)
|
||||
except queue.Empty:
|
||||
pass
|
||||
while (worker_queue_int or not worker_queue.empty()):
|
||||
try:
|
||||
(_, ready, _) = select.select([], [worker_pipe], [], 1)
|
||||
if not worker_queue.empty():
|
||||
worker_queue_int = worker_queue_int + worker_queue.get()
|
||||
written = os.write(worker_pipe, worker_queue_int)
|
||||
worker_queue_int = worker_queue_int[written:]
|
||||
except (IOError, OSError) as e:
|
||||
if e.errno != errno.EAGAIN and e.errno != errno.EPIPE:
|
||||
raise
|
||||
if worker_thread_exit and worker_queue.empty() and not worker_queue_int:
|
||||
return
|
||||
|
||||
worker_thread = Thread(target=worker_flush, args=(worker_queue,))
|
||||
worker_thread.start()
|
||||
try:
|
||||
written = os.write(worker_pipe, worker_queue)
|
||||
worker_queue = worker_queue[written:]
|
||||
except (IOError, OSError) as e:
|
||||
if e.errno != errno.EAGAIN:
|
||||
raise
|
||||
|
||||
def worker_child_fire(event, d):
|
||||
global worker_pipe
|
||||
global worker_pipe_lock
|
||||
|
||||
data = b"<event>" + pickle.dumps(event) + b"</event>"
|
||||
try:
|
||||
worker_pipe_lock.acquire()
|
||||
worker_pipe.write(data)
|
||||
worker_pipe_lock.release()
|
||||
except IOError:
|
||||
sigterm_handler(None, None)
|
||||
raise
|
||||
data = "<event>" + pickle.dumps(event) + "</event>"
|
||||
worker_pipe.write(data)
|
||||
|
||||
bb.event.worker_fire = worker_fire
|
||||
|
||||
@@ -136,7 +94,7 @@ def sigterm_handler(signum, frame):
|
||||
os.killpg(0, signal.SIGTERM)
|
||||
sys.exit()
|
||||
|
||||
def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, appends, taskdepdata, extraconfigdata, quieterrors=False, dry_run_exec=False):
|
||||
def fork_off_task(cfg, data, workerdata, fn, task, taskname, appends, taskdepdata, quieterrors=False):
|
||||
# We need to setup the environment BEFORE the fork, since
|
||||
# a fork() or exec*() activates PSEUDO...
|
||||
|
||||
@@ -152,10 +110,8 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, append
|
||||
except TypeError:
|
||||
umask = taskdep['umask'][taskname]
|
||||
|
||||
dry_run = cfg.dry_run or dry_run_exec
|
||||
|
||||
# We can't use the fakeroot environment in a dry run as it possibly hasn't been built
|
||||
if 'fakeroot' in taskdep and taskname in taskdep['fakeroot'] and not dry_run:
|
||||
if 'fakeroot' in taskdep and taskname in taskdep['fakeroot'] and not cfg.dry_run:
|
||||
envvars = (workerdata["fakerootenv"][fn] or "").split()
|
||||
for key, value in (var.split('=') for var in envvars):
|
||||
envbackup[key] = os.environ.get(key)
|
||||
@@ -183,26 +139,22 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, append
|
||||
pipeout = os.fdopen(pipeout, 'wb', 0)
|
||||
pid = os.fork()
|
||||
except OSError as e:
|
||||
logger.critical("fork failed: %d (%s)" % (e.errno, e.strerror))
|
||||
sys.exit(1)
|
||||
bb.msg.fatal("RunQueue", "fork failed: %d (%s)" % (e.errno, e.strerror))
|
||||
|
||||
if pid == 0:
|
||||
def child():
|
||||
global worker_pipe
|
||||
global worker_pipe_lock
|
||||
pipein.close()
|
||||
|
||||
signal.signal(signal.SIGTERM, sigterm_handler)
|
||||
# Let SIGHUP exit as SIGTERM
|
||||
signal.signal(signal.SIGHUP, sigterm_handler)
|
||||
bb.utils.signal_on_parent_exit("SIGTERM")
|
||||
|
||||
# Save out the PID so that the event can include it the
|
||||
# events
|
||||
bb.event.worker_pid = os.getpid()
|
||||
bb.event.worker_fire = worker_child_fire
|
||||
worker_pipe = pipeout
|
||||
worker_pipe_lock = Lock()
|
||||
|
||||
# Make the child the process group leader and ensure no
|
||||
# child process will be controlled by the current terminal
|
||||
@@ -216,58 +168,37 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, append
|
||||
if umask:
|
||||
os.umask(umask)
|
||||
|
||||
data.setVar("BB_WORKERCONTEXT", "1")
|
||||
data.setVar("BB_TASKDEPDATA", taskdepdata)
|
||||
data.setVar("BUILDNAME", workerdata["buildname"])
|
||||
data.setVar("DATE", workerdata["date"])
|
||||
data.setVar("TIME", workerdata["time"])
|
||||
bb.parse.siggen.set_taskdata(workerdata["sigdata"])
|
||||
ret = 0
|
||||
try:
|
||||
bb_cache = bb.cache.NoCache(databuilder)
|
||||
(realfn, virtual, mc) = bb.cache.virtualfn2realfn(fn)
|
||||
the_data = databuilder.mcdata[mc]
|
||||
the_data.setVar("BB_WORKERCONTEXT", "1")
|
||||
the_data.setVar("BB_TASKDEPDATA", taskdepdata)
|
||||
if cfg.limited_deps:
|
||||
the_data.setVar("BB_LIMITEDDEPS", "1")
|
||||
the_data.setVar("BUILDNAME", workerdata["buildname"])
|
||||
the_data.setVar("DATE", workerdata["date"])
|
||||
the_data.setVar("TIME", workerdata["time"])
|
||||
for varname, value in extraconfigdata.items():
|
||||
the_data.setVar(varname, value)
|
||||
|
||||
bb.parse.siggen.set_taskdata(workerdata["sigdata"])
|
||||
ret = 0
|
||||
|
||||
the_data = bb_cache.loadDataFull(fn, appends)
|
||||
the_data = bb.cache.Cache.loadDataFull(fn, appends, data)
|
||||
the_data.setVar('BB_TASKHASH', workerdata["runq_hash"][task])
|
||||
|
||||
bb.utils.set_process_name("%s:%s" % (the_data.getVar("PN"), taskname.replace("do_", "")))
|
||||
|
||||
# exported_vars() returns a generator which *cannot* be passed to os.environ.update()
|
||||
# successfully. We also need to unset anything from the environment which shouldn't be there
|
||||
exports = bb.data.exported_vars(the_data)
|
||||
|
||||
bb.utils.empty_environment()
|
||||
for e, v in exports:
|
||||
os.environ[e] = v
|
||||
|
||||
for e in fakeenv:
|
||||
os.environ[e] = fakeenv[e]
|
||||
the_data.setVar(e, fakeenv[e])
|
||||
the_data.setVarFlag(e, 'export', "1")
|
||||
|
||||
task_exports = the_data.getVarFlag(taskname, 'exports')
|
||||
if task_exports:
|
||||
for e in task_exports.split():
|
||||
the_data.setVarFlag(e, 'export', '1')
|
||||
v = the_data.getVar(e)
|
||||
if v is not None:
|
||||
os.environ[e] = v
|
||||
|
||||
if quieterrors:
|
||||
the_data.setVarFlag(taskname, "quieterrors", "1")
|
||||
|
||||
except Exception:
|
||||
except Exception as exc:
|
||||
if not quieterrors:
|
||||
logger.critical(traceback.format_exc())
|
||||
logger.critical(str(exc))
|
||||
os._exit(1)
|
||||
try:
|
||||
if dry_run:
|
||||
if cfg.dry_run:
|
||||
return 0
|
||||
return bb.build.exec_task(fn, taskname, the_data, cfg.profile)
|
||||
except:
|
||||
@@ -284,7 +215,7 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, append
|
||||
bb.utils.process_profilelog(profname)
|
||||
os._exit(ret)
|
||||
else:
|
||||
for key, value in iter(envbackup.items()):
|
||||
for key, value in envbackup.iteritems():
|
||||
if value is None:
|
||||
del os.environ[key]
|
||||
else:
|
||||
@@ -301,22 +232,22 @@ class runQueueWorkerPipe():
|
||||
if pipeout:
|
||||
pipeout.close()
|
||||
bb.utils.nonblockingfd(self.input)
|
||||
self.queue = b""
|
||||
self.queue = ""
|
||||
|
||||
def read(self):
|
||||
start = len(self.queue)
|
||||
try:
|
||||
self.queue = self.queue + (self.input.read(102400) or b"")
|
||||
self.queue = self.queue + self.input.read(102400)
|
||||
except (OSError, IOError) as e:
|
||||
if e.errno != errno.EAGAIN:
|
||||
raise
|
||||
|
||||
end = len(self.queue)
|
||||
index = self.queue.find(b"</event>")
|
||||
index = self.queue.find("</event>")
|
||||
while index != -1:
|
||||
worker_fire_prepickled(self.queue[:index+8])
|
||||
self.queue = self.queue[index+8:]
|
||||
index = self.queue.find(b"</event>")
|
||||
index = self.queue.find("</event>")
|
||||
return (end > start)
|
||||
|
||||
def close(self):
|
||||
@@ -332,27 +263,22 @@ class BitbakeWorker(object):
|
||||
def __init__(self, din):
|
||||
self.input = din
|
||||
bb.utils.nonblockingfd(self.input)
|
||||
self.queue = b""
|
||||
self.queue = ""
|
||||
self.cookercfg = None
|
||||
self.databuilder = None
|
||||
self.data = None
|
||||
self.extraconfigdata = None
|
||||
self.build_pids = {}
|
||||
self.build_pipes = {}
|
||||
|
||||
signal.signal(signal.SIGTERM, self.sigterm_exception)
|
||||
# Let SIGHUP exit as SIGTERM
|
||||
signal.signal(signal.SIGHUP, self.sigterm_exception)
|
||||
if "beef" in sys.argv[1]:
|
||||
bb.utils.set_process_name("Worker (Fakeroot)")
|
||||
else:
|
||||
bb.utils.set_process_name("Worker")
|
||||
|
||||
def sigterm_exception(self, signum, stackframe):
|
||||
if signum == signal.SIGTERM:
|
||||
bb.warn("Worker received SIGTERM, shutting down...")
|
||||
bb.warn("Worker recieved SIGTERM, shutting down...")
|
||||
elif signum == signal.SIGHUP:
|
||||
bb.warn("Worker received SIGHUP, shutting down...")
|
||||
bb.warn("Worker recieved SIGHUP, shutting down...")
|
||||
self.handle_finishnow(None)
|
||||
signal.signal(signal.SIGTERM, signal.SIG_DFL)
|
||||
os.kill(os.getpid(), signal.SIGTERM)
|
||||
@@ -360,39 +286,34 @@ class BitbakeWorker(object):
|
||||
def serve(self):
|
||||
while True:
|
||||
(ready, _, _) = select.select([self.input] + [i.input for i in self.build_pipes.values()], [] , [], 1)
|
||||
if self.input in ready:
|
||||
if self.input in ready or len(self.queue):
|
||||
start = len(self.queue)
|
||||
try:
|
||||
r = self.input.read()
|
||||
if len(r) == 0:
|
||||
# EOF on pipe, server must have terminated
|
||||
self.sigterm_exception(signal.SIGTERM, None)
|
||||
self.queue = self.queue + r
|
||||
self.queue = self.queue + self.input.read()
|
||||
except (OSError, IOError):
|
||||
pass
|
||||
if len(self.queue):
|
||||
self.handle_item(b"cookerconfig", self.handle_cookercfg)
|
||||
self.handle_item(b"extraconfigdata", self.handle_extraconfigdata)
|
||||
self.handle_item(b"workerdata", self.handle_workerdata)
|
||||
self.handle_item(b"runtask", self.handle_runtask)
|
||||
self.handle_item(b"finishnow", self.handle_finishnow)
|
||||
self.handle_item(b"ping", self.handle_ping)
|
||||
self.handle_item(b"quit", self.handle_quit)
|
||||
end = len(self.queue)
|
||||
self.handle_item("cookerconfig", self.handle_cookercfg)
|
||||
self.handle_item("workerdata", self.handle_workerdata)
|
||||
self.handle_item("runtask", self.handle_runtask)
|
||||
self.handle_item("finishnow", self.handle_finishnow)
|
||||
self.handle_item("ping", self.handle_ping)
|
||||
self.handle_item("quit", self.handle_quit)
|
||||
|
||||
for pipe in self.build_pipes:
|
||||
if self.build_pipes[pipe].input in ready:
|
||||
self.build_pipes[pipe].read()
|
||||
self.build_pipes[pipe].read()
|
||||
if len(self.build_pids):
|
||||
while self.process_waitpid():
|
||||
continue
|
||||
self.process_waitpid()
|
||||
worker_flush()
|
||||
|
||||
|
||||
def handle_item(self, item, func):
|
||||
if self.queue.startswith(b"<" + item + b">"):
|
||||
index = self.queue.find(b"</" + item + b">")
|
||||
if self.queue.startswith("<" + item + ">"):
|
||||
index = self.queue.find("</" + item + ">")
|
||||
while index != -1:
|
||||
func(self.queue[(len(item) + 2):index])
|
||||
self.queue = self.queue[(index + len(item) + 3):]
|
||||
index = self.queue.find(b"</" + item + b">")
|
||||
index = self.queue.find("</" + item + ">")
|
||||
|
||||
def handle_cookercfg(self, data):
|
||||
self.cookercfg = pickle.loads(data)
|
||||
@@ -400,22 +321,18 @@ class BitbakeWorker(object):
|
||||
self.databuilder.parseBaseConfiguration()
|
||||
self.data = self.databuilder.data
|
||||
|
||||
def handle_extraconfigdata(self, data):
|
||||
self.extraconfigdata = pickle.loads(data)
|
||||
|
||||
def handle_workerdata(self, data):
|
||||
self.workerdata = pickle.loads(data)
|
||||
bb.msg.loggerDefaultDebugLevel = self.workerdata["logdefaultdebug"]
|
||||
bb.msg.loggerDefaultVerbose = self.workerdata["logdefaultverbose"]
|
||||
bb.msg.loggerVerboseLogs = self.workerdata["logdefaultverboselogs"]
|
||||
bb.msg.loggerDefaultDomains = self.workerdata["logdefaultdomain"]
|
||||
for mc in self.databuilder.mcdata:
|
||||
self.databuilder.mcdata[mc].setVar("PRSERV_HOST", self.workerdata["prhost"])
|
||||
self.data.setVar("PRSERV_HOST", self.workerdata["prhost"])
|
||||
|
||||
def handle_ping(self, _):
|
||||
workerlog_write("Handling ping\n")
|
||||
|
||||
logger.warning("Pong from bitbake-worker!")
|
||||
logger.warn("Pong from bitbake-worker!")
|
||||
|
||||
def handle_quit(self, data):
|
||||
workerlog_write("Handling quit\n")
|
||||
@@ -425,10 +342,10 @@ class BitbakeWorker(object):
|
||||
sys.exit(0)
|
||||
|
||||
def handle_runtask(self, data):
|
||||
fn, task, taskname, quieterrors, appends, taskdepdata, dry_run_exec = pickle.loads(data)
|
||||
fn, task, taskname, quieterrors, appends, taskdepdata = pickle.loads(data)
|
||||
workerlog_write("Handling runtask %s %s %s\n" % (task, fn, taskname))
|
||||
|
||||
pid, pipein, pipeout = fork_off_task(self.cookercfg, self.data, self.databuilder, self.workerdata, fn, task, taskname, appends, taskdepdata, self.extraconfigdata, quieterrors, dry_run_exec)
|
||||
pid, pipein, pipeout = fork_off_task(self.cookercfg, self.data, self.workerdata, fn, task, taskname, appends, taskdepdata, quieterrors)
|
||||
|
||||
self.build_pids[pid] = task
|
||||
self.build_pipes[pid] = runQueueWorkerPipe(pipein, pipeout)
|
||||
@@ -441,9 +358,9 @@ class BitbakeWorker(object):
|
||||
try:
|
||||
pid, status = os.waitpid(-1, os.WNOHANG)
|
||||
if pid == 0 or os.WIFSTOPPED(status):
|
||||
return False
|
||||
return None
|
||||
except OSError:
|
||||
return False
|
||||
return None
|
||||
|
||||
workerlog_write("Exit code of %s for pid %s\n" % (status, pid))
|
||||
|
||||
@@ -460,14 +377,12 @@ class BitbakeWorker(object):
|
||||
self.build_pipes[pid].close()
|
||||
del self.build_pipes[pid]
|
||||
|
||||
worker_fire_prepickled(b"<exitcode>" + pickle.dumps((task, status)) + b"</exitcode>")
|
||||
|
||||
return True
|
||||
worker_fire_prepickled("<exitcode>" + pickle.dumps((task, status)) + "</exitcode>")
|
||||
|
||||
def handle_finishnow(self, _):
|
||||
if self.build_pids:
|
||||
logger.info("Sending SIGTERM to remaining %s tasks", len(self.build_pids))
|
||||
for k, v in iter(self.build_pids.items()):
|
||||
for k, v in self.build_pids.iteritems():
|
||||
try:
|
||||
os.kill(-k, signal.SIGTERM)
|
||||
os.waitpid(-1, 0)
|
||||
@@ -477,7 +392,7 @@ class BitbakeWorker(object):
|
||||
self.build_pipes[pipe].read()
|
||||
|
||||
try:
|
||||
worker = BitbakeWorker(os.fdopen(sys.stdin.fileno(), 'rb'))
|
||||
worker = BitbakeWorker(sys.stdin)
|
||||
if not profiling:
|
||||
worker.serve()
|
||||
else:
|
||||
@@ -493,9 +408,8 @@ except BaseException as e:
|
||||
import traceback
|
||||
sys.stderr.write(traceback.format_exc())
|
||||
sys.stderr.write(str(e))
|
||||
|
||||
worker_thread_exit = True
|
||||
worker_thread.join()
|
||||
|
||||
while len(worker_queue):
|
||||
worker_flush()
|
||||
workerlog_write("exitting")
|
||||
sys.exit(0)
|
||||
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
#!/usr/bin/env python3
|
||||
#!/usr/bin/env python
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
@@ -462,7 +462,7 @@ def main():
|
||||
state_group = 2
|
||||
|
||||
for key in bb.data.keys(documentation):
|
||||
data = documentation.getVarFlag(key, "doc", False)
|
||||
data = documentation.getVarFlag(key, "doc")
|
||||
if not data:
|
||||
continue
|
||||
|
||||
|
||||
@@ -1,165 +0,0 @@
|
||||
#!/usr/bin/env python3
|
||||
"""git-make-shallow: make the current git repository shallow
|
||||
|
||||
Remove the history of the specified revisions, then optionally filter the
|
||||
available refs to those specified.
|
||||
"""
|
||||
|
||||
import argparse
|
||||
import collections
|
||||
import errno
|
||||
import itertools
|
||||
import os
|
||||
import subprocess
|
||||
import sys
|
||||
|
||||
version = 1.0
|
||||
|
||||
|
||||
def main():
|
||||
if sys.version_info < (3, 4, 0):
|
||||
sys.exit('Python 3.4 or greater is required')
|
||||
|
||||
git_dir = check_output(['git', 'rev-parse', '--git-dir']).rstrip()
|
||||
shallow_file = os.path.join(git_dir, 'shallow')
|
||||
if os.path.exists(shallow_file):
|
||||
try:
|
||||
check_output(['git', 'fetch', '--unshallow'])
|
||||
except subprocess.CalledProcessError:
|
||||
try:
|
||||
os.unlink(shallow_file)
|
||||
except OSError as exc:
|
||||
if exc.errno != errno.ENOENT:
|
||||
raise
|
||||
|
||||
args = process_args()
|
||||
revs = check_output(['git', 'rev-list'] + args.revisions).splitlines()
|
||||
|
||||
make_shallow(shallow_file, args.revisions, args.refs)
|
||||
|
||||
ref_revs = check_output(['git', 'rev-list'] + args.refs).splitlines()
|
||||
remaining_history = set(revs) & set(ref_revs)
|
||||
for rev in remaining_history:
|
||||
if check_output(['git', 'rev-parse', '{}^@'.format(rev)]):
|
||||
sys.exit('Error: %s was not made shallow' % rev)
|
||||
|
||||
filter_refs(args.refs)
|
||||
|
||||
if args.shrink:
|
||||
shrink_repo(git_dir)
|
||||
subprocess.check_call(['git', 'fsck', '--unreachable'])
|
||||
|
||||
|
||||
def process_args():
|
||||
# TODO: add argument to automatically keep local-only refs, since they
|
||||
# can't be easily restored with a git fetch.
|
||||
parser = argparse.ArgumentParser(description='Remove the history of the specified revisions, then optionally filter the available refs to those specified.')
|
||||
parser.add_argument('--ref', '-r', metavar='REF', action='append', dest='refs', help='remove all but the specified refs (cumulative)')
|
||||
parser.add_argument('--shrink', '-s', action='store_true', help='shrink the git repository by repacking and pruning')
|
||||
parser.add_argument('revisions', metavar='REVISION', nargs='+', help='a git revision/commit')
|
||||
if len(sys.argv) < 2:
|
||||
parser.print_help()
|
||||
sys.exit(2)
|
||||
|
||||
args = parser.parse_args()
|
||||
|
||||
if args.refs:
|
||||
args.refs = check_output(['git', 'rev-parse', '--symbolic-full-name'] + args.refs).splitlines()
|
||||
else:
|
||||
args.refs = get_all_refs(lambda r, t, tt: t == 'commit' or tt == 'commit')
|
||||
|
||||
args.refs = list(filter(lambda r: not r.endswith('/HEAD'), args.refs))
|
||||
args.revisions = check_output(['git', 'rev-parse'] + ['%s^{}' % i for i in args.revisions]).splitlines()
|
||||
return args
|
||||
|
||||
|
||||
def check_output(cmd, input=None):
|
||||
return subprocess.check_output(cmd, universal_newlines=True, input=input)
|
||||
|
||||
|
||||
def make_shallow(shallow_file, revisions, refs):
|
||||
"""Remove the history of the specified revisions."""
|
||||
for rev in follow_history_intersections(revisions, refs):
|
||||
print("Processing %s" % rev)
|
||||
with open(shallow_file, 'a') as f:
|
||||
f.write(rev + '\n')
|
||||
|
||||
|
||||
def get_all_refs(ref_filter=None):
|
||||
"""Return all the existing refs in this repository, optionally filtering the refs."""
|
||||
ref_output = check_output(['git', 'for-each-ref', '--format=%(refname)\t%(objecttype)\t%(*objecttype)'])
|
||||
ref_split = [tuple(iter_extend(l.rsplit('\t'), 3)) for l in ref_output.splitlines()]
|
||||
if ref_filter:
|
||||
ref_split = (e for e in ref_split if ref_filter(*e))
|
||||
refs = [r[0] for r in ref_split]
|
||||
return refs
|
||||
|
||||
|
||||
def iter_extend(iterable, length, obj=None):
|
||||
"""Ensure that iterable is the specified length by extending with obj."""
|
||||
return itertools.islice(itertools.chain(iterable, itertools.repeat(obj)), length)
|
||||
|
||||
|
||||
def filter_refs(refs):
|
||||
"""Remove all but the specified refs from the git repository."""
|
||||
all_refs = get_all_refs()
|
||||
to_remove = set(all_refs) - set(refs)
|
||||
if to_remove:
|
||||
check_output(['xargs', '-0', '-n', '1', 'git', 'update-ref', '-d', '--no-deref'],
|
||||
input=''.join(l + '\0' for l in to_remove))
|
||||
|
||||
|
||||
def follow_history_intersections(revisions, refs):
|
||||
"""Determine all the points where the history of the specified revisions intersects the specified refs."""
|
||||
queue = collections.deque(revisions)
|
||||
seen = set()
|
||||
|
||||
for rev in iter_except(queue.popleft, IndexError):
|
||||
if rev in seen:
|
||||
continue
|
||||
|
||||
parents = check_output(['git', 'rev-parse', '%s^@' % rev]).splitlines()
|
||||
|
||||
yield rev
|
||||
seen.add(rev)
|
||||
|
||||
if not parents:
|
||||
continue
|
||||
|
||||
check_refs = check_output(['git', 'merge-base', '--independent'] + sorted(refs)).splitlines()
|
||||
for parent in parents:
|
||||
for ref in check_refs:
|
||||
print("Checking %s vs %s" % (parent, ref))
|
||||
try:
|
||||
merge_base = check_output(['git', 'merge-base', parent, ref]).rstrip()
|
||||
except subprocess.CalledProcessError:
|
||||
continue
|
||||
else:
|
||||
queue.append(merge_base)
|
||||
|
||||
|
||||
def iter_except(func, exception, start=None):
|
||||
"""Yield a function repeatedly until it raises an exception."""
|
||||
try:
|
||||
if start is not None:
|
||||
yield start()
|
||||
while True:
|
||||
yield func()
|
||||
except exception:
|
||||
pass
|
||||
|
||||
|
||||
def shrink_repo(git_dir):
|
||||
"""Shrink the newly shallow repository, removing the unreachable objects."""
|
||||
subprocess.check_call(['git', 'reflog', 'expire', '--expire-unreachable=now', '--all'])
|
||||
subprocess.check_call(['git', 'repack', '-ad'])
|
||||
try:
|
||||
os.unlink(os.path.join(git_dir, 'objects', 'info', 'alternates'))
|
||||
except OSError as exc:
|
||||
if exc.errno != errno.ENOENT:
|
||||
raise
|
||||
subprocess.check_call(['git', 'prune', '--expire', 'now'])
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
||||
122
bitbake/bin/image-writer
Executable file
122
bitbake/bin/image-writer
Executable file
@@ -0,0 +1,122 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright (c) 2012 Wind River Systems, Inc.
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
|
||||
# See the GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License
|
||||
# along with this program; if not, write to the Free Software
|
||||
# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
||||
|
||||
import os
|
||||
import sys
|
||||
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname( \
|
||||
os.path.abspath(__file__))), 'lib'))
|
||||
try:
|
||||
import bb
|
||||
except RuntimeError as exc:
|
||||
sys.exit(str(exc))
|
||||
|
||||
import gtk
|
||||
import optparse
|
||||
import pygtk
|
||||
|
||||
from bb.ui.crumbs.hobwidget import HobAltButton, HobButton
|
||||
from bb.ui.crumbs.hig.crumbsmessagedialog import CrumbsMessageDialog
|
||||
from bb.ui.crumbs.hig.deployimagedialog import DeployImageDialog
|
||||
from bb.ui.crumbs.hig.imageselectiondialog import ImageSelectionDialog
|
||||
|
||||
# I put all the fs bitbake supported here. Need more test.
|
||||
DEPLOYABLE_IMAGE_TYPES = ["jffs2", "cramfs", "ext2", "ext3", "btrfs", "squashfs", "ubi", "vmdk"]
|
||||
Title = "USB Image Writer"
|
||||
|
||||
class DeployWindow(gtk.Window):
|
||||
def __init__(self, image_path=''):
|
||||
super(DeployWindow, self).__init__()
|
||||
|
||||
if len(image_path) > 0:
|
||||
valid = True
|
||||
if not os.path.exists(image_path):
|
||||
valid = False
|
||||
lbl = "<b>Invalid image file path: %s.</b>\nPress <b>Select Image</b> to select an image." % image_path
|
||||
else:
|
||||
image_path = os.path.abspath(image_path)
|
||||
extend_name = os.path.splitext(image_path)[1][1:]
|
||||
if extend_name not in DEPLOYABLE_IMAGE_TYPES:
|
||||
valid = False
|
||||
lbl = "<b>Undeployable imge type: %s</b>\nPress <b>Select Image</b> to select an image." % extend_name
|
||||
|
||||
if not valid:
|
||||
image_path = ''
|
||||
crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
|
||||
button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
|
||||
HobButton.style_button(button)
|
||||
crumbs_dialog.run()
|
||||
crumbs_dialog.destroy()
|
||||
|
||||
self.deploy_dialog = DeployImageDialog(Title, image_path, self,
|
||||
gtk.DIALOG_MODAL | gtk.DIALOG_DESTROY_WITH_PARENT
|
||||
| gtk.DIALOG_NO_SEPARATOR, None, standalone=True)
|
||||
close_button = self.deploy_dialog.add_button("Close", gtk.RESPONSE_NO)
|
||||
HobAltButton.style_button(close_button)
|
||||
close_button.connect('clicked', gtk.main_quit)
|
||||
|
||||
write_button = self.deploy_dialog.add_button("Write USB image", gtk.RESPONSE_YES)
|
||||
HobAltButton.style_button(write_button)
|
||||
|
||||
self.deploy_dialog.connect('select_image_clicked', self.select_image_clicked_cb)
|
||||
self.deploy_dialog.connect('destroy', gtk.main_quit)
|
||||
response = self.deploy_dialog.show()
|
||||
|
||||
def select_image_clicked_cb(self, dialog):
|
||||
cwd = os.getcwd()
|
||||
dialog = ImageSelectionDialog(cwd, DEPLOYABLE_IMAGE_TYPES, Title, self, gtk.FILE_CHOOSER_ACTION_SAVE )
|
||||
button = dialog.add_button("Cancel", gtk.RESPONSE_NO)
|
||||
HobAltButton.style_button(button)
|
||||
button = dialog.add_button("Open", gtk.RESPONSE_YES)
|
||||
HobAltButton.style_button(button)
|
||||
response = dialog.run()
|
||||
|
||||
if response == gtk.RESPONSE_YES:
|
||||
if not dialog.image_names:
|
||||
lbl = "<b>No selections made</b>\nClicked the radio button to select a image."
|
||||
crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
|
||||
button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
|
||||
HobButton.style_button(button)
|
||||
crumbs_dialog.run()
|
||||
crumbs_dialog.destroy()
|
||||
dialog.destroy()
|
||||
return
|
||||
|
||||
# get the full path of image
|
||||
image_path = os.path.join(dialog.image_folder, dialog.image_names[0])
|
||||
self.deploy_dialog.set_image_text_buffer(image_path)
|
||||
self.deploy_dialog.set_image_path(image_path)
|
||||
|
||||
dialog.destroy()
|
||||
|
||||
def main():
|
||||
parser = optparse.OptionParser(
|
||||
usage = """%prog [-h] [image_file]
|
||||
|
||||
%prog writes bootable images to USB devices. You can
|
||||
provide the image file on the command line or select it using the GUI.""")
|
||||
|
||||
options, args = parser.parse_args(sys.argv)
|
||||
image_file = args[1] if len(args) > 1 else ''
|
||||
dw = DeployWindow(image_file)
|
||||
|
||||
if __name__ == '__main__':
|
||||
try:
|
||||
main()
|
||||
gtk.main()
|
||||
except Exception:
|
||||
import traceback
|
||||
traceback.print_exc(3)
|
||||
@@ -1,8 +1,5 @@
|
||||
#!/bin/echo ERROR: This script needs to be sourced. Please run as .
|
||||
|
||||
# toaster - shell script to start Toaster
|
||||
|
||||
# Copyright (C) 2013-2015 Intel Corp.
|
||||
#!/bin/bash
|
||||
# (c) 2013 Intel Corp.
|
||||
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License as published by
|
||||
@@ -15,307 +12,256 @@
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License
|
||||
# along with this program. If not, see http://www.gnu.org/licenses/.
|
||||
# along with this program; if not, write to the Free Software
|
||||
# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
||||
|
||||
HELP="
|
||||
Usage: source toaster start|stop [webport=<address:port>] [noweb] [nobuild] [toasterdir]
|
||||
Optional arguments:
|
||||
[nobuild] Setup the environment for capturing builds with toaster but disable managed builds
|
||||
[noweb] Setup the environment for capturing builds with toaster but don't start the web server
|
||||
[webport] Set the development server (default: localhost:8000)
|
||||
[toasterdir] Set absolute path to be used as TOASTER_DIR (default: BUILDDIR/../)
|
||||
"
|
||||
|
||||
custom_extention()
|
||||
# This script can be run in two modes.
|
||||
|
||||
# When used with "source", from a build directory,
|
||||
# it enables toaster event logging and starts the bitbake resident server.
|
||||
# use as: source toaster [start|stop] [noweb] [noui]
|
||||
|
||||
# When it is called as a stand-alone script, it starts just the
|
||||
# web server, and the building shall be done through the web interface.
|
||||
# As script, it will not return to the command prompt. Stop with Ctrl-C.
|
||||
|
||||
# Helper function to kill a background toaster development server
|
||||
|
||||
function webserverKillAll()
|
||||
{
|
||||
custom_extension=$BBBASEDIR/lib/toaster/orm/fixtures/custom_toaster_append.sh
|
||||
if [ -f $custom_extension ] ; then
|
||||
$custom_extension $*
|
||||
fi
|
||||
local pidfile
|
||||
for pidfile in ${BUILDDIR}/.toastermain.pid; do
|
||||
if [ -f ${pidfile} ]; then
|
||||
while kill -0 $(< ${pidfile}) 2>/dev/null; do
|
||||
kill -SIGTERM -$(< ${pidfile}) 2>/dev/null
|
||||
sleep 1;
|
||||
# Kill processes if they are still running - may happen in interactive shells
|
||||
ps fux | grep "python.*manage.py" | awk '{print $2}' | xargs kill
|
||||
done;
|
||||
rm ${pidfile}
|
||||
fi
|
||||
done
|
||||
}
|
||||
|
||||
databaseCheck()
|
||||
function webserverStartAll()
|
||||
{
|
||||
retval=0
|
||||
# you can always add a superuser later via
|
||||
# ../bitbake/lib/toaster/manage.py createsuperuser --username=<ME>
|
||||
$MANAGE migrate --noinput || retval=1
|
||||
|
||||
if [ $retval -eq 1 ]; then
|
||||
echo "Failed migrations, aborting system start" 1>&2
|
||||
return $retval
|
||||
fi
|
||||
# Make sure that checksettings can pick up any value for TEMPLATECONF
|
||||
export TEMPLATECONF
|
||||
$MANAGE checksettings --traceback || retval=1
|
||||
|
||||
if [ $retval -eq 1 ]; then
|
||||
printf "\nError while checking settings; aborting\n"
|
||||
return $retval
|
||||
fi
|
||||
|
||||
return $retval
|
||||
}
|
||||
|
||||
webserverKillAll()
|
||||
{
|
||||
local pidfile
|
||||
if [ -f ${BUILDDIR}/.toastermain.pid ] ; then
|
||||
custom_extention web_stop_postpend
|
||||
else
|
||||
custom_extention noweb_stop_postpend
|
||||
fi
|
||||
for pidfile in ${BUILDDIR}/.toastermain.pid ${BUILDDIR}/.runbuilds.pid; do
|
||||
if [ -f ${pidfile} ]; then
|
||||
pid=`cat ${pidfile}`
|
||||
while kill -0 $pid 2>/dev/null; do
|
||||
kill -SIGTERM $pid 2>/dev/null
|
||||
sleep 1
|
||||
done
|
||||
rm ${pidfile}
|
||||
# do not start if toastermain points to a valid process
|
||||
if ! cat "${BUILDDIR}/.toastermain.pid" 2>/dev/null | xargs -I{} kill -0 {} ; then
|
||||
retval=1
|
||||
rm "${BUILDDIR}/.toastermain.pid"
|
||||
fi
|
||||
done
|
||||
|
||||
retval=0
|
||||
python $BBBASEDIR/lib/toaster/manage.py syncdb || retval=1
|
||||
python $BBBASEDIR/lib/toaster/manage.py migrate orm || retval=2
|
||||
if [ $retval -eq 1 ]; then
|
||||
echo "Failed db sync, stopping system start" 1>&2
|
||||
elif [ $retval -eq 2 ]; then
|
||||
echo -e "\nError on migration, trying to recover... \n"
|
||||
python $BBBASEDIR/lib/toaster/manage.py migrate orm 0001_initial --fake
|
||||
retval=0
|
||||
python $BBBASEDIR/lib/toaster/manage.py migrate orm || retval=1
|
||||
fi
|
||||
if [ "x$TOASTER_MANAGED" == "x1" ]; then
|
||||
python $BBBASEDIR/lib/toaster/manage.py migrate bldcontrol || retval=1
|
||||
python $BBBASEDIR/lib/toaster/manage.py checksettings --traceback || retval=1
|
||||
fi
|
||||
if [ $retval -eq 0 ]; then
|
||||
echo "Starting webserver"
|
||||
python $BBBASEDIR/lib/toaster/manage.py runserver 0.0.0.0:8000 </dev/null >${BUILDDIR}/toaster_web.log 2>&1 & echo $! >${BUILDDIR}/.toastermain.pid
|
||||
sleep 1
|
||||
if ! cat "${BUILDDIR}/.toastermain.pid" | xargs -I{} kill -0 {} ; then
|
||||
retval=1
|
||||
rm "${BUILDDIR}/.toastermain.pid"
|
||||
fi
|
||||
fi
|
||||
return $retval
|
||||
}
|
||||
|
||||
webserverStartAll()
|
||||
# Helper functions to add a special configuration file
|
||||
|
||||
function addtoConfiguration()
|
||||
{
|
||||
# do not start if toastermain points to a valid process
|
||||
if ! cat "${BUILDDIR}/.toastermain.pid" 2>/dev/null | xargs -I{} kill -0 {} ; then
|
||||
retval=1
|
||||
rm "${BUILDDIR}/.toastermain.pid"
|
||||
fi
|
||||
|
||||
retval=0
|
||||
|
||||
# check the database
|
||||
databaseCheck || return 1
|
||||
|
||||
echo "Starting webserver..."
|
||||
|
||||
$MANAGE runserver --noreload "$ADDR_PORT" \
|
||||
</dev/null >>${BUILDDIR}/toaster_web.log 2>&1 \
|
||||
& echo $! >${BUILDDIR}/.toastermain.pid
|
||||
|
||||
sleep 1
|
||||
|
||||
if ! cat "${BUILDDIR}/.toastermain.pid" | xargs -I{} kill -0 {} ; then
|
||||
retval=1
|
||||
rm "${BUILDDIR}/.toastermain.pid"
|
||||
else
|
||||
echo "Toaster development webserver started at http://$ADDR_PORT"
|
||||
echo -e "\nYou can now run 'bitbake <target>' on the command line and monitor your build in Toaster.\nYou can also use a Toaster project to configure and run a build.\n"
|
||||
custom_extention web_start_postpend $ADDR_PORT
|
||||
fi
|
||||
|
||||
return $retval
|
||||
echo "#Created by toaster start script" > ${BUILDDIR}/conf/$2
|
||||
echo $1 >> ${BUILDDIR}/conf/$2
|
||||
}
|
||||
|
||||
INSTOPSYSTEM=0
|
||||
|
||||
# define the stop command
|
||||
stop_system()
|
||||
function stop_system()
|
||||
{
|
||||
# prevent reentry
|
||||
if [ $INSTOPSYSTEM -eq 1 ]; then return; fi
|
||||
if [ $INSTOPSYSTEM == 1 ]; then return; fi
|
||||
INSTOPSYSTEM=1
|
||||
if [ -f ${BUILDDIR}/.toasterui.pid ]; then
|
||||
kill $(< ${BUILDDIR}/.toasterui.pid ) 2>/dev/null
|
||||
rm ${BUILDDIR}/.toasterui.pid
|
||||
fi
|
||||
BBSERVER=0.0.0.0:8200 bitbake -m
|
||||
unset BBSERVER
|
||||
webserverKillAll
|
||||
# unset exported variables
|
||||
unset TOASTER_DIR
|
||||
unset BITBAKE_UI
|
||||
unset BBBASEDIR
|
||||
# force stop any misbehaving bitbake server
|
||||
lsof bitbake.lock | awk '{print $2}' | grep "[0-9]\+" | xargs -n1 -r kill
|
||||
trap - SIGHUP
|
||||
#trap - SIGCHLD
|
||||
INSTOPSYSTEM=0
|
||||
}
|
||||
|
||||
verify_prereq() {
|
||||
# Verify Django version
|
||||
reqfile=$(python3 -c "import os; print(os.path.realpath('$BBBASEDIR/toaster-requirements.txt'))")
|
||||
exp='s/Django\([><=]\+\)\([^,]\+\),\([><=]\+\)\(.\+\)/'
|
||||
# expand version parts to 2 digits to support 1.10.x > 1.8
|
||||
# (note:helper functions hard to insert in-line)
|
||||
exp=$exp'import sys,django;'
|
||||
exp=$exp'version=["%02d" % int(n) for n in django.get_version().split(".")];'
|
||||
exp=$exp'vmin=["%02d" % int(n) for n in "\2".split(".")];'
|
||||
exp=$exp'vmax=["%02d" % int(n) for n in "\4".split(".")];'
|
||||
exp=$exp'sys.exit(not (version \1 vmin and version \3 vmax))'
|
||||
exp=$exp'/p'
|
||||
if ! sed -n "$exp" $reqfile | python3 - ; then
|
||||
req=`grep ^Django $reqfile`
|
||||
echo "This program needs $req"
|
||||
echo "Please install with pip3 install -r $reqfile"
|
||||
return 2
|
||||
fi
|
||||
|
||||
return 0
|
||||
function check_pidbyfile() {
|
||||
[ -e $1 ] && kill -0 $(< $1) 2>/dev/null
|
||||
}
|
||||
|
||||
# read command line parameters
|
||||
if [ -n "$BASH_SOURCE" ] ; then
|
||||
TOASTER=${BASH_SOURCE}
|
||||
elif [ -n "$ZSH_NAME" ] ; then
|
||||
TOASTER=${(%):-%x}
|
||||
else
|
||||
TOASTER=$0
|
||||
fi
|
||||
|
||||
export BBBASEDIR=`dirname $TOASTER`/..
|
||||
MANAGE="python3 $BBBASEDIR/lib/toaster/manage.py"
|
||||
if [ -z "$OE_ROOT" ]; then
|
||||
OE_ROOT=`dirname $TOASTER`/../..
|
||||
fi
|
||||
|
||||
# this is the configuraton file we are using for toaster
|
||||
# we are using the same logic that oe-setup-builddir uses
|
||||
# (based on TEMPLATECONF and .templateconf) to determine
|
||||
# which toasterconf.json to use.
|
||||
# note: There are a number of relative path assumptions
|
||||
# in the local layers that currently make using an arbitrary
|
||||
# toasterconf.json difficult.
|
||||
|
||||
. $OE_ROOT/.templateconf
|
||||
if [ -n "$TEMPLATECONF" ]; then
|
||||
if [ ! -d "$TEMPLATECONF" ]; then
|
||||
# Allow TEMPLATECONF=meta-xyz/conf as a shortcut
|
||||
if [ -d "$OE_ROOT/$TEMPLATECONF" ]; then
|
||||
TEMPLATECONF="$OE_ROOT/$TEMPLATECONF"
|
||||
fi
|
||||
function notify_chldexit() {
|
||||
if [ $NOTOASTERUI == 0 ]; then
|
||||
check_pidbyfile ${BUILDDIR}/.toasterui.pid && return
|
||||
stop_system
|
||||
fi
|
||||
}
|
||||
|
||||
|
||||
BBBASEDIR=`dirname ${BASH_SOURCE}`/..
|
||||
RUNNING=0
|
||||
|
||||
if [ -z "$ZSH_NAME" ] && [ `basename \"$0\"` = `basename \"$BASH_SOURCE\"` ]; then
|
||||
# We are called as standalone. We refuse to run in a build environment - we need the interactive mode for that.
|
||||
# Start just the web server, point the web browser to the interface, and start any Django services.
|
||||
|
||||
if [ -n "$BUILDDIR" ]; then
|
||||
echo -e "Error: build/ directory detected. Toaster will not start in managed mode if a build environment is detected.\nUse a clean terminal to start Toaster." 1>&2;
|
||||
exit 1;
|
||||
fi
|
||||
|
||||
# Define a fake builddir where only the pid files are actually created. No real builds will take place here.
|
||||
BUILDDIR=/tmp
|
||||
RUNNING=1
|
||||
function trap_ctrlc() {
|
||||
echo "** Stopping system"
|
||||
webserverKillAll
|
||||
RUNNING=0
|
||||
}
|
||||
TOASTER_MANAGED=1
|
||||
export TOASTER_MANAGED=1
|
||||
if ! webserverStartAll; then
|
||||
echo "Failed to start the web server, stopping" 1>&2;
|
||||
exit 1;
|
||||
fi
|
||||
xdg-open http://0.0.0.0:8000/ >/dev/null 2>&1 &
|
||||
trap trap_ctrlc SIGINT
|
||||
echo "Running. Stop with Ctrl-C"
|
||||
while [ $RUNNING -gt 0 ]; do
|
||||
python $BBBASEDIR/lib/toaster/manage.py runbuilds
|
||||
sleep 1
|
||||
done
|
||||
echo "**** Exit"
|
||||
exit 0
|
||||
fi
|
||||
|
||||
unset OE_ROOT
|
||||
|
||||
|
||||
WEBSERVER=1
|
||||
export TOASTER_BUILDSERVER=1
|
||||
ADDR_PORT="localhost:8000"
|
||||
TOASTERDIR=`dirname $BUILDDIR`
|
||||
unset CMD
|
||||
for param in $*; do
|
||||
case $param in
|
||||
noweb )
|
||||
WEBSERVER=0
|
||||
;;
|
||||
nobuild )
|
||||
TOASTER_BUILDSERVER=0
|
||||
;;
|
||||
start )
|
||||
CMD=$param
|
||||
;;
|
||||
stop )
|
||||
CMD=$param
|
||||
;;
|
||||
webport=*)
|
||||
ADDR_PORT="${param#*=}"
|
||||
# Split the addr:port string
|
||||
ADDR=`echo $ADDR_PORT | cut -f 1 -d ':'`
|
||||
PORT=`echo $ADDR_PORT | cut -f 2 -d ':'`
|
||||
# If only a port has been speified then set address to localhost.
|
||||
if [ $ADDR = $PORT ] ; then
|
||||
ADDR_PORT="localhost:$PORT"
|
||||
fi
|
||||
;;
|
||||
toasterdir=*)
|
||||
TOASTERDIR="${param#*=}"
|
||||
;;
|
||||
--help)
|
||||
echo "$HELP"
|
||||
return 0
|
||||
;;
|
||||
*)
|
||||
echo "$HELP"
|
||||
return 1
|
||||
;;
|
||||
|
||||
esac
|
||||
done
|
||||
|
||||
if [ `basename \"$0\"` = `basename \"${TOASTER}\"` ]; then
|
||||
echo "Error: This script needs to be sourced. Please run as . $TOASTER"
|
||||
return 1
|
||||
fi
|
||||
|
||||
verify_prereq || return 1
|
||||
|
||||
# We make sure we're running in the current shell and in a good environment
|
||||
if [ -z "$BUILDDIR" ] || ! which bitbake >/dev/null 2>&1 ; then
|
||||
echo "Error: Build environment is not setup or bitbake is not in path." 1>&2
|
||||
if [ -z "$BUILDDIR" ] || [ -z `which bitbake` ]; then
|
||||
echo "Error: Build environment is not setup or bitbake is not in path." 1>&2;
|
||||
return 2
|
||||
fi
|
||||
|
||||
# this defines the dir toaster will use for
|
||||
# 1) clones of layers (in _toaster_clones )
|
||||
# 2) the build dir (in build)
|
||||
# 3) the sqlite db if that is being used.
|
||||
# 4) pid's we need to clean up on exit/shutdown
|
||||
export TOASTER_DIR=$TOASTERDIR
|
||||
export BB_ENV_EXTRAWHITE="$BB_ENV_EXTRAWHITE TOASTER_DIR"
|
||||
|
||||
|
||||
# Verify prerequisites
|
||||
|
||||
if ! echo "import django; print (1,) == django.VERSION[0:1] and django.VERSION[1:2][0] in (5,6)" | python 2>/dev/null | grep True >/dev/null; then
|
||||
echo -e "This program needs Django 1.5 or 1.6. Please install with\n\npip install django==1.6"
|
||||
return 2
|
||||
fi
|
||||
|
||||
if ! echo "import south; print [0,8,4] == map(int,south.__version__.split(\".\"))" | python 2>/dev/null | grep True >/dev/null; then
|
||||
echo -e "This program needs South 0.8.4. Please install with\n\npip install south==0.8.4"
|
||||
return 2
|
||||
fi
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
# Determine the action. If specified by arguments, fine, if not, toggle it
|
||||
if [ "$CMD" = "start" ] ; then
|
||||
if [ -n "$BBSERVER" ]; then
|
||||
echo " Toaster is already running. Exiting..."
|
||||
return 1
|
||||
fi
|
||||
elif [ "$CMD" = "" ]; then
|
||||
echo "No command specified"
|
||||
echo "$HELP"
|
||||
return 1
|
||||
if [ "x$1" == "xstart" ] || [ "x$1" == "xstop" ]; then
|
||||
CMD="$1"
|
||||
else
|
||||
if [ -z "$BBSERVER" ]; then
|
||||
CMD="start"
|
||||
else
|
||||
CMD="stop"
|
||||
fi;
|
||||
fi
|
||||
|
||||
NOTOASTERUI=0
|
||||
WEBSERVER=1
|
||||
for param in $*; do
|
||||
case $param in
|
||||
noui )
|
||||
NOTOASTERUI=1
|
||||
;;
|
||||
noweb )
|
||||
WEBSERVER=0
|
||||
;;
|
||||
esac
|
||||
done
|
||||
|
||||
echo "The system will $CMD."
|
||||
|
||||
# Make sure it's safe to run by checking bitbake lock
|
||||
|
||||
lock=1
|
||||
if [ -e $BUILDDIR/bitbake.lock ]; then
|
||||
(flock -n 200 ) 200<$BUILDDIR/bitbake.lock || lock=0
|
||||
fi
|
||||
|
||||
if [ ${CMD} == "start" ] && ( [ $lock -eq 0 ] || [ -e $BUILDDIR/.toastermain.pid ] ); then
|
||||
echo "Error: bitbake lock state error. File locks show that the system is on." 2>&1
|
||||
echo "If you see problems, stop and then start the system again." 2>&1
|
||||
return 3
|
||||
fi
|
||||
|
||||
|
||||
# Execute the commands
|
||||
custom_extention toaster_prepend $CMD $ADDR_PORT
|
||||
|
||||
case $CMD in
|
||||
start )
|
||||
# check if addr:port is not in use
|
||||
if [ "$CMD" == 'start' ]; then
|
||||
if [ $WEBSERVER -gt 0 ]; then
|
||||
$MANAGE checksocket "$ADDR_PORT" || return 1
|
||||
fi
|
||||
fi
|
||||
|
||||
# Create configuration file
|
||||
conf=${BUILDDIR}/conf/local.conf
|
||||
line='INHERIT+="toaster buildhistory"'
|
||||
grep -q "$line" $conf || echo $line >> $conf
|
||||
|
||||
if [ $WEBSERVER -eq 0 ] ; then
|
||||
# Do not update the database for "noweb" unless
|
||||
# it does not yet exist
|
||||
if [ ! -f "$TOASTER_DIR/toaster.sqlite" ] ; then
|
||||
if ! databaseCheck; then
|
||||
echo "Failed ${CMD}."
|
||||
return 4
|
||||
fi
|
||||
fi
|
||||
custom_extention noweb_start_postpend $ADDR_PORT
|
||||
fi
|
||||
start_success=1
|
||||
addtoConfiguration "INHERIT+=\"toaster buildhistory\"" toaster.conf
|
||||
if [ $WEBSERVER -gt 0 ] && ! webserverStartAll; then
|
||||
echo "Failed ${CMD}."
|
||||
return 4
|
||||
fi
|
||||
export BITBAKE_UI='toasterui'
|
||||
if [ $TOASTER_BUILDSERVER -eq 1 ] ; then
|
||||
$MANAGE runbuilds \
|
||||
</dev/null >>${BUILDDIR}/toaster_runbuilds.log 2>&1 \
|
||||
& echo $! >${BUILDDIR}/.runbuilds.pid
|
||||
unset BBSERVER
|
||||
bitbake --postread conf/toaster.conf --server-only -t xmlrpc -B 0.0.0.0:8200
|
||||
if [ $? -ne 0 ]; then
|
||||
start_success=0
|
||||
echo "Bitbake server start failed"
|
||||
else
|
||||
echo "Toaster build server not started."
|
||||
export BBSERVER=0.0.0.0:8200
|
||||
if [ $NOTOASTERUI == 0 ]; then # we start the TOASTERUI only if not inhibited
|
||||
bitbake --observe-only -u toasterui >${BUILDDIR}/toaster_ui.log 2>&1 & echo $! >${BUILDDIR}/.toasterui.pid
|
||||
fi
|
||||
fi
|
||||
|
||||
# set fail safe stop system on terminal exit
|
||||
if [ $start_success -eq 1 ]; then
|
||||
# set fail safe stop system on terminal exit
|
||||
trap stop_system SIGHUP
|
||||
echo "Successful ${CMD}."
|
||||
else
|
||||
# failed start, do stop
|
||||
stop_system
|
||||
echo "Failed ${CMD}."
|
||||
fi
|
||||
# stop system on terminal exit
|
||||
set -o monitor
|
||||
trap stop_system SIGHUP
|
||||
echo "Successful ${CMD}."
|
||||
custom_extention toaster_postpend $CMD $ADDR_PORT
|
||||
return 0
|
||||
#trap notify_chldexit SIGCHLD
|
||||
;;
|
||||
stop )
|
||||
stop_system
|
||||
echo "Successful ${CMD}."
|
||||
;;
|
||||
esac
|
||||
custom_extention toaster_postpend $CMD $ADDR_PORT
|
||||
|
||||
|
||||
|
||||
@@ -1,126 +0,0 @@
|
||||
#!/usr/bin/env python3
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Copyright (C) 2014 Alex Damian
|
||||
#
|
||||
# This file re-uses code spread throughout other Bitbake source files.
|
||||
# As such, all other copyrights belong to their own right holders.
|
||||
#
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
"""
|
||||
This command takes a filename as a single parameter. The filename is read
|
||||
as a build eventlog, and the ToasterUI is used to process events in the file
|
||||
and log data in the database
|
||||
"""
|
||||
|
||||
import os
|
||||
import sys
|
||||
import json
|
||||
import pickle
|
||||
import codecs
|
||||
|
||||
from collections import namedtuple
|
||||
|
||||
# mangle syspath to allow easy import of modules
|
||||
from os.path import join, dirname, abspath
|
||||
sys.path.insert(0, join(dirname(dirname(abspath(__file__))), 'lib'))
|
||||
|
||||
import bb.cooker
|
||||
from bb.ui import toasterui
|
||||
|
||||
class EventPlayer:
|
||||
"""Emulate a connection to a bitbake server."""
|
||||
|
||||
def __init__(self, eventfile, variables):
|
||||
self.eventfile = eventfile
|
||||
self.variables = variables
|
||||
self.eventmask = []
|
||||
|
||||
def waitEvent(self, _timeout):
|
||||
"""Read event from the file."""
|
||||
line = self.eventfile.readline().strip()
|
||||
if not line:
|
||||
return
|
||||
try:
|
||||
event_str = json.loads(line)['vars'].encode('utf-8')
|
||||
event = pickle.loads(codecs.decode(event_str, 'base64'))
|
||||
event_name = "%s.%s" % (event.__module__, event.__class__.__name__)
|
||||
if event_name not in self.eventmask:
|
||||
return
|
||||
return event
|
||||
except ValueError as err:
|
||||
print("Failed loading ", line)
|
||||
raise err
|
||||
|
||||
def runCommand(self, command_line):
|
||||
"""Emulate running a command on the server."""
|
||||
name = command_line[0]
|
||||
|
||||
if name == "getVariable":
|
||||
var_name = command_line[1]
|
||||
variable = self.variables.get(var_name)
|
||||
if variable:
|
||||
return variable['v'], None
|
||||
return None, "Missing variable %s" % var_name
|
||||
|
||||
elif name == "getAllKeysWithFlags":
|
||||
dump = {}
|
||||
flaglist = command_line[1]
|
||||
for key, val in self.variables.items():
|
||||
try:
|
||||
if not key.startswith("__"):
|
||||
dump[key] = {
|
||||
'v': val['v'],
|
||||
'history' : val['history'],
|
||||
}
|
||||
for flag in flaglist:
|
||||
dump[key][flag] = val[flag]
|
||||
except Exception as err:
|
||||
print(err)
|
||||
return (dump, None)
|
||||
|
||||
elif name == 'setEventMask':
|
||||
self.eventmask = command_line[-1]
|
||||
return True, None
|
||||
|
||||
else:
|
||||
raise Exception("Command %s not implemented" % command_line[0])
|
||||
|
||||
def getEventHandle(self):
|
||||
"""
|
||||
This method is called by toasterui.
|
||||
The return value is passed to self.runCommand but not used there.
|
||||
"""
|
||||
pass
|
||||
|
||||
def main(argv):
|
||||
with open(argv[-1]) as eventfile:
|
||||
# load variables from the first line
|
||||
variables = json.loads(eventfile.readline().strip())['allvariables']
|
||||
|
||||
params = namedtuple('ConfigParams', ['observe_only'])(True)
|
||||
player = EventPlayer(eventfile, variables)
|
||||
|
||||
return toasterui.main(player, player, params)
|
||||
|
||||
# run toaster ui on our mock bitbake class
|
||||
if __name__ == "__main__":
|
||||
if len(sys.argv) != 2:
|
||||
print("Usage: %s <event file>" % os.path.basename(sys.argv[0]))
|
||||
sys.exit(1)
|
||||
|
||||
sys.exit(main(sys.argv))
|
||||
@@ -1,8 +1,8 @@
|
||||
#!/usr/bin/env python3
|
||||
#!/usr/bin/env python
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Copyright (C) 2012, 2018 Wind River Systems, Inc.
|
||||
# Copyright (C) 2012 Wind River Systems, Inc.
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
@@ -18,68 +18,51 @@
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
#
|
||||
# Used for dumping the bb_cache.dat
|
||||
# This is used for dumping the bb_cache.dat, the output format is:
|
||||
# recipe_path PN PV PACKAGES
|
||||
#
|
||||
import os
|
||||
import sys
|
||||
import argparse
|
||||
import warnings
|
||||
|
||||
# For importing bb.cache
|
||||
sys.path.insert(0, os.path.join(os.path.abspath(os.path.dirname(sys.argv[0])), '../lib'))
|
||||
from bb.cache import CoreRecipeInfo
|
||||
|
||||
import pickle
|
||||
import cPickle as pickle
|
||||
|
||||
class DumpCache(object):
|
||||
def __init__(self):
|
||||
parser = argparse.ArgumentParser(
|
||||
description="bb_cache.dat's dumper",
|
||||
epilog="Use %(prog)s --help to get help")
|
||||
parser.add_argument("-r", "--recipe",
|
||||
help="specify the recipe, default: all recipes", action="store")
|
||||
parser.add_argument("-m", "--members",
|
||||
help = "specify the member, use comma as separator for multiple ones, default: all members", action="store", default="")
|
||||
parser.add_argument("-s", "--skip",
|
||||
help = "skip skipped recipes", action="store_true")
|
||||
parser.add_argument("cachefile",
|
||||
help = "specify bb_cache.dat", nargs = 1, action="store", default="")
|
||||
def main(argv=None):
|
||||
"""
|
||||
Get the mapping for the target recipe.
|
||||
"""
|
||||
if len(argv) != 1:
|
||||
print >>sys.stderr, "Error, need one argument!"
|
||||
return 2
|
||||
|
||||
self.args = parser.parse_args()
|
||||
cachefile = argv[0]
|
||||
|
||||
def main(self):
|
||||
with open(self.args.cachefile[0], "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
while True:
|
||||
try:
|
||||
key = pickled.load()
|
||||
val = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
if isinstance(val, CoreRecipeInfo):
|
||||
pn = val.pn
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
while cachefile:
|
||||
try:
|
||||
key = pickled.load()
|
||||
val = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
if isinstance(val, CoreRecipeInfo) and (not val.skipped):
|
||||
pn = val.pn
|
||||
# Filter out the native recipes.
|
||||
if key.startswith('virtual:native:') or pn.endswith("-native"):
|
||||
continue
|
||||
|
||||
if self.args.recipe and self.args.recipe != pn:
|
||||
continue
|
||||
# 1.0 is the default version for a no PV recipe.
|
||||
if val.__dict__.has_key("pv"):
|
||||
pv = val.pv
|
||||
else:
|
||||
pv = "1.0"
|
||||
|
||||
if self.args.skip and val.skipped:
|
||||
continue
|
||||
|
||||
if self.args.members:
|
||||
out = key
|
||||
for member in self.args.members.split(','):
|
||||
out += ": %s" % val.__dict__.get(member)
|
||||
print("%s" % out)
|
||||
else:
|
||||
print("%s: %s" % (key, val.__dict__))
|
||||
elif not self.args.recipe:
|
||||
print("%s %s" % (key, val))
|
||||
print("%s %s %s %s" % (key, pn, pv, ' '.join(val.packages)))
|
||||
|
||||
if __name__ == "__main__":
|
||||
try:
|
||||
dump = DumpCache()
|
||||
ret = dump.main()
|
||||
except Exception as esc:
|
||||
ret = 1
|
||||
import traceback
|
||||
traceback.print_exc()
|
||||
sys.exit(ret)
|
||||
sys.exit(main(sys.argv[1:]))
|
||||
|
||||
|
||||
@@ -11,7 +11,7 @@
|
||||
# validate: validates
|
||||
# clean: removes files
|
||||
#
|
||||
# The Makefile generates an HTML version of every document. The
|
||||
# The Makefile generates an HTML and PDF version of every document. The
|
||||
# variable DOC indicates the folder name for a given manual.
|
||||
#
|
||||
# To build a manual, you must invoke 'make' with the DOC argument.
|
||||
@@ -21,8 +21,8 @@
|
||||
# make DOC=bitbake-user-manual
|
||||
# make pdf DOC=bitbake-user-manual
|
||||
#
|
||||
# The first example generates the HTML version of the User Manual.
|
||||
# The second example generates the PDF version of the User Manual.
|
||||
# The first example generates the HTML and PDF versions of the User Manual.
|
||||
# The second example generates the HTML version only of the User Manual.
|
||||
#
|
||||
|
||||
ifeq ($(DOC),bitbake-user-manual)
|
||||
@@ -31,9 +31,9 @@ XSLTOPTS = --stringparam html.stylesheet bitbake-user-manual-style.css \
|
||||
--stringparam section.autolabel 1 \
|
||||
--stringparam section.label.includes.component.label 1 \
|
||||
--xinclude
|
||||
ALLPREQ = html tarball
|
||||
TARFILES = bitbake-user-manual-style.css bitbake-user-manual.html figures/bitbake-title.png
|
||||
MANUALS = $(DOC)/$(DOC).html
|
||||
ALLPREQ = html pdf tarball
|
||||
TARFILES = bitbake-user-manual-style.css bitbake-user-manual.html bitbake-user-manual.pdf figures/bitbake-title.png
|
||||
MANUALS = $(DOC)/$(DOC).html $(DOC)/$(DOC).pdf
|
||||
FIGURES = figures
|
||||
STYLESHEET = $(DOC)/*.css
|
||||
|
||||
|
||||
@@ -1,15 +1,7 @@
|
||||
<?xml version='1.0'?>
|
||||
<xsl:stylesheet xmlns:xsl="http://www.w3.org/1999/XSL/Transform" xmlns="http://www.w3.org/1999/xhtml" xmlns:fo="http://www.w3.org/1999/XSL/Format" version="1.0">
|
||||
|
||||
<xsl:import href="http://downloads.yoctoproject.org/mirror/docbook-mirror/docbook-xsl-1.76.1/xhtml/docbook.xsl" />
|
||||
|
||||
<!--
|
||||
|
||||
<xsl:import href="../template/1.76.1/docbook-xsl-1.76.1/xhtml/docbook.xsl" />
|
||||
|
||||
<xsl:import href="http://docbook.sourceforge.net/release/xsl/1.76.1/xhtml/docbook.xsl" />
|
||||
|
||||
-->
|
||||
<xsl:import href="http://docbook.sourceforge.net/release/xsl/current/xhtml/docbook.xsl" />
|
||||
|
||||
<xsl:include href="../template/permalinks.xsl"/>
|
||||
<xsl:include href="../template/section.title.xsl"/>
|
||||
|
||||
@@ -21,7 +21,7 @@
|
||||
The execution process is launched using the following command
|
||||
form:
|
||||
<literallayout class='monospaced'>
|
||||
$ bitbake <replaceable>target</replaceable>
|
||||
$ bitbake <target>
|
||||
</literallayout>
|
||||
For information on the BitBake command and its options,
|
||||
see
|
||||
@@ -37,16 +37,14 @@
|
||||
</para>
|
||||
|
||||
<para>
|
||||
A common method to determine this value for your build host is to run
|
||||
the following:
|
||||
A common way to determine this value for your build host is to run:
|
||||
<literallayout class='monospaced'>
|
||||
$ grep processor /proc/cpuinfo
|
||||
</literallayout>
|
||||
This command returns the number of processors, which takes into
|
||||
account hyper-threading.
|
||||
Thus, a quad-core build host with hyper-threading most likely
|
||||
shows eight processors, which is the value you would then assign to
|
||||
<filename>BB_NUMBER_THREADS</filename>.
|
||||
and count the number of processors displayed. Note that the number of
|
||||
processors will take into account hyper-threading, so that a quad-core
|
||||
build host with hyper-threading will most likely show eight processors,
|
||||
which is the value you would then assign to that variable.
|
||||
</para>
|
||||
|
||||
<para>
|
||||
@@ -116,35 +114,16 @@
|
||||
Prior to parsing configuration files, Bitbake looks
|
||||
at certain variables, including:
|
||||
<itemizedlist>
|
||||
<listitem><para>
|
||||
<link linkend='var-BB_ENV_WHITELIST'><filename>BB_ENV_WHITELIST</filename></link>
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
<link linkend='var-BB_ENV_EXTRAWHITE'><filename>BB_ENV_EXTRAWHITE</filename></link>
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
<link linkend='var-BB_PRESERVE_ENV'><filename>BB_PRESERVE_ENV</filename></link>
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
<link linkend='var-BB_ORIGENV'><filename>BB_ORIGENV</filename></link>
|
||||
</para></listitem>
|
||||
<listitem><para><link linkend='var-BB_ENV_WHITELIST'><filename>BB_ENV_WHITELIST</filename></link></para></listitem>
|
||||
<listitem><para><link linkend='var-BB_PRESERVE_ENV'><filename>BB_PRESERVE_ENV</filename></link></para></listitem>
|
||||
<listitem><para><link linkend='var-BB_ENV_EXTRAWHITE'><filename>BB_ENV_EXTRAWHITE</filename></link></para></listitem>
|
||||
<listitem><para>
|
||||
<link linkend='var-BITBAKE_UI'><filename>BITBAKE_UI</filename></link>
|
||||
</para></listitem>
|
||||
</itemizedlist>
|
||||
The first four variables in this list relate to how BitBake treats shell
|
||||
environment variables during task execution.
|
||||
By default, BitBake cleans the environment variables and provides tight
|
||||
control over the shell execution environment.
|
||||
However, through the use of these first four variables, you can
|
||||
apply your control regarding the
|
||||
environment variables allowed to be used by BitBake in the shell
|
||||
during execution of tasks.
|
||||
See the
|
||||
"<link linkend='passing-information-into-the-build-task-environment'>Passing Information Into the Build Task Environment</link>"
|
||||
section and the information about these variables in the
|
||||
variable glossary for more information on how they work and
|
||||
on how to use them.
|
||||
You can find information on how to pass environment variables into the BitBake
|
||||
execution environment in the
|
||||
"<link linkend='passing-information-into-the-build-task-environment'>Passing Information Into the Build Task Environment</link>" section.
|
||||
</para>
|
||||
|
||||
<para>
|
||||
@@ -306,8 +285,8 @@
|
||||
<link linkend='var-PN'><filename>PN</filename></link> and
|
||||
<link linkend='var-PV'><filename>PV</filename></link>:
|
||||
<literallayout class='monospaced'>
|
||||
PN = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE', False),d)[0] or 'defaultpkgname'}"
|
||||
PV = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE', False),d)[1] or '1.0'}"
|
||||
PN = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE'),d)[0] or 'defaultpkgname'}"
|
||||
PV = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE'),d)[1] or '1.0'}"
|
||||
</literallayout>
|
||||
In this example, a recipe called "something_1.2.3.bb" would set
|
||||
<filename>PN</filename> to "something" and
|
||||
@@ -596,7 +575,7 @@
|
||||
"<link linkend='checksums'>Checksums (Signatures)</link>"
|
||||
section for information).
|
||||
It is also possible to append extra metadata to the stamp using
|
||||
the <filename>[stamp-extra-info]</filename> task flag.
|
||||
the "stamp-extra-info" task flag.
|
||||
For example, OpenEmbedded uses this flag to make some tasks machine-specific.
|
||||
</para>
|
||||
|
||||
@@ -653,8 +632,7 @@
|
||||
</itemizedlist>
|
||||
It is possible to have functions run before and after a task's main
|
||||
function.
|
||||
This is done using the <filename>[prefuncs]</filename>
|
||||
and <filename>[postfuncs]</filename> flags of the task
|
||||
This is done using the "prefuncs" and "postfuncs" flags of the task
|
||||
that lists the functions to run.
|
||||
</para>
|
||||
</section>
|
||||
@@ -781,7 +759,7 @@
|
||||
The code in <filename>meta/lib/oe/sstatesig.py</filename> shows two examples
|
||||
of this and also illustrates how you can insert your own policy into the system
|
||||
if so desired.
|
||||
This file defines the two basic signature generators OpenEmbedded-Core
|
||||
This file defines the two basic signature generators OpenEmbedded Core
|
||||
uses: "OEBasic" and "OEBasicHash".
|
||||
By default, there is a dummy "noop" signature handler enabled in BitBake.
|
||||
This means that behavior is unchanged from previous versions.
|
||||
@@ -804,13 +782,13 @@
|
||||
make some dependency and hash information available to the build.
|
||||
This information includes:
|
||||
<itemizedlist>
|
||||
<listitem><para><filename>BB_BASEHASH_task-</filename><replaceable>taskname</replaceable>:
|
||||
<listitem><para><filename>BB_BASEHASH_task-<taskname></filename>:
|
||||
The base hashes for each task in the recipe.
|
||||
</para></listitem>
|
||||
<listitem><para><filename>BB_BASEHASH_</filename><replaceable>filename</replaceable><filename>:</filename><replaceable>taskname</replaceable>:
|
||||
<listitem><para><filename>BB_BASEHASH_<filename:taskname></filename>:
|
||||
The base hashes for each dependent task.
|
||||
</para></listitem>
|
||||
<listitem><para><filename>BBHASHDEPS_</filename><replaceable>filename</replaceable><filename>:</filename><replaceable>taskname</replaceable>:
|
||||
<listitem><para><filename>BBHASHDEPS_<filename:taskname></filename>:
|
||||
The task dependencies for each task.
|
||||
</para></listitem>
|
||||
<listitem><para><filename>BB_TASKHASH</filename>:
|
||||
@@ -828,7 +806,7 @@
|
||||
itself.
|
||||
The simplest parameter to pass is "none", which causes a
|
||||
set of signature information to be written out into
|
||||
<filename>STAMPS_DIR</filename>
|
||||
<filename>STAMP_DIR</filename>
|
||||
corresponding to the targets specified.
|
||||
The other currently available parameter is "printdiff",
|
||||
which causes BitBake to try to establish the closest
|
||||
@@ -916,7 +894,7 @@
|
||||
<para>
|
||||
Finally, after all the setscene tasks have executed, BitBake calls the
|
||||
function listed in
|
||||
<link linkend='var-BB_SETSCENE_VERIFY_FUNCTION2'><filename>BB_SETSCENE_VERIFY_FUNCTION2</filename></link>
|
||||
<link linkend='var-BB_SETSCENE_VERIFY_FUNCTION'><filename>BB_SETSCENE_VERIFY_FUNCTION</filename></link>
|
||||
with the list of tasks BitBake thinks has been "covered".
|
||||
The metadata can then ensure that this list is correct and can
|
||||
inform BitBake that it wants specific tasks to be run regardless
|
||||
|
||||
@@ -38,7 +38,7 @@
|
||||
The code to execute the first part of this process, a fetch,
|
||||
looks something like the following:
|
||||
<literallayout class='monospaced'>
|
||||
src_uri = (d.getVar('SRC_URI') or "").split()
|
||||
src_uri = (d.getVar('SRC_URI', True) or "").split()
|
||||
fetcher = bb.fetch2.Fetch(src_uri, d)
|
||||
fetcher.download()
|
||||
</literallayout>
|
||||
@@ -52,7 +52,7 @@
|
||||
<para>
|
||||
The instantiation of the fetch class is usually followed by:
|
||||
<literallayout class='monospaced'>
|
||||
rootdir = l.getVar('WORKDIR')
|
||||
rootdir = l.getVar('WORKDIR', True)
|
||||
fetcher.unpack(rootdir)
|
||||
</literallayout>
|
||||
This code unpacks the downloaded files to the
|
||||
@@ -157,8 +157,8 @@
|
||||
<filename>SRC_URI</filename> variable with the appropriate
|
||||
varflags as follows:
|
||||
<literallayout class='monospaced'>
|
||||
SRC_URI[md5sum] = "<replaceable>value</replaceable>"
|
||||
SRC_URI[sha256sum] = "<replaceable>value</replaceable>"
|
||||
SRC_URI[md5sum] = "value"
|
||||
SRC_URI[sha256sum] = "value"
|
||||
</literallayout>
|
||||
You can also specify the checksums as parameters on the
|
||||
<filename>SRC_URI</filename> as shown below:
|
||||
@@ -268,6 +268,15 @@
|
||||
<link linkend='var-FILESPATH'><filename>FILESPATH</filename></link>
|
||||
variable is used in the same way
|
||||
<filename>PATH</filename> is used to find executables.
|
||||
Failing that,
|
||||
<link linkend='var-FILESDIR'><filename>FILESDIR</filename></link>
|
||||
is used to find the appropriate relative file.
|
||||
<note>
|
||||
<filename>FILESDIR</filename> is deprecated and can
|
||||
be replaced with <filename>FILESPATH</filename>.
|
||||
Because <filename>FILESDIR</filename> is likely to be
|
||||
removed, you should not use this variable in any new code.
|
||||
</note>
|
||||
If the file cannot be found, it is assumed that it is available in
|
||||
<link linkend='var-DL_DIR'><filename>DL_DIR</filename></link>
|
||||
by the time the <filename>download()</filename> method is called.
|
||||
@@ -316,25 +325,6 @@
|
||||
SRC_URI = "ftp://you@oe.handhelds.org/home/you/secret.plan"
|
||||
</literallayout>
|
||||
</para>
|
||||
<note>
|
||||
Because URL parameters are delimited by semi-colons, this can
|
||||
introduce ambiguity when parsing URLs that also contain semi-colons,
|
||||
for example:
|
||||
<literallayout class='monospaced'>
|
||||
SRC_URI = "http://abc123.org/git/?p=gcc/gcc.git;a=snapshot;h=a5dd47"
|
||||
</literallayout>
|
||||
Such URLs should should be modified by replacing semi-colons with '&' characters:
|
||||
<literallayout class='monospaced'>
|
||||
SRC_URI = "http://abc123.org/git/?p=gcc/gcc.git&a=snapshot&h=a5dd47"
|
||||
</literallayout>
|
||||
In most cases this should work. Treating semi-colons and '&' in queries
|
||||
identically is recommended by the World Wide Web Consortium (W3C).
|
||||
Note that due to the nature of the URL, you may have to specify the name
|
||||
of the downloaded file as well:
|
||||
<literallayout class='monospaced'>
|
||||
SRC_URI = "http://abc123.org/git/?p=gcc/gcc.git&a=snapshot&h=a5dd47;downloadfilename=myfile.bz2"
|
||||
</literallayout>
|
||||
</note>
|
||||
</section>
|
||||
|
||||
<section id='cvs-fetcher'>
|
||||
@@ -355,7 +345,7 @@
|
||||
A special value of "now" causes the checkout to
|
||||
be updated on every build.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis><link linkend='var-CVSDIR'><filename>CVSDIR</filename></link>:</emphasis>
|
||||
<listitem><para><emphasis><filename>CVSDIR</filename>:</emphasis>
|
||||
Specifies where a temporary checkout is saved.
|
||||
The location is often <filename>DL_DIR/cvs</filename>.
|
||||
</para></listitem>
|
||||
@@ -376,8 +366,7 @@
|
||||
The supported parameters are as follows:
|
||||
<itemizedlist>
|
||||
<listitem><para><emphasis>"method":</emphasis>
|
||||
The protocol over which to communicate with the CVS
|
||||
server.
|
||||
The protocol over which to communicate with the CVS server.
|
||||
By default, this protocol is "pserver".
|
||||
If "method" is set to "ext", BitBake examines the
|
||||
"rsh" parameter and sets <filename>CVS_RSH</filename>.
|
||||
@@ -405,8 +394,7 @@
|
||||
Effectively, you are renaming the output directory
|
||||
to which the module is unpacked.
|
||||
You are forcing the module into a special
|
||||
directory relative to
|
||||
<link linkend='var-CVSDIR'><filename>CVSDIR</filename></link>.
|
||||
directory relative to <filename>CVSDIR</filename>.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>"rsh"</emphasis>
|
||||
Used in conjunction with the "method" parameter.
|
||||
@@ -447,9 +435,9 @@
|
||||
The executable used is specified by
|
||||
<filename>FETCHCMD_svn</filename>, which defaults
|
||||
to "svn".
|
||||
The fetcher's temporary working directory is set by
|
||||
<link linkend='var-SVNDIR'><filename>SVNDIR</filename></link>,
|
||||
which is usually <filename>DL_DIR/svn</filename>.
|
||||
The fetcher's temporary working directory is set
|
||||
by <filename>SVNDIR</filename>, which is usually
|
||||
<filename>DL_DIR/svn</filename>.
|
||||
</para>
|
||||
|
||||
<para>
|
||||
@@ -461,29 +449,25 @@
|
||||
You can think of this parameter as the top-level
|
||||
directory of the repository data you want.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>"path_spec":</emphasis>
|
||||
A specific directory in which to checkout the
|
||||
specified svn module.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>"protocol":</emphasis>
|
||||
The protocol to use, which defaults to "svn".
|
||||
If "protocol" is set to "svn+ssh", the "ssh"
|
||||
parameter is also used.
|
||||
Other options are "svn+ssh" and "rsh".
|
||||
For "rsh", the "rsh" parameter is also used.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>"rev":</emphasis>
|
||||
The revision of the source code to checkout.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>"date":</emphasis>
|
||||
The date of the source code to checkout.
|
||||
Specific revisions are generally much safer to checkout
|
||||
rather than by date as they do not involve timezones
|
||||
(e.g. they are much more deterministic).
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>"scmdata":</emphasis>
|
||||
Causes the “.svn” directories to be available during
|
||||
compile-time when set to "keep".
|
||||
By default, these directories are removed.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>"ssh":</emphasis>
|
||||
An optional parameter used when "protocol" is set
|
||||
to "svn+ssh".
|
||||
You can use this parameter to specify the ssh
|
||||
program used by svn.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>"transportuser":</emphasis>
|
||||
When required, sets the username for the transport.
|
||||
By default, this parameter is empty.
|
||||
@@ -492,11 +476,10 @@
|
||||
command.
|
||||
</para></listitem>
|
||||
</itemizedlist>
|
||||
Following are three examples using svn:
|
||||
Following are two examples using svn:
|
||||
<literallayout class='monospaced'>
|
||||
SRC_URI = "svn://myrepos/proj1;module=vip;protocol=http;rev=667"
|
||||
SRC_URI = "svn://myrepos/proj1;module=opie;protocol=svn+ssh"
|
||||
SRC_URI = "svn://myrepos/proj1;module=trunk;protocol=http;path_spec=${MY_DIR}/proj1"
|
||||
SRC_URI = "svn://svn.oe.handhelds.org/svn;module=vip;proto=http;rev=667"
|
||||
SRC_URI = "svn://svn.oe.handhelds.org/svn/;module=opie;proto=svn+ssh;date=20060126"
|
||||
</literallayout>
|
||||
</para>
|
||||
</section>
|
||||
@@ -508,9 +491,8 @@
|
||||
This fetcher submodule fetches code from the Git
|
||||
source control system.
|
||||
The fetcher works by creating a bare clone of the
|
||||
remote into
|
||||
<link linkend='var-GITDIR'><filename>GITDIR</filename></link>,
|
||||
which is usually <filename>DL_DIR/git2</filename>.
|
||||
remote into <filename>GITDIR</filename>, which is
|
||||
usually <filename>DL_DIR/git2</filename>.
|
||||
This bare clone is then cloned into the work directory during the
|
||||
unpack stage when a specific tree is checked out.
|
||||
This is done using alternates and by reference to
|
||||
@@ -588,14 +570,6 @@
|
||||
The name of the path in which to place the checkout.
|
||||
By default, the path is <filename>git/</filename>.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>"usehead":</emphasis>
|
||||
Enables local <filename>git://</filename> URLs to use the
|
||||
current branch HEAD as the revision for use with
|
||||
<filename>AUTOREV</filename>.
|
||||
The "usehead" parameter implies no branch and only works
|
||||
when the transfer protocol is
|
||||
<filename>file://</filename>.
|
||||
</para></listitem>
|
||||
</itemizedlist>
|
||||
Here are some example URLs:
|
||||
<literallayout class='monospaced'>
|
||||
@@ -628,9 +602,7 @@
|
||||
The Git Submodules fetcher is not a complete fetcher
|
||||
implementation.
|
||||
The fetcher has known issues where it does not use the
|
||||
normal source mirroring infrastructure properly. Further,
|
||||
the submodule sources it fetches are not visible to the
|
||||
licensing and source archiving infrastructures.
|
||||
normal source mirroring infrastructure properly.
|
||||
</para>
|
||||
</note>
|
||||
</para>
|
||||
@@ -654,7 +626,7 @@
|
||||
<literallayout class='monospaced'>
|
||||
SRC_URI = "ccrc://cc.example.org/ccrc;vob=/example_vob;module=/example_module"
|
||||
SRCREV = "EXAMPLE_CLEARCASE_TAG"
|
||||
PV = "${@d.getVar("SRCREV", False).replace("/", "+")}"
|
||||
PV = "${@d.getVar("SRCREV").replace("/", "+")}"
|
||||
</literallayout>
|
||||
The fetcher uses the <filename>rcleartool</filename> or
|
||||
<filename>cleartool</filename> remote client, depending on
|
||||
@@ -672,19 +644,13 @@
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis><filename>module</filename></emphasis>:
|
||||
The module, which must include the
|
||||
prepending "/" character, in the selected VOB.
|
||||
<note>
|
||||
The <filename>module</filename> and <filename>vob</filename>
|
||||
options are combined to create the <filename>load</filename> rule in
|
||||
the view config spec.
|
||||
As an example, consider the <filename>vob</filename> and
|
||||
<filename>module</filename> values from the
|
||||
<filename>SRC_URI</filename> statement at the start of this section.
|
||||
Combining those values results in the following:
|
||||
<literallayout class='monospaced'>
|
||||
load /example_vob/example_module
|
||||
</literallayout>
|
||||
</note>
|
||||
prepending "/" character, in the selected VOB
|
||||
The <filename>module</filename> and <filename>vob</filename>
|
||||
options are combined to create the following load rule in
|
||||
the view config spec:
|
||||
<literallayout class='monospaced'>
|
||||
load <vob><module>
|
||||
</literallayout>
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis><filename>proto</filename></emphasis>:
|
||||
The protocol, which can be either <filename>http</filename> or
|
||||
@@ -723,105 +689,6 @@
|
||||
</para>
|
||||
</section>
|
||||
|
||||
<section id='perforce-fetcher'>
|
||||
<title>Perforce Fetcher (<filename>p4://</filename>)</title>
|
||||
|
||||
<para>
|
||||
This fetcher submodule fetches code from the
|
||||
<ulink url='https://www.perforce.com/'>Perforce</ulink>
|
||||
source control system.
|
||||
The executable used is specified by
|
||||
<filename>FETCHCMD_p4</filename>, which defaults
|
||||
to "p4".
|
||||
The fetcher's temporary working directory is set by
|
||||
<link linkend='var-P4DIR'><filename>P4DIR</filename></link>,
|
||||
which defaults to "DL_DIR/p4".
|
||||
</para>
|
||||
|
||||
<para>
|
||||
To use this fetcher, make sure your recipe has proper
|
||||
<link linkend='var-SRC_URI'><filename>SRC_URI</filename></link>,
|
||||
<link linkend='var-SRCREV'><filename>SRCREV</filename></link>, and
|
||||
<link linkend='var-PV'><filename>PV</filename></link> values.
|
||||
The p4 executable is able to use the config file defined by your
|
||||
system's <filename>P4CONFIG</filename> environment variable in
|
||||
order to define the Perforce server URL and port, username, and
|
||||
password if you do not wish to keep those values in a recipe
|
||||
itself.
|
||||
If you choose not to use <filename>P4CONFIG</filename>,
|
||||
or to explicitly set variables that <filename>P4CONFIG</filename>
|
||||
can contain, you can specify the <filename>P4PORT</filename> value,
|
||||
which is the server's URL and port number, and you can
|
||||
specify a username and password directly in your recipe within
|
||||
<filename>SRC_URI</filename>.
|
||||
</para>
|
||||
|
||||
<para>
|
||||
Here is an example that relies on <filename>P4CONFIG</filename>
|
||||
to specify the server URL and port, username, and password, and
|
||||
fetches the Head Revision:
|
||||
<literallayout class='monospaced'>
|
||||
SRC_URI = "p4://example-depot/main/source/..."
|
||||
SRCREV = "${AUTOREV}"
|
||||
PV = "p4-${SRCPV}"
|
||||
S = "${WORKDIR}/p4"
|
||||
</literallayout>
|
||||
</para>
|
||||
|
||||
<para>
|
||||
Here is an example that specifies the server URL and port,
|
||||
username, and password, and fetches a Revision based on a Label:
|
||||
<literallayout class='monospaced'>
|
||||
P4PORT = "tcp:p4server.example.net:1666"
|
||||
SRC_URI = "p4://user:passwd@example-depot/main/source/..."
|
||||
SRCREV = "release-1.0"
|
||||
PV = "p4-${SRCPV}"
|
||||
S = "${WORKDIR}/p4"
|
||||
</literallayout>
|
||||
<note>
|
||||
You should always set <filename>S</filename>
|
||||
to <filename>"${WORKDIR}/p4"</filename> in your recipe.
|
||||
</note>
|
||||
</para>
|
||||
</section>
|
||||
|
||||
<section id='repo-fetcher'>
|
||||
<title>Repo Fetcher (<filename>repo://</filename>)</title>
|
||||
|
||||
<para>
|
||||
This fetcher submodule fetches code from
|
||||
<filename>google-repo</filename> source control system.
|
||||
The fetcher works by initiating and syncing sources of the
|
||||
repository into
|
||||
<link linkend='var-REPODIR'><filename>REPODIR</filename></link>,
|
||||
which is usually
|
||||
<link linkend='var-DL_DIR'><filename>DL_DIR</filename></link><filename>/repo</filename>.
|
||||
</para>
|
||||
|
||||
<para>
|
||||
This fetcher supports the following parameters:
|
||||
<itemizedlist>
|
||||
<listitem><para>
|
||||
<emphasis>"protocol":</emphasis>
|
||||
Protocol to fetch the repository manifest (default: git).
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
<emphasis>"branch":</emphasis>
|
||||
Branch or tag of repository to get (default: master).
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
<emphasis>"manifest":</emphasis>
|
||||
Name of the manifest file (default: <filename>default.xml</filename>).
|
||||
</para></listitem>
|
||||
</itemizedlist>
|
||||
Here are some example URLs:
|
||||
<literallayout class='monospaced'>
|
||||
SRC_URI = "repo://REPOROOT;protocol=git;branch=some_branch;manifest=my_manifest.xml"
|
||||
SRC_URI = "repo://REPOROOT;protocol=file;branch=some_branch;manifest=my_manifest.xml"
|
||||
</literallayout>
|
||||
</para>
|
||||
</section>
|
||||
|
||||
<section id='other-fetchers'>
|
||||
<title>Other Fetchers</title>
|
||||
|
||||
@@ -831,6 +698,9 @@
|
||||
<listitem><para>
|
||||
Bazaar (<filename>bzr://</filename>)
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
Perforce (<filename>p4://</filename>)
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
Trees using Git Annex (<filename>gitannex://</filename>)
|
||||
</para></listitem>
|
||||
@@ -840,6 +710,9 @@
|
||||
<listitem><para>
|
||||
Secure Shell (<filename>ssh://</filename>)
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
Repo (<filename>repo://</filename>)
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
OSC (<filename>osc://</filename>)
|
||||
</para></listitem>
|
||||
|
||||
@@ -47,6 +47,7 @@
|
||||
-rw-rw-r--. 1 wmat wmat 849 Nov 26 04:55 HEADER
|
||||
drwxrwxr-x. 5 wmat wmat 4096 Jan 31 13:44 lib
|
||||
-rw-rw-r--. 1 wmat wmat 195 Nov 26 04:55 MANIFEST.in
|
||||
-rwxrwxr-x. 1 wmat wmat 3195 Jan 31 11:57 setup.py
|
||||
-rw-rw-r--. 1 wmat wmat 2887 Nov 26 04:55 TODO
|
||||
</literallayout>
|
||||
</para>
|
||||
@@ -128,8 +129,15 @@
|
||||
</para>
|
||||
|
||||
<note>
|
||||
This example was inspired by and drew heavily from
|
||||
<ulink url="http://www.mail-archive.com/yocto@yoctoproject.org/msg09379.html">Mailing List post - The BitBake equivalent of "Hello, World!"</ulink>.
|
||||
This example was inspired by and drew heavily from these sources:
|
||||
<itemizedlist>
|
||||
<listitem><para>
|
||||
<ulink url="http://www.mail-archive.com/yocto@yoctoproject.org/msg09379.html">Mailing List post - The BitBake equivalent of "Hello, World!"</ulink>
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
<ulink url="http://hambedded.org/blog/2012/11/24/from-bitbake-hello-world-to-an-image/">Hambedded Linux blog post - From Bitbake Hello World to an Image</ulink>
|
||||
</para></listitem>
|
||||
</itemizedlist>
|
||||
</note>
|
||||
|
||||
<para>
|
||||
@@ -213,7 +221,7 @@
|
||||
<para>From your shell, enter the following commands to set and
|
||||
export the <filename>BBPATH</filename> variable:
|
||||
<literallayout class='monospaced'>
|
||||
$ BBPATH="<replaceable>projectdirectory</replaceable>"
|
||||
$ BBPATH="<projectdirectory>"
|
||||
$ export BBPATH
|
||||
</literallayout>
|
||||
Use your actual project directory in the command.
|
||||
@@ -260,9 +268,9 @@
|
||||
files.
|
||||
For this example, you need to create the file in your project directory
|
||||
and define some key BitBake variables.
|
||||
For more information on the <filename>bitbake.conf</filename> file,
|
||||
For more information on the <filename>bitbake.conf</filename>,
|
||||
see
|
||||
<ulink url='http://git.openembedded.org/bitbake/tree/conf/bitbake.conf'></ulink>.
|
||||
<ulink url='http://hambedded.org/blog/2012/11/24/from-bitbake-hello-world-to-an-image/#an-overview-of-bitbakeconf'></ulink>
|
||||
</para>
|
||||
<para>Use the following commands to create the <filename>conf</filename>
|
||||
directory in the project directory:
|
||||
@@ -273,32 +281,14 @@
|
||||
some editor to create the <filename>bitbake.conf</filename>
|
||||
so that it contains the following:
|
||||
<literallayout class='monospaced'>
|
||||
<link linkend='var-PN'>PN</link> = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE', False),d)[0] or 'defaultpkgname'}"
|
||||
</literallayout>
|
||||
<literallayout class='monospaced'>
|
||||
TMPDIR = "${<link linkend='var-TOPDIR'>TOPDIR</link>}/tmp"
|
||||
<link linkend='var-CACHE'>CACHE</link> = "${TMPDIR}/cache"
|
||||
<link linkend='var-STAMP'>STAMP</link> = "${TMPDIR}/${PN}/stamps"
|
||||
<link linkend='var-T'>T</link> = "${TMPDIR}/${PN}/work"
|
||||
<link linkend='var-B'>B</link> = "${TMPDIR}/${PN}"
|
||||
<link linkend='var-STAMP'>STAMP</link> = "${TMPDIR}/stamps"
|
||||
<link linkend='var-T'>T</link> = "${TMPDIR}/work"
|
||||
<link linkend='var-B'>B</link> = "${TMPDIR}"
|
||||
</literallayout>
|
||||
<note>
|
||||
Without a value for <filename>PN</filename>, the
|
||||
variables <filename>STAMP</filename>,
|
||||
<filename>T</filename>, and <filename>B</filename>,
|
||||
prevent more than one recipe from working. You can fix
|
||||
this by either setting <filename>PN</filename> to have
|
||||
a value similar to what OpenEmbedded and BitBake use
|
||||
in the default <filename>bitbake.conf</filename> file
|
||||
(see previous example). Or, by manually updating each
|
||||
recipe to set <filename>PN</filename>. You will also
|
||||
need to include <filename>PN</filename> as part of the
|
||||
<filename>STAMP</filename>, <filename>T</filename>, and
|
||||
<filename>B</filename> variable definitions in the
|
||||
<filename>local.conf</filename> file.
|
||||
</note>
|
||||
The <filename>TMPDIR</filename> variable establishes a directory
|
||||
that BitBake uses for build output and intermediate files other
|
||||
that BitBake uses for build output and intermediate files (other
|
||||
than the cached information used by the
|
||||
<link linkend='setscene'>Setscene</link> process.
|
||||
Here, the <filename>TMPDIR</filename> directory is set to
|
||||
@@ -318,19 +308,19 @@
|
||||
file exists, you can run the <filename>bitbake</filename>
|
||||
command again:
|
||||
<literallayout class='monospaced'>
|
||||
$ bitbake
|
||||
ERROR: Traceback (most recent call last):
|
||||
File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 163, in wrapped
|
||||
return func(fn, *args)
|
||||
File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 177, in _inherit
|
||||
bb.parse.BBHandler.inherit(bbclass, "configuration INHERITs", 0, data)
|
||||
File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/BBHandler.py", line 92, in inherit
|
||||
include(fn, file, lineno, d, "inherit")
|
||||
File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/ConfHandler.py", line 100, in include
|
||||
raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
|
||||
ParseError: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
|
||||
$ bitbake
|
||||
ERROR: Traceback (most recent call last):
|
||||
File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 163, in wrapped
|
||||
return func(fn, *args)
|
||||
File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 177, in _inherit
|
||||
bb.parse.BBHandler.inherit(bbclass, "configuration INHERITs", 0, data)
|
||||
File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/BBHandler.py", line 92, in inherit
|
||||
include(fn, file, lineno, d, "inherit")
|
||||
File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/ConfHandler.py", line 100, in include
|
||||
raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
|
||||
ParseError: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
|
||||
|
||||
ERROR: Unable to parse base: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
|
||||
ERROR: Unable to parse base: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
|
||||
</literallayout>
|
||||
In the sample output, BitBake could not find the
|
||||
<filename>classes/base.bbclass</filename> file.
|
||||
@@ -363,6 +353,9 @@
|
||||
Of course, the <filename>base.bbclass</filename> can have much
|
||||
more depending on which build environments BitBake is
|
||||
supporting.
|
||||
For more information on the <filename>base.bbclass</filename> file,
|
||||
you can look at
|
||||
<ulink url='http://hambedded.org/blog/2012/11/24/from-bitbake-hello-world-to-an-image/#tasks'></ulink>.
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis>Run Bitbake:</emphasis>
|
||||
After making sure that the <filename>classes/base.bbclass</filename>
|
||||
@@ -383,10 +376,10 @@
|
||||
code separate from the general metadata used by BitBake.
|
||||
Thus, this example creates and uses a layer called "mylayer".
|
||||
<note>
|
||||
You can find additional information on layers in the
|
||||
"<link linkend='layers'>Layers</link>" section.
|
||||
</note></para>
|
||||
|
||||
You can find additional information on adding a layer at
|
||||
<ulink url='http://hambedded.org/blog/2012/11/24/from-bitbake-hello-world-to-an-image/#adding-an-example-layer'></ulink>.
|
||||
</note>
|
||||
</para>
|
||||
<para>Minimally, you need a recipe file and a layer configuration
|
||||
file in your layer.
|
||||
The configuration file needs to be in the <filename>conf</filename>
|
||||
@@ -407,7 +400,7 @@
|
||||
<link linkend='var-BBFILES'>BBFILES</link> += "${LAYERDIR}/*.bb"
|
||||
|
||||
<link linkend='var-BBFILE_COLLECTIONS'>BBFILE_COLLECTIONS</link> += "mylayer"
|
||||
<link linkend='var-BBFILE_PATTERN'>BBFILE_PATTERN_mylayer</link> := "^${LAYERDIR_RE}/"
|
||||
<link linkend='var-BBFILE_PATTERN'>BBFILE_PATTERN_mylayer</link> := "^${LAYERDIR}/"
|
||||
</literallayout>
|
||||
For information on these variables, click the links
|
||||
to go to the definitions in the glossary.</para>
|
||||
@@ -478,7 +471,7 @@
|
||||
Time: 00:00:00
|
||||
Parsing of 1 .bb files complete (0 cached, 1 parsed). 1 targets, 0 skipped, 0 masked, 0 errors.
|
||||
NOTE: Resolving any missing task queue dependencies
|
||||
NOTE: Preparing RunQueue
|
||||
NOTE: Preparing runqueue
|
||||
NOTE: Executing RunQueue Tasks
|
||||
********************
|
||||
* *
|
||||
|
||||
@@ -440,7 +440,7 @@
|
||||
Build Checkout:</emphasis>
|
||||
A final possibility for getting a copy of BitBake is that it
|
||||
already comes with your checkout of a larger Bitbake-based build
|
||||
system, such as Poky.
|
||||
system, such as Poky or Yocto Project.
|
||||
Rather than manually checking out individual layers and
|
||||
gluing them together yourself, you can check
|
||||
out an entire build system.
|
||||
@@ -471,7 +471,7 @@
|
||||
Following is the usage and syntax for BitBake:
|
||||
<literallayout class='monospaced'>
|
||||
$ bitbake -h
|
||||
Usage: bitbake [options] [recipename/target recipe:do_task ...]
|
||||
Usage: bitbake [options] [recipename/target ...]
|
||||
|
||||
Executes the specified task (default is 'build') for a given set of target recipes (.bb files).
|
||||
It is assumed there is a conf/bblayers.conf available in cwd or in BBPATH which
|
||||
@@ -488,6 +488,8 @@
|
||||
target that failed and anything depending on it cannot
|
||||
be built, as much as possible will be built before
|
||||
stopping.
|
||||
-a, --tryaltconfigs Continue with builds by trying to use alternative
|
||||
providers where possible.
|
||||
-f, --force Force the specified targets/task to run (invalidating
|
||||
any existing stamp file).
|
||||
-c CMD, --cmd=CMD Specify the task to execute. The exact options
|
||||
@@ -502,20 +504,9 @@
|
||||
Read the specified file before bitbake.conf.
|
||||
-R POSTFILE, --postread=POSTFILE
|
||||
Read the specified file after bitbake.conf.
|
||||
-v, --verbose Enable tracing of shell tasks (with 'set -x'). Also
|
||||
print bb.note(...) messages to stdout (in addition to
|
||||
writing them to ${T}/log.do_<task>).
|
||||
-v, --verbose Output more log message data to the terminal.
|
||||
-D, --debug Increase the debug level. You can specify this more
|
||||
than once. -D sets the debug level to 1, where only
|
||||
bb.debug(1, ...) messages are printed to stdout; -DD
|
||||
sets the debug level to 2, where both bb.debug(1, ...)
|
||||
and bb.debug(2, ...) messages are printed; etc.
|
||||
Without -D, no debug messages are printed. Note that
|
||||
-D only affects output to stdout. All debug messages
|
||||
are written to ${T}/log.do_taskname, regardless of the
|
||||
debug level.
|
||||
-q, --quiet Output less log message data to the terminal. You can
|
||||
specify this more than once.
|
||||
than once.
|
||||
-n, --dry-run Don't execute, just go through the motions.
|
||||
-S SIGNATURE_HANDLER, --dump-signatures=SIGNATURE_HANDLER
|
||||
Dump out the signature construction information, with
|
||||
@@ -538,38 +529,23 @@
|
||||
-l DEBUG_DOMAINS, --log-domains=DEBUG_DOMAINS
|
||||
Show debug logging for the specified logging domains
|
||||
-P, --profile Profile the command and save reports.
|
||||
-u UI, --ui=UI The user interface to use (knotty, ncurses or taskexp
|
||||
- default knotty).
|
||||
-u UI, --ui=UI The user interface to use (e.g. knotty, hob, depexp).
|
||||
-t SERVERTYPE, --servertype=SERVERTYPE
|
||||
Choose which server to use, process or xmlrpc.
|
||||
--token=XMLRPCTOKEN Specify the connection token to be used when
|
||||
connecting to a remote server.
|
||||
--revisions-changed Set the exit code depending on whether upstream
|
||||
floating revisions have changed or not.
|
||||
--server-only Run bitbake without a UI, only starting a server
|
||||
(cooker) process.
|
||||
-B BIND, --bind=BIND The name/address for the bitbake xmlrpc server to bind
|
||||
to.
|
||||
-T SERVER_TIMEOUT, --idle-timeout=SERVER_TIMEOUT
|
||||
Set timeout to unload bitbake server due to
|
||||
inactivity, set to -1 means no unload, default:
|
||||
Environment variable BB_SERVER_TIMEOUT.
|
||||
-B BIND, --bind=BIND The name/address for the bitbake server to bind to.
|
||||
--no-setscene Do not run any setscene tasks. sstate will be ignored
|
||||
and everything needed, built.
|
||||
--setscene-only Only run setscene tasks, don't run any real tasks.
|
||||
--remote-server=REMOTE_SERVER
|
||||
Connect to the specified server.
|
||||
-m, --kill-server Terminate any running bitbake server.
|
||||
-m, --kill-server Terminate the remote server.
|
||||
--observe-only Connect to a server as an observing-only client.
|
||||
--status-only Check the status of the remote bitbake server.
|
||||
-w WRITEEVENTLOG, --write-log=WRITEEVENTLOG
|
||||
Writes the event log of the build to a bitbake event
|
||||
json file. Use '' (empty string) to assign the name
|
||||
automatically.
|
||||
--runall=RUNALL Run the specified task for any recipe in the taskgraph
|
||||
of the specified target (even if it wouldn't otherwise
|
||||
have run).
|
||||
--runonly=RUNONLY Run only the specified task within the taskgraph of
|
||||
the specified targets (and any task dependencies those
|
||||
tasks may have).
|
||||
</literallayout>
|
||||
</para>
|
||||
</section>
|
||||
@@ -652,25 +628,6 @@
|
||||
</para>
|
||||
</section>
|
||||
|
||||
<section id='executing-a-list-of-task-and-recipe-combinations'>
|
||||
<title>Executing a List of Task and Recipe Combinations</title>
|
||||
|
||||
<para>
|
||||
The BitBake command line supports specifying different
|
||||
tasks for individual targets when you specify multiple
|
||||
targets.
|
||||
For example, suppose you had two targets (or recipes)
|
||||
<filename>myfirstrecipe</filename> and
|
||||
<filename>mysecondrecipe</filename> and you needed
|
||||
BitBake to run <filename>taskA</filename> for the first
|
||||
recipe and <filename>taskB</filename> for the second
|
||||
recipe:
|
||||
<literallayout class='monospaced'>
|
||||
$ bitbake myfirstrecipe:do_taskA mysecondrecipe:do_taskB
|
||||
</literallayout>
|
||||
</para>
|
||||
</section>
|
||||
|
||||
<section id='generating-dependency-graphs'>
|
||||
<title>Generating Dependency Graphs</title>
|
||||
|
||||
@@ -683,21 +640,21 @@
|
||||
</para>
|
||||
|
||||
<para>
|
||||
When you generate a dependency graph, BitBake writes three files
|
||||
When you generate a dependency graph, BitBake writes four files
|
||||
to the current working directory:
|
||||
<itemizedlist>
|
||||
<listitem><para>
|
||||
<emphasis><filename>recipe-depends.dot</filename>:</emphasis>
|
||||
Shows dependencies between recipes (i.e. a collapsed version of
|
||||
<filename>task-depends.dot</filename>).
|
||||
<listitem><para><emphasis><filename>package-depends.dot</filename>:</emphasis>
|
||||
Shows BitBake's knowledge of dependencies between
|
||||
runtime targets.
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
<emphasis><filename>task-depends.dot</filename>:</emphasis>
|
||||
<listitem><para><emphasis><filename>pn-depends.dot</filename>:</emphasis>
|
||||
Shows dependencies between build-time targets
|
||||
(i.e. recipes).
|
||||
</para></listitem>
|
||||
<listitem><para><emphasis><filename>task-depends.dot</filename>:</emphasis>
|
||||
Shows dependencies between tasks.
|
||||
These dependencies match BitBake's internal task execution list.
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
<emphasis><filename>pn-buildlist</filename>:</emphasis>
|
||||
<listitem><para><emphasis><filename>pn-buildlist</filename>:</emphasis>
|
||||
Shows a simple list of targets that are to be built.
|
||||
</para></listitem>
|
||||
</itemizedlist>
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -43,8 +43,8 @@
|
||||
<link linkend='var-DEFAULT_PREFERENCE'>D</link>
|
||||
<link linkend='var-EXCLUDE_FROM_WORLD'>E</link>
|
||||
<link linkend='var-FAKEROOT'>F</link>
|
||||
<link linkend='var-GITDIR'>G</link>
|
||||
<link linkend='var-HGDIR'>H</link>
|
||||
<!-- <link linkend='var-GROUPADD_PARAM'>G</link> -->
|
||||
<link linkend='var-HOMEPAGE'>H</link>
|
||||
<!-- <link linkend='var-ICECC_DISABLED'>I</link> -->
|
||||
<!-- <link linkend='var-glossary-j'>J</link> -->
|
||||
<!-- <link linkend='var-KARCH'>K</link> -->
|
||||
@@ -52,7 +52,7 @@
|
||||
<link linkend='var-MIRRORS'>M</link>
|
||||
<!-- <link linkend='var-glossary-n'>N</link> -->
|
||||
<link linkend='var-OVERRIDES'>O</link>
|
||||
<link linkend='var-P4DIR'>P</link>
|
||||
<link linkend='var-PACKAGES'>P</link>
|
||||
<!-- <link linkend='var-QMAKE_PROFILES'>Q</link> -->
|
||||
<link linkend='var-RDEPENDS'>R</link>
|
||||
<link linkend='var-SECTION'>S</link>
|
||||
@@ -78,7 +78,7 @@
|
||||
</para>
|
||||
|
||||
<para>
|
||||
In OpenEmbedded-Core, <filename>ASSUME_PROVIDED</filename>
|
||||
In OpenEmbedded Core, <filename>ASSUME_PROVIDED</filename>
|
||||
mostly specifies native tools that should not be built.
|
||||
An example is <filename>git-native</filename>, which
|
||||
when specified allows for the Git binary from the host to
|
||||
@@ -102,56 +102,6 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BB_ALLOWED_NETWORKS'><glossterm>BB_ALLOWED_NETWORKS</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
Specifies a space-delimited list of hosts that the fetcher
|
||||
is allowed to use to obtain the required source code.
|
||||
Following are considerations surrounding this variable:
|
||||
<itemizedlist>
|
||||
<listitem><para>
|
||||
This host list is only used if
|
||||
<link linkend='var-BB_NO_NETWORK'><filename>BB_NO_NETWORK</filename></link>
|
||||
is either not set or set to "0".
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
Limited support for wildcard matching against the
|
||||
beginning of host names exists.
|
||||
For example, the following setting matches
|
||||
<filename>git.gnu.org</filename>,
|
||||
<filename>ftp.gnu.org</filename>, and
|
||||
<filename>foo.git.gnu.org</filename>.
|
||||
<literallayout class='monospaced'>
|
||||
BB_ALLOWED_NETWORKS = "*.gnu.org"
|
||||
</literallayout>
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
Mirrors not in the host list are skipped and
|
||||
logged in debug.
|
||||
</para></listitem>
|
||||
<listitem><para>
|
||||
Attempts to access networks not in the host list
|
||||
cause a failure.
|
||||
</para></listitem>
|
||||
</itemizedlist>
|
||||
Using <filename>BB_ALLOWED_NETWORKS</filename> in
|
||||
conjunction with
|
||||
<link linkend='var-PREMIRRORS'><filename>PREMIRRORS</filename></link>
|
||||
is very useful.
|
||||
Adding the host you want to use to
|
||||
<filename>PREMIRRORS</filename> results in the source code
|
||||
being fetched from an allowed location and avoids raising
|
||||
an error when a host that is not allowed is in a
|
||||
<link linkend='var-SRC_URI'><filename>SRC_URI</filename></link>
|
||||
statement.
|
||||
This is because the fetcher does not attempt to use the
|
||||
host listed in <filename>SRC_URI</filename> after a
|
||||
successful fetch from the
|
||||
<filename>PREMIRRORS</filename> occurs.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BB_CONSOLELOG'><glossterm>BB_CONSOLELOG</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
@@ -716,7 +666,7 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BB_SETSCENE_VERIFY_FUNCTION2'><glossterm>BB_SETSCENE_VERIFY_FUNCTION2</glossterm>
|
||||
<glossentry id='var-BB_SETSCENE_VERIFY_FUNCTION'><glossterm>BB_SETSCENE_VERIFY_FUNCTION</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
Specifies a function to call that verifies the list of
|
||||
@@ -856,56 +806,6 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BB_TASK_IONICE_LEVEL'><glossterm>BB_TASK_IONICE_LEVEL</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
Allows adjustment of a task's Input/Output priority.
|
||||
During Autobuilder testing, random failures can occur
|
||||
for tasks due to I/O starvation.
|
||||
These failures occur during various QEMU runtime timeouts.
|
||||
You can use the <filename>BB_TASK_IONICE_LEVEL</filename>
|
||||
variable to adjust the I/O priority of these tasks.
|
||||
<note>
|
||||
This variable works similarly to the
|
||||
<link linkend='var-BB_TASK_NICE_LEVEL'><filename>BB_TASK_NICE_LEVEL</filename></link>
|
||||
variable except with a task's I/O priorities.
|
||||
</note>
|
||||
</para>
|
||||
|
||||
<para>
|
||||
Set the variable as follows:
|
||||
<literallayout class='monospaced'>
|
||||
BB_TASK_IONICE_LEVEL = "<replaceable>class</replaceable>.<replaceable>prio</replaceable>"
|
||||
</literallayout>
|
||||
For <replaceable>class</replaceable>, the default value is
|
||||
"2", which is a best effort.
|
||||
You can use "1" for realtime and "3" for idle.
|
||||
If you want to use realtime, you must have superuser
|
||||
privileges.
|
||||
</para>
|
||||
|
||||
<para>
|
||||
For <replaceable>prio</replaceable>, you can use any
|
||||
value from "0", which is the highest priority, to "7",
|
||||
which is the lowest.
|
||||
The default value is "4".
|
||||
You do not need any special privileges to use this range
|
||||
of priority values.
|
||||
<note>
|
||||
In order for your I/O priority settings to take effect,
|
||||
you need the Completely Fair Queuing (CFQ) Scheduler
|
||||
selected for the backing block device.
|
||||
To select the scheduler, use the following command form
|
||||
where <replaceable>device</replaceable> is the device
|
||||
(e.g. sda, sdb, and so forth):
|
||||
<literallayout class='monospaced'>
|
||||
$ sudo sh -c “echo cfq > /sys/block/<replaceable>device</replaceable>/queu/scheduler
|
||||
</literallayout>
|
||||
</note>
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BB_TASK_NICE_LEVEL'><glossterm>BB_TASK_NICE_LEVEL</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
@@ -964,7 +864,7 @@
|
||||
Allows you to extend a recipe so that it builds variants
|
||||
of the software.
|
||||
Some examples of these variants for recipes from the
|
||||
OpenEmbedded-Core metadata are "natives" such as
|
||||
OpenEmbedded Core metadata are "natives" such as
|
||||
<filename>quilt-native</filename>, which is a copy of
|
||||
Quilt built to run on the build system; "crosses" such
|
||||
as <filename>gcc-cross</filename>, which is a compiler
|
||||
@@ -972,7 +872,7 @@
|
||||
that run on the target <filename>MACHINE</filename>;
|
||||
"nativesdk", which targets the SDK machine instead of
|
||||
<filename>MACHINE</filename>; and "mulitlibs" in the form
|
||||
"<filename>multilib:</filename><replaceable>multilib_name</replaceable>".
|
||||
"<filename>multilib:<multilib_name></filename>".
|
||||
</para>
|
||||
|
||||
<para>
|
||||
@@ -980,35 +880,12 @@
|
||||
amount of code, it usually is as simple as adding the
|
||||
variable to your recipe.
|
||||
Here are two examples.
|
||||
The "native" variants are from the OpenEmbedded-Core
|
||||
The "native" variants are from the OpenEmbedded Core
|
||||
metadata:
|
||||
<literallayout class='monospaced'>
|
||||
BBCLASSEXTEND =+ "native nativesdk"
|
||||
BBCLASSEXTEND =+ "multilib:<replaceable>multilib_name</replaceable>"
|
||||
BBCLASSEXTEND =+ "multilib:<multilib_name>"
|
||||
</literallayout>
|
||||
<note>
|
||||
<para>
|
||||
Internally, the <filename>BBCLASSEXTEND</filename>
|
||||
mechanism generates recipe variants by rewriting
|
||||
variable values and applying overrides such as
|
||||
<filename>_class-native</filename>.
|
||||
For example, to generate a native version of a recipe,
|
||||
a
|
||||
<link linkend='var-DEPENDS'><filename>DEPENDS</filename></link>
|
||||
on "foo" is rewritten to a <filename>DEPENDS</filename>
|
||||
on "foo-native".
|
||||
</para>
|
||||
|
||||
<para>
|
||||
Even when using <filename>BBCLASSEXTEND</filename>, the
|
||||
recipe is only parsed once.
|
||||
Parsing once adds some limitations.
|
||||
For example, it is not possible to
|
||||
include a different file depending on the variant,
|
||||
since <filename>include</filename> statements are
|
||||
processed when the recipe is parsed.
|
||||
</para>
|
||||
</note>
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
@@ -1017,7 +894,7 @@
|
||||
<glossdef>
|
||||
<para>
|
||||
Sets the BitBake debug output level to a specific value
|
||||
as incremented by the <filename>-D</filename> command line
|
||||
as incremented by the <filename>-d</filename> command line
|
||||
option.
|
||||
<note>
|
||||
You must set this variable in the external environment
|
||||
@@ -1139,18 +1016,6 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BBLAYERS_FETCH_DIR'><glossterm>BBLAYERS_FETCH_DIR</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
Sets the base location where layers are stored.
|
||||
This setting is used in conjunction with
|
||||
<filename>bitbake-layers layerindex-fetch</filename> and
|
||||
tells <filename>bitbake-layers</filename> where to place
|
||||
the fetched layers.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BBMASK'><glossterm>BBMASK</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
@@ -1163,14 +1028,14 @@
|
||||
to "hide" these <filename>.bb</filename> and
|
||||
<filename>.bbappend</filename> files.
|
||||
BitBake ignores any recipe or recipe append files that
|
||||
match any of the expressions.
|
||||
match the expression.
|
||||
It is as if BitBake does not see them at all.
|
||||
Consequently, matching files are not parsed or otherwise
|
||||
used by BitBake.</para>
|
||||
<para>
|
||||
The values you provide are passed to Python's regular
|
||||
The value you provide is passed to Python's regular
|
||||
expression compiler.
|
||||
The expressions are compared against the full paths to
|
||||
The expression is compared against the full paths to
|
||||
the files.
|
||||
For complete syntax information, see Python's
|
||||
documentation at
|
||||
@@ -1186,16 +1051,18 @@
|
||||
BBMASK = "meta-ti/recipes-misc/"
|
||||
</literallayout>
|
||||
If you want to mask out multiple directories or recipes,
|
||||
you can specify multiple regular expression fragments.
|
||||
use the vertical bar to separate the regular expression
|
||||
fragments.
|
||||
This next example masks out multiple directories and
|
||||
individual recipes:
|
||||
<literallayout class='monospaced'>
|
||||
BBMASK += "/meta-ti/recipes-misc/ meta-ti/recipes-ti/packagegroup/"
|
||||
BBMASK += "/meta-oe/recipes-support/"
|
||||
BBMASK += "/meta-foo/.*/openldap"
|
||||
BBMASK += "opencv.*\.bbappend"
|
||||
BBMASK += "lzma"
|
||||
BBMASK = "meta-ti/recipes-misc/|meta-ti/recipes-ti/packagegroup/"
|
||||
BBMASK .= "|.*meta-oe/recipes-support/"
|
||||
BBMASK .= "|.*openldap"
|
||||
BBMASK .= "|.*opencv"
|
||||
BBMASK .= "|.*lzma"
|
||||
</literallayout>
|
||||
Notice how the vertical bar is used to append the fragments.
|
||||
<note>
|
||||
When specifying a directory name, use the trailing
|
||||
slash character to ensure you match just that directory
|
||||
@@ -1224,9 +1091,9 @@
|
||||
Set the variable as you would any environment variable
|
||||
and then run BitBake:
|
||||
<literallayout class='monospaced'>
|
||||
$ BBPATH="<replaceable>build_directory</replaceable>"
|
||||
$ BBPATH="<build_directory>"
|
||||
$ export BBPATH
|
||||
$ bitbake <replaceable>target</replaceable>
|
||||
$ bitbake <target>
|
||||
</literallayout>
|
||||
</para>
|
||||
</glossdef>
|
||||
@@ -1242,15 +1109,6 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BBTARGETS'><glossterm>BBTARGETS</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
Allows you to use a configuration file to add to the list
|
||||
of command-line target recipes you want to build.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BBVERSIONS'><glossterm>BBVERSIONS</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
@@ -1296,15 +1154,6 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-BZRDIR'><glossterm>BZRDIR</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
The directory in which files checked out of a Bazaar
|
||||
system are stored.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
</glossdiv>
|
||||
|
||||
<glossdiv id='var-glossary-c'><title>C</title>
|
||||
@@ -1319,15 +1168,6 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-CVSDIR'><glossterm>CVSDIR</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
The directory in which files checked out under the
|
||||
CVS system are stored.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
</glossdiv>
|
||||
|
||||
<glossdiv id='var-glossary-d'><title>D</title>
|
||||
@@ -1537,6 +1377,24 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-FILESDIR'><glossterm>FILESDIR</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
Specifies directories BitBake uses when searching for
|
||||
patches and files.
|
||||
The "local" fetcher module uses these directories when
|
||||
handling <filename>file://</filename> URLs if the file
|
||||
was not found using
|
||||
<link linkend='var-FILESPATH'><filename>FILESPATH</filename></link>.
|
||||
<note>
|
||||
The <filename>FILESDIR</filename> variable is
|
||||
deprecated and you should use
|
||||
<filename>FILESPATH</filename> in all new code.
|
||||
</note>
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-FILESPATH'><glossterm>FILESPATH</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
@@ -1554,32 +1412,13 @@
|
||||
|
||||
</glossdiv>
|
||||
|
||||
|
||||
<!--
|
||||
<glossdiv id='var-glossary-g'><title>G</title>
|
||||
|
||||
<glossentry id='var-GITDIR'><glossterm>GITDIR</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
The directory in which a local copy of a Git repository
|
||||
is stored when it is cloned.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
</glossdiv>
|
||||
|
||||
-->
|
||||
|
||||
<glossdiv id='var-glossary-h'><title>H</title>
|
||||
|
||||
<glossentry id='var-HGDIR'><glossterm>HGDIR</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
The directory in which files checked out of a Mercurial
|
||||
system are stored.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-HOMEPAGE'><glossterm>HOMEPAGE</glossterm>
|
||||
<glossdef>
|
||||
<para>Website where more information about the software the recipe is building
|
||||
@@ -1594,19 +1433,9 @@
|
||||
<glossentry id='var-INHERIT'><glossterm>INHERIT</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
Causes the named class or classes to be inherited globally.
|
||||
Anonymous functions in the class or classes
|
||||
are not executed for the
|
||||
base configuration and in each individual recipe.
|
||||
The OpenEmbedded build system ignores changes to
|
||||
<filename>INHERIT</filename> in individual recipes.
|
||||
</para>
|
||||
|
||||
<para>
|
||||
For more information on <filename>INHERIT</filename>, see
|
||||
the
|
||||
"<link linkend="inherit-configuration-directive"><filename>INHERIT</filename> Configuration Directive</link>"
|
||||
section.
|
||||
Causes the named class to be inherited at
|
||||
this point during parsing.
|
||||
The variable is only valid in configuration files.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
@@ -1649,17 +1478,6 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-LAYERDIR_RE'><glossterm>LAYERDIR_RE</glossterm>
|
||||
<glossdef>
|
||||
<para>When used inside the <filename>layer.conf</filename> configuration
|
||||
file, this variable provides the path of the current layer,
|
||||
escaped for use in a regular expression
|
||||
(<link linkend='var-BBFILE_PATTERN'><filename>BBFILE_PATTERN</filename></link>).
|
||||
This variable is not available outside of <filename>layer.conf</filename>
|
||||
and references are expanded immediately when parsing of the file completes.</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-LAYERVERSION'><glossterm>LAYERVERSION</glossterm>
|
||||
<glossdef>
|
||||
<para>Optionally specifies the version of a layer as a single number.
|
||||
@@ -1761,15 +1579,6 @@
|
||||
|
||||
<glossdiv id='var-glossary-p'><title>P</title>
|
||||
|
||||
<glossentry id='var-P4DIR'><glossterm>P4DIR</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
The directory in which a local copy of a Perforce depot
|
||||
is stored when it is fetched.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-PACKAGES'><glossterm>PACKAGES</glossterm>
|
||||
<glossdef>
|
||||
<para>The list of packages the recipe creates.
|
||||
@@ -1901,7 +1710,7 @@
|
||||
Here are two examples:
|
||||
<literallayout class='monospaced'>
|
||||
PREFERRED_VERSION_python = "2.7.3"
|
||||
PREFERRED_VERSION_linux-yocto = "4.12%"
|
||||
PREFERRED_VERSION_linux-yocto = "3.10%"
|
||||
</literallayout>
|
||||
</para>
|
||||
</glossdef>
|
||||
@@ -1966,27 +1775,6 @@
|
||||
The <filename>PROVIDES</filename> statement results in
|
||||
the "libav" recipe also being known as "libpostproc".
|
||||
</para>
|
||||
|
||||
<para>
|
||||
In addition to providing recipes under alternate names,
|
||||
the <filename>PROVIDES</filename> mechanism is also used
|
||||
to implement virtual targets.
|
||||
A virtual target is a name that corresponds to some
|
||||
particular functionality (e.g. a Linux kernel).
|
||||
Recipes that provide the functionality in question list the
|
||||
virtual target in <filename>PROVIDES</filename>.
|
||||
Recipes that depend on the functionality in question can
|
||||
include the virtual target in
|
||||
<link linkend='var-DEPENDS'><filename>DEPENDS</filename></link>
|
||||
to leave the choice of provider open.
|
||||
</para>
|
||||
|
||||
<para>
|
||||
Conventionally, virtual targets have names on the form
|
||||
"virtual/function" (e.g. "virtual/kernel").
|
||||
The slash is simply part of the name and has no
|
||||
syntactical significance.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
@@ -2063,7 +1851,7 @@
|
||||
Here is the general syntax to specify versions with
|
||||
the <filename>RDEPENDS</filename> variable:
|
||||
<literallayout class='monospaced'>
|
||||
RDEPENDS_${PN} = "<replaceable>package</replaceable> (<replaceable>operator</replaceable> <replaceable>version</replaceable>)"
|
||||
RDEPENDS_${PN} = "<package> (<operator> <version>)"
|
||||
</literallayout>
|
||||
For <filename>operator</filename>, you can specify the
|
||||
following:
|
||||
@@ -2089,16 +1877,6 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-REPODIR'><glossterm>REPODIR</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
The directory in which a local copy of a
|
||||
<filename>google-repo</filename> directory is stored
|
||||
when it is synced.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-RPROVIDES'><glossterm>RPROVIDES</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
@@ -2139,7 +1917,7 @@
|
||||
Here is the general syntax to specify versions with
|
||||
the <filename>RRECOMMENDS</filename> variable:
|
||||
<literallayout class='monospaced'>
|
||||
RRECOMMENDS_${PN} = "<replaceable>package</replaceable> (<replaceable>operator</replaceable> <replaceable>version</replaceable>)"
|
||||
RRECOMMENDS_${PN} = "<package> (<operator> <version>)"
|
||||
</literallayout>
|
||||
For <filename>operator</filename>, you can specify the
|
||||
following:
|
||||
@@ -2322,15 +2100,6 @@
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
<glossentry id='var-SVNDIR'><glossterm>SVNDIR</glossterm>
|
||||
<glossdef>
|
||||
<para>
|
||||
The directory in which files checked out of a Subversion
|
||||
system are stored.
|
||||
</para>
|
||||
</glossdef>
|
||||
</glossentry>
|
||||
|
||||
</glossdiv>
|
||||
|
||||
<glossdiv id='var-glossary-t'><title>T</title>
|
||||
|
||||
@@ -56,7 +56,7 @@
|
||||
-->
|
||||
|
||||
<copyright>
|
||||
<year>2004-2018</year>
|
||||
<year>2004-2015</year>
|
||||
<holder>Richard Purdie</holder>
|
||||
<holder>Chris Larson</holder>
|
||||
<holder>and Phil Blundell</holder>
|
||||
|
||||
@@ -105,7 +105,7 @@ Show debug logging for the specified logging domains
|
||||
profile the command and print a report
|
||||
.TP
|
||||
.B \-uUI, \-\-ui=UI
|
||||
User interface to use. Currently, knotty, taskexp or ncurses can be specified as UI.
|
||||
User interface to use. Currently, hob, depexp, goggle or ncurses can be specified as UI.
|
||||
.TP
|
||||
.B \-tSERVERTYPE, \-\-servertype=SERVERTYPE
|
||||
Choose which server to use, none, process or xmlrpc.
|
||||
|
||||
@@ -3,7 +3,7 @@
|
||||
#
|
||||
# This is a copy on write dictionary and set which abuses classes to try and be nice and fast.
|
||||
#
|
||||
# Copyright (C) 2006 Tim Ansell
|
||||
# Copyright (C) 2006 Tim Amsell
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
@@ -23,17 +23,19 @@
|
||||
# Assign a file to __warn__ to get warnings about slow operations.
|
||||
#
|
||||
|
||||
|
||||
from __future__ import print_function
|
||||
import copy
|
||||
import types
|
||||
ImmutableTypes = (
|
||||
types.NoneType,
|
||||
bool,
|
||||
complex,
|
||||
float,
|
||||
int,
|
||||
long,
|
||||
tuple,
|
||||
frozenset,
|
||||
str
|
||||
basestring
|
||||
)
|
||||
|
||||
MUTABLE = "__mutable__"
|
||||
@@ -59,7 +61,7 @@ class COWDictMeta(COWMeta):
|
||||
__call__ = cow
|
||||
|
||||
def __setitem__(cls, key, value):
|
||||
if value is not None and not isinstance(value, ImmutableTypes):
|
||||
if not isinstance(value, ImmutableTypes):
|
||||
if not isinstance(value, COWMeta):
|
||||
cls.__hasmutable__ = True
|
||||
key += MUTABLE
|
||||
@@ -114,7 +116,7 @@ class COWDictMeta(COWMeta):
|
||||
cls.__setitem__(key, cls.__marker__)
|
||||
|
||||
def __revertitem__(cls, key):
|
||||
if key not in cls.__dict__:
|
||||
if not cls.__dict__.has_key(key):
|
||||
key += MUTABLE
|
||||
delattr(cls, key)
|
||||
|
||||
@@ -150,7 +152,7 @@ class COWDictMeta(COWMeta):
|
||||
yield value
|
||||
if type == "items":
|
||||
yield (key, value)
|
||||
return
|
||||
raise StopIteration()
|
||||
|
||||
def iterkeys(cls):
|
||||
return cls.iter("keys")
|
||||
@@ -181,7 +183,7 @@ class COWSetMeta(COWDictMeta):
|
||||
COWDictMeta.__delitem__(cls, repr(hash(value)))
|
||||
|
||||
def __in__(cls, value):
|
||||
return repr(hash(value)) in COWDictMeta
|
||||
return COWDictMeta.has_key(repr(hash(value)))
|
||||
|
||||
def iterkeys(cls):
|
||||
raise TypeError("sets don't have keys")
|
||||
@@ -190,10 +192,12 @@ class COWSetMeta(COWDictMeta):
|
||||
raise TypeError("sets don't have 'items'")
|
||||
|
||||
# These are the actual classes you use!
|
||||
class COWDictBase(object, metaclass = COWDictMeta):
|
||||
class COWDictBase(object):
|
||||
__metaclass__ = COWDictMeta
|
||||
__count__ = 0
|
||||
|
||||
class COWSetBase(object, metaclass = COWSetMeta):
|
||||
class COWSetBase(object):
|
||||
__metaclass__ = COWSetMeta
|
||||
__count__ = 0
|
||||
|
||||
if __name__ == "__main__":
|
||||
@@ -283,7 +287,7 @@ if __name__ == "__main__":
|
||||
except KeyError:
|
||||
print("Yay! deleted key raises error")
|
||||
|
||||
if 'b' in b:
|
||||
if b.has_key('b'):
|
||||
print("Boo!")
|
||||
else:
|
||||
print("Yay - has_key with delete works!")
|
||||
|
||||
@@ -21,11 +21,11 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
__version__ = "1.38.0"
|
||||
__version__ = "1.24.0"
|
||||
|
||||
import sys
|
||||
if sys.version_info < (3, 4, 0):
|
||||
raise RuntimeError("Sorry, python 3.4.0 or later is required for this version of bitbake")
|
||||
if sys.version_info < (2, 7, 3):
|
||||
raise RuntimeError("Sorry, python 2.7.3 or later is required for this version of bitbake")
|
||||
|
||||
|
||||
class BBHandledException(Exception):
|
||||
@@ -70,8 +70,6 @@ logger = logging.getLogger("BitBake")
|
||||
logger.addHandler(NullHandler())
|
||||
logger.setLevel(logging.DEBUG - 2)
|
||||
|
||||
mainlogger = logging.getLogger("BitBake.Main")
|
||||
|
||||
# This has to be imported after the setLoggerClass, as the import of bb.msg
|
||||
# can result in construction of the various loggers.
|
||||
import bb.msg
|
||||
@@ -81,26 +79,26 @@ sys.modules['bb.fetch'] = sys.modules['bb.fetch2']
|
||||
|
||||
# Messaging convenience functions
|
||||
def plain(*args):
|
||||
mainlogger.plain(''.join(args))
|
||||
logger.plain(''.join(args))
|
||||
|
||||
def debug(lvl, *args):
|
||||
if isinstance(lvl, str):
|
||||
mainlogger.warning("Passed invalid debug level '%s' to bb.debug", lvl)
|
||||
if isinstance(lvl, basestring):
|
||||
logger.warn("Passed invalid debug level '%s' to bb.debug", lvl)
|
||||
args = (lvl,) + args
|
||||
lvl = 1
|
||||
mainlogger.debug(lvl, ''.join(args))
|
||||
logger.debug(lvl, ''.join(args))
|
||||
|
||||
def note(*args):
|
||||
mainlogger.info(''.join(args))
|
||||
logger.info(''.join(args))
|
||||
|
||||
def warn(*args):
|
||||
mainlogger.warning(''.join(args))
|
||||
logger.warn(''.join(args))
|
||||
|
||||
def error(*args, **kwargs):
|
||||
mainlogger.error(''.join(args), extra=kwargs)
|
||||
def error(*args):
|
||||
logger.error(''.join(args))
|
||||
|
||||
def fatal(*args, **kwargs):
|
||||
mainlogger.critical(''.join(args), extra=kwargs)
|
||||
def fatal(*args):
|
||||
logger.critical(''.join(args))
|
||||
raise BBHandledException()
|
||||
|
||||
def deprecated(func, name=None, advice=""):
|
||||
|
||||
@@ -31,43 +31,23 @@ import logging
|
||||
import shlex
|
||||
import glob
|
||||
import time
|
||||
import stat
|
||||
import bb
|
||||
import bb.msg
|
||||
import bb.process
|
||||
import bb.progress
|
||||
from bb import data, event, utils
|
||||
from contextlib import nested
|
||||
from bb import event, utils
|
||||
|
||||
bblogger = logging.getLogger('BitBake')
|
||||
logger = logging.getLogger('BitBake.Build')
|
||||
|
||||
NULL = open(os.devnull, 'r+')
|
||||
|
||||
__mtime_cache = {}
|
||||
|
||||
def cached_mtime_noerror(f):
|
||||
if f not in __mtime_cache:
|
||||
try:
|
||||
__mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
|
||||
except OSError:
|
||||
return 0
|
||||
return __mtime_cache[f]
|
||||
|
||||
def reset_cache():
|
||||
global __mtime_cache
|
||||
__mtime_cache = {}
|
||||
|
||||
# When we execute a Python function, we'd like certain things
|
||||
# in all namespaces, hence we add them to __builtins__.
|
||||
# If we do not do this and use the exec globals, they will
|
||||
# not be available to subfunctions.
|
||||
if hasattr(__builtins__, '__setitem__'):
|
||||
builtins = __builtins__
|
||||
else:
|
||||
builtins = __builtins__.__dict__
|
||||
|
||||
builtins['bb'] = bb
|
||||
builtins['os'] = os
|
||||
__builtins__['bb'] = bb
|
||||
__builtins__['os'] = os
|
||||
|
||||
class FuncFailed(Exception):
|
||||
def __init__(self, name = None, logfile = None):
|
||||
@@ -91,14 +71,13 @@ class TaskBase(event.Event):
|
||||
|
||||
def __init__(self, t, logfile, d):
|
||||
self._task = t
|
||||
self._package = d.getVar("PF")
|
||||
self._mc = d.getVar("BB_CURRENT_MC")
|
||||
self.taskfile = d.getVar("FILE")
|
||||
self._package = d.getVar("PF", True)
|
||||
self.taskfile = d.getVar("FILE", True)
|
||||
self.taskname = self._task
|
||||
self.logfile = logfile
|
||||
self.time = time.time()
|
||||
event.Event.__init__(self)
|
||||
self._message = "recipe %s: task %s: %s" % (d.getVar("PF"), t, self.getDisplayName())
|
||||
self._message = "recipe %s: task %s: %s" % (d.getVar("PF", True), t, self.getDisplayName())
|
||||
|
||||
def getTask(self):
|
||||
return self._task
|
||||
@@ -139,25 +118,6 @@ class TaskInvalid(TaskBase):
|
||||
super(TaskInvalid, self).__init__(task, None, metadata)
|
||||
self._message = "No such task '%s'" % task
|
||||
|
||||
class TaskProgress(event.Event):
|
||||
"""
|
||||
Task made some progress that could be reported to the user, usually in
|
||||
the form of a progress bar or similar.
|
||||
NOTE: this class does not inherit from TaskBase since it doesn't need
|
||||
to - it's fired within the task context itself, so we don't have any of
|
||||
the context information that you do in the case of the other events.
|
||||
The event PID can be used to determine which task it came from.
|
||||
The progress value is normally 0-100, but can also be negative
|
||||
indicating that progress has been made but we aren't able to determine
|
||||
how much.
|
||||
The rate is optional, this is simply an extra string to display to the
|
||||
user if specified.
|
||||
"""
|
||||
def __init__(self, progress, rate=None):
|
||||
self.progress = progress
|
||||
self.rate = rate
|
||||
event.Event.__init__(self)
|
||||
|
||||
|
||||
class LogTee(object):
|
||||
def __init__(self, logger, outfile):
|
||||
@@ -181,27 +141,23 @@ class LogTee(object):
|
||||
def flush(self):
|
||||
self.outfile.flush()
|
||||
|
||||
#
|
||||
# pythonexception allows the python exceptions generated to be raised
|
||||
# as the real exceptions (not FuncFailed) and without a backtrace at the
|
||||
# origin of the failure.
|
||||
#
|
||||
def exec_func(func, d, dirs = None, pythonexception=False):
|
||||
def exec_func(func, d, dirs = None):
|
||||
"""Execute a BB 'function'"""
|
||||
|
||||
try:
|
||||
oldcwd = os.getcwd()
|
||||
except:
|
||||
oldcwd = None
|
||||
body = d.getVar(func)
|
||||
if not body:
|
||||
if body is None:
|
||||
logger.warn("Function %s doesn't exist", func)
|
||||
return
|
||||
|
||||
flags = d.getVarFlags(func)
|
||||
cleandirs = flags.get('cleandirs') if flags else None
|
||||
cleandirs = flags.get('cleandirs')
|
||||
if cleandirs:
|
||||
for cdir in d.expand(cleandirs).split():
|
||||
bb.utils.remove(cdir, True)
|
||||
bb.utils.mkdirhier(cdir)
|
||||
|
||||
if flags and dirs is None:
|
||||
if dirs is None:
|
||||
dirs = flags.get('dirs')
|
||||
if dirs:
|
||||
dirs = d.expand(dirs).split()
|
||||
@@ -211,13 +167,8 @@ def exec_func(func, d, dirs = None, pythonexception=False):
|
||||
bb.utils.mkdirhier(adir)
|
||||
adir = dirs[-1]
|
||||
else:
|
||||
adir = None
|
||||
|
||||
body = d.getVar(func, False)
|
||||
if not body:
|
||||
if body is None:
|
||||
logger.warning("Function %s doesn't exist", func)
|
||||
return
|
||||
adir = d.getVar('B', True)
|
||||
bb.utils.mkdirhier(adir)
|
||||
|
||||
ispython = flags.get('python')
|
||||
|
||||
@@ -227,17 +178,17 @@ def exec_func(func, d, dirs = None, pythonexception=False):
|
||||
else:
|
||||
lockfiles = None
|
||||
|
||||
tempdir = d.getVar('T')
|
||||
tempdir = d.getVar('T', True)
|
||||
|
||||
# or func allows items to be executed outside of the normal
|
||||
# task set, such as buildhistory
|
||||
task = d.getVar('BB_RUNTASK') or func
|
||||
task = d.getVar('BB_RUNTASK', True) or func
|
||||
if task == func:
|
||||
taskfunc = task
|
||||
else:
|
||||
taskfunc = "%s.%s" % (task, func)
|
||||
|
||||
runfmt = d.getVar('BB_RUNFMT') or "run.{func}.{pid}"
|
||||
runfmt = d.getVar('BB_RUNFMT', True) or "run.{func}.{pid}"
|
||||
runfn = runfmt.format(taskfunc=taskfunc, task=task, func=func, pid=os.getpid())
|
||||
runfile = os.path.join(tempdir, runfn)
|
||||
bb.utils.mkdirhier(os.path.dirname(runfile))
|
||||
@@ -258,30 +209,22 @@ def exec_func(func, d, dirs = None, pythonexception=False):
|
||||
|
||||
with bb.utils.fileslocked(lockfiles):
|
||||
if ispython:
|
||||
exec_func_python(func, d, runfile, cwd=adir, pythonexception=pythonexception)
|
||||
exec_func_python(func, d, runfile, cwd=adir)
|
||||
else:
|
||||
exec_func_shell(func, d, runfile, cwd=adir)
|
||||
|
||||
try:
|
||||
curcwd = os.getcwd()
|
||||
except:
|
||||
curcwd = None
|
||||
|
||||
if oldcwd and curcwd != oldcwd:
|
||||
try:
|
||||
bb.warn("Task %s changed cwd to %s" % (func, curcwd))
|
||||
os.chdir(oldcwd)
|
||||
except:
|
||||
pass
|
||||
|
||||
_functionfmt = """
|
||||
def {function}(d):
|
||||
{body}
|
||||
|
||||
{function}(d)
|
||||
"""
|
||||
logformatter = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
|
||||
def exec_func_python(func, d, runfile, cwd=None, pythonexception=False):
|
||||
def exec_func_python(func, d, runfile, cwd=None):
|
||||
"""Execute a python BB 'function'"""
|
||||
|
||||
code = _functionfmt.format(function=func)
|
||||
bbfile = d.getVar('FILE', True)
|
||||
code = _functionfmt.format(function=func, body=d.getVar(func, True))
|
||||
bb.utils.mkdirhier(os.path.dirname(runfile))
|
||||
with open(runfile, 'w') as script:
|
||||
bb.data.emit_func_python(func, script, d)
|
||||
@@ -289,26 +232,18 @@ def exec_func_python(func, d, runfile, cwd=None, pythonexception=False):
|
||||
if cwd:
|
||||
try:
|
||||
olddir = os.getcwd()
|
||||
except OSError as e:
|
||||
bb.warn("%s: Cannot get cwd: %s" % (func, e))
|
||||
except OSError:
|
||||
olddir = None
|
||||
os.chdir(cwd)
|
||||
|
||||
bb.debug(2, "Executing python function %s" % func)
|
||||
|
||||
try:
|
||||
text = "def %s(d):\n%s" % (func, d.getVar(func, False))
|
||||
fn = d.getVarFlag(func, "filename", False)
|
||||
lineno = int(d.getVarFlag(func, "lineno", False))
|
||||
bb.methodpool.insert_method(func, text, fn, lineno - 1)
|
||||
|
||||
comp = utils.better_compile(code, func, "exec_python_func() autogenerated")
|
||||
utils.better_exec(comp, {"d": d}, code, "exec_python_func() autogenerated", pythonexception=pythonexception)
|
||||
comp = utils.better_compile(code, func, bbfile)
|
||||
utils.better_exec(comp, {"d": d}, code, bbfile)
|
||||
except (bb.parse.SkipRecipe, bb.build.FuncFailed):
|
||||
raise
|
||||
except:
|
||||
if pythonexception:
|
||||
raise
|
||||
raise FuncFailed(func, None)
|
||||
finally:
|
||||
bb.debug(2, "Python function %s finished" % func)
|
||||
@@ -316,8 +251,8 @@ def exec_func_python(func, d, runfile, cwd=None, pythonexception=False):
|
||||
if cwd and olddir:
|
||||
try:
|
||||
os.chdir(olddir)
|
||||
except OSError as e:
|
||||
bb.warn("%s: Cannot restore cwd %s: %s" % (func, olddir, e))
|
||||
except OSError:
|
||||
pass
|
||||
|
||||
def shell_trap_code():
|
||||
return '''#!/bin/sh\n
|
||||
@@ -327,8 +262,9 @@ bb_exit_handler() {
|
||||
case $ret in
|
||||
0) ;;
|
||||
*) case $BASH_VERSION in
|
||||
"") echo "WARNING: exit code $ret from a shell command.";;
|
||||
*) echo "WARNING: ${BASH_SOURCE[0]}:${BASH_LINENO[0]} exit $ret from '$BASH_COMMAND'";;
|
||||
"") echo "WARNING: exit code $ret from a shell command.";;
|
||||
*) echo "WARNING: ${BASH_SOURCE[0]}:${BASH_LINENO[0]} exit $ret from
|
||||
\"$BASH_COMMAND\"";;
|
||||
esac
|
||||
exit $ret
|
||||
esac
|
||||
@@ -362,14 +298,14 @@ def exec_func_shell(func, d, runfile, cwd=None):
|
||||
# cleanup
|
||||
ret=$?
|
||||
trap '' 0
|
||||
exit $ret
|
||||
exit $?
|
||||
''')
|
||||
|
||||
os.chmod(runfile, 0o775)
|
||||
os.chmod(runfile, 0775)
|
||||
|
||||
cmd = runfile
|
||||
if d.getVarFlag(func, 'fakeroot', False):
|
||||
fakerootcmd = d.getVar('FAKEROOT')
|
||||
if d.getVarFlag(func, 'fakeroot'):
|
||||
fakerootcmd = d.getVar('FAKEROOT', True)
|
||||
if fakerootcmd:
|
||||
cmd = [fakerootcmd, runfile]
|
||||
|
||||
@@ -378,75 +314,14 @@ exit $ret
|
||||
else:
|
||||
logfile = sys.stdout
|
||||
|
||||
progress = d.getVarFlag(func, 'progress')
|
||||
if progress:
|
||||
if progress == 'percent':
|
||||
# Use default regex
|
||||
logfile = bb.progress.BasicProgressHandler(d, outfile=logfile)
|
||||
elif progress.startswith('percent:'):
|
||||
# Use specified regex
|
||||
logfile = bb.progress.BasicProgressHandler(d, regex=progress.split(':', 1)[1], outfile=logfile)
|
||||
elif progress.startswith('outof:'):
|
||||
# Use specified regex
|
||||
logfile = bb.progress.OutOfProgressHandler(d, regex=progress.split(':', 1)[1], outfile=logfile)
|
||||
else:
|
||||
bb.warn('%s: invalid task progress varflag value "%s", ignoring' % (func, progress))
|
||||
bb.debug(2, "Executing shell function %s" % func)
|
||||
|
||||
fifobuffer = bytearray()
|
||||
def readfifo(data):
|
||||
nonlocal fifobuffer
|
||||
fifobuffer.extend(data)
|
||||
while fifobuffer:
|
||||
message, token, nextmsg = fifobuffer.partition(b"\00")
|
||||
if token:
|
||||
splitval = message.split(b' ', 1)
|
||||
cmd = splitval[0].decode("utf-8")
|
||||
if len(splitval) > 1:
|
||||
value = splitval[1].decode("utf-8")
|
||||
else:
|
||||
value = ''
|
||||
if cmd == 'bbplain':
|
||||
bb.plain(value)
|
||||
elif cmd == 'bbnote':
|
||||
bb.note(value)
|
||||
elif cmd == 'bbwarn':
|
||||
bb.warn(value)
|
||||
elif cmd == 'bberror':
|
||||
bb.error(value)
|
||||
elif cmd == 'bbfatal':
|
||||
# The caller will call exit themselves, so bb.error() is
|
||||
# what we want here rather than bb.fatal()
|
||||
bb.error(value)
|
||||
elif cmd == 'bbfatal_log':
|
||||
bb.error(value, forcelog=True)
|
||||
elif cmd == 'bbdebug':
|
||||
splitval = value.split(' ', 1)
|
||||
level = int(splitval[0])
|
||||
value = splitval[1]
|
||||
bb.debug(level, value)
|
||||
else:
|
||||
bb.warn("Unrecognised command '%s' on FIFO" % cmd)
|
||||
fifobuffer = nextmsg
|
||||
else:
|
||||
break
|
||||
|
||||
tempdir = d.getVar('T')
|
||||
fifopath = os.path.join(tempdir, 'fifo.%s' % os.getpid())
|
||||
if os.path.exists(fifopath):
|
||||
os.unlink(fifopath)
|
||||
os.mkfifo(fifopath)
|
||||
with open(fifopath, 'r+b', buffering=0) as fifo:
|
||||
try:
|
||||
bb.debug(2, "Executing shell function %s" % func)
|
||||
|
||||
try:
|
||||
with open(os.devnull, 'r+') as stdin:
|
||||
bb.process.run(cmd, shell=False, stdin=stdin, log=logfile, extrafiles=[(fifo,readfifo)])
|
||||
except bb.process.CmdError:
|
||||
logfn = d.getVar('BB_LOGFILE')
|
||||
raise FuncFailed(func, logfn)
|
||||
finally:
|
||||
os.unlink(fifopath)
|
||||
try:
|
||||
with open(os.devnull, 'r+') as stdin:
|
||||
bb.process.run(cmd, shell=False, stdin=stdin, log=logfile)
|
||||
except bb.process.CmdError:
|
||||
logfn = d.getVar('BB_LOGFILE', True)
|
||||
raise FuncFailed(func, logfn)
|
||||
|
||||
bb.debug(2, "Shell function %s finished" % func)
|
||||
|
||||
@@ -466,7 +341,7 @@ def _exec_task(fn, task, d, quieterr):
|
||||
Execution of a task involves a bit more setup than executing a function,
|
||||
running it with its own local metadata, and with some useful variables set.
|
||||
"""
|
||||
if not d.getVarFlag(task, 'task', False):
|
||||
if not d.getVarFlag(task, 'task'):
|
||||
event.fire(TaskInvalid(task, d), d)
|
||||
logger.error("No such task: %s" % task)
|
||||
return 1
|
||||
@@ -474,29 +349,22 @@ def _exec_task(fn, task, d, quieterr):
|
||||
logger.debug(1, "Executing task %s", task)
|
||||
|
||||
localdata = _task_data(fn, task, d)
|
||||
tempdir = localdata.getVar('T')
|
||||
tempdir = localdata.getVar('T', True)
|
||||
if not tempdir:
|
||||
bb.fatal("T variable not set, unable to build")
|
||||
|
||||
# Change nice level if we're asked to
|
||||
nice = localdata.getVar("BB_TASK_NICE_LEVEL")
|
||||
nice = localdata.getVar("BB_TASK_NICE_LEVEL", True)
|
||||
if nice:
|
||||
curnice = os.nice(0)
|
||||
nice = int(nice) - curnice
|
||||
newnice = os.nice(nice)
|
||||
logger.debug(1, "Renice to %s " % newnice)
|
||||
ionice = localdata.getVar("BB_TASK_IONICE_LEVEL")
|
||||
if ionice:
|
||||
try:
|
||||
cls, prio = ionice.split(".", 1)
|
||||
bb.utils.ioprio_set(os.getpid(), int(cls), int(prio))
|
||||
except:
|
||||
bb.warn("Invalid ionice level %s" % ionice)
|
||||
|
||||
bb.utils.mkdirhier(tempdir)
|
||||
|
||||
# Determine the logfile to generate
|
||||
logfmt = localdata.getVar('BB_LOGFMT') or 'log.{task}.{pid}'
|
||||
logfmt = localdata.getVar('BB_LOGFMT', True) or 'log.{task}.{pid}'
|
||||
logbase = logfmt.format(task=task, pid=os.getpid())
|
||||
|
||||
# Document the order of the tasks...
|
||||
@@ -527,10 +395,7 @@ def _exec_task(fn, task, d, quieterr):
|
||||
self.triggered = False
|
||||
logging.Handler.__init__(self, logging.ERROR)
|
||||
def emit(self, record):
|
||||
if getattr(record, 'forcelog', False):
|
||||
self.triggered = False
|
||||
else:
|
||||
self.triggered = True
|
||||
self.triggered = True
|
||||
|
||||
# Handle logfiles
|
||||
si = open('/dev/null', 'r')
|
||||
@@ -563,36 +428,24 @@ def _exec_task(fn, task, d, quieterr):
|
||||
|
||||
localdata.setVar('BB_LOGFILE', logfn)
|
||||
localdata.setVar('BB_RUNTASK', task)
|
||||
localdata.setVar('BB_TASK_LOGGER', bblogger)
|
||||
|
||||
flags = localdata.getVarFlags(task)
|
||||
|
||||
event.fire(TaskStarted(task, logfn, flags, localdata), localdata)
|
||||
try:
|
||||
try:
|
||||
event.fire(TaskStarted(task, logfn, flags, localdata), localdata)
|
||||
except (bb.BBHandledException, SystemExit):
|
||||
return 1
|
||||
except FuncFailed as exc:
|
||||
for func in (prefuncs or '').split():
|
||||
exec_func(func, localdata)
|
||||
exec_func(task, localdata)
|
||||
for func in (postfuncs or '').split():
|
||||
exec_func(func, localdata)
|
||||
except FuncFailed as exc:
|
||||
if quieterr:
|
||||
event.fire(TaskFailedSilent(task, logfn, localdata), localdata)
|
||||
else:
|
||||
errprinted = errchk.triggered
|
||||
logger.error(str(exc))
|
||||
return 1
|
||||
|
||||
try:
|
||||
for func in (prefuncs or '').split():
|
||||
exec_func(func, localdata)
|
||||
exec_func(task, localdata)
|
||||
for func in (postfuncs or '').split():
|
||||
exec_func(func, localdata)
|
||||
except FuncFailed as exc:
|
||||
if quieterr:
|
||||
event.fire(TaskFailedSilent(task, logfn, localdata), localdata)
|
||||
else:
|
||||
errprinted = errchk.triggered
|
||||
logger.error(str(exc))
|
||||
event.fire(TaskFailed(task, logfn, localdata, errprinted), localdata)
|
||||
return 1
|
||||
except bb.BBHandledException:
|
||||
event.fire(TaskFailed(task, logfn, localdata, True), localdata)
|
||||
return 1
|
||||
event.fire(TaskFailed(task, logfn, localdata, errprinted), localdata)
|
||||
return 1
|
||||
finally:
|
||||
sys.stdout.flush()
|
||||
sys.stderr.flush()
|
||||
@@ -617,7 +470,7 @@ def _exec_task(fn, task, d, quieterr):
|
||||
bb.utils.remove(loglink)
|
||||
event.fire(TaskSucceeded(task, logfn, localdata), localdata)
|
||||
|
||||
if not localdata.getVarFlag(task, 'nostamp', False) and not localdata.getVarFlag(task, 'selfstamp', False):
|
||||
if not localdata.getVarFlag(task, 'nostamp') and not localdata.getVarFlag(task, 'selfstamp'):
|
||||
make_stamp(task, localdata)
|
||||
|
||||
return 0
|
||||
@@ -625,11 +478,11 @@ def _exec_task(fn, task, d, quieterr):
|
||||
def exec_task(fn, task, d, profile = False):
|
||||
try:
|
||||
quieterr = False
|
||||
if d.getVarFlag(task, "quieterrors", False) is not None:
|
||||
if d.getVarFlag(task, "quieterrors") is not None:
|
||||
quieterr = True
|
||||
|
||||
if profile:
|
||||
profname = "profile-%s.log" % (d.getVar("PN") + "-" + task)
|
||||
profname = "profile-%s.log" % (d.getVar("PN", True) + "-" + task)
|
||||
try:
|
||||
import cProfile as profile
|
||||
except:
|
||||
@@ -652,7 +505,7 @@ def exec_task(fn, task, d, profile = False):
|
||||
event.fire(failedevent, d)
|
||||
return 1
|
||||
|
||||
def stamp_internal(taskname, d, file_name, baseonly=False, noextra=False):
|
||||
def stamp_internal(taskname, d, file_name, baseonly=False):
|
||||
"""
|
||||
Internal stamp helper function
|
||||
Makes sure the stamp directory exists
|
||||
@@ -666,17 +519,15 @@ def stamp_internal(taskname, d, file_name, baseonly=False, noextra=False):
|
||||
taskflagname = taskname.replace("_setscene", "")
|
||||
|
||||
if file_name:
|
||||
stamp = d.stamp[file_name]
|
||||
stamp = d.stamp_base[file_name].get(taskflagname) or d.stamp[file_name]
|
||||
extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
|
||||
else:
|
||||
stamp = d.getVar('STAMP')
|
||||
file_name = d.getVar('BB_FILENAME')
|
||||
extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info') or ""
|
||||
stamp = d.getVarFlag(taskflagname, 'stamp-base', True) or d.getVar('STAMP', True)
|
||||
file_name = d.getVar('BB_FILENAME', True)
|
||||
extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
|
||||
|
||||
if baseonly:
|
||||
return stamp
|
||||
if noextra:
|
||||
extrainfo = ""
|
||||
|
||||
if not stamp:
|
||||
return
|
||||
@@ -684,7 +535,7 @@ def stamp_internal(taskname, d, file_name, baseonly=False, noextra=False):
|
||||
stamp = bb.parse.siggen.stampfile(stamp, file_name, taskname, extrainfo)
|
||||
|
||||
stampdir = os.path.dirname(stamp)
|
||||
if cached_mtime_noerror(stampdir) == 0:
|
||||
if bb.parse.cached_mtime_noerror(stampdir) == 0:
|
||||
bb.utils.mkdirhier(stampdir)
|
||||
|
||||
return stamp
|
||||
@@ -702,12 +553,12 @@ def stamp_cleanmask_internal(taskname, d, file_name):
|
||||
taskflagname = taskname.replace("_setscene", "")
|
||||
|
||||
if file_name:
|
||||
stamp = d.stampclean[file_name]
|
||||
stamp = d.stamp_base_clean[file_name].get(taskflagname) or d.stampclean[file_name]
|
||||
extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
|
||||
else:
|
||||
stamp = d.getVar('STAMPCLEAN')
|
||||
file_name = d.getVar('BB_FILENAME')
|
||||
extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info') or ""
|
||||
stamp = d.getVarFlag(taskflagname, 'stamp-base-clean', True) or d.getVar('STAMPCLEAN', True)
|
||||
file_name = d.getVar('BB_FILENAME', True)
|
||||
extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
|
||||
|
||||
if not stamp:
|
||||
return []
|
||||
@@ -725,7 +576,7 @@ def make_stamp(task, d, file_name = None):
|
||||
for mask in cleanmask:
|
||||
for name in glob.glob(mask):
|
||||
# Preserve sigdata files in the stamps directory
|
||||
if "sigdata" in name or "sigbasedata" in name:
|
||||
if "sigdata" in name:
|
||||
continue
|
||||
# Preserve taint files in the stamps directory
|
||||
if name.endswith('.taint'):
|
||||
@@ -743,7 +594,7 @@ def make_stamp(task, d, file_name = None):
|
||||
# as it completes
|
||||
if not task.endswith("_setscene") and task != "do_setscene" and not file_name:
|
||||
stampbase = stamp_internal(task, d, None, True)
|
||||
file_name = d.getVar('BB_FILENAME')
|
||||
file_name = d.getVar('BB_FILENAME', True)
|
||||
bb.parse.siggen.dump_sigtask(file_name, task, stampbase, True)
|
||||
|
||||
def del_stamp(task, d, file_name = None):
|
||||
@@ -765,22 +616,22 @@ def write_taint(task, d, file_name = None):
|
||||
if file_name:
|
||||
taintfn = d.stamp[file_name] + '.' + task + '.taint'
|
||||
else:
|
||||
taintfn = d.getVar('STAMP') + '.' + task + '.taint'
|
||||
taintfn = d.getVar('STAMP', True) + '.' + task + '.taint'
|
||||
bb.utils.mkdirhier(os.path.dirname(taintfn))
|
||||
# The specific content of the taint file is not really important,
|
||||
# we just need it to be random, so a random UUID is used
|
||||
with open(taintfn, 'w') as taintf:
|
||||
taintf.write(str(uuid.uuid4()))
|
||||
|
||||
def stampfile(taskname, d, file_name = None, noextra=False):
|
||||
def stampfile(taskname, d, file_name = None):
|
||||
"""
|
||||
Return the stamp for a given task
|
||||
(d can be a data dict or dataCache)
|
||||
"""
|
||||
return stamp_internal(taskname, d, file_name, noextra=noextra)
|
||||
return stamp_internal(taskname, d, file_name)
|
||||
|
||||
def add_tasks(tasklist, d):
|
||||
task_deps = d.getVar('_task_deps', False)
|
||||
def add_tasks(tasklist, deltasklist, d):
|
||||
task_deps = d.getVar('_task_deps')
|
||||
if not task_deps:
|
||||
task_deps = {}
|
||||
if not 'tasks' in task_deps:
|
||||
@@ -791,6 +642,9 @@ def add_tasks(tasklist, d):
|
||||
for task in tasklist:
|
||||
task = d.expand(task)
|
||||
|
||||
if task in deltasklist:
|
||||
continue
|
||||
|
||||
d.setVarFlag(task, 'task', 1)
|
||||
|
||||
if not task in task_deps['tasks']:
|
||||
@@ -827,12 +681,12 @@ def addtask(task, before, after, d):
|
||||
task = "do_" + task
|
||||
|
||||
d.setVarFlag(task, "task", 1)
|
||||
bbtasks = d.getVar('__BBTASKS', False) or []
|
||||
if task not in bbtasks:
|
||||
bbtasks = d.getVar('__BBTASKS') or []
|
||||
if not task in bbtasks:
|
||||
bbtasks.append(task)
|
||||
d.setVar('__BBTASKS', bbtasks)
|
||||
|
||||
existing = d.getVarFlag(task, "deps", False) or []
|
||||
existing = d.getVarFlag(task, "deps") or []
|
||||
if after is not None:
|
||||
# set up deps for function
|
||||
for entry in after.split():
|
||||
@@ -842,7 +696,7 @@ def addtask(task, before, after, d):
|
||||
if before is not None:
|
||||
# set up things that depend on this func
|
||||
for entry in before.split():
|
||||
existing = d.getVarFlag(entry, "deps", False) or []
|
||||
existing = d.getVarFlag(entry, "deps") or []
|
||||
if task not in existing:
|
||||
d.setVarFlag(entry, "deps", [task] + existing)
|
||||
|
||||
@@ -850,64 +704,8 @@ def deltask(task, d):
|
||||
if task[:3] != "do_":
|
||||
task = "do_" + task
|
||||
|
||||
bbtasks = d.getVar('__BBTASKS', False) or []
|
||||
if task in bbtasks:
|
||||
bbtasks.remove(task)
|
||||
d.delVarFlag(task, 'task')
|
||||
d.setVar('__BBTASKS', bbtasks)
|
||||
bbtasks = d.getVar('__BBDELTASKS') or []
|
||||
if not task in bbtasks:
|
||||
bbtasks.append(task)
|
||||
d.setVar('__BBDELTASKS', bbtasks)
|
||||
|
||||
d.delVarFlag(task, 'deps')
|
||||
for bbtask in d.getVar('__BBTASKS', False) or []:
|
||||
deps = d.getVarFlag(bbtask, 'deps', False) or []
|
||||
if task in deps:
|
||||
deps.remove(task)
|
||||
d.setVarFlag(bbtask, 'deps', deps)
|
||||
|
||||
def preceedtask(task, with_recrdeptasks, d):
|
||||
"""
|
||||
Returns a set of tasks in the current recipe which were specified as
|
||||
precondition by the task itself ("after") or which listed themselves
|
||||
as precondition ("before"). Preceeding tasks specified via the
|
||||
"recrdeptask" are included in the result only if requested. Beware
|
||||
that this may lead to the task itself being listed.
|
||||
"""
|
||||
preceed = set()
|
||||
|
||||
# Ignore tasks which don't exist
|
||||
tasks = d.getVar('__BBTASKS', False)
|
||||
if task not in tasks:
|
||||
return preceed
|
||||
|
||||
preceed.update(d.getVarFlag(task, 'deps') or [])
|
||||
if with_recrdeptasks:
|
||||
recrdeptask = d.getVarFlag(task, 'recrdeptask')
|
||||
if recrdeptask:
|
||||
preceed.update(recrdeptask.split())
|
||||
return preceed
|
||||
|
||||
def tasksbetween(task_start, task_end, d):
|
||||
"""
|
||||
Return the list of tasks between two tasks in the current recipe,
|
||||
where task_start is to start at and task_end is the task to end at
|
||||
(and task_end has a dependency chain back to task_start).
|
||||
"""
|
||||
outtasks = []
|
||||
tasks = list(filter(lambda k: d.getVarFlag(k, "task"), d.keys()))
|
||||
def follow_chain(task, endtask, chain=None):
|
||||
if not chain:
|
||||
chain = []
|
||||
chain.append(task)
|
||||
for othertask in tasks:
|
||||
if othertask == task:
|
||||
continue
|
||||
if task == endtask:
|
||||
for ctask in chain:
|
||||
if ctask not in outtasks:
|
||||
outtasks.append(ctask)
|
||||
else:
|
||||
deps = d.getVarFlag(othertask, 'deps', False)
|
||||
if task in deps:
|
||||
follow_chain(othertask, endtask, chain)
|
||||
chain.pop()
|
||||
follow_chain(task_start, task_end)
|
||||
return outtasks
|
||||
|
||||
@@ -28,16 +28,22 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import pickle
|
||||
from collections import defaultdict
|
||||
import bb.utils
|
||||
|
||||
logger = logging.getLogger("BitBake.Cache")
|
||||
|
||||
__cache_version__ = "151"
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
logger.info("Importing cPickle failed. "
|
||||
"Falling back to a very slow implementation.")
|
||||
|
||||
__cache_version__ = "148"
|
||||
|
||||
def getCacheFile(path, filename, data_hash):
|
||||
return os.path.join(path, filename + "." + data_hash)
|
||||
@@ -71,29 +77,29 @@ class RecipeInfoCommon(object):
|
||||
|
||||
@classmethod
|
||||
def flaglist(cls, flag, varlist, metadata, squash=False):
|
||||
out_dict = dict((var, metadata.getVarFlag(var, flag))
|
||||
out_dict = dict((var, metadata.getVarFlag(var, flag, True))
|
||||
for var in varlist)
|
||||
if squash:
|
||||
return dict((k,v) for (k,v) in out_dict.items() if v)
|
||||
return dict((k,v) for (k,v) in out_dict.iteritems() if v)
|
||||
else:
|
||||
return out_dict
|
||||
|
||||
@classmethod
|
||||
def getvar(cls, var, metadata, expand = True):
|
||||
return metadata.getVar(var, expand) or ''
|
||||
def getvar(cls, var, metadata):
|
||||
return metadata.getVar(var, True) or ''
|
||||
|
||||
|
||||
class CoreRecipeInfo(RecipeInfoCommon):
|
||||
__slots__ = ()
|
||||
|
||||
cachefile = "bb_cache.dat"
|
||||
cachefile = "bb_cache.dat"
|
||||
|
||||
def __init__(self, filename, metadata):
|
||||
def __init__(self, filename, metadata):
|
||||
self.file_depends = metadata.getVar('__depends', False)
|
||||
self.timestamp = bb.parse.cached_mtime(filename)
|
||||
self.variants = self.listvar('__VARIANTS', metadata) + ['']
|
||||
self.appends = self.listvar('__BBAPPEND', metadata)
|
||||
self.nocache = self.getvar('BB_DONT_CACHE', metadata)
|
||||
self.nocache = self.getvar('__BB_DONT_CACHE', metadata)
|
||||
|
||||
self.skipreason = self.getvar('__SKIPPED', metadata)
|
||||
if self.skipreason:
|
||||
@@ -107,7 +113,7 @@ class CoreRecipeInfo(RecipeInfoCommon):
|
||||
|
||||
self.pn = self.getvar('PN', metadata)
|
||||
self.packages = self.listvar('PACKAGES', metadata)
|
||||
if not self.packages:
|
||||
if not self.pn in self.packages:
|
||||
self.packages.append(self.pn)
|
||||
|
||||
self.basetaskhashes = self.taskvar('BB_BASEHASH', self.tasks, metadata)
|
||||
@@ -122,7 +128,9 @@ class CoreRecipeInfo(RecipeInfoCommon):
|
||||
self.defaultpref = self.intvar('DEFAULT_PREFERENCE', metadata)
|
||||
self.not_world = self.getvar('EXCLUDE_FROM_WORLD', metadata)
|
||||
self.stamp = self.getvar('STAMP', metadata)
|
||||
self.stampclean = self.getvar('STAMPCLEAN', metadata)
|
||||
self.stampclean = self.getvar('STAMPCLEAN', metadata)
|
||||
self.stamp_base = self.flaglist('stamp-base', self.tasks, metadata)
|
||||
self.stamp_base_clean = self.flaglist('stamp-base-clean', self.tasks, metadata)
|
||||
self.stamp_extrainfo = self.flaglist('stamp-extra-info', self.tasks, metadata)
|
||||
self.file_checksums = self.flaglist('file-checksums', self.tasks, metadata, True)
|
||||
self.packages_dynamic = self.listvar('PACKAGES_DYNAMIC', metadata)
|
||||
@@ -134,11 +142,10 @@ class CoreRecipeInfo(RecipeInfoCommon):
|
||||
self.rprovides_pkg = self.pkgvar('RPROVIDES', self.packages, metadata)
|
||||
self.rdepends_pkg = self.pkgvar('RDEPENDS', self.packages, metadata)
|
||||
self.rrecommends_pkg = self.pkgvar('RRECOMMENDS', self.packages, metadata)
|
||||
self.inherits = self.getvar('__inherit_cache', metadata, expand=False)
|
||||
self.inherits = self.getvar('__inherit_cache', metadata)
|
||||
self.fakerootenv = self.getvar('FAKEROOTENV', metadata)
|
||||
self.fakerootdirs = self.getvar('FAKEROOTDIRS', metadata)
|
||||
self.fakerootnoenv = self.getvar('FAKEROOTNOENV', metadata)
|
||||
self.extradepsfunc = self.getvar('calculate_extra_depends', metadata)
|
||||
|
||||
@classmethod
|
||||
def init_cacheData(cls, cachedata):
|
||||
@@ -151,6 +158,8 @@ class CoreRecipeInfo(RecipeInfoCommon):
|
||||
|
||||
cachedata.stamp = {}
|
||||
cachedata.stampclean = {}
|
||||
cachedata.stamp_base = {}
|
||||
cachedata.stamp_base_clean = {}
|
||||
cachedata.stamp_extrainfo = {}
|
||||
cachedata.file_checksums = {}
|
||||
cachedata.fn_provides = {}
|
||||
@@ -174,7 +183,6 @@ class CoreRecipeInfo(RecipeInfoCommon):
|
||||
cachedata.fakerootenv = {}
|
||||
cachedata.fakerootnoenv = {}
|
||||
cachedata.fakerootdirs = {}
|
||||
cachedata.extradepsfunc = {}
|
||||
|
||||
def add_cacheData(self, cachedata, fn):
|
||||
cachedata.task_deps[fn] = self.task_deps
|
||||
@@ -184,6 +192,8 @@ class CoreRecipeInfo(RecipeInfoCommon):
|
||||
cachedata.pkg_dp[fn] = self.defaultpref
|
||||
cachedata.stamp[fn] = self.stamp
|
||||
cachedata.stampclean[fn] = self.stampclean
|
||||
cachedata.stamp_base[fn] = self.stamp_base
|
||||
cachedata.stamp_base_clean[fn] = self.stamp_base_clean
|
||||
cachedata.stamp_extrainfo[fn] = self.stamp_extrainfo
|
||||
cachedata.file_checksums[fn] = self.file_checksums
|
||||
|
||||
@@ -210,14 +220,13 @@ class CoreRecipeInfo(RecipeInfoCommon):
|
||||
rprovides += self.rprovides_pkg[package]
|
||||
|
||||
for rprovide in rprovides:
|
||||
if fn not in cachedata.rproviders[rprovide]:
|
||||
cachedata.rproviders[rprovide].append(fn)
|
||||
cachedata.rproviders[rprovide].append(fn)
|
||||
|
||||
for package in self.packages_dynamic:
|
||||
cachedata.packages_dynamic[package].append(fn)
|
||||
|
||||
# Build hash of runtime depends and recommends
|
||||
for package in self.packages:
|
||||
for package in self.packages + [self.pn]:
|
||||
cachedata.rundeps[fn][package] = list(self.rdepends) + self.rdepends_pkg[package]
|
||||
cachedata.runrecs[fn][package] = list(self.rrecommends) + self.rrecommends_pkg[package]
|
||||
|
||||
@@ -234,7 +243,7 @@ class CoreRecipeInfo(RecipeInfoCommon):
|
||||
cachedata.universe_target.append(self.pn)
|
||||
|
||||
cachedata.hashfn[fn] = self.hashfilename
|
||||
for task, taskhash in self.basetaskhashes.items():
|
||||
for task, taskhash in self.basetaskhashes.iteritems():
|
||||
identifier = '%s.%s' % (fn, task)
|
||||
cachedata.basetaskhash[identifier] = taskhash
|
||||
|
||||
@@ -242,146 +251,24 @@ class CoreRecipeInfo(RecipeInfoCommon):
|
||||
cachedata.fakerootenv[fn] = self.fakerootenv
|
||||
cachedata.fakerootnoenv[fn] = self.fakerootnoenv
|
||||
cachedata.fakerootdirs[fn] = self.fakerootdirs
|
||||
cachedata.extradepsfunc[fn] = self.extradepsfunc
|
||||
|
||||
def virtualfn2realfn(virtualfn):
|
||||
"""
|
||||
Convert a virtual file name to a real one + the associated subclass keyword
|
||||
"""
|
||||
mc = ""
|
||||
if virtualfn.startswith('multiconfig:'):
|
||||
elems = virtualfn.split(':')
|
||||
mc = elems[1]
|
||||
virtualfn = ":".join(elems[2:])
|
||||
|
||||
fn = virtualfn
|
||||
cls = ""
|
||||
if virtualfn.startswith('virtual:'):
|
||||
elems = virtualfn.split(':')
|
||||
cls = ":".join(elems[1:-1])
|
||||
fn = elems[-1]
|
||||
|
||||
return (fn, cls, mc)
|
||||
|
||||
def realfn2virtual(realfn, cls, mc):
|
||||
"""
|
||||
Convert a real filename + the associated subclass keyword to a virtual filename
|
||||
"""
|
||||
if cls:
|
||||
realfn = "virtual:" + cls + ":" + realfn
|
||||
if mc:
|
||||
realfn = "multiconfig:" + mc + ":" + realfn
|
||||
return realfn
|
||||
|
||||
def variant2virtual(realfn, variant):
|
||||
"""
|
||||
Convert a real filename + the associated subclass keyword to a virtual filename
|
||||
"""
|
||||
if variant == "":
|
||||
return realfn
|
||||
if variant.startswith("multiconfig:"):
|
||||
elems = variant.split(":")
|
||||
if elems[2]:
|
||||
return "multiconfig:" + elems[1] + ":virtual:" + ":".join(elems[2:]) + ":" + realfn
|
||||
return "multiconfig:" + elems[1] + ":" + realfn
|
||||
return "virtual:" + variant + ":" + realfn
|
||||
|
||||
def parse_recipe(bb_data, bbfile, appends, mc=''):
|
||||
"""
|
||||
Parse a recipe
|
||||
"""
|
||||
|
||||
chdir_back = False
|
||||
|
||||
bb_data.setVar("__BBMULTICONFIG", mc)
|
||||
|
||||
# expand tmpdir to include this topdir
|
||||
bb_data.setVar('TMPDIR', bb_data.getVar('TMPDIR') or "")
|
||||
bbfile_loc = os.path.abspath(os.path.dirname(bbfile))
|
||||
oldpath = os.path.abspath(os.getcwd())
|
||||
bb.parse.cached_mtime_noerror(bbfile_loc)
|
||||
|
||||
# The ConfHandler first looks if there is a TOPDIR and if not
|
||||
# then it would call getcwd().
|
||||
# Previously, we chdir()ed to bbfile_loc, called the handler
|
||||
# and finally chdir()ed back, a couple of thousand times. We now
|
||||
# just fill in TOPDIR to point to bbfile_loc if there is no TOPDIR yet.
|
||||
if not bb_data.getVar('TOPDIR', False):
|
||||
chdir_back = True
|
||||
bb_data.setVar('TOPDIR', bbfile_loc)
|
||||
try:
|
||||
if appends:
|
||||
bb_data.setVar('__BBAPPEND', " ".join(appends))
|
||||
bb_data = bb.parse.handle(bbfile, bb_data)
|
||||
if chdir_back:
|
||||
os.chdir(oldpath)
|
||||
return bb_data
|
||||
except:
|
||||
if chdir_back:
|
||||
os.chdir(oldpath)
|
||||
raise
|
||||
|
||||
|
||||
|
||||
class NoCache(object):
|
||||
|
||||
def __init__(self, databuilder):
|
||||
self.databuilder = databuilder
|
||||
self.data = databuilder.data
|
||||
|
||||
def loadDataFull(self, virtualfn, appends):
|
||||
"""
|
||||
Return a complete set of data for fn.
|
||||
To do this, we need to parse the file.
|
||||
"""
|
||||
logger.debug(1, "Parsing %s (full)" % virtualfn)
|
||||
(fn, virtual, mc) = virtualfn2realfn(virtualfn)
|
||||
bb_data = self.load_bbfile(virtualfn, appends, virtonly=True)
|
||||
return bb_data[virtual]
|
||||
|
||||
def load_bbfile(self, bbfile, appends, virtonly = False):
|
||||
"""
|
||||
Load and parse one .bb build file
|
||||
Return the data and whether parsing resulted in the file being skipped
|
||||
"""
|
||||
|
||||
if virtonly:
|
||||
(bbfile, virtual, mc) = virtualfn2realfn(bbfile)
|
||||
bb_data = self.databuilder.mcdata[mc].createCopy()
|
||||
bb_data.setVar("__ONLYFINALISE", virtual or "default")
|
||||
datastores = parse_recipe(bb_data, bbfile, appends, mc)
|
||||
return datastores
|
||||
|
||||
bb_data = self.data.createCopy()
|
||||
datastores = parse_recipe(bb_data, bbfile, appends)
|
||||
|
||||
for mc in self.databuilder.mcdata:
|
||||
if not mc:
|
||||
continue
|
||||
bb_data = self.databuilder.mcdata[mc].createCopy()
|
||||
newstores = parse_recipe(bb_data, bbfile, appends, mc)
|
||||
for ns in newstores:
|
||||
datastores["multiconfig:%s:%s" % (mc, ns)] = newstores[ns]
|
||||
|
||||
return datastores
|
||||
|
||||
class Cache(NoCache):
|
||||
class Cache(object):
|
||||
"""
|
||||
BitBake Cache implementation
|
||||
"""
|
||||
|
||||
def __init__(self, databuilder, data_hash, caches_array):
|
||||
super().__init__(databuilder)
|
||||
data = databuilder.data
|
||||
|
||||
def __init__(self, data, data_hash, caches_array):
|
||||
# Pass caches_array information into Cache Constructor
|
||||
# It will be used later for deciding whether we
|
||||
# need extra cache file dump/load support
|
||||
# It will be used later for deciding whether we
|
||||
# need extra cache file dump/load support
|
||||
self.caches_array = caches_array
|
||||
self.cachedir = data.getVar("CACHE")
|
||||
self.cachedir = data.getVar("CACHE", True)
|
||||
self.clean = set()
|
||||
self.checked = set()
|
||||
self.depends_cache = {}
|
||||
self.data = None
|
||||
self.data_fn = None
|
||||
self.cacheclean = True
|
||||
self.data_hash = data_hash
|
||||
@@ -395,87 +282,78 @@ class Cache(NoCache):
|
||||
self.has_cache = True
|
||||
self.cachefile = getCacheFile(self.cachedir, "bb_cache.dat", self.data_hash)
|
||||
|
||||
logger.debug(1, "Cache dir: %s", self.cachedir)
|
||||
logger.debug(1, "Using cache in '%s'", self.cachedir)
|
||||
bb.utils.mkdirhier(self.cachedir)
|
||||
|
||||
cache_ok = True
|
||||
if self.caches_array:
|
||||
for cache_class in self.caches_array:
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
cache_ok = cache_ok and os.path.exists(cachefile)
|
||||
cache_class.init_cacheData(self)
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
cache_ok = cache_ok and os.path.exists(cachefile)
|
||||
cache_class.init_cacheData(self)
|
||||
if cache_ok:
|
||||
self.load_cachefile()
|
||||
elif os.path.isfile(self.cachefile):
|
||||
logger.info("Out of date cache found, rebuilding...")
|
||||
else:
|
||||
logger.debug(1, "Cache file %s not found, building..." % self.cachefile)
|
||||
|
||||
def load_cachefile(self):
|
||||
# Firstly, using core cache file information for
|
||||
# valid checking
|
||||
with open(self.cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
try:
|
||||
cache_ver = pickled.load()
|
||||
bitbake_ver = pickled.load()
|
||||
except Exception:
|
||||
logger.info('Invalid cache, rebuilding...')
|
||||
return
|
||||
|
||||
if cache_ver != __cache_version__:
|
||||
logger.info('Cache version mismatch, rebuilding...')
|
||||
return
|
||||
elif bitbake_ver != bb.__version__:
|
||||
logger.info('Bitbake version mismatch, rebuilding...')
|
||||
return
|
||||
|
||||
|
||||
cachesize = 0
|
||||
previous_progress = 0
|
||||
previous_percent = 0
|
||||
|
||||
# Calculate the correct cachesize of all those cache files
|
||||
for cache_class in self.caches_array:
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
cachesize += os.fstat(cachefile.fileno()).st_size
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
cachesize += os.fstat(cachefile.fileno()).st_size
|
||||
|
||||
bb.event.fire(bb.event.CacheLoadStarted(cachesize), self.data)
|
||||
|
||||
|
||||
for cache_class in self.caches_array:
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
logger.debug(1, 'Loading cache file: %s' % cachefile)
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
# Check cache version information
|
||||
try:
|
||||
cache_ver = pickled.load()
|
||||
bitbake_ver = pickled.load()
|
||||
except Exception:
|
||||
logger.info('Invalid cache, rebuilding...')
|
||||
return
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
with open(cachefile, "rb") as cachefile:
|
||||
pickled = pickle.Unpickler(cachefile)
|
||||
while cachefile:
|
||||
try:
|
||||
key = pickled.load()
|
||||
value = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
if self.depends_cache.has_key(key):
|
||||
self.depends_cache[key].append(value)
|
||||
else:
|
||||
self.depends_cache[key] = [value]
|
||||
# only fire events on even percentage boundaries
|
||||
current_progress = cachefile.tell() + previous_progress
|
||||
current_percent = 100 * current_progress / cachesize
|
||||
if current_percent > previous_percent:
|
||||
previous_percent = current_percent
|
||||
bb.event.fire(bb.event.CacheLoadProgress(current_progress, cachesize),
|
||||
self.data)
|
||||
|
||||
if cache_ver != __cache_version__:
|
||||
logger.info('Cache version mismatch, rebuilding...')
|
||||
return
|
||||
elif bitbake_ver != bb.__version__:
|
||||
logger.info('Bitbake version mismatch, rebuilding...')
|
||||
return
|
||||
|
||||
# Load the rest of the cache file
|
||||
current_progress = 0
|
||||
while cachefile:
|
||||
try:
|
||||
key = pickled.load()
|
||||
value = pickled.load()
|
||||
except Exception:
|
||||
break
|
||||
if not isinstance(key, str):
|
||||
bb.warn("%s from extras cache is not a string?" % key)
|
||||
break
|
||||
if not isinstance(value, RecipeInfoCommon):
|
||||
bb.warn("%s from extras cache is not a RecipeInfoCommon class?" % value)
|
||||
break
|
||||
|
||||
if key in self.depends_cache:
|
||||
self.depends_cache[key].append(value)
|
||||
else:
|
||||
self.depends_cache[key] = [value]
|
||||
# only fire events on even percentage boundaries
|
||||
current_progress = cachefile.tell() + previous_progress
|
||||
if current_progress > cachesize:
|
||||
# we might have calculated incorrect total size because a file
|
||||
# might've been written out just after we checked its size
|
||||
cachesize = current_progress
|
||||
current_percent = 100 * current_progress / cachesize
|
||||
if current_percent > previous_percent:
|
||||
previous_percent = current_percent
|
||||
bb.event.fire(bb.event.CacheLoadProgress(current_progress, cachesize),
|
||||
self.data)
|
||||
|
||||
previous_progress += current_progress
|
||||
previous_progress += current_progress
|
||||
|
||||
# Note: depends cache number is corresponding to the parsing file numbers.
|
||||
# The same file has several caches, still regarded as one item in the cache
|
||||
@@ -483,33 +361,69 @@ class Cache(NoCache):
|
||||
len(self.depends_cache)),
|
||||
self.data)
|
||||
|
||||
def parse(self, filename, appends):
|
||||
|
||||
@staticmethod
|
||||
def virtualfn2realfn(virtualfn):
|
||||
"""
|
||||
Convert a virtual file name to a real one + the associated subclass keyword
|
||||
"""
|
||||
|
||||
fn = virtualfn
|
||||
cls = ""
|
||||
if virtualfn.startswith('virtual:'):
|
||||
elems = virtualfn.split(':')
|
||||
cls = ":".join(elems[1:-1])
|
||||
fn = elems[-1]
|
||||
return (fn, cls)
|
||||
|
||||
@staticmethod
|
||||
def realfn2virtual(realfn, cls):
|
||||
"""
|
||||
Convert a real filename + the associated subclass keyword to a virtual filename
|
||||
"""
|
||||
if cls == "":
|
||||
return realfn
|
||||
return "virtual:" + cls + ":" + realfn
|
||||
|
||||
@classmethod
|
||||
def loadDataFull(cls, virtualfn, appends, cfgData):
|
||||
"""
|
||||
Return a complete set of data for fn.
|
||||
To do this, we need to parse the file.
|
||||
"""
|
||||
|
||||
(fn, virtual) = cls.virtualfn2realfn(virtualfn)
|
||||
|
||||
logger.debug(1, "Parsing %s (full)", fn)
|
||||
|
||||
cfgData.setVar("__ONLYFINALISE", virtual or "default")
|
||||
bb_data = cls.load_bbfile(fn, appends, cfgData)
|
||||
return bb_data[virtual]
|
||||
|
||||
@classmethod
|
||||
def parse(cls, filename, appends, configdata, caches_array):
|
||||
"""Parse the specified filename, returning the recipe information"""
|
||||
logger.debug(1, "Parsing %s", filename)
|
||||
infos = []
|
||||
datastores = self.load_bbfile(filename, appends)
|
||||
datastores = cls.load_bbfile(filename, appends, configdata)
|
||||
depends = []
|
||||
variants = []
|
||||
# Process the "real" fn last so we can store variants list
|
||||
for variant, data in sorted(datastores.items(),
|
||||
for variant, data in sorted(datastores.iteritems(),
|
||||
key=lambda i: i[0],
|
||||
reverse=True):
|
||||
virtualfn = variant2virtual(filename, variant)
|
||||
variants.append(variant)
|
||||
virtualfn = cls.realfn2virtual(filename, variant)
|
||||
depends = depends + (data.getVar("__depends", False) or [])
|
||||
if depends and not variant:
|
||||
data.setVar("__depends", depends)
|
||||
if virtualfn == filename:
|
||||
data.setVar("__VARIANTS", " ".join(variants))
|
||||
|
||||
info_array = []
|
||||
for cache_class in self.caches_array:
|
||||
info = cache_class(filename, data)
|
||||
info_array.append(info)
|
||||
for cache_class in caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
info = cache_class(filename, data)
|
||||
info_array.append(info)
|
||||
infos.append((virtualfn, info_array))
|
||||
|
||||
return infos
|
||||
|
||||
def load(self, filename, appends):
|
||||
def load(self, filename, appends, configdata):
|
||||
"""Obtain the recipe information for the specified filename,
|
||||
using cached values if available, otherwise parsing.
|
||||
|
||||
@@ -523,20 +437,21 @@ class Cache(NoCache):
|
||||
# info_array item is a list of [CoreRecipeInfo, XXXRecipeInfo]
|
||||
info_array = self.depends_cache[filename]
|
||||
for variant in info_array[0].variants:
|
||||
virtualfn = variant2virtual(filename, variant)
|
||||
virtualfn = self.realfn2virtual(filename, variant)
|
||||
infos.append((virtualfn, self.depends_cache[virtualfn]))
|
||||
else:
|
||||
logger.debug(1, "Parsing %s", filename)
|
||||
return self.parse(filename, appends, configdata, self.caches_array)
|
||||
|
||||
return cached, infos
|
||||
|
||||
def loadData(self, fn, appends, cacheData):
|
||||
def loadData(self, fn, appends, cfgData, cacheData):
|
||||
"""Load the recipe info for the specified filename,
|
||||
parsing and adding to the cache if necessary, and adding
|
||||
the recipe information to the supplied CacheData instance."""
|
||||
skipped, virtuals = 0, 0
|
||||
|
||||
cached, infos = self.load(fn, appends)
|
||||
cached, infos = self.load(fn, appends, cfgData)
|
||||
for virtualfn, info_array in infos:
|
||||
if info_array[0].skipped:
|
||||
logger.debug(1, "Skipping %s: %s", virtualfn, info_array[0].skipreason)
|
||||
@@ -613,20 +528,7 @@ class Cache(NoCache):
|
||||
|
||||
if hasattr(info_array[0], 'file_checksums'):
|
||||
for _, fl in info_array[0].file_checksums.items():
|
||||
fl = fl.strip()
|
||||
while fl:
|
||||
# A .split() would be simpler but means spaces or colons in filenames would break
|
||||
a = fl.find(":True")
|
||||
b = fl.find(":False")
|
||||
if ((a < 0) and b) or ((b > 0) and (b < a)):
|
||||
f = fl[:b+6]
|
||||
fl = fl[b+7:]
|
||||
elif ((b < 0) and a) or ((a > 0) and (a < b)):
|
||||
f = fl[:a+5]
|
||||
fl = fl[a+6:]
|
||||
else:
|
||||
break
|
||||
fl = fl.strip()
|
||||
for f in fl.split():
|
||||
if "*" in f:
|
||||
continue
|
||||
f, exist = f.split(":")
|
||||
@@ -644,19 +546,16 @@ class Cache(NoCache):
|
||||
|
||||
invalid = False
|
||||
for cls in info_array[0].variants:
|
||||
virtualfn = variant2virtual(fn, cls)
|
||||
virtualfn = self.realfn2virtual(fn, cls)
|
||||
self.clean.add(virtualfn)
|
||||
if virtualfn not in self.depends_cache:
|
||||
logger.debug(2, "Cache: %s is not cached", virtualfn)
|
||||
invalid = True
|
||||
elif len(self.depends_cache[virtualfn]) != len(self.caches_array):
|
||||
logger.debug(2, "Cache: Extra caches missing for %s?" % virtualfn)
|
||||
invalid = True
|
||||
|
||||
# If any one of the variants is not present, mark as invalid for all
|
||||
if invalid:
|
||||
for cls in info_array[0].variants:
|
||||
virtualfn = variant2virtual(fn, cls)
|
||||
virtualfn = self.realfn2virtual(fn, cls)
|
||||
if virtualfn in self.clean:
|
||||
logger.debug(2, "Cache: Removing %s from cache", virtualfn)
|
||||
self.clean.remove(virtualfn)
|
||||
@@ -693,19 +592,30 @@ class Cache(NoCache):
|
||||
logger.debug(2, "Cache is clean, not saving.")
|
||||
return
|
||||
|
||||
file_dict = {}
|
||||
pickler_dict = {}
|
||||
for cache_class in self.caches_array:
|
||||
cache_class_name = cache_class.__name__
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
with open(cachefile, "wb") as f:
|
||||
p = pickle.Pickler(f, pickle.HIGHEST_PROTOCOL)
|
||||
p.dump(__cache_version__)
|
||||
p.dump(bb.__version__)
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cache_class_name = cache_class.__name__
|
||||
cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
|
||||
file_dict[cache_class_name] = open(cachefile, "wb")
|
||||
pickler_dict[cache_class_name] = pickle.Pickler(file_dict[cache_class_name], pickle.HIGHEST_PROTOCOL)
|
||||
|
||||
pickler_dict['CoreRecipeInfo'].dump(__cache_version__)
|
||||
pickler_dict['CoreRecipeInfo'].dump(bb.__version__)
|
||||
|
||||
for key, info_array in self.depends_cache.items():
|
||||
for info in info_array:
|
||||
if isinstance(info, RecipeInfoCommon) and info.__class__.__name__ == cache_class_name:
|
||||
p.dump(key)
|
||||
p.dump(info)
|
||||
try:
|
||||
for key, info_array in self.depends_cache.iteritems():
|
||||
for info in info_array:
|
||||
if isinstance(info, RecipeInfoCommon):
|
||||
cache_class_name = info.__class__.__name__
|
||||
pickler_dict[cache_class_name].dump(key)
|
||||
pickler_dict[cache_class_name].dump(info)
|
||||
finally:
|
||||
for cache_class in self.caches_array:
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cache_class_name = cache_class.__name__
|
||||
file_dict[cache_class_name].close()
|
||||
|
||||
del self.depends_cache
|
||||
|
||||
@@ -733,13 +643,50 @@ class Cache(NoCache):
|
||||
Save data we need into the cache
|
||||
"""
|
||||
|
||||
realfn = virtualfn2realfn(file_name)[0]
|
||||
realfn = self.virtualfn2realfn(file_name)[0]
|
||||
|
||||
info_array = []
|
||||
for cache_class in self.caches_array:
|
||||
info_array.append(cache_class(realfn, data))
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
info_array.append(cache_class(realfn, data))
|
||||
self.add_info(file_name, info_array, cacheData, parsed)
|
||||
|
||||
@staticmethod
|
||||
def load_bbfile(bbfile, appends, config):
|
||||
"""
|
||||
Load and parse one .bb build file
|
||||
Return the data and whether parsing resulted in the file being skipped
|
||||
"""
|
||||
chdir_back = False
|
||||
|
||||
from bb import data, parse
|
||||
|
||||
# expand tmpdir to include this topdir
|
||||
data.setVar('TMPDIR', data.getVar('TMPDIR', config, 1) or "", config)
|
||||
bbfile_loc = os.path.abspath(os.path.dirname(bbfile))
|
||||
oldpath = os.path.abspath(os.getcwd())
|
||||
parse.cached_mtime_noerror(bbfile_loc)
|
||||
bb_data = data.init_db(config)
|
||||
# The ConfHandler first looks if there is a TOPDIR and if not
|
||||
# then it would call getcwd().
|
||||
# Previously, we chdir()ed to bbfile_loc, called the handler
|
||||
# and finally chdir()ed back, a couple of thousand times. We now
|
||||
# just fill in TOPDIR to point to bbfile_loc if there is no TOPDIR yet.
|
||||
if not data.getVar('TOPDIR', bb_data):
|
||||
chdir_back = True
|
||||
data.setVar('TOPDIR', bbfile_loc, bb_data)
|
||||
try:
|
||||
if appends:
|
||||
data.setVar('__BBAPPEND', " ".join(appends), bb_data)
|
||||
bb_data = parse.handle(bbfile, bb_data)
|
||||
if chdir_back:
|
||||
os.chdir(oldpath)
|
||||
return bb_data
|
||||
except:
|
||||
if chdir_back:
|
||||
os.chdir(oldpath)
|
||||
raise
|
||||
|
||||
|
||||
def init(cooker):
|
||||
"""
|
||||
@@ -769,9 +716,8 @@ class CacheData(object):
|
||||
def __init__(self, caches_array):
|
||||
self.caches_array = caches_array
|
||||
for cache_class in self.caches_array:
|
||||
if not issubclass(cache_class, RecipeInfoCommon):
|
||||
bb.error("Extra cache data class %s should subclass RecipeInfoCommon class" % cache_class)
|
||||
cache_class.init_cacheData(self)
|
||||
if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
|
||||
cache_class.init_cacheData(self)
|
||||
|
||||
# Direct cache variables
|
||||
self.task_queues = {}
|
||||
@@ -798,14 +744,13 @@ class MultiProcessCache(object):
|
||||
self.cachedata = self.create_cachedata()
|
||||
self.cachedata_extras = self.create_cachedata()
|
||||
|
||||
def init_cache(self, d, cache_file_name=None):
|
||||
cachedir = (d.getVar("PERSISTENT_DIR") or
|
||||
d.getVar("CACHE"))
|
||||
def init_cache(self, d):
|
||||
cachedir = (d.getVar("PERSISTENT_DIR", True) or
|
||||
d.getVar("CACHE", True))
|
||||
if cachedir in [None, '']:
|
||||
return
|
||||
bb.utils.mkdirhier(cachedir)
|
||||
self.cachefile = os.path.join(cachedir,
|
||||
cache_file_name or self.__class__.cache_file_name)
|
||||
self.cachefile = os.path.join(cachedir, self.__class__.cache_file_name)
|
||||
logger.debug(1, "Using cache in '%s'", self.cachefile)
|
||||
|
||||
glf = bb.utils.lockfile(self.cachefile + ".lock")
|
||||
@@ -829,7 +774,7 @@ class MultiProcessCache(object):
|
||||
data = [{}]
|
||||
return data
|
||||
|
||||
def save_extras(self):
|
||||
def save_extras(self, d):
|
||||
if not self.cachefile:
|
||||
return
|
||||
|
||||
@@ -859,7 +804,7 @@ class MultiProcessCache(object):
|
||||
if h not in dest[j]:
|
||||
dest[j][h] = source[j][h]
|
||||
|
||||
def save_merge(self):
|
||||
def save_merge(self, d):
|
||||
if not self.cachefile:
|
||||
return
|
||||
|
||||
@@ -889,3 +834,4 @@ class MultiProcessCache(object):
|
||||
p.dump([data, self.__class__.CACHE_VERSION])
|
||||
|
||||
bb.utils.unlockfile(glf)
|
||||
|
||||
|
||||
@@ -15,17 +15,22 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import glob
|
||||
import operator
|
||||
import os
|
||||
import stat
|
||||
import pickle
|
||||
import bb.utils
|
||||
import logging
|
||||
from bb.cache import MultiProcessCache
|
||||
|
||||
logger = logging.getLogger("BitBake.Cache")
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
logger.info("Importing cPickle failed. "
|
||||
"Falling back to a very slow implementation.")
|
||||
|
||||
|
||||
# mtime cache (non-persistent)
|
||||
# based upon the assumption that files do not change during bitbake run
|
||||
class FileMtimeCache(object):
|
||||
@@ -83,54 +88,3 @@ class FileChecksumCache(MultiProcessCache):
|
||||
dest[0][h] = source[0][h]
|
||||
else:
|
||||
dest[0][h] = source[0][h]
|
||||
|
||||
def get_checksums(self, filelist, pn):
|
||||
"""Get checksums for a list of files"""
|
||||
|
||||
def checksum_file(f):
|
||||
try:
|
||||
checksum = self.get_checksum(f)
|
||||
except OSError as e:
|
||||
bb.warn("Unable to get checksum for %s SRC_URI entry %s: %s" % (pn, os.path.basename(f), e))
|
||||
return None
|
||||
return checksum
|
||||
|
||||
def checksum_dir(pth):
|
||||
# Handle directories recursively
|
||||
if pth == "/":
|
||||
bb.fatal("Refusing to checksum /")
|
||||
dirchecksums = []
|
||||
for root, dirs, files in os.walk(pth):
|
||||
for name in files:
|
||||
fullpth = os.path.join(root, name)
|
||||
checksum = checksum_file(fullpth)
|
||||
if checksum:
|
||||
dirchecksums.append((fullpth, checksum))
|
||||
return dirchecksums
|
||||
|
||||
checksums = []
|
||||
for pth in filelist.split():
|
||||
exist = pth.split(":")[1]
|
||||
if exist == "False":
|
||||
continue
|
||||
pth = pth.split(":")[0]
|
||||
if '*' in pth:
|
||||
# Handle globs
|
||||
for f in glob.glob(pth):
|
||||
if os.path.isdir(f):
|
||||
if not os.path.islink(f):
|
||||
checksums.extend(checksum_dir(f))
|
||||
else:
|
||||
checksum = checksum_file(f)
|
||||
if checksum:
|
||||
checksums.append((f, checksum))
|
||||
elif os.path.isdir(pth):
|
||||
if not os.path.islink(pth):
|
||||
checksums.extend(checksum_dir(pth))
|
||||
else:
|
||||
checksum = checksum_file(pth)
|
||||
if checksum:
|
||||
checksums.append((pth, checksum))
|
||||
|
||||
checksums.sort(key=operator.itemgetter(1))
|
||||
return checksums
|
||||
|
||||
@@ -1,39 +1,21 @@
|
||||
"""
|
||||
BitBake code parser
|
||||
|
||||
Parses actual code (i.e. python and shell) for functions and in-line
|
||||
expressions. Used mainly to determine dependencies on other functions
|
||||
and variables within the BitBake metadata. Also provides a cache for
|
||||
this information in order to speed up processing.
|
||||
|
||||
(Not to be confused with the code that parses the metadata itself,
|
||||
see lib/bb/parse/ for that).
|
||||
|
||||
NOTE: if you change how the parsers gather information you will almost
|
||||
certainly need to increment CodeParserCache.CACHE_VERSION below so that
|
||||
any existing codeparser cache gets invalidated. Additionally you'll need
|
||||
to increment __cache_version__ in cache.py in order to ensure that old
|
||||
recipe caches don't trigger "Taskhash mismatch" errors.
|
||||
|
||||
"""
|
||||
|
||||
import ast
|
||||
import sys
|
||||
import codegen
|
||||
import logging
|
||||
import pickle
|
||||
import bb.pysh as pysh
|
||||
import os.path
|
||||
import bb.utils, bb.data
|
||||
import hashlib
|
||||
from itertools import chain
|
||||
from bb.pysh import pyshyacc, pyshlex, sherrors
|
||||
from pysh import pyshyacc, pyshlex, sherrors
|
||||
from bb.cache import MultiProcessCache
|
||||
|
||||
|
||||
logger = logging.getLogger('BitBake.CodeParser')
|
||||
|
||||
def bbhash(s):
|
||||
return hashlib.md5(s.encode("utf-8")).hexdigest()
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
logger.info('Importing cPickle failed. Falling back to a very slow implementation.')
|
||||
|
||||
|
||||
def check_indent(codestr):
|
||||
"""If the code is indented, add a top level piece of code to 'remove' the indentation"""
|
||||
@@ -46,10 +28,6 @@ def check_indent(codestr):
|
||||
return codestr
|
||||
|
||||
if codestr[i-1] == "\t" or codestr[i-1] == " ":
|
||||
if codestr[0] == "\n":
|
||||
# Since we're adding a line, we need to remove one line of any empty padding
|
||||
# to ensure line numbers are correct
|
||||
codestr = codestr[1:]
|
||||
return "if 1:\n" + codestr
|
||||
|
||||
return codestr
|
||||
@@ -86,12 +64,11 @@ class SetCache(object):
|
||||
|
||||
new = []
|
||||
for i in items:
|
||||
new.append(sys.intern(i))
|
||||
new.append(intern(i))
|
||||
s = frozenset(new)
|
||||
h = hash(s)
|
||||
if h in self.setcache:
|
||||
return self.setcache[h]
|
||||
self.setcache[h] = s
|
||||
if hash(s) in self.setcache:
|
||||
return self.setcache[hash(s)]
|
||||
self.setcache[hash(s)] = s
|
||||
return s
|
||||
|
||||
codecache = SetCache()
|
||||
@@ -115,9 +92,6 @@ class pythonCacheLine(object):
|
||||
for c in sorted(self.contains.keys()):
|
||||
l = l + (c, hash(self.contains[c]))
|
||||
return hash(l)
|
||||
def __repr__(self):
|
||||
return " ".join([str(self.refs), str(self.execs), str(self.contains)])
|
||||
|
||||
|
||||
class shellCacheLine(object):
|
||||
def __init__(self, execs):
|
||||
@@ -131,16 +105,10 @@ class shellCacheLine(object):
|
||||
self.__init__(execs)
|
||||
def __hash__(self):
|
||||
return hash(self.execs)
|
||||
def __repr__(self):
|
||||
return str(self.execs)
|
||||
|
||||
class CodeParserCache(MultiProcessCache):
|
||||
cache_file_name = "bb_codeparser.dat"
|
||||
# NOTE: you must increment this if you change how the parsers gather information,
|
||||
# so that an existing cache gets invalidated. Additionally you'll need
|
||||
# to increment __cache_version__ in cache.py in order to ensure that old
|
||||
# recipe caches don't trigger "Taskhash mismatch" errors.
|
||||
CACHE_VERSION = 9
|
||||
CACHE_VERSION = 7
|
||||
|
||||
def __init__(self):
|
||||
MultiProcessCache.__init__(self)
|
||||
@@ -171,10 +139,6 @@ class CodeParserCache(MultiProcessCache):
|
||||
return cacheline
|
||||
|
||||
def init_cache(self, d):
|
||||
# Check if we already have the caches
|
||||
if self.pythoncache:
|
||||
return
|
||||
|
||||
MultiProcessCache.init_cache(self, d)
|
||||
|
||||
# cachedata gets re-assigned in the parent
|
||||
@@ -190,11 +154,11 @@ codeparsercache = CodeParserCache()
|
||||
def parser_cache_init(d):
|
||||
codeparsercache.init_cache(d)
|
||||
|
||||
def parser_cache_save():
|
||||
codeparsercache.save_extras()
|
||||
def parser_cache_save(d):
|
||||
codeparsercache.save_extras(d)
|
||||
|
||||
def parser_cache_savemerge():
|
||||
codeparsercache.save_merge()
|
||||
def parser_cache_savemerge(d):
|
||||
codeparsercache.save_merge(d)
|
||||
|
||||
Logger = logging.getLoggerClass()
|
||||
class BufferedLogger(Logger):
|
||||
@@ -209,15 +173,12 @@ class BufferedLogger(Logger):
|
||||
|
||||
def flush(self):
|
||||
for record in self.buffer:
|
||||
if self.target.isEnabledFor(record.levelno):
|
||||
self.target.handle(record)
|
||||
self.target.handle(record)
|
||||
self.buffer = []
|
||||
|
||||
class PythonParser():
|
||||
getvars = (".getVar", ".appendVar", ".prependVar")
|
||||
getvarflags = (".getVarFlag", ".appendVarFlag", ".prependVarFlag")
|
||||
containsfuncs = ("bb.utils.contains", "base_contains")
|
||||
containsanyfuncs = ("bb.utils.contains_any", "bb.utils.filter")
|
||||
containsfuncs = ("bb.utils.contains", "base_contains", "oe.utils.contains", "bb.utils.contains_any")
|
||||
execfuncs = ("bb.build.exec_func", "bb.build.exec_task")
|
||||
|
||||
def warn(self, func, arg):
|
||||
@@ -236,37 +197,17 @@ class PythonParser():
|
||||
|
||||
def visit_Call(self, node):
|
||||
name = self.called_node_name(node.func)
|
||||
if name and (name.endswith(self.getvars) or name.endswith(self.getvarflags) or name in self.containsfuncs or name in self.containsanyfuncs):
|
||||
if name and name.endswith(self.getvars) or name in self.containsfuncs:
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
varname = node.args[0].s
|
||||
if name in self.containsfuncs and isinstance(node.args[1], ast.Str):
|
||||
if varname not in self.contains:
|
||||
self.contains[varname] = set()
|
||||
self.contains[varname].add(node.args[1].s)
|
||||
elif name in self.containsanyfuncs and isinstance(node.args[1], ast.Str):
|
||||
if varname not in self.contains:
|
||||
self.contains[varname] = set()
|
||||
self.contains[varname].update(node.args[1].s.split())
|
||||
elif name.endswith(self.getvarflags):
|
||||
if isinstance(node.args[1], ast.Str):
|
||||
self.references.add('%s[%s]' % (varname, node.args[1].s))
|
||||
else:
|
||||
self.warn(node.func, node.args[1])
|
||||
else:
|
||||
self.references.add(varname)
|
||||
else:
|
||||
self.references.add(node.args[0].s)
|
||||
else:
|
||||
self.warn(node.func, node.args[0])
|
||||
elif name and name.endswith(".expand"):
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
value = node.args[0].s
|
||||
d = bb.data.init()
|
||||
parser = d.expandWithRefs(value, self.name)
|
||||
self.references |= parser.references
|
||||
self.execs |= parser.execs
|
||||
for varname in parser.contains:
|
||||
if varname not in self.contains:
|
||||
self.contains[varname] = set()
|
||||
self.contains[varname] |= parser.contains[varname]
|
||||
elif name in self.execfuncs:
|
||||
if isinstance(node.args[0], ast.Str):
|
||||
self.var_execs.add(node.args[0].s)
|
||||
@@ -289,7 +230,6 @@ class PythonParser():
|
||||
break
|
||||
|
||||
def __init__(self, name, log):
|
||||
self.name = name
|
||||
self.var_execs = set()
|
||||
self.contains = {}
|
||||
self.execs = set()
|
||||
@@ -299,11 +239,8 @@ class PythonParser():
|
||||
self.unhandled_message = "in call of %s, argument '%s' is not a string literal"
|
||||
self.unhandled_message = "while parsing %s, %s" % (name, self.unhandled_message)
|
||||
|
||||
def parse_python(self, node, lineno=0, filename="<string>"):
|
||||
if not node or not node.strip():
|
||||
return
|
||||
|
||||
h = bbhash(str(node))
|
||||
def parse_python(self, node):
|
||||
h = hash(str(node))
|
||||
|
||||
if h in codeparsercache.pythoncache:
|
||||
self.references = set(codeparsercache.pythoncache[h].refs)
|
||||
@@ -321,9 +258,7 @@ class PythonParser():
|
||||
self.contains[i] = set(codeparsercache.pythoncacheextras[h].contains[i])
|
||||
return
|
||||
|
||||
# We can't add to the linenumbers for compile, we can pad to the correct number of blank lines though
|
||||
node = "\n" * int(lineno) + node
|
||||
code = compile(check_indent(str(node)), filename, "exec",
|
||||
code = compile(check_indent(str(node)), "<string>", "exec",
|
||||
ast.PyCF_ONLY_AST)
|
||||
|
||||
for n in ast.walk(code):
|
||||
@@ -348,7 +283,7 @@ class ShellParser():
|
||||
commands it executes.
|
||||
"""
|
||||
|
||||
h = bbhash(str(value))
|
||||
h = hash(str(value))
|
||||
|
||||
if h in codeparsercache.shellcache:
|
||||
self.execs = set(codeparsercache.shellcache[h].execs)
|
||||
@@ -371,7 +306,8 @@ class ShellParser():
|
||||
except pyshlex.NeedMore:
|
||||
raise sherrors.ShellSyntaxError("Unexpected EOF")
|
||||
|
||||
self.process_tokens(tokens)
|
||||
for token in tokens:
|
||||
self.process_tokens(token)
|
||||
|
||||
def process_tokens(self, tokens):
|
||||
"""Process a supplied portion of the syntax tree as returned by
|
||||
@@ -417,24 +353,18 @@ class ShellParser():
|
||||
"case_clause": case_clause,
|
||||
}
|
||||
|
||||
def process_token_list(tokens):
|
||||
for token in tokens:
|
||||
if isinstance(token, list):
|
||||
process_token_list(token)
|
||||
continue
|
||||
name, value = token
|
||||
try:
|
||||
more_tokens, words = token_handlers[name](value)
|
||||
except KeyError:
|
||||
raise NotImplementedError("Unsupported token type " + name)
|
||||
for token in tokens:
|
||||
name, value = token
|
||||
try:
|
||||
more_tokens, words = token_handlers[name](value)
|
||||
except KeyError:
|
||||
raise NotImplementedError("Unsupported token type " + name)
|
||||
|
||||
if more_tokens:
|
||||
self.process_tokens(more_tokens)
|
||||
if more_tokens:
|
||||
self.process_tokens(more_tokens)
|
||||
|
||||
if words:
|
||||
self.process_words(words)
|
||||
|
||||
process_token_list(tokens)
|
||||
if words:
|
||||
self.process_words(words)
|
||||
|
||||
def process_words(self, words):
|
||||
"""Process a set of 'words' in pyshyacc parlance, which includes
|
||||
|
||||
@@ -28,15 +28,8 @@ and must not trigger events, directly or indirectly.
|
||||
Commands are queued in a CommandQueue
|
||||
"""
|
||||
|
||||
from collections import OrderedDict, defaultdict
|
||||
|
||||
import bb.event
|
||||
import bb.cooker
|
||||
import bb.remotedata
|
||||
|
||||
class DataStoreConnectionHandle(object):
|
||||
def __init__(self, dsindex=0):
|
||||
self.dsindex = dsindex
|
||||
|
||||
class CommandCompleted(bb.event.Event):
|
||||
pass
|
||||
@@ -50,8 +43,6 @@ class CommandFailed(CommandExit):
|
||||
def __init__(self, message):
|
||||
self.error = message
|
||||
CommandExit.__init__(self, 1)
|
||||
def __str__(self):
|
||||
return "Command execution failed: %s" % self.error
|
||||
|
||||
class CommandError(Exception):
|
||||
pass
|
||||
@@ -64,7 +55,6 @@ class Command:
|
||||
self.cooker = cooker
|
||||
self.cmds_sync = CommandsSync()
|
||||
self.cmds_async = CommandsAsync()
|
||||
self.remotedatastores = bb.remotedata.RemoteDatastores(cooker)
|
||||
|
||||
# FIXME Add lock for this
|
||||
self.currentAsyncCommand = None
|
||||
@@ -78,13 +68,10 @@ class Command:
|
||||
if not hasattr(command_method, 'readonly') or False == getattr(command_method, 'readonly'):
|
||||
return None, "Not able to execute not readonly commands in readonly mode"
|
||||
try:
|
||||
self.cooker.process_inotify_updates()
|
||||
if getattr(command_method, 'needconfig', True):
|
||||
self.cooker.updateCacheSync()
|
||||
result = command_method(self, commandline)
|
||||
except CommandError as exc:
|
||||
return None, exc.args[0]
|
||||
except (Exception, SystemExit):
|
||||
except Exception:
|
||||
import traceback
|
||||
return None, traceback.format_exc()
|
||||
else:
|
||||
@@ -99,7 +86,6 @@ class Command:
|
||||
|
||||
def runAsyncCommand(self):
|
||||
try:
|
||||
self.cooker.process_inotify_updates()
|
||||
if self.cooker.state in (bb.cooker.state.error, bb.cooker.state.shutdown, bb.cooker.state.forceshutdown):
|
||||
# updateCache will trigger a shutdown of the parser
|
||||
# and then raise BBHandledException triggering an exit
|
||||
@@ -122,7 +108,7 @@ class Command:
|
||||
return False
|
||||
except SystemExit as exc:
|
||||
arg = exc.args[0]
|
||||
if isinstance(arg, str):
|
||||
if isinstance(arg, basestring):
|
||||
self.finishAsyncCommand(arg)
|
||||
else:
|
||||
self.finishAsyncCommand("Exited with %s" % arg)
|
||||
@@ -137,23 +123,14 @@ class Command:
|
||||
|
||||
def finishAsyncCommand(self, msg=None, code=None):
|
||||
if msg or msg == "":
|
||||
bb.event.fire(CommandFailed(msg), self.cooker.data)
|
||||
bb.event.fire(CommandFailed(msg), self.cooker.event_data)
|
||||
elif code:
|
||||
bb.event.fire(CommandExit(code), self.cooker.data)
|
||||
bb.event.fire(CommandExit(code), self.cooker.event_data)
|
||||
else:
|
||||
bb.event.fire(CommandCompleted(), self.cooker.data)
|
||||
bb.event.fire(CommandCompleted(), self.cooker.event_data)
|
||||
self.currentAsyncCommand = None
|
||||
self.cooker.finishcommand()
|
||||
|
||||
def reset(self):
|
||||
self.remotedatastores = bb.remotedata.RemoteDatastores(self.cooker)
|
||||
|
||||
def split_mc_pn(pn):
|
||||
if pn.startswith("multiconfig:"):
|
||||
_, mc, pn = pn.split(":", 2)
|
||||
return (mc, pn)
|
||||
return ('', pn)
|
||||
|
||||
class CommandsSync:
|
||||
"""
|
||||
A class of synchronous commands
|
||||
@@ -200,19 +177,8 @@ class CommandsSync:
|
||||
"""
|
||||
varname = params[0]
|
||||
value = str(params[1])
|
||||
command.cooker.extraconfigdata[varname] = value
|
||||
command.cooker.data.setVar(varname, value)
|
||||
|
||||
def getSetVariable(self, command, params):
|
||||
"""
|
||||
Read the value of a variable from data and set it into the datastore
|
||||
which effectively expands and locks the value.
|
||||
"""
|
||||
varname = params[0]
|
||||
result = self.getVariable(command, params)
|
||||
command.cooker.data.setVar(varname, result)
|
||||
return result
|
||||
|
||||
def setConfig(self, command, params):
|
||||
"""
|
||||
Set the value of variable in configuration
|
||||
@@ -238,17 +204,54 @@ class CommandsSync:
|
||||
postfiles = params[1].split()
|
||||
command.cooker.configuration.prefile = prefiles
|
||||
command.cooker.configuration.postfile = postfiles
|
||||
setPrePostConfFiles.needconfig = False
|
||||
|
||||
def getCpuCount(self, command, params):
|
||||
"""
|
||||
Get the CPU count on the bitbake server
|
||||
"""
|
||||
return bb.utils.cpu_count()
|
||||
getCpuCount.readonly = True
|
||||
|
||||
def matchFile(self, command, params):
|
||||
fMatch = params[0]
|
||||
return command.cooker.matchFile(fMatch)
|
||||
matchFile.needconfig = False
|
||||
|
||||
def getUIHandlerNum(self, command, params):
|
||||
return bb.event.get_uihandler()
|
||||
getUIHandlerNum.needconfig = False
|
||||
getUIHandlerNum.readonly = True
|
||||
def generateNewImage(self, command, params):
|
||||
image = params[0]
|
||||
base_image = params[1]
|
||||
package_queue = params[2]
|
||||
timestamp = params[3]
|
||||
description = params[4]
|
||||
return command.cooker.generateNewImage(image, base_image,
|
||||
package_queue, timestamp, description)
|
||||
|
||||
def ensureDir(self, command, params):
|
||||
directory = params[0]
|
||||
bb.utils.mkdirhier(directory)
|
||||
|
||||
def setVarFile(self, command, params):
|
||||
"""
|
||||
Save a variable in a file; used for saving in a configuration file
|
||||
"""
|
||||
var = params[0]
|
||||
val = params[1]
|
||||
default_file = params[2]
|
||||
op = params[3]
|
||||
command.cooker.modifyConfigurationVar(var, val, default_file, op)
|
||||
|
||||
def removeVarFile(self, command, params):
|
||||
"""
|
||||
Remove a variable declaration from a file
|
||||
"""
|
||||
var = params[0]
|
||||
command.cooker.removeConfigurationVar(var)
|
||||
|
||||
def createConfigFile(self, command, params):
|
||||
"""
|
||||
Create an extra configuration file
|
||||
"""
|
||||
name = params[0]
|
||||
command.cooker.createConfigFile(name)
|
||||
|
||||
def setEventMask(self, command, params):
|
||||
handlerNum = params[0]
|
||||
@@ -256,8 +259,6 @@ class CommandsSync:
|
||||
debug_domains = params[2]
|
||||
mask = params[3]
|
||||
return bb.event.set_UIHmask(handlerNum, llevel, debug_domains, mask)
|
||||
setEventMask.needconfig = False
|
||||
setEventMask.readonly = True
|
||||
|
||||
def setFeatures(self, command, params):
|
||||
"""
|
||||
@@ -265,314 +266,14 @@ class CommandsSync:
|
||||
"""
|
||||
features = params[0]
|
||||
command.cooker.setFeatures(features)
|
||||
setFeatures.needconfig = False
|
||||
|
||||
# although we change the internal state of the cooker, this is transparent since
|
||||
# we always take and leave the cooker in state.initial
|
||||
setFeatures.readonly = True
|
||||
|
||||
def updateConfig(self, command, params):
|
||||
options = params[0]
|
||||
environment = params[1]
|
||||
cmdline = params[2]
|
||||
command.cooker.updateConfigOpts(options, environment, cmdline)
|
||||
updateConfig.needconfig = False
|
||||
|
||||
def parseConfiguration(self, command, params):
|
||||
"""Instruct bitbake to parse its configuration
|
||||
NOTE: it is only necessary to call this if you aren't calling any normal action
|
||||
(otherwise parsing is taken care of automatically)
|
||||
"""
|
||||
command.cooker.parseConfiguration()
|
||||
parseConfiguration.needconfig = False
|
||||
|
||||
def getLayerPriorities(self, command, params):
|
||||
command.cooker.parseConfiguration()
|
||||
ret = []
|
||||
# regex objects cannot be marshalled by xmlrpc
|
||||
for collection, pattern, regex, pri in command.cooker.bbfile_config_priorities:
|
||||
ret.append((collection, pattern, regex.pattern, pri))
|
||||
return ret
|
||||
getLayerPriorities.readonly = True
|
||||
|
||||
def getRecipes(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return list(command.cooker.recipecaches[mc].pkg_pn.items())
|
||||
getRecipes.readonly = True
|
||||
|
||||
def getRecipeDepends(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return list(command.cooker.recipecaches[mc].deps.items())
|
||||
getRecipeDepends.readonly = True
|
||||
|
||||
def getRecipeVersions(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return command.cooker.recipecaches[mc].pkg_pepvpr
|
||||
getRecipeVersions.readonly = True
|
||||
|
||||
def getRecipeProvides(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return command.cooker.recipecaches[mc].fn_provides
|
||||
getRecipeProvides.readonly = True
|
||||
|
||||
def getRecipePackages(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return command.cooker.recipecaches[mc].packages
|
||||
getRecipePackages.readonly = True
|
||||
|
||||
def getRecipePackagesDynamic(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return command.cooker.recipecaches[mc].packages_dynamic
|
||||
getRecipePackagesDynamic.readonly = True
|
||||
|
||||
def getRProviders(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return command.cooker.recipecaches[mc].rproviders
|
||||
getRProviders.readonly = True
|
||||
|
||||
def getRuntimeDepends(self, command, params):
|
||||
ret = []
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
rundeps = command.cooker.recipecaches[mc].rundeps
|
||||
for key, value in rundeps.items():
|
||||
if isinstance(value, defaultdict):
|
||||
value = dict(value)
|
||||
ret.append((key, value))
|
||||
return ret
|
||||
getRuntimeDepends.readonly = True
|
||||
|
||||
def getRuntimeRecommends(self, command, params):
|
||||
ret = []
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
runrecs = command.cooker.recipecaches[mc].runrecs
|
||||
for key, value in runrecs.items():
|
||||
if isinstance(value, defaultdict):
|
||||
value = dict(value)
|
||||
ret.append((key, value))
|
||||
return ret
|
||||
getRuntimeRecommends.readonly = True
|
||||
|
||||
def getRecipeInherits(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return command.cooker.recipecaches[mc].inherits
|
||||
getRecipeInherits.readonly = True
|
||||
|
||||
def getBbFilePriority(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return command.cooker.recipecaches[mc].bbfile_priority
|
||||
getBbFilePriority.readonly = True
|
||||
|
||||
def getDefaultPreference(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return command.cooker.recipecaches[mc].pkg_dp
|
||||
getDefaultPreference.readonly = True
|
||||
|
||||
def getSkippedRecipes(self, command, params):
|
||||
# Return list sorted by reverse priority order
|
||||
import bb.cache
|
||||
skipdict = OrderedDict(sorted(command.cooker.skiplist.items(),
|
||||
key=lambda x: (-command.cooker.collection.calc_bbfile_priority(bb.cache.virtualfn2realfn(x[0])[0]), x[0])))
|
||||
return list(skipdict.items())
|
||||
getSkippedRecipes.readonly = True
|
||||
|
||||
def getOverlayedRecipes(self, command, params):
|
||||
return list(command.cooker.collection.overlayed.items())
|
||||
getOverlayedRecipes.readonly = True
|
||||
|
||||
def getFileAppends(self, command, params):
|
||||
fn = params[0]
|
||||
return command.cooker.collection.get_file_appends(fn)
|
||||
getFileAppends.readonly = True
|
||||
|
||||
def getAllAppends(self, command, params):
|
||||
return command.cooker.collection.bbappends
|
||||
getAllAppends.readonly = True
|
||||
|
||||
def findProviders(self, command, params):
|
||||
return command.cooker.findProviders()
|
||||
findProviders.readonly = True
|
||||
|
||||
def findBestProvider(self, command, params):
|
||||
(mc, pn) = split_mc_pn(params[0])
|
||||
return command.cooker.findBestProvider(pn, mc)
|
||||
findBestProvider.readonly = True
|
||||
|
||||
def allProviders(self, command, params):
|
||||
try:
|
||||
mc = params[0]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
return list(bb.providers.allProviders(command.cooker.recipecaches[mc]).items())
|
||||
allProviders.readonly = True
|
||||
|
||||
def getRuntimeProviders(self, command, params):
|
||||
rprovide = params[0]
|
||||
try:
|
||||
mc = params[1]
|
||||
except IndexError:
|
||||
mc = ''
|
||||
all_p = bb.providers.getRuntimeProviders(command.cooker.recipecaches[mc], rprovide)
|
||||
if all_p:
|
||||
best = bb.providers.filterProvidersRunTime(all_p, rprovide,
|
||||
command.cooker.data,
|
||||
command.cooker.recipecaches[mc])[0][0]
|
||||
else:
|
||||
best = None
|
||||
return all_p, best
|
||||
getRuntimeProviders.readonly = True
|
||||
|
||||
def dataStoreConnectorFindVar(self, command, params):
|
||||
dsindex = params[0]
|
||||
name = params[1]
|
||||
datastore = command.remotedatastores[dsindex]
|
||||
value, overridedata = datastore._findVar(name)
|
||||
|
||||
if value:
|
||||
content = value.get('_content', None)
|
||||
if isinstance(content, bb.data_smart.DataSmart):
|
||||
# Value is a datastore (e.g. BB_ORIGENV) - need to handle this carefully
|
||||
idx = command.remotedatastores.check_store(content, True)
|
||||
return {'_content': DataStoreConnectionHandle(idx),
|
||||
'_connector_origtype': 'DataStoreConnectionHandle',
|
||||
'_connector_overrides': overridedata}
|
||||
elif isinstance(content, set):
|
||||
return {'_content': list(content),
|
||||
'_connector_origtype': 'set',
|
||||
'_connector_overrides': overridedata}
|
||||
else:
|
||||
value['_connector_overrides'] = overridedata
|
||||
else:
|
||||
value = {}
|
||||
value['_connector_overrides'] = overridedata
|
||||
return value
|
||||
dataStoreConnectorFindVar.readonly = True
|
||||
|
||||
def dataStoreConnectorGetKeys(self, command, params):
|
||||
dsindex = params[0]
|
||||
datastore = command.remotedatastores[dsindex]
|
||||
return list(datastore.keys())
|
||||
dataStoreConnectorGetKeys.readonly = True
|
||||
|
||||
def dataStoreConnectorGetVarHistory(self, command, params):
|
||||
dsindex = params[0]
|
||||
name = params[1]
|
||||
datastore = command.remotedatastores[dsindex]
|
||||
return datastore.varhistory.variable(name)
|
||||
dataStoreConnectorGetVarHistory.readonly = True
|
||||
|
||||
def dataStoreConnectorExpandPythonRef(self, command, params):
|
||||
config_data_dict = params[0]
|
||||
varname = params[1]
|
||||
expr = params[2]
|
||||
|
||||
config_data = command.remotedatastores.receive_datastore(config_data_dict)
|
||||
|
||||
varparse = bb.data_smart.VariableParse(varname, config_data)
|
||||
return varparse.python_sub(expr)
|
||||
|
||||
def dataStoreConnectorRelease(self, command, params):
|
||||
dsindex = params[0]
|
||||
if dsindex <= 0:
|
||||
raise CommandError('dataStoreConnectorRelease: invalid index %d' % dsindex)
|
||||
command.remotedatastores.release(dsindex)
|
||||
|
||||
def dataStoreConnectorSetVarFlag(self, command, params):
|
||||
dsindex = params[0]
|
||||
name = params[1]
|
||||
flag = params[2]
|
||||
value = params[3]
|
||||
datastore = command.remotedatastores[dsindex]
|
||||
datastore.setVarFlag(name, flag, value)
|
||||
|
||||
def dataStoreConnectorDelVar(self, command, params):
|
||||
dsindex = params[0]
|
||||
name = params[1]
|
||||
datastore = command.remotedatastores[dsindex]
|
||||
if len(params) > 2:
|
||||
flag = params[2]
|
||||
datastore.delVarFlag(name, flag)
|
||||
else:
|
||||
datastore.delVar(name)
|
||||
|
||||
def dataStoreConnectorRenameVar(self, command, params):
|
||||
dsindex = params[0]
|
||||
name = params[1]
|
||||
newname = params[2]
|
||||
datastore = command.remotedatastores[dsindex]
|
||||
datastore.renameVar(name, newname)
|
||||
|
||||
def parseRecipeFile(self, command, params):
|
||||
"""
|
||||
Parse the specified recipe file (with or without bbappends)
|
||||
and return a datastore object representing the environment
|
||||
for the recipe.
|
||||
"""
|
||||
fn = params[0]
|
||||
appends = params[1]
|
||||
appendlist = params[2]
|
||||
if len(params) > 3:
|
||||
config_data_dict = params[3]
|
||||
config_data = command.remotedatastores.receive_datastore(config_data_dict)
|
||||
else:
|
||||
config_data = None
|
||||
|
||||
if appends:
|
||||
if appendlist is not None:
|
||||
appendfiles = appendlist
|
||||
else:
|
||||
appendfiles = command.cooker.collection.get_file_appends(fn)
|
||||
else:
|
||||
appendfiles = []
|
||||
# We are calling bb.cache locally here rather than on the server,
|
||||
# but that's OK because it doesn't actually need anything from
|
||||
# the server barring the global datastore (which we have a remote
|
||||
# version of)
|
||||
if config_data:
|
||||
# We have to use a different function here if we're passing in a datastore
|
||||
# NOTE: we took a copy above, so we don't do it here again
|
||||
envdata = bb.cache.parse_recipe(config_data, fn, appendfiles)['']
|
||||
else:
|
||||
# Use the standard path
|
||||
parser = bb.cache.NoCache(command.cooker.databuilder)
|
||||
envdata = parser.loadDataFull(fn, appendfiles)
|
||||
idx = command.remotedatastores.store(envdata)
|
||||
return DataStoreConnectionHandle(idx)
|
||||
parseRecipeFile.readonly = True
|
||||
command.cooker.updateConfigOpts(options)
|
||||
|
||||
class CommandsAsync:
|
||||
"""
|
||||
@@ -587,15 +288,8 @@ class CommandsAsync:
|
||||
"""
|
||||
bfile = params[0]
|
||||
task = params[1]
|
||||
if len(params) > 2:
|
||||
internal = params[2]
|
||||
else:
|
||||
internal = False
|
||||
|
||||
if internal:
|
||||
command.cooker.buildFileInternal(bfile, task, fireevents=False, quietlog=True)
|
||||
else:
|
||||
command.cooker.buildFile(bfile, task)
|
||||
command.cooker.buildFile(bfile, task)
|
||||
buildFile.needcache = False
|
||||
|
||||
def buildTargets(self, command, params):
|
||||
@@ -645,6 +339,17 @@ class CommandsAsync:
|
||||
command.finishAsyncCommand()
|
||||
generateTargetsTree.needcache = True
|
||||
|
||||
def findCoreBaseFiles(self, command, params):
|
||||
"""
|
||||
Find certain files in COREBASE directory. i.e. Layers
|
||||
"""
|
||||
subdir = params[0]
|
||||
filename = params[1]
|
||||
|
||||
command.cooker.findCoreBaseFiles(subdir, filename)
|
||||
command.finishAsyncCommand()
|
||||
findCoreBaseFiles.needcache = False
|
||||
|
||||
def findConfigFiles(self, command, params):
|
||||
"""
|
||||
Find config files which provide appropriate values
|
||||
@@ -744,22 +449,3 @@ class CommandsAsync:
|
||||
command.finishAsyncCommand()
|
||||
resetCooker.needcache = False
|
||||
|
||||
def clientComplete(self, command, params):
|
||||
"""
|
||||
Do the right thing when the controlling client exits
|
||||
"""
|
||||
command.cooker.clientComplete()
|
||||
command.finishAsyncCommand()
|
||||
clientComplete.needcache = False
|
||||
|
||||
def findSigInfo(self, command, params):
|
||||
"""
|
||||
Find signature info files via the signature generator
|
||||
"""
|
||||
pn = params[0]
|
||||
taskname = params[1]
|
||||
sigs = params[2]
|
||||
res = bb.siggen.find_siginfo(pn, taskname, sigs, command.cooker.data)
|
||||
bb.event.fire(bb.event.FindSigInfoResult(res), command.cooker.data)
|
||||
command.finishAsyncCommand()
|
||||
findSigInfo.needcache = False
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -22,11 +22,9 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import logging
|
||||
import os
|
||||
import re
|
||||
import sys
|
||||
import os, sys
|
||||
from functools import wraps
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
import bb.parse
|
||||
@@ -35,16 +33,20 @@ logger = logging.getLogger("BitBake")
|
||||
parselog = logging.getLogger("BitBake.Parsing")
|
||||
|
||||
class ConfigParameters(object):
|
||||
def __init__(self, argv=sys.argv):
|
||||
self.options, targets = self.parseCommandLine(argv)
|
||||
def __init__(self):
|
||||
self.options, targets = self.parseCommandLine()
|
||||
self.environment = self.parseEnvironment()
|
||||
|
||||
self.options.pkgs_to_build = targets or []
|
||||
|
||||
self.options.tracking = False
|
||||
if hasattr(self.options, "show_environment") and self.options.show_environment:
|
||||
self.options.tracking = True
|
||||
|
||||
for key, val in self.options.__dict__.items():
|
||||
setattr(self, key, val)
|
||||
|
||||
def parseCommandLine(self, argv=sys.argv):
|
||||
def parseCommandLine(self):
|
||||
raise Exception("Caller must implement commandline option parsing")
|
||||
|
||||
def parseEnvironment(self):
|
||||
@@ -61,23 +63,22 @@ class ConfigParameters(object):
|
||||
raise Exception("Unable to set configuration option 'cmd' on the server: %s" % error)
|
||||
|
||||
if not self.options.pkgs_to_build:
|
||||
bbpkgs, error = server.runCommand(["getVariable", "BBTARGETS"])
|
||||
bbpkgs, error = server.runCommand(["getVariable", "BBPKGS"])
|
||||
if error:
|
||||
raise Exception("Unable to get the value of BBTARGETS from the server: %s" % error)
|
||||
raise Exception("Unable to get the value of BBPKGS from the server: %s" % error)
|
||||
if bbpkgs:
|
||||
self.options.pkgs_to_build.extend(bbpkgs.split())
|
||||
|
||||
def updateToServer(self, server, environment):
|
||||
def updateToServer(self, server):
|
||||
options = {}
|
||||
for o in ["abort", "force", "invalidate_stamp",
|
||||
"verbose", "debug", "dry_run", "dump_signatures",
|
||||
"debug_domains", "extra_assume_provided", "profile",
|
||||
"prefile", "postfile", "server_timeout"]:
|
||||
for o in ["abort", "tryaltconfigs", "force", "invalidate_stamp",
|
||||
"verbose", "debug", "dry_run", "dump_signatures",
|
||||
"debug_domains", "extra_assume_provided", "profile"]:
|
||||
options[o] = getattr(self.options, o)
|
||||
|
||||
ret, error = server.runCommand(["updateConfig", options, environment, sys.argv])
|
||||
ret, error = server.runCommand(["updateConfig", options])
|
||||
if error:
|
||||
raise Exception("Unable to update the server configuration with local parameters: %s" % error)
|
||||
raise Exception("Unable to update the server configuration with local parameters: %s" % error)
|
||||
|
||||
def parseActions(self):
|
||||
# Parse any commandline into actions
|
||||
@@ -133,18 +134,11 @@ class CookerConfiguration(object):
|
||||
self.force = False
|
||||
self.profile = False
|
||||
self.nosetscene = False
|
||||
self.setsceneonly = False
|
||||
self.invalidate_stamp = False
|
||||
self.dump_signatures = []
|
||||
self.dry_run = False
|
||||
self.tracking = False
|
||||
self.xmlrpcinterface = []
|
||||
self.server_timeout = None
|
||||
self.writeeventlog = False
|
||||
self.server_only = False
|
||||
self.limited_deps = False
|
||||
self.runall = []
|
||||
self.runonly = []
|
||||
self.interface = []
|
||||
|
||||
self.env = {}
|
||||
|
||||
@@ -153,6 +147,7 @@ class CookerConfiguration(object):
|
||||
if key in parameters.options.__dict__:
|
||||
setattr(self, key, parameters.options.__dict__[key])
|
||||
self.env = parameters.environment.copy()
|
||||
self.tracking = parameters.tracking
|
||||
|
||||
def setServerRegIdleCallback(self, srcb):
|
||||
self.server_register_idlecallback = srcb
|
||||
@@ -168,7 +163,7 @@ class CookerConfiguration(object):
|
||||
|
||||
def __setstate__(self,state):
|
||||
for k in state:
|
||||
setattr(self, k, state[k])
|
||||
setattr(self, k, state[k])
|
||||
|
||||
|
||||
def catch_parse_error(func):
|
||||
@@ -177,26 +172,11 @@ def catch_parse_error(func):
|
||||
def wrapped(fn, *args):
|
||||
try:
|
||||
return func(fn, *args)
|
||||
except IOError as exc:
|
||||
except (IOError, bb.parse.ParseError, bb.data_smart.ExpansionError) as exc:
|
||||
import traceback
|
||||
parselog.critical(traceback.format_exc())
|
||||
parselog.critical( traceback.format_exc())
|
||||
parselog.critical("Unable to parse %s: %s" % (fn, exc))
|
||||
sys.exit(1)
|
||||
except bb.data_smart.ExpansionError as exc:
|
||||
import traceback
|
||||
|
||||
bbdir = os.path.dirname(__file__) + os.sep
|
||||
exc_class, exc, tb = sys.exc_info()
|
||||
for tb in iter(lambda: tb.tb_next, None):
|
||||
# Skip frames in bitbake itself, we only want the metadata
|
||||
fn, _, _, _ = traceback.extract_tb(tb, 1)[0]
|
||||
if not fn.startswith(bbdir):
|
||||
break
|
||||
parselog.critical("Unable to parse %s" % fn, exc_info=(exc_class, exc, tb))
|
||||
sys.exit(1)
|
||||
except bb.parse.ParseError as exc:
|
||||
parselog.critical(str(exc))
|
||||
sys.exit(1)
|
||||
return wrapped
|
||||
|
||||
@catch_parse_error
|
||||
@@ -210,7 +190,7 @@ def _inherit(bbclass, data):
|
||||
|
||||
def findConfigFile(configfile, data):
|
||||
search = []
|
||||
bbpath = data.getVar("BBPATH")
|
||||
bbpath = data.getVar("BBPATH", True)
|
||||
if bbpath:
|
||||
for i in bbpath.split(":"):
|
||||
search.append(os.path.join(i, "conf", configfile))
|
||||
@@ -225,27 +205,6 @@ def findConfigFile(configfile, data):
|
||||
|
||||
return None
|
||||
|
||||
#
|
||||
# We search for a conf/bblayers.conf under an entry in BBPATH or in cwd working
|
||||
# up to /. If that fails, we search for a conf/bitbake.conf in BBPATH.
|
||||
#
|
||||
|
||||
def findTopdir():
|
||||
d = bb.data.init()
|
||||
bbpath = None
|
||||
if 'BBPATH' in os.environ:
|
||||
bbpath = os.environ['BBPATH']
|
||||
d.setVar('BBPATH', bbpath)
|
||||
|
||||
layerconf = findConfigFile("bblayers.conf", d)
|
||||
if layerconf:
|
||||
return os.path.dirname(os.path.dirname(layerconf))
|
||||
if bbpath:
|
||||
bitbakeconf = bb.utils.which(bbpath, "conf/bitbake.conf")
|
||||
if bitbakeconf:
|
||||
return os.path.dirname(os.path.dirname(bitbakeconf))
|
||||
return None
|
||||
|
||||
class CookerDataBuilder(object):
|
||||
|
||||
def __init__(self, cookercfg, worker = False):
|
||||
@@ -256,9 +215,9 @@ class CookerDataBuilder(object):
|
||||
|
||||
bb.utils.set_context(bb.utils.clean_context())
|
||||
bb.event.set_class_handlers(bb.event.clean_class_handlers())
|
||||
self.basedata = bb.data.init()
|
||||
self.data = bb.data.init()
|
||||
if self.tracking:
|
||||
self.basedata.enableTracking()
|
||||
self.data.enableTracking()
|
||||
|
||||
# Keep a datastore of the initial environment variables and their
|
||||
# values from when BitBake was launched to enable child processes
|
||||
@@ -269,51 +228,16 @@ class CookerDataBuilder(object):
|
||||
self.savedenv.setVar(k, cookercfg.env[k])
|
||||
|
||||
filtered_keys = bb.utils.approved_variables()
|
||||
bb.data.inheritFromOS(self.basedata, self.savedenv, filtered_keys)
|
||||
self.basedata.setVar("BB_ORIGENV", self.savedenv)
|
||||
|
||||
bb.data.inheritFromOS(self.data, self.savedenv, filtered_keys)
|
||||
self.data.setVar("BB_ORIGENV", self.savedenv)
|
||||
|
||||
if worker:
|
||||
self.basedata.setVar("BB_WORKERCONTEXT", "1")
|
||||
|
||||
self.data = self.basedata
|
||||
self.mcdata = {}
|
||||
self.data.setVar("BB_WORKERCONTEXT", "1")
|
||||
|
||||
def parseBaseConfiguration(self):
|
||||
try:
|
||||
bb.parse.init_parser(self.basedata)
|
||||
self.data = self.parseConfigurationFiles(self.prefiles, self.postfiles)
|
||||
|
||||
if self.data.getVar("BB_WORKERCONTEXT", False) is None:
|
||||
bb.fetch.fetcher_init(self.data)
|
||||
bb.codeparser.parser_cache_init(self.data)
|
||||
|
||||
bb.event.fire(bb.event.ConfigParsed(), self.data)
|
||||
|
||||
reparse_cnt = 0
|
||||
while self.data.getVar("BB_INVALIDCONF", False) is True:
|
||||
if reparse_cnt > 20:
|
||||
logger.error("Configuration has been re-parsed over 20 times, "
|
||||
"breaking out of the loop...")
|
||||
raise Exception("Too deep config re-parse loop. Check locations where "
|
||||
"BB_INVALIDCONF is being set (ConfigParsed event handlers)")
|
||||
self.data.setVar("BB_INVALIDCONF", False)
|
||||
self.data = self.parseConfigurationFiles(self.prefiles, self.postfiles)
|
||||
reparse_cnt += 1
|
||||
bb.event.fire(bb.event.ConfigParsed(), self.data)
|
||||
|
||||
bb.parse.init_parser(self.data)
|
||||
self.data_hash = self.data.get_hash()
|
||||
self.mcdata[''] = self.data
|
||||
|
||||
multiconfig = (self.data.getVar("BBMULTICONFIG") or "").split()
|
||||
for config in multiconfig:
|
||||
mcdata = self.parseConfigurationFiles(self.prefiles, self.postfiles, config)
|
||||
bb.event.fire(bb.event.ConfigParsed(), mcdata)
|
||||
self.mcdata[config] = mcdata
|
||||
if multiconfig:
|
||||
bb.event.fire(bb.event.MultiConfigParsed(self.mcdata), self.data)
|
||||
|
||||
except (SyntaxError, bb.BBHandledException):
|
||||
self.parseConfigurationFiles(self.prefiles, self.postfiles)
|
||||
except SyntaxError:
|
||||
raise bb.BBHandledException
|
||||
except bb.data_smart.ExpansionError as e:
|
||||
logger.error(str(e))
|
||||
@@ -322,24 +246,12 @@ class CookerDataBuilder(object):
|
||||
logger.exception("Error parsing configuration files")
|
||||
raise bb.BBHandledException
|
||||
|
||||
# Create a copy so we can reset at a later date when UIs disconnect
|
||||
self.origdata = self.data
|
||||
self.data = bb.data.createCopy(self.origdata)
|
||||
self.mcdata[''] = self.data
|
||||
|
||||
def reset(self):
|
||||
# We may not have run parseBaseConfiguration() yet
|
||||
if not hasattr(self, 'origdata'):
|
||||
return
|
||||
self.data = bb.data.createCopy(self.origdata)
|
||||
self.mcdata[''] = self.data
|
||||
|
||||
def _findLayerConf(self, data):
|
||||
return findConfigFile("bblayers.conf", data)
|
||||
|
||||
def parseConfigurationFiles(self, prefiles, postfiles, mc = "default"):
|
||||
data = bb.data.createCopy(self.basedata)
|
||||
data.setVar("BB_CURRENT_MC", mc)
|
||||
def parseConfigurationFiles(self, prefiles, postfiles):
|
||||
data = self.data
|
||||
bb.parse.init_parser(data)
|
||||
|
||||
# Parse files for loading *before* bitbake.conf and any includes
|
||||
for f in prefiles:
|
||||
@@ -353,53 +265,18 @@ class CookerDataBuilder(object):
|
||||
data.setVar("TOPDIR", os.path.dirname(os.path.dirname(layerconf)))
|
||||
data = parse_config_file(layerconf, data)
|
||||
|
||||
layers = (data.getVar('BBLAYERS') or "").split()
|
||||
layers = (data.getVar('BBLAYERS', True) or "").split()
|
||||
|
||||
data = bb.data.createCopy(data)
|
||||
approved = bb.utils.approved_variables()
|
||||
for layer in layers:
|
||||
if not os.path.isdir(layer):
|
||||
parselog.critical("Layer directory '%s' does not exist! "
|
||||
"Please check BBLAYERS in %s" % (layer, layerconf))
|
||||
sys.exit(1)
|
||||
parselog.debug(2, "Adding layer %s", layer)
|
||||
if 'HOME' in approved and '~' in layer:
|
||||
layer = os.path.expanduser(layer)
|
||||
if layer.endswith('/'):
|
||||
layer = layer.rstrip('/')
|
||||
data.setVar('LAYERDIR', layer)
|
||||
data.setVar('LAYERDIR_RE', re.escape(layer))
|
||||
data = parse_config_file(os.path.join(layer, "conf", "layer.conf"), data)
|
||||
data.expandVarref('LAYERDIR')
|
||||
data.expandVarref('LAYERDIR_RE')
|
||||
|
||||
data.delVar('LAYERDIR_RE')
|
||||
data.delVar('LAYERDIR')
|
||||
|
||||
bbfiles_dynamic = (data.getVar('BBFILES_DYNAMIC') or "").split()
|
||||
collections = (data.getVar('BBFILE_COLLECTIONS') or "").split()
|
||||
invalid = []
|
||||
for entry in bbfiles_dynamic:
|
||||
parts = entry.split(":", 1)
|
||||
if len(parts) != 2:
|
||||
invalid.append(entry)
|
||||
continue
|
||||
l, f = parts
|
||||
if l in collections:
|
||||
data.appendVar("BBFILES", " " + f)
|
||||
if invalid:
|
||||
bb.fatal("BBFILES_DYNAMIC entries must be of the form <collection name>:<filename pattern>, not:\n %s" % "\n ".join(invalid))
|
||||
|
||||
layerseries = set((data.getVar("LAYERSERIES_CORENAMES") or "").split())
|
||||
for c in collections:
|
||||
compat = set((data.getVar("LAYERSERIES_COMPAT_%s" % c) or "").split())
|
||||
if compat and not (compat & layerseries):
|
||||
bb.fatal("Layer %s is not compatible with the core layer which only supports these series: %s (layer is compatible with %s)"
|
||||
% (c, " ".join(layerseries), " ".join(compat)))
|
||||
elif not compat and not data.getVar("BB_WORKERCONTEXT"):
|
||||
bb.warn("Layer %s should set LAYERSERIES_COMPAT_%s in its conf/layer.conf file to list the core layer names it is compatible with." % (c, c))
|
||||
|
||||
if not data.getVar("BBPATH"):
|
||||
if not data.getVar("BBPATH", True):
|
||||
msg = "The BBPATH variable is not set"
|
||||
if not layerconf:
|
||||
msg += (" and bitbake did not find a conf/bblayers.conf file in"
|
||||
@@ -414,21 +291,29 @@ class CookerDataBuilder(object):
|
||||
data = parse_config_file(p, data)
|
||||
|
||||
# Handle any INHERITs and inherit the base class
|
||||
bbclasses = ["base"] + (data.getVar('INHERIT') or "").split()
|
||||
bbclasses = ["base"] + (data.getVar('INHERIT', True) or "").split()
|
||||
for bbclass in bbclasses:
|
||||
data = _inherit(bbclass, data)
|
||||
|
||||
# Nomally we only register event handlers at the end of parsing .bb files
|
||||
# We register any handlers we've found so far here...
|
||||
for var in data.getVar('__BBHANDLERS', False) or []:
|
||||
handlerfn = data.getVarFlag(var, "filename", False)
|
||||
if not handlerfn:
|
||||
parselog.critical("Undefined event handler function '%s'" % var)
|
||||
sys.exit(1)
|
||||
handlerln = int(data.getVarFlag(var, "lineno", False))
|
||||
bb.event.register(var, data.getVar(var, False), (data.getVarFlag(var, "eventmask") or "").split(), handlerfn, handlerln)
|
||||
for var in data.getVar('__BBHANDLERS') or []:
|
||||
bb.event.register(var, data.getVar(var), (data.getVarFlag(var, "eventmask", True) or "").split())
|
||||
|
||||
if data.getVar("BB_WORKERCONTEXT", False) is None:
|
||||
bb.fetch.fetcher_init(data)
|
||||
bb.codeparser.parser_cache_init(data)
|
||||
bb.event.fire(bb.event.ConfigParsed(), data)
|
||||
|
||||
if data.getVar("BB_INVALIDCONF") is True:
|
||||
data.setVar("BB_INVALIDCONF", False)
|
||||
self.parseConfigurationFiles(self.prefiles, self.postfiles)
|
||||
return
|
||||
|
||||
bb.parse.init_parser(data)
|
||||
data.setVar('BBINCLUDED',bb.parse.get_file_depends(data))
|
||||
self.data = data
|
||||
self.data_hash = data.get_hash()
|
||||
|
||||
|
||||
return data
|
||||
|
||||
|
||||
@@ -1,14 +1,48 @@
|
||||
"""
|
||||
Python Daemonizing helper
|
||||
|
||||
Originally based on code Copyright (C) 2005 Chad J. Schroeder but now heavily modified
|
||||
to allow a function to be daemonized and return for bitbake use by Richard Purdie
|
||||
Configurable daemon behaviors:
|
||||
|
||||
1.) The current working directory set to the "/" directory.
|
||||
2.) The current file creation mode mask set to 0.
|
||||
3.) Close all open files (1024).
|
||||
4.) Redirect standard I/O streams to "/dev/null".
|
||||
|
||||
A failed call to fork() now raises an exception.
|
||||
|
||||
References:
|
||||
1) Advanced Programming in the Unix Environment: W. Richard Stevens
|
||||
http://www.apuebook.com/apue3e.html
|
||||
2) The Linux Programming Interface: Michael Kerrisk
|
||||
http://man7.org/tlpi/index.html
|
||||
3) Unix Programming Frequently Asked Questions:
|
||||
http://www.faqs.org/faqs/unix-faq/programmer/faq/
|
||||
|
||||
Modified to allow a function to be daemonized and return for
|
||||
bitbake use by Richard Purdie
|
||||
"""
|
||||
|
||||
import os
|
||||
import sys
|
||||
import io
|
||||
import traceback
|
||||
__author__ = "Chad J. Schroeder"
|
||||
__copyright__ = "Copyright (C) 2005 Chad J. Schroeder"
|
||||
__version__ = "0.2"
|
||||
|
||||
# Standard Python modules.
|
||||
import os # Miscellaneous OS interfaces.
|
||||
import sys # System-specific parameters and functions.
|
||||
|
||||
# Default daemon parameters.
|
||||
# File mode creation mask of the daemon.
|
||||
# For BitBake's children, we do want to inherit the parent umask.
|
||||
UMASK = None
|
||||
|
||||
# Default maximum for the number of available file descriptors.
|
||||
MAXFD = 1024
|
||||
|
||||
# The standard I/O file descriptors are redirected to /dev/null by default.
|
||||
if (hasattr(os, "devnull")):
|
||||
REDIRECT_TO = os.devnull
|
||||
else:
|
||||
REDIRECT_TO = "/dev/null"
|
||||
|
||||
def createDaemon(function, logfile):
|
||||
"""
|
||||
@@ -31,6 +65,36 @@ def createDaemon(function, logfile):
|
||||
# leader of the new process group, we call os.setsid(). The process is
|
||||
# also guaranteed not to have a controlling terminal.
|
||||
os.setsid()
|
||||
|
||||
# Is ignoring SIGHUP necessary?
|
||||
#
|
||||
# It's often suggested that the SIGHUP signal should be ignored before
|
||||
# the second fork to avoid premature termination of the process. The
|
||||
# reason is that when the first child terminates, all processes, e.g.
|
||||
# the second child, in the orphaned group will be sent a SIGHUP.
|
||||
#
|
||||
# "However, as part of the session management system, there are exactly
|
||||
# two cases where SIGHUP is sent on the death of a process:
|
||||
#
|
||||
# 1) When the process that dies is the session leader of a session that
|
||||
# is attached to a terminal device, SIGHUP is sent to all processes
|
||||
# in the foreground process group of that terminal device.
|
||||
# 2) When the death of a process causes a process group to become
|
||||
# orphaned, and one or more processes in the orphaned group are
|
||||
# stopped, then SIGHUP and SIGCONT are sent to all members of the
|
||||
# orphaned group." [2]
|
||||
#
|
||||
# The first case can be ignored since the child is guaranteed not to have
|
||||
# a controlling terminal. The second case isn't so easy to dismiss.
|
||||
# The process group is orphaned when the first child terminates and
|
||||
# POSIX.1 requires that every STOPPED process in an orphaned process
|
||||
# group be sent a SIGHUP signal followed by a SIGCONT signal. Since the
|
||||
# second child is not STOPPED though, we can safely forego ignoring the
|
||||
# SIGHUP signal. In any case, there are no ill-effects if it is ignored.
|
||||
#
|
||||
# import signal # Set handlers for asynchronous events.
|
||||
# signal.signal(signal.SIGHUP, signal.SIG_IGN)
|
||||
|
||||
try:
|
||||
# Fork a second child and exit immediately to prevent zombies. This
|
||||
# causes the second child process to be orphaned, making the init
|
||||
@@ -44,39 +108,86 @@ def createDaemon(function, logfile):
|
||||
except OSError as e:
|
||||
raise Exception("%s [%d]" % (e.strerror, e.errno))
|
||||
|
||||
if (pid != 0):
|
||||
if (pid == 0): # The second child.
|
||||
# We probably don't want the file mode creation mask inherited from
|
||||
# the parent, so we give the child complete control over permissions.
|
||||
if UMASK is not None:
|
||||
os.umask(UMASK)
|
||||
else:
|
||||
# Parent (the first child) of the second child.
|
||||
# exit() or _exit()?
|
||||
# _exit is like exit(), but it doesn't call any functions registered
|
||||
# with atexit (and on_exit) or any registered signal handlers. It also
|
||||
# closes any open file descriptors. Using exit() may cause all stdio
|
||||
# streams to be flushed twice and any temporary files may be unexpectedly
|
||||
# removed. It's therefore recommended that child branches of a fork()
|
||||
# and the parent branch(es) of a daemon use _exit().
|
||||
os._exit(0)
|
||||
else:
|
||||
os.waitpid(pid, 0)
|
||||
# exit() or _exit()?
|
||||
# _exit is like exit(), but it doesn't call any functions registered
|
||||
# with atexit (and on_exit) or any registered signal handlers. It also
|
||||
# closes any open file descriptors. Using exit() may cause all stdio
|
||||
# streams to be flushed twice and any temporary files may be unexpectedly
|
||||
# removed. It's therefore recommended that child branches of a fork()
|
||||
# and the parent branch(es) of a daemon use _exit().
|
||||
return
|
||||
|
||||
# The second child.
|
||||
# Close all open file descriptors. This prevents the child from keeping
|
||||
# open any file descriptors inherited from the parent. There is a variety
|
||||
# of methods to accomplish this task. Three are listed below.
|
||||
#
|
||||
# Try the system configuration variable, SC_OPEN_MAX, to obtain the maximum
|
||||
# number of open file descriptors to close. If it doesn't exist, use
|
||||
# the default value (configurable).
|
||||
#
|
||||
# try:
|
||||
# maxfd = os.sysconf("SC_OPEN_MAX")
|
||||
# except (AttributeError, ValueError):
|
||||
# maxfd = MAXFD
|
||||
#
|
||||
# OR
|
||||
#
|
||||
# if (os.sysconf_names.has_key("SC_OPEN_MAX")):
|
||||
# maxfd = os.sysconf("SC_OPEN_MAX")
|
||||
# else:
|
||||
# maxfd = MAXFD
|
||||
#
|
||||
# OR
|
||||
#
|
||||
# Use the getrlimit method to retrieve the maximum file descriptor number
|
||||
# that can be opened by this process. If there is no limit on the
|
||||
# resource, use the default value.
|
||||
#
|
||||
import resource # Resource usage information.
|
||||
maxfd = resource.getrlimit(resource.RLIMIT_NOFILE)[1]
|
||||
if (maxfd == resource.RLIM_INFINITY):
|
||||
maxfd = MAXFD
|
||||
|
||||
# Iterate through and close all file descriptors.
|
||||
# for fd in range(0, maxfd):
|
||||
# try:
|
||||
# os.close(fd)
|
||||
# except OSError: # ERROR, fd wasn't open to begin with (ignored)
|
||||
# pass
|
||||
|
||||
# Replace standard fds with our own
|
||||
si = open('/dev/null', 'r')
|
||||
# Redirect the standard I/O file descriptors to the specified file. Since
|
||||
# the daemon has no controlling terminal, most daemons redirect stdin,
|
||||
# stdout, and stderr to /dev/null. This is done to prevent side-effects
|
||||
# from reads and writes to the standard I/O file descriptors.
|
||||
|
||||
# This call to open is guaranteed to return the lowest file descriptor,
|
||||
# which will be 0 (stdin), since it was closed above.
|
||||
# os.open(REDIRECT_TO, os.O_RDWR) # standard input (0)
|
||||
|
||||
# Duplicate standard input to standard output and standard error.
|
||||
# os.dup2(0, 1) # standard output (1)
|
||||
# os.dup2(0, 2) # standard error (2)
|
||||
|
||||
|
||||
si = file('/dev/null', 'r')
|
||||
so = file(logfile, 'w')
|
||||
se = so
|
||||
|
||||
|
||||
# Replace those fds with our own
|
||||
os.dup2(si.fileno(), sys.stdin.fileno())
|
||||
os.dup2(so.fileno(), sys.stdout.fileno())
|
||||
os.dup2(se.fileno(), sys.stderr.fileno())
|
||||
|
||||
try:
|
||||
so = open(logfile, 'a+')
|
||||
se = so
|
||||
os.dup2(so.fileno(), sys.stdout.fileno())
|
||||
os.dup2(se.fileno(), sys.stderr.fileno())
|
||||
except io.UnsupportedOperation:
|
||||
sys.stdout = open(logfile, 'a+')
|
||||
sys.stderr = sys.stdout
|
||||
function()
|
||||
|
||||
try:
|
||||
function()
|
||||
except Exception as e:
|
||||
traceback.print_exc()
|
||||
finally:
|
||||
bb.event.print_ui_queue()
|
||||
os._exit(0)
|
||||
os._exit(0)
|
||||
|
||||
@@ -78,6 +78,59 @@ def initVar(var, d):
|
||||
"""Non-destructive var init for data structure"""
|
||||
d.initVar(var)
|
||||
|
||||
|
||||
def setVar(var, value, d):
|
||||
"""Set a variable to a given value"""
|
||||
d.setVar(var, value)
|
||||
|
||||
|
||||
def getVar(var, d, exp = 0):
|
||||
"""Gets the value of a variable"""
|
||||
return d.getVar(var, exp)
|
||||
|
||||
|
||||
def renameVar(key, newkey, d):
|
||||
"""Renames a variable from key to newkey"""
|
||||
d.renameVar(key, newkey)
|
||||
|
||||
def delVar(var, d):
|
||||
"""Removes a variable from the data set"""
|
||||
d.delVar(var)
|
||||
|
||||
def appendVar(var, value, d):
|
||||
"""Append additional value to a variable"""
|
||||
d.appendVar(var, value)
|
||||
|
||||
def setVarFlag(var, flag, flagvalue, d):
|
||||
"""Set a flag for a given variable to a given value"""
|
||||
d.setVarFlag(var, flag, flagvalue)
|
||||
|
||||
def getVarFlag(var, flag, d):
|
||||
"""Gets given flag from given var"""
|
||||
return d.getVarFlag(var, flag)
|
||||
|
||||
def delVarFlag(var, flag, d):
|
||||
"""Removes a given flag from the variable's flags"""
|
||||
d.delVarFlag(var, flag)
|
||||
|
||||
def setVarFlags(var, flags, d):
|
||||
"""Set the flags for a given variable
|
||||
|
||||
Note:
|
||||
setVarFlags will not clear previous
|
||||
flags. Think of this method as
|
||||
addVarFlags
|
||||
"""
|
||||
d.setVarFlags(var, flags)
|
||||
|
||||
def getVarFlags(var, d):
|
||||
"""Gets a variable's flags"""
|
||||
return d.getVarFlags(var)
|
||||
|
||||
def delVarFlags(var, d):
|
||||
"""Removes a variable's flags"""
|
||||
d.delVarFlags(var)
|
||||
|
||||
def keys(d):
|
||||
"""Return a list of keys in d"""
|
||||
return d.keys()
|
||||
@@ -106,12 +159,13 @@ def expandKeys(alterdata, readdata = None):
|
||||
|
||||
# These two for loops are split for performance to maximise the
|
||||
# usefulness of the expand cache
|
||||
for key in sorted(todolist):
|
||||
|
||||
for key in todolist:
|
||||
ekey = todolist[key]
|
||||
newval = alterdata.getVar(ekey, False)
|
||||
if newval is not None:
|
||||
val = alterdata.getVar(key, False)
|
||||
if val is not None:
|
||||
newval = alterdata.getVar(ekey, 0)
|
||||
if newval:
|
||||
val = alterdata.getVar(key, 0)
|
||||
if val is not None and newval is not None:
|
||||
bb.warn("Variable key %s (%s) replaces original key %s (%s)." % (key, val, ekey, newval))
|
||||
alterdata.renameVar(key, ekey)
|
||||
|
||||
@@ -121,7 +175,7 @@ def inheritFromOS(d, savedenv, permitted):
|
||||
for s in savedenv.keys():
|
||||
if s in permitted:
|
||||
try:
|
||||
d.setVar(s, savedenv.getVar(s), op = 'from env')
|
||||
d.setVar(s, getVar(s, savedenv, True), op = 'from env')
|
||||
if s in exportlist:
|
||||
d.setVarFlag(s, "export", True, op = 'auto env export')
|
||||
except TypeError:
|
||||
@@ -129,39 +183,39 @@ def inheritFromOS(d, savedenv, permitted):
|
||||
|
||||
def emit_var(var, o=sys.__stdout__, d = init(), all=False):
|
||||
"""Emit a variable to be sourced by a shell."""
|
||||
func = d.getVarFlag(var, "func", False)
|
||||
if d.getVarFlag(var, 'python', False) and func:
|
||||
return False
|
||||
if getVarFlag(var, "python", d):
|
||||
return 0
|
||||
|
||||
export = d.getVarFlag(var, "export", False)
|
||||
unexport = d.getVarFlag(var, "unexport", False)
|
||||
export = getVarFlag(var, "export", d)
|
||||
unexport = getVarFlag(var, "unexport", d)
|
||||
func = getVarFlag(var, "func", d)
|
||||
if not all and not export and not unexport and not func:
|
||||
return False
|
||||
return 0
|
||||
|
||||
try:
|
||||
if all:
|
||||
oval = d.getVar(var, False)
|
||||
val = d.getVar(var)
|
||||
oval = getVar(var, d, 0)
|
||||
val = getVar(var, d, 1)
|
||||
except (KeyboardInterrupt, bb.build.FuncFailed):
|
||||
raise
|
||||
except Exception as exc:
|
||||
o.write('# expansion of %s threw %s: %s\n' % (var, exc.__class__.__name__, str(exc)))
|
||||
return False
|
||||
return 0
|
||||
|
||||
if all:
|
||||
d.varhistory.emit(var, oval, val, o, d)
|
||||
d.varhistory.emit(var, oval, val, o)
|
||||
|
||||
if (var.find("-") != -1 or var.find(".") != -1 or var.find('{') != -1 or var.find('}') != -1 or var.find('+') != -1) and not all:
|
||||
return False
|
||||
return 0
|
||||
|
||||
varExpanded = d.expand(var)
|
||||
varExpanded = expand(var, d)
|
||||
|
||||
if unexport:
|
||||
o.write('unset %s\n' % varExpanded)
|
||||
return False
|
||||
return 0
|
||||
|
||||
if val is None:
|
||||
return False
|
||||
return 0
|
||||
|
||||
val = str(val)
|
||||
|
||||
@@ -170,11 +224,10 @@ def emit_var(var, o=sys.__stdout__, d = init(), all=False):
|
||||
val = val[3:] # Strip off "() "
|
||||
o.write("%s() %s\n" % (varExpanded, val))
|
||||
o.write("export -f %s\n" % (varExpanded))
|
||||
return True
|
||||
return 1
|
||||
|
||||
if func:
|
||||
# NOTE: should probably check for unbalanced {} within the var
|
||||
val = val.rstrip('\n')
|
||||
o.write("%s() {\n%s\n}\n" % (varExpanded, val))
|
||||
return 1
|
||||
|
||||
@@ -187,31 +240,29 @@ def emit_var(var, o=sys.__stdout__, d = init(), all=False):
|
||||
alter = re.sub('\n', ' \\\n', alter)
|
||||
alter = re.sub('\\$', '\\\\$', alter)
|
||||
o.write('%s="%s"\n' % (varExpanded, alter))
|
||||
return False
|
||||
return 0
|
||||
|
||||
def emit_env(o=sys.__stdout__, d = init(), all=False):
|
||||
"""Emits all items in the data store in a format such that it can be sourced by a shell."""
|
||||
|
||||
isfunc = lambda key: bool(d.getVarFlag(key, "func", False))
|
||||
isfunc = lambda key: bool(d.getVarFlag(key, "func"))
|
||||
keys = sorted((key for key in d.keys() if not key.startswith("__")), key=isfunc)
|
||||
grouped = groupby(keys, isfunc)
|
||||
for isfunc, keys in grouped:
|
||||
for key in sorted(keys):
|
||||
for key in keys:
|
||||
emit_var(key, o, d, all and not isfunc) and o.write('\n')
|
||||
|
||||
def exported_keys(d):
|
||||
return (key for key in d.keys() if not key.startswith('__') and
|
||||
d.getVarFlag(key, 'export', False) and
|
||||
not d.getVarFlag(key, 'unexport', False))
|
||||
d.getVarFlag(key, 'export') and
|
||||
not d.getVarFlag(key, 'unexport'))
|
||||
|
||||
def exported_vars(d):
|
||||
k = list(exported_keys(d))
|
||||
for key in k:
|
||||
for key in exported_keys(d):
|
||||
try:
|
||||
value = d.getVar(key)
|
||||
except Exception as err:
|
||||
bb.warn("%s: Unable to export ${%s}: %s" % (d.getVar("FILE"), key, err))
|
||||
continue
|
||||
value = d.getVar(key, True)
|
||||
except Exception:
|
||||
pass
|
||||
|
||||
if value is not None:
|
||||
yield key, str(value)
|
||||
@@ -219,24 +270,23 @@ def exported_vars(d):
|
||||
def emit_func(func, o=sys.__stdout__, d = init()):
|
||||
"""Emits all items in the data store in a format such that it can be sourced by a shell."""
|
||||
|
||||
keys = (key for key in d.keys() if not key.startswith("__") and not d.getVarFlag(key, "func", False))
|
||||
for key in sorted(keys):
|
||||
emit_var(key, o, d, False)
|
||||
keys = (key for key in d.keys() if not key.startswith("__") and not d.getVarFlag(key, "func"))
|
||||
for key in keys:
|
||||
emit_var(key, o, d, False) and o.write('\n')
|
||||
|
||||
o.write('\n')
|
||||
emit_var(func, o, d, False) and o.write('\n')
|
||||
newdeps = bb.codeparser.ShellParser(func, logger).parse_shell(d.getVar(func))
|
||||
newdeps |= set((d.getVarFlag(func, "vardeps") or "").split())
|
||||
newdeps = bb.codeparser.ShellParser(func, logger).parse_shell(d.getVar(func, True))
|
||||
newdeps |= set((d.getVarFlag(func, "vardeps", True) or "").split())
|
||||
seen = set()
|
||||
while newdeps:
|
||||
deps = newdeps
|
||||
seen |= deps
|
||||
newdeps = set()
|
||||
for dep in deps:
|
||||
if d.getVarFlag(dep, "func", False) and not d.getVarFlag(dep, "python", False):
|
||||
if d.getVarFlag(dep, "func") and not d.getVarFlag(dep, "python"):
|
||||
emit_var(dep, o, d, False) and o.write('\n')
|
||||
newdeps |= bb.codeparser.ShellParser(dep, logger).parse_shell(d.getVar(dep))
|
||||
newdeps |= set((d.getVarFlag(dep, "vardeps") or "").split())
|
||||
newdeps |= bb.codeparser.ShellParser(dep, logger).parse_shell(d.getVar(dep, True))
|
||||
newdeps |= set((d.getVarFlag(dep, "vardeps", True) or "").split())
|
||||
newdeps -= seen
|
||||
|
||||
_functionfmt = """
|
||||
@@ -247,7 +297,7 @@ def emit_func_python(func, o=sys.__stdout__, d = init()):
|
||||
"""Emits all items in the data store in a format such that it can be sourced by a shell."""
|
||||
|
||||
def write_func(func, o, call = False):
|
||||
body = d.getVar(func, False)
|
||||
body = d.getVar(func, True)
|
||||
if not body.startswith("def"):
|
||||
body = _functionfmt.format(function=func, body=body)
|
||||
|
||||
@@ -257,21 +307,21 @@ def emit_func_python(func, o=sys.__stdout__, d = init()):
|
||||
|
||||
write_func(func, o, True)
|
||||
pp = bb.codeparser.PythonParser(func, logger)
|
||||
pp.parse_python(d.getVar(func, False))
|
||||
pp.parse_python(d.getVar(func, True))
|
||||
newdeps = pp.execs
|
||||
newdeps |= set((d.getVarFlag(func, "vardeps") or "").split())
|
||||
newdeps |= set((d.getVarFlag(func, "vardeps", True) or "").split())
|
||||
seen = set()
|
||||
while newdeps:
|
||||
deps = newdeps
|
||||
seen |= deps
|
||||
newdeps = set()
|
||||
for dep in deps:
|
||||
if d.getVarFlag(dep, "func", False) and d.getVarFlag(dep, "python", False):
|
||||
if d.getVarFlag(dep, "func") and d.getVarFlag(dep, "python"):
|
||||
write_func(dep, o)
|
||||
pp = bb.codeparser.PythonParser(dep, logger)
|
||||
pp.parse_python(d.getVar(dep, False))
|
||||
pp.parse_python(d.getVar(dep, True))
|
||||
newdeps |= pp.execs
|
||||
newdeps |= set((d.getVarFlag(dep, "vardeps") or "").split())
|
||||
newdeps |= set((d.getVarFlag(dep, "vardeps", True) or "").split())
|
||||
newdeps -= seen
|
||||
|
||||
def update_data(d):
|
||||
@@ -288,21 +338,19 @@ def build_dependencies(key, keys, shelldeps, varflagsexcl, d):
|
||||
deps |= parser.references
|
||||
deps = deps | (keys & parser.execs)
|
||||
return deps, value
|
||||
varflags = d.getVarFlags(key, ["vardeps", "vardepvalue", "vardepsexclude", "exports", "postfuncs", "prefuncs", "lineno", "filename"]) or {}
|
||||
varflags = d.getVarFlags(key, ["vardeps", "vardepvalue", "vardepsexclude", "vardepvalueexclude", "postfuncs", "prefuncs"]) or {}
|
||||
vardeps = varflags.get("vardeps")
|
||||
value = d.getVarFlag(key, "_content", False)
|
||||
value = d.getVar(key, False)
|
||||
|
||||
def handle_contains(value, contains, d):
|
||||
newvalue = ""
|
||||
for k in sorted(contains):
|
||||
l = (d.getVar(k) or "").split()
|
||||
for item in sorted(contains[k]):
|
||||
for word in item.split():
|
||||
if not word in l:
|
||||
newvalue += "\n%s{%s} = Unset" % (k, item)
|
||||
break
|
||||
l = (d.getVar(k, True) or "").split()
|
||||
for word in sorted(contains[k]):
|
||||
if word in l:
|
||||
newvalue += "\n%s{%s} = Set" % (k, word)
|
||||
else:
|
||||
newvalue += "\n%s{%s} = Set" % (k, item)
|
||||
newvalue += "\n%s{%s} = Unset" % (k, word)
|
||||
if not newvalue:
|
||||
return value
|
||||
if not value:
|
||||
@@ -313,29 +361,27 @@ def build_dependencies(key, keys, shelldeps, varflagsexcl, d):
|
||||
value = varflags.get("vardepvalue")
|
||||
elif varflags.get("func"):
|
||||
if varflags.get("python"):
|
||||
parsedvar = d.expandWithRefs(value, key)
|
||||
parser = bb.codeparser.PythonParser(key, logger)
|
||||
if value and "\t" in value:
|
||||
logger.warning("Variable %s contains tabs, please remove these (%s)" % (key, d.getVar("FILE")))
|
||||
parser.parse_python(value, filename=varflags.get("filename"), lineno=varflags.get("lineno"))
|
||||
if parsedvar.value and "\t" in parsedvar.value:
|
||||
logger.warn("Variable %s contains tabs, please remove these (%s)" % (key, d.getVar("FILE", True)))
|
||||
parser.parse_python(parsedvar.value)
|
||||
deps = deps | parser.references
|
||||
deps = deps | (keys & parser.execs)
|
||||
value = handle_contains(value, parser.contains, d)
|
||||
else:
|
||||
parsedvar = d.expandWithRefs(value, key)
|
||||
parser = bb.codeparser.ShellParser(key, logger)
|
||||
parser.parse_shell(parsedvar.value)
|
||||
deps = deps | shelldeps
|
||||
deps = deps | parsedvar.references
|
||||
deps = deps | (keys & parser.execs) | (keys & parsedvar.execs)
|
||||
value = handle_contains(value, parsedvar.contains, d)
|
||||
if vardeps is None:
|
||||
parser.log.flush()
|
||||
if "prefuncs" in varflags:
|
||||
deps = deps | set(varflags["prefuncs"].split())
|
||||
if "postfuncs" in varflags:
|
||||
deps = deps | set(varflags["postfuncs"].split())
|
||||
if "exports" in varflags:
|
||||
deps = deps | set(varflags["exports"].split())
|
||||
deps = deps | parsedvar.references
|
||||
deps = deps | (keys & parser.execs) | (keys & parsedvar.execs)
|
||||
value = handle_contains(value, parsedvar.contains, d)
|
||||
else:
|
||||
parser = d.expandWithRefs(value, key)
|
||||
deps |= parser.references
|
||||
@@ -359,11 +405,8 @@ def build_dependencies(key, keys, shelldeps, varflagsexcl, d):
|
||||
|
||||
deps |= set((vardeps or "").split())
|
||||
deps -= set(varflags.get("vardepsexclude", "").split())
|
||||
except bb.parse.SkipRecipe:
|
||||
raise
|
||||
except Exception as e:
|
||||
bb.warn("Exception during build_dependencies for %s" % key)
|
||||
raise
|
||||
raise bb.data_smart.ExpansionError(key, None, e)
|
||||
return deps, value
|
||||
#bb.note("Variable %s references %s and calls %s" % (key, str(deps), str(execs)))
|
||||
#d.setVarFlag(key, "vardeps", deps)
|
||||
@@ -371,13 +414,13 @@ def build_dependencies(key, keys, shelldeps, varflagsexcl, d):
|
||||
def generate_dependencies(d):
|
||||
|
||||
keys = set(key for key in d if not key.startswith("__"))
|
||||
shelldeps = set(key for key in d.getVar("__exportlist", False) if d.getVarFlag(key, "export", False) and not d.getVarFlag(key, "unexport", False))
|
||||
varflagsexcl = d.getVar('BB_SIGNATURE_EXCLUDE_FLAGS')
|
||||
shelldeps = set(key for key in d.getVar("__exportlist", False) if d.getVarFlag(key, "export") and not d.getVarFlag(key, "unexport"))
|
||||
varflagsexcl = d.getVar('BB_SIGNATURE_EXCLUDE_FLAGS', True)
|
||||
|
||||
deps = {}
|
||||
values = {}
|
||||
|
||||
tasklist = d.getVar('__BBTASKS', False) or []
|
||||
tasklist = d.getVar('__BBTASKS') or []
|
||||
for task in tasklist:
|
||||
deps[task], values[task] = build_dependencies(task, keys, shelldeps, varflagsexcl, d)
|
||||
newdeps = deps[task]
|
||||
@@ -395,7 +438,7 @@ def generate_dependencies(d):
|
||||
return tasklist, deps, values
|
||||
|
||||
def inherits_class(klass, d):
|
||||
val = d.getVar('__inherit_cache', False) or []
|
||||
val = getVar('__inherit_cache', d) or []
|
||||
needle = os.path.join('classes', '%s.bbclass' % klass)
|
||||
for v in val:
|
||||
if v.endswith(needle):
|
||||
|
||||
@@ -39,8 +39,8 @@ from bb.COW import COWDictBase
|
||||
logger = logging.getLogger("BitBake.Data")
|
||||
|
||||
__setvar_keyword__ = ["_append", "_prepend", "_remove"]
|
||||
__setvar_regexp__ = re.compile('(?P<base>.*?)(?P<keyword>_append|_prepend|_remove)(_(?P<add>[^A-Z]*))?$')
|
||||
__expand_var_regexp__ = re.compile(r"\${[^{}@\n\t :]+}")
|
||||
__setvar_regexp__ = re.compile('(?P<base>.*?)(?P<keyword>_append|_prepend|_remove)(_(?P<add>.*))?$')
|
||||
__expand_var_regexp__ = re.compile(r"\${[^{}@\n\t ]+}")
|
||||
__expand_python_regexp__ = re.compile(r"\${@.+?}")
|
||||
|
||||
def infer_caller_details(loginfo, parent = False, varval = True):
|
||||
@@ -54,36 +54,27 @@ def infer_caller_details(loginfo, parent = False, varval = True):
|
||||
return
|
||||
# Infer caller's likely values for variable (var) and value (value),
|
||||
# to reduce clutter in the rest of the code.
|
||||
above = None
|
||||
def set_above():
|
||||
if varval and ('variable' not in loginfo or 'detail' not in loginfo):
|
||||
try:
|
||||
raise Exception
|
||||
except Exception:
|
||||
tb = sys.exc_info()[2]
|
||||
if parent:
|
||||
return tb.tb_frame.f_back.f_back.f_back
|
||||
above = tb.tb_frame.f_back.f_back
|
||||
else:
|
||||
return tb.tb_frame.f_back.f_back
|
||||
|
||||
if varval and ('variable' not in loginfo or 'detail' not in loginfo):
|
||||
if not above:
|
||||
above = set_above()
|
||||
lcls = above.f_locals.items()
|
||||
above = tb.tb_frame.f_back
|
||||
lcls = above.f_locals.items()
|
||||
for k, v in lcls:
|
||||
if k == 'value' and 'detail' not in loginfo:
|
||||
loginfo['detail'] = v
|
||||
if k == 'var' and 'variable' not in loginfo:
|
||||
loginfo['variable'] = v
|
||||
# Infer file/line/function from traceback
|
||||
# Don't use traceback.extract_stack() since it fills the line contents which
|
||||
# we don't need and that hits stat syscalls
|
||||
if 'file' not in loginfo:
|
||||
if not above:
|
||||
above = set_above()
|
||||
f = above.f_back
|
||||
line = f.f_lineno
|
||||
file = f.f_code.co_filename
|
||||
func = f.f_code.co_name
|
||||
depth = 3
|
||||
if parent:
|
||||
depth = 4
|
||||
file, line, func, text = traceback.extract_stack(limit = depth)[0]
|
||||
loginfo['file'] = file
|
||||
loginfo['line'] = line
|
||||
if func not in loginfo:
|
||||
@@ -108,7 +99,7 @@ class VariableParse:
|
||||
varparse = self.d.expand_cache[key]
|
||||
var = varparse.value
|
||||
else:
|
||||
var = self.d.getVarFlag(key, "_content")
|
||||
var = self.d.getVarFlag(key, "_content", True)
|
||||
self.references.add(key)
|
||||
if var is not None:
|
||||
return var
|
||||
@@ -116,21 +107,13 @@ class VariableParse:
|
||||
return match.group()
|
||||
|
||||
def python_sub(self, match):
|
||||
if isinstance(match, str):
|
||||
code = match
|
||||
else:
|
||||
code = match.group()[3:-1]
|
||||
|
||||
if "_remote_data" in self.d:
|
||||
connector = self.d["_remote_data"]
|
||||
return connector.expandPythonRef(self.varname, code, self.d)
|
||||
|
||||
code = match.group()[3:-1]
|
||||
codeobj = compile(code.strip(), self.varname or "<expansion>", "eval")
|
||||
|
||||
parser = bb.codeparser.PythonParser(self.varname, logger)
|
||||
parser.parse_python(code)
|
||||
if self.varname:
|
||||
vardeps = self.d.getVarFlag(self.varname, "vardeps")
|
||||
vardeps = self.d.getVarFlag(self.varname, "vardeps", True)
|
||||
if vardeps is None:
|
||||
parser.log.flush()
|
||||
else:
|
||||
@@ -143,7 +126,7 @@ class VariableParse:
|
||||
self.contains[k] = parser.contains[k].copy()
|
||||
else:
|
||||
self.contains[k].update(parser.contains[k])
|
||||
value = utils.better_eval(codeobj, DataContext(self.d), {'d' : self.d})
|
||||
value = utils.better_eval(codeobj, DataContext(self.d))
|
||||
return str(value)
|
||||
|
||||
|
||||
@@ -154,8 +137,8 @@ class DataContext(dict):
|
||||
self['d'] = metadata
|
||||
|
||||
def __missing__(self, key):
|
||||
value = self.metadata.getVar(key)
|
||||
if value is None or self.metadata.getVarFlag(key, 'func', False):
|
||||
value = self.metadata.getVar(key, True)
|
||||
if value is None or self.metadata.getVarFlag(key, 'func'):
|
||||
raise KeyError(key)
|
||||
else:
|
||||
return value
|
||||
@@ -230,19 +213,6 @@ class VariableHistory(object):
|
||||
new.variables = self.variables.copy()
|
||||
return new
|
||||
|
||||
def __getstate__(self):
|
||||
vardict = {}
|
||||
for k, v in self.variables.iteritems():
|
||||
vardict[k] = v
|
||||
return {'dataroot': self.dataroot,
|
||||
'variables': vardict}
|
||||
|
||||
def __setstate__(self, state):
|
||||
self.dataroot = state['dataroot']
|
||||
self.variables = COWDictBase.copy()
|
||||
for k, v in state['variables'].items():
|
||||
self.variables[k] = v
|
||||
|
||||
def record(self, *kwonly, **loginfo):
|
||||
if not self.dataroot._tracking:
|
||||
return
|
||||
@@ -261,37 +231,16 @@ class VariableHistory(object):
|
||||
|
||||
if var not in self.variables:
|
||||
self.variables[var] = []
|
||||
if not isinstance(self.variables[var], list):
|
||||
return
|
||||
if 'nodups' in loginfo and loginfo in self.variables[var]:
|
||||
return
|
||||
self.variables[var].append(loginfo.copy())
|
||||
|
||||
def variable(self, var):
|
||||
remote_connector = self.dataroot.getVar('_remote_data', False)
|
||||
if remote_connector:
|
||||
varhistory = remote_connector.getVarHistory(var)
|
||||
else:
|
||||
varhistory = []
|
||||
|
||||
if var in self.variables:
|
||||
varhistory.extend(self.variables[var])
|
||||
return varhistory
|
||||
return self.variables[var]
|
||||
else:
|
||||
return []
|
||||
|
||||
def emit(self, var, oval, val, o, d):
|
||||
def emit(self, var, oval, val, o):
|
||||
history = self.variable(var)
|
||||
|
||||
# Append override history
|
||||
if var in d.overridedata:
|
||||
for (r, override) in d.overridedata[var]:
|
||||
for event in self.variable(r):
|
||||
loginfo = event.copy()
|
||||
if 'flag' in loginfo and not loginfo['flag'].startswith("_"):
|
||||
continue
|
||||
loginfo['variable'] = var
|
||||
loginfo['op'] = 'override[%s]:%s' % (override, loginfo['op'])
|
||||
history.append(loginfo)
|
||||
|
||||
commentVal = re.sub('\n', '\n#', str(oval))
|
||||
if history:
|
||||
if len(history) == 1:
|
||||
@@ -338,31 +287,6 @@ class VariableHistory(object):
|
||||
lines.append(line)
|
||||
return lines
|
||||
|
||||
def get_variable_items_files(self, var, d):
|
||||
"""
|
||||
Use variable history to map items added to a list variable and
|
||||
the files in which they were added.
|
||||
"""
|
||||
history = self.variable(var)
|
||||
finalitems = (d.getVar(var) or '').split()
|
||||
filemap = {}
|
||||
isset = False
|
||||
for event in history:
|
||||
if 'flag' in event:
|
||||
continue
|
||||
if event['op'] == '_remove':
|
||||
continue
|
||||
if isset and event['op'] == 'set?':
|
||||
continue
|
||||
isset = True
|
||||
items = d.expand(event['detail']).split()
|
||||
for item in items:
|
||||
# This is a little crude but is belt-and-braces to avoid us
|
||||
# having to handle every possible operation type specifically
|
||||
if item in finalitems and not item in filemap:
|
||||
filemap[item] = event['file']
|
||||
return filemap
|
||||
|
||||
def del_var_history(self, var, f=None, line=None):
|
||||
"""If file f and line are not given, the entire history of var is deleted"""
|
||||
if var in self.variables:
|
||||
@@ -372,23 +296,18 @@ class VariableHistory(object):
|
||||
self.variables[var] = []
|
||||
|
||||
class DataSmart(MutableMapping):
|
||||
def __init__(self):
|
||||
def __init__(self, special = COWDictBase.copy(), seen = COWDictBase.copy() ):
|
||||
self.dict = {}
|
||||
|
||||
self.inchistory = IncludeHistory()
|
||||
self.varhistory = VariableHistory(self)
|
||||
self._tracking = False
|
||||
|
||||
self.expand_cache = {}
|
||||
|
||||
# cookie monster tribute
|
||||
# Need to be careful about writes to overridedata as
|
||||
# its only a shallow copy, could influence other data store
|
||||
# copies!
|
||||
self.overridedata = {}
|
||||
self.overrides = None
|
||||
self.overridevars = set(["OVERRIDES", "FILE"])
|
||||
self.inoverride = False
|
||||
self._special_values = special
|
||||
self._seen_overrides = seen
|
||||
|
||||
self.expand_cache = {}
|
||||
|
||||
def enableTracking(self):
|
||||
self._tracking = True
|
||||
@@ -398,7 +317,7 @@ class DataSmart(MutableMapping):
|
||||
|
||||
def expandWithRefs(self, s, varname):
|
||||
|
||||
if not isinstance(s, str): # sanity check
|
||||
if not isinstance(s, basestring): # sanity check
|
||||
return VariableParse(varname, self, s)
|
||||
|
||||
if varname and varname in self.expand_cache:
|
||||
@@ -410,12 +329,7 @@ class DataSmart(MutableMapping):
|
||||
olds = s
|
||||
try:
|
||||
s = __expand_var_regexp__.sub(varparse.var_sub, s)
|
||||
try:
|
||||
s = __expand_python_regexp__.sub(varparse.python_sub, s)
|
||||
except SyntaxError as e:
|
||||
# Likely unmatched brackets, just don't expand the expression
|
||||
if e.msg != "EOL while scanning string literal":
|
||||
raise
|
||||
s = __expand_python_regexp__.sub(varparse.python_sub, s)
|
||||
if s == olds:
|
||||
break
|
||||
except ExpansionError:
|
||||
@@ -423,7 +337,7 @@ class DataSmart(MutableMapping):
|
||||
except bb.parse.SkipRecipe:
|
||||
raise
|
||||
except Exception as exc:
|
||||
raise ExpansionError(varname, s, exc) from exc
|
||||
raise ExpansionError(varname, s, exc)
|
||||
|
||||
varparse.value = s
|
||||
|
||||
@@ -435,34 +349,97 @@ class DataSmart(MutableMapping):
|
||||
def expand(self, s, varname = None):
|
||||
return self.expandWithRefs(s, varname).value
|
||||
|
||||
|
||||
def finalize(self, parent = False):
|
||||
return
|
||||
|
||||
def internal_finalize(self, parent = False):
|
||||
"""Performs final steps upon the datastore, including application of overrides"""
|
||||
self.overrides = None
|
||||
|
||||
def need_overrides(self):
|
||||
if self.overrides is not None:
|
||||
return
|
||||
if self.inoverride:
|
||||
return
|
||||
for count in range(5):
|
||||
self.inoverride = True
|
||||
# Can end up here recursively so setup dummy values
|
||||
self.overrides = []
|
||||
self.overridesset = set()
|
||||
self.overrides = (self.getVar("OVERRIDES") or "").split(":") or []
|
||||
self.overridesset = set(self.overrides)
|
||||
self.inoverride = False
|
||||
self.expand_cache = {}
|
||||
newoverrides = (self.getVar("OVERRIDES") or "").split(":") or []
|
||||
if newoverrides == self.overrides:
|
||||
break
|
||||
self.overrides = newoverrides
|
||||
self.overridesset = set(self.overrides)
|
||||
else:
|
||||
bb.fatal("Overrides could not be expanded into a stable state after 5 iterations, overrides must be being referenced by other overridden variables in some recursive fashion. Please provide your configuration to bitbake-devel so we can laugh, er, I mean try and understand how to make it work.")
|
||||
overrides = (self.getVar("OVERRIDES", True) or "").split(":") or []
|
||||
finalize_caller = {
|
||||
'op': 'finalize',
|
||||
}
|
||||
infer_caller_details(finalize_caller, parent = parent, varval = False)
|
||||
|
||||
#
|
||||
# Well let us see what breaks here. We used to iterate
|
||||
# over each variable and apply the override and then
|
||||
# do the line expanding.
|
||||
# If we have bad luck - which we will have - the keys
|
||||
# where in some order that is so important for this
|
||||
# method which we don't have anymore.
|
||||
# Anyway we will fix that and write test cases this
|
||||
# time.
|
||||
|
||||
#
|
||||
# First we apply all overrides
|
||||
# Then we will handle _append and _prepend and store the _remove
|
||||
# information for later.
|
||||
#
|
||||
|
||||
# We only want to report finalization once per variable overridden.
|
||||
finalizes_reported = {}
|
||||
|
||||
for o in overrides:
|
||||
# calculate '_'+override
|
||||
l = len(o) + 1
|
||||
|
||||
# see if one should even try
|
||||
if o not in self._seen_overrides:
|
||||
continue
|
||||
|
||||
vars = self._seen_overrides[o].copy()
|
||||
for var in vars:
|
||||
name = var[:-l]
|
||||
try:
|
||||
# Report only once, even if multiple changes.
|
||||
if name not in finalizes_reported:
|
||||
finalizes_reported[name] = True
|
||||
finalize_caller['variable'] = name
|
||||
finalize_caller['detail'] = 'was: ' + str(self.getVar(name, False))
|
||||
self.varhistory.record(**finalize_caller)
|
||||
# Copy history of the override over.
|
||||
for event in self.varhistory.variable(var):
|
||||
loginfo = event.copy()
|
||||
loginfo['variable'] = name
|
||||
loginfo['op'] = 'override[%s]:%s' % (o, loginfo['op'])
|
||||
self.varhistory.record(**loginfo)
|
||||
self.setVar(name, self.getVar(var, False), op = 'finalize', file = 'override[%s]' % o, line = '')
|
||||
self.delVar(var)
|
||||
except Exception:
|
||||
logger.info("Untracked delVar")
|
||||
|
||||
# now on to the appends and prepends, and stashing the removes
|
||||
for op in __setvar_keyword__:
|
||||
if op in self._special_values:
|
||||
appends = self._special_values[op] or []
|
||||
for append in appends:
|
||||
keep = []
|
||||
for (a, o) in self.getVarFlag(append, op) or []:
|
||||
match = True
|
||||
if o:
|
||||
for o2 in o.split("_"):
|
||||
if not o2 in overrides:
|
||||
match = False
|
||||
if not match:
|
||||
keep.append((a ,o))
|
||||
continue
|
||||
|
||||
if op == "_append":
|
||||
sval = self.getVar(append, False) or ""
|
||||
sval += a
|
||||
self.setVar(append, sval)
|
||||
elif op == "_prepend":
|
||||
sval = a + (self.getVar(append, False) or "")
|
||||
self.setVar(append, sval)
|
||||
elif op == "_remove":
|
||||
removes = self.getVarFlag(append, "_removeactive", False) or []
|
||||
removes.extend(a.split())
|
||||
self.setVarFlag(append, "_removeactive", removes, ignore=True)
|
||||
|
||||
# We save overrides that may be applied at some later stage
|
||||
if keep:
|
||||
self.setVarFlag(append, op, keep, ignore=True)
|
||||
else:
|
||||
self.delVarFlag(append, op, ignore=True)
|
||||
|
||||
def initVar(self, var):
|
||||
self.expand_cache = {}
|
||||
@@ -473,22 +450,17 @@ class DataSmart(MutableMapping):
|
||||
dest = self.dict
|
||||
while dest:
|
||||
if var in dest:
|
||||
return dest[var], self.overridedata.get(var, None)
|
||||
|
||||
if "_remote_data" in dest:
|
||||
connector = dest["_remote_data"]["_content"]
|
||||
return connector.getVar(var)
|
||||
return dest[var]
|
||||
|
||||
if "_data" not in dest:
|
||||
break
|
||||
dest = dest["_data"]
|
||||
return None, self.overridedata.get(var, None)
|
||||
|
||||
def _makeShadowCopy(self, var):
|
||||
if var in self.dict:
|
||||
return
|
||||
|
||||
local_var, _ = self._findVar(var)
|
||||
local_var = self._findVar(var)
|
||||
|
||||
if local_var:
|
||||
self.dict[var] = copy.copy(local_var)
|
||||
@@ -498,16 +470,6 @@ class DataSmart(MutableMapping):
|
||||
|
||||
def setVar(self, var, value, **loginfo):
|
||||
#print("var=" + str(var) + " val=" + str(value))
|
||||
parsing=False
|
||||
if 'parsing' in loginfo:
|
||||
parsing=True
|
||||
|
||||
if '_remote_data' in self.dict:
|
||||
connector = self.dict["_remote_data"]["_content"]
|
||||
res = connector.setVar(var, value)
|
||||
if not res:
|
||||
return
|
||||
|
||||
if 'op' not in loginfo:
|
||||
loginfo['op'] = "set"
|
||||
self.expand_cache = {}
|
||||
@@ -516,7 +478,7 @@ class DataSmart(MutableMapping):
|
||||
base = match.group('base')
|
||||
keyword = match.group("keyword")
|
||||
override = match.group('add')
|
||||
l = self.getVarFlag(base, keyword, False) or []
|
||||
l = self.getVarFlag(base, keyword) or []
|
||||
l.append([value, override])
|
||||
self.setVarFlag(base, keyword, l, ignore=True)
|
||||
# And cause that to be recorded:
|
||||
@@ -529,119 +491,65 @@ class DataSmart(MutableMapping):
|
||||
self.varhistory.record(**loginfo)
|
||||
# todo make sure keyword is not __doc__ or __module__
|
||||
# pay the cookie monster
|
||||
try:
|
||||
self._special_values[keyword].add(base)
|
||||
except KeyError:
|
||||
self._special_values[keyword] = set()
|
||||
self._special_values[keyword].add(base)
|
||||
|
||||
# more cookies for the cookie monster
|
||||
if '_' in var:
|
||||
self._setvar_update_overrides(base, **loginfo)
|
||||
|
||||
if base in self.overridevars:
|
||||
self._setvar_update_overridevars(var, value)
|
||||
return
|
||||
|
||||
if not var in self.dict:
|
||||
self._makeShadowCopy(var)
|
||||
|
||||
if not parsing:
|
||||
if "_append" in self.dict[var]:
|
||||
del self.dict[var]["_append"]
|
||||
if "_prepend" in self.dict[var]:
|
||||
del self.dict[var]["_prepend"]
|
||||
if "_remove" in self.dict[var]:
|
||||
del self.dict[var]["_remove"]
|
||||
if var in self.overridedata:
|
||||
active = []
|
||||
self.need_overrides()
|
||||
for (r, o) in self.overridedata[var]:
|
||||
if o in self.overridesset:
|
||||
active.append(r)
|
||||
elif "_" in o:
|
||||
if set(o.split("_")).issubset(self.overridesset):
|
||||
active.append(r)
|
||||
for a in active:
|
||||
self.delVar(a)
|
||||
del self.overridedata[var]
|
||||
|
||||
# more cookies for the cookie monster
|
||||
if '_' in var:
|
||||
self._setvar_update_overrides(var, **loginfo)
|
||||
self._setvar_update_overrides(var)
|
||||
|
||||
# setting var
|
||||
self.dict[var]["_content"] = value
|
||||
self.varhistory.record(**loginfo)
|
||||
|
||||
if var in self.overridevars:
|
||||
self._setvar_update_overridevars(var, value)
|
||||
|
||||
def _setvar_update_overridevars(self, var, value):
|
||||
vardata = self.expandWithRefs(value, var)
|
||||
new = vardata.references
|
||||
new.update(vardata.contains.keys())
|
||||
while not new.issubset(self.overridevars):
|
||||
nextnew = set()
|
||||
self.overridevars.update(new)
|
||||
for i in new:
|
||||
vardata = self.expandWithRefs(self.getVar(i), i)
|
||||
nextnew.update(vardata.references)
|
||||
nextnew.update(vardata.contains.keys())
|
||||
new = nextnew
|
||||
self.internal_finalize(True)
|
||||
|
||||
def _setvar_update_overrides(self, var, **loginfo):
|
||||
def _setvar_update_overrides(self, var):
|
||||
# aka pay the cookie monster
|
||||
override = var[var.rfind('_')+1:]
|
||||
shortvar = var[:var.rfind('_')]
|
||||
while override and override.islower():
|
||||
if shortvar not in self.overridedata:
|
||||
self.overridedata[shortvar] = []
|
||||
if [var, override] not in self.overridedata[shortvar]:
|
||||
# Force CoW by recreating the list first
|
||||
self.overridedata[shortvar] = list(self.overridedata[shortvar])
|
||||
self.overridedata[shortvar].append([var, override])
|
||||
while override:
|
||||
if override not in self._seen_overrides:
|
||||
self._seen_overrides[override] = set()
|
||||
self._seen_overrides[override].add( var )
|
||||
override = None
|
||||
if "_" in shortvar:
|
||||
override = var[shortvar.rfind('_')+1:]
|
||||
shortvar = var[:shortvar.rfind('_')]
|
||||
if len(shortvar) == 0:
|
||||
override = None
|
||||
|
||||
def getVar(self, var, expand=True, noweakdefault=False, parsing=False):
|
||||
return self.getVarFlag(var, "_content", expand, noweakdefault, parsing)
|
||||
def getVar(self, var, expand=False, noweakdefault=False):
|
||||
return self.getVarFlag(var, "_content", expand, noweakdefault)
|
||||
|
||||
def renameVar(self, key, newkey, **loginfo):
|
||||
"""
|
||||
Rename the variable key to newkey
|
||||
"""
|
||||
if '_remote_data' in self.dict:
|
||||
connector = self.dict["_remote_data"]["_content"]
|
||||
res = connector.renameVar(key, newkey)
|
||||
if not res:
|
||||
return
|
||||
|
||||
val = self.getVar(key, 0, parsing=True)
|
||||
val = self.getVar(key, 0)
|
||||
if val is not None:
|
||||
loginfo['variable'] = newkey
|
||||
loginfo['op'] = 'rename from %s' % key
|
||||
loginfo['detail'] = val
|
||||
self.varhistory.record(**loginfo)
|
||||
self.setVar(newkey, val, ignore=True, parsing=True)
|
||||
self.setVar(newkey, val, ignore=True)
|
||||
|
||||
for i in (__setvar_keyword__):
|
||||
src = self.getVarFlag(key, i, False)
|
||||
src = self.getVarFlag(key, i)
|
||||
if src is None:
|
||||
continue
|
||||
|
||||
dest = self.getVarFlag(newkey, i, False) or []
|
||||
dest = self.getVarFlag(newkey, i) or []
|
||||
dest.extend(src)
|
||||
self.setVarFlag(newkey, i, dest, ignore=True)
|
||||
|
||||
if key in self.overridedata:
|
||||
self.overridedata[newkey] = []
|
||||
for (v, o) in self.overridedata[key]:
|
||||
self.overridedata[newkey].append([v.replace(key, newkey), o])
|
||||
self.renameVar(v, v.replace(key, newkey))
|
||||
|
||||
if '_' in newkey and val is None:
|
||||
self._setvar_update_overrides(newkey, **loginfo)
|
||||
if i in self._special_values and key in self._special_values[i]:
|
||||
self._special_values[i].remove(key)
|
||||
self._special_values[i].add(newkey)
|
||||
|
||||
loginfo['variable'] = key
|
||||
loginfo['op'] = 'rename (to)'
|
||||
@@ -652,53 +560,27 @@ class DataSmart(MutableMapping):
|
||||
def appendVar(self, var, value, **loginfo):
|
||||
loginfo['op'] = 'append'
|
||||
self.varhistory.record(**loginfo)
|
||||
self.setVar(var + "_append", value, ignore=True, parsing=True)
|
||||
newvalue = (self.getVar(var, False) or "") + value
|
||||
self.setVar(var, newvalue, ignore=True)
|
||||
|
||||
def prependVar(self, var, value, **loginfo):
|
||||
loginfo['op'] = 'prepend'
|
||||
self.varhistory.record(**loginfo)
|
||||
self.setVar(var + "_prepend", value, ignore=True, parsing=True)
|
||||
newvalue = value + (self.getVar(var, False) or "")
|
||||
self.setVar(var, newvalue, ignore=True)
|
||||
|
||||
def delVar(self, var, **loginfo):
|
||||
if '_remote_data' in self.dict:
|
||||
connector = self.dict["_remote_data"]["_content"]
|
||||
res = connector.delVar(var)
|
||||
if not res:
|
||||
return
|
||||
|
||||
loginfo['detail'] = ""
|
||||
loginfo['op'] = 'del'
|
||||
self.varhistory.record(**loginfo)
|
||||
self.expand_cache = {}
|
||||
self.dict[var] = {}
|
||||
if var in self.overridedata:
|
||||
del self.overridedata[var]
|
||||
if '_' in var:
|
||||
override = var[var.rfind('_')+1:]
|
||||
shortvar = var[:var.rfind('_')]
|
||||
while override and override.islower():
|
||||
try:
|
||||
if shortvar in self.overridedata:
|
||||
# Force CoW by recreating the list first
|
||||
self.overridedata[shortvar] = list(self.overridedata[shortvar])
|
||||
self.overridedata[shortvar].remove([var, override])
|
||||
except ValueError as e:
|
||||
pass
|
||||
override = None
|
||||
if "_" in shortvar:
|
||||
override = var[shortvar.rfind('_')+1:]
|
||||
shortvar = var[:shortvar.rfind('_')]
|
||||
if len(shortvar) == 0:
|
||||
override = None
|
||||
if override and override in self._seen_overrides and var in self._seen_overrides[override]:
|
||||
self._seen_overrides[override].remove(var)
|
||||
|
||||
def setVarFlag(self, var, flag, value, **loginfo):
|
||||
if '_remote_data' in self.dict:
|
||||
connector = self.dict["_remote_data"]["_content"]
|
||||
res = connector.setVarFlag(var, flag, value)
|
||||
if not res:
|
||||
return
|
||||
|
||||
self.expand_cache = {}
|
||||
if 'op' not in loginfo:
|
||||
loginfo['op'] = "set"
|
||||
loginfo['flag'] = flag
|
||||
@@ -707,10 +589,8 @@ class DataSmart(MutableMapping):
|
||||
self._makeShadowCopy(var)
|
||||
self.dict[var][flag] = value
|
||||
|
||||
if flag == "_defaultval" and '_' in var:
|
||||
self._setvar_update_overrides(var, **loginfo)
|
||||
if flag == "_defaultval" and var in self.overridevars:
|
||||
self._setvar_update_overridevars(var, value)
|
||||
if flag == "defaultval" and '_' in var:
|
||||
self._setvar_update_overrides(var)
|
||||
|
||||
if flag == "unexport" or flag == "export":
|
||||
if not "__exportlist" in self.dict:
|
||||
@@ -719,71 +599,14 @@ class DataSmart(MutableMapping):
|
||||
self.dict["__exportlist"]["_content"] = set()
|
||||
self.dict["__exportlist"]["_content"].add(var)
|
||||
|
||||
def getVarFlag(self, var, flag, expand=True, noweakdefault=False, parsing=False):
|
||||
local_var, overridedata = self._findVar(var)
|
||||
def getVarFlag(self, var, flag, expand=False, noweakdefault=False):
|
||||
local_var = self._findVar(var)
|
||||
value = None
|
||||
if flag == "_content" and overridedata is not None and not parsing:
|
||||
match = False
|
||||
active = {}
|
||||
self.need_overrides()
|
||||
for (r, o) in overridedata:
|
||||
# What about double overrides both with "_" in the name?
|
||||
if o in self.overridesset:
|
||||
active[o] = r
|
||||
elif "_" in o:
|
||||
if set(o.split("_")).issubset(self.overridesset):
|
||||
active[o] = r
|
||||
|
||||
mod = True
|
||||
while mod:
|
||||
mod = False
|
||||
for o in self.overrides:
|
||||
for a in active.copy():
|
||||
if a.endswith("_" + o):
|
||||
t = active[a]
|
||||
del active[a]
|
||||
active[a.replace("_" + o, "")] = t
|
||||
mod = True
|
||||
elif a == o:
|
||||
match = active[a]
|
||||
del active[a]
|
||||
if match:
|
||||
value = self.getVar(match, False)
|
||||
|
||||
if local_var is not None and value is None:
|
||||
if local_var is not None:
|
||||
if flag in local_var:
|
||||
value = copy.copy(local_var[flag])
|
||||
elif flag == "_content" and "_defaultval" in local_var and not noweakdefault:
|
||||
value = copy.copy(local_var["_defaultval"])
|
||||
|
||||
|
||||
if flag == "_content" and local_var is not None and "_append" in local_var and not parsing:
|
||||
if not value:
|
||||
value = ""
|
||||
self.need_overrides()
|
||||
for (r, o) in local_var["_append"]:
|
||||
match = True
|
||||
if o:
|
||||
for o2 in o.split("_"):
|
||||
if not o2 in self.overrides:
|
||||
match = False
|
||||
if match:
|
||||
value = value + r
|
||||
|
||||
if flag == "_content" and local_var is not None and "_prepend" in local_var and not parsing:
|
||||
if not value:
|
||||
value = ""
|
||||
self.need_overrides()
|
||||
for (r, o) in local_var["_prepend"]:
|
||||
|
||||
match = True
|
||||
if o:
|
||||
for o2 in o.split("_"):
|
||||
if not o2 in self.overrides:
|
||||
match = False
|
||||
if match:
|
||||
value = r + value
|
||||
|
||||
elif flag == "_content" and "defaultval" in local_var and not noweakdefault:
|
||||
value = copy.copy(local_var["defaultval"])
|
||||
if expand and value:
|
||||
# Only getvar (flag == _content) hits the expand cache
|
||||
cachename = None
|
||||
@@ -792,38 +615,20 @@ class DataSmart(MutableMapping):
|
||||
else:
|
||||
cachename = var + "[" + flag + "]"
|
||||
value = self.expand(value, cachename)
|
||||
|
||||
if value and flag == "_content" and local_var is not None and "_remove" in local_var:
|
||||
removes = []
|
||||
self.need_overrides()
|
||||
for (r, o) in local_var["_remove"]:
|
||||
match = True
|
||||
if o:
|
||||
for o2 in o.split("_"):
|
||||
if not o2 in self.overrides:
|
||||
match = False
|
||||
if match:
|
||||
removes.extend(self.expand(r).split())
|
||||
|
||||
if removes:
|
||||
filtered = filter(lambda v: v not in removes,
|
||||
value.split())
|
||||
value = " ".join(filtered)
|
||||
if expand and var in self.expand_cache:
|
||||
# We need to ensure the expand cache has the correct value
|
||||
# flag == "_content" here
|
||||
self.expand_cache[var].value = value
|
||||
if value and flag == "_content" and local_var is not None and "_removeactive" in local_var:
|
||||
removes = [self.expand(r).split() for r in local_var["_removeactive"]]
|
||||
removes = reduce(lambda a, b: a+b, removes, [])
|
||||
filtered = filter(lambda v: v not in removes,
|
||||
value.split())
|
||||
value = " ".join(filtered)
|
||||
if expand:
|
||||
# We need to ensure the expand cache has the correct value
|
||||
# flag == "_content" here
|
||||
self.expand_cache[var].value = value
|
||||
return value
|
||||
|
||||
def delVarFlag(self, var, flag, **loginfo):
|
||||
if '_remote_data' in self.dict:
|
||||
connector = self.dict["_remote_data"]["_content"]
|
||||
res = connector.delVarFlag(var, flag)
|
||||
if not res:
|
||||
return
|
||||
|
||||
self.expand_cache = {}
|
||||
local_var, _ = self._findVar(var)
|
||||
local_var = self._findVar(var)
|
||||
if not local_var:
|
||||
return
|
||||
if not var in self.dict:
|
||||
@@ -852,7 +657,6 @@ class DataSmart(MutableMapping):
|
||||
self.setVarFlag(var, flag, newvalue, ignore=True)
|
||||
|
||||
def setVarFlags(self, var, flags, **loginfo):
|
||||
self.expand_cache = {}
|
||||
infer_caller_details(loginfo)
|
||||
if not var in self.dict:
|
||||
self._makeShadowCopy(var)
|
||||
@@ -866,7 +670,7 @@ class DataSmart(MutableMapping):
|
||||
self.dict[var][i] = flags[i]
|
||||
|
||||
def getVarFlags(self, var, expand = False, internalflags=False):
|
||||
local_var, _ = self._findVar(var)
|
||||
local_var = self._findVar(var)
|
||||
flags = {}
|
||||
|
||||
if local_var:
|
||||
@@ -882,7 +686,6 @@ class DataSmart(MutableMapping):
|
||||
|
||||
|
||||
def delVarFlags(self, var, **loginfo):
|
||||
self.expand_cache = {}
|
||||
if not var in self.dict:
|
||||
self._makeShadowCopy(var)
|
||||
|
||||
@@ -900,25 +703,20 @@ class DataSmart(MutableMapping):
|
||||
else:
|
||||
del self.dict[var]
|
||||
|
||||
|
||||
def createCopy(self):
|
||||
"""
|
||||
Create a copy of self by setting _data to self
|
||||
"""
|
||||
# we really want this to be a DataSmart...
|
||||
data = DataSmart()
|
||||
data = DataSmart(seen=self._seen_overrides.copy(), special=self._special_values.copy())
|
||||
data.dict["_data"] = self.dict
|
||||
data.varhistory = self.varhistory.copy()
|
||||
data.varhistory.dataroot = data
|
||||
data.varhistory.datasmart = data
|
||||
data.inchistory = self.inchistory.copy()
|
||||
|
||||
data._tracking = self._tracking
|
||||
|
||||
data.overrides = None
|
||||
data.overridevars = copy.copy(self.overridevars)
|
||||
# Should really be a deepcopy but has heavy overhead.
|
||||
# Instead, we're careful with writes.
|
||||
data.overridedata = copy.copy(self.overridedata)
|
||||
|
||||
return data
|
||||
|
||||
def expandVarref(self, variable, parents=False):
|
||||
@@ -939,55 +737,29 @@ class DataSmart(MutableMapping):
|
||||
|
||||
def localkeys(self):
|
||||
for key in self.dict:
|
||||
if key not in ['_data', '_remote_data']:
|
||||
if key != '_data':
|
||||
yield key
|
||||
|
||||
def __iter__(self):
|
||||
deleted = set()
|
||||
overrides = set()
|
||||
def keylist(d):
|
||||
klist = set()
|
||||
for key in d:
|
||||
if key in ["_data", "_remote_data"]:
|
||||
continue
|
||||
if key in deleted:
|
||||
continue
|
||||
if key in overrides:
|
||||
if key == "_data":
|
||||
continue
|
||||
if not d[key]:
|
||||
deleted.add(key)
|
||||
continue
|
||||
klist.add(key)
|
||||
|
||||
if "_data" in d:
|
||||
klist |= keylist(d["_data"])
|
||||
|
||||
if "_remote_data" in d:
|
||||
connector = d["_remote_data"]["_content"]
|
||||
for key in connector.getKeys():
|
||||
if key in deleted:
|
||||
continue
|
||||
klist.add(key)
|
||||
|
||||
return klist
|
||||
|
||||
self.need_overrides()
|
||||
for var in self.overridedata:
|
||||
for (r, o) in self.overridedata[var]:
|
||||
if o in self.overridesset:
|
||||
overrides.add(var)
|
||||
elif "_" in o:
|
||||
if set(o.split("_")).issubset(self.overridesset):
|
||||
overrides.add(var)
|
||||
|
||||
for k in keylist(self.dict):
|
||||
yield k
|
||||
|
||||
for k in overrides:
|
||||
yield k
|
||||
|
||||
def __len__(self):
|
||||
return len(frozenset(iter(self)))
|
||||
return len(frozenset(self))
|
||||
|
||||
def __getitem__(self, item):
|
||||
value = self.getVar(item, False)
|
||||
@@ -1006,8 +778,9 @@ class DataSmart(MutableMapping):
|
||||
data = {}
|
||||
d = self.createCopy()
|
||||
bb.data.expandKeys(d)
|
||||
bb.data.update_data(d)
|
||||
|
||||
config_whitelist = set((d.getVar("BB_HASHCONFIG_WHITELIST") or "").split())
|
||||
config_whitelist = set((d.getVar("BB_HASHCONFIG_WHITELIST", True) or "").split())
|
||||
keys = set(key for key in iter(d) if not key.startswith("__"))
|
||||
for key in keys:
|
||||
if key in config_whitelist:
|
||||
@@ -1026,12 +799,13 @@ class DataSmart(MutableMapping):
|
||||
|
||||
for key in ["__BBTASKS", "__BBANONFUNCS", "__BBHANDLERS"]:
|
||||
bb_list = d.getVar(key, False) or []
|
||||
bb_list.sort()
|
||||
data.update({key:str(bb_list)})
|
||||
|
||||
if key == "__BBANONFUNCS":
|
||||
for i in bb_list:
|
||||
value = d.getVar(i, False) or ""
|
||||
value = d.getVar(i, True) or ""
|
||||
data.update({i:value})
|
||||
|
||||
data_str = str([(k, data[k]) for k in sorted(data.keys())])
|
||||
return hashlib.md5(data_str.encode("utf-8")).hexdigest()
|
||||
return hashlib.md5(data_str).hexdigest()
|
||||
|
||||
@@ -24,13 +24,13 @@ BitBake build tools.
|
||||
|
||||
import os, sys
|
||||
import warnings
|
||||
import pickle
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
import logging
|
||||
import atexit
|
||||
import traceback
|
||||
import ast
|
||||
import threading
|
||||
|
||||
import bb.utils
|
||||
import bb.compat
|
||||
import bb.exceptions
|
||||
@@ -48,16 +48,6 @@ class Event(object):
|
||||
def __init__(self):
|
||||
self.pid = worker_pid
|
||||
|
||||
|
||||
class HeartbeatEvent(Event):
|
||||
"""Triggered at regular time intervals of 10 seconds. Other events can fire much more often
|
||||
(runQueueTaskStarted when there are many short tasks) or not at all for long periods
|
||||
of time (again runQueueTaskStarted, when there is just one long-running task), so this
|
||||
event is more suitable for doing some task-independent work occassionally."""
|
||||
def __init__(self, time):
|
||||
Event.__init__(self)
|
||||
self.time = time
|
||||
|
||||
Registered = 10
|
||||
AlreadyRegistered = 14
|
||||
|
||||
@@ -78,30 +68,9 @@ _ui_logfilters = {}
|
||||
_ui_handler_seq = 0
|
||||
_event_handler_map = {}
|
||||
_catchall_handlers = {}
|
||||
_eventfilter = None
|
||||
_uiready = False
|
||||
_thread_lock = threading.Lock()
|
||||
_thread_lock_enabled = False
|
||||
|
||||
if hasattr(__builtins__, '__setitem__'):
|
||||
builtins = __builtins__
|
||||
else:
|
||||
builtins = __builtins__.__dict__
|
||||
|
||||
def enable_threadlock():
|
||||
global _thread_lock_enabled
|
||||
_thread_lock_enabled = True
|
||||
|
||||
def disable_threadlock():
|
||||
global _thread_lock_enabled
|
||||
_thread_lock_enabled = False
|
||||
|
||||
def execute_handler(name, handler, event, d):
|
||||
event.data = d
|
||||
addedd = False
|
||||
if 'd' not in builtins:
|
||||
builtins['d'] = d
|
||||
addedd = True
|
||||
try:
|
||||
ret = handler(event)
|
||||
except (bb.parse.SkipRecipe, bb.BBHandledException):
|
||||
@@ -117,8 +86,6 @@ def execute_handler(name, handler, event, d):
|
||||
raise
|
||||
finally:
|
||||
del event.data
|
||||
if addedd:
|
||||
del builtins['d']
|
||||
|
||||
def fire_class_handlers(event, d):
|
||||
if isinstance(event, logging.LogRecord):
|
||||
@@ -126,11 +93,8 @@ def fire_class_handlers(event, d):
|
||||
|
||||
eid = str(event.__class__)[8:-2]
|
||||
evt_hmap = _event_handler_map.get(eid, {})
|
||||
for name, handler in list(_handlers.items()):
|
||||
for name, handler in _handlers.iteritems():
|
||||
if name in _catchall_handlers or name in evt_hmap:
|
||||
if _eventfilter:
|
||||
if not _eventfilter(name, handler, event, d):
|
||||
continue
|
||||
execute_handler(name, handler, event, d)
|
||||
|
||||
ui_queue = []
|
||||
@@ -139,57 +103,33 @@ def print_ui_queue():
|
||||
"""If we're exiting before a UI has been spawned, display any queued
|
||||
LogRecords to the console."""
|
||||
logger = logging.getLogger("BitBake")
|
||||
if not _uiready:
|
||||
if not _ui_handlers:
|
||||
from bb.msg import BBLogFormatter
|
||||
stdout = logging.StreamHandler(sys.stdout)
|
||||
stderr = logging.StreamHandler(sys.stderr)
|
||||
formatter = BBLogFormatter("%(levelname)s: %(message)s")
|
||||
stdout.setFormatter(formatter)
|
||||
stderr.setFormatter(formatter)
|
||||
console = logging.StreamHandler(sys.stdout)
|
||||
console.setFormatter(BBLogFormatter("%(levelname)s: %(message)s"))
|
||||
logger.handlers = [console]
|
||||
|
||||
# First check to see if we have any proper messages
|
||||
msgprint = False
|
||||
msgerrs = False
|
||||
|
||||
# Should we print to stderr?
|
||||
for event in ui_queue[:]:
|
||||
if isinstance(event, logging.LogRecord) and event.levelno >= logging.WARNING:
|
||||
msgerrs = True
|
||||
break
|
||||
|
||||
if msgerrs:
|
||||
logger.addHandler(stderr)
|
||||
else:
|
||||
logger.addHandler(stdout)
|
||||
|
||||
for event in ui_queue[:]:
|
||||
for event in ui_queue:
|
||||
if isinstance(event, logging.LogRecord):
|
||||
if event.levelno > logging.DEBUG:
|
||||
logger.handle(event)
|
||||
msgprint = True
|
||||
if msgprint:
|
||||
return
|
||||
|
||||
# Nope, so just print all of the messages we have (including debug messages)
|
||||
if not msgprint:
|
||||
for event in ui_queue[:]:
|
||||
if isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
if msgerrs:
|
||||
logger.removeHandler(stderr)
|
||||
else:
|
||||
logger.removeHandler(stdout)
|
||||
for event in ui_queue:
|
||||
if isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
|
||||
def fire_ui_handlers(event, d):
|
||||
global _thread_lock
|
||||
global _thread_lock_enabled
|
||||
|
||||
if not _uiready:
|
||||
if not _ui_handlers:
|
||||
# No UI handlers registered yet, queue up the messages
|
||||
ui_queue.append(event)
|
||||
return
|
||||
|
||||
if _thread_lock_enabled:
|
||||
_thread_lock.acquire()
|
||||
|
||||
errors = []
|
||||
for h in _ui_handlers:
|
||||
#print "Sending event %s" % event
|
||||
@@ -208,9 +148,6 @@ def fire_ui_handlers(event, d):
|
||||
for h in errors:
|
||||
del _ui_handlers[h]
|
||||
|
||||
if _thread_lock_enabled:
|
||||
_thread_lock.release()
|
||||
|
||||
def fire(event, d):
|
||||
"""Fire off an Event"""
|
||||
|
||||
@@ -223,19 +160,13 @@ def fire(event, d):
|
||||
if worker_fire:
|
||||
worker_fire(event, d)
|
||||
else:
|
||||
# If messages have been queued up, clear the queue
|
||||
global _uiready, ui_queue
|
||||
if _uiready and ui_queue:
|
||||
for queue_event in ui_queue:
|
||||
fire_ui_handlers(queue_event, d)
|
||||
ui_queue = []
|
||||
fire_ui_handlers(event, d)
|
||||
|
||||
def fire_from_worker(event, d):
|
||||
fire_ui_handlers(event, d)
|
||||
|
||||
noop = lambda _: None
|
||||
def register(name, handler, mask=None, filename=None, lineno=None):
|
||||
def register(name, handler, mask=[]):
|
||||
"""Register an Event handler"""
|
||||
|
||||
# already registered
|
||||
@@ -244,18 +175,10 @@ def register(name, handler, mask=None, filename=None, lineno=None):
|
||||
|
||||
if handler is not None:
|
||||
# handle string containing python code
|
||||
if isinstance(handler, str):
|
||||
if isinstance(handler, basestring):
|
||||
tmp = "def %s(e):\n%s" % (name, handler)
|
||||
try:
|
||||
code = bb.methodpool.compile_cache(tmp)
|
||||
if not code:
|
||||
if filename is None:
|
||||
filename = "%s(e)" % name
|
||||
code = compile(tmp, filename, "exec", ast.PyCF_ONLY_AST)
|
||||
if lineno is not None:
|
||||
ast.increment_lineno(code, lineno-1)
|
||||
code = compile(code, filename, "exec")
|
||||
bb.methodpool.compile_cache_add(tmp, code)
|
||||
code = compile(tmp, "%s(e)" % name, "exec")
|
||||
except SyntaxError:
|
||||
logger.error("Unable to register event handler '%s':\n%s", name,
|
||||
''.join(traceback.format_exc(limit=0)))
|
||||
@@ -281,46 +204,19 @@ def register(name, handler, mask=None, filename=None, lineno=None):
|
||||
def remove(name, handler):
|
||||
"""Remove an Event handler"""
|
||||
_handlers.pop(name)
|
||||
if name in _catchall_handlers:
|
||||
_catchall_handlers.pop(name)
|
||||
for event in _event_handler_map.keys():
|
||||
if name in _event_handler_map[event]:
|
||||
_event_handler_map[event].pop(name)
|
||||
|
||||
def get_handlers():
|
||||
return _handlers
|
||||
|
||||
def set_handlers(handlers):
|
||||
global _handlers
|
||||
_handlers = handlers
|
||||
|
||||
def set_eventfilter(func):
|
||||
global _eventfilter
|
||||
_eventfilter = func
|
||||
|
||||
def register_UIHhandler(handler, mainui=False):
|
||||
def register_UIHhandler(handler):
|
||||
bb.event._ui_handler_seq = bb.event._ui_handler_seq + 1
|
||||
_ui_handlers[_ui_handler_seq] = handler
|
||||
level, debug_domains = bb.msg.constructLogOptions()
|
||||
_ui_logfilters[_ui_handler_seq] = UIEventFilter(level, debug_domains)
|
||||
if mainui:
|
||||
global _uiready
|
||||
_uiready = _ui_handler_seq
|
||||
return _ui_handler_seq
|
||||
|
||||
def unregister_UIHhandler(handlerNum, mainui=False):
|
||||
if mainui:
|
||||
global _uiready
|
||||
_uiready = False
|
||||
def unregister_UIHhandler(handlerNum):
|
||||
if handlerNum in _ui_handlers:
|
||||
del _ui_handlers[handlerNum]
|
||||
return
|
||||
|
||||
def get_uihandler():
|
||||
if _uiready is False:
|
||||
return None
|
||||
return _uiready
|
||||
|
||||
# Class to allow filtering of events and specific filtering of LogRecords *before* we put them over the IPC
|
||||
class UIEventFilter(object):
|
||||
def __init__(self, level, debug_domains):
|
||||
@@ -383,12 +279,6 @@ class OperationProgress(Event):
|
||||
class ConfigParsed(Event):
|
||||
"""Configuration Parsing Complete"""
|
||||
|
||||
class MultiConfigParsed(Event):
|
||||
"""Multi-Config Parsing Complete"""
|
||||
def __init__(self, mcdata):
|
||||
self.mcdata = mcdata
|
||||
Event.__init__(self)
|
||||
|
||||
class RecipeEvent(Event):
|
||||
def __init__(self, fn):
|
||||
self.fn = fn
|
||||
@@ -397,17 +287,6 @@ class RecipeEvent(Event):
|
||||
class RecipePreFinalise(RecipeEvent):
|
||||
""" Recipe Parsing Complete but not yet finialised"""
|
||||
|
||||
class RecipeTaskPreProcess(RecipeEvent):
|
||||
"""
|
||||
Recipe Tasks about to be finalised
|
||||
The list of tasks should be final at this point and handlers
|
||||
are only able to change interdependencies
|
||||
"""
|
||||
def __init__(self, fn, tasklist):
|
||||
self.fn = fn
|
||||
self.tasklist = tasklist
|
||||
Event.__init__(self)
|
||||
|
||||
class RecipeParsed(RecipeEvent):
|
||||
""" Recipe Parsing Complete """
|
||||
|
||||
@@ -429,7 +308,7 @@ class StampUpdate(Event):
|
||||
targets = property(getTargets)
|
||||
|
||||
class BuildBase(Event):
|
||||
"""Base class for bitbake build events"""
|
||||
"""Base class for bbmake run events"""
|
||||
|
||||
def __init__(self, n, p, failures = 0):
|
||||
self._name = n
|
||||
@@ -449,6 +328,12 @@ class BuildBase(Event):
|
||||
def setName(self, name):
|
||||
self._name = name
|
||||
|
||||
def getCfg(self):
|
||||
return self.data
|
||||
|
||||
def setCfg(self, cfg):
|
||||
self.data = cfg
|
||||
|
||||
def getFailures(self):
|
||||
"""
|
||||
Return the number of failed packages
|
||||
@@ -457,27 +342,25 @@ class BuildBase(Event):
|
||||
|
||||
pkgs = property(getPkgs, setPkgs, None, "pkgs property")
|
||||
name = property(getName, setName, None, "name property")
|
||||
cfg = property(getCfg, setCfg, None, "cfg property")
|
||||
|
||||
|
||||
|
||||
|
||||
class BuildInit(BuildBase):
|
||||
"""buildFile or buildTargets was invoked"""
|
||||
def __init__(self, p=[]):
|
||||
name = None
|
||||
BuildBase.__init__(self, name, p)
|
||||
|
||||
class BuildStarted(BuildBase, OperationStarted):
|
||||
"""Event when builds start"""
|
||||
"""bbmake build run started"""
|
||||
def __init__(self, n, p, failures = 0):
|
||||
OperationStarted.__init__(self, "Building Started")
|
||||
BuildBase.__init__(self, n, p, failures)
|
||||
|
||||
class BuildCompleted(BuildBase, OperationCompleted):
|
||||
"""Event when builds have completed"""
|
||||
def __init__(self, total, n, p, failures=0, interrupted=0):
|
||||
"""bbmake build run completed"""
|
||||
def __init__(self, total, n, p, failures = 0):
|
||||
if not failures:
|
||||
OperationCompleted.__init__(self, total, "Building Succeeded")
|
||||
else:
|
||||
OperationCompleted.__init__(self, total, "Building Failed")
|
||||
self._interrupted = interrupted
|
||||
BuildBase.__init__(self, n, p, failures)
|
||||
|
||||
class DiskFull(Event):
|
||||
@@ -489,27 +372,10 @@ class DiskFull(Event):
|
||||
self._free = freespace
|
||||
self._mountpoint = mountpoint
|
||||
|
||||
class DiskUsageSample:
|
||||
def __init__(self, available_bytes, free_bytes, total_bytes):
|
||||
# Number of bytes available to non-root processes.
|
||||
self.available_bytes = available_bytes
|
||||
# Number of bytes available to root processes.
|
||||
self.free_bytes = free_bytes
|
||||
# Total capacity of the volume.
|
||||
self.total_bytes = total_bytes
|
||||
|
||||
class MonitorDiskEvent(Event):
|
||||
"""If BB_DISKMON_DIRS is set, then this event gets triggered each time disk space is checked.
|
||||
Provides information about devices that are getting monitored."""
|
||||
def __init__(self, disk_usage):
|
||||
Event.__init__(self)
|
||||
# hash of device root path -> DiskUsageSample
|
||||
self.disk_usage = disk_usage
|
||||
|
||||
class NoProvider(Event):
|
||||
"""No Provider for an Event"""
|
||||
|
||||
def __init__(self, item, runtime=False, dependees=None, reasons=None, close_matches=None):
|
||||
def __init__(self, item, runtime=False, dependees=None, reasons=[], close_matches=[]):
|
||||
Event.__init__(self)
|
||||
self._item = item
|
||||
self._runtime = runtime
|
||||
@@ -523,28 +389,6 @@ class NoProvider(Event):
|
||||
def isRuntime(self):
|
||||
return self._runtime
|
||||
|
||||
def __str__(self):
|
||||
msg = ''
|
||||
if self._runtime:
|
||||
r = "R"
|
||||
else:
|
||||
r = ""
|
||||
|
||||
extra = ''
|
||||
if not self._reasons:
|
||||
if self._close_matches:
|
||||
extra = ". Close matches:\n %s" % '\n '.join(self._close_matches)
|
||||
|
||||
if self._dependees:
|
||||
msg = "Nothing %sPROVIDES '%s' (but %s %sDEPENDS on or otherwise requires it)%s" % (r, self._item, ", ".join(self._dependees), r, extra)
|
||||
else:
|
||||
msg = "Nothing %sPROVIDES '%s'%s" % (r, self._item, extra)
|
||||
if self._reasons:
|
||||
for reason in self._reasons:
|
||||
msg += '\n' + reason
|
||||
return msg
|
||||
|
||||
|
||||
class MultipleProviders(Event):
|
||||
"""Multiple Providers"""
|
||||
|
||||
@@ -572,16 +416,6 @@ class MultipleProviders(Event):
|
||||
"""
|
||||
return self._candidates
|
||||
|
||||
def __str__(self):
|
||||
msg = "Multiple providers are available for %s%s (%s)" % (self._is_runtime and "runtime " or "",
|
||||
self._item,
|
||||
", ".join(self._candidates))
|
||||
rtime = ""
|
||||
if self._is_runtime:
|
||||
rtime = "R"
|
||||
msg += "\nConsider defining a PREFERRED_%sPROVIDER entry to match %s" % (rtime, self._item)
|
||||
return msg
|
||||
|
||||
class ParseStarted(OperationStarted):
|
||||
"""Recipe parsing for the runqueue has begun"""
|
||||
def __init__(self, total):
|
||||
@@ -655,16 +489,6 @@ class TargetsTreeGenerated(Event):
|
||||
Event.__init__(self)
|
||||
self._model = model
|
||||
|
||||
class ReachableStamps(Event):
|
||||
"""
|
||||
An event listing all stamps reachable after parsing
|
||||
which the metadata may use to clean up stale data
|
||||
"""
|
||||
|
||||
def __init__(self, stamps):
|
||||
Event.__init__(self)
|
||||
self.stamps = stamps
|
||||
|
||||
class FilesMatchingFound(Event):
|
||||
"""
|
||||
Event when a list of files matching the supplied pattern has
|
||||
@@ -675,6 +499,14 @@ class FilesMatchingFound(Event):
|
||||
self._pattern = pattern
|
||||
self._matches = matches
|
||||
|
||||
class CoreBaseFilesFound(Event):
|
||||
"""
|
||||
Event when a list of appropriate config files has been generated
|
||||
"""
|
||||
def __init__(self, paths):
|
||||
Event.__init__(self)
|
||||
self._paths = paths
|
||||
|
||||
class ConfigFilesFound(Event):
|
||||
"""
|
||||
Event when a list of appropriate config files has been generated
|
||||
@@ -734,10 +566,7 @@ class LogHandler(logging.Handler):
|
||||
etype, value, tb = record.exc_info
|
||||
if hasattr(tb, 'tb_next'):
|
||||
tb = list(bb.exceptions.extract_traceback(tb, context=3))
|
||||
# Need to turn the value into something the logging system can pickle
|
||||
record.bb_exc_info = (etype, value, tb)
|
||||
record.bb_exc_formatted = bb.exceptions.format_exception(etype, value, tb, limit=5)
|
||||
value = str(value)
|
||||
record.exc_info = None
|
||||
fire(record, None)
|
||||
|
||||
@@ -745,6 +574,19 @@ class LogHandler(logging.Handler):
|
||||
record.taskpid = worker_pid
|
||||
return True
|
||||
|
||||
class RequestPackageInfo(Event):
|
||||
"""
|
||||
Event to request package information
|
||||
"""
|
||||
|
||||
class PackageInfo(Event):
|
||||
"""
|
||||
Package information for GUI
|
||||
"""
|
||||
def __init__(self, pkginfolist):
|
||||
Event.__init__(self)
|
||||
self._pkginfolist = pkginfolist
|
||||
|
||||
class MetadataEvent(Event):
|
||||
"""
|
||||
Generic event that target for OE-Core classes
|
||||
@@ -755,33 +597,6 @@ class MetadataEvent(Event):
|
||||
self.type = eventtype
|
||||
self._localdata = eventdata
|
||||
|
||||
class ProcessStarted(Event):
|
||||
"""
|
||||
Generic process started event (usually part of the initial startup)
|
||||
where further progress events will be delivered
|
||||
"""
|
||||
def __init__(self, processname, total):
|
||||
Event.__init__(self)
|
||||
self.processname = processname
|
||||
self.total = total
|
||||
|
||||
class ProcessProgress(Event):
|
||||
"""
|
||||
Generic process progress event (usually part of the initial startup)
|
||||
"""
|
||||
def __init__(self, processname, progress):
|
||||
Event.__init__(self)
|
||||
self.processname = processname
|
||||
self.progress = progress
|
||||
|
||||
class ProcessFinished(Event):
|
||||
"""
|
||||
Generic process finished event (usually part of the initial startup)
|
||||
"""
|
||||
def __init__(self, processname):
|
||||
Event.__init__(self)
|
||||
self.processname = processname
|
||||
|
||||
class SanityCheck(Event):
|
||||
"""
|
||||
Event to run sanity checks, either raise errors or generate events as return status.
|
||||
@@ -822,10 +637,3 @@ class NetworkTestFailed(Event):
|
||||
Event to indicate network test has failed
|
||||
"""
|
||||
|
||||
class FindSigInfoResult(Event):
|
||||
"""
|
||||
Event to return results from findSigInfo command
|
||||
"""
|
||||
def __init__(self, result):
|
||||
Event.__init__(self)
|
||||
self.result = result
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
|
||||
from __future__ import absolute_import
|
||||
import inspect
|
||||
import traceback
|
||||
import bb.namedtuple_with_abc
|
||||
@@ -86,6 +86,6 @@ def format_exception(etype, value, tb, context=1, limit=None, formatter=None):
|
||||
|
||||
def to_string(exc):
|
||||
if isinstance(exc, SystemExit):
|
||||
if not isinstance(exc.code, str):
|
||||
if not isinstance(exc.code, basestring):
|
||||
return 'Exited with "%d"' % exc.code
|
||||
return str(exc)
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -27,6 +27,7 @@ import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import runfetchcmd
|
||||
@@ -42,14 +43,14 @@ class Bzr(FetchMethod):
|
||||
"""
|
||||
# Create paths to bzr checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(d.expand('${BZRDIR}'), ud.host, relpath)
|
||||
ud.pkgdir = os.path.join(data.expand('${BZRDIR}', d), ud.host, relpath)
|
||||
|
||||
ud.setup_revisions(d)
|
||||
ud.setup_revisons(d)
|
||||
|
||||
if not ud.revision:
|
||||
ud.revision = self.latest_revision(ud, d)
|
||||
|
||||
ud.localfile = d.expand('bzr_%s_%s_%s.tar.gz' % (ud.host, ud.path.replace('/', '.'), ud.revision))
|
||||
ud.localfile = data.expand('bzr_%s_%s_%s.tar.gz' % (ud.host, ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
def _buildbzrcommand(self, ud, d, command):
|
||||
"""
|
||||
@@ -57,7 +58,7 @@ class Bzr(FetchMethod):
|
||||
command is "fetch", "update", "revno"
|
||||
"""
|
||||
|
||||
basecmd = d.expand('${FETCHCMD_bzr}')
|
||||
basecmd = data.expand('${FETCHCMD_bzr}', d)
|
||||
|
||||
proto = ud.parm.get('protocol', 'http')
|
||||
|
||||
@@ -87,25 +88,28 @@ class Bzr(FetchMethod):
|
||||
bzrcmd = self._buildbzrcommand(ud, d, "update")
|
||||
logger.debug(1, "BZR Update %s", ud.url)
|
||||
bb.fetch2.check_network_access(d, bzrcmd, ud.url)
|
||||
runfetchcmd(bzrcmd, d, workdir=os.path.join(ud.pkgdir, os.path.basename(ud.path)))
|
||||
os.chdir(os.path.join (ud.pkgdir, os.path.basename(ud.path)))
|
||||
runfetchcmd(bzrcmd, d)
|
||||
else:
|
||||
bb.utils.remove(os.path.join(ud.pkgdir, os.path.basename(ud.pkgdir)), True)
|
||||
bzrcmd = self._buildbzrcommand(ud, d, "fetch")
|
||||
bb.fetch2.check_network_access(d, bzrcmd, ud.url)
|
||||
logger.debug(1, "BZR Checkout %s", ud.url)
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", bzrcmd)
|
||||
runfetchcmd(bzrcmd, d, workdir=ud.pkgdir)
|
||||
runfetchcmd(bzrcmd, d)
|
||||
|
||||
os.chdir(ud.pkgdir)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude='.bzr' --exclude='.bzrtags'"
|
||||
tar_flags = "--exclude '.bzr' --exclude '.bzrtags'"
|
||||
|
||||
# tar them up to a defined filename
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(ud.pkgdir)),
|
||||
d, cleanup=[ud.localpath], workdir=ud.pkgdir)
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(ud.pkgdir)), d, cleanup = [ud.localpath])
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
@@ -9,7 +9,7 @@ Usage in the recipe:
|
||||
|
||||
SRC_URI = "ccrc://cc.example.org/ccrc;vob=/example_vob;module=/example_module"
|
||||
SRCREV = "EXAMPLE_CLEARCASE_TAG"
|
||||
PV = "${@d.getVar("SRCREV", False).replace("/", "+")}"
|
||||
PV = "${@d.getVar("SRCREV").replace("/", "+")}"
|
||||
|
||||
The fetcher uses the rcleartool or cleartool remote client, depending on which one is available.
|
||||
|
||||
@@ -65,10 +65,12 @@ import os
|
||||
import sys
|
||||
import shutil
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import runfetchcmd
|
||||
from bb.fetch2 import logger
|
||||
from distutils import spawn
|
||||
|
||||
class ClearCase(FetchMethod):
|
||||
"""Class to fetch urls via 'clearcase'"""
|
||||
@@ -106,13 +108,13 @@ class ClearCase(FetchMethod):
|
||||
else:
|
||||
ud.module = ""
|
||||
|
||||
ud.basecmd = d.getVar("FETCHCMD_ccrc") or "/usr/bin/env cleartool || rcleartool"
|
||||
ud.basecmd = d.getVar("FETCHCMD_ccrc", True) or spawn.find_executable("cleartool") or spawn.find_executable("rcleartool")
|
||||
|
||||
if d.getVar("SRCREV") == "INVALID":
|
||||
if data.getVar("SRCREV", d, True) == "INVALID":
|
||||
raise FetchError("Set a valid SRCREV for the clearcase fetcher in your recipe, e.g. SRCREV = \"/main/LATEST\" or any other label of your choice.")
|
||||
|
||||
ud.label = d.getVar("SRCREV", False)
|
||||
ud.customspec = d.getVar("CCASE_CUSTOM_CONFIG_SPEC")
|
||||
ud.label = d.getVar("SRCREV")
|
||||
ud.customspec = d.getVar("CCASE_CUSTOM_CONFIG_SPEC", True)
|
||||
|
||||
ud.server = "%s://%s%s" % (ud.proto, ud.host, ud.path)
|
||||
|
||||
@@ -122,7 +124,7 @@ class ClearCase(FetchMethod):
|
||||
|
||||
ud.viewname = "%s-view%s" % (ud.identifier, d.getVar("DATETIME", d, True))
|
||||
ud.csname = "%s-config-spec" % (ud.identifier)
|
||||
ud.ccasedir = os.path.join(d.getVar("DL_DIR"), ud.type)
|
||||
ud.ccasedir = os.path.join(data.getVar("DL_DIR", d, True), ud.type)
|
||||
ud.viewdir = os.path.join(ud.ccasedir, ud.viewname)
|
||||
ud.configspecfile = os.path.join(ud.ccasedir, ud.csname)
|
||||
ud.localfile = "%s.tar.gz" % (ud.identifier)
|
||||
@@ -142,7 +144,7 @@ class ClearCase(FetchMethod):
|
||||
self.debug("configspecfile = %s" % ud.configspecfile)
|
||||
self.debug("localfile = %s" % ud.localfile)
|
||||
|
||||
ud.localfile = os.path.join(d.getVar("DL_DIR"), ud.localfile)
|
||||
ud.localfile = os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
|
||||
|
||||
def _build_ccase_command(self, ud, command):
|
||||
"""
|
||||
@@ -200,10 +202,11 @@ class ClearCase(FetchMethod):
|
||||
|
||||
def _remove_view(self, ud, d):
|
||||
if os.path.exists(ud.viewdir):
|
||||
os.chdir(ud.ccasedir)
|
||||
cmd = self._build_ccase_command(ud, 'rmview');
|
||||
logger.info("cleaning up [VOB=%s label=%s view=%s]", ud.vob, ud.label, ud.viewname)
|
||||
bb.fetch2.check_network_access(d, cmd, ud.url)
|
||||
output = runfetchcmd(cmd, d, workdir=ud.ccasedir)
|
||||
output = runfetchcmd(cmd, d)
|
||||
logger.info("rmview output: %s", output)
|
||||
|
||||
def need_update(self, ud, d):
|
||||
@@ -238,10 +241,11 @@ class ClearCase(FetchMethod):
|
||||
raise e
|
||||
|
||||
# Set configspec: Setting the configspec effectively fetches the files as defined in the configspec
|
||||
os.chdir(ud.viewdir)
|
||||
cmd = self._build_ccase_command(ud, 'setcs');
|
||||
logger.info("fetching data [VOB=%s label=%s view=%s]", ud.vob, ud.label, ud.viewname)
|
||||
bb.fetch2.check_network_access(d, cmd, ud.url)
|
||||
output = runfetchcmd(cmd, d, workdir=ud.viewdir)
|
||||
output = runfetchcmd(cmd, d)
|
||||
logger.info("%s", output)
|
||||
|
||||
# Copy the configspec to the viewdir so we have it in our source tarball later
|
||||
|
||||
@@ -63,7 +63,7 @@ class Cvs(FetchMethod):
|
||||
if 'fullpath' in ud.parm:
|
||||
fullpath = '_fullpath'
|
||||
|
||||
ud.localfile = d.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath))
|
||||
ud.localfile = bb.data.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath), d)
|
||||
|
||||
def need_update(self, ud, d):
|
||||
if (ud.date == "now"):
|
||||
@@ -87,10 +87,10 @@ class Cvs(FetchMethod):
|
||||
cvsroot = ud.path
|
||||
else:
|
||||
cvsroot = ":" + method
|
||||
cvsproxyhost = d.getVar('CVS_PROXY_HOST')
|
||||
cvsproxyhost = d.getVar('CVS_PROXY_HOST', True)
|
||||
if cvsproxyhost:
|
||||
cvsroot += ";proxy=" + cvsproxyhost
|
||||
cvsproxyport = d.getVar('CVS_PROXY_PORT')
|
||||
cvsproxyport = d.getVar('CVS_PROXY_PORT', True)
|
||||
if cvsproxyport:
|
||||
cvsroot += ";proxyport=" + cvsproxyport
|
||||
cvsroot += ":" + ud.user
|
||||
@@ -110,7 +110,7 @@ class Cvs(FetchMethod):
|
||||
if ud.tag:
|
||||
options.append("-r %s" % ud.tag)
|
||||
|
||||
cvsbasecmd = d.getVar("FETCHCMD_cvs")
|
||||
cvsbasecmd = d.getVar("FETCHCMD_cvs", True)
|
||||
cvscmd = cvsbasecmd + " '-d" + cvsroot + "' co " + " ".join(options) + " " + ud.module
|
||||
cvsupdatecmd = cvsbasecmd + " '-d" + cvsroot + "' update -d -P " + " ".join(options)
|
||||
|
||||
@@ -120,26 +120,25 @@ class Cvs(FetchMethod):
|
||||
|
||||
# create module directory
|
||||
logger.debug(2, "Fetch: checking for module directory")
|
||||
pkg = d.getVar('PN')
|
||||
pkgdir = os.path.join(d.getVar('CVSDIR'), pkg)
|
||||
pkg = d.getVar('PN', True)
|
||||
pkgdir = os.path.join(d.getVar('CVSDIR', True), pkg)
|
||||
moddir = os.path.join(pkgdir, localdir)
|
||||
workdir = None
|
||||
if os.access(os.path.join(moddir, 'CVS'), os.R_OK):
|
||||
logger.info("Update " + ud.url)
|
||||
bb.fetch2.check_network_access(d, cvsupdatecmd, ud.url)
|
||||
# update sources there
|
||||
workdir = moddir
|
||||
os.chdir(moddir)
|
||||
cmd = cvsupdatecmd
|
||||
else:
|
||||
logger.info("Fetch " + ud.url)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(pkgdir)
|
||||
workdir = pkgdir
|
||||
os.chdir(pkgdir)
|
||||
logger.debug(1, "Running %s", cvscmd)
|
||||
bb.fetch2.check_network_access(d, cvscmd, ud.url)
|
||||
cmd = cvscmd
|
||||
|
||||
runfetchcmd(cmd, d, cleanup=[moddir], workdir=workdir)
|
||||
runfetchcmd(cmd, d, cleanup = [moddir])
|
||||
|
||||
if not os.access(moddir, os.R_OK):
|
||||
raise FetchError("Directory %s was not readable despite sucessful fetch?!" % moddir, ud.url)
|
||||
@@ -148,24 +147,24 @@ class Cvs(FetchMethod):
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude='CVS'"
|
||||
tar_flags = "--exclude 'CVS'"
|
||||
|
||||
# tar them up to a defined filename
|
||||
workdir = None
|
||||
if 'fullpath' in ud.parm:
|
||||
workdir = pkgdir
|
||||
os.chdir(pkgdir)
|
||||
cmd = "tar %s -czf %s %s" % (tar_flags, ud.localpath, localdir)
|
||||
else:
|
||||
workdir = os.path.dirname(os.path.realpath(moddir))
|
||||
os.chdir(moddir)
|
||||
os.chdir('..')
|
||||
cmd = "tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(moddir))
|
||||
|
||||
runfetchcmd(cmd, d, cleanup=[ud.localpath], workdir=workdir)
|
||||
runfetchcmd(cmd, d, cleanup = [ud.localpath])
|
||||
|
||||
def clean(self, ud, d):
|
||||
""" Clean CVS Files and tarballs """
|
||||
|
||||
pkg = d.getVar('PN')
|
||||
pkgdir = os.path.join(d.getVar("CVSDIR"), pkg)
|
||||
pkg = d.getVar('PN', True)
|
||||
pkgdir = os.path.join(d.getVar("CVSDIR", True), pkg)
|
||||
|
||||
bb.utils.remove(pkgdir, True)
|
||||
bb.utils.remove(ud.localpath)
|
||||
|
||||
@@ -49,10 +49,6 @@ Supported SRC_URI options are:
|
||||
referring to commit which is valid in tag instead of branch.
|
||||
The default is "0", set nobranch=1 if needed.
|
||||
|
||||
- usehead
|
||||
For local git:// urls to use the current branch HEAD as the revision for use with
|
||||
AUTOREV. Implies nobranch.
|
||||
|
||||
"""
|
||||
|
||||
#Copyright (C) 2005 Richard Purdie
|
||||
@@ -70,64 +66,14 @@ Supported SRC_URI options are:
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import collections
|
||||
import errno
|
||||
import fnmatch
|
||||
import os
|
||||
import re
|
||||
import subprocess
|
||||
import tempfile
|
||||
import bb
|
||||
import bb.progress
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import runfetchcmd
|
||||
from bb.fetch2 import logger
|
||||
|
||||
|
||||
class GitProgressHandler(bb.progress.LineFilterProgressHandler):
|
||||
"""Extract progress information from git output"""
|
||||
def __init__(self, d):
|
||||
self._buffer = ''
|
||||
self._count = 0
|
||||
super(GitProgressHandler, self).__init__(d)
|
||||
# Send an initial progress event so the bar gets shown
|
||||
self._fire_progress(-1)
|
||||
|
||||
def write(self, string):
|
||||
self._buffer += string
|
||||
stages = ['Counting objects', 'Compressing objects', 'Receiving objects', 'Resolving deltas']
|
||||
stage_weights = [0.2, 0.05, 0.5, 0.25]
|
||||
stagenum = 0
|
||||
for i, stage in reversed(list(enumerate(stages))):
|
||||
if stage in self._buffer:
|
||||
stagenum = i
|
||||
self._buffer = ''
|
||||
break
|
||||
self._status = stages[stagenum]
|
||||
percs = re.findall(r'(\d+)%', string)
|
||||
if percs:
|
||||
progress = int(round((int(percs[-1]) * stage_weights[stagenum]) + (sum(stage_weights[:stagenum]) * 100)))
|
||||
rates = re.findall(r'([\d.]+ [a-zA-Z]*/s+)', string)
|
||||
if rates:
|
||||
rate = rates[-1]
|
||||
else:
|
||||
rate = None
|
||||
self.update(progress, rate)
|
||||
else:
|
||||
if stagenum == 0:
|
||||
percs = re.findall(r': (\d+)', string)
|
||||
if percs:
|
||||
count = int(percs[-1])
|
||||
if count > self._count:
|
||||
self._count = count
|
||||
self._fire_progress(-count)
|
||||
super(GitProgressHandler, self).write(string)
|
||||
|
||||
|
||||
class Git(FetchMethod):
|
||||
bitbake_dir = os.path.abspath(os.path.join(os.path.dirname(os.path.join(os.path.abspath(__file__))), '..', '..', '..'))
|
||||
make_shallow_path = os.path.join(bitbake_dir, 'bin', 'git-make-shallow')
|
||||
|
||||
"""Class to fetch a module or modules from git repositories"""
|
||||
def init(self, d):
|
||||
pass
|
||||
@@ -162,13 +108,6 @@ class Git(FetchMethod):
|
||||
|
||||
ud.nobranch = ud.parm.get("nobranch","0") == "1"
|
||||
|
||||
# usehead implies nobranch
|
||||
ud.usehead = ud.parm.get("usehead","0") == "1"
|
||||
if ud.usehead:
|
||||
if ud.proto != "file":
|
||||
raise bb.fetch2.ParameterError("The usehead option is only for use with local ('protocol=file') git repositories", ud.url)
|
||||
ud.nobranch = 1
|
||||
|
||||
# bareclone implies nocheckout
|
||||
ud.bareclone = ud.parm.get("bareclone","0") == "1"
|
||||
if ud.bareclone:
|
||||
@@ -178,68 +117,17 @@ class Git(FetchMethod):
|
||||
branches = ud.parm.get("branch", "master").split(',')
|
||||
if len(branches) != len(ud.names):
|
||||
raise bb.fetch2.ParameterError("The number of name and branch parameters is not balanced", ud.url)
|
||||
|
||||
ud.cloneflags = "-s -n"
|
||||
if ud.bareclone:
|
||||
ud.cloneflags += " --mirror"
|
||||
|
||||
ud.shallow = d.getVar("BB_GIT_SHALLOW") == "1"
|
||||
ud.shallow_extra_refs = (d.getVar("BB_GIT_SHALLOW_EXTRA_REFS") or "").split()
|
||||
|
||||
depth_default = d.getVar("BB_GIT_SHALLOW_DEPTH")
|
||||
if depth_default is not None:
|
||||
try:
|
||||
depth_default = int(depth_default or 0)
|
||||
except ValueError:
|
||||
raise bb.fetch2.FetchError("Invalid depth for BB_GIT_SHALLOW_DEPTH: %s" % depth_default)
|
||||
else:
|
||||
if depth_default < 0:
|
||||
raise bb.fetch2.FetchError("Invalid depth for BB_GIT_SHALLOW_DEPTH: %s" % depth_default)
|
||||
else:
|
||||
depth_default = 1
|
||||
ud.shallow_depths = collections.defaultdict(lambda: depth_default)
|
||||
|
||||
revs_default = d.getVar("BB_GIT_SHALLOW_REVS", True)
|
||||
ud.shallow_revs = []
|
||||
ud.branches = {}
|
||||
for pos, name in enumerate(ud.names):
|
||||
branch = branches[pos]
|
||||
for name in ud.names:
|
||||
branch = branches[ud.names.index(name)]
|
||||
ud.branches[name] = branch
|
||||
ud.unresolvedrev[name] = branch
|
||||
|
||||
shallow_depth = d.getVar("BB_GIT_SHALLOW_DEPTH_%s" % name)
|
||||
if shallow_depth is not None:
|
||||
try:
|
||||
shallow_depth = int(shallow_depth or 0)
|
||||
except ValueError:
|
||||
raise bb.fetch2.FetchError("Invalid depth for BB_GIT_SHALLOW_DEPTH_%s: %s" % (name, shallow_depth))
|
||||
else:
|
||||
if shallow_depth < 0:
|
||||
raise bb.fetch2.FetchError("Invalid depth for BB_GIT_SHALLOW_DEPTH_%s: %s" % (name, shallow_depth))
|
||||
ud.shallow_depths[name] = shallow_depth
|
||||
ud.basecmd = data.getVar("FETCHCMD_git", d, True) or "git -c core.fsyncobjectfiles=0"
|
||||
|
||||
revs = d.getVar("BB_GIT_SHALLOW_REVS_%s" % name)
|
||||
if revs is not None:
|
||||
ud.shallow_revs.extend(revs.split())
|
||||
elif revs_default is not None:
|
||||
ud.shallow_revs.extend(revs_default.split())
|
||||
ud.write_tarballs = ((data.getVar("BB_GENERATE_MIRROR_TARBALLS", d, True) or "0") != "0") or ud.rebaseable
|
||||
|
||||
if (ud.shallow and
|
||||
not ud.shallow_revs and
|
||||
all(ud.shallow_depths[n] == 0 for n in ud.names)):
|
||||
# Shallow disabled for this URL
|
||||
ud.shallow = False
|
||||
|
||||
if ud.usehead:
|
||||
ud.unresolvedrev['default'] = 'HEAD'
|
||||
|
||||
ud.basecmd = d.getVar("FETCHCMD_git") or "git -c core.fsyncobjectfiles=0"
|
||||
|
||||
write_tarballs = d.getVar("BB_GENERATE_MIRROR_TARBALLS") or "0"
|
||||
ud.write_tarballs = write_tarballs != "0" or ud.rebaseable
|
||||
ud.write_shallow_tarballs = (d.getVar("BB_GENERATE_SHALLOW_TARBALLS") or write_tarballs) != "0"
|
||||
|
||||
ud.setup_revisions(d)
|
||||
ud.setup_revisons(d)
|
||||
|
||||
for name in ud.names:
|
||||
# Ensure anything that doesn't look like a sha256 checksum/revision is translated into one
|
||||
@@ -248,10 +136,7 @@ class Git(FetchMethod):
|
||||
ud.unresolvedrev[name] = ud.revisions[name]
|
||||
ud.revisions[name] = self.latest_revision(ud, d, name)
|
||||
|
||||
gitsrcname = '%s%s' % (ud.host.replace(':', '.'), ud.path.replace('/', '.').replace('*', '.'))
|
||||
if gitsrcname.startswith('.'):
|
||||
gitsrcname = gitsrcname[1:]
|
||||
|
||||
gitsrcname = '%s%s' % (ud.host.replace(':','.'), ud.path.replace('/', '.').replace('*', '.'))
|
||||
# for rebaseable git repo, it is necessary to keep mirror tar ball
|
||||
# per revision, so that even the revision disappears from the
|
||||
# upstream repo in the future, the mirror will remain intact and still
|
||||
@@ -259,53 +144,23 @@ class Git(FetchMethod):
|
||||
if ud.rebaseable:
|
||||
for name in ud.names:
|
||||
gitsrcname = gitsrcname + '_' + ud.revisions[name]
|
||||
|
||||
dl_dir = d.getVar("DL_DIR")
|
||||
gitdir = d.getVar("GITDIR") or (dl_dir + "/git2/")
|
||||
ud.mirrortarball = 'git2_%s.tar.gz' % (gitsrcname)
|
||||
ud.fullmirror = os.path.join(d.getVar("DL_DIR", True), ud.mirrortarball)
|
||||
gitdir = d.getVar("GITDIR", True) or (d.getVar("DL_DIR", True) + "/git2/")
|
||||
ud.clonedir = os.path.join(gitdir, gitsrcname)
|
||||
|
||||
ud.localfile = ud.clonedir
|
||||
|
||||
mirrortarball = 'git2_%s.tar.gz' % gitsrcname
|
||||
ud.fullmirror = os.path.join(dl_dir, mirrortarball)
|
||||
ud.mirrortarballs = [mirrortarball]
|
||||
if ud.shallow:
|
||||
tarballname = gitsrcname
|
||||
if ud.bareclone:
|
||||
tarballname = "%s_bare" % tarballname
|
||||
|
||||
if ud.shallow_revs:
|
||||
tarballname = "%s_%s" % (tarballname, "_".join(sorted(ud.shallow_revs)))
|
||||
|
||||
for name, revision in sorted(ud.revisions.items()):
|
||||
tarballname = "%s_%s" % (tarballname, ud.revisions[name][:7])
|
||||
depth = ud.shallow_depths[name]
|
||||
if depth:
|
||||
tarballname = "%s-%s" % (tarballname, depth)
|
||||
|
||||
shallow_refs = []
|
||||
if not ud.nobranch:
|
||||
shallow_refs.extend(ud.branches.values())
|
||||
if ud.shallow_extra_refs:
|
||||
shallow_refs.extend(r.replace('refs/heads/', '').replace('*', 'ALL') for r in ud.shallow_extra_refs)
|
||||
if shallow_refs:
|
||||
tarballname = "%s_%s" % (tarballname, "_".join(sorted(shallow_refs)).replace('/', '.'))
|
||||
|
||||
fetcher = self.__class__.__name__.lower()
|
||||
ud.shallowtarball = '%sshallow_%s.tar.gz' % (fetcher, tarballname)
|
||||
ud.fullshallow = os.path.join(dl_dir, ud.shallowtarball)
|
||||
ud.mirrortarballs.insert(0, ud.shallowtarball)
|
||||
|
||||
def localpath(self, ud, d):
|
||||
return ud.clonedir
|
||||
|
||||
def need_update(self, ud, d):
|
||||
if not os.path.exists(ud.clonedir):
|
||||
return True
|
||||
os.chdir(ud.clonedir)
|
||||
for name in ud.names:
|
||||
if not self._contains_ref(ud, d, name, ud.clonedir):
|
||||
if not self._contains_ref(ud, d, name):
|
||||
return True
|
||||
if ud.shallow and ud.write_shallow_tarballs and not os.path.exists(ud.fullshallow):
|
||||
return True
|
||||
if ud.write_tarballs and not os.path.exists(ud.fullmirror):
|
||||
return True
|
||||
return False
|
||||
@@ -313,7 +168,7 @@ class Git(FetchMethod):
|
||||
def try_premirror(self, ud, d):
|
||||
# If we don't do this, updating an existing checkout with only premirrors
|
||||
# is not possible
|
||||
if d.getVar("BB_FETCH_PREMIRRORONLY") is not None:
|
||||
if d.getVar("BB_FETCH_PREMIRRORONLY", True) is not None:
|
||||
return True
|
||||
if os.path.exists(ud.clonedir):
|
||||
return False
|
||||
@@ -322,145 +177,74 @@ class Git(FetchMethod):
|
||||
def download(self, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
no_clone = not os.path.exists(ud.clonedir)
|
||||
need_update = no_clone or self.need_update(ud, d)
|
||||
if ud.user:
|
||||
username = ud.user + '@'
|
||||
else:
|
||||
username = ""
|
||||
|
||||
# A current clone is preferred to either tarball, a shallow tarball is
|
||||
# preferred to an out of date clone, and a missing clone will use
|
||||
# either tarball.
|
||||
if ud.shallow and os.path.exists(ud.fullshallow) and need_update:
|
||||
ud.localpath = ud.fullshallow
|
||||
return
|
||||
elif os.path.exists(ud.fullmirror) and no_clone:
|
||||
ud.repochanged = not os.path.exists(ud.fullmirror)
|
||||
|
||||
# If the checkout doesn't exist and the mirror tarball does, extract it
|
||||
if not os.path.exists(ud.clonedir) and os.path.exists(ud.fullmirror):
|
||||
bb.utils.mkdirhier(ud.clonedir)
|
||||
runfetchcmd("tar -xzf %s" % ud.fullmirror, d, workdir=ud.clonedir)
|
||||
os.chdir(ud.clonedir)
|
||||
runfetchcmd("tar -xzf %s" % (ud.fullmirror), d)
|
||||
|
||||
repourl = self._get_repo_url(ud)
|
||||
repourl = "%s://%s%s%s" % (ud.proto, username, ud.host, ud.path)
|
||||
|
||||
# If the repo still doesn't exist, fallback to cloning it
|
||||
if not os.path.exists(ud.clonedir):
|
||||
# We do this since git will use a "-l" option automatically for local urls where possible
|
||||
if repourl.startswith("file://"):
|
||||
repourl = repourl[7:]
|
||||
clone_cmd = "LANG=C %s clone --bare --mirror %s %s --progress" % (ud.basecmd, repourl, ud.clonedir)
|
||||
clone_cmd = "%s clone --bare --mirror %s %s" % (ud.basecmd, repourl, ud.clonedir)
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, clone_cmd, ud.url)
|
||||
progresshandler = GitProgressHandler(d)
|
||||
runfetchcmd(clone_cmd, d, log=progresshandler)
|
||||
bb.fetch2.check_network_access(d, clone_cmd)
|
||||
runfetchcmd(clone_cmd, d)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
# Update the checkout if needed
|
||||
needupdate = False
|
||||
for name in ud.names:
|
||||
if not self._contains_ref(ud, d, name, ud.clonedir):
|
||||
if not self._contains_ref(ud, d, name):
|
||||
needupdate = True
|
||||
if needupdate:
|
||||
output = runfetchcmd("%s remote" % ud.basecmd, d, quiet=True, workdir=ud.clonedir)
|
||||
if "origin" in output:
|
||||
runfetchcmd("%s remote rm origin" % ud.basecmd, d, workdir=ud.clonedir)
|
||||
try:
|
||||
runfetchcmd("%s remote rm origin" % ud.basecmd, d)
|
||||
except bb.fetch2.FetchError:
|
||||
logger.debug(1, "No Origin")
|
||||
|
||||
runfetchcmd("%s remote add --mirror=fetch origin %s" % (ud.basecmd, repourl), d, workdir=ud.clonedir)
|
||||
fetch_cmd = "LANG=C %s fetch -f --prune --progress %s refs/*:refs/*" % (ud.basecmd, repourl)
|
||||
runfetchcmd("%s remote add --mirror=fetch origin %s" % (ud.basecmd, repourl), d)
|
||||
fetch_cmd = "%s fetch -f --prune %s refs/*:refs/*" % (ud.basecmd, repourl)
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, fetch_cmd, ud.url)
|
||||
progresshandler = GitProgressHandler(d)
|
||||
runfetchcmd(fetch_cmd, d, log=progresshandler, workdir=ud.clonedir)
|
||||
runfetchcmd("%s prune-packed" % ud.basecmd, d, workdir=ud.clonedir)
|
||||
runfetchcmd("%s pack-refs --all" % ud.basecmd, d, workdir=ud.clonedir)
|
||||
runfetchcmd("%s pack-redundant --all | xargs -r rm" % ud.basecmd, d, workdir=ud.clonedir)
|
||||
try:
|
||||
os.unlink(ud.fullmirror)
|
||||
except OSError as exc:
|
||||
if exc.errno != errno.ENOENT:
|
||||
raise
|
||||
runfetchcmd(fetch_cmd, d)
|
||||
runfetchcmd("%s prune-packed" % ud.basecmd, d)
|
||||
runfetchcmd("%s pack-redundant --all | xargs -r rm" % ud.basecmd, d)
|
||||
ud.repochanged = True
|
||||
os.chdir(ud.clonedir)
|
||||
for name in ud.names:
|
||||
if not self._contains_ref(ud, d, name, ud.clonedir):
|
||||
if not self._contains_ref(ud, d, name):
|
||||
raise bb.fetch2.FetchError("Unable to find revision %s in branch %s even from upstream" % (ud.revisions[name], ud.branches[name]))
|
||||
|
||||
def build_mirror_data(self, ud, d):
|
||||
if ud.shallow and ud.write_shallow_tarballs:
|
||||
if not os.path.exists(ud.fullshallow):
|
||||
if os.path.islink(ud.fullshallow):
|
||||
os.unlink(ud.fullshallow)
|
||||
tempdir = tempfile.mkdtemp(dir=d.getVar('DL_DIR'))
|
||||
shallowclone = os.path.join(tempdir, 'git')
|
||||
try:
|
||||
self.clone_shallow_local(ud, shallowclone, d)
|
||||
|
||||
logger.info("Creating tarball of git repository")
|
||||
runfetchcmd("tar -czf %s ." % ud.fullshallow, d, workdir=shallowclone)
|
||||
runfetchcmd("touch %s.done" % ud.fullshallow, d)
|
||||
finally:
|
||||
bb.utils.remove(tempdir, recurse=True)
|
||||
elif ud.write_tarballs and not os.path.exists(ud.fullmirror):
|
||||
# Generate a mirror tarball if needed
|
||||
if ud.write_tarballs and (ud.repochanged or not os.path.exists(ud.fullmirror)):
|
||||
# it's possible that this symlink points to read-only filesystem with PREMIRROR
|
||||
if os.path.islink(ud.fullmirror):
|
||||
os.unlink(ud.fullmirror)
|
||||
|
||||
os.chdir(ud.clonedir)
|
||||
logger.info("Creating tarball of git repository")
|
||||
runfetchcmd("tar -czf %s ." % ud.fullmirror, d, workdir=ud.clonedir)
|
||||
runfetchcmd("touch %s.done" % ud.fullmirror, d)
|
||||
|
||||
def clone_shallow_local(self, ud, dest, d):
|
||||
"""Clone the repo and make it shallow.
|
||||
|
||||
The upstream url of the new clone isn't set at this time, as it'll be
|
||||
set correctly when unpacked."""
|
||||
runfetchcmd("%s clone %s %s %s" % (ud.basecmd, ud.cloneflags, ud.clonedir, dest), d)
|
||||
|
||||
to_parse, shallow_branches = [], []
|
||||
for name in ud.names:
|
||||
revision = ud.revisions[name]
|
||||
depth = ud.shallow_depths[name]
|
||||
if depth:
|
||||
to_parse.append('%s~%d^{}' % (revision, depth - 1))
|
||||
|
||||
# For nobranch, we need a ref, otherwise the commits will be
|
||||
# removed, and for non-nobranch, we truncate the branch to our
|
||||
# srcrev, to avoid keeping unnecessary history beyond that.
|
||||
branch = ud.branches[name]
|
||||
if ud.nobranch:
|
||||
ref = "refs/shallow/%s" % name
|
||||
elif ud.bareclone:
|
||||
ref = "refs/heads/%s" % branch
|
||||
else:
|
||||
ref = "refs/remotes/origin/%s" % branch
|
||||
|
||||
shallow_branches.append(ref)
|
||||
runfetchcmd("%s update-ref %s %s" % (ud.basecmd, ref, revision), d, workdir=dest)
|
||||
|
||||
# Map srcrev+depths to revisions
|
||||
parsed_depths = runfetchcmd("%s rev-parse %s" % (ud.basecmd, " ".join(to_parse)), d, workdir=dest)
|
||||
|
||||
# Resolve specified revisions
|
||||
parsed_revs = runfetchcmd("%s rev-parse %s" % (ud.basecmd, " ".join('"%s^{}"' % r for r in ud.shallow_revs)), d, workdir=dest)
|
||||
shallow_revisions = parsed_depths.splitlines() + parsed_revs.splitlines()
|
||||
|
||||
# Apply extra ref wildcards
|
||||
all_refs = runfetchcmd('%s for-each-ref "--format=%%(refname)"' % ud.basecmd,
|
||||
d, workdir=dest).splitlines()
|
||||
for r in ud.shallow_extra_refs:
|
||||
if not ud.bareclone:
|
||||
r = r.replace('refs/heads/', 'refs/remotes/origin/')
|
||||
|
||||
if '*' in r:
|
||||
matches = filter(lambda a: fnmatch.fnmatchcase(a, r), all_refs)
|
||||
shallow_branches.extend(matches)
|
||||
else:
|
||||
shallow_branches.append(r)
|
||||
|
||||
# Make the repository shallow
|
||||
shallow_cmd = [self.make_shallow_path, '-s']
|
||||
for b in shallow_branches:
|
||||
shallow_cmd.append('-r')
|
||||
shallow_cmd.append(b)
|
||||
shallow_cmd.extend(shallow_revisions)
|
||||
runfetchcmd(subprocess.list2cmdline(shallow_cmd), d, workdir=dest)
|
||||
runfetchcmd("tar -czf %s %s" % (ud.fullmirror, os.path.join(".") ), d)
|
||||
runfetchcmd("touch %s.done" % (ud.fullmirror), d)
|
||||
|
||||
def unpack(self, ud, destdir, d):
|
||||
""" unpack the downloaded src to destdir"""
|
||||
|
||||
subdir = ud.parm.get("subpath", "")
|
||||
if subdir != "":
|
||||
readpathspec = ":%s" % subdir
|
||||
readpathspec = ":%s" % (subdir)
|
||||
def_destsuffix = "%s/" % os.path.basename(subdir.rstrip('/'))
|
||||
else:
|
||||
readpathspec = ""
|
||||
@@ -471,28 +255,34 @@ class Git(FetchMethod):
|
||||
if os.path.exists(destdir):
|
||||
bb.utils.prunedir(destdir)
|
||||
|
||||
if ud.shallow and (not os.path.exists(ud.clonedir) or self.need_update(ud, d)):
|
||||
bb.utils.mkdirhier(destdir)
|
||||
runfetchcmd("tar -xzf %s" % ud.fullshallow, d, workdir=destdir)
|
||||
else:
|
||||
runfetchcmd("%s clone %s %s/ %s" % (ud.basecmd, ud.cloneflags, ud.clonedir, destdir), d)
|
||||
cloneflags = "-s -n"
|
||||
if ud.bareclone:
|
||||
cloneflags += " --mirror"
|
||||
|
||||
repourl = self._get_repo_url(ud)
|
||||
runfetchcmd("%s remote set-url origin %s" % (ud.basecmd, repourl), d, workdir=destdir)
|
||||
# Versions of git prior to 1.7.9.2 have issues where foo.git and foo get confused
|
||||
# and you end up with some horrible union of the two when you attempt to clone it
|
||||
# The least invasive workaround seems to be a symlink to the real directory to
|
||||
# fool git into ignoring any .git version that may also be present.
|
||||
#
|
||||
# The issue is fixed in more recent versions of git so we can drop this hack in future
|
||||
# when that version becomes common enough.
|
||||
clonedir = ud.clonedir
|
||||
if not ud.path.endswith(".git"):
|
||||
indirectiondir = destdir[:-1] + ".indirectionsymlink"
|
||||
if os.path.exists(indirectiondir):
|
||||
os.remove(indirectiondir)
|
||||
bb.utils.mkdirhier(os.path.dirname(indirectiondir))
|
||||
os.symlink(ud.clonedir, indirectiondir)
|
||||
clonedir = indirectiondir
|
||||
|
||||
runfetchcmd("%s clone %s %s/ %s" % (ud.basecmd, cloneflags, clonedir, destdir), d)
|
||||
if not ud.nocheckout:
|
||||
os.chdir(destdir)
|
||||
if subdir != "":
|
||||
runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.revisions[ud.names[0]], readpathspec), d,
|
||||
workdir=destdir)
|
||||
runfetchcmd("%s checkout-index -q -f -a" % ud.basecmd, d, workdir=destdir)
|
||||
elif not ud.nobranch:
|
||||
branchname = ud.branches[ud.names[0]]
|
||||
runfetchcmd("%s checkout -B %s %s" % (ud.basecmd, branchname, \
|
||||
ud.revisions[ud.names[0]]), d, workdir=destdir)
|
||||
runfetchcmd("%s branch %s --set-upstream-to origin/%s" % (ud.basecmd, branchname, \
|
||||
branchname), d, workdir=destdir)
|
||||
runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.revisions[ud.names[0]], readpathspec), d)
|
||||
runfetchcmd("%s checkout-index -q -f -a" % ud.basecmd, d)
|
||||
else:
|
||||
runfetchcmd("%s checkout %s" % (ud.basecmd, ud.revisions[ud.names[0]]), d, workdir=destdir)
|
||||
|
||||
runfetchcmd("%s checkout %s" % (ud.basecmd, ud.revisions[ud.names[0]]), d)
|
||||
return True
|
||||
|
||||
def clean(self, ud, d):
|
||||
@@ -505,7 +295,7 @@ class Git(FetchMethod):
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
|
||||
def _contains_ref(self, ud, d, name, wd):
|
||||
def _contains_ref(self, ud, d, name):
|
||||
cmd = ""
|
||||
if ud.nobranch:
|
||||
cmd = "%s log --pretty=oneline -n 1 %s -- 2> /dev/null | wc -l" % (
|
||||
@@ -514,23 +304,13 @@ class Git(FetchMethod):
|
||||
cmd = "%s branch --contains %s --list %s 2> /dev/null | wc -l" % (
|
||||
ud.basecmd, ud.revisions[name], ud.branches[name])
|
||||
try:
|
||||
output = runfetchcmd(cmd, d, quiet=True, workdir=wd)
|
||||
output = runfetchcmd(cmd, d, quiet=True)
|
||||
except bb.fetch2.FetchError:
|
||||
return False
|
||||
if len(output.split()) > 1:
|
||||
raise bb.fetch2.FetchError("The command '%s' gave output with more then 1 line unexpectedly, output: '%s'" % (cmd, output))
|
||||
return output.split()[0] != "0"
|
||||
|
||||
def _get_repo_url(self, ud):
|
||||
"""
|
||||
Return the repository URL
|
||||
"""
|
||||
if ud.user:
|
||||
username = ud.user + '@'
|
||||
else:
|
||||
username = ""
|
||||
return "%s://%s%s%s" % (ud.proto, username, ud.host, ud.path)
|
||||
|
||||
def _revision_key(self, ud, d, name):
|
||||
"""
|
||||
Return a unique key for the url
|
||||
@@ -541,123 +321,38 @@ class Git(FetchMethod):
|
||||
"""
|
||||
Run git ls-remote with the specified search string
|
||||
"""
|
||||
# Prevent recursion e.g. in OE if SRCPV is in PV, PV is in WORKDIR,
|
||||
# and WORKDIR is in PATH (as a result of RSS), our call to
|
||||
# runfetchcmd() exports PATH so this function will get called again (!)
|
||||
# In this scenario the return call of the function isn't actually
|
||||
# important - WORKDIR isn't needed in PATH to call git ls-remote
|
||||
# anyway.
|
||||
if d.getVar('_BB_GIT_IN_LSREMOTE', False):
|
||||
return ''
|
||||
d.setVar('_BB_GIT_IN_LSREMOTE', '1')
|
||||
try:
|
||||
repourl = self._get_repo_url(ud)
|
||||
cmd = "%s ls-remote %s %s" % \
|
||||
(ud.basecmd, repourl, search)
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, cmd, repourl)
|
||||
output = runfetchcmd(cmd, d, True)
|
||||
if not output:
|
||||
raise bb.fetch2.FetchError("The command %s gave empty output unexpectedly" % cmd, ud.url)
|
||||
finally:
|
||||
d.delVar('_BB_GIT_IN_LSREMOTE')
|
||||
if ud.user:
|
||||
username = ud.user + '@'
|
||||
else:
|
||||
username = ""
|
||||
|
||||
cmd = "%s ls-remote %s://%s%s%s %s" % \
|
||||
(ud.basecmd, ud.proto, username, ud.host, ud.path, search)
|
||||
if ud.proto.lower() != 'file':
|
||||
bb.fetch2.check_network_access(d, cmd)
|
||||
output = runfetchcmd(cmd, d, True)
|
||||
if not output:
|
||||
raise bb.fetch2.FetchError("The command %s gave empty output unexpectedly" % cmd, ud.url)
|
||||
return output
|
||||
|
||||
def _latest_revision(self, ud, d, name):
|
||||
"""
|
||||
Compute the HEAD revision for the url
|
||||
"""
|
||||
output = self._lsremote(ud, d, "")
|
||||
# Tags of the form ^{} may not work, need to fallback to other form
|
||||
if ud.unresolvedrev[name][:5] == "refs/" or ud.usehead:
|
||||
head = ud.unresolvedrev[name]
|
||||
tag = ud.unresolvedrev[name]
|
||||
if ud.unresolvedrev[name][:5] == "refs/":
|
||||
search = "%s %s^{}" % (ud.unresolvedrev[name], ud.unresolvedrev[name])
|
||||
else:
|
||||
head = "refs/heads/%s" % ud.unresolvedrev[name]
|
||||
tag = "refs/tags/%s" % ud.unresolvedrev[name]
|
||||
for s in [head, tag + "^{}", tag]:
|
||||
for l in output.strip().split('\n'):
|
||||
sha1, ref = l.split()
|
||||
if s == ref:
|
||||
return sha1
|
||||
raise bb.fetch2.FetchError("Unable to resolve '%s' in upstream git repository in git ls-remote output for %s" % \
|
||||
(ud.unresolvedrev[name], ud.host+ud.path))
|
||||
|
||||
def latest_versionstring(self, ud, d):
|
||||
"""
|
||||
Compute the latest release name like "x.y.x" in "x.y.x+gitHASH"
|
||||
by searching through the tags output of ls-remote, comparing
|
||||
versions and returning the highest match.
|
||||
"""
|
||||
pupver = ('', '')
|
||||
|
||||
tagregex = re.compile(d.getVar('UPSTREAM_CHECK_GITTAGREGEX') or "(?P<pver>([0-9][\.|_]?)+)")
|
||||
try:
|
||||
output = self._lsremote(ud, d, "refs/tags/*")
|
||||
except (bb.fetch2.FetchError, bb.fetch2.NetworkAccess) as e:
|
||||
bb.note("Could not list remote: %s" % str(e))
|
||||
return pupver
|
||||
|
||||
verstring = ""
|
||||
revision = ""
|
||||
for line in output.split("\n"):
|
||||
if not line:
|
||||
break
|
||||
|
||||
tag_head = line.split("/")[-1]
|
||||
# Ignore non-released branches
|
||||
m = re.search("(alpha|beta|rc|final)+", tag_head)
|
||||
if m:
|
||||
continue
|
||||
|
||||
# search for version in the line
|
||||
tag = tagregex.search(tag_head)
|
||||
if tag == None:
|
||||
continue
|
||||
|
||||
tag = tag.group('pver')
|
||||
tag = tag.replace("_", ".")
|
||||
|
||||
if verstring and bb.utils.vercmp(("0", tag, ""), ("0", verstring, "")) < 0:
|
||||
continue
|
||||
|
||||
verstring = tag
|
||||
revision = line.split()[0]
|
||||
pupver = (verstring, revision)
|
||||
|
||||
return pupver
|
||||
search = "refs/heads/%s refs/tags/%s^{}" % (ud.unresolvedrev[name], ud.unresolvedrev[name])
|
||||
output = self._lsremote(ud, d, search)
|
||||
return output.split()[0]
|
||||
|
||||
def _build_revision(self, ud, d, name):
|
||||
return ud.revisions[name]
|
||||
|
||||
def gitpkgv_revision(self, ud, d, name):
|
||||
"""
|
||||
Return a sortable revision number by counting commits in the history
|
||||
Based on gitpkgv.bblass in meta-openembedded
|
||||
"""
|
||||
rev = self._build_revision(ud, d, name)
|
||||
localpath = ud.localpath
|
||||
rev_file = os.path.join(localpath, "oe-gitpkgv_" + rev)
|
||||
if not os.path.exists(localpath):
|
||||
commits = None
|
||||
else:
|
||||
if not os.path.exists(rev_file) or not os.path.getsize(rev_file):
|
||||
from pipes import quote
|
||||
commits = bb.fetch2.runfetchcmd(
|
||||
"git rev-list %s -- | wc -l" % quote(rev),
|
||||
d, quiet=True).strip().lstrip('0')
|
||||
if commits:
|
||||
open(rev_file, "w").write("%d\n" % int(commits))
|
||||
else:
|
||||
commits = open(rev_file, "r").readline(128).strip()
|
||||
if commits:
|
||||
return False, "%s+%s" % (commits, rev[:7])
|
||||
else:
|
||||
return True, str(rev)
|
||||
|
||||
def checkstatus(self, fetch, ud, d):
|
||||
def checkstatus(self, ud, d):
|
||||
fetchcmd = "%s ls-remote %s" % (ud.basecmd, ud.url)
|
||||
try:
|
||||
self._lsremote(ud, d, "")
|
||||
runfetchcmd(fetchcmd, d, quiet=True)
|
||||
return True
|
||||
except bb.fetch2.FetchError:
|
||||
except FetchError:
|
||||
return False
|
||||
|
||||
@@ -22,6 +22,7 @@ BitBake 'Fetch' git annex implementation
|
||||
|
||||
import os
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2.git import Git
|
||||
from bb.fetch2 import runfetchcmd
|
||||
from bb.fetch2 import logger
|
||||
@@ -33,59 +34,43 @@ class GitANNEX(Git):
|
||||
"""
|
||||
return ud.type in ['gitannex']
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
super(GitANNEX, self).urldata_init(ud, d)
|
||||
if ud.shallow:
|
||||
ud.shallow_extra_refs += ['refs/heads/git-annex', 'refs/heads/synced/*']
|
||||
|
||||
def uses_annex(self, ud, d, wd):
|
||||
def uses_annex(self, ud, d):
|
||||
for name in ud.names:
|
||||
try:
|
||||
runfetchcmd("%s rev-list git-annex" % (ud.basecmd), d, quiet=True, workdir=wd)
|
||||
runfetchcmd("%s rev-list git-annex" % (ud.basecmd), d, quiet=True)
|
||||
return True
|
||||
except bb.fetch.FetchError:
|
||||
pass
|
||||
|
||||
return False
|
||||
|
||||
def update_annex(self, ud, d, wd):
|
||||
def update_annex(self, ud, d):
|
||||
try:
|
||||
runfetchcmd("%s annex get --all" % (ud.basecmd), d, quiet=True, workdir=wd)
|
||||
runfetchcmd("%s annex get --all" % (ud.basecmd), d, quiet=True)
|
||||
except bb.fetch.FetchError:
|
||||
return False
|
||||
runfetchcmd("chmod u+w -R %s/annex" % (ud.clonedir), d, quiet=True, workdir=wd)
|
||||
runfetchcmd("chmod u+w -R %s/annex" % (ud.clonedir), d, quiet=True)
|
||||
|
||||
return True
|
||||
|
||||
def download(self, ud, d):
|
||||
Git.download(self, ud, d)
|
||||
|
||||
if not ud.shallow or ud.localpath != ud.fullshallow:
|
||||
if self.uses_annex(ud, d, ud.clonedir):
|
||||
self.update_annex(ud, d, ud.clonedir)
|
||||
|
||||
def clone_shallow_local(self, ud, dest, d):
|
||||
super(GitANNEX, self).clone_shallow_local(ud, dest, d)
|
||||
|
||||
try:
|
||||
runfetchcmd("%s annex init" % ud.basecmd, d, workdir=dest)
|
||||
except bb.fetch.FetchError:
|
||||
pass
|
||||
|
||||
if self.uses_annex(ud, d, dest):
|
||||
runfetchcmd("%s annex get" % ud.basecmd, d, workdir=dest)
|
||||
runfetchcmd("chmod u+w -R %s/.git/annex" % (dest), d, quiet=True, workdir=dest)
|
||||
os.chdir(ud.clonedir)
|
||||
annex = self.uses_annex(ud, d)
|
||||
if annex:
|
||||
self.update_annex(ud, d)
|
||||
|
||||
def unpack(self, ud, destdir, d):
|
||||
Git.unpack(self, ud, destdir, d)
|
||||
|
||||
os.chdir(ud.destdir)
|
||||
try:
|
||||
runfetchcmd("%s annex init" % (ud.basecmd), d, workdir=ud.destdir)
|
||||
runfetchcmd("%s annex sync" % (ud.basecmd), d)
|
||||
except bb.fetch.FetchError:
|
||||
pass
|
||||
|
||||
annex = self.uses_annex(ud, d, ud.destdir)
|
||||
annex = self.uses_annex(ud, d)
|
||||
if annex:
|
||||
runfetchcmd("%s annex get" % (ud.basecmd), d, workdir=ud.destdir)
|
||||
runfetchcmd("chmod u+w -R %s/.git/annex" % (ud.destdir), d, quiet=True, workdir=ud.destdir)
|
||||
|
||||
runfetchcmd("%s annex get" % (ud.basecmd), d)
|
||||
runfetchcmd("chmod u+w -R %s/.git/annex" % (ud.destdir), d, quiet=True)
|
||||
|
||||
@@ -31,6 +31,7 @@ NOTE: Switching a SRC_URI from "git://" to "gitsm://" requires a clean of your r
|
||||
|
||||
import os
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2.git import Git
|
||||
from bb.fetch2 import runfetchcmd
|
||||
from bb.fetch2 import logger
|
||||
@@ -42,10 +43,10 @@ class GitSM(Git):
|
||||
"""
|
||||
return ud.type in ['gitsm']
|
||||
|
||||
def uses_submodules(self, ud, d, wd):
|
||||
def uses_submodules(self, ud, d):
|
||||
for name in ud.names:
|
||||
try:
|
||||
runfetchcmd("%s show %s:.gitmodules" % (ud.basecmd, ud.revisions[name]), d, quiet=True, workdir=wd)
|
||||
runfetchcmd("%s show %s:.gitmodules" % (ud.basecmd, ud.revisions[name]), d, quiet=True)
|
||||
return True
|
||||
except bb.fetch.FetchError:
|
||||
pass
|
||||
@@ -106,30 +107,30 @@ class GitSM(Git):
|
||||
os.mkdir(tmpclonedir)
|
||||
os.rename(ud.clonedir, gitdir)
|
||||
runfetchcmd("sed " + gitdir + "/config -i -e 's/bare.*=.*true/bare = false/'", d)
|
||||
runfetchcmd(ud.basecmd + " reset --hard", d, workdir=tmpclonedir)
|
||||
runfetchcmd(ud.basecmd + " checkout -f " + ud.revisions[ud.names[0]], d, workdir=tmpclonedir)
|
||||
runfetchcmd(ud.basecmd + " submodule update --init --recursive", d, workdir=tmpclonedir)
|
||||
os.chdir(tmpclonedir)
|
||||
runfetchcmd(ud.basecmd + " reset --hard", d)
|
||||
runfetchcmd(ud.basecmd + " submodule init", d)
|
||||
runfetchcmd(ud.basecmd + " submodule update", d)
|
||||
self._set_relative_paths(tmpclonedir)
|
||||
runfetchcmd("sed " + gitdir + "/config -i -e 's/bare.*=.*false/bare = true/'", d, workdir=tmpclonedir)
|
||||
runfetchcmd("sed " + gitdir + "/config -i -e 's/bare.*=.*false/bare = true/'", d)
|
||||
os.rename(gitdir, ud.clonedir,)
|
||||
bb.utils.remove(tmpclonedir, True)
|
||||
|
||||
def download(self, ud, d):
|
||||
Git.download(self, ud, d)
|
||||
|
||||
if not ud.shallow or ud.localpath != ud.fullshallow:
|
||||
submodules = self.uses_submodules(ud, d, ud.clonedir)
|
||||
if submodules:
|
||||
self.update_submodules(ud, d)
|
||||
|
||||
def clone_shallow_local(self, ud, dest, d):
|
||||
super(GitSM, self).clone_shallow_local(ud, dest, d)
|
||||
|
||||
runfetchcmd('cp -fpPRH "%s/modules" "%s/"' % (ud.clonedir, os.path.join(dest, '.git')), d)
|
||||
os.chdir(ud.clonedir)
|
||||
submodules = self.uses_submodules(ud, d)
|
||||
if submodules:
|
||||
self.update_submodules(ud, d)
|
||||
|
||||
def unpack(self, ud, destdir, d):
|
||||
Git.unpack(self, ud, destdir, d)
|
||||
|
||||
os.chdir(ud.destdir)
|
||||
submodules = self.uses_submodules(ud, d)
|
||||
if submodules:
|
||||
runfetchcmd("cp -r " + ud.clonedir + "/modules " + ud.destdir + "/.git/", d)
|
||||
runfetchcmd(ud.basecmd + " submodule init", d)
|
||||
runfetchcmd(ud.basecmd + " submodule update", d)
|
||||
|
||||
if self.uses_submodules(ud, d, ud.destdir):
|
||||
runfetchcmd(ud.basecmd + " checkout " + ud.revisions[ud.names[0]], d, workdir=ud.destdir)
|
||||
runfetchcmd(ud.basecmd + " submodule update --init --recursive", d, workdir=ud.destdir)
|
||||
|
||||
@@ -28,7 +28,7 @@ import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
import errno
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import MissingParameterError
|
||||
@@ -43,13 +43,6 @@ class Hg(FetchMethod):
|
||||
"""
|
||||
return ud.type in ['hg']
|
||||
|
||||
def supports_checksum(self, urldata):
|
||||
"""
|
||||
Don't require checksums for local archives created from
|
||||
repository checkouts.
|
||||
"""
|
||||
return False
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
"""
|
||||
init hg specific variable within url data
|
||||
@@ -59,34 +52,19 @@ class Hg(FetchMethod):
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
if 'protocol' in ud.parm:
|
||||
ud.proto = ud.parm['protocol']
|
||||
elif not ud.host:
|
||||
ud.proto = 'file'
|
||||
else:
|
||||
ud.proto = "hg"
|
||||
# Create paths to mercurial checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(data.expand('${HGDIR}', d), ud.host, relpath)
|
||||
ud.moddir = os.path.join(ud.pkgdir, ud.module)
|
||||
|
||||
ud.setup_revisions(d)
|
||||
ud.setup_revisons(d)
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
ud.revision = ud.parm['rev']
|
||||
elif not ud.revision:
|
||||
ud.revision = self.latest_revision(ud, d)
|
||||
|
||||
# Create paths to mercurial checkouts
|
||||
hgsrcname = '%s_%s_%s' % (ud.module.replace('/', '.'), \
|
||||
ud.host, ud.path.replace('/', '.'))
|
||||
mirrortarball = 'hg_%s.tar.gz' % hgsrcname
|
||||
ud.fullmirror = os.path.join(d.getVar("DL_DIR"), mirrortarball)
|
||||
ud.mirrortarballs = [mirrortarball]
|
||||
|
||||
hgdir = d.getVar("HGDIR") or (d.getVar("DL_DIR") + "/hg/")
|
||||
ud.pkgdir = os.path.join(hgdir, hgsrcname)
|
||||
ud.moddir = os.path.join(ud.pkgdir, ud.module)
|
||||
ud.localfile = ud.moddir
|
||||
ud.basecmd = d.getVar("FETCHCMD_hg") or "/usr/bin/env hg"
|
||||
|
||||
ud.write_tarballs = d.getVar("BB_GENERATE_MIRROR_TARBALLS")
|
||||
ud.localfile = data.expand('%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
def need_update(self, ud, d):
|
||||
revTag = ud.parm.get('rev', 'tip')
|
||||
@@ -96,21 +74,14 @@ class Hg(FetchMethod):
|
||||
return True
|
||||
return False
|
||||
|
||||
def try_premirror(self, ud, d):
|
||||
# If we don't do this, updating an existing checkout with only premirrors
|
||||
# is not possible
|
||||
if d.getVar("BB_FETCH_PREMIRRORONLY") is not None:
|
||||
return True
|
||||
if os.path.exists(ud.moddir):
|
||||
return False
|
||||
return True
|
||||
|
||||
def _buildhgcommand(self, ud, d, command):
|
||||
"""
|
||||
Build up an hg commandline based on ud
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
basecmd = data.expand('${FETCHCMD_hg}', d)
|
||||
|
||||
proto = ud.parm.get('protocol', 'http')
|
||||
|
||||
host = ud.host
|
||||
@@ -127,7 +98,7 @@ class Hg(FetchMethod):
|
||||
hgroot = ud.user + "@" + host + ud.path
|
||||
|
||||
if command == "info":
|
||||
return "%s identify -i %s://%s/%s" % (ud.basecmd, proto, hgroot, ud.module)
|
||||
return "%s identify -i %s://%s/%s" % (basecmd, proto, hgroot, ud.module)
|
||||
|
||||
options = [];
|
||||
|
||||
@@ -140,22 +111,22 @@ class Hg(FetchMethod):
|
||||
|
||||
if command == "fetch":
|
||||
if ud.user and ud.pswd:
|
||||
cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" clone %s %s://%s/%s %s" % (ud.basecmd, ud.user, ud.pswd, proto, " ".join(options), proto, hgroot, ud.module, ud.module)
|
||||
cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" clone %s %s://%s/%s %s" % (basecmd, ud.user, ud.pswd, proto, " ".join(options), proto, hgroot, ud.module, ud.module)
|
||||
else:
|
||||
cmd = "%s clone %s %s://%s/%s %s" % (ud.basecmd, " ".join(options), proto, hgroot, ud.module, ud.module)
|
||||
cmd = "%s clone %s %s://%s/%s %s" % (basecmd, " ".join(options), proto, hgroot, ud.module, ud.module)
|
||||
elif command == "pull":
|
||||
# do not pass options list; limiting pull to rev causes the local
|
||||
# repo not to contain it and immediately following "update" command
|
||||
# will crash
|
||||
if ud.user and ud.pswd:
|
||||
cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" pull" % (ud.basecmd, ud.user, ud.pswd, proto)
|
||||
cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" pull" % (basecmd, ud.user, ud.pswd, proto)
|
||||
else:
|
||||
cmd = "%s pull" % (ud.basecmd)
|
||||
cmd = "%s pull" % (basecmd)
|
||||
elif command == "update":
|
||||
if ud.user and ud.pswd:
|
||||
cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" update -C %s" % (ud.basecmd, ud.user, ud.pswd, proto, " ".join(options))
|
||||
cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" update -C %s" % (basecmd, ud.user, ud.pswd, proto, " ".join(options))
|
||||
else:
|
||||
cmd = "%s update -C %s" % (ud.basecmd, " ".join(options))
|
||||
cmd = "%s update -C %s" % (basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid hg command %s" % command, ud.url)
|
||||
|
||||
@@ -166,53 +137,40 @@ class Hg(FetchMethod):
|
||||
|
||||
logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
|
||||
|
||||
# If the checkout doesn't exist and the mirror tarball does, extract it
|
||||
if not os.path.exists(ud.pkgdir) and os.path.exists(ud.fullmirror):
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
runfetchcmd("tar -xzf %s" % (ud.fullmirror), d, workdir=ud.pkgdir)
|
||||
|
||||
if os.access(os.path.join(ud.moddir, '.hg'), os.R_OK):
|
||||
# Found the source, check whether need pull
|
||||
updatecmd = self._buildhgcommand(ud, d, "update")
|
||||
updatecmd = self._buildhgcommand(ud, d, "pull")
|
||||
logger.info("Update " + ud.url)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", updatecmd)
|
||||
try:
|
||||
runfetchcmd(updatecmd, d, workdir=ud.moddir)
|
||||
except bb.fetch2.FetchError:
|
||||
# Runnning pull in the repo
|
||||
pullcmd = self._buildhgcommand(ud, d, "pull")
|
||||
logger.info("Pulling " + ud.url)
|
||||
# update sources there
|
||||
logger.debug(1, "Running %s", pullcmd)
|
||||
bb.fetch2.check_network_access(d, pullcmd, ud.url)
|
||||
runfetchcmd(pullcmd, d, workdir=ud.moddir)
|
||||
try:
|
||||
os.unlink(ud.fullmirror)
|
||||
except OSError as exc:
|
||||
if exc.errno != errno.ENOENT:
|
||||
raise
|
||||
bb.fetch2.check_network_access(d, updatecmd, ud.url)
|
||||
runfetchcmd(updatecmd, d)
|
||||
|
||||
# No source found, clone it.
|
||||
if not os.path.exists(ud.moddir):
|
||||
else:
|
||||
fetchcmd = self._buildhgcommand(ud, d, "fetch")
|
||||
logger.info("Fetch " + ud.url)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", fetchcmd)
|
||||
bb.fetch2.check_network_access(d, fetchcmd, ud.url)
|
||||
runfetchcmd(fetchcmd, d, workdir=ud.pkgdir)
|
||||
runfetchcmd(fetchcmd, d)
|
||||
|
||||
# Even when we clone (fetch), we still need to update as hg's clone
|
||||
# won't checkout the specified revision if its on a branch
|
||||
updatecmd = self._buildhgcommand(ud, d, "update")
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", updatecmd)
|
||||
runfetchcmd(updatecmd, d, workdir=ud.moddir)
|
||||
runfetchcmd(updatecmd, d)
|
||||
|
||||
def clean(self, ud, d):
|
||||
""" Clean the hg dir """
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude '.hg' --exclude '.hgrags'"
|
||||
|
||||
bb.utils.remove(ud.localpath, True)
|
||||
bb.utils.remove(ud.fullmirror)
|
||||
bb.utils.remove(ud.fullmirror + ".done")
|
||||
os.chdir(ud.pkgdir)
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d, cleanup = [ud.localpath])
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
@@ -221,7 +179,7 @@ class Hg(FetchMethod):
|
||||
"""
|
||||
Compute tip revision for the url
|
||||
"""
|
||||
bb.fetch2.check_network_access(d, self._buildhgcommand(ud, d, "info"), ud.url)
|
||||
bb.fetch2.check_network_access(d, self._buildhgcommand(ud, d, "info"))
|
||||
output = runfetchcmd(self._buildhgcommand(ud, d, "info"), d)
|
||||
return output.strip()
|
||||
|
||||
@@ -233,38 +191,3 @@ class Hg(FetchMethod):
|
||||
Return a unique key for the url
|
||||
"""
|
||||
return "hg:" + ud.moddir
|
||||
|
||||
def build_mirror_data(self, ud, d):
|
||||
# Generate a mirror tarball if needed
|
||||
if ud.write_tarballs == "1" and not os.path.exists(ud.fullmirror):
|
||||
# it's possible that this symlink points to read-only filesystem with PREMIRROR
|
||||
if os.path.islink(ud.fullmirror):
|
||||
os.unlink(ud.fullmirror)
|
||||
|
||||
logger.info("Creating tarball of hg repository")
|
||||
runfetchcmd("tar -czf %s %s" % (ud.fullmirror, ud.module), d, workdir=ud.pkgdir)
|
||||
runfetchcmd("touch %s.done" % (ud.fullmirror), d, workdir=ud.pkgdir)
|
||||
|
||||
def localpath(self, ud, d):
|
||||
return ud.pkgdir
|
||||
|
||||
def unpack(self, ud, destdir, d):
|
||||
"""
|
||||
Make a local clone or export for the url
|
||||
"""
|
||||
|
||||
revflag = "-r %s" % ud.revision
|
||||
subdir = ud.parm.get("destsuffix", ud.module)
|
||||
codir = "%s/%s" % (destdir, subdir)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata != "nokeep":
|
||||
if not os.access(os.path.join(codir, '.hg'), os.R_OK):
|
||||
logger.debug(2, "Unpack: creating new hg repository in '" + codir + "'")
|
||||
runfetchcmd("%s init %s" % (ud.basecmd, codir), d)
|
||||
logger.debug(2, "Unpack: updating source in '" + codir + "'")
|
||||
runfetchcmd("%s pull %s" % (ud.basecmd, ud.moddir), d, workdir=codir)
|
||||
runfetchcmd("%s up -C %s" % (ud.basecmd, revflag), d, workdir=codir)
|
||||
else:
|
||||
logger.debug(2, "Unpack: extracting source to '" + codir + "'")
|
||||
runfetchcmd("%s archive -t files %s %s" % (ud.basecmd, revflag, codir), d, workdir=ud.moddir)
|
||||
|
||||
@@ -26,9 +26,10 @@ BitBake build tools.
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import urllib.request, urllib.parse, urllib.error
|
||||
import urllib
|
||||
import bb
|
||||
import bb.utils
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod, FetchError
|
||||
from bb.fetch2 import logger
|
||||
|
||||
@@ -41,10 +42,9 @@ class Local(FetchMethod):
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
# We don't set localfile as for this fetcher the file is already local!
|
||||
ud.decodedurl = urllib.parse.unquote(ud.url.split("://")[1].split(";")[0])
|
||||
ud.decodedurl = urllib.unquote(ud.url.split("://")[1].split(";")[0])
|
||||
ud.basename = os.path.basename(ud.decodedurl)
|
||||
ud.basepath = ud.decodedurl
|
||||
ud.needdonestamp = False
|
||||
return
|
||||
|
||||
def localpath(self, urldata, d):
|
||||
@@ -62,11 +62,17 @@ class Local(FetchMethod):
|
||||
newpath = path
|
||||
if path[0] == "/":
|
||||
return [path]
|
||||
filespath = d.getVar('FILESPATH')
|
||||
filespath = data.getVar('FILESPATH', d, True)
|
||||
if filespath:
|
||||
logger.debug(2, "Searching for %s in paths:\n %s" % (path, "\n ".join(filespath.split(":"))))
|
||||
newpath, hist = bb.utils.which(filespath, path, history=True)
|
||||
searched.extend(hist)
|
||||
if not newpath:
|
||||
filesdir = data.getVar('FILESDIR', d, True)
|
||||
if filesdir:
|
||||
logger.debug(2, "Searching for %s in path: %s" % (path, filesdir))
|
||||
newpath = os.path.join(filesdir, path)
|
||||
searched.append(newpath)
|
||||
if (not newpath or not os.path.exists(newpath)) and path.find("*") != -1:
|
||||
# For expressions using '*', best we can do is take the first directory in FILESPATH that exists
|
||||
newpath, hist = bb.utils.which(filespath, ".", history=True)
|
||||
@@ -74,7 +80,7 @@ class Local(FetchMethod):
|
||||
logger.debug(2, "Searching for %s in path: %s" % (path, newpath))
|
||||
return searched
|
||||
if not os.path.exists(newpath):
|
||||
dldirfile = os.path.join(d.getVar("DL_DIR"), path)
|
||||
dldirfile = os.path.join(d.getVar("DL_DIR", True), path)
|
||||
logger.debug(2, "Defaulting to %s for %s" % (dldirfile, path))
|
||||
bb.utils.mkdirhier(os.path.dirname(dldirfile))
|
||||
searched.append(dldirfile)
|
||||
@@ -93,17 +99,20 @@ class Local(FetchMethod):
|
||||
# no need to fetch local files, we'll deal with them in place.
|
||||
if self.supports_checksum(urldata) and not os.path.exists(urldata.localpath):
|
||||
locations = []
|
||||
filespath = d.getVar('FILESPATH')
|
||||
filespath = data.getVar('FILESPATH', d, True)
|
||||
if filespath:
|
||||
locations = filespath.split(":")
|
||||
locations.append(d.getVar("DL_DIR"))
|
||||
filesdir = data.getVar('FILESDIR', d, True)
|
||||
if filesdir:
|
||||
locations.append(filesdir)
|
||||
locations.append(d.getVar("DL_DIR", True))
|
||||
|
||||
msg = "Unable to find file " + urldata.url + " anywhere. The paths that were searched were:\n " + "\n ".join(locations)
|
||||
raise FetchError(msg)
|
||||
|
||||
return True
|
||||
|
||||
def checkstatus(self, fetch, urldata, d):
|
||||
def checkstatus(self, urldata, d):
|
||||
"""
|
||||
Check the status of the url
|
||||
"""
|
||||
|
||||
@@ -1,308 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' NPM implementation
|
||||
|
||||
The NPM fetcher is used to retrieve files from the npmjs repository
|
||||
|
||||
Usage in the recipe:
|
||||
|
||||
SRC_URI = "npm://registry.npmjs.org/;name=${PN};version=${PV}"
|
||||
Suported SRC_URI options are:
|
||||
|
||||
- name
|
||||
- version
|
||||
|
||||
npm://registry.npmjs.org/${PN}/-/${PN}-${PV}.tgz would become npm://registry.npmjs.org;name=${PN};version=${PV}
|
||||
The fetcher all triggers off the existence of ud.localpath. If that exists and has the ".done" stamp, its assumed the fetch is good/done
|
||||
|
||||
"""
|
||||
|
||||
import os
|
||||
import sys
|
||||
import urllib.request, urllib.parse, urllib.error
|
||||
import json
|
||||
import subprocess
|
||||
import signal
|
||||
import bb
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import ChecksumError
|
||||
from bb.fetch2 import runfetchcmd
|
||||
from bb.fetch2 import logger
|
||||
from bb.fetch2 import UnpackError
|
||||
from bb.fetch2 import ParameterError
|
||||
|
||||
def subprocess_setup():
|
||||
# Python installs a SIGPIPE handler by default. This is usually not what
|
||||
# non-Python subprocesses expect.
|
||||
# SIGPIPE errors are known issues with gzip/bash
|
||||
signal.signal(signal.SIGPIPE, signal.SIG_DFL)
|
||||
|
||||
class Npm(FetchMethod):
|
||||
|
||||
"""Class to fetch urls via 'npm'"""
|
||||
def init(self, d):
|
||||
pass
|
||||
|
||||
def supports(self, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with npm
|
||||
"""
|
||||
return ud.type in ['npm']
|
||||
|
||||
def debug(self, msg):
|
||||
logger.debug(1, "NpmFetch: %s", msg)
|
||||
|
||||
def clean(self, ud, d):
|
||||
logger.debug(2, "Calling cleanup %s" % ud.pkgname)
|
||||
bb.utils.remove(ud.localpath, False)
|
||||
bb.utils.remove(ud.pkgdatadir, True)
|
||||
bb.utils.remove(ud.fullmirror, False)
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
"""
|
||||
init NPM specific variable within url data
|
||||
"""
|
||||
if 'downloadfilename' in ud.parm:
|
||||
ud.basename = ud.parm['downloadfilename']
|
||||
else:
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
|
||||
# can't call it ud.name otherwise fetcher base class will start doing sha1stuff
|
||||
# TODO: find a way to get an sha1/sha256 manifest of pkg & all deps
|
||||
ud.pkgname = ud.parm.get("name", None)
|
||||
if not ud.pkgname:
|
||||
raise ParameterError("NPM fetcher requires a name parameter", ud.url)
|
||||
ud.version = ud.parm.get("version", None)
|
||||
if not ud.version:
|
||||
raise ParameterError("NPM fetcher requires a version parameter", ud.url)
|
||||
ud.bbnpmmanifest = "%s-%s.deps.json" % (ud.pkgname, ud.version)
|
||||
ud.bbnpmmanifest = ud.bbnpmmanifest.replace('/', '-')
|
||||
ud.registry = "http://%s" % (ud.url.replace('npm://', '', 1).split(';'))[0]
|
||||
prefixdir = "npm/%s" % ud.pkgname
|
||||
ud.pkgdatadir = d.expand("${DL_DIR}/%s" % prefixdir)
|
||||
if not os.path.exists(ud.pkgdatadir):
|
||||
bb.utils.mkdirhier(ud.pkgdatadir)
|
||||
ud.localpath = d.expand("${DL_DIR}/npm/%s" % ud.bbnpmmanifest)
|
||||
|
||||
self.basecmd = d.getVar("FETCHCMD_wget") or "/usr/bin/env wget -O -t 2 -T 30 -nv --passive-ftp --no-check-certificate "
|
||||
ud.prefixdir = prefixdir
|
||||
|
||||
ud.write_tarballs = ((d.getVar("BB_GENERATE_MIRROR_TARBALLS") or "0") != "0")
|
||||
mirrortarball = 'npm_%s-%s.tar.xz' % (ud.pkgname, ud.version)
|
||||
mirrortarball = mirrortarball.replace('/', '-')
|
||||
ud.fullmirror = os.path.join(d.getVar("DL_DIR"), mirrortarball)
|
||||
ud.mirrortarballs = [mirrortarball]
|
||||
|
||||
def need_update(self, ud, d):
|
||||
if os.path.exists(ud.localpath):
|
||||
return False
|
||||
return True
|
||||
|
||||
def _runwget(self, ud, d, command, quiet):
|
||||
logger.debug(2, "Fetching %s using command '%s'" % (ud.url, command))
|
||||
bb.fetch2.check_network_access(d, command, ud.url)
|
||||
dldir = d.getVar("DL_DIR")
|
||||
runfetchcmd(command, d, quiet, workdir=dldir)
|
||||
|
||||
def _unpackdep(self, ud, pkg, data, destdir, dldir, d):
|
||||
file = data[pkg]['tgz']
|
||||
logger.debug(2, "file to extract is %s" % file)
|
||||
if file.endswith('.tgz') or file.endswith('.tar.gz') or file.endswith('.tar.Z'):
|
||||
cmd = 'tar xz --strip 1 --no-same-owner --warning=no-unknown-keyword -f %s/%s' % (dldir, file)
|
||||
else:
|
||||
bb.fatal("NPM package %s downloaded not a tarball!" % file)
|
||||
|
||||
# Change to subdir before executing command
|
||||
if not os.path.exists(destdir):
|
||||
os.makedirs(destdir)
|
||||
path = d.getVar('PATH')
|
||||
if path:
|
||||
cmd = "PATH=\"%s\" %s" % (path, cmd)
|
||||
bb.note("Unpacking %s to %s/" % (file, destdir))
|
||||
ret = subprocess.call(cmd, preexec_fn=subprocess_setup, shell=True, cwd=destdir)
|
||||
|
||||
if ret != 0:
|
||||
raise UnpackError("Unpack command %s failed with return value %s" % (cmd, ret), ud.url)
|
||||
|
||||
if 'deps' not in data[pkg]:
|
||||
return
|
||||
for dep in data[pkg]['deps']:
|
||||
self._unpackdep(ud, dep, data[pkg]['deps'], "%s/node_modules/%s" % (destdir, dep), dldir, d)
|
||||
|
||||
|
||||
def unpack(self, ud, destdir, d):
|
||||
dldir = d.getVar("DL_DIR")
|
||||
with open("%s/npm/%s" % (dldir, ud.bbnpmmanifest)) as datafile:
|
||||
workobj = json.load(datafile)
|
||||
dldir = "%s/%s" % (os.path.dirname(ud.localpath), ud.pkgname)
|
||||
|
||||
if 'subdir' in ud.parm:
|
||||
unpackdir = '%s/%s' % (destdir, ud.parm.get('subdir'))
|
||||
else:
|
||||
unpackdir = '%s/npmpkg' % destdir
|
||||
|
||||
self._unpackdep(ud, ud.pkgname, workobj, unpackdir, dldir, d)
|
||||
|
||||
def _parse_view(self, output):
|
||||
'''
|
||||
Parse the output of npm view --json; the last JSON result
|
||||
is assumed to be the one that we're interested in.
|
||||
'''
|
||||
pdata = None
|
||||
outdeps = {}
|
||||
datalines = []
|
||||
bracelevel = 0
|
||||
for line in output.splitlines():
|
||||
if bracelevel:
|
||||
datalines.append(line)
|
||||
elif '{' in line:
|
||||
datalines = []
|
||||
datalines.append(line)
|
||||
bracelevel = bracelevel + line.count('{') - line.count('}')
|
||||
if datalines:
|
||||
pdata = json.loads('\n'.join(datalines))
|
||||
return pdata
|
||||
|
||||
def _getdependencies(self, pkg, data, version, d, ud, optional=False, fetchedlist=None):
|
||||
if fetchedlist is None:
|
||||
fetchedlist = []
|
||||
pkgfullname = pkg
|
||||
if version != '*' and not '/' in version:
|
||||
pkgfullname += "@'%s'" % version
|
||||
logger.debug(2, "Calling getdeps on %s" % pkg)
|
||||
fetchcmd = "npm view %s --json --registry %s" % (pkgfullname, ud.registry)
|
||||
output = runfetchcmd(fetchcmd, d, True)
|
||||
pdata = self._parse_view(output)
|
||||
if not pdata:
|
||||
raise FetchError("The command '%s' returned no output" % fetchcmd)
|
||||
if optional:
|
||||
pkg_os = pdata.get('os', None)
|
||||
if pkg_os:
|
||||
if not isinstance(pkg_os, list):
|
||||
pkg_os = [pkg_os]
|
||||
blacklist = False
|
||||
for item in pkg_os:
|
||||
if item.startswith('!'):
|
||||
blacklist = True
|
||||
break
|
||||
if (not blacklist and 'linux' not in pkg_os) or '!linux' in pkg_os:
|
||||
logger.debug(2, "Skipping %s since it's incompatible with Linux" % pkg)
|
||||
return
|
||||
#logger.debug(2, "Output URL is %s - %s - %s" % (ud.basepath, ud.basename, ud.localfile))
|
||||
outputurl = pdata['dist']['tarball']
|
||||
data[pkg] = {}
|
||||
data[pkg]['tgz'] = os.path.basename(outputurl)
|
||||
if outputurl in fetchedlist:
|
||||
return
|
||||
|
||||
self._runwget(ud, d, "%s --directory-prefix=%s %s" % (self.basecmd, ud.prefixdir, outputurl), False)
|
||||
fetchedlist.append(outputurl)
|
||||
|
||||
dependencies = pdata.get('dependencies', {})
|
||||
optionalDependencies = pdata.get('optionalDependencies', {})
|
||||
dependencies.update(optionalDependencies)
|
||||
depsfound = {}
|
||||
optdepsfound = {}
|
||||
data[pkg]['deps'] = {}
|
||||
for dep in dependencies:
|
||||
if dep in optionalDependencies:
|
||||
optdepsfound[dep] = dependencies[dep]
|
||||
else:
|
||||
depsfound[dep] = dependencies[dep]
|
||||
for dep, version in optdepsfound.items():
|
||||
self._getdependencies(dep, data[pkg]['deps'], version, d, ud, optional=True, fetchedlist=fetchedlist)
|
||||
for dep, version in depsfound.items():
|
||||
self._getdependencies(dep, data[pkg]['deps'], version, d, ud, fetchedlist=fetchedlist)
|
||||
|
||||
def _getshrinkeddependencies(self, pkg, data, version, d, ud, lockdown, manifest, toplevel=True):
|
||||
logger.debug(2, "NPM shrinkwrap file is %s" % data)
|
||||
if toplevel:
|
||||
name = data.get('name', None)
|
||||
if name and name != pkg:
|
||||
for obj in data.get('dependencies', []):
|
||||
if obj == pkg:
|
||||
self._getshrinkeddependencies(obj, data['dependencies'][obj], data['dependencies'][obj]['version'], d, ud, lockdown, manifest, False)
|
||||
return
|
||||
outputurl = "invalid"
|
||||
if ('resolved' not in data) or (not data['resolved'].startswith('http')):
|
||||
# will be the case for ${PN}
|
||||
fetchcmd = "npm view %s@%s dist.tarball --registry %s" % (pkg, version, ud.registry)
|
||||
logger.debug(2, "Found this matching URL: %s" % str(fetchcmd))
|
||||
outputurl = runfetchcmd(fetchcmd, d, True)
|
||||
else:
|
||||
outputurl = data['resolved']
|
||||
self._runwget(ud, d, "%s --directory-prefix=%s %s" % (self.basecmd, ud.prefixdir, outputurl), False)
|
||||
manifest[pkg] = {}
|
||||
manifest[pkg]['tgz'] = os.path.basename(outputurl).rstrip()
|
||||
manifest[pkg]['deps'] = {}
|
||||
|
||||
if pkg in lockdown:
|
||||
sha1_expected = lockdown[pkg][version]
|
||||
sha1_data = bb.utils.sha1_file("npm/%s/%s" % (ud.pkgname, manifest[pkg]['tgz']))
|
||||
if sha1_expected != sha1_data:
|
||||
msg = "\nFile: '%s' has %s checksum %s when %s was expected" % (manifest[pkg]['tgz'], 'sha1', sha1_data, sha1_expected)
|
||||
raise ChecksumError('Checksum mismatch!%s' % msg)
|
||||
else:
|
||||
logger.debug(2, "No lockdown data for %s@%s" % (pkg, version))
|
||||
|
||||
if 'dependencies' in data:
|
||||
for obj in data['dependencies']:
|
||||
logger.debug(2, "Found dep is %s" % str(obj))
|
||||
self._getshrinkeddependencies(obj, data['dependencies'][obj], data['dependencies'][obj]['version'], d, ud, lockdown, manifest[pkg]['deps'], False)
|
||||
|
||||
def download(self, ud, d):
|
||||
"""Fetch url"""
|
||||
jsondepobj = {}
|
||||
shrinkobj = {}
|
||||
lockdown = {}
|
||||
|
||||
if not os.listdir(ud.pkgdatadir) and os.path.exists(ud.fullmirror):
|
||||
dest = d.getVar("DL_DIR")
|
||||
bb.utils.mkdirhier(dest)
|
||||
runfetchcmd("tar -xJf %s" % (ud.fullmirror), d, workdir=dest)
|
||||
return
|
||||
|
||||
if ud.parm.get("noverify", None) != '1':
|
||||
shwrf = d.getVar('NPM_SHRINKWRAP')
|
||||
logger.debug(2, "NPM shrinkwrap file is %s" % shwrf)
|
||||
if shwrf:
|
||||
try:
|
||||
with open(shwrf) as datafile:
|
||||
shrinkobj = json.load(datafile)
|
||||
except Exception as e:
|
||||
raise FetchError('Error loading NPM_SHRINKWRAP file "%s" for %s: %s' % (shwrf, ud.pkgname, str(e)))
|
||||
elif not ud.ignore_checksums:
|
||||
logger.warning('Missing shrinkwrap file in NPM_SHRINKWRAP for %s, this will lead to unreliable builds!' % ud.pkgname)
|
||||
lckdf = d.getVar('NPM_LOCKDOWN')
|
||||
logger.debug(2, "NPM lockdown file is %s" % lckdf)
|
||||
if lckdf:
|
||||
try:
|
||||
with open(lckdf) as datafile:
|
||||
lockdown = json.load(datafile)
|
||||
except Exception as e:
|
||||
raise FetchError('Error loading NPM_LOCKDOWN file "%s" for %s: %s' % (lckdf, ud.pkgname, str(e)))
|
||||
elif not ud.ignore_checksums:
|
||||
logger.warning('Missing lockdown file in NPM_LOCKDOWN for %s, this will lead to unreproducible builds!' % ud.pkgname)
|
||||
|
||||
if ('name' not in shrinkobj):
|
||||
self._getdependencies(ud.pkgname, jsondepobj, ud.version, d, ud)
|
||||
else:
|
||||
self._getshrinkeddependencies(ud.pkgname, shrinkobj, ud.version, d, ud, lockdown, jsondepobj)
|
||||
|
||||
with open(ud.localpath, 'w') as outfile:
|
||||
json.dump(jsondepobj, outfile)
|
||||
|
||||
def build_mirror_data(self, ud, d):
|
||||
# Generate a mirror tarball if needed
|
||||
if ud.write_tarballs and not os.path.exists(ud.fullmirror):
|
||||
# it's possible that this symlink points to read-only filesystem with PREMIRROR
|
||||
if os.path.islink(ud.fullmirror):
|
||||
os.unlink(ud.fullmirror)
|
||||
|
||||
dldir = d.getVar("DL_DIR")
|
||||
logger.info("Creating tarball of npm data")
|
||||
runfetchcmd("tar -cJf %s npm/%s npm/%s" % (ud.fullmirror, ud.bbnpmmanifest, ud.pkgname), d,
|
||||
workdir=dldir)
|
||||
runfetchcmd("touch %s.done" % (ud.fullmirror), d, workdir=dldir)
|
||||
@@ -10,6 +10,7 @@ import os
|
||||
import sys
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import MissingParameterError
|
||||
@@ -33,20 +34,20 @@ class Osc(FetchMethod):
|
||||
|
||||
# Create paths to osc checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(d.getVar('OSCDIR'), ud.host)
|
||||
ud.pkgdir = os.path.join(data.expand('${OSCDIR}', d), ud.host)
|
||||
ud.moddir = os.path.join(ud.pkgdir, relpath, ud.module)
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
ud.revision = ud.parm['rev']
|
||||
else:
|
||||
pv = d.getVar("PV", False)
|
||||
pv = data.getVar("PV", d, 0)
|
||||
rev = bb.fetch2.srcrev_internal_helper(ud, d)
|
||||
if rev and rev != True:
|
||||
ud.revision = rev
|
||||
else:
|
||||
ud.revision = ""
|
||||
|
||||
ud.localfile = d.expand('%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.path.replace('/', '.'), ud.revision))
|
||||
ud.localfile = data.expand('%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
def _buildosccommand(self, ud, d, command):
|
||||
"""
|
||||
@@ -54,7 +55,7 @@ class Osc(FetchMethod):
|
||||
command is "fetch", "update", "info"
|
||||
"""
|
||||
|
||||
basecmd = d.expand('${FETCHCMD_osc}')
|
||||
basecmd = data.expand('${FETCHCMD_osc}', d)
|
||||
|
||||
proto = ud.parm.get('protocol', 'ocs')
|
||||
|
||||
@@ -83,25 +84,27 @@ class Osc(FetchMethod):
|
||||
|
||||
logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
|
||||
|
||||
if os.access(os.path.join(d.getVar('OSCDIR'), ud.path, ud.module), os.R_OK):
|
||||
if os.access(os.path.join(data.expand('${OSCDIR}', d), ud.path, ud.module), os.R_OK):
|
||||
oscupdatecmd = self._buildosccommand(ud, d, "update")
|
||||
logger.info("Update "+ ud.url)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
logger.debug(1, "Running %s", oscupdatecmd)
|
||||
bb.fetch2.check_network_access(d, oscupdatecmd, ud.url)
|
||||
runfetchcmd(oscupdatecmd, d, workdir=ud.moddir)
|
||||
runfetchcmd(oscupdatecmd, d)
|
||||
else:
|
||||
oscfetchcmd = self._buildosccommand(ud, d, "fetch")
|
||||
logger.info("Fetch " + ud.url)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", oscfetchcmd)
|
||||
bb.fetch2.check_network_access(d, oscfetchcmd, ud.url)
|
||||
runfetchcmd(oscfetchcmd, d, workdir=ud.pkgdir)
|
||||
runfetchcmd(oscfetchcmd, d)
|
||||
|
||||
os.chdir(os.path.join(ud.pkgdir + ud.path))
|
||||
# tar them up to a defined filename
|
||||
runfetchcmd("tar -czf %s %s" % (ud.localpath, ud.module), d,
|
||||
cleanup=[ud.localpath], workdir=os.path.join(ud.pkgdir + ud.path))
|
||||
runfetchcmd("tar -czf %s %s" % (ud.localpath, ud.module), d, cleanup = [ud.localpath])
|
||||
|
||||
def supports_srcrev(self):
|
||||
return False
|
||||
@@ -111,7 +114,7 @@ class Osc(FetchMethod):
|
||||
Generate a .oscrc to be used for this run.
|
||||
"""
|
||||
|
||||
config_path = os.path.join(d.getVar('OSCDIR'), "oscrc")
|
||||
config_path = os.path.join(data.expand('${OSCDIR}', d), "oscrc")
|
||||
if (os.path.exists(config_path)):
|
||||
os.remove(config_path)
|
||||
|
||||
@@ -120,8 +123,8 @@ class Osc(FetchMethod):
|
||||
f.write("apisrv = %s\n" % ud.host)
|
||||
f.write("scheme = http\n")
|
||||
f.write("su-wrapper = su -c\n")
|
||||
f.write("build-root = %s\n" % d.getVar('WORKDIR'))
|
||||
f.write("urllist = %s\n" % d.getVar("OSCURLLIST"))
|
||||
f.write("build-root = %s\n" % data.expand('${WORKDIR}', d))
|
||||
f.write("urllist = http://moblin-obs.jf.intel.com:8888/build/%(project)s/%(repository)s/%(buildarch)s/:full/%(name)s.rpm\n")
|
||||
f.write("extra-pkgs = gzip\n")
|
||||
f.write("\n")
|
||||
f.write("[%s]\n" % ud.host)
|
||||
|
||||
@@ -1,12 +1,14 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementation for perforce
|
||||
BitBake 'Fetch' implementations
|
||||
|
||||
Classes for obtaining upstream sources for the
|
||||
BitBake build tools.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
# Copyright (C) 2016 Kodak Alaris, Inc.
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
@@ -23,187 +25,163 @@ BitBake 'Fetch' implementation for perforce
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
from future_builtins import zip
|
||||
import os
|
||||
import subprocess
|
||||
import logging
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import logger
|
||||
from bb.fetch2 import runfetchcmd
|
||||
|
||||
class Perforce(FetchMethod):
|
||||
""" Class to fetch from perforce repositories """
|
||||
def supports(self, ud, d):
|
||||
""" Check to see if a given url can be fetched with perforce. """
|
||||
return ud.type in ['p4']
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
"""
|
||||
Initialize perforce specific variables within url data. If P4CONFIG is
|
||||
provided by the env, use it. If P4PORT is specified by the recipe, use
|
||||
its values, which may override the settings in P4CONFIG.
|
||||
"""
|
||||
ud.basecmd = d.getVar('FETCHCMD_p4')
|
||||
if not ud.basecmd:
|
||||
ud.basecmd = "/usr/bin/env p4"
|
||||
|
||||
ud.dldir = d.getVar('P4DIR')
|
||||
if not ud.dldir:
|
||||
ud.dldir = '%s/%s' % (d.getVar('DL_DIR'), 'p4')
|
||||
|
||||
path = ud.url.split('://')[1]
|
||||
path = path.split(';')[0]
|
||||
delim = path.find('@');
|
||||
def doparse(url, d):
|
||||
parm = {}
|
||||
path = url.split("://")[1]
|
||||
delim = path.find("@");
|
||||
if delim != -1:
|
||||
(ud.user, ud.pswd) = path.split('@')[0].split(':')
|
||||
ud.path = path.split('@')[1]
|
||||
(user, pswd, host, port) = path.split('@')[0].split(":")
|
||||
path = path.split('@')[1]
|
||||
else:
|
||||
ud.path = path
|
||||
(host, port) = d.getVar('P4PORT').split(':')
|
||||
user = ""
|
||||
pswd = ""
|
||||
|
||||
ud.usingp4config = False
|
||||
p4port = d.getVar('P4PORT')
|
||||
if path.find(";") != -1:
|
||||
keys=[]
|
||||
values=[]
|
||||
plist = path.split(';')
|
||||
for item in plist:
|
||||
if item.count('='):
|
||||
(key, value) = item.split('=')
|
||||
keys.append(key)
|
||||
values.append(value)
|
||||
|
||||
if p4port:
|
||||
logger.debug(1, 'Using recipe provided P4PORT: %s' % p4port)
|
||||
ud.host = p4port
|
||||
else:
|
||||
logger.debug(1, 'Trying to use P4CONFIG to automatically set P4PORT...')
|
||||
ud.usingp4config = True
|
||||
p4cmd = '%s info | grep "Server address"' % ud.basecmd
|
||||
bb.fetch2.check_network_access(d, p4cmd, ud.url)
|
||||
ud.host = runfetchcmd(p4cmd, d, True)
|
||||
ud.host = ud.host.split(': ')[1].strip()
|
||||
logger.debug(1, 'Determined P4PORT to be: %s' % ud.host)
|
||||
if not ud.host:
|
||||
raise FetchError('Could not determine P4PORT from P4CONFIG')
|
||||
|
||||
if ud.path.find('/...') >= 0:
|
||||
ud.pathisdir = True
|
||||
else:
|
||||
ud.pathisdir = False
|
||||
parm = dict(zip(keys, values))
|
||||
path = "//" + path.split(';')[0]
|
||||
host += ":%s" % (port)
|
||||
parm["cset"] = Perforce.getcset(d, path, host, user, pswd, parm)
|
||||
|
||||
cleanedpath = ud.path.replace('/...', '').replace('/', '.')
|
||||
cleanedhost = ud.host.replace(':', '.')
|
||||
ud.pkgdir = os.path.join(ud.dldir, cleanedhost, cleanedpath)
|
||||
return host, path, user, pswd, parm
|
||||
doparse = staticmethod(doparse)
|
||||
|
||||
ud.setup_revisions(d)
|
||||
|
||||
ud.localfile = d.expand('%s_%s_%s.tar.gz' % (cleanedhost, cleanedpath, ud.revision))
|
||||
|
||||
def _buildp4command(self, ud, d, command, depot_filename=None):
|
||||
"""
|
||||
Build a p4 commandline. Valid commands are "changes", "print", and
|
||||
"files". depot_filename is the full path to the file in the depot
|
||||
including the trailing '#rev' value.
|
||||
"""
|
||||
def getcset(d, depot, host, user, pswd, parm):
|
||||
p4opt = ""
|
||||
if "cset" in parm:
|
||||
return parm["cset"];
|
||||
if user:
|
||||
p4opt += " -u %s" % (user)
|
||||
if pswd:
|
||||
p4opt += " -P %s" % (pswd)
|
||||
if host:
|
||||
p4opt += " -p %s" % (host)
|
||||
|
||||
if ud.user:
|
||||
p4opt += ' -u "%s"' % (ud.user)
|
||||
p4date = d.getVar("P4DATE", True)
|
||||
if "revision" in parm:
|
||||
depot += "#%s" % (parm["revision"])
|
||||
elif "label" in parm:
|
||||
depot += "@%s" % (parm["label"])
|
||||
elif p4date:
|
||||
depot += "@%s" % (p4date)
|
||||
|
||||
if ud.pswd:
|
||||
p4opt += ' -P "%s"' % (ud.pswd)
|
||||
p4cmd = d.getVar('FETCHCMD_p4', True) or "p4"
|
||||
logger.debug(1, "Running %s%s changes -m 1 %s", p4cmd, p4opt, depot)
|
||||
p4file, errors = bb.process.run("%s%s changes -m 1 %s" % (p4cmd, p4opt, depot))
|
||||
cset = p4file.strip()
|
||||
logger.debug(1, "READ %s", cset)
|
||||
if not cset:
|
||||
return -1
|
||||
|
||||
if ud.host and not ud.usingp4config:
|
||||
p4opt += ' -p %s' % (ud.host)
|
||||
return cset.split(' ')[1]
|
||||
getcset = staticmethod(getcset)
|
||||
|
||||
if hasattr(ud, 'revision') and ud.revision:
|
||||
pathnrev = '%s@%s' % (ud.path, ud.revision)
|
||||
def urldata_init(self, ud, d):
|
||||
(host, path, user, pswd, parm) = Perforce.doparse(ud.url, d)
|
||||
|
||||
base_path = path.replace('/...', '')
|
||||
base_path = self._strip_leading_slashes(base_path)
|
||||
|
||||
if "label" in parm:
|
||||
version = parm["label"]
|
||||
else:
|
||||
pathnrev = '%s' % (ud.path)
|
||||
version = Perforce.getcset(d, path, host, user, pswd, parm)
|
||||
|
||||
if depot_filename:
|
||||
if ud.pathisdir: # Remove leading path to obtain filename
|
||||
filename = depot_filename[len(ud.path)-1:]
|
||||
else:
|
||||
filename = depot_filename[depot_filename.rfind('/'):]
|
||||
filename = filename[:filename.find('#')] # Remove trailing '#rev'
|
||||
|
||||
if command == 'changes':
|
||||
p4cmd = '%s%s changes -m 1 //%s' % (ud.basecmd, p4opt, pathnrev)
|
||||
elif command == 'print':
|
||||
if depot_filename != None:
|
||||
p4cmd = '%s%s print -o "p4/%s" "%s"' % (ud.basecmd, p4opt, filename, depot_filename)
|
||||
else:
|
||||
raise FetchError('No depot file name provided to p4 %s' % command, ud.url)
|
||||
elif command == 'files':
|
||||
p4cmd = '%s%s files //%s' % (ud.basecmd, p4opt, pathnrev)
|
||||
else:
|
||||
raise FetchError('Invalid p4 command %s' % command, ud.url)
|
||||
|
||||
return p4cmd
|
||||
|
||||
def _p4listfiles(self, ud, d):
|
||||
"""
|
||||
Return a list of the file names which are present in the depot using the
|
||||
'p4 files' command, including trailing '#rev' file revision indicator
|
||||
"""
|
||||
p4cmd = self._buildp4command(ud, d, 'files')
|
||||
bb.fetch2.check_network_access(d, p4cmd, ud.url)
|
||||
p4fileslist = runfetchcmd(p4cmd, d, True)
|
||||
p4fileslist = [f.rstrip() for f in p4fileslist.splitlines()]
|
||||
|
||||
if not p4fileslist:
|
||||
raise FetchError('Unable to fetch listing of p4 files from %s@%s' % (ud.host, ud.path))
|
||||
|
||||
count = 0
|
||||
filelist = []
|
||||
|
||||
for filename in p4fileslist:
|
||||
item = filename.split(' - ')
|
||||
lastaction = item[1].split()
|
||||
logger.debug(1, 'File: %s Last Action: %s' % (item[0], lastaction[0]))
|
||||
if lastaction[0] == 'delete':
|
||||
continue
|
||||
filelist.append(item[0])
|
||||
|
||||
return filelist
|
||||
ud.localfile = data.expand('%s+%s+%s.tar.gz' % (host, base_path.replace('/', '.'), version), d)
|
||||
|
||||
def download(self, ud, d):
|
||||
""" Get the list of files, fetch each one """
|
||||
filelist = self._p4listfiles(ud, d)
|
||||
if not filelist:
|
||||
raise FetchError('No files found in depot %s@%s' % (ud.host, ud.path))
|
||||
"""
|
||||
Fetch urls
|
||||
"""
|
||||
|
||||
bb.utils.remove(ud.pkgdir, True)
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
(host, depot, user, pswd, parm) = Perforce.doparse(ud.url, d)
|
||||
|
||||
for afile in filelist:
|
||||
p4fetchcmd = self._buildp4command(ud, d, 'print', afile)
|
||||
bb.fetch2.check_network_access(d, p4fetchcmd, ud.url)
|
||||
runfetchcmd(p4fetchcmd, d, workdir=ud.pkgdir)
|
||||
if depot.find('/...') != -1:
|
||||
path = depot[:depot.find('/...')]
|
||||
else:
|
||||
path = depot
|
||||
|
||||
runfetchcmd('tar -czf %s p4' % (ud.localpath), d, cleanup=[ud.localpath], workdir=ud.pkgdir)
|
||||
module = parm.get('module', os.path.basename(path))
|
||||
|
||||
def clean(self, ud, d):
|
||||
""" Cleanup p4 specific files and dirs"""
|
||||
bb.utils.remove(ud.localpath)
|
||||
bb.utils.remove(ud.pkgdir, True)
|
||||
# Get the p4 command
|
||||
p4opt = ""
|
||||
if user:
|
||||
p4opt += " -u %s" % (user)
|
||||
|
||||
def supports_srcrev(self):
|
||||
return True
|
||||
if pswd:
|
||||
p4opt += " -P %s" % (pswd)
|
||||
|
||||
def _revision_key(self, ud, d, name):
|
||||
""" Return a unique key for the url """
|
||||
return 'p4:%s' % ud.pkgdir
|
||||
if host:
|
||||
p4opt += " -p %s" % (host)
|
||||
|
||||
def _latest_revision(self, ud, d, name):
|
||||
""" Return the latest upstream scm revision number """
|
||||
p4cmd = self._buildp4command(ud, d, "changes")
|
||||
bb.fetch2.check_network_access(d, p4cmd, ud.url)
|
||||
tip = runfetchcmd(p4cmd, d, True)
|
||||
p4cmd = d.getVar('FETCHCMD_p4', True) or "p4"
|
||||
|
||||
if not tip:
|
||||
raise FetchError('Could not determine the latest perforce changelist')
|
||||
# create temp directory
|
||||
logger.debug(2, "Fetch: creating temporary directory")
|
||||
bb.utils.mkdirhier(d.expand('${WORKDIR}'))
|
||||
mktemp = d.getVar("FETCHCMD_p4mktemp", True) or d.expand("mktemp -d -q '${WORKDIR}/oep4.XXXXXX'")
|
||||
tmpfile, errors = bb.process.run(mktemp)
|
||||
tmpfile = tmpfile.strip()
|
||||
if not tmpfile:
|
||||
raise FetchError("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.", ud.url)
|
||||
|
||||
tipcset = tip.split(' ')[1]
|
||||
logger.debug(1, 'p4 tip found to be changelist %s' % tipcset)
|
||||
return tipcset
|
||||
if "label" in parm:
|
||||
depot = "%s@%s" % (depot, parm["label"])
|
||||
else:
|
||||
cset = Perforce.getcset(d, depot, host, user, pswd, parm)
|
||||
depot = "%s@%s" % (depot, cset)
|
||||
|
||||
def sortable_revision(self, ud, d, name):
|
||||
""" Return a sortable revision number """
|
||||
return False, self._build_revision(ud, d)
|
||||
os.chdir(tmpfile)
|
||||
logger.info("Fetch " + ud.url)
|
||||
logger.info("%s%s files %s", p4cmd, p4opt, depot)
|
||||
p4file, errors = bb.process.run("%s%s files %s" % (p4cmd, p4opt, depot))
|
||||
p4file = [f.rstrip() for f in p4file.splitlines()]
|
||||
|
||||
def _build_revision(self, ud, d):
|
||||
return ud.revision
|
||||
if not p4file:
|
||||
raise FetchError("Fetch: unable to get the P4 files from %s" % depot, ud.url)
|
||||
|
||||
count = 0
|
||||
|
||||
for file in p4file:
|
||||
list = file.split()
|
||||
|
||||
if list[2] == "delete":
|
||||
continue
|
||||
|
||||
dest = list[0][len(path)+1:]
|
||||
where = dest.find("#")
|
||||
|
||||
subprocess.call("%s%s print -o %s/%s %s" % (p4cmd, p4opt, module, dest[:where], list[0]), shell=True)
|
||||
count = count + 1
|
||||
|
||||
if count == 0:
|
||||
logger.error()
|
||||
raise FetchError("Fetch: No files gathered from the P4 fetch", ud.url)
|
||||
|
||||
runfetchcmd("tar -czf %s %s" % (ud.localpath, module), d, cleanup = [ud.localpath])
|
||||
# cleanup
|
||||
bb.utils.prunedir(tmpfile)
|
||||
|
||||
@@ -25,9 +25,9 @@ BitBake "Fetch" repo (git) implementation
|
||||
|
||||
import os
|
||||
import bb
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import runfetchcmd
|
||||
from bb.fetch2 import logger
|
||||
|
||||
class Repo(FetchMethod):
|
||||
"""Class to fetch a module or modules from repo (git) repositories"""
|
||||
@@ -51,17 +51,17 @@ class Repo(FetchMethod):
|
||||
if not ud.manifest.endswith('.xml'):
|
||||
ud.manifest += '.xml'
|
||||
|
||||
ud.localfile = d.expand("repo_%s%s_%s_%s.tar.gz" % (ud.host, ud.path.replace("/", "."), ud.manifest, ud.branch))
|
||||
ud.localfile = data.expand("repo_%s%s_%s_%s.tar.gz" % (ud.host, ud.path.replace("/", "."), ud.manifest, ud.branch), d)
|
||||
|
||||
def download(self, ud, d):
|
||||
"""Fetch url"""
|
||||
|
||||
if os.access(os.path.join(d.getVar("DL_DIR"), ud.localfile), os.R_OK):
|
||||
if os.access(os.path.join(data.getVar("DL_DIR", d, True), ud.localfile), os.R_OK):
|
||||
logger.debug(1, "%s already exists (or was stashed). Skipping repo init / sync.", ud.localpath)
|
||||
return
|
||||
|
||||
gitsrcname = "%s%s" % (ud.host, ud.path.replace("/", "."))
|
||||
repodir = d.getVar("REPODIR") or os.path.join(d.getVar("DL_DIR"), "repo")
|
||||
repodir = data.getVar("REPODIR", d, True) or os.path.join(data.getVar("DL_DIR", d, True), "repo")
|
||||
codir = os.path.join(repodir, gitsrcname, ud.manifest)
|
||||
|
||||
if ud.user:
|
||||
@@ -69,23 +69,24 @@ class Repo(FetchMethod):
|
||||
else:
|
||||
username = ""
|
||||
|
||||
repodir = os.path.join(codir, "repo")
|
||||
bb.utils.mkdirhier(repodir)
|
||||
if not os.path.exists(os.path.join(repodir, ".repo")):
|
||||
bb.utils.mkdirhier(os.path.join(codir, "repo"))
|
||||
os.chdir(os.path.join(codir, "repo"))
|
||||
if not os.path.exists(os.path.join(codir, "repo", ".repo")):
|
||||
bb.fetch2.check_network_access(d, "repo init -m %s -b %s -u %s://%s%s%s" % (ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), ud.url)
|
||||
runfetchcmd("repo init -m %s -b %s -u %s://%s%s%s" % (ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), d, workdir=repodir)
|
||||
runfetchcmd("repo init -m %s -b %s -u %s://%s%s%s" % (ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), d)
|
||||
|
||||
bb.fetch2.check_network_access(d, "repo sync %s" % ud.url, ud.url)
|
||||
runfetchcmd("repo sync", d, workdir=repodir)
|
||||
runfetchcmd("repo sync", d)
|
||||
os.chdir(codir)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude='.repo' --exclude='.git'"
|
||||
tar_flags = "--exclude '.repo' --exclude '.git'"
|
||||
|
||||
# Create a cache
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.join(".", "*") ), d, workdir=codir)
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.join(".", "*") ), d)
|
||||
|
||||
def supports_srcrev(self):
|
||||
return False
|
||||
|
||||
@@ -1,98 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
"""
|
||||
BitBake 'Fetch' implementation for Amazon AWS S3.
|
||||
|
||||
Class for fetching files from Amazon S3 using the AWS Command Line Interface.
|
||||
The aws tool must be correctly installed and configured prior to use.
|
||||
|
||||
"""
|
||||
|
||||
# Copyright (C) 2017, Andre McCurdy <armccurdy@gmail.com>
|
||||
#
|
||||
# Based in part on bb.fetch2.wget:
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import os
|
||||
import bb
|
||||
import urllib.request, urllib.parse, urllib.error
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import runfetchcmd
|
||||
|
||||
class S3(FetchMethod):
|
||||
"""Class to fetch urls via 'aws s3'"""
|
||||
|
||||
def supports(self, ud, d):
|
||||
"""
|
||||
Check to see if a given url can be fetched with s3.
|
||||
"""
|
||||
return ud.type in ['s3']
|
||||
|
||||
def recommends_checksum(self, urldata):
|
||||
return True
|
||||
|
||||
def urldata_init(self, ud, d):
|
||||
if 'downloadfilename' in ud.parm:
|
||||
ud.basename = ud.parm['downloadfilename']
|
||||
else:
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
|
||||
ud.localfile = d.expand(urllib.parse.unquote(ud.basename))
|
||||
|
||||
ud.basecmd = d.getVar("FETCHCMD_s3") or "/usr/bin/env aws s3"
|
||||
|
||||
def download(self, ud, d):
|
||||
"""
|
||||
Fetch urls
|
||||
Assumes localpath was called first
|
||||
"""
|
||||
|
||||
cmd = '%s cp s3://%s%s %s' % (ud.basecmd, ud.host, ud.path, ud.localpath)
|
||||
bb.fetch2.check_network_access(d, cmd, ud.url)
|
||||
runfetchcmd(cmd, d)
|
||||
|
||||
# Additional sanity checks copied from the wget class (although there
|
||||
# are no known issues which mean these are required, treat the aws cli
|
||||
# tool with a little healthy suspicion).
|
||||
|
||||
if not os.path.exists(ud.localpath):
|
||||
raise FetchError("The aws cp command returned success for s3://%s%s but %s doesn't exist?!" % (ud.host, ud.path, ud.localpath))
|
||||
|
||||
if os.path.getsize(ud.localpath) == 0:
|
||||
os.remove(ud.localpath)
|
||||
raise FetchError("The aws cp command for s3://%s%s resulted in a zero size file?! Deleting and failing since this isn't right." % (ud.host, ud.path))
|
||||
|
||||
return True
|
||||
|
||||
def checkstatus(self, fetch, ud, d):
|
||||
"""
|
||||
Check the status of a URL
|
||||
"""
|
||||
|
||||
cmd = '%s ls s3://%s%s' % (ud.basecmd, ud.host, ud.path)
|
||||
bb.fetch2.check_network_access(d, cmd, ud.url)
|
||||
output = runfetchcmd(cmd, d)
|
||||
|
||||
# "aws s3 ls s3://mybucket/foo" will exit with success even if the file
|
||||
# is not found, so check output of the command to confirm success.
|
||||
|
||||
if not output:
|
||||
raise FetchError("The aws ls command for s3://%s%s gave empty output" % (ud.host, ud.path))
|
||||
|
||||
return True
|
||||
@@ -61,11 +61,14 @@ SRC_URI = "sftp://user@host.example.com/dir/path.file.txt"
|
||||
|
||||
import os
|
||||
import bb
|
||||
import urllib.request, urllib.parse, urllib.error
|
||||
import urllib
|
||||
import commands
|
||||
from bb import data
|
||||
from bb.fetch2 import URI
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import runfetchcmd
|
||||
|
||||
|
||||
class SFTP(FetchMethod):
|
||||
"""Class to fetch urls via 'sftp'"""
|
||||
|
||||
@@ -90,19 +93,19 @@ class SFTP(FetchMethod):
|
||||
else:
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
|
||||
ud.localfile = d.expand(urllib.parse.unquote(ud.basename))
|
||||
ud.localfile = data.expand(urllib.unquote(ud.basename), d)
|
||||
|
||||
def download(self, ud, d):
|
||||
"""Fetch urls"""
|
||||
|
||||
urlo = URI(ud.url)
|
||||
basecmd = 'sftp -oBatchMode=yes'
|
||||
basecmd = 'sftp -oPasswordAuthentication=no'
|
||||
port = ''
|
||||
if urlo.port:
|
||||
port = '-P %d' % urlo.port
|
||||
urlo.port = None
|
||||
|
||||
dldir = d.getVar('DL_DIR')
|
||||
dldir = data.getVar('DL_DIR', d, True)
|
||||
lpath = os.path.join(dldir, ud.localfile)
|
||||
|
||||
user = ''
|
||||
@@ -118,7 +121,8 @@ class SFTP(FetchMethod):
|
||||
|
||||
remote = '%s%s:%s' % (user, urlo.hostname, path)
|
||||
|
||||
cmd = '%s %s %s %s' % (basecmd, port, remote, lpath)
|
||||
cmd = '%s %s %s %s' % (basecmd, port, commands.mkarg(remote),
|
||||
commands.mkarg(lpath))
|
||||
|
||||
bb.fetch2.check_network_access(d, cmd, ud.url)
|
||||
runfetchcmd(cmd, d)
|
||||
|
||||
@@ -43,6 +43,7 @@ IETF secsh internet draft:
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import re, os
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import logger
|
||||
@@ -86,11 +87,10 @@ class SSH(FetchMethod):
|
||||
m = __pattern__.match(urldata.url)
|
||||
path = m.group('path')
|
||||
host = m.group('host')
|
||||
urldata.localpath = os.path.join(d.getVar('DL_DIR'),
|
||||
os.path.basename(os.path.normpath(path)))
|
||||
urldata.localpath = os.path.join(d.getVar('DL_DIR', True), os.path.basename(path))
|
||||
|
||||
def download(self, urldata, d):
|
||||
dldir = d.getVar('DL_DIR')
|
||||
dldir = d.getVar('DL_DIR', True)
|
||||
|
||||
m = __pattern__.match(urldata.url)
|
||||
path = m.group('path')
|
||||
@@ -113,10 +113,12 @@ class SSH(FetchMethod):
|
||||
fr = host
|
||||
fr += ':%s' % path
|
||||
|
||||
|
||||
import commands
|
||||
cmd = 'scp -B -r %s %s %s/' % (
|
||||
portarg,
|
||||
fr,
|
||||
dldir
|
||||
commands.mkarg(fr),
|
||||
commands.mkarg(dldir)
|
||||
)
|
||||
|
||||
bb.fetch2.check_network_access(d, cmd, urldata.url)
|
||||
|
||||
@@ -28,6 +28,7 @@ import sys
|
||||
import logging
|
||||
import bb
|
||||
import re
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import MissingParameterError
|
||||
@@ -49,26 +50,21 @@ class Svn(FetchMethod):
|
||||
if not "module" in ud.parm:
|
||||
raise MissingParameterError('module', ud.url)
|
||||
|
||||
ud.basecmd = d.getVar('FETCHCMD_svn')
|
||||
ud.basecmd = d.getVar('FETCHCMD_svn', True)
|
||||
|
||||
ud.module = ud.parm["module"]
|
||||
|
||||
if not "path_spec" in ud.parm:
|
||||
ud.path_spec = ud.module
|
||||
else:
|
||||
ud.path_spec = ud.parm["path_spec"]
|
||||
|
||||
# Create paths to svn checkouts
|
||||
relpath = self._strip_leading_slashes(ud.path)
|
||||
ud.pkgdir = os.path.join(d.expand('${SVNDIR}'), ud.host, relpath)
|
||||
ud.pkgdir = os.path.join(data.expand('${SVNDIR}', d), ud.host, relpath)
|
||||
ud.moddir = os.path.join(ud.pkgdir, ud.module)
|
||||
|
||||
ud.setup_revisions(d)
|
||||
ud.setup_revisons(d)
|
||||
|
||||
if 'rev' in ud.parm:
|
||||
ud.revision = ud.parm['rev']
|
||||
|
||||
ud.localfile = d.expand('%s_%s_%s_%s_.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision))
|
||||
ud.localfile = data.expand('%s_%s_%s_%s_.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision), d)
|
||||
|
||||
def _buildsvncommand(self, ud, d, command):
|
||||
"""
|
||||
@@ -78,9 +74,9 @@ class Svn(FetchMethod):
|
||||
|
||||
proto = ud.parm.get('protocol', 'svn')
|
||||
|
||||
svn_ssh = None
|
||||
if proto == "svn+ssh" and "ssh" in ud.parm:
|
||||
svn_ssh = ud.parm["ssh"]
|
||||
svn_rsh = None
|
||||
if proto == "svn+ssh" and "rsh" in ud.parm:
|
||||
svn_rsh = ud.parm["rsh"]
|
||||
|
||||
svnroot = ud.host + ud.path
|
||||
|
||||
@@ -106,14 +102,14 @@ class Svn(FetchMethod):
|
||||
|
||||
if command == "fetch":
|
||||
transportuser = ud.parm.get("transportuser", "")
|
||||
svncmd = "%s co %s %s://%s%s/%s%s %s" % (ud.basecmd, " ".join(options), proto, transportuser, svnroot, ud.module, suffix, ud.path_spec)
|
||||
svncmd = "%s co %s %s://%s%s/%s%s %s" % (ud.basecmd, " ".join(options), proto, transportuser, svnroot, ud.module, suffix, ud.module)
|
||||
elif command == "update":
|
||||
svncmd = "%s update %s" % (ud.basecmd, " ".join(options))
|
||||
else:
|
||||
raise FetchError("Invalid svn command %s" % command, ud.url)
|
||||
|
||||
if svn_ssh:
|
||||
svncmd = "SVN_SSH=\"%s\" %s" % (svn_ssh, svncmd)
|
||||
if svn_rsh:
|
||||
svncmd = "svn_RSH=\"%s\" %s" % (svn_rsh, svncmd)
|
||||
|
||||
return svncmd
|
||||
|
||||
@@ -125,32 +121,35 @@ class Svn(FetchMethod):
|
||||
if os.access(os.path.join(ud.moddir, '.svn'), os.R_OK):
|
||||
svnupdatecmd = self._buildsvncommand(ud, d, "update")
|
||||
logger.info("Update " + ud.url)
|
||||
# update sources there
|
||||
os.chdir(ud.moddir)
|
||||
# We need to attempt to run svn upgrade first in case its an older working format
|
||||
try:
|
||||
runfetchcmd(ud.basecmd + " upgrade", d, workdir=ud.moddir)
|
||||
runfetchcmd(ud.basecmd + " upgrade", d)
|
||||
except FetchError:
|
||||
pass
|
||||
logger.debug(1, "Running %s", svnupdatecmd)
|
||||
bb.fetch2.check_network_access(d, svnupdatecmd, ud.url)
|
||||
runfetchcmd(svnupdatecmd, d, workdir=ud.moddir)
|
||||
runfetchcmd(svnupdatecmd, d)
|
||||
else:
|
||||
svnfetchcmd = self._buildsvncommand(ud, d, "fetch")
|
||||
logger.info("Fetch " + ud.url)
|
||||
# check out sources there
|
||||
bb.utils.mkdirhier(ud.pkgdir)
|
||||
os.chdir(ud.pkgdir)
|
||||
logger.debug(1, "Running %s", svnfetchcmd)
|
||||
bb.fetch2.check_network_access(d, svnfetchcmd, ud.url)
|
||||
runfetchcmd(svnfetchcmd, d, workdir=ud.pkgdir)
|
||||
runfetchcmd(svnfetchcmd, d)
|
||||
|
||||
scmdata = ud.parm.get("scmdata", "")
|
||||
if scmdata == "keep":
|
||||
tar_flags = ""
|
||||
else:
|
||||
tar_flags = "--exclude='.svn'"
|
||||
tar_flags = "--exclude '.svn'"
|
||||
|
||||
os.chdir(ud.pkgdir)
|
||||
# tar them up to a defined filename
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.path_spec), d,
|
||||
cleanup=[ud.localpath], workdir=ud.pkgdir)
|
||||
runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d, cleanup = [ud.localpath])
|
||||
|
||||
def clean(self, ud, d):
|
||||
""" Clean SVN specific files and dirs """
|
||||
@@ -172,7 +171,7 @@ class Svn(FetchMethod):
|
||||
"""
|
||||
Return the latest upstream revision number
|
||||
"""
|
||||
bb.fetch2.check_network_access(d, self._buildsvncommand(ud, d, "log1"), ud.url)
|
||||
bb.fetch2.check_network_access(d, self._buildsvncommand(ud, d, "log1"))
|
||||
|
||||
output = runfetchcmd("LANG=C LC_ALL=C " + self._buildsvncommand(ud, d, "log1"), d, True)
|
||||
|
||||
|
||||
@@ -25,43 +25,15 @@ BitBake build tools.
|
||||
#
|
||||
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
|
||||
|
||||
import re
|
||||
import tempfile
|
||||
import subprocess
|
||||
import os
|
||||
import logging
|
||||
import errno
|
||||
import bb
|
||||
import bb.progress
|
||||
import urllib.request, urllib.parse, urllib.error
|
||||
import urllib
|
||||
from bb import data
|
||||
from bb.fetch2 import FetchMethod
|
||||
from bb.fetch2 import FetchError
|
||||
from bb.fetch2 import logger
|
||||
from bb.fetch2 import runfetchcmd
|
||||
from bb.utils import export_proxies
|
||||
from bs4 import BeautifulSoup
|
||||
from bs4 import SoupStrainer
|
||||
|
||||
class WgetProgressHandler(bb.progress.LineFilterProgressHandler):
|
||||
"""
|
||||
Extract progress information from wget output.
|
||||
Note: relies on --progress=dot (with -v or without -q/-nv) being
|
||||
specified on the wget command line.
|
||||
"""
|
||||
def __init__(self, d):
|
||||
super(WgetProgressHandler, self).__init__(d)
|
||||
# Send an initial progress event so the bar gets shown
|
||||
self._fire_progress(0)
|
||||
|
||||
def writeline(self, line):
|
||||
percs = re.findall(r'(\d+)%\s+([\d.]+[A-Z])', line)
|
||||
if percs:
|
||||
progress = int(percs[-1][0])
|
||||
rate = percs[-1][1] + '/s'
|
||||
self.update(progress, rate)
|
||||
return False
|
||||
return True
|
||||
|
||||
|
||||
class Wget(FetchMethod):
|
||||
"""Class to fetch urls via 'wget'"""
|
||||
@@ -84,19 +56,15 @@ class Wget(FetchMethod):
|
||||
else:
|
||||
ud.basename = os.path.basename(ud.path)
|
||||
|
||||
ud.localfile = d.expand(urllib.parse.unquote(ud.basename))
|
||||
if not ud.localfile:
|
||||
ud.localfile = d.expand(urllib.parse.unquote(ud.host + ud.path).replace("/", "."))
|
||||
ud.localfile = data.expand(urllib.unquote(ud.basename), d)
|
||||
|
||||
self.basecmd = d.getVar("FETCHCMD_wget") or "/usr/bin/env wget -t 2 -T 30 --passive-ftp --no-check-certificate"
|
||||
self.basecmd = d.getVar("FETCHCMD_wget", True) or "/usr/bin/env wget -t 2 -T 30 -nv --passive-ftp --no-check-certificate"
|
||||
|
||||
def _runwget(self, ud, d, command, quiet, workdir=None):
|
||||
|
||||
progresshandler = WgetProgressHandler(d)
|
||||
def _runwget(self, ud, d, command, quiet):
|
||||
|
||||
logger.debug(2, "Fetching %s using command '%s'" % (ud.url, command))
|
||||
bb.fetch2.check_network_access(d, command, ud.url)
|
||||
runfetchcmd(command + ' --progress=dot -v', d, quiet, log=progresshandler, workdir=workdir)
|
||||
bb.fetch2.check_network_access(d, command)
|
||||
runfetchcmd(command, d, quiet)
|
||||
|
||||
def download(self, ud, d):
|
||||
"""Fetch urls"""
|
||||
@@ -104,13 +72,10 @@ class Wget(FetchMethod):
|
||||
fetchcmd = self.basecmd
|
||||
|
||||
if 'downloadfilename' in ud.parm:
|
||||
dldir = d.getVar("DL_DIR")
|
||||
dldir = d.getVar("DL_DIR", True)
|
||||
bb.utils.mkdirhier(os.path.dirname(dldir + os.sep + ud.localfile))
|
||||
fetchcmd += " -O " + dldir + os.sep + ud.localfile
|
||||
|
||||
if ud.user and ud.pswd:
|
||||
fetchcmd += " --user=%s --password=%s --auth-no-challenge" % (ud.user, ud.pswd)
|
||||
|
||||
uri = ud.url.split(";")[0]
|
||||
if os.path.exists(ud.localpath):
|
||||
# file exists, but we didnt complete it.. trying again..
|
||||
@@ -131,496 +96,11 @@ class Wget(FetchMethod):
|
||||
|
||||
return True
|
||||
|
||||
def checkstatus(self, fetch, ud, d, try_again=True):
|
||||
import urllib.request, urllib.error, urllib.parse, socket, http.client
|
||||
from urllib.response import addinfourl
|
||||
from bb.fetch2 import FetchConnectionCache
|
||||
def checkstatus(self, ud, d):
|
||||
|
||||
class HTTPConnectionCache(http.client.HTTPConnection):
|
||||
if fetch.connection_cache:
|
||||
def connect(self):
|
||||
"""Connect to the host and port specified in __init__."""
|
||||
uri = ud.url.split(";")[0]
|
||||
fetchcmd = self.basecmd + " --spider '%s'" % uri
|
||||
|
||||
sock = fetch.connection_cache.get_connection(self.host, self.port)
|
||||
if sock:
|
||||
self.sock = sock
|
||||
else:
|
||||
self.sock = socket.create_connection((self.host, self.port),
|
||||
self.timeout, self.source_address)
|
||||
fetch.connection_cache.add_connection(self.host, self.port, self.sock)
|
||||
self._runwget(ud, d, fetchcmd, True)
|
||||
|
||||
if self._tunnel_host:
|
||||
self._tunnel()
|
||||
|
||||
class CacheHTTPHandler(urllib.request.HTTPHandler):
|
||||
def http_open(self, req):
|
||||
return self.do_open(HTTPConnectionCache, req)
|
||||
|
||||
def do_open(self, http_class, req):
|
||||
"""Return an addinfourl object for the request, using http_class.
|
||||
|
||||
http_class must implement the HTTPConnection API from httplib.
|
||||
The addinfourl return value is a file-like object. It also
|
||||
has methods and attributes including:
|
||||
- info(): return a mimetools.Message object for the headers
|
||||
- geturl(): return the original request URL
|
||||
- code: HTTP status code
|
||||
"""
|
||||
host = req.host
|
||||
if not host:
|
||||
raise urlllib2.URLError('no host given')
|
||||
|
||||
h = http_class(host, timeout=req.timeout) # will parse host:port
|
||||
h.set_debuglevel(self._debuglevel)
|
||||
|
||||
headers = dict(req.unredirected_hdrs)
|
||||
headers.update(dict((k, v) for k, v in list(req.headers.items())
|
||||
if k not in headers))
|
||||
|
||||
# We want to make an HTTP/1.1 request, but the addinfourl
|
||||
# class isn't prepared to deal with a persistent connection.
|
||||
# It will try to read all remaining data from the socket,
|
||||
# which will block while the server waits for the next request.
|
||||
# So make sure the connection gets closed after the (only)
|
||||
# request.
|
||||
|
||||
# Don't close connection when connection_cache is enabled,
|
||||
if fetch.connection_cache is None:
|
||||
headers["Connection"] = "close"
|
||||
else:
|
||||
headers["Connection"] = "Keep-Alive" # Works for HTTP/1.0
|
||||
|
||||
headers = dict(
|
||||
(name.title(), val) for name, val in list(headers.items()))
|
||||
|
||||
if req._tunnel_host:
|
||||
tunnel_headers = {}
|
||||
proxy_auth_hdr = "Proxy-Authorization"
|
||||
if proxy_auth_hdr in headers:
|
||||
tunnel_headers[proxy_auth_hdr] = headers[proxy_auth_hdr]
|
||||
# Proxy-Authorization should not be sent to origin
|
||||
# server.
|
||||
del headers[proxy_auth_hdr]
|
||||
h.set_tunnel(req._tunnel_host, headers=tunnel_headers)
|
||||
|
||||
try:
|
||||
h.request(req.get_method(), req.selector, req.data, headers)
|
||||
except socket.error as err: # XXX what error?
|
||||
# Don't close connection when cache is enabled.
|
||||
# Instead, try to detect connections that are no longer
|
||||
# usable (for example, closed unexpectedly) and remove
|
||||
# them from the cache.
|
||||
if fetch.connection_cache is None:
|
||||
h.close()
|
||||
elif isinstance(err, OSError) and err.errno == errno.EBADF:
|
||||
# This happens when the server closes the connection despite the Keep-Alive.
|
||||
# Apparently urllib then uses the file descriptor, expecting it to be
|
||||
# connected, when in reality the connection is already gone.
|
||||
# We let the request fail and expect it to be
|
||||
# tried once more ("try_again" in check_status()),
|
||||
# with the dead connection removed from the cache.
|
||||
# If it still fails, we give up, which can happend for bad
|
||||
# HTTP proxy settings.
|
||||
fetch.connection_cache.remove_connection(h.host, h.port)
|
||||
raise urllib.error.URLError(err)
|
||||
else:
|
||||
try:
|
||||
r = h.getresponse(buffering=True)
|
||||
except TypeError: # buffering kw not supported
|
||||
r = h.getresponse()
|
||||
|
||||
# Pick apart the HTTPResponse object to get the addinfourl
|
||||
# object initialized properly.
|
||||
|
||||
# Wrap the HTTPResponse object in socket's file object adapter
|
||||
# for Windows. That adapter calls recv(), so delegate recv()
|
||||
# to read(). This weird wrapping allows the returned object to
|
||||
# have readline() and readlines() methods.
|
||||
|
||||
# XXX It might be better to extract the read buffering code
|
||||
# out of socket._fileobject() and into a base class.
|
||||
r.recv = r.read
|
||||
|
||||
# no data, just have to read
|
||||
r.read()
|
||||
class fp_dummy(object):
|
||||
def read(self):
|
||||
return ""
|
||||
def readline(self):
|
||||
return ""
|
||||
def close(self):
|
||||
pass
|
||||
closed = False
|
||||
|
||||
resp = addinfourl(fp_dummy(), r.msg, req.get_full_url())
|
||||
resp.code = r.status
|
||||
resp.msg = r.reason
|
||||
|
||||
# Close connection when server request it.
|
||||
if fetch.connection_cache is not None:
|
||||
if 'Connection' in r.msg and r.msg['Connection'] == 'close':
|
||||
fetch.connection_cache.remove_connection(h.host, h.port)
|
||||
|
||||
return resp
|
||||
|
||||
class HTTPMethodFallback(urllib.request.BaseHandler):
|
||||
"""
|
||||
Fallback to GET if HEAD is not allowed (405 HTTP error)
|
||||
"""
|
||||
def http_error_405(self, req, fp, code, msg, headers):
|
||||
fp.read()
|
||||
fp.close()
|
||||
|
||||
newheaders = dict((k,v) for k,v in list(req.headers.items())
|
||||
if k.lower() not in ("content-length", "content-type"))
|
||||
return self.parent.open(urllib.request.Request(req.get_full_url(),
|
||||
headers=newheaders,
|
||||
origin_req_host=req.origin_req_host,
|
||||
unverifiable=True))
|
||||
|
||||
"""
|
||||
Some servers (e.g. GitHub archives, hosted on Amazon S3) return 403
|
||||
Forbidden when they actually mean 405 Method Not Allowed.
|
||||
"""
|
||||
http_error_403 = http_error_405
|
||||
|
||||
|
||||
class FixedHTTPRedirectHandler(urllib.request.HTTPRedirectHandler):
|
||||
"""
|
||||
urllib2.HTTPRedirectHandler resets the method to GET on redirect,
|
||||
when we want to follow redirects using the original method.
|
||||
"""
|
||||
def redirect_request(self, req, fp, code, msg, headers, newurl):
|
||||
newreq = urllib.request.HTTPRedirectHandler.redirect_request(self, req, fp, code, msg, headers, newurl)
|
||||
newreq.get_method = lambda: req.get_method()
|
||||
return newreq
|
||||
exported_proxies = export_proxies(d)
|
||||
|
||||
handlers = [FixedHTTPRedirectHandler, HTTPMethodFallback]
|
||||
if export_proxies:
|
||||
handlers.append(urllib.request.ProxyHandler())
|
||||
handlers.append(CacheHTTPHandler())
|
||||
# XXX: Since Python 2.7.9 ssl cert validation is enabled by default
|
||||
# see PEP-0476, this causes verification errors on some https servers
|
||||
# so disable by default.
|
||||
import ssl
|
||||
if hasattr(ssl, '_create_unverified_context'):
|
||||
handlers.append(urllib.request.HTTPSHandler(context=ssl._create_unverified_context()))
|
||||
opener = urllib.request.build_opener(*handlers)
|
||||
|
||||
try:
|
||||
uri = ud.url.split(";")[0]
|
||||
r = urllib.request.Request(uri)
|
||||
r.get_method = lambda: "HEAD"
|
||||
# Some servers (FusionForge, as used on Alioth) require that the
|
||||
# optional Accept header is set.
|
||||
r.add_header("Accept", "*/*")
|
||||
def add_basic_auth(login_str, request):
|
||||
'''Adds Basic auth to http request, pass in login:password as string'''
|
||||
import base64
|
||||
encodeuser = base64.b64encode(login_str.encode('utf-8')).decode("utf-8")
|
||||
authheader = "Basic %s" % encodeuser
|
||||
r.add_header("Authorization", authheader)
|
||||
|
||||
if ud.user:
|
||||
add_basic_auth(ud.user, r)
|
||||
|
||||
try:
|
||||
import netrc, urllib.parse
|
||||
n = netrc.netrc()
|
||||
login, unused, password = n.authenticators(urllib.parse.urlparse(uri).hostname)
|
||||
add_basic_auth("%s:%s" % (login, password), r)
|
||||
except (TypeError, ImportError, IOError, netrc.NetrcParseError):
|
||||
pass
|
||||
|
||||
with opener.open(r) as response:
|
||||
pass
|
||||
except urllib.error.URLError as e:
|
||||
if try_again:
|
||||
logger.debug(2, "checkstatus: trying again")
|
||||
return self.checkstatus(fetch, ud, d, False)
|
||||
else:
|
||||
# debug for now to avoid spamming the logs in e.g. remote sstate searches
|
||||
logger.debug(2, "checkstatus() urlopen failed: %s" % e)
|
||||
return False
|
||||
return True
|
||||
|
||||
def _parse_path(self, regex, s):
|
||||
"""
|
||||
Find and group name, version and archive type in the given string s
|
||||
"""
|
||||
|
||||
m = regex.search(s)
|
||||
if m:
|
||||
pname = ''
|
||||
pver = ''
|
||||
ptype = ''
|
||||
|
||||
mdict = m.groupdict()
|
||||
if 'name' in mdict.keys():
|
||||
pname = mdict['name']
|
||||
if 'pver' in mdict.keys():
|
||||
pver = mdict['pver']
|
||||
if 'type' in mdict.keys():
|
||||
ptype = mdict['type']
|
||||
|
||||
bb.debug(3, "_parse_path: %s, %s, %s" % (pname, pver, ptype))
|
||||
|
||||
return (pname, pver, ptype)
|
||||
|
||||
return None
|
||||
|
||||
def _modelate_version(self, version):
|
||||
if version[0] in ['.', '-']:
|
||||
if version[1].isdigit():
|
||||
version = version[1] + version[0] + version[2:len(version)]
|
||||
else:
|
||||
version = version[1:len(version)]
|
||||
|
||||
version = re.sub('-', '.', version)
|
||||
version = re.sub('_', '.', version)
|
||||
version = re.sub('(rc)+', '.1000.', version)
|
||||
version = re.sub('(beta)+', '.100.', version)
|
||||
version = re.sub('(alpha)+', '.10.', version)
|
||||
if version[0] == 'v':
|
||||
version = version[1:len(version)]
|
||||
return version
|
||||
|
||||
def _vercmp(self, old, new):
|
||||
"""
|
||||
Check whether 'new' is newer than 'old' version. We use existing vercmp() for the
|
||||
purpose. PE is cleared in comparison as it's not for build, and PR is cleared too
|
||||
for simplicity as it's somehow difficult to get from various upstream format
|
||||
"""
|
||||
|
||||
(oldpn, oldpv, oldsuffix) = old
|
||||
(newpn, newpv, newsuffix) = new
|
||||
|
||||
"""
|
||||
Check for a new suffix type that we have never heard of before
|
||||
"""
|
||||
if (newsuffix):
|
||||
m = self.suffix_regex_comp.search(newsuffix)
|
||||
if not m:
|
||||
bb.warn("%s has a possible unknown suffix: %s" % (newpn, newsuffix))
|
||||
return False
|
||||
|
||||
"""
|
||||
Not our package so ignore it
|
||||
"""
|
||||
if oldpn != newpn:
|
||||
return False
|
||||
|
||||
oldpv = self._modelate_version(oldpv)
|
||||
newpv = self._modelate_version(newpv)
|
||||
|
||||
return bb.utils.vercmp(("0", oldpv, ""), ("0", newpv, ""))
|
||||
|
||||
def _fetch_index(self, uri, ud, d):
|
||||
"""
|
||||
Run fetch checkstatus to get directory information
|
||||
"""
|
||||
f = tempfile.NamedTemporaryFile()
|
||||
with tempfile.TemporaryDirectory(prefix="wget-index-") as workdir, tempfile.NamedTemporaryFile(dir=workdir, prefix="wget-listing-") as f:
|
||||
agent = "Mozilla/5.0 (X11; U; Linux i686; en-US; rv:1.9.2.12) Gecko/20101027 Ubuntu/9.10 (karmic) Firefox/3.6.12"
|
||||
fetchcmd = self.basecmd
|
||||
fetchcmd += " -O " + f.name + " --user-agent='" + agent + "' '" + uri + "'"
|
||||
try:
|
||||
self._runwget(ud, d, fetchcmd, True, workdir=workdir)
|
||||
fetchresult = f.read()
|
||||
except bb.fetch2.BBFetchException:
|
||||
fetchresult = ""
|
||||
|
||||
return fetchresult
|
||||
|
||||
def _check_latest_version(self, url, package, package_regex, current_version, ud, d):
|
||||
"""
|
||||
Return the latest version of a package inside a given directory path
|
||||
If error or no version, return ""
|
||||
"""
|
||||
valid = 0
|
||||
version = ['', '', '']
|
||||
|
||||
bb.debug(3, "VersionURL: %s" % (url))
|
||||
soup = BeautifulSoup(self._fetch_index(url, ud, d), "html.parser", parse_only=SoupStrainer("a"))
|
||||
if not soup:
|
||||
bb.debug(3, "*** %s NO SOUP" % (url))
|
||||
return ""
|
||||
|
||||
for line in soup.find_all('a', href=True):
|
||||
bb.debug(3, "line['href'] = '%s'" % (line['href']))
|
||||
bb.debug(3, "line = '%s'" % (str(line)))
|
||||
|
||||
newver = self._parse_path(package_regex, line['href'])
|
||||
if not newver:
|
||||
newver = self._parse_path(package_regex, str(line))
|
||||
|
||||
if newver:
|
||||
bb.debug(3, "Upstream version found: %s" % newver[1])
|
||||
if valid == 0:
|
||||
version = newver
|
||||
valid = 1
|
||||
elif self._vercmp(version, newver) < 0:
|
||||
version = newver
|
||||
|
||||
pupver = re.sub('_', '.', version[1])
|
||||
|
||||
bb.debug(3, "*** %s -> UpstreamVersion = %s (CurrentVersion = %s)" %
|
||||
(package, pupver or "N/A", current_version[1]))
|
||||
|
||||
if valid:
|
||||
return pupver
|
||||
|
||||
return ""
|
||||
|
||||
def _check_latest_version_by_dir(self, dirver, package, package_regex,
|
||||
current_version, ud, d):
|
||||
"""
|
||||
Scan every directory in order to get upstream version.
|
||||
"""
|
||||
version_dir = ['', '', '']
|
||||
version = ['', '', '']
|
||||
|
||||
dirver_regex = re.compile("(?P<pfx>\D*)(?P<ver>(\d+[\.\-_])+(\d+))")
|
||||
s = dirver_regex.search(dirver)
|
||||
if s:
|
||||
version_dir[1] = s.group('ver')
|
||||
else:
|
||||
version_dir[1] = dirver
|
||||
|
||||
dirs_uri = bb.fetch.encodeurl([ud.type, ud.host,
|
||||
ud.path.split(dirver)[0], ud.user, ud.pswd, {}])
|
||||
bb.debug(3, "DirURL: %s, %s" % (dirs_uri, package))
|
||||
|
||||
soup = BeautifulSoup(self._fetch_index(dirs_uri, ud, d), "html.parser", parse_only=SoupStrainer("a"))
|
||||
if not soup:
|
||||
return version[1]
|
||||
|
||||
for line in soup.find_all('a', href=True):
|
||||
s = dirver_regex.search(line['href'].strip("/"))
|
||||
if s:
|
||||
sver = s.group('ver')
|
||||
|
||||
# When prefix is part of the version directory it need to
|
||||
# ensure that only version directory is used so remove previous
|
||||
# directories if exists.
|
||||
#
|
||||
# Example: pfx = '/dir1/dir2/v' and version = '2.5' the expected
|
||||
# result is v2.5.
|
||||
spfx = s.group('pfx').split('/')[-1]
|
||||
|
||||
version_dir_new = ['', sver, '']
|
||||
if self._vercmp(version_dir, version_dir_new) <= 0:
|
||||
dirver_new = spfx + sver
|
||||
path = ud.path.replace(dirver, dirver_new, True) \
|
||||
.split(package)[0]
|
||||
uri = bb.fetch.encodeurl([ud.type, ud.host, path,
|
||||
ud.user, ud.pswd, {}])
|
||||
|
||||
pupver = self._check_latest_version(uri,
|
||||
package, package_regex, current_version, ud, d)
|
||||
if pupver:
|
||||
version[1] = pupver
|
||||
|
||||
version_dir = version_dir_new
|
||||
|
||||
return version[1]
|
||||
|
||||
def _init_regexes(self, package, ud, d):
|
||||
"""
|
||||
Match as many patterns as possible such as:
|
||||
gnome-common-2.20.0.tar.gz (most common format)
|
||||
gtk+-2.90.1.tar.gz
|
||||
xf86-input-synaptics-12.6.9.tar.gz
|
||||
dri2proto-2.3.tar.gz
|
||||
blktool_4.orig.tar.gz
|
||||
libid3tag-0.15.1b.tar.gz
|
||||
unzip552.tar.gz
|
||||
icu4c-3_6-src.tgz
|
||||
genext2fs_1.3.orig.tar.gz
|
||||
gst-fluendo-mp3
|
||||
"""
|
||||
# match most patterns which uses "-" as separator to version digits
|
||||
pn_prefix1 = "[a-zA-Z][a-zA-Z0-9]*([-_][a-zA-Z]\w+)*\+?[-_]"
|
||||
# a loose pattern such as for unzip552.tar.gz
|
||||
pn_prefix2 = "[a-zA-Z]+"
|
||||
# a loose pattern such as for 80325-quicky-0.4.tar.gz
|
||||
pn_prefix3 = "[0-9]+[-]?[a-zA-Z]+"
|
||||
# Save the Package Name (pn) Regex for use later
|
||||
pn_regex = "(%s|%s|%s)" % (pn_prefix1, pn_prefix2, pn_prefix3)
|
||||
|
||||
# match version
|
||||
pver_regex = "(([A-Z]*\d+[a-zA-Z]*[\.\-_]*)+)"
|
||||
|
||||
# match arch
|
||||
parch_regex = "-source|_all_"
|
||||
|
||||
# src.rpm extension was added only for rpm package. Can be removed if the rpm
|
||||
# packaged will always be considered as having to be manually upgraded
|
||||
psuffix_regex = "(tar\.gz|tgz|tar\.bz2|zip|xz|tar\.lz|rpm|bz2|orig\.tar\.gz|tar\.xz|src\.tar\.gz|src\.tgz|svnr\d+\.tar\.bz2|stable\.tar\.gz|src\.rpm)"
|
||||
|
||||
# match name, version and archive type of a package
|
||||
package_regex_comp = re.compile("(?P<name>%s?\.?v?)(?P<pver>%s)(?P<arch>%s)?[\.-](?P<type>%s$)"
|
||||
% (pn_regex, pver_regex, parch_regex, psuffix_regex))
|
||||
self.suffix_regex_comp = re.compile(psuffix_regex)
|
||||
|
||||
# compile regex, can be specific by package or generic regex
|
||||
pn_regex = d.getVar('UPSTREAM_CHECK_REGEX')
|
||||
if pn_regex:
|
||||
package_custom_regex_comp = re.compile(pn_regex)
|
||||
else:
|
||||
version = self._parse_path(package_regex_comp, package)
|
||||
if version:
|
||||
package_custom_regex_comp = re.compile(
|
||||
"(?P<name>%s)(?P<pver>%s)(?P<arch>%s)?[\.-](?P<type>%s)" %
|
||||
(re.escape(version[0]), pver_regex, parch_regex, psuffix_regex))
|
||||
else:
|
||||
package_custom_regex_comp = None
|
||||
|
||||
return package_custom_regex_comp
|
||||
|
||||
def latest_versionstring(self, ud, d):
|
||||
"""
|
||||
Manipulate the URL and try to obtain the latest package version
|
||||
|
||||
sanity check to ensure same name and type.
|
||||
"""
|
||||
package = ud.path.split("/")[-1]
|
||||
current_version = ['', d.getVar('PV'), '']
|
||||
|
||||
"""possible to have no version in pkg name, such as spectrum-fw"""
|
||||
if not re.search("\d+", package):
|
||||
current_version[1] = re.sub('_', '.', current_version[1])
|
||||
current_version[1] = re.sub('-', '.', current_version[1])
|
||||
return (current_version[1], '')
|
||||
|
||||
package_regex = self._init_regexes(package, ud, d)
|
||||
if package_regex is None:
|
||||
bb.warn("latest_versionstring: package %s don't match pattern" % (package))
|
||||
return ('', '')
|
||||
bb.debug(3, "latest_versionstring, regex: %s" % (package_regex.pattern))
|
||||
|
||||
uri = ""
|
||||
regex_uri = d.getVar("UPSTREAM_CHECK_URI")
|
||||
if not regex_uri:
|
||||
path = ud.path.split(package)[0]
|
||||
|
||||
# search for version matches on folders inside the path, like:
|
||||
# "5.7" in http://download.gnome.org/sources/${PN}/5.7/${PN}-${PV}.tar.gz
|
||||
dirver_regex = re.compile("(?P<dirver>[^/]*(\d+\.)*\d+([-_]r\d+)*)/")
|
||||
m = dirver_regex.search(path)
|
||||
if m:
|
||||
pn = d.getVar('PN')
|
||||
dirver = m.group('dirver')
|
||||
|
||||
dirver_pn_regex = re.compile("%s\d?" % (re.escape(pn)))
|
||||
if not dirver_pn_regex.search(dirver):
|
||||
return (self._check_latest_version_by_dir(dirver,
|
||||
package, package_regex, current_version, ud, d), '')
|
||||
|
||||
uri = bb.fetch.encodeurl([ud.type, ud.host, path, ud.user, ud.pswd, {}])
|
||||
else:
|
||||
uri = regex_uri
|
||||
|
||||
return (self._check_latest_version(uri, package, package_regex,
|
||||
current_version, ud, d), '')
|
||||
|
||||
@@ -1,509 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# Copyright (C) 2003, 2004 Chris Larson
|
||||
# Copyright (C) 2003, 2004 Phil Blundell
|
||||
# Copyright (C) 2003 - 2005 Michael 'Mickey' Lauer
|
||||
# Copyright (C) 2005 Holger Hans Peter Freyther
|
||||
# Copyright (C) 2005 ROAD GmbH
|
||||
# Copyright (C) 2006 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys
|
||||
import logging
|
||||
import optparse
|
||||
import warnings
|
||||
import fcntl
|
||||
import time
|
||||
import traceback
|
||||
|
||||
import bb
|
||||
from bb import event
|
||||
import bb.msg
|
||||
from bb import cooker
|
||||
from bb import ui
|
||||
from bb import server
|
||||
from bb import cookerdata
|
||||
|
||||
import bb.server.process
|
||||
import bb.server.xmlrpcclient
|
||||
|
||||
logger = logging.getLogger("BitBake")
|
||||
|
||||
class BBMainException(Exception):
|
||||
pass
|
||||
|
||||
class BBMainFatal(bb.BBHandledException):
|
||||
pass
|
||||
|
||||
def present_options(optionlist):
|
||||
if len(optionlist) > 1:
|
||||
return ' or '.join([', '.join(optionlist[:-1]), optionlist[-1]])
|
||||
else:
|
||||
return optionlist[0]
|
||||
|
||||
class BitbakeHelpFormatter(optparse.IndentedHelpFormatter):
|
||||
def format_option(self, option):
|
||||
# We need to do this here rather than in the text we supply to
|
||||
# add_option() because we don't want to call list_extension_modules()
|
||||
# on every execution (since it imports all of the modules)
|
||||
# Note also that we modify option.help rather than the returned text
|
||||
# - this is so that we don't have to re-format the text ourselves
|
||||
if option.dest == 'ui':
|
||||
valid_uis = list_extension_modules(bb.ui, 'main')
|
||||
option.help = option.help.replace('@CHOICES@', present_options(valid_uis))
|
||||
|
||||
return optparse.IndentedHelpFormatter.format_option(self, option)
|
||||
|
||||
def list_extension_modules(pkg, checkattr):
|
||||
"""
|
||||
Lists extension modules in a specific Python package
|
||||
(e.g. UIs, servers). NOTE: Calling this function will import all of the
|
||||
submodules of the specified module in order to check for the specified
|
||||
attribute; this can have unusual side-effects. As a result, this should
|
||||
only be called when displaying help text or error messages.
|
||||
Parameters:
|
||||
pkg: previously imported Python package to list
|
||||
checkattr: attribute to look for in module to determine if it's valid
|
||||
as the type of extension you are looking for
|
||||
"""
|
||||
import pkgutil
|
||||
pkgdir = os.path.dirname(pkg.__file__)
|
||||
|
||||
modules = []
|
||||
for _, modulename, _ in pkgutil.iter_modules([pkgdir]):
|
||||
if os.path.isdir(os.path.join(pkgdir, modulename)):
|
||||
# ignore directories
|
||||
continue
|
||||
try:
|
||||
module = __import__(pkg.__name__, fromlist=[modulename])
|
||||
except:
|
||||
# If we can't import it, it's not valid
|
||||
continue
|
||||
module_if = getattr(module, modulename)
|
||||
if getattr(module_if, 'hidden_extension', False):
|
||||
continue
|
||||
if not checkattr or hasattr(module_if, checkattr):
|
||||
modules.append(modulename)
|
||||
return modules
|
||||
|
||||
def import_extension_module(pkg, modulename, checkattr):
|
||||
try:
|
||||
# Dynamically load the UI based on the ui name. Although we
|
||||
# suggest a fixed set this allows you to have flexibility in which
|
||||
# ones are available.
|
||||
module = __import__(pkg.__name__, fromlist=[modulename])
|
||||
return getattr(module, modulename)
|
||||
except AttributeError:
|
||||
modules = present_options(list_extension_modules(pkg, checkattr))
|
||||
raise BBMainException('FATAL: Unable to import extension module "%s" from %s. '
|
||||
'Valid extension modules: %s' % (modulename, pkg.__name__, modules))
|
||||
|
||||
# Display bitbake/OE warnings via the BitBake.Warnings logger, ignoring others"""
|
||||
warnlog = logging.getLogger("BitBake.Warnings")
|
||||
_warnings_showwarning = warnings.showwarning
|
||||
def _showwarning(message, category, filename, lineno, file=None, line=None):
|
||||
if file is not None:
|
||||
if _warnings_showwarning is not None:
|
||||
_warnings_showwarning(message, category, filename, lineno, file, line)
|
||||
else:
|
||||
s = warnings.formatwarning(message, category, filename, lineno)
|
||||
warnlog.warning(s)
|
||||
|
||||
warnings.showwarning = _showwarning
|
||||
warnings.filterwarnings("ignore")
|
||||
warnings.filterwarnings("default", module="(<string>$|(oe|bb)\.)")
|
||||
warnings.filterwarnings("ignore", category=PendingDeprecationWarning)
|
||||
warnings.filterwarnings("ignore", category=ImportWarning)
|
||||
warnings.filterwarnings("ignore", category=DeprecationWarning, module="<string>$")
|
||||
warnings.filterwarnings("ignore", message="With-statements now directly support multiple context managers")
|
||||
|
||||
class BitBakeConfigParameters(cookerdata.ConfigParameters):
|
||||
|
||||
def parseCommandLine(self, argv=sys.argv):
|
||||
parser = optparse.OptionParser(
|
||||
formatter=BitbakeHelpFormatter(),
|
||||
version="BitBake Build Tool Core version %s" % bb.__version__,
|
||||
usage="""%prog [options] [recipename/target recipe:do_task ...]
|
||||
|
||||
Executes the specified task (default is 'build') for a given set of target recipes (.bb files).
|
||||
It is assumed there is a conf/bblayers.conf available in cwd or in BBPATH which
|
||||
will provide the layer, BBFILES and other configuration information.""")
|
||||
|
||||
parser.add_option("-b", "--buildfile", action="store", dest="buildfile", default=None,
|
||||
help="Execute tasks from a specific .bb recipe directly. WARNING: Does "
|
||||
"not handle any dependencies from other recipes.")
|
||||
|
||||
parser.add_option("-k", "--continue", action="store_false", dest="abort", default=True,
|
||||
help="Continue as much as possible after an error. While the target that "
|
||||
"failed and anything depending on it cannot be built, as much as "
|
||||
"possible will be built before stopping.")
|
||||
|
||||
parser.add_option("-f", "--force", action="store_true", dest="force", default=False,
|
||||
help="Force the specified targets/task to run (invalidating any "
|
||||
"existing stamp file).")
|
||||
|
||||
parser.add_option("-c", "--cmd", action="store", dest="cmd",
|
||||
help="Specify the task to execute. The exact options available "
|
||||
"depend on the metadata. Some examples might be 'compile'"
|
||||
" or 'populate_sysroot' or 'listtasks' may give a list of "
|
||||
"the tasks available.")
|
||||
|
||||
parser.add_option("-C", "--clear-stamp", action="store", dest="invalidate_stamp",
|
||||
help="Invalidate the stamp for the specified task such as 'compile' "
|
||||
"and then run the default task for the specified target(s).")
|
||||
|
||||
parser.add_option("-r", "--read", action="append", dest="prefile", default=[],
|
||||
help="Read the specified file before bitbake.conf.")
|
||||
|
||||
parser.add_option("-R", "--postread", action="append", dest="postfile", default=[],
|
||||
help="Read the specified file after bitbake.conf.")
|
||||
|
||||
parser.add_option("-v", "--verbose", action="store_true", dest="verbose", default=False,
|
||||
help="Enable tracing of shell tasks (with 'set -x'). "
|
||||
"Also print bb.note(...) messages to stdout (in "
|
||||
"addition to writing them to ${T}/log.do_<task>).")
|
||||
|
||||
parser.add_option("-D", "--debug", action="count", dest="debug", default=0,
|
||||
help="Increase the debug level. You can specify this "
|
||||
"more than once. -D sets the debug level to 1, "
|
||||
"where only bb.debug(1, ...) messages are printed "
|
||||
"to stdout; -DD sets the debug level to 2, where "
|
||||
"both bb.debug(1, ...) and bb.debug(2, ...) "
|
||||
"messages are printed; etc. Without -D, no debug "
|
||||
"messages are printed. Note that -D only affects "
|
||||
"output to stdout. All debug messages are written "
|
||||
"to ${T}/log.do_taskname, regardless of the debug "
|
||||
"level.")
|
||||
|
||||
parser.add_option("-q", "--quiet", action="count", dest="quiet", default=0,
|
||||
help="Output less log message data to the terminal. You can specify this more than once.")
|
||||
|
||||
parser.add_option("-n", "--dry-run", action="store_true", dest="dry_run", default=False,
|
||||
help="Don't execute, just go through the motions.")
|
||||
|
||||
parser.add_option("-S", "--dump-signatures", action="append", dest="dump_signatures",
|
||||
default=[], metavar="SIGNATURE_HANDLER",
|
||||
help="Dump out the signature construction information, with no task "
|
||||
"execution. The SIGNATURE_HANDLER parameter is passed to the "
|
||||
"handler. Two common values are none and printdiff but the handler "
|
||||
"may define more/less. none means only dump the signature, printdiff"
|
||||
" means compare the dumped signature with the cached one.")
|
||||
|
||||
parser.add_option("-p", "--parse-only", action="store_true",
|
||||
dest="parse_only", default=False,
|
||||
help="Quit after parsing the BB recipes.")
|
||||
|
||||
parser.add_option("-s", "--show-versions", action="store_true",
|
||||
dest="show_versions", default=False,
|
||||
help="Show current and preferred versions of all recipes.")
|
||||
|
||||
parser.add_option("-e", "--environment", action="store_true",
|
||||
dest="show_environment", default=False,
|
||||
help="Show the global or per-recipe environment complete with information"
|
||||
" about where variables were set/changed.")
|
||||
|
||||
parser.add_option("-g", "--graphviz", action="store_true", dest="dot_graph", default=False,
|
||||
help="Save dependency tree information for the specified "
|
||||
"targets in the dot syntax.")
|
||||
|
||||
parser.add_option("-I", "--ignore-deps", action="append",
|
||||
dest="extra_assume_provided", default=[],
|
||||
help="Assume these dependencies don't exist and are already provided "
|
||||
"(equivalent to ASSUME_PROVIDED). Useful to make dependency "
|
||||
"graphs more appealing")
|
||||
|
||||
parser.add_option("-l", "--log-domains", action="append", dest="debug_domains", default=[],
|
||||
help="Show debug logging for the specified logging domains")
|
||||
|
||||
parser.add_option("-P", "--profile", action="store_true", dest="profile", default=False,
|
||||
help="Profile the command and save reports.")
|
||||
|
||||
# @CHOICES@ is substituted out by BitbakeHelpFormatter above
|
||||
parser.add_option("-u", "--ui", action="store", dest="ui",
|
||||
default=os.environ.get('BITBAKE_UI', 'knotty'),
|
||||
help="The user interface to use (@CHOICES@ - default %default).")
|
||||
|
||||
parser.add_option("", "--token", action="store", dest="xmlrpctoken",
|
||||
default=os.environ.get("BBTOKEN"),
|
||||
help="Specify the connection token to be used when connecting "
|
||||
"to a remote server.")
|
||||
|
||||
parser.add_option("", "--revisions-changed", action="store_true",
|
||||
dest="revisions_changed", default=False,
|
||||
help="Set the exit code depending on whether upstream floating "
|
||||
"revisions have changed or not.")
|
||||
|
||||
parser.add_option("", "--server-only", action="store_true",
|
||||
dest="server_only", default=False,
|
||||
help="Run bitbake without a UI, only starting a server "
|
||||
"(cooker) process.")
|
||||
|
||||
parser.add_option("-B", "--bind", action="store", dest="bind", default=False,
|
||||
help="The name/address for the bitbake xmlrpc server to bind to.")
|
||||
|
||||
parser.add_option("-T", "--idle-timeout", type=float, dest="server_timeout",
|
||||
default=os.getenv("BB_SERVER_TIMEOUT"),
|
||||
help="Set timeout to unload bitbake server due to inactivity, "
|
||||
"set to -1 means no unload, "
|
||||
"default: Environment variable BB_SERVER_TIMEOUT.")
|
||||
|
||||
parser.add_option("", "--no-setscene", action="store_true",
|
||||
dest="nosetscene", default=False,
|
||||
help="Do not run any setscene tasks. sstate will be ignored and "
|
||||
"everything needed, built.")
|
||||
|
||||
parser.add_option("", "--setscene-only", action="store_true",
|
||||
dest="setsceneonly", default=False,
|
||||
help="Only run setscene tasks, don't run any real tasks.")
|
||||
|
||||
parser.add_option("", "--remote-server", action="store", dest="remote_server",
|
||||
default=os.environ.get("BBSERVER"),
|
||||
help="Connect to the specified server.")
|
||||
|
||||
parser.add_option("-m", "--kill-server", action="store_true",
|
||||
dest="kill_server", default=False,
|
||||
help="Terminate any running bitbake server.")
|
||||
|
||||
parser.add_option("", "--observe-only", action="store_true",
|
||||
dest="observe_only", default=False,
|
||||
help="Connect to a server as an observing-only client.")
|
||||
|
||||
parser.add_option("", "--status-only", action="store_true",
|
||||
dest="status_only", default=False,
|
||||
help="Check the status of the remote bitbake server.")
|
||||
|
||||
parser.add_option("-w", "--write-log", action="store", dest="writeeventlog",
|
||||
default=os.environ.get("BBEVENTLOG"),
|
||||
help="Writes the event log of the build to a bitbake event json file. "
|
||||
"Use '' (empty string) to assign the name automatically.")
|
||||
|
||||
parser.add_option("", "--runall", action="append", dest="runall",
|
||||
help="Run the specified task for any recipe in the taskgraph of the specified target (even if it wouldn't otherwise have run).")
|
||||
|
||||
parser.add_option("", "--runonly", action="append", dest="runonly",
|
||||
help="Run only the specified task within the taskgraph of the specified targets (and any task dependencies those tasks may have).")
|
||||
|
||||
|
||||
options, targets = parser.parse_args(argv)
|
||||
|
||||
if options.quiet and options.verbose:
|
||||
parser.error("options --quiet and --verbose are mutually exclusive")
|
||||
|
||||
if options.quiet and options.debug:
|
||||
parser.error("options --quiet and --debug are mutually exclusive")
|
||||
|
||||
# use configuration files from environment variables
|
||||
if "BBPRECONF" in os.environ:
|
||||
options.prefile.append(os.environ["BBPRECONF"])
|
||||
|
||||
if "BBPOSTCONF" in os.environ:
|
||||
options.postfile.append(os.environ["BBPOSTCONF"])
|
||||
|
||||
# fill in proper log name if not supplied
|
||||
if options.writeeventlog is not None and len(options.writeeventlog) == 0:
|
||||
from datetime import datetime
|
||||
eventlog = "bitbake_eventlog_%s.json" % datetime.now().strftime("%Y%m%d%H%M%S")
|
||||
options.writeeventlog = eventlog
|
||||
|
||||
if options.bind:
|
||||
try:
|
||||
#Checking that the port is a number and is a ':' delimited value
|
||||
(host, port) = options.bind.split(':')
|
||||
port = int(port)
|
||||
except (ValueError,IndexError):
|
||||
raise BBMainException("FATAL: Malformed host:port bind parameter")
|
||||
options.xmlrpcinterface = (host, port)
|
||||
else:
|
||||
options.xmlrpcinterface = (None, 0)
|
||||
|
||||
return options, targets[1:]
|
||||
|
||||
|
||||
def bitbake_main(configParams, configuration):
|
||||
|
||||
# Python multiprocessing requires /dev/shm on Linux
|
||||
if sys.platform.startswith('linux') and not os.access('/dev/shm', os.W_OK | os.X_OK):
|
||||
raise BBMainException("FATAL: /dev/shm does not exist or is not writable")
|
||||
|
||||
# Unbuffer stdout to avoid log truncation in the event
|
||||
# of an unorderly exit as well as to provide timely
|
||||
# updates to log files for use with tail
|
||||
try:
|
||||
if sys.stdout.name == '<stdout>':
|
||||
# Reopen with O_SYNC (unbuffered)
|
||||
fl = fcntl.fcntl(sys.stdout.fileno(), fcntl.F_GETFL)
|
||||
fl |= os.O_SYNC
|
||||
fcntl.fcntl(sys.stdout.fileno(), fcntl.F_SETFL, fl)
|
||||
except:
|
||||
pass
|
||||
|
||||
configuration.setConfigParameters(configParams)
|
||||
|
||||
if configParams.server_only and configParams.remote_server:
|
||||
raise BBMainException("FATAL: The '--server-only' option conflicts with %s.\n" %
|
||||
("the BBSERVER environment variable" if "BBSERVER" in os.environ \
|
||||
else "the '--remote-server' option"))
|
||||
|
||||
if configParams.observe_only and not (configParams.remote_server or configParams.bind):
|
||||
raise BBMainException("FATAL: '--observe-only' can only be used by UI clients "
|
||||
"connecting to a server.\n")
|
||||
|
||||
if "BBDEBUG" in os.environ:
|
||||
level = int(os.environ["BBDEBUG"])
|
||||
if level > configuration.debug:
|
||||
configuration.debug = level
|
||||
|
||||
bb.msg.init_msgconfig(configParams.verbose, configuration.debug,
|
||||
configuration.debug_domains)
|
||||
|
||||
server_connection, ui_module = setup_bitbake(configParams, configuration)
|
||||
# No server connection
|
||||
if server_connection is None:
|
||||
if configParams.status_only:
|
||||
return 1
|
||||
if configParams.kill_server:
|
||||
return 0
|
||||
|
||||
if not configParams.server_only:
|
||||
if configParams.status_only:
|
||||
server_connection.terminate()
|
||||
return 0
|
||||
|
||||
try:
|
||||
for event in bb.event.ui_queue:
|
||||
server_connection.events.queue_event(event)
|
||||
bb.event.ui_queue = []
|
||||
|
||||
return ui_module.main(server_connection.connection, server_connection.events,
|
||||
configParams)
|
||||
finally:
|
||||
server_connection.terminate()
|
||||
else:
|
||||
return 0
|
||||
|
||||
return 1
|
||||
|
||||
def setup_bitbake(configParams, configuration, extrafeatures=None):
|
||||
# Ensure logging messages get sent to the UI as events
|
||||
handler = bb.event.LogHandler()
|
||||
if not configParams.status_only:
|
||||
# In status only mode there are no logs and no UI
|
||||
logger.addHandler(handler)
|
||||
|
||||
if configParams.server_only:
|
||||
featureset = []
|
||||
ui_module = None
|
||||
else:
|
||||
ui_module = import_extension_module(bb.ui, configParams.ui, 'main')
|
||||
# Collect the feature set for the UI
|
||||
featureset = getattr(ui_module, "featureSet", [])
|
||||
|
||||
if extrafeatures:
|
||||
for feature in extrafeatures:
|
||||
if not feature in featureset:
|
||||
featureset.append(feature)
|
||||
|
||||
server_connection = None
|
||||
|
||||
# Clear away any spurious environment variables while we stoke up the cooker
|
||||
# (done after import_extension_module() above since for example import gi triggers env var usage)
|
||||
cleanedvars = bb.utils.clean_environment()
|
||||
|
||||
if configParams.remote_server:
|
||||
# Connect to a remote XMLRPC server
|
||||
server_connection = bb.server.xmlrpcclient.connectXMLRPC(configParams.remote_server, featureset,
|
||||
configParams.observe_only, configParams.xmlrpctoken)
|
||||
else:
|
||||
retries = 8
|
||||
while retries:
|
||||
try:
|
||||
topdir, lock = lockBitbake()
|
||||
sockname = topdir + "/bitbake.sock"
|
||||
if lock:
|
||||
if configParams.status_only or configParams.kill_server:
|
||||
logger.info("bitbake server is not running.")
|
||||
lock.close()
|
||||
return None, None
|
||||
# we start a server with a given configuration
|
||||
logger.info("Starting bitbake server...")
|
||||
# Clear the event queue since we already displayed messages
|
||||
bb.event.ui_queue = []
|
||||
server = bb.server.process.BitBakeServer(lock, sockname, configuration, featureset)
|
||||
|
||||
else:
|
||||
logger.info("Reconnecting to bitbake server...")
|
||||
if not os.path.exists(sockname):
|
||||
logger.info("Previous bitbake instance shutting down?, waiting to retry...")
|
||||
i = 0
|
||||
lock = None
|
||||
# Wait for 5s or until we can get the lock
|
||||
while not lock and i < 50:
|
||||
time.sleep(0.1)
|
||||
_, lock = lockBitbake()
|
||||
i += 1
|
||||
if lock:
|
||||
bb.utils.unlockfile(lock)
|
||||
raise bb.server.process.ProcessTimeout("Bitbake still shutting down as socket exists but no lock?")
|
||||
if not configParams.server_only:
|
||||
try:
|
||||
server_connection = bb.server.process.connectProcessServer(sockname, featureset)
|
||||
except EOFError:
|
||||
# The server may have been shutting down but not closed the socket yet. If that happened,
|
||||
# ignore it.
|
||||
pass
|
||||
|
||||
if server_connection or configParams.server_only:
|
||||
break
|
||||
except BBMainFatal:
|
||||
raise
|
||||
except (Exception, bb.server.process.ProcessTimeout) as e:
|
||||
if not retries:
|
||||
raise
|
||||
retries -= 1
|
||||
if isinstance(e, (bb.server.process.ProcessTimeout, BrokenPipeError)):
|
||||
logger.info("Retrying server connection...")
|
||||
else:
|
||||
logger.info("Retrying server connection... (%s)" % traceback.format_exc())
|
||||
if not retries:
|
||||
bb.fatal("Unable to connect to bitbake server, or start one")
|
||||
if retries < 5:
|
||||
time.sleep(5)
|
||||
|
||||
if configParams.kill_server:
|
||||
server_connection.connection.terminateServer()
|
||||
server_connection.terminate()
|
||||
bb.event.ui_queue = []
|
||||
logger.info("Terminated bitbake server.")
|
||||
return None, None
|
||||
|
||||
# Restore the environment in case the UI needs it
|
||||
for k in cleanedvars:
|
||||
os.environ[k] = cleanedvars[k]
|
||||
|
||||
logger.removeHandler(handler)
|
||||
|
||||
return server_connection, ui_module
|
||||
|
||||
def lockBitbake():
|
||||
topdir = bb.cookerdata.findTopdir()
|
||||
if not topdir:
|
||||
bb.error("Unable to find conf/bblayers.conf or conf/bitbake.conf. BBAPTH is unset and/or not in a build directory?")
|
||||
raise BBMainFatal
|
||||
lockfile = topdir + "/bitbake.lock"
|
||||
return topdir, bb.utils.lockfile(lockfile, False, False)
|
||||
|
||||
@@ -19,22 +19,11 @@
|
||||
|
||||
from bb.utils import better_compile, better_exec
|
||||
|
||||
def insert_method(modulename, code, fn, lineno):
|
||||
def insert_method(modulename, code, fn):
|
||||
"""
|
||||
Add code of a module should be added. The methods
|
||||
will be simply added, no checking will be done
|
||||
"""
|
||||
comp = better_compile(code, modulename, fn, lineno=lineno)
|
||||
comp = better_compile(code, modulename, fn )
|
||||
better_exec(comp, None, code, fn)
|
||||
|
||||
compilecache = {}
|
||||
|
||||
def compile_cache(code):
|
||||
h = hash(code)
|
||||
if h in compilecache:
|
||||
return compilecache[h]
|
||||
return None
|
||||
|
||||
def compile_cache_add(code, compileobj):
|
||||
h = hash(code)
|
||||
compilecache[h] = compileobj
|
||||
|
||||
@@ -129,7 +129,7 @@ def getDiskData(BBDirs, configuration):
|
||||
bb.utils.mkdirhier(path)
|
||||
dev = getMountedDev(path)
|
||||
# Use path/action as the key
|
||||
devDict[(path, action)] = [dev, minSpace, minInode]
|
||||
devDict[os.path.join(path, action)] = [dev, minSpace, minInode]
|
||||
|
||||
return devDict
|
||||
|
||||
@@ -141,7 +141,7 @@ def getInterval(configuration):
|
||||
spaceDefault = 50 * 1024 * 1024
|
||||
inodeDefault = 5 * 1024
|
||||
|
||||
interval = configuration.getVar("BB_DISKMON_WARNINTERVAL")
|
||||
interval = configuration.getVar("BB_DISKMON_WARNINTERVAL", True)
|
||||
if not interval:
|
||||
return spaceDefault, inodeDefault
|
||||
else:
|
||||
@@ -179,7 +179,7 @@ class diskMonitor:
|
||||
self.enableMonitor = False
|
||||
self.configuration = configuration
|
||||
|
||||
BBDirs = configuration.getVar("BB_DISKMON_DIRS") or None
|
||||
BBDirs = configuration.getVar("BB_DISKMON_DIRS", True) or None
|
||||
if BBDirs:
|
||||
self.devDict = getDiskData(BBDirs, configuration)
|
||||
if self.devDict:
|
||||
@@ -205,25 +205,22 @@ class diskMonitor:
|
||||
""" Take action for the monitor """
|
||||
|
||||
if self.enableMonitor:
|
||||
diskUsage = {}
|
||||
for k, attributes in self.devDict.items():
|
||||
path, action = k
|
||||
dev, minSpace, minInode = attributes
|
||||
for k in self.devDict:
|
||||
path = os.path.dirname(k)
|
||||
action = os.path.basename(k)
|
||||
dev = self.devDict[k][0]
|
||||
minSpace = self.devDict[k][1]
|
||||
minInode = self.devDict[k][2]
|
||||
|
||||
st = os.statvfs(path)
|
||||
|
||||
# The available free space, integer number
|
||||
# The free space, float point number
|
||||
freeSpace = st.f_bavail * st.f_frsize
|
||||
|
||||
# Send all relevant information in the event.
|
||||
freeSpaceRoot = st.f_bfree * st.f_frsize
|
||||
totalSpace = st.f_blocks * st.f_frsize
|
||||
diskUsage[dev] = bb.event.DiskUsageSample(freeSpace, freeSpaceRoot, totalSpace)
|
||||
|
||||
if minSpace and freeSpace < minSpace:
|
||||
# Always show warning, the self.checked would always be False if the action is WARN
|
||||
if self.preFreeS[k] == 0 or self.preFreeS[k] - freeSpace > self.spaceInterval and not self.checked[k]:
|
||||
logger.warning("The free space of %s (%s) is running low (%.3fGB left)" % \
|
||||
logger.warn("The free space of %s (%s) is running low (%.3fGB left)" % \
|
||||
(path, dev, freeSpace / 1024 / 1024 / 1024.0))
|
||||
self.preFreeS[k] = freeSpace
|
||||
|
||||
@@ -238,7 +235,7 @@ class diskMonitor:
|
||||
rq.finish_runqueue(True)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'disk', freeSpace, path), self.configuration)
|
||||
|
||||
# The free inodes, integer number
|
||||
# The free inodes, float point number
|
||||
freeInode = st.f_favail
|
||||
|
||||
if minInode and freeInode < minInode:
|
||||
@@ -249,7 +246,7 @@ class diskMonitor:
|
||||
continue
|
||||
# Always show warning, the self.checked would always be False if the action is WARN
|
||||
if self.preFreeI[k] == 0 or self.preFreeI[k] - freeInode > self.inodeInterval and not self.checked[k]:
|
||||
logger.warning("The free inode of %s (%s) is running low (%.3fK left)" % \
|
||||
logger.warn("The free inode of %s (%s) is running low (%.3fK left)" % \
|
||||
(path, dev, freeInode / 1024.0))
|
||||
self.preFreeI[k] = freeInode
|
||||
|
||||
@@ -263,6 +260,4 @@ class diskMonitor:
|
||||
self.checked[k] = True
|
||||
rq.finish_runqueue(True)
|
||||
bb.event.fire(bb.event.DiskFull(dev, 'inode', freeInode, path), self.configuration)
|
||||
|
||||
bb.event.fire(bb.event.MonitorDiskEvent(diskUsage), self.configuration)
|
||||
return
|
||||
|
||||
@@ -57,7 +57,7 @@ class BBLogFormatter(logging.Formatter):
|
||||
}
|
||||
|
||||
color_enabled = False
|
||||
BASECOLOR, BLACK, RED, GREEN, YELLOW, BLUE, MAGENTA, CYAN, WHITE = list(range(29,38))
|
||||
BASECOLOR, BLACK, RED, GREEN, YELLOW, BLUE, MAGENTA, CYAN, WHITE = range(29,38)
|
||||
|
||||
COLORS = {
|
||||
DEBUG3 : CYAN,
|
||||
@@ -90,9 +90,8 @@ class BBLogFormatter(logging.Formatter):
|
||||
if self.color_enabled:
|
||||
record = self.colorize(record)
|
||||
msg = logging.Formatter.format(self, record)
|
||||
if hasattr(record, 'bb_exc_formatted'):
|
||||
msg += '\n' + ''.join(record.bb_exc_formatted)
|
||||
elif hasattr(record, 'bb_exc_info'):
|
||||
|
||||
if hasattr(record, 'bb_exc_info'):
|
||||
etype, value, tb = record.bb_exc_info
|
||||
formatted = bb.exceptions.format_exception(etype, value, tb, limit=5)
|
||||
msg += '\n' + ''.join(formatted)
|
||||
@@ -151,7 +150,7 @@ loggerDefaultVerbose = False
|
||||
loggerVerboseLogs = False
|
||||
loggerDefaultDomains = []
|
||||
|
||||
def init_msgconfig(verbose, debug, debug_domains=None):
|
||||
def init_msgconfig(verbose, debug, debug_domains = []):
|
||||
"""
|
||||
Set default verbosity and debug levels config the logger
|
||||
"""
|
||||
@@ -159,10 +158,7 @@ def init_msgconfig(verbose, debug, debug_domains=None):
|
||||
bb.msg.loggerDefaultVerbose = verbose
|
||||
if verbose:
|
||||
bb.msg.loggerVerboseLogs = True
|
||||
if debug_domains:
|
||||
bb.msg.loggerDefaultDomains = debug_domains
|
||||
else:
|
||||
bb.msg.loggerDefaultDomains = []
|
||||
bb.msg.loggerDefaultDomains = debug_domains
|
||||
|
||||
def constructLogOptions():
|
||||
debug = loggerDefaultDebugLevel
|
||||
@@ -182,12 +178,9 @@ def constructLogOptions():
|
||||
debug_domains["BitBake.%s" % domainarg] = logging.DEBUG - dlevel + 1
|
||||
return level, debug_domains
|
||||
|
||||
def addDefaultlogFilter(handler, cls = BBLogFilter, forcelevel=None):
|
||||
def addDefaultlogFilter(handler, cls = BBLogFilter):
|
||||
level, debug_domains = constructLogOptions()
|
||||
|
||||
if forcelevel is not None:
|
||||
level = forcelevel
|
||||
|
||||
cls(handler, level, debug_domains)
|
||||
|
||||
#
|
||||
@@ -201,25 +194,3 @@ def fatal(msgdomain, msg):
|
||||
logger = logging.getLogger("BitBake")
|
||||
logger.critical(msg)
|
||||
sys.exit(1)
|
||||
|
||||
def logger_create(name, output=sys.stderr, level=logging.INFO, preserve_handlers=False, color='auto'):
|
||||
"""Standalone logger creation function"""
|
||||
logger = logging.getLogger(name)
|
||||
console = logging.StreamHandler(output)
|
||||
format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
|
||||
if color == 'always' or (color == 'auto' and output.isatty()):
|
||||
format.enable_color()
|
||||
console.setFormatter(format)
|
||||
if preserve_handlers:
|
||||
logger.addHandler(console)
|
||||
else:
|
||||
logger.handlers = [console]
|
||||
logger.setLevel(level)
|
||||
return logger
|
||||
|
||||
def has_console_handler(logger):
|
||||
for handler in logger.handlers:
|
||||
if isinstance(handler, logging.StreamHandler):
|
||||
if handler.stream in [sys.stderr, sys.stdout]:
|
||||
return True
|
||||
return False
|
||||
|
||||
@@ -26,10 +26,9 @@ File parsers for the BitBake build tools.
|
||||
|
||||
handlers = []
|
||||
|
||||
import errno
|
||||
import logging
|
||||
import os
|
||||
import stat
|
||||
import logging
|
||||
import bb
|
||||
import bb.utils
|
||||
import bb.siggen
|
||||
@@ -71,12 +70,7 @@ def cached_mtime_noerror(f):
|
||||
return __mtime_cache[f]
|
||||
|
||||
def update_mtime(f):
|
||||
try:
|
||||
__mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
|
||||
except OSError:
|
||||
if f in __mtime_cache:
|
||||
del __mtime_cache[f]
|
||||
return 0
|
||||
__mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
|
||||
return __mtime_cache[f]
|
||||
|
||||
def update_cache(f):
|
||||
@@ -84,14 +78,10 @@ def update_cache(f):
|
||||
logger.debug(1, "Updating mtime cache for %s" % f)
|
||||
update_mtime(f)
|
||||
|
||||
def clear_cache():
|
||||
global __mtime_cache
|
||||
__mtime_cache = {}
|
||||
|
||||
def mark_dependency(d, f):
|
||||
if f.startswith('./'):
|
||||
f = "%s/%s" % (os.getcwd(), f[2:])
|
||||
deps = (d.getVar('__depends', False) or [])
|
||||
deps = (d.getVar('__depends') or [])
|
||||
s = (f, cached_mtime_noerror(f))
|
||||
if s not in deps:
|
||||
deps.append(s)
|
||||
@@ -99,7 +89,7 @@ def mark_dependency(d, f):
|
||||
|
||||
def check_dependency(d, f):
|
||||
s = (f, cached_mtime_noerror(f))
|
||||
deps = (d.getVar('__depends', False) or [])
|
||||
deps = (d.getVar('__depends') or [])
|
||||
return s in deps
|
||||
|
||||
def supports(fn, data):
|
||||
@@ -127,18 +117,17 @@ def init_parser(d):
|
||||
|
||||
def resolve_file(fn, d):
|
||||
if not os.path.isabs(fn):
|
||||
bbpath = d.getVar("BBPATH")
|
||||
bbpath = d.getVar("BBPATH", True)
|
||||
newfn, attempts = bb.utils.which(bbpath, fn, history=True)
|
||||
for af in attempts:
|
||||
mark_dependency(d, af)
|
||||
if not newfn:
|
||||
raise IOError(errno.ENOENT, "file %s not found in %s" % (fn, bbpath))
|
||||
raise IOError("file %s not found in %s" % (fn, bbpath))
|
||||
fn = newfn
|
||||
else:
|
||||
mark_dependency(d, fn)
|
||||
|
||||
mark_dependency(d, fn)
|
||||
if not os.path.isfile(fn):
|
||||
raise IOError(errno.ENOENT, "file %s not found" % fn)
|
||||
raise IOError("file %s not found" % fn)
|
||||
|
||||
return fn
|
||||
|
||||
@@ -166,8 +155,8 @@ def vars_from_file(mypkg, d):
|
||||
def get_file_depends(d):
|
||||
'''Return the dependent files'''
|
||||
dep_files = []
|
||||
depends = d.getVar('__base_depends', False) or []
|
||||
depends = depends + (d.getVar('__depends', False) or [])
|
||||
depends = d.getVar('__base_depends', True) or []
|
||||
depends = depends + (d.getVar('__depends', True) or [])
|
||||
for (fn, _) in depends:
|
||||
dep_files.append(os.path.abspath(fn))
|
||||
return " ".join(dep_files)
|
||||
|
||||
@@ -21,7 +21,8 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
|
||||
from __future__ import absolute_import
|
||||
from future_builtins import filter
|
||||
import re
|
||||
import string
|
||||
import logging
|
||||
@@ -30,6 +31,8 @@ import itertools
|
||||
from bb import methodpool
|
||||
from bb.parse import logger
|
||||
|
||||
_bbversions_re = re.compile(r"\[(?P<from>[0-9]+)-(?P<to>[0-9]+)\]")
|
||||
|
||||
class StatementGroup(list):
|
||||
def eval(self, data):
|
||||
for statement in self:
|
||||
@@ -67,33 +70,6 @@ class ExportNode(AstNode):
|
||||
def eval(self, data):
|
||||
data.setVarFlag(self.var, "export", 1, op = 'exported')
|
||||
|
||||
class UnsetNode(AstNode):
|
||||
def __init__(self, filename, lineno, var):
|
||||
AstNode.__init__(self, filename, lineno)
|
||||
self.var = var
|
||||
|
||||
def eval(self, data):
|
||||
loginfo = {
|
||||
'variable': self.var,
|
||||
'file': self.filename,
|
||||
'line': self.lineno,
|
||||
}
|
||||
data.delVar(self.var,**loginfo)
|
||||
|
||||
class UnsetFlagNode(AstNode):
|
||||
def __init__(self, filename, lineno, var, flag):
|
||||
AstNode.__init__(self, filename, lineno)
|
||||
self.var = var
|
||||
self.flag = flag
|
||||
|
||||
def eval(self, data):
|
||||
loginfo = {
|
||||
'variable': self.var,
|
||||
'file': self.filename,
|
||||
'line': self.lineno,
|
||||
}
|
||||
data.delVarFlag(self.var, self.flag, **loginfo)
|
||||
|
||||
class DataNode(AstNode):
|
||||
"""
|
||||
Various data related updates. For the sake of sanity
|
||||
@@ -107,9 +83,9 @@ class DataNode(AstNode):
|
||||
|
||||
def getFunc(self, key, data):
|
||||
if 'flag' in self.groupd and self.groupd['flag'] != None:
|
||||
return data.getVarFlag(key, self.groupd['flag'], expand=False, noweakdefault=True)
|
||||
return data.getVarFlag(key, self.groupd['flag'], noweakdefault=True)
|
||||
else:
|
||||
return data.getVar(key, False, noweakdefault=True, parsing=True)
|
||||
return data.getVar(key, noweakdefault=True)
|
||||
|
||||
def eval(self, data):
|
||||
groupd = self.groupd
|
||||
@@ -130,6 +106,7 @@ class DataNode(AstNode):
|
||||
val = groupd["value"]
|
||||
elif "colon" in groupd and groupd["colon"] != None:
|
||||
e = data.createCopy()
|
||||
bb.data.update_data(e)
|
||||
op = "immediate"
|
||||
val = e.expand(groupd["value"], key + "[:=]")
|
||||
elif "append" in groupd and groupd["append"] != None:
|
||||
@@ -151,7 +128,7 @@ class DataNode(AstNode):
|
||||
if 'flag' in groupd and groupd['flag'] != None:
|
||||
flag = groupd['flag']
|
||||
elif groupd["lazyques"]:
|
||||
flag = "_defaultval"
|
||||
flag = "defaultval"
|
||||
|
||||
loginfo['op'] = op
|
||||
loginfo['detail'] = groupd["value"]
|
||||
@@ -159,42 +136,29 @@ class DataNode(AstNode):
|
||||
if flag:
|
||||
data.setVarFlag(key, flag, val, **loginfo)
|
||||
else:
|
||||
data.setVar(key, val, parsing=True, **loginfo)
|
||||
data.setVar(key, val, **loginfo)
|
||||
|
||||
class MethodNode(AstNode):
|
||||
tr_tbl = str.maketrans('/.+-@%&', '_______')
|
||||
tr_tbl = string.maketrans('/.+-@%', '______')
|
||||
|
||||
def __init__(self, filename, lineno, func_name, body, python, fakeroot):
|
||||
def __init__(self, filename, lineno, func_name, body):
|
||||
AstNode.__init__(self, filename, lineno)
|
||||
self.func_name = func_name
|
||||
self.body = body
|
||||
self.python = python
|
||||
self.fakeroot = fakeroot
|
||||
|
||||
def eval(self, data):
|
||||
text = '\n'.join(self.body)
|
||||
funcname = self.func_name
|
||||
if self.func_name == "__anonymous":
|
||||
funcname = ("__anon_%s_%s" % (self.lineno, self.filename.translate(MethodNode.tr_tbl)))
|
||||
self.python = True
|
||||
text = "def %s(d):\n" % (funcname) + text
|
||||
bb.methodpool.insert_method(funcname, text, self.filename, self.lineno - len(self.body))
|
||||
anonfuncs = data.getVar('__BBANONFUNCS', False) or []
|
||||
bb.methodpool.insert_method(funcname, text, self.filename)
|
||||
anonfuncs = data.getVar('__BBANONFUNCS') or []
|
||||
anonfuncs.append(funcname)
|
||||
data.setVar('__BBANONFUNCS', anonfuncs)
|
||||
if data.getVar(funcname, False):
|
||||
# clean up old version of this piece of metadata, as its
|
||||
# flags could cause problems
|
||||
data.delVarFlag(funcname, 'python')
|
||||
data.delVarFlag(funcname, 'fakeroot')
|
||||
if self.python:
|
||||
data.setVarFlag(funcname, "python", "1")
|
||||
if self.fakeroot:
|
||||
data.setVarFlag(funcname, "fakeroot", "1")
|
||||
data.setVarFlag(funcname, "func", 1)
|
||||
data.setVar(funcname, text, parsing=True)
|
||||
data.setVarFlag(funcname, 'filename', self.filename)
|
||||
data.setVarFlag(funcname, 'lineno', str(self.lineno - len(self.body)))
|
||||
data.setVar(funcname, text)
|
||||
else:
|
||||
data.setVarFlag(self.func_name, "func", 1)
|
||||
data.setVar(self.func_name, text)
|
||||
|
||||
class PythonMethodNode(AstNode):
|
||||
def __init__(self, filename, lineno, function, modulename, body):
|
||||
@@ -208,12 +172,31 @@ class PythonMethodNode(AstNode):
|
||||
# 'this' file. This means we will not parse methods from
|
||||
# bb classes twice
|
||||
text = '\n'.join(self.body)
|
||||
bb.methodpool.insert_method(self.modulename, text, self.filename, self.lineno - len(self.body) - 1)
|
||||
bb.methodpool.insert_method(self.modulename, text, self.filename)
|
||||
data.setVarFlag(self.function, "func", 1)
|
||||
data.setVarFlag(self.function, "python", 1)
|
||||
data.setVar(self.function, text, parsing=True)
|
||||
data.setVarFlag(self.function, 'filename', self.filename)
|
||||
data.setVarFlag(self.function, 'lineno', str(self.lineno - len(self.body) - 1))
|
||||
data.setVar(self.function, text)
|
||||
|
||||
class MethodFlagsNode(AstNode):
|
||||
def __init__(self, filename, lineno, key, m):
|
||||
AstNode.__init__(self, filename, lineno)
|
||||
self.key = key
|
||||
self.m = m
|
||||
|
||||
def eval(self, data):
|
||||
if data.getVar(self.key):
|
||||
# clean up old version of this piece of metadata, as its
|
||||
# flags could cause problems
|
||||
data.setVarFlag(self.key, 'python', None)
|
||||
data.setVarFlag(self.key, 'fakeroot', None)
|
||||
if self.m.group("py") is not None:
|
||||
data.setVarFlag(self.key, "python", "1")
|
||||
else:
|
||||
data.delVarFlag(self.key, "python")
|
||||
if self.m.group("fr") is not None:
|
||||
data.setVarFlag(self.key, "fakeroot", "1")
|
||||
else:
|
||||
data.delVarFlag(self.key, "fakeroot")
|
||||
|
||||
class ExportFuncsNode(AstNode):
|
||||
def __init__(self, filename, lineno, fns, classname):
|
||||
@@ -226,28 +209,26 @@ class ExportFuncsNode(AstNode):
|
||||
for func in self.n:
|
||||
calledfunc = self.classname + "_" + func
|
||||
|
||||
if data.getVar(func, False) and not data.getVarFlag(func, 'export_func', False):
|
||||
if data.getVar(func) and not data.getVarFlag(func, 'export_func'):
|
||||
continue
|
||||
|
||||
if data.getVar(func, False):
|
||||
if data.getVar(func):
|
||||
data.setVarFlag(func, 'python', None)
|
||||
data.setVarFlag(func, 'func', None)
|
||||
|
||||
for flag in [ "func", "python" ]:
|
||||
if data.getVarFlag(calledfunc, flag, False):
|
||||
data.setVarFlag(func, flag, data.getVarFlag(calledfunc, flag, False))
|
||||
if data.getVarFlag(calledfunc, flag):
|
||||
data.setVarFlag(func, flag, data.getVarFlag(calledfunc, flag))
|
||||
for flag in [ "dirs" ]:
|
||||
if data.getVarFlag(func, flag, False):
|
||||
data.setVarFlag(calledfunc, flag, data.getVarFlag(func, flag, False))
|
||||
data.setVarFlag(func, "filename", "autogenerated")
|
||||
data.setVarFlag(func, "lineno", 1)
|
||||
if data.getVarFlag(func, flag):
|
||||
data.setVarFlag(calledfunc, flag, data.getVarFlag(func, flag))
|
||||
|
||||
if data.getVarFlag(calledfunc, "python", False):
|
||||
data.setVar(func, " bb.build.exec_func('" + calledfunc + "', d)\n", parsing=True)
|
||||
if data.getVarFlag(calledfunc, "python"):
|
||||
data.setVar(func, " bb.build.exec_func('" + calledfunc + "', d)\n")
|
||||
else:
|
||||
if "-" in self.classname:
|
||||
bb.fatal("The classname %s contains a dash character and is calling an sh function %s using EXPORT_FUNCTIONS. Since a dash is illegal in sh function names, this cannot work, please rename the class or don't use EXPORT_FUNCTIONS." % (self.classname, calledfunc))
|
||||
data.setVar(func, " " + calledfunc + "\n", parsing=True)
|
||||
data.setVar(func, " " + calledfunc + "\n")
|
||||
data.setVarFlag(func, 'export_func', '1')
|
||||
|
||||
class AddTaskNode(AstNode):
|
||||
@@ -274,7 +255,7 @@ class BBHandlerNode(AstNode):
|
||||
self.hs = fns.split()
|
||||
|
||||
def eval(self, data):
|
||||
bbhands = data.getVar('__BBHANDLERS', False) or []
|
||||
bbhands = data.getVar('__BBHANDLERS') or []
|
||||
for h in self.hs:
|
||||
bbhands.append(h)
|
||||
data.setVarFlag(h, "handler", 1)
|
||||
@@ -294,21 +275,18 @@ def handleInclude(statements, filename, lineno, m, force):
|
||||
def handleExport(statements, filename, lineno, m):
|
||||
statements.append(ExportNode(filename, lineno, m.group(1)))
|
||||
|
||||
def handleUnset(statements, filename, lineno, m):
|
||||
statements.append(UnsetNode(filename, lineno, m.group(1)))
|
||||
|
||||
def handleUnsetFlag(statements, filename, lineno, m):
|
||||
statements.append(UnsetFlagNode(filename, lineno, m.group(1), m.group(2)))
|
||||
|
||||
def handleData(statements, filename, lineno, groupd):
|
||||
statements.append(DataNode(filename, lineno, groupd))
|
||||
|
||||
def handleMethod(statements, filename, lineno, func_name, body, python, fakeroot):
|
||||
statements.append(MethodNode(filename, lineno, func_name, body, python, fakeroot))
|
||||
def handleMethod(statements, filename, lineno, func_name, body):
|
||||
statements.append(MethodNode(filename, lineno, func_name, body))
|
||||
|
||||
def handlePythonMethod(statements, filename, lineno, funcname, modulename, body):
|
||||
statements.append(PythonMethodNode(filename, lineno, funcname, modulename, body))
|
||||
|
||||
def handleMethodFlags(statements, filename, lineno, key, m):
|
||||
statements.append(MethodFlagsNode(filename, lineno, key, m))
|
||||
|
||||
def handleExportFuncs(statements, filename, lineno, m, classname):
|
||||
statements.append(ExportFuncsNode(filename, lineno, m.group(1), classname))
|
||||
|
||||
@@ -335,38 +313,31 @@ def handleInherit(statements, filename, lineno, m):
|
||||
classes = m.group(1)
|
||||
statements.append(InheritNode(filename, lineno, classes))
|
||||
|
||||
def runAnonFuncs(d):
|
||||
code = []
|
||||
for funcname in d.getVar("__BBANONFUNCS", False) or []:
|
||||
code.append("%s(d)" % funcname)
|
||||
bb.utils.better_exec("\n".join(code), {"d": d})
|
||||
|
||||
def finalize(fn, d, variant = None):
|
||||
saved_handlers = bb.event.get_handlers().copy()
|
||||
|
||||
for var in d.getVar('__BBHANDLERS', False) or []:
|
||||
all_handlers = {}
|
||||
for var in d.getVar('__BBHANDLERS') or []:
|
||||
# try to add the handler
|
||||
handlerfn = d.getVarFlag(var, "filename", False)
|
||||
if not handlerfn:
|
||||
bb.fatal("Undefined event handler function '%s'" % var)
|
||||
handlerln = int(d.getVarFlag(var, "lineno", False))
|
||||
bb.event.register(var, d.getVar(var, False), (d.getVarFlag(var, "eventmask") or "").split(), handlerfn, handlerln)
|
||||
bb.event.register(var, d.getVar(var), (d.getVarFlag(var, "eventmask", True) or "").split())
|
||||
|
||||
bb.event.fire(bb.event.RecipePreFinalise(fn), d)
|
||||
|
||||
bb.data.expandKeys(d)
|
||||
runAnonFuncs(d)
|
||||
bb.data.update_data(d)
|
||||
code = []
|
||||
for funcname in d.getVar("__BBANONFUNCS") or []:
|
||||
code.append("%s(d)" % funcname)
|
||||
bb.utils.better_exec("\n".join(code), {"d": d})
|
||||
bb.data.update_data(d)
|
||||
|
||||
tasklist = d.getVar('__BBTASKS', False) or []
|
||||
bb.event.fire(bb.event.RecipeTaskPreProcess(fn, list(tasklist)), d)
|
||||
bb.build.add_tasks(tasklist, d)
|
||||
tasklist = d.getVar('__BBTASKS') or []
|
||||
deltasklist = d.getVar('__BBDELTASKS') or []
|
||||
bb.build.add_tasks(tasklist, deltasklist, d)
|
||||
|
||||
bb.parse.siggen.finalise(fn, d, variant)
|
||||
|
||||
d.setVar('BBINCLUDED', bb.parse.get_file_depends(d))
|
||||
|
||||
bb.event.fire(bb.event.RecipeParsed(fn), d)
|
||||
bb.event.set_handlers(saved_handlers)
|
||||
|
||||
def _create_variants(datastores, names, function, onlyfinalise):
|
||||
def create_variant(name, orig_d, arg = None):
|
||||
@@ -376,16 +347,37 @@ def _create_variants(datastores, names, function, onlyfinalise):
|
||||
function(arg or name, new_d)
|
||||
datastores[name] = new_d
|
||||
|
||||
for variant in list(datastores.keys()):
|
||||
for variant, variant_d in datastores.items():
|
||||
for name in names:
|
||||
if not variant:
|
||||
# Based on main recipe
|
||||
create_variant(name, datastores[""])
|
||||
create_variant(name, variant_d)
|
||||
else:
|
||||
create_variant("%s-%s" % (variant, name), datastores[variant], name)
|
||||
create_variant("%s-%s" % (variant, name), variant_d, name)
|
||||
|
||||
def _expand_versions(versions):
|
||||
def expand_one(version, start, end):
|
||||
for i in xrange(start, end + 1):
|
||||
ver = _bbversions_re.sub(str(i), version, 1)
|
||||
yield ver
|
||||
|
||||
versions = iter(versions)
|
||||
while True:
|
||||
try:
|
||||
version = next(versions)
|
||||
except StopIteration:
|
||||
break
|
||||
|
||||
range_ver = _bbversions_re.search(version)
|
||||
if not range_ver:
|
||||
yield version
|
||||
else:
|
||||
newversions = expand_one(version, int(range_ver.group("from")),
|
||||
int(range_ver.group("to")))
|
||||
versions = itertools.chain(newversions, versions)
|
||||
|
||||
def multi_finalize(fn, d):
|
||||
appends = (d.getVar("__BBAPPEND") or "").split()
|
||||
appends = (d.getVar("__BBAPPEND", True) or "").split()
|
||||
for append in appends:
|
||||
logger.debug(1, "Appending .bbappend file %s to %s", append, fn)
|
||||
bb.parse.BBHandler.handle(append, d, True)
|
||||
@@ -400,7 +392,51 @@ def multi_finalize(fn, d):
|
||||
d.setVar("__SKIPPED", e.args[0])
|
||||
datastores = {"": safe_d}
|
||||
|
||||
extended = d.getVar("BBCLASSEXTEND") or ""
|
||||
versions = (d.getVar("BBVERSIONS", True) or "").split()
|
||||
if versions:
|
||||
pv = orig_pv = d.getVar("PV", True)
|
||||
baseversions = {}
|
||||
|
||||
def verfunc(ver, d, pv_d = None):
|
||||
if pv_d is None:
|
||||
pv_d = d
|
||||
|
||||
overrides = d.getVar("OVERRIDES", True).split(":")
|
||||
pv_d.setVar("PV", ver)
|
||||
overrides.append(ver)
|
||||
bpv = baseversions.get(ver) or orig_pv
|
||||
pv_d.setVar("BPV", bpv)
|
||||
overrides.append(bpv)
|
||||
d.setVar("OVERRIDES", ":".join(overrides))
|
||||
|
||||
versions = list(_expand_versions(versions))
|
||||
for pos, version in enumerate(list(versions)):
|
||||
try:
|
||||
pv, bpv = version.split(":", 2)
|
||||
except ValueError:
|
||||
pass
|
||||
else:
|
||||
versions[pos] = pv
|
||||
baseversions[pv] = bpv
|
||||
|
||||
if pv in versions and not baseversions.get(pv):
|
||||
versions.remove(pv)
|
||||
else:
|
||||
pv = versions.pop()
|
||||
|
||||
# This is necessary because our existing main datastore
|
||||
# has already been finalized with the old PV, we need one
|
||||
# that's been finalized with the new PV.
|
||||
d = bb.data.createCopy(safe_d)
|
||||
verfunc(pv, d, safe_d)
|
||||
try:
|
||||
finalize(fn, d)
|
||||
except bb.parse.SkipRecipe as e:
|
||||
d.setVar("__SKIPPED", e.args[0])
|
||||
|
||||
_create_variants(datastores, versions, verfunc, onlyfinalise)
|
||||
|
||||
extended = d.getVar("BBCLASSEXTEND", True) or ""
|
||||
if extended:
|
||||
# the following is to support bbextends with arguments, for e.g. multilib
|
||||
# an example is as follows:
|
||||
@@ -418,7 +454,7 @@ def multi_finalize(fn, d):
|
||||
else:
|
||||
extendedmap[ext] = ext
|
||||
|
||||
pn = d.getVar("PN")
|
||||
pn = d.getVar("PN", True)
|
||||
def extendfunc(name, d):
|
||||
if name != extendedmap[name]:
|
||||
d.setVar("BBEXTENDCURR", extendedmap[name])
|
||||
@@ -430,13 +466,17 @@ def multi_finalize(fn, d):
|
||||
safe_d.setVar("BBCLASSEXTEND", extended)
|
||||
_create_variants(datastores, extendedmap.keys(), extendfunc, onlyfinalise)
|
||||
|
||||
for variant in datastores.keys():
|
||||
for variant, variant_d in datastores.iteritems():
|
||||
if variant:
|
||||
try:
|
||||
if not onlyfinalise or variant in onlyfinalise:
|
||||
finalize(fn, datastores[variant], variant)
|
||||
finalize(fn, variant_d, variant)
|
||||
except bb.parse.SkipRecipe as e:
|
||||
datastores[variant].setVar("__SKIPPED", e.args[0])
|
||||
variant_d.setVar("__SKIPPED", e.args[0])
|
||||
|
||||
if len(datastores) > 1:
|
||||
variants = filter(None, datastores.iterkeys())
|
||||
safe_d.setVar("__VARIANTS", " ".join(variants))
|
||||
|
||||
datastores[""] = d
|
||||
return datastores
|
||||
|
||||
@@ -25,14 +25,14 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
|
||||
from __future__ import absolute_import
|
||||
import re, bb, os
|
||||
import logging
|
||||
import bb.build, bb.utils
|
||||
from bb import data
|
||||
|
||||
from . import ConfHandler
|
||||
from .. import resolve_file, ast, logger, ParseError
|
||||
from .. import resolve_file, ast, logger
|
||||
from .ConfHandler import include, init
|
||||
|
||||
# For compatibility
|
||||
@@ -47,26 +47,37 @@ __addhandler_regexp__ = re.compile( r"addhandler\s+(.+)" )
|
||||
__def_regexp__ = re.compile( r"def\s+(\w+).*:" )
|
||||
__python_func_regexp__ = re.compile( r"(\s+.*)|(^$)" )
|
||||
|
||||
__infunc__ = []
|
||||
|
||||
__infunc__ = ""
|
||||
__inpython__ = False
|
||||
__body__ = []
|
||||
__classname__ = ""
|
||||
|
||||
cached_statements = {}
|
||||
|
||||
# We need to indicate EOF to the feeder. This code is so messy that
|
||||
# factoring it out to a close_parse_file method is out of question.
|
||||
# We will use the IN_PYTHON_EOF as an indicator to just close the method
|
||||
#
|
||||
# The two parts using it are tightly integrated anyway
|
||||
IN_PYTHON_EOF = -9999999999999
|
||||
|
||||
|
||||
|
||||
def supports(fn, d):
|
||||
"""Return True if fn has a supported extension"""
|
||||
return os.path.splitext(fn)[-1] in [".bb", ".bbclass", ".inc"]
|
||||
|
||||
def inherit(files, fn, lineno, d):
|
||||
__inherit_cache = d.getVar('__inherit_cache', False) or []
|
||||
__inherit_cache = d.getVar('__inherit_cache') or []
|
||||
files = d.expand(files).split()
|
||||
for file in files:
|
||||
if not os.path.isabs(file) and not file.endswith(".bbclass"):
|
||||
file = os.path.join('classes', '%s.bbclass' % file)
|
||||
|
||||
if not os.path.isabs(file):
|
||||
bbpath = d.getVar("BBPATH")
|
||||
dname = os.path.dirname(fn)
|
||||
bbpath = "%s:%s" % (dname, d.getVar("BBPATH", True))
|
||||
abs_fn, attempts = bb.utils.which(bbpath, file, history=True)
|
||||
for af in attempts:
|
||||
if af != abs_fn:
|
||||
@@ -79,7 +90,7 @@ def inherit(files, fn, lineno, d):
|
||||
__inherit_cache.append( file )
|
||||
d.setVar('__inherit_cache', __inherit_cache)
|
||||
include(fn, file, lineno, d, "inherit")
|
||||
__inherit_cache = d.getVar('__inherit_cache', False) or []
|
||||
__inherit_cache = d.getVar('__inherit_cache') or []
|
||||
|
||||
def get_statements(filename, absolute_filename, base_name):
|
||||
global cached_statements
|
||||
@@ -87,20 +98,20 @@ def get_statements(filename, absolute_filename, base_name):
|
||||
try:
|
||||
return cached_statements[absolute_filename]
|
||||
except KeyError:
|
||||
with open(absolute_filename, 'r') as f:
|
||||
statements = ast.StatementGroup()
|
||||
|
||||
lineno = 0
|
||||
while True:
|
||||
lineno = lineno + 1
|
||||
s = f.readline()
|
||||
if not s: break
|
||||
s = s.rstrip()
|
||||
feeder(lineno, s, filename, base_name, statements)
|
||||
file = open(absolute_filename, 'r')
|
||||
statements = ast.StatementGroup()
|
||||
|
||||
lineno = 0
|
||||
while True:
|
||||
lineno = lineno + 1
|
||||
s = file.readline()
|
||||
if not s: break
|
||||
s = s.rstrip()
|
||||
feeder(lineno, s, filename, base_name, statements)
|
||||
file.close()
|
||||
if __inpython__:
|
||||
# add a blank line to close out any python definition
|
||||
feeder(lineno, "", filename, base_name, statements, eof=True)
|
||||
feeder(IN_PYTHON_EOF, "", filename, base_name, statements)
|
||||
|
||||
if filename.endswith(".bbclass") or filename.endswith(".inc"):
|
||||
cached_statements[absolute_filename] = statements
|
||||
@@ -109,7 +120,7 @@ def get_statements(filename, absolute_filename, base_name):
|
||||
def handle(fn, d, include):
|
||||
global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __infunc__, __body__, __residue__, __classname__
|
||||
__body__ = []
|
||||
__infunc__ = []
|
||||
__infunc__ = ""
|
||||
__classname__ = ""
|
||||
__residue__ = []
|
||||
|
||||
@@ -119,52 +130,50 @@ def handle(fn, d, include):
|
||||
|
||||
if ext == ".bbclass":
|
||||
__classname__ = root
|
||||
__inherit_cache = d.getVar('__inherit_cache', False) or []
|
||||
__inherit_cache = d.getVar('__inherit_cache') or []
|
||||
if not fn in __inherit_cache:
|
||||
__inherit_cache.append(fn)
|
||||
d.setVar('__inherit_cache', __inherit_cache)
|
||||
|
||||
if include != 0:
|
||||
oldfile = d.getVar('FILE', False)
|
||||
oldfile = d.getVar('FILE')
|
||||
else:
|
||||
oldfile = None
|
||||
|
||||
abs_fn = resolve_file(fn, d)
|
||||
|
||||
if include:
|
||||
bb.parse.mark_dependency(d, abs_fn)
|
||||
|
||||
# actual loading
|
||||
statements = get_statements(fn, abs_fn, base_name)
|
||||
|
||||
# DONE WITH PARSING... time to evaluate
|
||||
if ext != ".bbclass" and abs_fn != oldfile:
|
||||
if ext != ".bbclass":
|
||||
d.setVar('FILE', abs_fn)
|
||||
|
||||
try:
|
||||
statements.eval(d)
|
||||
except bb.parse.SkipRecipe:
|
||||
d.setVar("__SKIPPED", True)
|
||||
bb.data.setVar("__SKIPPED", True, d)
|
||||
if include == 0:
|
||||
return { "" : d }
|
||||
|
||||
if __infunc__:
|
||||
raise ParseError("Shell function %s is never closed" % __infunc__[0], __infunc__[1], __infunc__[2])
|
||||
if __residue__:
|
||||
raise ParseError("Leftover unparsed (incomplete?) data %s from %s" % __residue__, fn)
|
||||
|
||||
if ext != ".bbclass" and include == 0:
|
||||
return ast.multi_finalize(fn, d)
|
||||
|
||||
if ext != ".bbclass" and oldfile and abs_fn != oldfile:
|
||||
if oldfile:
|
||||
d.setVar("FILE", oldfile)
|
||||
|
||||
return d
|
||||
|
||||
def feeder(lineno, s, fn, root, statements, eof=False):
|
||||
def feeder(lineno, s, fn, root, statements):
|
||||
global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __def_regexp__, __python_func_regexp__, __inpython__, __infunc__, __body__, bb, __residue__, __classname__
|
||||
if __infunc__:
|
||||
if s == '}':
|
||||
__body__.append('')
|
||||
ast.handleMethod(statements, fn, lineno, __infunc__[0], __body__, __infunc__[3], __infunc__[4])
|
||||
__infunc__ = []
|
||||
ast.handleMethod(statements, fn, lineno, __infunc__, __body__)
|
||||
__infunc__ = ""
|
||||
__body__ = []
|
||||
else:
|
||||
__body__.append(s)
|
||||
@@ -172,7 +181,7 @@ def feeder(lineno, s, fn, root, statements, eof=False):
|
||||
|
||||
if __inpython__:
|
||||
m = __python_func_regexp__.match(s)
|
||||
if m and not eof:
|
||||
if m and lineno != IN_PYTHON_EOF:
|
||||
__body__.append(s)
|
||||
return
|
||||
else:
|
||||
@@ -181,7 +190,7 @@ def feeder(lineno, s, fn, root, statements, eof=False):
|
||||
__body__ = []
|
||||
__inpython__ = False
|
||||
|
||||
if eof:
|
||||
if lineno == IN_PYTHON_EOF:
|
||||
return
|
||||
|
||||
if s and s[0] == '#':
|
||||
@@ -208,7 +217,8 @@ def feeder(lineno, s, fn, root, statements, eof=False):
|
||||
|
||||
m = __func_start_regexp__.match(s)
|
||||
if m:
|
||||
__infunc__ = [m.group("func") or "__anonymous", fn, lineno, m.group("py") is not None, m.group("fr") is not None]
|
||||
__infunc__ = m.group("func") or "__anonymous"
|
||||
ast.handleMethodFlags(statements, fn, lineno, __infunc__, m)
|
||||
return
|
||||
|
||||
m = __def_regexp__.match(s)
|
||||
|
||||
@@ -24,16 +24,15 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import errno
|
||||
import re
|
||||
import os
|
||||
import re, os
|
||||
import logging
|
||||
import bb.utils
|
||||
from bb.parse import ParseError, resolve_file, ast, logger, handle
|
||||
from bb.parse import ParseError, resolve_file, ast, logger
|
||||
|
||||
__config_regexp__ = re.compile( r"""
|
||||
^
|
||||
(?P<exp>export\s+)?
|
||||
(?P<var>[a-zA-Z0-9\-_+.${}/~]+?)
|
||||
(?P<exp>export\s*)?
|
||||
(?P<var>[a-zA-Z0-9\-~_+.${}/]+?)
|
||||
(\[(?P<flag>[a-zA-Z0-9\-_+.]+)\])?
|
||||
|
||||
\s* (
|
||||
@@ -56,12 +55,10 @@ __config_regexp__ = re.compile( r"""
|
||||
""", re.X)
|
||||
__include_regexp__ = re.compile( r"include\s+(.+)" )
|
||||
__require_regexp__ = re.compile( r"require\s+(.+)" )
|
||||
__export_regexp__ = re.compile( r"export\s+([a-zA-Z0-9\-_+.${}/~]+)$" )
|
||||
__unset_regexp__ = re.compile( r"unset\s+([a-zA-Z0-9\-_+.${}/~]+)$" )
|
||||
__unset_flag_regexp__ = re.compile( r"unset\s+([a-zA-Z0-9\-_+.${}/~]+)\[([a-zA-Z0-9\-_+.]+)\]$" )
|
||||
__export_regexp__ = re.compile( r"export\s+([a-zA-Z0-9\-_+.${}/]+)$" )
|
||||
|
||||
def init(data):
|
||||
topdir = data.getVar('TOPDIR', False)
|
||||
topdir = data.getVar('TOPDIR')
|
||||
if not topdir:
|
||||
data.setVar('TOPDIR', os.getcwd())
|
||||
|
||||
@@ -69,51 +66,40 @@ def init(data):
|
||||
def supports(fn, d):
|
||||
return fn[-5:] == ".conf"
|
||||
|
||||
def include(parentfn, fns, lineno, data, error_out):
|
||||
def include(oldfn, fn, lineno, data, error_out):
|
||||
"""
|
||||
error_out: A string indicating the verb (e.g. "include", "inherit") to be
|
||||
used in a ParseError that will be raised if the file to be included could
|
||||
not be included. Specify False to avoid raising an error in this case.
|
||||
"""
|
||||
fns = data.expand(fns)
|
||||
parentfn = data.expand(parentfn)
|
||||
|
||||
# "include" or "require" accept zero to n space-separated file names to include.
|
||||
for fn in fns.split():
|
||||
include_single_file(parentfn, fn, lineno, data, error_out)
|
||||
|
||||
def include_single_file(parentfn, fn, lineno, data, error_out):
|
||||
"""
|
||||
Helper function for include() which does not expand or split its parameters.
|
||||
"""
|
||||
if parentfn == fn: # prevent infinite recursion
|
||||
if oldfn == fn: # prevent infinite recursion
|
||||
return None
|
||||
|
||||
import bb
|
||||
fn = data.expand(fn)
|
||||
oldfn = data.expand(oldfn)
|
||||
|
||||
if not os.path.isabs(fn):
|
||||
dname = os.path.dirname(parentfn)
|
||||
bbpath = "%s:%s" % (dname, data.getVar("BBPATH"))
|
||||
dname = os.path.dirname(oldfn)
|
||||
bbpath = "%s:%s" % (dname, data.getVar("BBPATH", True))
|
||||
abs_fn, attempts = bb.utils.which(bbpath, fn, history=True)
|
||||
if abs_fn and bb.parse.check_dependency(data, abs_fn):
|
||||
logger.warning("Duplicate inclusion for %s in %s" % (abs_fn, data.getVar('FILE')))
|
||||
bb.warn("Duplicate inclusion for %s in %s" % (abs_fn, data.getVar('FILE', True)))
|
||||
for af in attempts:
|
||||
bb.parse.mark_dependency(data, af)
|
||||
if abs_fn:
|
||||
fn = abs_fn
|
||||
elif bb.parse.check_dependency(data, fn):
|
||||
logger.warning("Duplicate inclusion for %s in %s" % (fn, data.getVar('FILE')))
|
||||
bb.warn("Duplicate inclusion for %s in %s" % (fn, data.getVar('FILE', True)))
|
||||
|
||||
from bb.parse import handle
|
||||
try:
|
||||
bb.parse.handle(fn, data, True)
|
||||
except (IOError, OSError) as exc:
|
||||
if exc.errno == errno.ENOENT:
|
||||
if error_out:
|
||||
raise ParseError("Could not %s file %s" % (error_out, fn), parentfn, lineno)
|
||||
logger.debug(2, "CONF file '%s' not found", fn)
|
||||
else:
|
||||
if error_out:
|
||||
raise ParseError("Could not %s file %s: %s" % (error_out, fn, exc.strerror), parentfn, lineno)
|
||||
else:
|
||||
raise ParseError("Error parsing %s: %s" % (fn, exc.strerror), parentfn, lineno)
|
||||
ret = handle(fn, data, True)
|
||||
except (IOError, OSError):
|
||||
if error_out:
|
||||
raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
|
||||
logger.debug(2, "CONF file '%s' not found", fn)
|
||||
bb.parse.mark_dependency(data, fn)
|
||||
|
||||
# We have an issue where a UI might want to enforce particular settings such as
|
||||
# an empty DISTRO variable. If configuration files do something like assigning
|
||||
@@ -129,11 +115,14 @@ def handle(fn, data, include):
|
||||
if include == 0:
|
||||
oldfile = None
|
||||
else:
|
||||
oldfile = data.getVar('FILE', False)
|
||||
oldfile = data.getVar('FILE')
|
||||
|
||||
abs_fn = resolve_file(fn, data)
|
||||
f = open(abs_fn, 'r')
|
||||
|
||||
if include:
|
||||
bb.parse.mark_dependency(data, abs_fn)
|
||||
|
||||
statements = ast.StatementGroup()
|
||||
lineno = 0
|
||||
while True:
|
||||
@@ -192,16 +181,6 @@ def feeder(lineno, s, fn, statements):
|
||||
ast.handleExport(statements, fn, lineno, m)
|
||||
return
|
||||
|
||||
m = __unset_regexp__.match(s)
|
||||
if m:
|
||||
ast.handleUnset(statements, fn, lineno, m)
|
||||
return
|
||||
|
||||
m = __unset_flag_regexp__.match(s)
|
||||
if m:
|
||||
ast.handleUnsetFlag(statements, fn, lineno, m)
|
||||
return
|
||||
|
||||
raise ParseError("unparsed line: '%s'" % s, fn, lineno);
|
||||
|
||||
# Add us to the handlers list
|
||||
|
||||
@@ -28,7 +28,11 @@ import sys
|
||||
import warnings
|
||||
from bb.compat import total_ordering
|
||||
from collections import Mapping
|
||||
import sqlite3
|
||||
|
||||
try:
|
||||
import sqlite3
|
||||
except ImportError:
|
||||
from pysqlite2 import dbapi2 as sqlite3
|
||||
|
||||
sqlversion = sqlite3.sqlite_version_info
|
||||
if sqlversion[0] < 3 or (sqlversion[0] == 3 and sqlversion[1] < 3):
|
||||
@@ -88,9 +92,9 @@ class SQLTable(collections.MutableMapping):
|
||||
self._execute("DELETE from %s where key=?;" % self.table, [key])
|
||||
|
||||
def __setitem__(self, key, value):
|
||||
if not isinstance(key, str):
|
||||
if not isinstance(key, basestring):
|
||||
raise TypeError('Only string keys are supported')
|
||||
elif not isinstance(value, str):
|
||||
elif not isinstance(value, basestring):
|
||||
raise TypeError('Only string values are supported')
|
||||
|
||||
data = self._execute("SELECT * from %s where key=?;" %
|
||||
@@ -174,7 +178,7 @@ class PersistData(object):
|
||||
"""
|
||||
Return a list of key + value pairs for a domain
|
||||
"""
|
||||
return list(self.data[domain].items())
|
||||
return self.data[domain].items()
|
||||
|
||||
def getValue(self, domain, key):
|
||||
"""
|
||||
@@ -197,14 +201,13 @@ class PersistData(object):
|
||||
def connect(database):
|
||||
connection = sqlite3.connect(database, timeout=5, isolation_level=None)
|
||||
connection.execute("pragma synchronous = off;")
|
||||
connection.text_factory = str
|
||||
return connection
|
||||
|
||||
def persist(domain, d):
|
||||
"""Convenience factory for SQLTable objects based upon metadata"""
|
||||
import bb.utils
|
||||
cachedir = (d.getVar("PERSISTENT_DIR") or
|
||||
d.getVar("CACHE"))
|
||||
cachedir = (d.getVar("PERSISTENT_DIR", True) or
|
||||
d.getVar("CACHE", True))
|
||||
if not cachedir:
|
||||
logger.critical("Please set the 'PERSISTENT_DIR' or 'CACHE' variable")
|
||||
sys.exit(1)
|
||||
|
||||
@@ -17,7 +17,7 @@ class CmdError(RuntimeError):
|
||||
self.msg = msg
|
||||
|
||||
def __str__(self):
|
||||
if not isinstance(self.command, str):
|
||||
if not isinstance(self.command, basestring):
|
||||
cmd = subprocess.list2cmdline(self.command)
|
||||
else:
|
||||
cmd = self.command
|
||||
@@ -64,7 +64,7 @@ class Popen(subprocess.Popen):
|
||||
options.update(kwargs)
|
||||
subprocess.Popen.__init__(self, *args, **options)
|
||||
|
||||
def _logged_communicate(pipe, log, input, extrafiles):
|
||||
def _logged_communicate(pipe, log, input):
|
||||
if pipe.stdin:
|
||||
if input is not None:
|
||||
pipe.stdin.write(input)
|
||||
@@ -79,82 +79,40 @@ def _logged_communicate(pipe, log, input, extrafiles):
|
||||
if pipe.stderr is not None:
|
||||
bb.utils.nonblockingfd(pipe.stderr.fileno())
|
||||
rin.append(pipe.stderr)
|
||||
for fobj, _ in extrafiles:
|
||||
bb.utils.nonblockingfd(fobj.fileno())
|
||||
rin.append(fobj)
|
||||
|
||||
def readextras(selected):
|
||||
for fobj, func in extrafiles:
|
||||
if fobj in selected:
|
||||
try:
|
||||
data = fobj.read()
|
||||
except IOError as err:
|
||||
if err.errno == errno.EAGAIN or err.errno == errno.EWOULDBLOCK:
|
||||
data = None
|
||||
if data is not None:
|
||||
func(data)
|
||||
|
||||
def read_all_pipes(log, rin, outdata, errdata):
|
||||
rlist = rin
|
||||
stdoutbuf = b""
|
||||
stderrbuf = b""
|
||||
|
||||
try:
|
||||
r,w,e = select.select (rlist, [], [], 1)
|
||||
except OSError as e:
|
||||
if e.errno != errno.EINTR:
|
||||
raise
|
||||
|
||||
readextras(r)
|
||||
|
||||
if pipe.stdout in r:
|
||||
data = stdoutbuf + pipe.stdout.read()
|
||||
if data is not None and len(data) > 0:
|
||||
try:
|
||||
data = data.decode("utf-8")
|
||||
outdata.append(data)
|
||||
log.write(data)
|
||||
log.flush()
|
||||
stdoutbuf = b""
|
||||
except UnicodeDecodeError:
|
||||
stdoutbuf = data
|
||||
|
||||
if pipe.stderr in r:
|
||||
data = stderrbuf + pipe.stderr.read()
|
||||
if data is not None and len(data) > 0:
|
||||
try:
|
||||
data = data.decode("utf-8")
|
||||
errdata.append(data)
|
||||
log.write(data)
|
||||
log.flush()
|
||||
stderrbuf = b""
|
||||
except UnicodeDecodeError:
|
||||
stderrbuf = data
|
||||
|
||||
try:
|
||||
# Read all pipes while the process is open
|
||||
while pipe.poll() is None:
|
||||
read_all_pipes(log, rin, outdata, errdata)
|
||||
rlist = rin
|
||||
try:
|
||||
r,w,e = select.select (rlist, [], [], 1)
|
||||
except OSError as e:
|
||||
if e.errno != errno.EINTR:
|
||||
raise
|
||||
|
||||
# Pocess closed, drain all pipes...
|
||||
read_all_pipes(log, rin, outdata, errdata)
|
||||
finally:
|
||||
if pipe.stdout in r:
|
||||
data = pipe.stdout.read()
|
||||
if data is not None:
|
||||
outdata.append(data)
|
||||
log.write(data)
|
||||
|
||||
if pipe.stderr in r:
|
||||
data = pipe.stderr.read()
|
||||
if data is not None:
|
||||
errdata.append(data)
|
||||
log.write(data)
|
||||
finally:
|
||||
log.flush()
|
||||
|
||||
if pipe.stdout is not None:
|
||||
pipe.stdout.close()
|
||||
if pipe.stderr is not None:
|
||||
pipe.stderr.close()
|
||||
return ''.join(outdata), ''.join(errdata)
|
||||
|
||||
def run(cmd, input=None, log=None, extrafiles=None, **options):
|
||||
def run(cmd, input=None, log=None, **options):
|
||||
"""Convenience function to run a command and return its output, raising an
|
||||
exception when the command fails"""
|
||||
|
||||
if not extrafiles:
|
||||
extrafiles = []
|
||||
|
||||
if isinstance(cmd, str) and not "shell" in options:
|
||||
if isinstance(cmd, basestring) and not "shell" in options:
|
||||
options["shell"] = True
|
||||
|
||||
try:
|
||||
@@ -166,13 +124,9 @@ def run(cmd, input=None, log=None, extrafiles=None, **options):
|
||||
raise CmdError(cmd, exc)
|
||||
|
||||
if log:
|
||||
stdout, stderr = _logged_communicate(pipe, log, input, extrafiles)
|
||||
stdout, stderr = _logged_communicate(pipe, log, input)
|
||||
else:
|
||||
stdout, stderr = pipe.communicate(input)
|
||||
if not stdout is None:
|
||||
stdout = stdout.decode("utf-8")
|
||||
if not stderr is None:
|
||||
stderr = stderr.decode("utf-8")
|
||||
|
||||
if pipe.returncode != 0:
|
||||
raise ExecutionError(cmd, pipe.returncode, stdout, stderr)
|
||||
|
||||
@@ -1,276 +0,0 @@
|
||||
"""
|
||||
BitBake progress handling code
|
||||
"""
|
||||
|
||||
# Copyright (C) 2016 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import sys
|
||||
import re
|
||||
import time
|
||||
import inspect
|
||||
import bb.event
|
||||
import bb.build
|
||||
|
||||
class ProgressHandler(object):
|
||||
"""
|
||||
Base class that can pretend to be a file object well enough to be
|
||||
used to build objects to intercept console output and determine the
|
||||
progress of some operation.
|
||||
"""
|
||||
def __init__(self, d, outfile=None):
|
||||
self._progress = 0
|
||||
self._data = d
|
||||
self._lastevent = 0
|
||||
if outfile:
|
||||
self._outfile = outfile
|
||||
else:
|
||||
self._outfile = sys.stdout
|
||||
|
||||
def _fire_progress(self, taskprogress, rate=None):
|
||||
"""Internal function to fire the progress event"""
|
||||
bb.event.fire(bb.build.TaskProgress(taskprogress, rate), self._data)
|
||||
|
||||
def write(self, string):
|
||||
self._outfile.write(string)
|
||||
|
||||
def flush(self):
|
||||
self._outfile.flush()
|
||||
|
||||
def update(self, progress, rate=None):
|
||||
ts = time.time()
|
||||
if progress > 100:
|
||||
progress = 100
|
||||
if progress != self._progress or self._lastevent + 1 < ts:
|
||||
self._fire_progress(progress, rate)
|
||||
self._lastevent = ts
|
||||
self._progress = progress
|
||||
|
||||
class LineFilterProgressHandler(ProgressHandler):
|
||||
"""
|
||||
A ProgressHandler variant that provides the ability to filter out
|
||||
the lines if they contain progress information. Additionally, it
|
||||
filters out anything before the last line feed on a line. This can
|
||||
be used to keep the logs clean of output that we've only enabled for
|
||||
getting progress, assuming that that can be done on a per-line
|
||||
basis.
|
||||
"""
|
||||
def __init__(self, d, outfile=None):
|
||||
self._linebuffer = ''
|
||||
super(LineFilterProgressHandler, self).__init__(d, outfile)
|
||||
|
||||
def write(self, string):
|
||||
self._linebuffer += string
|
||||
while True:
|
||||
breakpos = self._linebuffer.find('\n') + 1
|
||||
if breakpos == 0:
|
||||
break
|
||||
line = self._linebuffer[:breakpos]
|
||||
self._linebuffer = self._linebuffer[breakpos:]
|
||||
# Drop any line feeds and anything that precedes them
|
||||
lbreakpos = line.rfind('\r') + 1
|
||||
if lbreakpos:
|
||||
line = line[lbreakpos:]
|
||||
if self.writeline(line):
|
||||
super(LineFilterProgressHandler, self).write(line)
|
||||
|
||||
def writeline(self, line):
|
||||
return True
|
||||
|
||||
class BasicProgressHandler(ProgressHandler):
|
||||
def __init__(self, d, regex=r'(\d+)%', outfile=None):
|
||||
super(BasicProgressHandler, self).__init__(d, outfile)
|
||||
self._regex = re.compile(regex)
|
||||
# Send an initial progress event so the bar gets shown
|
||||
self._fire_progress(0)
|
||||
|
||||
def write(self, string):
|
||||
percs = self._regex.findall(string)
|
||||
if percs:
|
||||
progress = int(percs[-1])
|
||||
self.update(progress)
|
||||
super(BasicProgressHandler, self).write(string)
|
||||
|
||||
class OutOfProgressHandler(ProgressHandler):
|
||||
def __init__(self, d, regex, outfile=None):
|
||||
super(OutOfProgressHandler, self).__init__(d, outfile)
|
||||
self._regex = re.compile(regex)
|
||||
# Send an initial progress event so the bar gets shown
|
||||
self._fire_progress(0)
|
||||
|
||||
def write(self, string):
|
||||
nums = self._regex.findall(string)
|
||||
if nums:
|
||||
progress = (float(nums[-1][0]) / float(nums[-1][1])) * 100
|
||||
self.update(progress)
|
||||
super(OutOfProgressHandler, self).write(string)
|
||||
|
||||
class MultiStageProgressReporter(object):
|
||||
"""
|
||||
Class which allows reporting progress without the caller
|
||||
having to know where they are in the overall sequence. Useful
|
||||
for tasks made up of python code spread across multiple
|
||||
classes / functions - the progress reporter object can
|
||||
be passed around or stored at the object level and calls
|
||||
to next_stage() and update() made whereever needed.
|
||||
"""
|
||||
def __init__(self, d, stage_weights, debug=False):
|
||||
"""
|
||||
Initialise the progress reporter.
|
||||
|
||||
Parameters:
|
||||
* d: the datastore (needed for firing the events)
|
||||
* stage_weights: a list of weight values, one for each stage.
|
||||
The value is scaled internally so you only need to specify
|
||||
values relative to other values in the list, so if there
|
||||
are two stages and the first takes 2s and the second takes
|
||||
10s you would specify [2, 10] (or [1, 5], it doesn't matter).
|
||||
* debug: specify True (and ensure you call finish() at the end)
|
||||
in order to show a printout of the calculated stage weights
|
||||
based on timing each stage. Use this to determine what the
|
||||
weights should be when you're not sure.
|
||||
"""
|
||||
self._data = d
|
||||
total = sum(stage_weights)
|
||||
self._stage_weights = [float(x)/total for x in stage_weights]
|
||||
self._stage = -1
|
||||
self._base_progress = 0
|
||||
# Send an initial progress event so the bar gets shown
|
||||
self._fire_progress(0)
|
||||
self._debug = debug
|
||||
self._finished = False
|
||||
if self._debug:
|
||||
self._last_time = time.time()
|
||||
self._stage_times = []
|
||||
self._stage_total = None
|
||||
self._callers = []
|
||||
|
||||
def _fire_progress(self, taskprogress):
|
||||
bb.event.fire(bb.build.TaskProgress(taskprogress), self._data)
|
||||
|
||||
def next_stage(self, stage_total=None):
|
||||
"""
|
||||
Move to the next stage.
|
||||
Parameters:
|
||||
* stage_total: optional total for progress within the stage,
|
||||
see update() for details
|
||||
NOTE: you need to call this before the first stage.
|
||||
"""
|
||||
self._stage += 1
|
||||
self._stage_total = stage_total
|
||||
if self._stage == 0:
|
||||
# First stage
|
||||
if self._debug:
|
||||
self._last_time = time.time()
|
||||
else:
|
||||
if self._stage < len(self._stage_weights):
|
||||
self._base_progress = sum(self._stage_weights[:self._stage]) * 100
|
||||
if self._debug:
|
||||
currtime = time.time()
|
||||
self._stage_times.append(currtime - self._last_time)
|
||||
self._last_time = currtime
|
||||
self._callers.append(inspect.getouterframes(inspect.currentframe())[1])
|
||||
elif not self._debug:
|
||||
bb.warn('ProgressReporter: current stage beyond declared number of stages')
|
||||
self._base_progress = 100
|
||||
self._fire_progress(self._base_progress)
|
||||
|
||||
def update(self, stage_progress):
|
||||
"""
|
||||
Update progress within the current stage.
|
||||
Parameters:
|
||||
* stage_progress: progress value within the stage. If stage_total
|
||||
was specified when next_stage() was last called, then this
|
||||
value is considered to be out of stage_total, otherwise it should
|
||||
be a percentage value from 0 to 100.
|
||||
"""
|
||||
if self._stage_total:
|
||||
stage_progress = (float(stage_progress) / self._stage_total) * 100
|
||||
if self._stage < 0:
|
||||
bb.warn('ProgressReporter: update called before first call to next_stage()')
|
||||
elif self._stage < len(self._stage_weights):
|
||||
progress = self._base_progress + (stage_progress * self._stage_weights[self._stage])
|
||||
else:
|
||||
progress = self._base_progress
|
||||
if progress > 100:
|
||||
progress = 100
|
||||
self._fire_progress(progress)
|
||||
|
||||
def finish(self):
|
||||
if self._finished:
|
||||
return
|
||||
self._finished = True
|
||||
if self._debug:
|
||||
import math
|
||||
self._stage_times.append(time.time() - self._last_time)
|
||||
mintime = max(min(self._stage_times), 0.01)
|
||||
self._callers.append(None)
|
||||
stage_weights = [int(math.ceil(x / mintime)) for x in self._stage_times]
|
||||
bb.warn('Stage weights: %s' % stage_weights)
|
||||
out = []
|
||||
for stage_weight, caller in zip(stage_weights, self._callers):
|
||||
if caller:
|
||||
out.append('Up to %s:%d: %d' % (caller[1], caller[2], stage_weight))
|
||||
else:
|
||||
out.append('Up to finish: %d' % stage_weight)
|
||||
bb.warn('Stage times:\n %s' % '\n '.join(out))
|
||||
|
||||
class MultiStageProcessProgressReporter(MultiStageProgressReporter):
|
||||
"""
|
||||
Version of MultiStageProgressReporter intended for use with
|
||||
standalone processes (such as preparing the runqueue)
|
||||
"""
|
||||
def __init__(self, d, processname, stage_weights, debug=False):
|
||||
self._processname = processname
|
||||
self._started = False
|
||||
MultiStageProgressReporter.__init__(self, d, stage_weights, debug)
|
||||
|
||||
def start(self):
|
||||
if not self._started:
|
||||
bb.event.fire(bb.event.ProcessStarted(self._processname, 100), self._data)
|
||||
self._started = True
|
||||
|
||||
def _fire_progress(self, taskprogress):
|
||||
if taskprogress == 0:
|
||||
self.start()
|
||||
return
|
||||
bb.event.fire(bb.event.ProcessProgress(self._processname, taskprogress), self._data)
|
||||
|
||||
def finish(self):
|
||||
MultiStageProgressReporter.finish(self)
|
||||
bb.event.fire(bb.event.ProcessFinished(self._processname), self._data)
|
||||
|
||||
class DummyMultiStageProcessProgressReporter(MultiStageProgressReporter):
|
||||
"""
|
||||
MultiStageProcessProgressReporter that takes the calls and does nothing
|
||||
with them (to avoid a bunch of "if progress_reporter:" checks)
|
||||
"""
|
||||
def __init__(self):
|
||||
MultiStageProcessProgressReporter.__init__(self, "", None, [])
|
||||
|
||||
def _fire_progress(self, taskprogress, rate=None):
|
||||
pass
|
||||
|
||||
def start(self):
|
||||
pass
|
||||
|
||||
def next_stage(self, stage_total=None):
|
||||
pass
|
||||
|
||||
def update(self, stage_progress):
|
||||
pass
|
||||
|
||||
def finish(self):
|
||||
pass
|
||||
@@ -48,6 +48,7 @@ def findProviders(cfgData, dataCache, pkg_pn = None):
|
||||
|
||||
# Need to ensure data store is expanded
|
||||
localdata = data.createCopy(cfgData)
|
||||
bb.data.update_data(localdata)
|
||||
bb.data.expandKeys(localdata)
|
||||
|
||||
preferred_versions = {}
|
||||
@@ -120,14 +121,11 @@ def findPreferredProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
|
||||
preferred_file = None
|
||||
preferred_ver = None
|
||||
|
||||
# pn can contain '_', e.g. gcc-cross-x86_64 and an override cannot
|
||||
# hence we do this manually rather than use OVERRIDES
|
||||
preferred_v = cfgData.getVar("PREFERRED_VERSION_pn-%s" % pn)
|
||||
if not preferred_v:
|
||||
preferred_v = cfgData.getVar("PREFERRED_VERSION_%s" % pn)
|
||||
if not preferred_v:
|
||||
preferred_v = cfgData.getVar("PREFERRED_VERSION")
|
||||
localdata = data.createCopy(cfgData)
|
||||
localdata.setVar('OVERRIDES', "%s:pn-%s:%s" % (data.getVar('OVERRIDES', localdata), pn, pn))
|
||||
bb.data.update_data(localdata)
|
||||
|
||||
preferred_v = localdata.getVar('PREFERRED_VERSION', True)
|
||||
if preferred_v:
|
||||
m = re.match('(\d+:)*(.*)(_.*)*', preferred_v)
|
||||
if m:
|
||||
@@ -225,7 +223,7 @@ def findBestProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
|
||||
def _filterProviders(providers, item, cfgData, dataCache):
|
||||
"""
|
||||
Take a list of providers and filter/reorder according to the
|
||||
environment variables
|
||||
environment variables and previous build results
|
||||
"""
|
||||
eligible = []
|
||||
preferred_versions = {}
|
||||
@@ -244,17 +242,17 @@ def _filterProviders(providers, item, cfgData, dataCache):
|
||||
pkg_pn[pn] = []
|
||||
pkg_pn[pn].append(p)
|
||||
|
||||
logger.debug(1, "providers for %s are: %s", item, list(sorted(pkg_pn.keys())))
|
||||
logger.debug(1, "providers for %s are: %s", item, pkg_pn.keys())
|
||||
|
||||
# First add PREFERRED_VERSIONS
|
||||
for pn in sorted(pkg_pn):
|
||||
for pn in pkg_pn:
|
||||
sortpkg_pn[pn] = sortPriorities(pn, dataCache, pkg_pn)
|
||||
preferred_versions[pn] = findPreferredProvider(pn, cfgData, dataCache, sortpkg_pn[pn], item)
|
||||
if preferred_versions[pn][1]:
|
||||
eligible.append(preferred_versions[pn][1])
|
||||
|
||||
# Now add latest versions
|
||||
for pn in sorted(sortpkg_pn):
|
||||
for pn in sortpkg_pn:
|
||||
if pn in preferred_versions and preferred_versions[pn][1]:
|
||||
continue
|
||||
preferred_versions[pn] = findLatestProvider(pn, cfgData, dataCache, sortpkg_pn[pn][0])
|
||||
@@ -282,13 +280,13 @@ def _filterProviders(providers, item, cfgData, dataCache):
|
||||
def filterProviders(providers, item, cfgData, dataCache):
|
||||
"""
|
||||
Take a list of providers and filter/reorder according to the
|
||||
environment variables
|
||||
environment variables and previous build results
|
||||
Takes a "normal" target item
|
||||
"""
|
||||
|
||||
eligible = _filterProviders(providers, item, cfgData, dataCache)
|
||||
|
||||
prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % item)
|
||||
prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % item, True)
|
||||
if prefervar:
|
||||
dataCache.preferred[item] = prefervar
|
||||
|
||||
@@ -310,56 +308,38 @@ def filterProviders(providers, item, cfgData, dataCache):
|
||||
def filterProvidersRunTime(providers, item, cfgData, dataCache):
|
||||
"""
|
||||
Take a list of providers and filter/reorder according to the
|
||||
environment variables
|
||||
environment variables and previous build results
|
||||
Takes a "runtime" target item
|
||||
"""
|
||||
|
||||
eligible = _filterProviders(providers, item, cfgData, dataCache)
|
||||
|
||||
# First try and match any PREFERRED_RPROVIDER entry
|
||||
prefervar = cfgData.getVar('PREFERRED_RPROVIDER_%s' % item)
|
||||
foundUnique = False
|
||||
if prefervar:
|
||||
for p in eligible:
|
||||
pn = dataCache.pkg_fn[p]
|
||||
if prefervar == pn:
|
||||
logger.verbose("selecting %s to satisfy %s due to PREFERRED_RPROVIDER", pn, item)
|
||||
eligible.remove(p)
|
||||
eligible = [p] + eligible
|
||||
foundUnique = True
|
||||
numberPreferred = 1
|
||||
# Should use dataCache.preferred here?
|
||||
preferred = []
|
||||
preferred_vars = []
|
||||
pns = {}
|
||||
for p in eligible:
|
||||
pns[dataCache.pkg_fn[p]] = p
|
||||
for p in eligible:
|
||||
pn = dataCache.pkg_fn[p]
|
||||
provides = dataCache.pn_provides[pn]
|
||||
for provide in provides:
|
||||
prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % provide, True)
|
||||
#logger.debug(1, "checking PREFERRED_PROVIDER_%s (value %s) against %s", provide, prefervar, pns.keys())
|
||||
if prefervar in pns and pns[prefervar] not in preferred:
|
||||
var = "PREFERRED_PROVIDER_%s = %s" % (provide, prefervar)
|
||||
logger.verbose("selecting %s to satisfy runtime %s due to %s", prefervar, item, var)
|
||||
preferred_vars.append(var)
|
||||
pref = pns[prefervar]
|
||||
eligible.remove(pref)
|
||||
eligible = [pref] + eligible
|
||||
preferred.append(pref)
|
||||
break
|
||||
|
||||
# If we didn't find an RPROVIDER entry, try and infer the provider from PREFERRED_PROVIDER entries
|
||||
# by looking through the provides of each eligible recipe and seeing if a PREFERRED_PROVIDER was set.
|
||||
# This is most useful for virtual/ entries rather than having a RPROVIDER per entry.
|
||||
if not foundUnique:
|
||||
# Should use dataCache.preferred here?
|
||||
preferred = []
|
||||
preferred_vars = []
|
||||
pns = {}
|
||||
for p in eligible:
|
||||
pns[dataCache.pkg_fn[p]] = p
|
||||
for p in eligible:
|
||||
pn = dataCache.pkg_fn[p]
|
||||
provides = dataCache.pn_provides[pn]
|
||||
for provide in provides:
|
||||
prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % provide)
|
||||
#logger.debug(1, "checking PREFERRED_PROVIDER_%s (value %s) against %s", provide, prefervar, pns.keys())
|
||||
if prefervar in pns and pns[prefervar] not in preferred:
|
||||
var = "PREFERRED_PROVIDER_%s = %s" % (provide, prefervar)
|
||||
logger.verbose("selecting %s to satisfy runtime %s due to %s", prefervar, item, var)
|
||||
preferred_vars.append(var)
|
||||
pref = pns[prefervar]
|
||||
eligible.remove(pref)
|
||||
eligible = [pref] + eligible
|
||||
preferred.append(pref)
|
||||
break
|
||||
|
||||
numberPreferred = len(preferred)
|
||||
numberPreferred = len(preferred)
|
||||
|
||||
if numberPreferred > 1:
|
||||
logger.error("Trying to resolve runtime dependency %s resulted in conflicting PREFERRED_PROVIDER entries being found.\nThe providers found were: %s\nThe PREFERRED_PROVIDER entries resulting in this conflict were: %s. You could set PREFERRED_RPROVIDER_%s" % (item, preferred, preferred_vars, item))
|
||||
logger.error("Trying to resolve runtime dependency %s resulted in conflicting PREFERRED_PROVIDER entries being found.\nThe providers found were: %s\nThe PREFERRED_PROVIDER entries resulting in this conflict were: %s", item, preferred, preferred_vars)
|
||||
|
||||
logger.debug(1, "sorted runtime providers for %s are: %s", item, eligible)
|
||||
|
||||
@@ -399,32 +379,3 @@ def getRuntimeProviders(dataCache, rdepend):
|
||||
logger.debug(1, "Assuming %s is a dynamic package, but it may not exist" % rdepend)
|
||||
|
||||
return rproviders
|
||||
|
||||
|
||||
def buildWorldTargetList(dataCache, task=None):
|
||||
"""
|
||||
Build package list for "bitbake world"
|
||||
"""
|
||||
if dataCache.world_target:
|
||||
return
|
||||
|
||||
logger.debug(1, "collating packages for \"world\"")
|
||||
for f in dataCache.possible_world:
|
||||
terminal = True
|
||||
pn = dataCache.pkg_fn[f]
|
||||
if task and task not in dataCache.task_deps[f]['tasks']:
|
||||
logger.debug(2, "World build skipping %s as task %s doesn't exist", f, task)
|
||||
terminal = False
|
||||
|
||||
for p in dataCache.pn_provides[pn]:
|
||||
if p.startswith('virtual/'):
|
||||
logger.debug(2, "World build skipping %s due to %s provider starting with virtual/", f, p)
|
||||
terminal = False
|
||||
break
|
||||
for pf in dataCache.providers[p]:
|
||||
if dataCache.pkg_fn[pf] != pn:
|
||||
logger.debug(2, "World build skipping %s due to both us and %s providing %s", f, pf, p)
|
||||
terminal = False
|
||||
break
|
||||
if terminal:
|
||||
dataCache.world_target.add(pn)
|
||||
|
||||
@@ -527,7 +527,7 @@ def utility_sed(name, args, interp, env, stdin, stdout, stderr, debugflags):
|
||||
print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
|
||||
|
||||
# Scan pattern arguments and append a space if necessary
|
||||
for i in range(len(args)):
|
||||
for i in xrange(len(args)):
|
||||
if not RE_SED.search(args[i]):
|
||||
continue
|
||||
args[i] = args[i] + ' '
|
||||
|
||||
@@ -474,7 +474,7 @@ class Environment:
|
||||
"""
|
||||
# Save and remove previous arguments
|
||||
prevargs = []
|
||||
for i in range(int(self._env['#'])):
|
||||
for i in xrange(int(self._env['#'])):
|
||||
i = str(i+1)
|
||||
prevargs.append(self._env[i])
|
||||
del self._env[i]
|
||||
@@ -488,7 +488,7 @@ class Environment:
|
||||
return prevargs
|
||||
|
||||
def get_positional_args(self):
|
||||
return [self._env[str(i+1)] for i in range(int(self._env['#']))]
|
||||
return [self._env[str(i+1)] for i in xrange(int(self._env['#']))]
|
||||
|
||||
def get_variables(self):
|
||||
return dict(self._env)
|
||||
|
||||
@@ -20,7 +20,7 @@ except NameError:
|
||||
from Set import Set as set
|
||||
|
||||
from ply import lex
|
||||
from bb.pysh.sherrors import *
|
||||
from sherrors import *
|
||||
|
||||
class NeedMore(Exception):
|
||||
pass
|
||||
|
||||
@@ -10,11 +10,11 @@
|
||||
import os.path
|
||||
import sys
|
||||
|
||||
import bb.pysh.pyshlex as pyshlex
|
||||
import pyshlex
|
||||
tokens = pyshlex.tokens
|
||||
|
||||
from ply import yacc
|
||||
import bb.pysh.sherrors as sherrors
|
||||
import sherrors
|
||||
|
||||
class IORedirect:
|
||||
def __init__(self, op, filename, io_number=None):
|
||||
|
||||
@@ -1,116 +0,0 @@
|
||||
"""
|
||||
BitBake 'remotedata' module
|
||||
|
||||
Provides support for using a datastore from the bitbake client
|
||||
"""
|
||||
|
||||
# Copyright (C) 2016 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import bb.data
|
||||
|
||||
class RemoteDatastores:
|
||||
"""Used on the server side to manage references to server-side datastores"""
|
||||
def __init__(self, cooker):
|
||||
self.cooker = cooker
|
||||
self.datastores = {}
|
||||
self.locked = []
|
||||
self.nextindex = 1
|
||||
|
||||
def __len__(self):
|
||||
return len(self.datastores)
|
||||
|
||||
def __getitem__(self, key):
|
||||
if key is None:
|
||||
return self.cooker.data
|
||||
else:
|
||||
return self.datastores[key]
|
||||
|
||||
def items(self):
|
||||
return self.datastores.items()
|
||||
|
||||
def store(self, d, locked=False):
|
||||
"""
|
||||
Put a datastore into the collection. If locked=True then the datastore
|
||||
is understood to be managed externally and cannot be released by calling
|
||||
release().
|
||||
"""
|
||||
idx = self.nextindex
|
||||
self.datastores[idx] = d
|
||||
if locked:
|
||||
self.locked.append(idx)
|
||||
self.nextindex += 1
|
||||
return idx
|
||||
|
||||
def check_store(self, d, locked=False):
|
||||
"""
|
||||
Put a datastore into the collection if it's not already in there;
|
||||
in either case return the index
|
||||
"""
|
||||
for key, val in self.datastores.items():
|
||||
if val is d:
|
||||
idx = key
|
||||
break
|
||||
else:
|
||||
idx = self.store(d, locked)
|
||||
return idx
|
||||
|
||||
def release(self, idx):
|
||||
"""Discard a datastore in the collection"""
|
||||
if idx in self.locked:
|
||||
raise Exception('Tried to release locked datastore %d' % idx)
|
||||
del self.datastores[idx]
|
||||
|
||||
def receive_datastore(self, remote_data):
|
||||
"""Receive a datastore object sent from the client (as prepared by transmit_datastore())"""
|
||||
dct = dict(remote_data)
|
||||
d = bb.data_smart.DataSmart()
|
||||
d.dict = dct
|
||||
while True:
|
||||
if '_remote_data' in dct:
|
||||
dsindex = dct['_remote_data']['_content']
|
||||
del dct['_remote_data']
|
||||
if dsindex is None:
|
||||
dct['_data'] = self.cooker.data.dict
|
||||
else:
|
||||
dct['_data'] = self.datastores[dsindex].dict
|
||||
break
|
||||
elif '_data' in dct:
|
||||
idct = dict(dct['_data'])
|
||||
dct['_data'] = idct
|
||||
dct = idct
|
||||
else:
|
||||
break
|
||||
return d
|
||||
|
||||
@staticmethod
|
||||
def transmit_datastore(d):
|
||||
"""Prepare a datastore object for sending over IPC from the client end"""
|
||||
# FIXME content might be a dict, need to turn that into a list as well
|
||||
def copy_dicts(dct):
|
||||
if '_remote_data' in dct:
|
||||
dsindex = dct['_remote_data']['_content'].dsindex
|
||||
newdct = dct.copy()
|
||||
newdct['_remote_data'] = {'_content': dsindex}
|
||||
return list(newdct.items())
|
||||
elif '_data' in dct:
|
||||
newdct = dct.copy()
|
||||
newdata = copy_dicts(dct['_data'])
|
||||
if newdata:
|
||||
newdct['_data'] = newdata
|
||||
return list(newdct.items())
|
||||
return None
|
||||
main_dict = copy_dicts(d.dict)
|
||||
return main_dict
|
||||
File diff suppressed because it is too large
Load Diff
@@ -18,4 +18,79 @@
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
""" Base code for Bitbake server process
|
||||
|
||||
Have a common base for that all Bitbake server classes ensures a consistent
|
||||
approach to the interface, and minimize risks associated with code duplication.
|
||||
|
||||
"""
|
||||
|
||||
""" BaseImplServer() the base class for all XXServer() implementations.
|
||||
|
||||
These classes contain the actual code that runs the server side, i.e.
|
||||
listens for the commands and executes them. Although these implementations
|
||||
contain all the data of the original bitbake command, i.e the cooker instance,
|
||||
they may well run on a different process or even machine.
|
||||
|
||||
"""
|
||||
|
||||
class BaseImplServer():
|
||||
def __init__(self):
|
||||
self._idlefuns = {}
|
||||
|
||||
def addcooker(self, cooker):
|
||||
self.cooker = cooker
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
"""Register a function to be called while the server is idle"""
|
||||
assert hasattr(function, '__call__')
|
||||
self._idlefuns[function] = data
|
||||
|
||||
|
||||
|
||||
""" BitBakeBaseServerConnection class is the common ancestor to all
|
||||
BitBakeServerConnection classes.
|
||||
|
||||
These classes control the remote server. The only command currently
|
||||
implemented is the terminate() command.
|
||||
|
||||
"""
|
||||
|
||||
class BitBakeBaseServerConnection():
|
||||
def __init__(self, serverImpl):
|
||||
pass
|
||||
|
||||
def terminate(self):
|
||||
pass
|
||||
|
||||
|
||||
""" BitBakeBaseServer class is the common ancestor to all Bitbake servers
|
||||
|
||||
Derive this class in order to implement a BitBakeServer which is the
|
||||
controlling stub for the actual server implementation
|
||||
|
||||
"""
|
||||
class BitBakeBaseServer(object):
|
||||
def initServer(self):
|
||||
self.serverImpl = None # we ensure a runtime crash if not overloaded
|
||||
self.connection = None
|
||||
return
|
||||
|
||||
def addcooker(self, cooker):
|
||||
self.cooker = cooker
|
||||
self.serverImpl.addcooker(cooker)
|
||||
|
||||
def getServerIdleCB(self):
|
||||
return self.serverImpl.register_idle_function
|
||||
|
||||
def saveConnectionDetails(self):
|
||||
return
|
||||
|
||||
def detach(self):
|
||||
return
|
||||
|
||||
def establishConnection(self, featureset):
|
||||
raise "Must redefine the %s.establishConnection()" % self.__class__.__name__
|
||||
|
||||
def endSession(self):
|
||||
self.connection.terminate()
|
||||
|
||||
@@ -22,268 +22,112 @@
|
||||
|
||||
import bb
|
||||
import bb.event
|
||||
import itertools
|
||||
import logging
|
||||
import multiprocessing
|
||||
import threading
|
||||
import array
|
||||
import os
|
||||
import signal
|
||||
import sys
|
||||
import time
|
||||
import select
|
||||
import socket
|
||||
import subprocess
|
||||
import errno
|
||||
import re
|
||||
import datetime
|
||||
import bb.server.xmlrpcserver
|
||||
from bb import daemonize
|
||||
from multiprocessing import queues
|
||||
from Queue import Empty
|
||||
from multiprocessing import Event, Process, util, Queue, Pipe, queues, Manager
|
||||
|
||||
from . import BitBakeBaseServer, BitBakeBaseServerConnection, BaseImplServer
|
||||
|
||||
logger = logging.getLogger('BitBake')
|
||||
|
||||
class ProcessTimeout(SystemExit):
|
||||
pass
|
||||
class ServerCommunicator():
|
||||
def __init__(self, connection, event_handle, server):
|
||||
self.connection = connection
|
||||
self.event_handle = event_handle
|
||||
self.server = server
|
||||
|
||||
class ProcessServer(multiprocessing.Process):
|
||||
def runCommand(self, command):
|
||||
# @todo try/except
|
||||
self.connection.send(command)
|
||||
|
||||
if not self.server.is_alive():
|
||||
raise SystemExit
|
||||
|
||||
while True:
|
||||
# don't let the user ctrl-c while we're waiting for a response
|
||||
try:
|
||||
if self.connection.poll(20):
|
||||
return self.connection.recv()
|
||||
else:
|
||||
bb.fatal("Timeout while attempting to communicate with bitbake server")
|
||||
except KeyboardInterrupt:
|
||||
pass
|
||||
|
||||
def getEventHandle(self):
|
||||
return self.event_handle.value
|
||||
|
||||
class EventAdapter():
|
||||
"""
|
||||
Adapter to wrap our event queue since the caller (bb.event) expects to
|
||||
call a send() method, but our actual queue only has put()
|
||||
"""
|
||||
def __init__(self, queue):
|
||||
self.queue = queue
|
||||
|
||||
def send(self, event):
|
||||
try:
|
||||
self.queue.put(event)
|
||||
except Exception as err:
|
||||
print("EventAdapter puked: %s" % str(err))
|
||||
|
||||
|
||||
class ProcessServer(Process, BaseImplServer):
|
||||
profile_filename = "profile.log"
|
||||
profile_processed_filename = "profile.log.processed"
|
||||
|
||||
def __init__(self, lock, sock, sockname):
|
||||
multiprocessing.Process.__init__(self)
|
||||
self.command_channel = False
|
||||
self.command_channel_reply = False
|
||||
def __init__(self, command_channel, event_queue, featurelist):
|
||||
BaseImplServer.__init__(self)
|
||||
Process.__init__(self)
|
||||
self.command_channel = command_channel
|
||||
self.event_queue = event_queue
|
||||
self.event = EventAdapter(event_queue)
|
||||
self.featurelist = featurelist
|
||||
self.quit = False
|
||||
self.heartbeat_seconds = 1 # default, BB_HEARTBEAT_EVENT will be checked once we have a datastore.
|
||||
self.next_heartbeat = time.time()
|
||||
|
||||
self.event_handle = None
|
||||
self.haveui = False
|
||||
self.lastui = False
|
||||
self.xmlrpc = False
|
||||
|
||||
self._idlefuns = {}
|
||||
|
||||
self.bitbake_lock = lock
|
||||
self.sock = sock
|
||||
self.sockname = sockname
|
||||
|
||||
def register_idle_function(self, function, data):
|
||||
"""Register a function to be called while the server is idle"""
|
||||
assert hasattr(function, '__call__')
|
||||
self._idlefuns[function] = data
|
||||
self.quitin, self.quitout = Pipe()
|
||||
self.event_handle = multiprocessing.Value("i")
|
||||
|
||||
def run(self):
|
||||
for event in bb.event.ui_queue:
|
||||
self.event_queue.put(event)
|
||||
self.event_handle.value = bb.event.register_UIHhandler(self)
|
||||
|
||||
if self.xmlrpcinterface[0]:
|
||||
self.xmlrpc = bb.server.xmlrpcserver.BitBakeXMLRPCServer(self.xmlrpcinterface, self.cooker, self)
|
||||
|
||||
print("Bitbake XMLRPC server address: %s, server port: %s" % (self.xmlrpc.host, self.xmlrpc.port))
|
||||
|
||||
heartbeat_event = self.cooker.data.getVar('BB_HEARTBEAT_EVENT')
|
||||
if heartbeat_event:
|
||||
try:
|
||||
self.heartbeat_seconds = float(heartbeat_event)
|
||||
except:
|
||||
bb.warn('Ignoring invalid BB_HEARTBEAT_EVENT=%s, must be a float specifying seconds.' % heartbeat_event)
|
||||
|
||||
self.timeout = self.server_timeout or self.cooker.data.getVar('BB_SERVER_TIMEOUT')
|
||||
try:
|
||||
if self.timeout:
|
||||
self.timeout = float(self.timeout)
|
||||
except:
|
||||
bb.warn('Ignoring invalid BB_SERVER_TIMEOUT=%s, must be a float specifying seconds.' % self.timeout)
|
||||
|
||||
|
||||
try:
|
||||
self.bitbake_lock.seek(0)
|
||||
self.bitbake_lock.truncate()
|
||||
if self.xmlrpc:
|
||||
self.bitbake_lock.write("%s %s:%s\n" % (os.getpid(), self.xmlrpc.host, self.xmlrpc.port))
|
||||
else:
|
||||
self.bitbake_lock.write("%s\n" % (os.getpid()))
|
||||
self.bitbake_lock.flush()
|
||||
except Exception as e:
|
||||
print("Error writing to lock file: %s" % str(e))
|
||||
pass
|
||||
|
||||
if self.cooker.configuration.profile:
|
||||
try:
|
||||
import cProfile as profile
|
||||
except:
|
||||
import profile
|
||||
prof = profile.Profile()
|
||||
|
||||
ret = profile.Profile.runcall(prof, self.main)
|
||||
|
||||
prof.dump_stats("profile.log")
|
||||
bb.utils.process_profilelog("profile.log")
|
||||
print("Raw profiling information saved to profile.log and processed statistics to profile.log.processed")
|
||||
|
||||
else:
|
||||
ret = self.main()
|
||||
|
||||
return ret
|
||||
bb.cooker.server_main(self.cooker, self.main)
|
||||
|
||||
def main(self):
|
||||
self.cooker.pre_serve()
|
||||
|
||||
bb.utils.set_process_name("Cooker")
|
||||
|
||||
ready = []
|
||||
newconnections = []
|
||||
|
||||
self.controllersock = False
|
||||
fds = [self.sock]
|
||||
if self.xmlrpc:
|
||||
fds.append(self.xmlrpc)
|
||||
print("Entering server connection loop")
|
||||
|
||||
def disconnect_client(self, fds):
|
||||
print("Disconnecting Client")
|
||||
if self.controllersock:
|
||||
fds.remove(self.controllersock)
|
||||
self.controllersock.close()
|
||||
self.controllersock = False
|
||||
if self.haveui:
|
||||
fds.remove(self.command_channel)
|
||||
bb.event.unregister_UIHhandler(self.event_handle, True)
|
||||
self.command_channel_reply.writer.close()
|
||||
self.event_writer.writer.close()
|
||||
self.command_channel.close()
|
||||
self.command_channel = False
|
||||
del self.event_writer
|
||||
self.lastui = time.time()
|
||||
self.cooker.clientComplete()
|
||||
self.haveui = False
|
||||
ready = select.select(fds,[],[],0)[0]
|
||||
if newconnections:
|
||||
print("Starting new client")
|
||||
conn = newconnections.pop(-1)
|
||||
fds.append(conn)
|
||||
self.controllersock = conn
|
||||
elif self.timeout is None and not ready:
|
||||
print("No timeout, exiting.")
|
||||
self.quit = True
|
||||
|
||||
# Ignore SIGINT within the server, as all SIGINT handling is done by
|
||||
# the UI and communicated to us
|
||||
self.quitin.close()
|
||||
signal.signal(signal.SIGINT, signal.SIG_IGN)
|
||||
while not self.quit:
|
||||
if self.sock in ready:
|
||||
while select.select([self.sock],[],[],0)[0]:
|
||||
controllersock, address = self.sock.accept()
|
||||
if self.controllersock:
|
||||
print("Queuing %s (%s)" % (str(ready), str(newconnections)))
|
||||
newconnections.append(controllersock)
|
||||
else:
|
||||
print("Accepting %s (%s)" % (str(ready), str(newconnections)))
|
||||
self.controllersock = controllersock
|
||||
fds.append(controllersock)
|
||||
if self.controllersock in ready:
|
||||
try:
|
||||
print("Processing Client")
|
||||
ui_fds = recvfds(self.controllersock, 3)
|
||||
print("Connecting Client")
|
||||
|
||||
# Where to write events to
|
||||
writer = ConnectionWriter(ui_fds[0])
|
||||
self.event_handle = bb.event.register_UIHhandler(writer, True)
|
||||
self.event_writer = writer
|
||||
|
||||
# Where to read commands from
|
||||
reader = ConnectionReader(ui_fds[1])
|
||||
fds.append(reader)
|
||||
self.command_channel = reader
|
||||
|
||||
# Where to send command return values to
|
||||
writer = ConnectionWriter(ui_fds[2])
|
||||
self.command_channel_reply = writer
|
||||
|
||||
self.haveui = True
|
||||
|
||||
except (EOFError, OSError):
|
||||
disconnect_client(self, fds)
|
||||
|
||||
if not self.timeout == -1.0 and not self.haveui and self.lastui and self.timeout and \
|
||||
(self.lastui + self.timeout) < time.time():
|
||||
print("Server timeout, exiting.")
|
||||
self.quit = True
|
||||
|
||||
if self.command_channel in ready:
|
||||
try:
|
||||
command = self.command_channel.get()
|
||||
except EOFError:
|
||||
# Client connection shutting down
|
||||
ready = []
|
||||
disconnect_client(self, fds)
|
||||
continue
|
||||
if command[0] == "terminateServer":
|
||||
try:
|
||||
if self.command_channel.poll():
|
||||
command = self.command_channel.recv()
|
||||
self.runCommand(command)
|
||||
if self.quitout.poll():
|
||||
self.quitout.recv()
|
||||
self.quit = True
|
||||
continue
|
||||
try:
|
||||
print("Running command %s" % command)
|
||||
self.command_channel_reply.send(self.cooker.command.runCommand(command))
|
||||
except Exception as e:
|
||||
logger.exception('Exception in server main event loop running command %s (%s)' % (command, str(e)))
|
||||
|
||||
if self.xmlrpc in ready:
|
||||
self.xmlrpc.handle_requests()
|
||||
self.idle_commands(.1, [self.event_queue._reader, self.command_channel, self.quitout])
|
||||
except Exception:
|
||||
logger.exception('Running command %s', command)
|
||||
|
||||
ready = self.idle_commands(.1, fds)
|
||||
self.event_queue.close()
|
||||
bb.event.unregister_UIHhandler(self.event_handle.value)
|
||||
self.command_channel.close()
|
||||
self.cooker.shutdown(True)
|
||||
|
||||
print("Exiting")
|
||||
# Remove the socket file so we don't get any more connections to avoid races
|
||||
os.unlink(self.sockname)
|
||||
self.sock.close()
|
||||
|
||||
try:
|
||||
self.cooker.shutdown(True)
|
||||
self.cooker.notifier.stop()
|
||||
self.cooker.confignotifier.stop()
|
||||
except:
|
||||
pass
|
||||
|
||||
self.cooker.post_serve()
|
||||
|
||||
# Finally release the lockfile but warn about other processes holding it open
|
||||
lock = self.bitbake_lock
|
||||
lockfile = lock.name
|
||||
lock.close()
|
||||
lock = None
|
||||
|
||||
while not lock:
|
||||
with bb.utils.timeout(3):
|
||||
lock = bb.utils.lockfile(lockfile, shared=False, retry=False, block=True)
|
||||
if lock:
|
||||
# We hold the lock so we can remove the file (hide stale pid data)
|
||||
bb.utils.remove(lockfile)
|
||||
bb.utils.unlockfile(lock)
|
||||
return
|
||||
|
||||
if not lock:
|
||||
# Some systems may not have lsof available
|
||||
procs = None
|
||||
try:
|
||||
procs = subprocess.check_output(["lsof", '-w', lockfile], stderr=subprocess.STDOUT)
|
||||
except OSError as e:
|
||||
if e.errno != errno.ENOENT:
|
||||
raise
|
||||
if procs is None:
|
||||
# Fall back to fuser if lsof is unavailable
|
||||
try:
|
||||
procs = subprocess.check_output(["fuser", '-v', lockfile], stderr=subprocess.STDOUT)
|
||||
except OSError as e:
|
||||
if e.errno != errno.ENOENT:
|
||||
raise
|
||||
|
||||
msg = "Delaying shutdown due to active processes which appear to be holding bitbake.lock"
|
||||
if procs:
|
||||
msg += ":\n%s" % str(procs)
|
||||
print(msg)
|
||||
|
||||
def idle_commands(self, delay, fds=None):
|
||||
def idle_commands(self, delay, fds = []):
|
||||
nextsleep = delay
|
||||
if not fds:
|
||||
fds = []
|
||||
|
||||
for function, data in list(self._idlefuns.items()):
|
||||
for function, data in self._idlefuns.items():
|
||||
try:
|
||||
retval = function(self, data, False)
|
||||
if retval is False:
|
||||
@@ -291,7 +135,7 @@ class ProcessServer(multiprocessing.Process):
|
||||
nextsleep = None
|
||||
elif retval is True:
|
||||
nextsleep = None
|
||||
elif isinstance(retval, float) and nextsleep:
|
||||
elif isinstance(retval, float):
|
||||
if (retval < nextsleep):
|
||||
nextsleep = retval
|
||||
elif nextsleep is None:
|
||||
@@ -300,365 +144,109 @@ class ProcessServer(multiprocessing.Process):
|
||||
fds = fds + retval
|
||||
except SystemExit:
|
||||
raise
|
||||
except Exception as exc:
|
||||
if not isinstance(exc, bb.BBHandledException):
|
||||
logger.exception('Running idle function')
|
||||
except Exception:
|
||||
logger.exception('Running idle function')
|
||||
del self._idlefuns[function]
|
||||
self.quit = True
|
||||
|
||||
# Create new heartbeat event?
|
||||
now = time.time()
|
||||
if now >= self.next_heartbeat:
|
||||
# We might have missed heartbeats. Just trigger once in
|
||||
# that case and continue after the usual delay.
|
||||
self.next_heartbeat += self.heartbeat_seconds
|
||||
if self.next_heartbeat <= now:
|
||||
self.next_heartbeat = now + self.heartbeat_seconds
|
||||
heartbeat = bb.event.HeartbeatEvent(now)
|
||||
bb.event.fire(heartbeat, self.cooker.data)
|
||||
if nextsleep and now + nextsleep > self.next_heartbeat:
|
||||
# Shorten timeout so that we we wake up in time for
|
||||
# the heartbeat.
|
||||
nextsleep = self.next_heartbeat - now
|
||||
|
||||
if nextsleep is not None:
|
||||
if self.xmlrpc:
|
||||
nextsleep = self.xmlrpc.get_timeout(nextsleep)
|
||||
try:
|
||||
return select.select(fds,[],[],nextsleep)[0]
|
||||
except InterruptedError:
|
||||
# Ignore EINTR
|
||||
return []
|
||||
else:
|
||||
return select.select(fds,[],[],0)[0]
|
||||
|
||||
|
||||
class ServerCommunicator():
|
||||
def __init__(self, connection, recv):
|
||||
self.connection = connection
|
||||
self.recv = recv
|
||||
select.select(fds,[],[],nextsleep)
|
||||
|
||||
def runCommand(self, command):
|
||||
self.connection.send(command)
|
||||
if not self.recv.poll(30):
|
||||
raise ProcessTimeout("Timeout while waiting for a reply from the bitbake server")
|
||||
return self.recv.get()
|
||||
"""
|
||||
Run a cooker command on the server
|
||||
"""
|
||||
self.command_channel.send(self.cooker.command.runCommand(command))
|
||||
|
||||
def updateFeatureSet(self, featureset):
|
||||
_, error = self.runCommand(["setFeatures", featureset])
|
||||
def stop(self):
|
||||
self.quitin.send("quit")
|
||||
self.quitin.close()
|
||||
|
||||
class BitBakeProcessServerConnection(BitBakeBaseServerConnection):
|
||||
def __init__(self, serverImpl, ui_channel, event_queue):
|
||||
self.procserver = serverImpl
|
||||
self.ui_channel = ui_channel
|
||||
self.event_queue = event_queue
|
||||
self.connection = ServerCommunicator(self.ui_channel, self.procserver.event_handle, self.procserver)
|
||||
self.events = self.event_queue
|
||||
|
||||
def sigterm_terminate(self):
|
||||
bb.error("UI received SIGTERM")
|
||||
self.terminate()
|
||||
|
||||
def terminate(self):
|
||||
def flushevents():
|
||||
while True:
|
||||
try:
|
||||
event = self.event_queue.get(block=False)
|
||||
except (Empty, IOError):
|
||||
break
|
||||
if isinstance(event, logging.LogRecord):
|
||||
logger.handle(event)
|
||||
|
||||
signal.signal(signal.SIGINT, signal.SIG_IGN)
|
||||
self.procserver.stop()
|
||||
|
||||
while self.procserver.is_alive():
|
||||
flushevents()
|
||||
self.procserver.join(0.1)
|
||||
|
||||
self.ui_channel.close()
|
||||
self.event_queue.close()
|
||||
self.event_queue.setexit()
|
||||
|
||||
# Wrap Queue to provide API which isn't server implementation specific
|
||||
class ProcessEventQueue(multiprocessing.queues.Queue):
|
||||
def __init__(self, maxsize):
|
||||
multiprocessing.queues.Queue.__init__(self, maxsize)
|
||||
self.exit = False
|
||||
|
||||
def setexit(self):
|
||||
self.exit = True
|
||||
|
||||
def waitEvent(self, timeout):
|
||||
if self.exit:
|
||||
sys.exit(1)
|
||||
try:
|
||||
if not self.server.is_alive():
|
||||
self.setexit()
|
||||
return None
|
||||
return self.get(True, timeout)
|
||||
except Empty:
|
||||
return None
|
||||
|
||||
def getEvent(self):
|
||||
try:
|
||||
if not self.server.is_alive():
|
||||
self.setexit()
|
||||
return None
|
||||
return self.get(False)
|
||||
except Empty:
|
||||
return None
|
||||
|
||||
|
||||
class BitBakeServer(BitBakeBaseServer):
|
||||
def initServer(self):
|
||||
# establish communication channels. We use bidirectional pipes for
|
||||
# ui <--> server command/response pairs
|
||||
# and a queue for server -> ui event notifications
|
||||
#
|
||||
self.ui_channel, self.server_channel = Pipe()
|
||||
self.event_queue = ProcessEventQueue(0)
|
||||
self.serverImpl = ProcessServer(self.server_channel, self.event_queue, None)
|
||||
self.event_queue.server = self.serverImpl
|
||||
|
||||
def detach(self):
|
||||
self.serverImpl.start()
|
||||
return
|
||||
|
||||
def establishConnection(self, featureset):
|
||||
|
||||
self.connection = BitBakeProcessServerConnection(self.serverImpl, self.ui_channel, self.event_queue)
|
||||
|
||||
_, error = self.connection.connection.runCommand(["setFeatures", featureset])
|
||||
if error:
|
||||
logger.error("Unable to set the cooker to the correct featureset: %s" % error)
|
||||
raise BaseException(error)
|
||||
|
||||
def getEventHandle(self):
|
||||
handle, error = self.runCommand(["getUIHandlerNum"])
|
||||
if error:
|
||||
logger.error("Unable to get UI Handler Number: %s" % error)
|
||||
raise BaseException(error)
|
||||
|
||||
return handle
|
||||
|
||||
def terminateServer(self):
|
||||
self.connection.send(['terminateServer'])
|
||||
return
|
||||
|
||||
class BitBakeProcessServerConnection(object):
|
||||
def __init__(self, ui_channel, recv, eq, sock):
|
||||
self.connection = ServerCommunicator(ui_channel, recv)
|
||||
self.events = eq
|
||||
# Save sock so it doesn't get gc'd for the life of our connection
|
||||
self.socket_connection = sock
|
||||
|
||||
def terminate(self):
|
||||
self.socket_connection.close()
|
||||
self.connection.connection.close()
|
||||
self.connection.recv.close()
|
||||
return
|
||||
|
||||
class BitBakeServer(object):
|
||||
start_log_format = '--- Starting bitbake server pid %s at %s ---'
|
||||
start_log_datetime_format = '%Y-%m-%d %H:%M:%S.%f'
|
||||
|
||||
def __init__(self, lock, sockname, configuration, featureset):
|
||||
|
||||
self.configuration = configuration
|
||||
self.featureset = featureset
|
||||
self.sockname = sockname
|
||||
self.bitbake_lock = lock
|
||||
self.readypipe, self.readypipein = os.pipe()
|
||||
|
||||
# Create server control socket
|
||||
if os.path.exists(sockname):
|
||||
os.unlink(sockname)
|
||||
|
||||
self.sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM)
|
||||
# AF_UNIX has path length issues so chdir here to workaround
|
||||
cwd = os.getcwd()
|
||||
logfile = os.path.join(cwd, "bitbake-cookerdaemon.log")
|
||||
|
||||
try:
|
||||
os.chdir(os.path.dirname(sockname))
|
||||
self.sock.bind(os.path.basename(sockname))
|
||||
finally:
|
||||
os.chdir(cwd)
|
||||
self.sock.listen(1)
|
||||
|
||||
os.set_inheritable(self.sock.fileno(), True)
|
||||
startdatetime = datetime.datetime.now()
|
||||
bb.daemonize.createDaemon(self._startServer, logfile)
|
||||
self.sock.close()
|
||||
self.bitbake_lock.close()
|
||||
|
||||
ready = ConnectionReader(self.readypipe)
|
||||
r = ready.poll(5)
|
||||
if not r:
|
||||
bb.note("Bitbake server didn't start within 5 seconds, waiting for 90")
|
||||
r = ready.poll(90)
|
||||
if r:
|
||||
r = ready.get()
|
||||
if not r or r != "ready":
|
||||
ready.close()
|
||||
bb.error("Unable to start bitbake server")
|
||||
if os.path.exists(logfile):
|
||||
logstart_re = re.compile(self.start_log_format % ('([0-9]+)', '([0-9-]+ [0-9:.]+)'))
|
||||
started = False
|
||||
lines = []
|
||||
lastlines = []
|
||||
with open(logfile, "r") as f:
|
||||
for line in f:
|
||||
if started:
|
||||
lines.append(line)
|
||||
else:
|
||||
lastlines.append(line)
|
||||
res = logstart_re.match(line.rstrip())
|
||||
if res:
|
||||
ldatetime = datetime.datetime.strptime(res.group(2), self.start_log_datetime_format)
|
||||
if ldatetime >= startdatetime:
|
||||
started = True
|
||||
lines.append(line)
|
||||
if len(lastlines) > 60:
|
||||
lastlines = lastlines[-60:]
|
||||
if lines:
|
||||
if len(lines) > 60:
|
||||
bb.error("Last 60 lines of server log for this session (%s):\n%s" % (logfile, "".join(lines[-60:])))
|
||||
else:
|
||||
bb.error("Server log for this session (%s):\n%s" % (logfile, "".join(lines)))
|
||||
elif lastlines:
|
||||
bb.error("Server didn't start, last 60 loglines (%s):\n%s" % (logfile, "".join(lastlines)))
|
||||
else:
|
||||
bb.error("%s doesn't exist" % logfile)
|
||||
|
||||
raise SystemExit(1)
|
||||
|
||||
ready.close()
|
||||
os.close(self.readypipein)
|
||||
|
||||
def _startServer(self):
|
||||
print(self.start_log_format % (os.getpid(), datetime.datetime.now().strftime(self.start_log_datetime_format)))
|
||||
sys.stdout.flush()
|
||||
|
||||
server = ProcessServer(self.bitbake_lock, self.sock, self.sockname)
|
||||
self.configuration.setServerRegIdleCallback(server.register_idle_function)
|
||||
writer = ConnectionWriter(self.readypipein)
|
||||
try:
|
||||
self.cooker = bb.cooker.BBCooker(self.configuration, self.featureset)
|
||||
writer.send("ready")
|
||||
except:
|
||||
writer.send("fail")
|
||||
raise
|
||||
finally:
|
||||
os.close(self.readypipein)
|
||||
server.cooker = self.cooker
|
||||
server.server_timeout = self.configuration.server_timeout
|
||||
server.xmlrpcinterface = self.configuration.xmlrpcinterface
|
||||
print("Started bitbake server pid %d" % os.getpid())
|
||||
sys.stdout.flush()
|
||||
|
||||
server.start()
|
||||
|
||||
def connectProcessServer(sockname, featureset):
|
||||
# Connect to socket
|
||||
sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM)
|
||||
# AF_UNIX has path length issues so chdir here to workaround
|
||||
cwd = os.getcwd()
|
||||
|
||||
readfd = writefd = readfd1 = writefd1 = readfd2 = writefd2 = None
|
||||
eq = command_chan_recv = command_chan = None
|
||||
|
||||
sock.settimeout(10)
|
||||
|
||||
try:
|
||||
try:
|
||||
os.chdir(os.path.dirname(sockname))
|
||||
finished = False
|
||||
while not finished:
|
||||
try:
|
||||
sock.connect(os.path.basename(sockname))
|
||||
finished = True
|
||||
except IOError as e:
|
||||
if e.errno == errno.EWOULDBLOCK:
|
||||
pass
|
||||
finally:
|
||||
os.chdir(cwd)
|
||||
|
||||
# Send an fd for the remote to write events to
|
||||
readfd, writefd = os.pipe()
|
||||
eq = BBUIEventQueue(readfd)
|
||||
# Send an fd for the remote to recieve commands from
|
||||
readfd1, writefd1 = os.pipe()
|
||||
command_chan = ConnectionWriter(writefd1)
|
||||
# Send an fd for the remote to write commands results to
|
||||
readfd2, writefd2 = os.pipe()
|
||||
command_chan_recv = ConnectionReader(readfd2)
|
||||
|
||||
sendfds(sock, [writefd, readfd1, writefd2])
|
||||
|
||||
server_connection = BitBakeProcessServerConnection(command_chan, command_chan_recv, eq, sock)
|
||||
|
||||
# Close the ends of the pipes we won't use
|
||||
for i in [writefd, readfd1, writefd2]:
|
||||
os.close(i)
|
||||
|
||||
server_connection.connection.updateFeatureSet(featureset)
|
||||
|
||||
except (Exception, SystemExit) as e:
|
||||
if command_chan_recv:
|
||||
command_chan_recv.close()
|
||||
if command_chan:
|
||||
command_chan.close()
|
||||
for i in [writefd, readfd1, writefd2]:
|
||||
try:
|
||||
if i:
|
||||
os.close(i)
|
||||
except OSError:
|
||||
pass
|
||||
sock.close()
|
||||
raise
|
||||
|
||||
return server_connection
|
||||
|
||||
def sendfds(sock, fds):
|
||||
'''Send an array of fds over an AF_UNIX socket.'''
|
||||
fds = array.array('i', fds)
|
||||
msg = bytes([len(fds) % 256])
|
||||
sock.sendmsg([msg], [(socket.SOL_SOCKET, socket.SCM_RIGHTS, fds)])
|
||||
|
||||
def recvfds(sock, size):
|
||||
'''Receive an array of fds over an AF_UNIX socket.'''
|
||||
a = array.array('i')
|
||||
bytes_size = a.itemsize * size
|
||||
msg, ancdata, flags, addr = sock.recvmsg(1, socket.CMSG_LEN(bytes_size))
|
||||
if not msg and not ancdata:
|
||||
raise EOFError
|
||||
try:
|
||||
if len(ancdata) != 1:
|
||||
raise RuntimeError('received %d items of ancdata' %
|
||||
len(ancdata))
|
||||
cmsg_level, cmsg_type, cmsg_data = ancdata[0]
|
||||
if (cmsg_level == socket.SOL_SOCKET and
|
||||
cmsg_type == socket.SCM_RIGHTS):
|
||||
if len(cmsg_data) % a.itemsize != 0:
|
||||
raise ValueError
|
||||
a.frombytes(cmsg_data)
|
||||
assert len(a) % 256 == msg[0]
|
||||
return list(a)
|
||||
except (ValueError, IndexError):
|
||||
pass
|
||||
raise RuntimeError('Invalid data received')
|
||||
|
||||
class BBUIEventQueue:
|
||||
def __init__(self, readfd):
|
||||
|
||||
self.eventQueue = []
|
||||
self.eventQueueLock = threading.Lock()
|
||||
self.eventQueueNotify = threading.Event()
|
||||
|
||||
self.reader = ConnectionReader(readfd)
|
||||
|
||||
self.t = threading.Thread()
|
||||
self.t.setDaemon(True)
|
||||
self.t.run = self.startCallbackHandler
|
||||
self.t.start()
|
||||
|
||||
def getEvent(self):
|
||||
self.eventQueueLock.acquire()
|
||||
|
||||
if len(self.eventQueue) == 0:
|
||||
self.eventQueueLock.release()
|
||||
return None
|
||||
|
||||
item = self.eventQueue.pop(0)
|
||||
|
||||
if len(self.eventQueue) == 0:
|
||||
self.eventQueueNotify.clear()
|
||||
|
||||
self.eventQueueLock.release()
|
||||
return item
|
||||
|
||||
def waitEvent(self, delay):
|
||||
self.eventQueueNotify.wait(delay)
|
||||
return self.getEvent()
|
||||
|
||||
def queue_event(self, event):
|
||||
self.eventQueueLock.acquire()
|
||||
self.eventQueue.append(event)
|
||||
self.eventQueueNotify.set()
|
||||
self.eventQueueLock.release()
|
||||
|
||||
def send_event(self, event):
|
||||
self.queue_event(pickle.loads(event))
|
||||
|
||||
def startCallbackHandler(self):
|
||||
bb.utils.set_process_name("UIEventQueue")
|
||||
while True:
|
||||
try:
|
||||
self.reader.wait()
|
||||
event = self.reader.get()
|
||||
self.queue_event(event)
|
||||
except EOFError:
|
||||
# Easiest way to exit is to close the file descriptor to cause an exit
|
||||
break
|
||||
self.reader.close()
|
||||
|
||||
class ConnectionReader(object):
|
||||
|
||||
def __init__(self, fd):
|
||||
self.reader = multiprocessing.connection.Connection(fd, writable=False)
|
||||
self.rlock = multiprocessing.Lock()
|
||||
|
||||
def wait(self, timeout=None):
|
||||
return multiprocessing.connection.wait([self.reader], timeout)
|
||||
|
||||
def poll(self, timeout=None):
|
||||
return self.reader.poll(timeout)
|
||||
|
||||
def get(self):
|
||||
with self.rlock:
|
||||
res = self.reader.recv_bytes()
|
||||
return multiprocessing.reduction.ForkingPickler.loads(res)
|
||||
|
||||
def fileno(self):
|
||||
return self.reader.fileno()
|
||||
|
||||
def close(self):
|
||||
return self.reader.close()
|
||||
|
||||
|
||||
class ConnectionWriter(object):
|
||||
|
||||
def __init__(self, fd):
|
||||
self.writer = multiprocessing.connection.Connection(fd, readable=False)
|
||||
self.wlock = multiprocessing.Lock()
|
||||
# Why bb.event needs this I have no idea
|
||||
self.event = self
|
||||
|
||||
def send(self, obj):
|
||||
obj = multiprocessing.reduction.ForkingPickler.dumps(obj)
|
||||
with self.wlock:
|
||||
self.writer.send_bytes(obj)
|
||||
|
||||
def fileno(self):
|
||||
return self.writer.fileno()
|
||||
|
||||
def close(self):
|
||||
return self.writer.close()
|
||||
signal.signal(signal.SIGTERM, lambda i, s: self.connection.sigterm_terminate())
|
||||
return self.connection
|
||||
|
||||
383
bitbake/lib/bb/server/xmlrpc.py
Normal file
383
bitbake/lib/bb/server/xmlrpc.py
Normal file
@@ -0,0 +1,383 @@
|
||||
#
|
||||
# BitBake XMLRPC Server
|
||||
#
|
||||
# Copyright (C) 2006 - 2007 Michael 'Mickey' Lauer
|
||||
# Copyright (C) 2006 - 2008 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
"""
|
||||
This module implements an xmlrpc server for BitBake.
|
||||
|
||||
Use this by deriving a class from BitBakeXMLRPCServer and then adding
|
||||
methods which you want to "export" via XMLRPC. If the methods have the
|
||||
prefix xmlrpc_, then registering those function will happen automatically,
|
||||
if not, you need to call register_function.
|
||||
|
||||
Use register_idle_function() to add a function which the xmlrpc server
|
||||
calls from within server_forever when no requests are pending. Make sure
|
||||
that those functions are non-blocking or else you will introduce latency
|
||||
in the server's main loop.
|
||||
"""
|
||||
|
||||
import bb
|
||||
import xmlrpclib, sys
|
||||
from bb import daemonize
|
||||
from bb.ui import uievent
|
||||
import hashlib, time
|
||||
import socket
|
||||
import os, signal
|
||||
import threading
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
|
||||
DEBUG = False
|
||||
|
||||
from SimpleXMLRPCServer import SimpleXMLRPCServer, SimpleXMLRPCRequestHandler
|
||||
import inspect, select, httplib
|
||||
|
||||
from . import BitBakeBaseServer, BitBakeBaseServerConnection, BaseImplServer
|
||||
|
||||
class BBTransport(xmlrpclib.Transport):
|
||||
def __init__(self, timeout):
|
||||
self.timeout = timeout
|
||||
self.connection_token = None
|
||||
xmlrpclib.Transport.__init__(self)
|
||||
|
||||
# Modified from default to pass timeout to HTTPConnection
|
||||
def make_connection(self, host):
|
||||
#return an existing connection if possible. This allows
|
||||
#HTTP/1.1 keep-alive.
|
||||
if self._connection and host == self._connection[0]:
|
||||
return self._connection[1]
|
||||
|
||||
# create a HTTP connection object from a host descriptor
|
||||
chost, self._extra_headers, x509 = self.get_host_info(host)
|
||||
#store the host argument along with the connection object
|
||||
self._connection = host, httplib.HTTPConnection(chost, timeout=self.timeout)
|
||||
return self._connection[1]
|
||||
|
||||
def set_connection_token(self, token):
|
||||
self.connection_token = token
|
||||
|
||||
def send_content(self, h, body):
|
||||
if self.connection_token:
|
||||
h.putheader("Bitbake-token", self.connection_token)
|
||||
xmlrpclib.Transport.send_content(self, h, body)
|
||||
|
||||
def _create_server(host, port, timeout = 60):
|
||||
t = BBTransport(timeout)
|
||||
s = xmlrpclib.ServerProxy("http://%s:%d/" % (host, port), transport=t, allow_none=True)
|
||||
return s, t
|
||||
|
||||
class BitBakeServerCommands():
|
||||
|
||||
def __init__(self, server):
|
||||
self.server = server
|
||||
self.has_client = False
|
||||
|
||||
def registerEventHandler(self, host, port):
|
||||
"""
|
||||
Register a remote UI Event Handler
|
||||
"""
|
||||
s, t = _create_server(host, port)
|
||||
|
||||
# we don't allow connections if the cooker is running
|
||||
if (self.cooker.state in [bb.cooker.state.parsing, bb.cooker.state.running]):
|
||||
return None
|
||||
|
||||
self.event_handle = bb.event.register_UIHhandler(s)
|
||||
return self.event_handle
|
||||
|
||||
def unregisterEventHandler(self, handlerNum):
|
||||
"""
|
||||
Unregister a remote UI Event Handler
|
||||
"""
|
||||
return bb.event.unregister_UIHhandler(handlerNum)
|
||||
|
||||
def runCommand(self, command):
|
||||
"""
|
||||
Run a cooker command on the server
|
||||
"""
|
||||
return self.cooker.command.runCommand(command, self.server.readonly)
|
||||
|
||||
def getEventHandle(self):
|
||||
return self.event_handle
|
||||
|
||||
def terminateServer(self):
|
||||
"""
|
||||
Trigger the server to quit
|
||||
"""
|
||||
self.server.quit = True
|
||||
print("Server (cooker) exiting")
|
||||
return
|
||||
|
||||
def addClient(self):
|
||||
if self.has_client:
|
||||
return None
|
||||
token = hashlib.md5(str(time.time())).hexdigest()
|
||||
self.server.set_connection_token(token)
|
||||
self.has_client = True
|
||||
return token
|
||||
|
||||
def removeClient(self):
|
||||
if self.has_client:
|
||||
self.server.set_connection_token(None)
|
||||
self.has_client = False
|
||||
if self.server.single_use:
|
||||
self.server.quit = True
|
||||
|
||||
# This request handler checks if the request has a "Bitbake-token" header
|
||||
# field (this comes from the client side) and compares it with its internal
|
||||
# "Bitbake-token" field (this comes from the server). If the two are not
|
||||
# equal, it is assumed that a client is trying to connect to the server
|
||||
# while another client is connected to the server. In this case, a 503 error
|
||||
# ("service unavailable") is returned to the client.
|
||||
class BitBakeXMLRPCRequestHandler(SimpleXMLRPCRequestHandler):
|
||||
def __init__(self, request, client_address, server):
|
||||
self.server = server
|
||||
SimpleXMLRPCRequestHandler.__init__(self, request, client_address, server)
|
||||
|
||||
def do_POST(self):
|
||||
try:
|
||||
remote_token = self.headers["Bitbake-token"]
|
||||
except:
|
||||
remote_token = None
|
||||
if remote_token != self.server.connection_token and remote_token != "observer":
|
||||
self.report_503()
|
||||
else:
|
||||
if remote_token == "observer":
|
||||
self.server.readonly = True
|
||||
else:
|
||||
self.server.readonly = False
|
||||
SimpleXMLRPCRequestHandler.do_POST(self)
|
||||
|
||||
def report_503(self):
|
||||
self.send_response(503)
|
||||
response = 'No more client allowed'
|
||||
self.send_header("Content-type", "text/plain")
|
||||
self.send_header("Content-length", str(len(response)))
|
||||
self.end_headers()
|
||||
self.wfile.write(response)
|
||||
|
||||
|
||||
class XMLRPCProxyServer(BaseImplServer):
|
||||
""" not a real working server, but a stub for a proxy server connection
|
||||
|
||||
"""
|
||||
def __init__(self, host, port):
|
||||
self.host = host
|
||||
self.port = port
|
||||
|
||||
class XMLRPCServer(SimpleXMLRPCServer, BaseImplServer):
|
||||
# remove this when you're done with debugging
|
||||
# allow_reuse_address = True
|
||||
|
||||
def __init__(self, interface):
|
||||
"""
|
||||
Constructor
|
||||
"""
|
||||
BaseImplServer.__init__(self)
|
||||
if (interface[1] == 0): # anonymous port, not getting reused
|
||||
self.single_use = True
|
||||
# Use auto port configuration
|
||||
if (interface[1] == -1):
|
||||
interface = (interface[0], 0)
|
||||
SimpleXMLRPCServer.__init__(self, interface,
|
||||
requestHandler=BitBakeXMLRPCRequestHandler,
|
||||
logRequests=False, allow_none=True)
|
||||
self.host, self.port = self.socket.getsockname()
|
||||
self.connection_token = None
|
||||
#self.register_introspection_functions()
|
||||
self.commands = BitBakeServerCommands(self)
|
||||
self.autoregister_all_functions(self.commands, "")
|
||||
self.interface = interface
|
||||
self.single_use = False
|
||||
|
||||
def addcooker(self, cooker):
|
||||
BaseImplServer.addcooker(self, cooker)
|
||||
self.commands.cooker = cooker
|
||||
|
||||
def autoregister_all_functions(self, context, prefix):
|
||||
"""
|
||||
Convenience method for registering all functions in the scope
|
||||
of this class that start with a common prefix
|
||||
"""
|
||||
methodlist = inspect.getmembers(context, inspect.ismethod)
|
||||
for name, method in methodlist:
|
||||
if name.startswith(prefix):
|
||||
self.register_function(method, name[len(prefix):])
|
||||
|
||||
|
||||
def serve_forever(self):
|
||||
# Start the actual XMLRPC server
|
||||
bb.cooker.server_main(self.cooker, self._serve_forever)
|
||||
|
||||
def _serve_forever(self):
|
||||
"""
|
||||
Serve Requests. Overloaded to honor a quit command
|
||||
"""
|
||||
self.quit = False
|
||||
while not self.quit:
|
||||
fds = [self]
|
||||
nextsleep = 0.1
|
||||
for function, data in self._idlefuns.items():
|
||||
try:
|
||||
retval = function(self, data, False)
|
||||
if retval is False:
|
||||
del self._idlefuns[function]
|
||||
elif retval is True:
|
||||
nextsleep = 0
|
||||
elif isinstance(retval, float):
|
||||
if (retval < nextsleep):
|
||||
nextsleep = retval
|
||||
else:
|
||||
fds = fds + retval
|
||||
except SystemExit:
|
||||
raise
|
||||
except:
|
||||
import traceback
|
||||
traceback.print_exc()
|
||||
pass
|
||||
|
||||
socktimeout = self.socket.gettimeout() or nextsleep
|
||||
socktimeout = min(socktimeout, nextsleep)
|
||||
# Mirror what BaseServer handle_request would do
|
||||
try:
|
||||
fd_sets = select.select(fds, [], [], socktimeout)
|
||||
if fd_sets[0] and self in fd_sets[0]:
|
||||
self._handle_request_noblock()
|
||||
except IOError:
|
||||
# we ignore interrupted calls
|
||||
pass
|
||||
|
||||
# Tell idle functions we're exiting
|
||||
for function, data in self._idlefuns.items():
|
||||
try:
|
||||
retval = function(self, data, True)
|
||||
except:
|
||||
pass
|
||||
self.server_close()
|
||||
return
|
||||
|
||||
def set_connection_token(self, token):
|
||||
self.connection_token = token
|
||||
|
||||
class BitBakeXMLRPCServerConnection(BitBakeBaseServerConnection):
|
||||
def __init__(self, serverImpl, clientinfo=("localhost", 0), observer_only = False, featureset = []):
|
||||
self.connection, self.transport = _create_server(serverImpl.host, serverImpl.port)
|
||||
self.clientinfo = clientinfo
|
||||
self.serverImpl = serverImpl
|
||||
self.observer_only = observer_only
|
||||
self.featureset = featureset
|
||||
|
||||
def connect(self, token = None):
|
||||
if token is None:
|
||||
if self.observer_only:
|
||||
token = "observer"
|
||||
else:
|
||||
token = self.connection.addClient()
|
||||
|
||||
if token is None:
|
||||
return None
|
||||
|
||||
self.transport.set_connection_token(token)
|
||||
|
||||
self.events = uievent.BBUIEventQueue(self.connection, self.clientinfo)
|
||||
for event in bb.event.ui_queue:
|
||||
self.events.queue_event(event)
|
||||
|
||||
_, error = self.connection.runCommand(["setFeatures", self.featureset])
|
||||
if error:
|
||||
# no need to log it here, the error shall be sent to the client
|
||||
raise BaseException(error)
|
||||
|
||||
return self
|
||||
|
||||
def removeClient(self):
|
||||
if not self.observer_only:
|
||||
self.connection.removeClient()
|
||||
|
||||
def terminate(self):
|
||||
# Don't wait for server indefinitely
|
||||
import socket
|
||||
socket.setdefaulttimeout(2)
|
||||
try:
|
||||
self.events.system_quit()
|
||||
except:
|
||||
pass
|
||||
try:
|
||||
self.connection.removeClient()
|
||||
except:
|
||||
pass
|
||||
|
||||
class BitBakeServer(BitBakeBaseServer):
|
||||
def initServer(self, interface = ("localhost", 0)):
|
||||
self.interface = interface
|
||||
self.serverImpl = XMLRPCServer(interface)
|
||||
|
||||
def detach(self):
|
||||
daemonize.createDaemon(self.serverImpl.serve_forever, "bitbake-cookerdaemon.log")
|
||||
del self.cooker
|
||||
|
||||
def establishConnection(self, featureset):
|
||||
self.connection = BitBakeXMLRPCServerConnection(self.serverImpl, self.interface, False, featureset)
|
||||
return self.connection.connect()
|
||||
|
||||
def set_connection_token(self, token):
|
||||
self.connection.transport.set_connection_token(token)
|
||||
|
||||
class BitBakeXMLRPCClient(BitBakeBaseServer):
|
||||
|
||||
def __init__(self, observer_only = False, token = None):
|
||||
self.token = token
|
||||
|
||||
self.observer_only = observer_only
|
||||
# if we need extra caches, just tell the server to load them all
|
||||
pass
|
||||
|
||||
def saveConnectionDetails(self, remote):
|
||||
self.remote = remote
|
||||
|
||||
def establishConnection(self, featureset):
|
||||
# The format of "remote" must be "server:port"
|
||||
try:
|
||||
[host, port] = self.remote.split(":")
|
||||
port = int(port)
|
||||
except Exception as e:
|
||||
bb.warn("Failed to read remote definition (%s)" % str(e))
|
||||
raise e
|
||||
|
||||
# We need our IP for the server connection. We get the IP
|
||||
# by trying to connect with the server
|
||||
try:
|
||||
s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)
|
||||
s.connect((host, port))
|
||||
ip = s.getsockname()[0]
|
||||
s.close()
|
||||
except Exception as e:
|
||||
bb.warn("Could not create socket for %s:%s (%s)" % (host, port, str(e)))
|
||||
raise e
|
||||
try:
|
||||
self.serverImpl = XMLRPCProxyServer(host, port)
|
||||
self.connection = BitBakeXMLRPCServerConnection(self.serverImpl, (ip, 0), self.observer_only, featureset)
|
||||
return self.connection.connect(self.token)
|
||||
except Exception as e:
|
||||
bb.warn("Could not connect to server at %s:%s (%s)" % (host, port, str(e)))
|
||||
raise e
|
||||
|
||||
def endSession(self):
|
||||
self.connection.removeClient()
|
||||
@@ -1,154 +0,0 @@
|
||||
#
|
||||
# BitBake XMLRPC Client Interface
|
||||
#
|
||||
# Copyright (C) 2006 - 2007 Michael 'Mickey' Lauer
|
||||
# Copyright (C) 2006 - 2008 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys
|
||||
|
||||
import socket
|
||||
import http.client
|
||||
import xmlrpc.client
|
||||
|
||||
import bb
|
||||
from bb.ui import uievent
|
||||
|
||||
class BBTransport(xmlrpc.client.Transport):
|
||||
def __init__(self, timeout):
|
||||
self.timeout = timeout
|
||||
self.connection_token = None
|
||||
xmlrpc.client.Transport.__init__(self)
|
||||
|
||||
# Modified from default to pass timeout to HTTPConnection
|
||||
def make_connection(self, host):
|
||||
#return an existing connection if possible. This allows
|
||||
#HTTP/1.1 keep-alive.
|
||||
if self._connection and host == self._connection[0]:
|
||||
return self._connection[1]
|
||||
|
||||
# create a HTTP connection object from a host descriptor
|
||||
chost, self._extra_headers, x509 = self.get_host_info(host)
|
||||
#store the host argument along with the connection object
|
||||
self._connection = host, http.client.HTTPConnection(chost, timeout=self.timeout)
|
||||
return self._connection[1]
|
||||
|
||||
def set_connection_token(self, token):
|
||||
self.connection_token = token
|
||||
|
||||
def send_content(self, h, body):
|
||||
if self.connection_token:
|
||||
h.putheader("Bitbake-token", self.connection_token)
|
||||
xmlrpc.client.Transport.send_content(self, h, body)
|
||||
|
||||
def _create_server(host, port, timeout = 60):
|
||||
t = BBTransport(timeout)
|
||||
s = xmlrpc.client.ServerProxy("http://%s:%d/" % (host, port), transport=t, allow_none=True, use_builtin_types=True)
|
||||
return s, t
|
||||
|
||||
def check_connection(remote, timeout):
|
||||
try:
|
||||
host, port = remote.split(":")
|
||||
port = int(port)
|
||||
except Exception as e:
|
||||
bb.warn("Failed to read remote definition (%s)" % str(e))
|
||||
raise e
|
||||
|
||||
server, _transport = _create_server(host, port, timeout)
|
||||
try:
|
||||
ret, err = server.runCommand(['getVariable', 'TOPDIR'])
|
||||
if err or not ret:
|
||||
return False
|
||||
except ConnectionError:
|
||||
return False
|
||||
return True
|
||||
|
||||
class BitBakeXMLRPCServerConnection(object):
|
||||
def __init__(self, host, port, clientinfo=("localhost", 0), observer_only = False, featureset = None):
|
||||
self.connection, self.transport = _create_server(host, port)
|
||||
self.clientinfo = clientinfo
|
||||
self.observer_only = observer_only
|
||||
if featureset:
|
||||
self.featureset = featureset
|
||||
else:
|
||||
self.featureset = []
|
||||
|
||||
self.events = uievent.BBUIEventQueue(self.connection, self.clientinfo)
|
||||
|
||||
_, error = self.connection.runCommand(["setFeatures", self.featureset])
|
||||
if error:
|
||||
# disconnect the client, we can't make the setFeature work
|
||||
self.connection.removeClient()
|
||||
# no need to log it here, the error shall be sent to the client
|
||||
raise BaseException(error)
|
||||
|
||||
def connect(self, token = None):
|
||||
if token is None:
|
||||
if self.observer_only:
|
||||
token = "observer"
|
||||
else:
|
||||
token = self.connection.addClient()
|
||||
|
||||
if token is None:
|
||||
return None
|
||||
|
||||
self.transport.set_connection_token(token)
|
||||
return self
|
||||
|
||||
def removeClient(self):
|
||||
if not self.observer_only:
|
||||
self.connection.removeClient()
|
||||
|
||||
def terminate(self):
|
||||
# Don't wait for server indefinitely
|
||||
socket.setdefaulttimeout(2)
|
||||
try:
|
||||
self.events.system_quit()
|
||||
except:
|
||||
pass
|
||||
try:
|
||||
self.connection.removeClient()
|
||||
except:
|
||||
pass
|
||||
|
||||
def connectXMLRPC(remote, featureset, observer_only = False, token = None):
|
||||
# The format of "remote" must be "server:port"
|
||||
try:
|
||||
[host, port] = remote.split(":")
|
||||
port = int(port)
|
||||
except Exception as e:
|
||||
bb.warn("Failed to parse remote definition %s (%s)" % (remote, str(e)))
|
||||
raise e
|
||||
|
||||
# We need our IP for the server connection. We get the IP
|
||||
# by trying to connect with the server
|
||||
try:
|
||||
s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)
|
||||
s.connect((host, port))
|
||||
ip = s.getsockname()[0]
|
||||
s.close()
|
||||
except Exception as e:
|
||||
bb.warn("Could not create socket for %s:%s (%s)" % (host, port, str(e)))
|
||||
raise e
|
||||
try:
|
||||
connection = BitBakeXMLRPCServerConnection(host, port, (ip, 0), observer_only, featureset)
|
||||
return connection.connect(token)
|
||||
except Exception as e:
|
||||
bb.warn("Could not connect to server at %s:%s (%s)" % (host, port, str(e)))
|
||||
raise e
|
||||
|
||||
|
||||
|
||||
@@ -1,158 +0,0 @@
|
||||
#
|
||||
# BitBake XMLRPC Server Interface
|
||||
#
|
||||
# Copyright (C) 2006 - 2007 Michael 'Mickey' Lauer
|
||||
# Copyright (C) 2006 - 2008 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import os
|
||||
import sys
|
||||
|
||||
import hashlib
|
||||
import time
|
||||
import inspect
|
||||
from xmlrpc.server import SimpleXMLRPCServer, SimpleXMLRPCRequestHandler
|
||||
|
||||
import bb
|
||||
|
||||
# This request handler checks if the request has a "Bitbake-token" header
|
||||
# field (this comes from the client side) and compares it with its internal
|
||||
# "Bitbake-token" field (this comes from the server). If the two are not
|
||||
# equal, it is assumed that a client is trying to connect to the server
|
||||
# while another client is connected to the server. In this case, a 503 error
|
||||
# ("service unavailable") is returned to the client.
|
||||
class BitBakeXMLRPCRequestHandler(SimpleXMLRPCRequestHandler):
|
||||
def __init__(self, request, client_address, server):
|
||||
self.server = server
|
||||
SimpleXMLRPCRequestHandler.__init__(self, request, client_address, server)
|
||||
|
||||
def do_POST(self):
|
||||
try:
|
||||
remote_token = self.headers["Bitbake-token"]
|
||||
except:
|
||||
remote_token = None
|
||||
if 0 and remote_token != self.server.connection_token and remote_token != "observer":
|
||||
self.report_503()
|
||||
else:
|
||||
if remote_token == "observer":
|
||||
self.server.readonly = True
|
||||
else:
|
||||
self.server.readonly = False
|
||||
SimpleXMLRPCRequestHandler.do_POST(self)
|
||||
|
||||
def report_503(self):
|
||||
self.send_response(503)
|
||||
response = 'No more client allowed'
|
||||
self.send_header("Content-type", "text/plain")
|
||||
self.send_header("Content-length", str(len(response)))
|
||||
self.end_headers()
|
||||
self.wfile.write(bytes(response, 'utf-8'))
|
||||
|
||||
class BitBakeXMLRPCServer(SimpleXMLRPCServer):
|
||||
# remove this when you're done with debugging
|
||||
# allow_reuse_address = True
|
||||
|
||||
def __init__(self, interface, cooker, parent):
|
||||
# Use auto port configuration
|
||||
if (interface[1] == -1):
|
||||
interface = (interface[0], 0)
|
||||
SimpleXMLRPCServer.__init__(self, interface,
|
||||
requestHandler=BitBakeXMLRPCRequestHandler,
|
||||
logRequests=False, allow_none=True)
|
||||
self.host, self.port = self.socket.getsockname()
|
||||
self.interface = interface
|
||||
|
||||
self.connection_token = None
|
||||
self.commands = BitBakeXMLRPCServerCommands(self)
|
||||
self.register_functions(self.commands, "")
|
||||
|
||||
self.cooker = cooker
|
||||
self.parent = parent
|
||||
|
||||
|
||||
def register_functions(self, context, prefix):
|
||||
"""
|
||||
Convenience method for registering all functions in the scope
|
||||
of this class that start with a common prefix
|
||||
"""
|
||||
methodlist = inspect.getmembers(context, inspect.ismethod)
|
||||
for name, method in methodlist:
|
||||
if name.startswith(prefix):
|
||||
self.register_function(method, name[len(prefix):])
|
||||
|
||||
def get_timeout(self, delay):
|
||||
socktimeout = self.socket.gettimeout() or delay
|
||||
return min(socktimeout, delay)
|
||||
|
||||
def handle_requests(self):
|
||||
self._handle_request_noblock()
|
||||
|
||||
class BitBakeXMLRPCServerCommands():
|
||||
|
||||
def __init__(self, server):
|
||||
self.server = server
|
||||
self.has_client = False
|
||||
|
||||
def registerEventHandler(self, host, port):
|
||||
"""
|
||||
Register a remote UI Event Handler
|
||||
"""
|
||||
s, t = bb.server.xmlrpcclient._create_server(host, port)
|
||||
|
||||
# we don't allow connections if the cooker is running
|
||||
if (self.server.cooker.state in [bb.cooker.state.parsing, bb.cooker.state.running]):
|
||||
return None, "Cooker is busy: %s" % bb.cooker.state.get_name(self.server.cooker.state)
|
||||
|
||||
self.event_handle = bb.event.register_UIHhandler(s, True)
|
||||
return self.event_handle, 'OK'
|
||||
|
||||
def unregisterEventHandler(self, handlerNum):
|
||||
"""
|
||||
Unregister a remote UI Event Handler
|
||||
"""
|
||||
ret = bb.event.unregister_UIHhandler(handlerNum, True)
|
||||
self.event_handle = None
|
||||
return ret
|
||||
|
||||
def runCommand(self, command):
|
||||
"""
|
||||
Run a cooker command on the server
|
||||
"""
|
||||
return self.server.cooker.command.runCommand(command, self.server.readonly)
|
||||
|
||||
def getEventHandle(self):
|
||||
return self.event_handle
|
||||
|
||||
def terminateServer(self):
|
||||
"""
|
||||
Trigger the server to quit
|
||||
"""
|
||||
self.server.parent.quit = True
|
||||
print("XMLRPC Server triggering exit")
|
||||
return
|
||||
|
||||
def addClient(self):
|
||||
if self.server.parent.haveui:
|
||||
return None
|
||||
token = hashlib.md5(str(time.time()).encode("utf-8")).hexdigest()
|
||||
self.server.connection_token = token
|
||||
self.server.parent.haveui = True
|
||||
return token
|
||||
|
||||
def removeClient(self):
|
||||
if self.server.parent.haveui:
|
||||
self.server.connection_token = None
|
||||
self.server.parent.haveui = False
|
||||
|
||||
820
bitbake/lib/bb/shell.py
Normal file
820
bitbake/lib/bb/shell.py
Normal file
@@ -0,0 +1,820 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
##########################################################################
|
||||
#
|
||||
# Copyright (C) 2005-2006 Michael 'Mickey' Lauer <mickey@Vanille.de>
|
||||
# Copyright (C) 2005-2006 Vanille Media
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
##########################################################################
|
||||
#
|
||||
# Thanks to:
|
||||
# * Holger Freyther <zecke@handhelds.org>
|
||||
# * Justin Patrin <papercrane@reversefold.com>
|
||||
#
|
||||
##########################################################################
|
||||
|
||||
"""
|
||||
BitBake Shell
|
||||
|
||||
IDEAS:
|
||||
* list defined tasks per package
|
||||
* list classes
|
||||
* toggle force
|
||||
* command to reparse just one (or more) bbfile(s)
|
||||
* automatic check if reparsing is necessary (inotify?)
|
||||
* frontend for bb file manipulation
|
||||
* more shell-like features:
|
||||
- output control, i.e. pipe output into grep, sort, etc.
|
||||
- job control, i.e. bring running commands into background and foreground
|
||||
* start parsing in background right after startup
|
||||
* ncurses interface
|
||||
|
||||
PROBLEMS:
|
||||
* force doesn't always work
|
||||
* readline completion for commands with more than one parameters
|
||||
|
||||
"""
|
||||
|
||||
##########################################################################
|
||||
# Import and setup global variables
|
||||
##########################################################################
|
||||
|
||||
from __future__ import print_function
|
||||
from functools import reduce
|
||||
try:
|
||||
set
|
||||
except NameError:
|
||||
from sets import Set as set
|
||||
import sys, os, readline, socket, httplib, urllib, commands, popen2, shlex, Queue, fnmatch
|
||||
from bb import data, parse, build, cache, taskdata, runqueue, providers as Providers
|
||||
|
||||
__version__ = "0.5.3.1"
|
||||
__credits__ = """BitBake Shell Version %s (C) 2005 Michael 'Mickey' Lauer <mickey@Vanille.de>
|
||||
Type 'help' for more information, press CTRL-D to exit.""" % __version__
|
||||
|
||||
cmds = {}
|
||||
leave_mainloop = False
|
||||
last_exception = None
|
||||
cooker = None
|
||||
parsed = False
|
||||
debug = os.environ.get( "BBSHELL_DEBUG", "" )
|
||||
|
||||
##########################################################################
|
||||
# Class BitBakeShellCommands
|
||||
##########################################################################
|
||||
|
||||
class BitBakeShellCommands:
|
||||
"""This class contains the valid commands for the shell"""
|
||||
|
||||
def __init__( self, shell ):
|
||||
"""Register all the commands"""
|
||||
self._shell = shell
|
||||
for attr in BitBakeShellCommands.__dict__:
|
||||
if not attr.startswith( "_" ):
|
||||
if attr.endswith( "_" ):
|
||||
command = attr[:-1].lower()
|
||||
else:
|
||||
command = attr[:].lower()
|
||||
method = getattr( BitBakeShellCommands, attr )
|
||||
debugOut( "registering command '%s'" % command )
|
||||
# scan number of arguments
|
||||
usage = getattr( method, "usage", "" )
|
||||
if usage != "<...>":
|
||||
numArgs = len( usage.split() )
|
||||
else:
|
||||
numArgs = -1
|
||||
shell.registerCommand( command, method, numArgs, "%s %s" % ( command, usage ), method.__doc__ )
|
||||
|
||||
def _checkParsed( self ):
|
||||
if not parsed:
|
||||
print("SHELL: This command needs to parse bbfiles...")
|
||||
self.parse( None )
|
||||
|
||||
def _findProvider( self, item ):
|
||||
self._checkParsed()
|
||||
# Need to use taskData for this information
|
||||
preferred = data.getVar( "PREFERRED_PROVIDER_%s" % item, cooker.configuration.data, 1 )
|
||||
if not preferred: preferred = item
|
||||
try:
|
||||
lv, lf, pv, pf = Providers.findBestProvider(preferred, cooker.configuration.data, cooker.status)
|
||||
except KeyError:
|
||||
if item in cooker.status.providers:
|
||||
pf = cooker.status.providers[item][0]
|
||||
else:
|
||||
pf = None
|
||||
return pf
|
||||
|
||||
def alias( self, params ):
|
||||
"""Register a new name for a command"""
|
||||
new, old = params
|
||||
if not old in cmds:
|
||||
print("ERROR: Command '%s' not known" % old)
|
||||
else:
|
||||
cmds[new] = cmds[old]
|
||||
print("OK")
|
||||
alias.usage = "<alias> <command>"
|
||||
|
||||
def buffer( self, params ):
|
||||
"""Dump specified output buffer"""
|
||||
index = params[0]
|
||||
print(self._shell.myout.buffer( int( index ) ))
|
||||
buffer.usage = "<index>"
|
||||
|
||||
def buffers( self, params ):
|
||||
"""Show the available output buffers"""
|
||||
commands = self._shell.myout.bufferedCommands()
|
||||
if not commands:
|
||||
print("SHELL: No buffered commands available yet. Start doing something.")
|
||||
else:
|
||||
print("="*35, "Available Output Buffers", "="*27)
|
||||
for index, cmd in enumerate( commands ):
|
||||
print("| %s %s" % ( str( index ).ljust( 3 ), cmd ))
|
||||
print("="*88)
|
||||
|
||||
def build( self, params, cmd = "build" ):
|
||||
"""Build a providee"""
|
||||
global last_exception
|
||||
globexpr = params[0]
|
||||
self._checkParsed()
|
||||
names = globfilter( cooker.status.pkg_pn, globexpr )
|
||||
if len( names ) == 0: names = [ globexpr ]
|
||||
print("SHELL: Building %s" % ' '.join( names ))
|
||||
|
||||
td = taskdata.TaskData(cooker.configuration.abort)
|
||||
localdata = data.createCopy(cooker.configuration.data)
|
||||
data.update_data(localdata)
|
||||
data.expandKeys(localdata)
|
||||
|
||||
try:
|
||||
tasks = []
|
||||
for name in names:
|
||||
td.add_provider(localdata, cooker.status, name)
|
||||
providers = td.get_provider(name)
|
||||
|
||||
if len(providers) == 0:
|
||||
raise Providers.NoProvider
|
||||
|
||||
tasks.append([name, "do_%s" % cmd])
|
||||
|
||||
td.add_unresolved(localdata, cooker.status)
|
||||
|
||||
rq = runqueue.RunQueue(cooker, localdata, cooker.status, td, tasks)
|
||||
rq.prepare_runqueue()
|
||||
rq.execute_runqueue()
|
||||
|
||||
except Providers.NoProvider:
|
||||
print("ERROR: No Provider")
|
||||
last_exception = Providers.NoProvider
|
||||
|
||||
except runqueue.TaskFailure as fnids:
|
||||
last_exception = runqueue.TaskFailure
|
||||
|
||||
except build.FuncFailed as e:
|
||||
print("ERROR: Couldn't build '%s'" % names)
|
||||
last_exception = e
|
||||
|
||||
|
||||
build.usage = "<providee>"
|
||||
|
||||
def clean( self, params ):
|
||||
"""Clean a providee"""
|
||||
self.build( params, "clean" )
|
||||
clean.usage = "<providee>"
|
||||
|
||||
def compile( self, params ):
|
||||
"""Execute 'compile' on a providee"""
|
||||
self.build( params, "compile" )
|
||||
compile.usage = "<providee>"
|
||||
|
||||
def configure( self, params ):
|
||||
"""Execute 'configure' on a providee"""
|
||||
self.build( params, "configure" )
|
||||
configure.usage = "<providee>"
|
||||
|
||||
def install( self, params ):
|
||||
"""Execute 'install' on a providee"""
|
||||
self.build( params, "install" )
|
||||
install.usage = "<providee>"
|
||||
|
||||
def edit( self, params ):
|
||||
"""Call $EDITOR on a providee"""
|
||||
name = params[0]
|
||||
bbfile = self._findProvider( name )
|
||||
if bbfile is not None:
|
||||
os.system( "%s %s" % ( os.environ.get( "EDITOR", "vi" ), bbfile ) )
|
||||
else:
|
||||
print("ERROR: Nothing provides '%s'" % name)
|
||||
edit.usage = "<providee>"
|
||||
|
||||
def environment( self, params ):
|
||||
"""Dump out the outer BitBake environment"""
|
||||
cooker.showEnvironment()
|
||||
|
||||
def exit_( self, params ):
|
||||
"""Leave the BitBake Shell"""
|
||||
debugOut( "setting leave_mainloop to true" )
|
||||
global leave_mainloop
|
||||
leave_mainloop = True
|
||||
|
||||
def fetch( self, params ):
|
||||
"""Fetch a providee"""
|
||||
self.build( params, "fetch" )
|
||||
fetch.usage = "<providee>"
|
||||
|
||||
def fileBuild( self, params, cmd = "build" ):
|
||||
"""Parse and build a .bb file"""
|
||||
global last_exception
|
||||
name = params[0]
|
||||
bf = completeFilePath( name )
|
||||
print("SHELL: Calling '%s' on '%s'" % ( cmd, bf ))
|
||||
|
||||
try:
|
||||
cooker.buildFile(bf, cmd)
|
||||
except parse.ParseError:
|
||||
print("ERROR: Unable to open or parse '%s'" % bf)
|
||||
except build.FuncFailed as e:
|
||||
print("ERROR: Couldn't build '%s'" % name)
|
||||
last_exception = e
|
||||
|
||||
fileBuild.usage = "<bbfile>"
|
||||
|
||||
def fileClean( self, params ):
|
||||
"""Clean a .bb file"""
|
||||
self.fileBuild( params, "clean" )
|
||||
fileClean.usage = "<bbfile>"
|
||||
|
||||
def fileEdit( self, params ):
|
||||
"""Call $EDITOR on a .bb file"""
|
||||
name = params[0]
|
||||
os.system( "%s %s" % ( os.environ.get( "EDITOR", "vi" ), completeFilePath( name ) ) )
|
||||
fileEdit.usage = "<bbfile>"
|
||||
|
||||
def fileRebuild( self, params ):
|
||||
"""Rebuild (clean & build) a .bb file"""
|
||||
self.fileBuild( params, "rebuild" )
|
||||
fileRebuild.usage = "<bbfile>"
|
||||
|
||||
def fileReparse( self, params ):
|
||||
"""(re)Parse a bb file"""
|
||||
bbfile = params[0]
|
||||
print("SHELL: Parsing '%s'" % bbfile)
|
||||
parse.update_mtime( bbfile )
|
||||
cooker.parser.reparse(bbfile)
|
||||
if False: #fromCache:
|
||||
print("SHELL: File has not been updated, not reparsing")
|
||||
else:
|
||||
print("SHELL: Parsed")
|
||||
fileReparse.usage = "<bbfile>"
|
||||
|
||||
def abort( self, params ):
|
||||
"""Toggle abort task execution flag (see bitbake -k)"""
|
||||
cooker.configuration.abort = not cooker.configuration.abort
|
||||
print("SHELL: Abort Flag is now '%s'" % repr( cooker.configuration.abort ))
|
||||
|
||||
def force( self, params ):
|
||||
"""Toggle force task execution flag (see bitbake -f)"""
|
||||
cooker.configuration.force = not cooker.configuration.force
|
||||
print("SHELL: Force Flag is now '%s'" % repr( cooker.configuration.force ))
|
||||
|
||||
def help( self, params ):
|
||||
"""Show a comprehensive list of commands and their purpose"""
|
||||
print("="*30, "Available Commands", "="*30)
|
||||
for cmd in sorted(cmds):
|
||||
function, numparams, usage, helptext = cmds[cmd]
|
||||
print("| %s | %s" % (usage.ljust(30), helptext))
|
||||
print("="*78)
|
||||
|
||||
def lastError( self, params ):
|
||||
"""Show the reason or log that was produced by the last BitBake event exception"""
|
||||
if last_exception is None:
|
||||
print("SHELL: No Errors yet (Phew)...")
|
||||
else:
|
||||
reason, event = last_exception.args
|
||||
print("SHELL: Reason for the last error: '%s'" % reason)
|
||||
if ':' in reason:
|
||||
msg, filename = reason.split( ':' )
|
||||
filename = filename.strip()
|
||||
print("SHELL: Dumping log file for last error:")
|
||||
try:
|
||||
print(open( filename ).read())
|
||||
except IOError:
|
||||
print("ERROR: Couldn't open '%s'" % filename)
|
||||
|
||||
def match( self, params ):
|
||||
"""Dump all files or providers matching a glob expression"""
|
||||
what, globexpr = params
|
||||
if what == "files":
|
||||
self._checkParsed()
|
||||
for key in globfilter( cooker.status.pkg_fn, globexpr ): print(key)
|
||||
elif what == "providers":
|
||||
self._checkParsed()
|
||||
for key in globfilter( cooker.status.pkg_pn, globexpr ): print(key)
|
||||
else:
|
||||
print("Usage: match %s" % self.print_.usage)
|
||||
match.usage = "<files|providers> <glob>"
|
||||
|
||||
def new( self, params ):
|
||||
"""Create a new .bb file and open the editor"""
|
||||
dirname, filename = params
|
||||
packages = '/'.join( data.getVar( "BBFILES", cooker.configuration.data, 1 ).split('/')[:-2] )
|
||||
fulldirname = "%s/%s" % ( packages, dirname )
|
||||
|
||||
if not os.path.exists( fulldirname ):
|
||||
print("SHELL: Creating '%s'" % fulldirname)
|
||||
os.mkdir( fulldirname )
|
||||
if os.path.exists( fulldirname ) and os.path.isdir( fulldirname ):
|
||||
if os.path.exists( "%s/%s" % ( fulldirname, filename ) ):
|
||||
print("SHELL: ERROR: %s/%s already exists" % ( fulldirname, filename ))
|
||||
return False
|
||||
print("SHELL: Creating '%s/%s'" % ( fulldirname, filename ))
|
||||
newpackage = open( "%s/%s" % ( fulldirname, filename ), "w" )
|
||||
print("""DESCRIPTION = ""
|
||||
SECTION = ""
|
||||
AUTHOR = ""
|
||||
HOMEPAGE = ""
|
||||
MAINTAINER = ""
|
||||
LICENSE = "GPL"
|
||||
PR = "r0"
|
||||
|
||||
SRC_URI = ""
|
||||
|
||||
#inherit base
|
||||
|
||||
#do_configure() {
|
||||
#
|
||||
#}
|
||||
|
||||
#do_compile() {
|
||||
#
|
||||
#}
|
||||
|
||||
#do_stage() {
|
||||
#
|
||||
#}
|
||||
|
||||
#do_install() {
|
||||
#
|
||||
#}
|
||||
""", file=newpackage)
|
||||
newpackage.close()
|
||||
os.system( "%s %s/%s" % ( os.environ.get( "EDITOR" ), fulldirname, filename ) )
|
||||
new.usage = "<directory> <filename>"
|
||||
|
||||
def package( self, params ):
|
||||
"""Execute 'package' on a providee"""
|
||||
self.build( params, "package" )
|
||||
package.usage = "<providee>"
|
||||
|
||||
def pasteBin( self, params ):
|
||||
"""Send a command + output buffer to the pastebin at http://rafb.net/paste"""
|
||||
index = params[0]
|
||||
contents = self._shell.myout.buffer( int( index ) )
|
||||
sendToPastebin( "output of " + params[0], contents )
|
||||
pasteBin.usage = "<index>"
|
||||
|
||||
def pasteLog( self, params ):
|
||||
"""Send the last event exception error log (if there is one) to http://rafb.net/paste"""
|
||||
if last_exception is None:
|
||||
print("SHELL: No Errors yet (Phew)...")
|
||||
else:
|
||||
reason, event = last_exception.args
|
||||
print("SHELL: Reason for the last error: '%s'" % reason)
|
||||
if ':' in reason:
|
||||
msg, filename = reason.split( ':' )
|
||||
filename = filename.strip()
|
||||
print("SHELL: Pasting log file to pastebin...")
|
||||
|
||||
file = open( filename ).read()
|
||||
sendToPastebin( "contents of " + filename, file )
|
||||
|
||||
def patch( self, params ):
|
||||
"""Execute 'patch' command on a providee"""
|
||||
self.build( params, "patch" )
|
||||
patch.usage = "<providee>"
|
||||
|
||||
def parse( self, params ):
|
||||
"""(Re-)parse .bb files and calculate the dependency graph"""
|
||||
cooker.status = cache.CacheData(cooker.caches_array)
|
||||
ignore = data.getVar("ASSUME_PROVIDED", cooker.configuration.data, 1) or ""
|
||||
cooker.status.ignored_dependencies = set( ignore.split() )
|
||||
cooker.handleCollections( data.getVar("BBFILE_COLLECTIONS", cooker.configuration.data, 1) )
|
||||
|
||||
(filelist, masked) = cooker.collect_bbfiles()
|
||||
cooker.parse_bbfiles(filelist, masked, cooker.myProgressCallback)
|
||||
cooker.buildDepgraph()
|
||||
global parsed
|
||||
parsed = True
|
||||
print()
|
||||
|
||||
def reparse( self, params ):
|
||||
"""(re)Parse a providee's bb file"""
|
||||
bbfile = self._findProvider( params[0] )
|
||||
if bbfile is not None:
|
||||
print("SHELL: Found bbfile '%s' for '%s'" % ( bbfile, params[0] ))
|
||||
self.fileReparse( [ bbfile ] )
|
||||
else:
|
||||
print("ERROR: Nothing provides '%s'" % params[0])
|
||||
reparse.usage = "<providee>"
|
||||
|
||||
def getvar( self, params ):
|
||||
"""Dump the contents of an outer BitBake environment variable"""
|
||||
var = params[0]
|
||||
value = data.getVar( var, cooker.configuration.data, 1 )
|
||||
print(value)
|
||||
getvar.usage = "<variable>"
|
||||
|
||||
def peek( self, params ):
|
||||
"""Dump contents of variable defined in providee's metadata"""
|
||||
name, var = params
|
||||
bbfile = self._findProvider( name )
|
||||
if bbfile is not None:
|
||||
the_data = cache.Cache.loadDataFull(bbfile, cooker.configuration.data)
|
||||
value = the_data.getVar( var, 1 )
|
||||
print(value)
|
||||
else:
|
||||
print("ERROR: Nothing provides '%s'" % name)
|
||||
peek.usage = "<providee> <variable>"
|
||||
|
||||
def poke( self, params ):
|
||||
"""Set contents of variable defined in providee's metadata"""
|
||||
name, var, value = params
|
||||
bbfile = self._findProvider( name )
|
||||
if bbfile is not None:
|
||||
print("ERROR: Sorry, this functionality is currently broken")
|
||||
#d = cooker.pkgdata[bbfile]
|
||||
#data.setVar( var, value, d )
|
||||
|
||||
# mark the change semi persistant
|
||||
#cooker.pkgdata.setDirty(bbfile, d)
|
||||
#print "OK"
|
||||
else:
|
||||
print("ERROR: Nothing provides '%s'" % name)
|
||||
poke.usage = "<providee> <variable> <value>"
|
||||
|
||||
def print_( self, params ):
|
||||
"""Dump all files or providers"""
|
||||
what = params[0]
|
||||
if what == "files":
|
||||
self._checkParsed()
|
||||
for key in cooker.status.pkg_fn: print(key)
|
||||
elif what == "providers":
|
||||
self._checkParsed()
|
||||
for key in cooker.status.providers: print(key)
|
||||
else:
|
||||
print("Usage: print %s" % self.print_.usage)
|
||||
print_.usage = "<files|providers>"
|
||||
|
||||
def python( self, params ):
|
||||
"""Enter the expert mode - an interactive BitBake Python Interpreter"""
|
||||
sys.ps1 = "EXPERT BB>>> "
|
||||
sys.ps2 = "EXPERT BB... "
|
||||
import code
|
||||
interpreter = code.InteractiveConsole( dict( globals() ) )
|
||||
interpreter.interact( "SHELL: Expert Mode - BitBake Python %s\nType 'help' for more information, press CTRL-D to switch back to BBSHELL." % sys.version )
|
||||
|
||||
def showdata( self, params ):
|
||||
"""Execute 'showdata' on a providee"""
|
||||
cooker.showEnvironment(None, params)
|
||||
showdata.usage = "<providee>"
|
||||
|
||||
def setVar( self, params ):
|
||||
"""Set an outer BitBake environment variable"""
|
||||
var, value = params
|
||||
data.setVar( var, value, cooker.configuration.data )
|
||||
print("OK")
|
||||
setVar.usage = "<variable> <value>"
|
||||
|
||||
def rebuild( self, params ):
|
||||
"""Clean and rebuild a .bb file or a providee"""
|
||||
self.build( params, "clean" )
|
||||
self.build( params, "build" )
|
||||
rebuild.usage = "<providee>"
|
||||
|
||||
def shell( self, params ):
|
||||
"""Execute a shell command and dump the output"""
|
||||
if params != "":
|
||||
print(commands.getoutput( " ".join( params ) ))
|
||||
shell.usage = "<...>"
|
||||
|
||||
def stage( self, params ):
|
||||
"""Execute 'stage' on a providee"""
|
||||
self.build( params, "populate_staging" )
|
||||
stage.usage = "<providee>"
|
||||
|
||||
def status( self, params ):
|
||||
"""<just for testing>"""
|
||||
print("-" * 78)
|
||||
print("building list = '%s'" % cooker.building_list)
|
||||
print("build path = '%s'" % cooker.build_path)
|
||||
print("consider_msgs_cache = '%s'" % cooker.consider_msgs_cache)
|
||||
print("build stats = '%s'" % cooker.stats)
|
||||
if last_exception is not None: print("last_exception = '%s'" % repr( last_exception.args ))
|
||||
print("memory output contents = '%s'" % self._shell.myout._buffer)
|
||||
|
||||
def test( self, params ):
|
||||
"""<just for testing>"""
|
||||
print("testCommand called with '%s'" % params)
|
||||
|
||||
def unpack( self, params ):
|
||||
"""Execute 'unpack' on a providee"""
|
||||
self.build( params, "unpack" )
|
||||
unpack.usage = "<providee>"
|
||||
|
||||
def which( self, params ):
|
||||
"""Computes the providers for a given providee"""
|
||||
# Need to use taskData for this information
|
||||
item = params[0]
|
||||
|
||||
self._checkParsed()
|
||||
|
||||
preferred = data.getVar( "PREFERRED_PROVIDER_%s" % item, cooker.configuration.data, 1 )
|
||||
if not preferred: preferred = item
|
||||
|
||||
try:
|
||||
lv, lf, pv, pf = Providers.findBestProvider(preferred, cooker.configuration.data, cooker.status)
|
||||
except KeyError:
|
||||
lv, lf, pv, pf = (None,)*4
|
||||
|
||||
try:
|
||||
providers = cooker.status.providers[item]
|
||||
except KeyError:
|
||||
print("SHELL: ERROR: Nothing provides", preferred)
|
||||
else:
|
||||
for provider in providers:
|
||||
if provider == pf: provider = " (***) %s" % provider
|
||||
else: provider = " %s" % provider
|
||||
print(provider)
|
||||
which.usage = "<providee>"
|
||||
|
||||
##########################################################################
|
||||
# Common helper functions
|
||||
##########################################################################
|
||||
|
||||
def completeFilePath( bbfile ):
|
||||
"""Get the complete bbfile path"""
|
||||
if not cooker.status: return bbfile
|
||||
if not cooker.status.pkg_fn: return bbfile
|
||||
for key in cooker.status.pkg_fn:
|
||||
if key.endswith( bbfile ):
|
||||
return key
|
||||
return bbfile
|
||||
|
||||
def sendToPastebin( desc, content ):
|
||||
"""Send content to http://oe.pastebin.com"""
|
||||
mydata = {}
|
||||
mydata["lang"] = "Plain Text"
|
||||
mydata["desc"] = desc
|
||||
mydata["cvt_tabs"] = "No"
|
||||
mydata["nick"] = "%s@%s" % ( os.environ.get( "USER", "unknown" ), socket.gethostname() or "unknown" )
|
||||
mydata["text"] = content
|
||||
params = urllib.urlencode( mydata )
|
||||
headers = {"Content-type": "application/x-www-form-urlencoded", "Accept": "text/plain"}
|
||||
|
||||
host = "rafb.net"
|
||||
conn = httplib.HTTPConnection( "%s:80" % host )
|
||||
conn.request("POST", "/paste/paste.php", params, headers )
|
||||
|
||||
response = conn.getresponse()
|
||||
conn.close()
|
||||
|
||||
if response.status == 302:
|
||||
location = response.getheader( "location" ) or "unknown"
|
||||
print("SHELL: Pasted to http://%s%s" % ( host, location ))
|
||||
else:
|
||||
print("ERROR: %s %s" % ( response.status, response.reason ))
|
||||
|
||||
def completer( text, state ):
|
||||
"""Return a possible readline completion"""
|
||||
debugOut( "completer called with text='%s', state='%d'" % ( text, state ) )
|
||||
|
||||
if state == 0:
|
||||
line = readline.get_line_buffer()
|
||||
if " " in line:
|
||||
line = line.split()
|
||||
# we are in second (or more) argument
|
||||
if line[0] in cmds and hasattr( cmds[line[0]][0], "usage" ): # known command and usage
|
||||
u = getattr( cmds[line[0]][0], "usage" ).split()[0]
|
||||
if u == "<variable>":
|
||||
allmatches = cooker.configuration.data.keys()
|
||||
elif u == "<bbfile>":
|
||||
if cooker.status.pkg_fn is None: allmatches = [ "(No Matches Available. Parsed yet?)" ]
|
||||
else: allmatches = [ x.split("/")[-1] for x in cooker.status.pkg_fn ]
|
||||
elif u == "<providee>":
|
||||
if cooker.status.pkg_fn is None: allmatches = [ "(No Matches Available. Parsed yet?)" ]
|
||||
else: allmatches = cooker.status.providers.iterkeys()
|
||||
else: allmatches = [ "(No tab completion available for this command)" ]
|
||||
else: allmatches = [ "(No tab completion available for this command)" ]
|
||||
else:
|
||||
# we are in first argument
|
||||
allmatches = cmds.iterkeys()
|
||||
|
||||
completer.matches = [ x for x in allmatches if x[:len(text)] == text ]
|
||||
#print "completer.matches = '%s'" % completer.matches
|
||||
if len( completer.matches ) > state:
|
||||
return completer.matches[state]
|
||||
else:
|
||||
return None
|
||||
|
||||
def debugOut( text ):
|
||||
if debug:
|
||||
sys.stderr.write( "( %s )\n" % text )
|
||||
|
||||
def columnize( alist, width = 80 ):
|
||||
"""
|
||||
A word-wrap function that preserves existing line breaks
|
||||
and most spaces in the text. Expects that existing line
|
||||
breaks are posix newlines (\n).
|
||||
"""
|
||||
return reduce(lambda line, word, width=width: '%s%s%s' %
|
||||
(line,
|
||||
' \n'[(len(line[line.rfind('\n')+1:])
|
||||
+ len(word.split('\n', 1)[0]
|
||||
) >= width)],
|
||||
word),
|
||||
alist
|
||||
)
|
||||
|
||||
def globfilter( names, pattern ):
|
||||
return fnmatch.filter( names, pattern )
|
||||
|
||||
##########################################################################
|
||||
# Class MemoryOutput
|
||||
##########################################################################
|
||||
|
||||
class MemoryOutput:
|
||||
"""File-like output class buffering the output of the last 10 commands"""
|
||||
def __init__( self, delegate ):
|
||||
self.delegate = delegate
|
||||
self._buffer = []
|
||||
self.text = []
|
||||
self._command = None
|
||||
|
||||
def startCommand( self, command ):
|
||||
self._command = command
|
||||
self.text = []
|
||||
def endCommand( self ):
|
||||
if self._command is not None:
|
||||
if len( self._buffer ) == 10: del self._buffer[0]
|
||||
self._buffer.append( ( self._command, self.text ) )
|
||||
def removeLast( self ):
|
||||
if self._buffer:
|
||||
del self._buffer[ len( self._buffer ) - 1 ]
|
||||
self.text = []
|
||||
self._command = None
|
||||
def lastBuffer( self ):
|
||||
if self._buffer:
|
||||
return self._buffer[ len( self._buffer ) -1 ][1]
|
||||
def bufferedCommands( self ):
|
||||
return [ cmd for cmd, output in self._buffer ]
|
||||
def buffer( self, i ):
|
||||
if i < len( self._buffer ):
|
||||
return "BB>> %s\n%s" % ( self._buffer[i][0], "".join( self._buffer[i][1] ) )
|
||||
else: return "ERROR: Invalid buffer number. Buffer needs to be in (0, %d)" % ( len( self._buffer ) - 1 )
|
||||
def write( self, text ):
|
||||
if self._command is not None and text != "BB>> ": self.text.append( text )
|
||||
if self.delegate is not None: self.delegate.write( text )
|
||||
def flush( self ):
|
||||
return self.delegate.flush()
|
||||
def fileno( self ):
|
||||
return self.delegate.fileno()
|
||||
def isatty( self ):
|
||||
return self.delegate.isatty()
|
||||
|
||||
##########################################################################
|
||||
# Class BitBakeShell
|
||||
##########################################################################
|
||||
|
||||
class BitBakeShell:
|
||||
|
||||
def __init__( self ):
|
||||
"""Register commands and set up readline"""
|
||||
self.commandQ = Queue.Queue()
|
||||
self.commands = BitBakeShellCommands( self )
|
||||
self.myout = MemoryOutput( sys.stdout )
|
||||
self.historyfilename = os.path.expanduser( "~/.bbsh_history" )
|
||||
self.startupfilename = os.path.expanduser( "~/.bbsh_startup" )
|
||||
|
||||
readline.set_completer( completer )
|
||||
readline.set_completer_delims( " " )
|
||||
readline.parse_and_bind("tab: complete")
|
||||
|
||||
try:
|
||||
readline.read_history_file( self.historyfilename )
|
||||
except IOError:
|
||||
pass # It doesn't exist yet.
|
||||
|
||||
print(__credits__)
|
||||
|
||||
def cleanup( self ):
|
||||
"""Write readline history and clean up resources"""
|
||||
debugOut( "writing command history" )
|
||||
try:
|
||||
readline.write_history_file( self.historyfilename )
|
||||
except:
|
||||
print("SHELL: Unable to save command history")
|
||||
|
||||
def registerCommand( self, command, function, numparams = 0, usage = "", helptext = "" ):
|
||||
"""Register a command"""
|
||||
if usage == "": usage = command
|
||||
if helptext == "": helptext = function.__doc__ or "<not yet documented>"
|
||||
cmds[command] = ( function, numparams, usage, helptext )
|
||||
|
||||
def processCommand( self, command, params ):
|
||||
"""Process a command. Check number of params and print a usage string, if appropriate"""
|
||||
debugOut( "processing command '%s'..." % command )
|
||||
try:
|
||||
function, numparams, usage, helptext = cmds[command]
|
||||
except KeyError:
|
||||
print("SHELL: ERROR: '%s' command is not a valid command." % command)
|
||||
self.myout.removeLast()
|
||||
else:
|
||||
if (numparams != -1) and (not len( params ) == numparams):
|
||||
print("Usage: '%s'" % usage)
|
||||
return
|
||||
|
||||
result = function( self.commands, params )
|
||||
debugOut( "result was '%s'" % result )
|
||||
|
||||
def processStartupFile( self ):
|
||||
"""Read and execute all commands found in $HOME/.bbsh_startup"""
|
||||
if os.path.exists( self.startupfilename ):
|
||||
startupfile = open( self.startupfilename, "r" )
|
||||
for cmdline in startupfile:
|
||||
debugOut( "processing startup line '%s'" % cmdline )
|
||||
if not cmdline:
|
||||
continue
|
||||
if "|" in cmdline:
|
||||
print("ERROR: '|' in startup file is not allowed. Ignoring line")
|
||||
continue
|
||||
self.commandQ.put( cmdline.strip() )
|
||||
|
||||
def main( self ):
|
||||
"""The main command loop"""
|
||||
while not leave_mainloop:
|
||||
try:
|
||||
if self.commandQ.empty():
|
||||
sys.stdout = self.myout.delegate
|
||||
cmdline = raw_input( "BB>> " )
|
||||
sys.stdout = self.myout
|
||||
else:
|
||||
cmdline = self.commandQ.get()
|
||||
if cmdline:
|
||||
allCommands = cmdline.split( ';' )
|
||||
for command in allCommands:
|
||||
pipecmd = None
|
||||
#
|
||||
# special case for expert mode
|
||||
if command == 'python':
|
||||
sys.stdout = self.myout.delegate
|
||||
self.processCommand( command, "" )
|
||||
sys.stdout = self.myout
|
||||
else:
|
||||
self.myout.startCommand( command )
|
||||
if '|' in command: # disable output
|
||||
command, pipecmd = command.split( '|' )
|
||||
delegate = self.myout.delegate
|
||||
self.myout.delegate = None
|
||||
tokens = shlex.split( command, True )
|
||||
self.processCommand( tokens[0], tokens[1:] or "" )
|
||||
self.myout.endCommand()
|
||||
if pipecmd is not None: # restore output
|
||||
self.myout.delegate = delegate
|
||||
|
||||
pipe = popen2.Popen4( pipecmd )
|
||||
pipe.tochild.write( "\n".join( self.myout.lastBuffer() ) )
|
||||
pipe.tochild.close()
|
||||
sys.stdout.write( pipe.fromchild.read() )
|
||||
#
|
||||
except EOFError:
|
||||
print()
|
||||
return
|
||||
except KeyboardInterrupt:
|
||||
print()
|
||||
|
||||
##########################################################################
|
||||
# Start function - called from the BitBake command line utility
|
||||
##########################################################################
|
||||
|
||||
def start( aCooker ):
|
||||
global cooker
|
||||
cooker = aCooker
|
||||
bbshell = BitBakeShell()
|
||||
bbshell.processStartupFile()
|
||||
bbshell.main()
|
||||
bbshell.cleanup()
|
||||
|
||||
if __name__ == "__main__":
|
||||
print("SHELL: Sorry, this program should only be called by BitBake.")
|
||||
@@ -3,19 +3,21 @@ import logging
|
||||
import os
|
||||
import re
|
||||
import tempfile
|
||||
import pickle
|
||||
import bb.data
|
||||
import difflib
|
||||
import simplediff
|
||||
from bb.checksum import FileChecksumCache
|
||||
|
||||
logger = logging.getLogger('BitBake.SigGen')
|
||||
|
||||
try:
|
||||
import cPickle as pickle
|
||||
except ImportError:
|
||||
import pickle
|
||||
logger.info('Importing cPickle failed. Falling back to a very slow implementation.')
|
||||
|
||||
def init(d):
|
||||
siggens = [obj for obj in globals().values()
|
||||
siggens = [obj for obj in globals().itervalues()
|
||||
if type(obj) is type and issubclass(obj, SignatureGenerator)]
|
||||
|
||||
desired = d.getVar("BB_SIGNATURE_HANDLER") or "noop"
|
||||
desired = d.getVar("BB_SIGNATURE_HANDLER", True) or "noop"
|
||||
for sg in siggens:
|
||||
if desired == sg.name:
|
||||
return sg(d)
|
||||
@@ -32,11 +34,9 @@ class SignatureGenerator(object):
|
||||
name = "noop"
|
||||
|
||||
def __init__(self, data):
|
||||
self.basehash = {}
|
||||
self.taskhash = {}
|
||||
self.runtaskdeps = {}
|
||||
self.file_checksum_values = {}
|
||||
self.taints = {}
|
||||
|
||||
def finalise(self, fn, d, varient):
|
||||
return
|
||||
@@ -44,8 +44,7 @@ class SignatureGenerator(object):
|
||||
def get_taskhash(self, fn, task, deps, dataCache):
|
||||
return "0"
|
||||
|
||||
def writeout_file_checksum_cache(self):
|
||||
"""Write/update the file checksum cache onto disk"""
|
||||
def set_taskdata(self, hashes, deps, checksum):
|
||||
return
|
||||
|
||||
def stampfile(self, stampbase, file_name, taskname, extrainfo):
|
||||
@@ -64,13 +63,10 @@ class SignatureGenerator(object):
|
||||
return
|
||||
|
||||
def get_taskdata(self):
|
||||
return (self.runtaskdeps, self.taskhash, self.file_checksum_values, self.taints, self.basehash)
|
||||
return (self.runtaskdeps, self.taskhash, self.file_checksum_values)
|
||||
|
||||
def set_taskdata(self, data):
|
||||
self.runtaskdeps, self.taskhash, self.file_checksum_values, self.taints, self.basehash = data
|
||||
|
||||
def reset(self, data):
|
||||
self.__init__(data)
|
||||
self.runtaskdeps, self.taskhash, self.file_checksum_values = data
|
||||
|
||||
|
||||
class SignatureGeneratorBasic(SignatureGenerator):
|
||||
@@ -84,22 +80,15 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
self.taskdeps = {}
|
||||
self.runtaskdeps = {}
|
||||
self.file_checksum_values = {}
|
||||
self.taints = {}
|
||||
self.gendeps = {}
|
||||
self.lookupcache = {}
|
||||
self.pkgnameextract = re.compile("(?P<fn>.*)\..*")
|
||||
self.basewhitelist = set((data.getVar("BB_HASHBASE_WHITELIST") or "").split())
|
||||
self.basewhitelist = set((data.getVar("BB_HASHBASE_WHITELIST", True) or "").split())
|
||||
self.taskwhitelist = None
|
||||
self.init_rundepcheck(data)
|
||||
checksum_cache_file = data.getVar("BB_HASH_CHECKSUM_CACHE_FILE")
|
||||
if checksum_cache_file:
|
||||
self.checksum_cache = FileChecksumCache()
|
||||
self.checksum_cache.init_cache(data, checksum_cache_file)
|
||||
else:
|
||||
self.checksum_cache = None
|
||||
|
||||
def init_rundepcheck(self, data):
|
||||
self.taskwhitelist = data.getVar("BB_HASHTASK_WHITELIST") or None
|
||||
self.taskwhitelist = data.getVar("BB_HASHTASK_WHITELIST", True) or None
|
||||
if self.taskwhitelist:
|
||||
self.twl = re.compile(self.taskwhitelist)
|
||||
else:
|
||||
@@ -107,7 +96,6 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
|
||||
def _build_data(self, fn, d):
|
||||
|
||||
ignore_mismatch = ((d.getVar("BB_HASH_IGNORE_MISMATCH") or '') == '1')
|
||||
tasklist, gendeps, lookupcache = bb.data.generate_dependencies(d)
|
||||
|
||||
taskdeps = {}
|
||||
@@ -140,11 +128,7 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
var = lookupcache[dep]
|
||||
if var is not None:
|
||||
data = data + str(var)
|
||||
datahash = hashlib.md5(data.encode("utf-8")).hexdigest()
|
||||
k = fn + "." + task
|
||||
if not ignore_mismatch and k in self.basehash and self.basehash[k] != datahash:
|
||||
bb.error("When reparsing %s, the basehash value changed from %s to %s. The metadata is not deterministic and this needs to be fixed." % (k, self.basehash[k], datahash))
|
||||
self.basehash[k] = datahash
|
||||
self.basehash[fn + "." + task] = hashlib.md5(data).hexdigest()
|
||||
taskdeps[task] = alldeps
|
||||
|
||||
self.taskdeps[fn] = taskdeps
|
||||
@@ -155,21 +139,18 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
|
||||
def finalise(self, fn, d, variant):
|
||||
|
||||
mc = d.getVar("__BBMULTICONFIG", False) or ""
|
||||
if variant or mc:
|
||||
fn = bb.cache.realfn2virtual(fn, variant, mc)
|
||||
if variant:
|
||||
fn = "virtual:" + variant + ":" + fn
|
||||
|
||||
try:
|
||||
taskdeps = self._build_data(fn, d)
|
||||
except bb.parse.SkipRecipe:
|
||||
raise
|
||||
except:
|
||||
bb.warn("Error during finalise of %s" % fn)
|
||||
bb.note("Error during finalise of %s" % fn)
|
||||
raise
|
||||
|
||||
#Slow but can be useful for debugging mismatched basehashes
|
||||
#for task in self.taskdeps[fn]:
|
||||
# self.dump_sigtask(fn, task, d.getVar("STAMP"), False)
|
||||
# self.dump_sigtask(fn, task, d.getVar("STAMP", True), False)
|
||||
|
||||
for task in taskdeps:
|
||||
d.setVar("BB_BASEHASH_task-%s" % task, self.basehash[fn + "." + task])
|
||||
@@ -195,11 +176,9 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
def get_taskhash(self, fn, task, deps, dataCache):
|
||||
k = fn + "." + task
|
||||
data = dataCache.basetaskhash[k]
|
||||
self.basehash[k] = data
|
||||
self.runtaskdeps[k] = []
|
||||
self.file_checksum_values[k] = []
|
||||
self.file_checksum_values[k] = {}
|
||||
recipename = dataCache.pkg_fn[fn]
|
||||
|
||||
for dep in sorted(deps, key=clean_basepath):
|
||||
depname = dataCache.pkg_fn[self.pkgnameextract.search(dep).group('fn')]
|
||||
if not self.rundep_check(fn, recipename, task, dep, depname, dataCache):
|
||||
@@ -210,50 +189,26 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
self.runtaskdeps[k].append(dep)
|
||||
|
||||
if task in dataCache.file_checksums[fn]:
|
||||
if self.checksum_cache:
|
||||
checksums = self.checksum_cache.get_checksums(dataCache.file_checksums[fn][task], recipename)
|
||||
else:
|
||||
checksums = bb.fetch2.get_file_checksums(dataCache.file_checksums[fn][task], recipename)
|
||||
checksums = bb.fetch2.get_file_checksums(dataCache.file_checksums[fn][task], recipename)
|
||||
for (f,cs) in checksums:
|
||||
self.file_checksum_values[k].append((f,cs))
|
||||
self.file_checksum_values[k][f] = cs
|
||||
if cs:
|
||||
data = data + cs
|
||||
|
||||
taskdep = dataCache.task_deps[fn]
|
||||
if 'nostamp' in taskdep and task in taskdep['nostamp']:
|
||||
# Nostamp tasks need an implicit taint so that they force any dependent tasks to run
|
||||
import uuid
|
||||
taint = str(uuid.uuid4())
|
||||
data = data + taint
|
||||
self.taints[k] = "nostamp:" + taint
|
||||
|
||||
taint = self.read_taint(fn, task, dataCache.stamp[fn])
|
||||
if taint:
|
||||
data = data + taint
|
||||
self.taints[k] = taint
|
||||
logger.warning("%s is tainted from a forced run" % k)
|
||||
logger.warn("%s is tainted from a forced run" % k)
|
||||
|
||||
h = hashlib.md5(data.encode("utf-8")).hexdigest()
|
||||
h = hashlib.md5(data).hexdigest()
|
||||
self.taskhash[k] = h
|
||||
#d.setVar("BB_TASKHASH_task-%s" % task, taskhash[task])
|
||||
return h
|
||||
|
||||
def writeout_file_checksum_cache(self):
|
||||
"""Write/update the file checksum cache onto disk"""
|
||||
if self.checksum_cache:
|
||||
self.checksum_cache.save_extras()
|
||||
self.checksum_cache.save_merge()
|
||||
else:
|
||||
bb.fetch2.fetcher_parse_save()
|
||||
bb.fetch2.fetcher_parse_done()
|
||||
|
||||
def dump_sigtask(self, fn, task, stampbase, runtime):
|
||||
|
||||
k = fn + "." + task
|
||||
referencestamp = stampbase
|
||||
if isinstance(runtime, str) and runtime.startswith("customfile"):
|
||||
if runtime == "customfile":
|
||||
sigfile = stampbase
|
||||
referencestamp = runtime[11:]
|
||||
elif runtime and k in self.taskhash:
|
||||
sigfile = stampbase + "." + task + ".sigdata" + "." + self.taskhash[k]
|
||||
else:
|
||||
@@ -262,7 +217,6 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
bb.utils.mkdirhier(os.path.dirname(sigfile))
|
||||
|
||||
data = {}
|
||||
data['task'] = task
|
||||
data['basewhitelist'] = self.basewhitelist
|
||||
data['taskwhitelist'] = self.taskwhitelist
|
||||
data['taskdeps'] = self.taskdeps[fn][task]
|
||||
@@ -278,35 +232,21 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
|
||||
if runtime and k in self.taskhash:
|
||||
data['runtaskdeps'] = self.runtaskdeps[k]
|
||||
data['file_checksum_values'] = [(os.path.basename(f), cs) for f,cs in self.file_checksum_values[k]]
|
||||
data['file_checksum_values'] = [(os.path.basename(f), cs) for f,cs in self.file_checksum_values[k].items()]
|
||||
data['runtaskhashes'] = {}
|
||||
for dep in data['runtaskdeps']:
|
||||
data['runtaskhashes'][dep] = self.taskhash[dep]
|
||||
data['taskhash'] = self.taskhash[k]
|
||||
|
||||
taint = self.read_taint(fn, task, referencestamp)
|
||||
taint = self.read_taint(fn, task, stampbase)
|
||||
if taint:
|
||||
data['taint'] = taint
|
||||
|
||||
if runtime and k in self.taints:
|
||||
if 'nostamp:' in self.taints[k]:
|
||||
data['taint'] = self.taints[k]
|
||||
|
||||
computed_basehash = calc_basehash(data)
|
||||
if computed_basehash != self.basehash[k]:
|
||||
bb.error("Basehash mismatch %s versus %s for %s" % (computed_basehash, self.basehash[k], k))
|
||||
if runtime and k in self.taskhash:
|
||||
computed_taskhash = calc_taskhash(data)
|
||||
if computed_taskhash != self.taskhash[k]:
|
||||
bb.error("Taskhash mismatch %s versus %s for %s" % (computed_taskhash, self.taskhash[k], k))
|
||||
sigfile = sigfile.replace(self.taskhash[k], computed_taskhash)
|
||||
|
||||
fd, tmpfile = tempfile.mkstemp(dir=os.path.dirname(sigfile), prefix="sigtask.")
|
||||
try:
|
||||
with os.fdopen(fd, "wb") as stream:
|
||||
p = pickle.dump(data, stream, -1)
|
||||
stream.flush()
|
||||
os.chmod(tmpfile, 0o664)
|
||||
os.chmod(tmpfile, 0664)
|
||||
os.rename(tmpfile, sigfile)
|
||||
except (OSError, IOError) as err:
|
||||
try:
|
||||
@@ -315,18 +255,16 @@ class SignatureGeneratorBasic(SignatureGenerator):
|
||||
pass
|
||||
raise err
|
||||
|
||||
def dump_sigfn(self, fn, dataCaches, options):
|
||||
if fn in self.taskdeps:
|
||||
def dump_sigs(self, dataCache, options):
|
||||
for fn in self.taskdeps:
|
||||
for task in self.taskdeps[fn]:
|
||||
tid = fn + ":" + task
|
||||
(mc, _, _) = bb.runqueue.split_tid(tid)
|
||||
k = fn + "." + task
|
||||
if k not in self.taskhash:
|
||||
continue
|
||||
if dataCaches[mc].basetaskhash[k] != self.basehash[k]:
|
||||
if dataCache.basetaskhash[k] != self.basehash[k]:
|
||||
bb.error("Bitbake's cached basehash does not match the one we just generated (%s)!" % k)
|
||||
bb.error("The mismatched hashes were %s and %s" % (dataCaches[mc].basetaskhash[k], self.basehash[k]))
|
||||
self.dump_sigtask(fn, task, dataCaches[mc].stamp[fn], True)
|
||||
bb.error("The mismatched hashes were %s and %s" % (dataCache.basetaskhash[k], self.basehash[k]))
|
||||
self.dump_sigtask(fn, task, dataCache.stamp[fn], True)
|
||||
|
||||
class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
|
||||
name = "basichash"
|
||||
@@ -354,71 +292,14 @@ class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
|
||||
|
||||
def dump_this_task(outfile, d):
|
||||
import bb.parse
|
||||
fn = d.getVar("BB_FILENAME")
|
||||
task = "do_" + d.getVar("BB_CURRENTTASK")
|
||||
referencestamp = bb.build.stamp_internal(task, d, None, True)
|
||||
bb.parse.siggen.dump_sigtask(fn, task, outfile, "customfile:" + referencestamp)
|
||||
|
||||
def init_colors(enable_color):
|
||||
"""Initialise colour dict for passing to compare_sigfiles()"""
|
||||
# First set up the colours
|
||||
colors = {'color_title': '\033[1;37;40m',
|
||||
'color_default': '\033[0;37;40m',
|
||||
'color_add': '\033[1;32;40m',
|
||||
'color_remove': '\033[1;31;40m',
|
||||
}
|
||||
# Leave all keys present but clear the values
|
||||
if not enable_color:
|
||||
for k in colors.keys():
|
||||
colors[k] = ''
|
||||
return colors
|
||||
|
||||
def worddiff_str(oldstr, newstr, colors=None):
|
||||
if not colors:
|
||||
colors = init_colors(False)
|
||||
diff = simplediff.diff(oldstr.split(' '), newstr.split(' '))
|
||||
ret = []
|
||||
for change, value in diff:
|
||||
value = ' '.join(value)
|
||||
if change == '=':
|
||||
ret.append(value)
|
||||
elif change == '+':
|
||||
item = '{color_add}{{+{value}+}}{color_default}'.format(value=value, **colors)
|
||||
ret.append(item)
|
||||
elif change == '-':
|
||||
item = '{color_remove}[-{value}-]{color_default}'.format(value=value, **colors)
|
||||
ret.append(item)
|
||||
whitespace_note = ''
|
||||
if oldstr != newstr and ' '.join(oldstr.split()) == ' '.join(newstr.split()):
|
||||
whitespace_note = ' (whitespace changed)'
|
||||
return '"%s"%s' % (' '.join(ret), whitespace_note)
|
||||
|
||||
def list_inline_diff(oldlist, newlist, colors=None):
|
||||
if not colors:
|
||||
colors = init_colors(False)
|
||||
diff = simplediff.diff(oldlist, newlist)
|
||||
ret = []
|
||||
for change, value in diff:
|
||||
value = ' '.join(value)
|
||||
if change == '=':
|
||||
ret.append("'%s'" % value)
|
||||
elif change == '+':
|
||||
item = '{color_add}+{value}{color_default}'.format(value=value, **colors)
|
||||
ret.append(item)
|
||||
elif change == '-':
|
||||
item = '{color_remove}-{value}{color_default}'.format(value=value, **colors)
|
||||
ret.append(item)
|
||||
return '[%s]' % (', '.join(ret))
|
||||
fn = d.getVar("BB_FILENAME", True)
|
||||
task = "do_" + d.getVar("BB_CURRENTTASK", True)
|
||||
bb.parse.siggen.dump_sigtask(fn, task, outfile, "customfile")
|
||||
|
||||
def clean_basepath(a):
|
||||
mc = None
|
||||
if a.startswith("multiconfig:"):
|
||||
_, mc, a = a.split(":", 2)
|
||||
b = a.rsplit("/", 2)[1] + '/' + a.rsplit("/", 2)[2]
|
||||
b = a.rsplit("/", 2)[1] + a.rsplit("/", 2)[2]
|
||||
if a.startswith("virtual:"):
|
||||
b = b + ":" + a.rsplit(":", 1)[0]
|
||||
if mc:
|
||||
b = b + ":multiconfig:" + mc
|
||||
return b
|
||||
|
||||
def clean_basepaths(a):
|
||||
@@ -427,38 +308,13 @@ def clean_basepaths(a):
|
||||
b[clean_basepath(x)] = a[x]
|
||||
return b
|
||||
|
||||
def clean_basepaths_list(a):
|
||||
b = []
|
||||
for x in a:
|
||||
b.append(clean_basepath(x))
|
||||
return b
|
||||
|
||||
def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
|
||||
def compare_sigfiles(a, b, recursecb = None):
|
||||
output = []
|
||||
|
||||
colors = init_colors(color)
|
||||
def color_format(formatstr, **values):
|
||||
"""
|
||||
Return colour formatted string.
|
||||
NOTE: call with the format string, not an already formatted string
|
||||
containing values (otherwise you could have trouble with { and }
|
||||
characters)
|
||||
"""
|
||||
if not formatstr.endswith('{color_default}'):
|
||||
formatstr += '{color_default}'
|
||||
# In newer python 3 versions you can pass both of these directly,
|
||||
# but we only require 3.4 at the moment
|
||||
formatparams = {}
|
||||
formatparams.update(colors)
|
||||
formatparams.update(values)
|
||||
return formatstr.format(**formatparams)
|
||||
|
||||
with open(a, 'rb') as f:
|
||||
p1 = pickle.Unpickler(f)
|
||||
a_data = p1.load()
|
||||
with open(b, 'rb') as f:
|
||||
p2 = pickle.Unpickler(f)
|
||||
b_data = p2.load()
|
||||
p1 = pickle.Unpickler(open(a, "rb"))
|
||||
a_data = p1.load()
|
||||
p2 = pickle.Unpickler(open(b, "rb"))
|
||||
b_data = p2.load()
|
||||
|
||||
def dict_diff(a, b, whitelist=set()):
|
||||
sa = set(a.keys())
|
||||
@@ -506,100 +362,50 @@ def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
|
||||
return changed, added, removed
|
||||
|
||||
if 'basewhitelist' in a_data and a_data['basewhitelist'] != b_data['basewhitelist']:
|
||||
output.append(color_format("{color_title}basewhitelist changed{color_default} from '%s' to '%s'") % (a_data['basewhitelist'], b_data['basewhitelist']))
|
||||
output.append("basewhitelist changed from '%s' to '%s'" % (a_data['basewhitelist'], b_data['basewhitelist']))
|
||||
if a_data['basewhitelist'] and b_data['basewhitelist']:
|
||||
output.append("changed items: %s" % a_data['basewhitelist'].symmetric_difference(b_data['basewhitelist']))
|
||||
|
||||
if 'taskwhitelist' in a_data and a_data['taskwhitelist'] != b_data['taskwhitelist']:
|
||||
output.append(color_format("{color_title}taskwhitelist changed{color_default} from '%s' to '%s'") % (a_data['taskwhitelist'], b_data['taskwhitelist']))
|
||||
output.append("taskwhitelist changed from '%s' to '%s'" % (a_data['taskwhitelist'], b_data['taskwhitelist']))
|
||||
if a_data['taskwhitelist'] and b_data['taskwhitelist']:
|
||||
output.append("changed items: %s" % a_data['taskwhitelist'].symmetric_difference(b_data['taskwhitelist']))
|
||||
|
||||
if a_data['taskdeps'] != b_data['taskdeps']:
|
||||
output.append(color_format("{color_title}Task dependencies changed{color_default} from:\n%s\nto:\n%s") % (sorted(a_data['taskdeps']), sorted(b_data['taskdeps'])))
|
||||
output.append("Task dependencies changed from:\n%s\nto:\n%s" % (sorted(a_data['taskdeps']), sorted(b_data['taskdeps'])))
|
||||
|
||||
if a_data['basehash'] != b_data['basehash'] and not collapsed:
|
||||
output.append(color_format("{color_title}basehash changed{color_default} from %s to %s") % (a_data['basehash'], b_data['basehash']))
|
||||
if a_data['basehash'] != b_data['basehash']:
|
||||
output.append("basehash changed from %s to %s" % (a_data['basehash'], b_data['basehash']))
|
||||
|
||||
changed, added, removed = dict_diff(a_data['gendeps'], b_data['gendeps'], a_data['basewhitelist'] & b_data['basewhitelist'])
|
||||
if changed:
|
||||
for dep in changed:
|
||||
output.append(color_format("{color_title}List of dependencies for variable %s changed from '{color_default}%s{color_title}' to '{color_default}%s{color_title}'") % (dep, a_data['gendeps'][dep], b_data['gendeps'][dep]))
|
||||
output.append("List of dependencies for variable %s changed from '%s' to '%s'" % (dep, a_data['gendeps'][dep], b_data['gendeps'][dep]))
|
||||
if a_data['gendeps'][dep] and b_data['gendeps'][dep]:
|
||||
output.append("changed items: %s" % a_data['gendeps'][dep].symmetric_difference(b_data['gendeps'][dep]))
|
||||
if added:
|
||||
for dep in added:
|
||||
output.append(color_format("{color_title}Dependency on variable %s was added") % (dep))
|
||||
output.append("Dependency on variable %s was added" % (dep))
|
||||
if removed:
|
||||
for dep in removed:
|
||||
output.append(color_format("{color_title}Dependency on Variable %s was removed") % (dep))
|
||||
output.append("Dependency on Variable %s was removed" % (dep))
|
||||
|
||||
|
||||
changed, added, removed = dict_diff(a_data['varvals'], b_data['varvals'])
|
||||
if changed:
|
||||
for dep in changed:
|
||||
oldval = a_data['varvals'][dep]
|
||||
newval = b_data['varvals'][dep]
|
||||
if newval and oldval and ('\n' in oldval or '\n' in newval):
|
||||
diff = difflib.unified_diff(oldval.splitlines(), newval.splitlines(), lineterm='')
|
||||
# Cut off the first two lines, since we aren't interested in
|
||||
# the old/new filename (they are blank anyway in this case)
|
||||
difflines = list(diff)[2:]
|
||||
if color:
|
||||
# Add colour to diff output
|
||||
for i, line in enumerate(difflines):
|
||||
if line.startswith('+'):
|
||||
line = color_format('{color_add}{line}', line=line)
|
||||
difflines[i] = line
|
||||
elif line.startswith('-'):
|
||||
line = color_format('{color_remove}{line}', line=line)
|
||||
difflines[i] = line
|
||||
output.append(color_format("{color_title}Variable {var} value changed:{color_default}\n{diff}", var=dep, diff='\n'.join(difflines)))
|
||||
elif newval and oldval and (' ' in oldval or ' ' in newval):
|
||||
output.append(color_format("{color_title}Variable {var} value changed:{color_default}\n{diff}", var=dep, diff=worddiff_str(oldval, newval, colors)))
|
||||
else:
|
||||
output.append(color_format("{color_title}Variable {var} value changed from '{color_default}{oldval}{color_title}' to '{color_default}{newval}{color_title}'{color_default}", var=dep, oldval=oldval, newval=newval))
|
||||
|
||||
if not 'file_checksum_values' in a_data:
|
||||
a_data['file_checksum_values'] = {}
|
||||
if not 'file_checksum_values' in b_data:
|
||||
b_data['file_checksum_values'] = {}
|
||||
output.append("Variable %s value changed from '%s' to '%s'" % (dep, a_data['varvals'][dep], b_data['varvals'][dep]))
|
||||
|
||||
changed, added, removed = file_checksums_diff(a_data['file_checksum_values'], b_data['file_checksum_values'])
|
||||
if changed:
|
||||
for f, old, new in changed:
|
||||
output.append(color_format("{color_title}Checksum for file %s changed{color_default} from %s to %s") % (f, old, new))
|
||||
output.append("Checksum for file %s changed from %s to %s" % (f, old, new))
|
||||
if added:
|
||||
for f in added:
|
||||
output.append(color_format("{color_title}Dependency on checksum of file %s was added") % (f))
|
||||
output.append("Dependency on checksum of file %s was added" % (f))
|
||||
if removed:
|
||||
for f in removed:
|
||||
output.append(color_format("{color_title}Dependency on checksum of file %s was removed") % (f))
|
||||
|
||||
if not 'runtaskdeps' in a_data:
|
||||
a_data['runtaskdeps'] = {}
|
||||
if not 'runtaskdeps' in b_data:
|
||||
b_data['runtaskdeps'] = {}
|
||||
|
||||
if not collapsed:
|
||||
if len(a_data['runtaskdeps']) != len(b_data['runtaskdeps']):
|
||||
changed = ["Number of task dependencies changed"]
|
||||
else:
|
||||
changed = []
|
||||
for idx, task in enumerate(a_data['runtaskdeps']):
|
||||
a = a_data['runtaskdeps'][idx]
|
||||
b = b_data['runtaskdeps'][idx]
|
||||
if a_data['runtaskhashes'][a] != b_data['runtaskhashes'][b] and not collapsed:
|
||||
changed.append("%s with hash %s\n changed to\n%s with hash %s" % (clean_basepath(a), a_data['runtaskhashes'][a], clean_basepath(b), b_data['runtaskhashes'][b]))
|
||||
|
||||
if changed:
|
||||
clean_a = clean_basepaths_list(a_data['runtaskdeps'])
|
||||
clean_b = clean_basepaths_list(b_data['runtaskdeps'])
|
||||
if clean_a != clean_b:
|
||||
output.append(color_format("{color_title}runtaskdeps changed:{color_default}\n%s") % list_inline_diff(clean_a, clean_b, colors))
|
||||
else:
|
||||
output.append(color_format("{color_title}runtaskdeps changed:"))
|
||||
output.append("\n".join(changed))
|
||||
output.append("Dependency on checksum of file %s was removed" % (f))
|
||||
|
||||
|
||||
if 'runtaskhashes' in a_data and 'runtaskhashes' in b_data:
|
||||
@@ -615,7 +421,7 @@ def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
|
||||
#output.append("Dependency on task %s was replaced by %s with same hash" % (dep, bdep))
|
||||
bdep_found = True
|
||||
if not bdep_found:
|
||||
output.append(color_format("{color_title}Dependency on task %s was added{color_default} with hash %s") % (clean_basepath(dep), b[dep]))
|
||||
output.append("Dependency on task %s was added with hash %s" % (clean_basepath(dep), b[dep]))
|
||||
if removed:
|
||||
for dep in removed:
|
||||
adep_found = False
|
||||
@@ -625,70 +431,30 @@ def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
|
||||
#output.append("Dependency on task %s was replaced by %s with same hash" % (adep, dep))
|
||||
adep_found = True
|
||||
if not adep_found:
|
||||
output.append(color_format("{color_title}Dependency on task %s was removed{color_default} with hash %s") % (clean_basepath(dep), a[dep]))
|
||||
output.append("Dependency on task %s was removed with hash %s" % (clean_basepath(dep), a[dep]))
|
||||
if changed:
|
||||
for dep in changed:
|
||||
if not collapsed:
|
||||
output.append(color_format("{color_title}Hash for dependent task %s changed{color_default} from %s to %s") % (clean_basepath(dep), a[dep], b[dep]))
|
||||
output.append("Hash for dependent task %s changed from %s to %s" % (clean_basepath(dep), a[dep], b[dep]))
|
||||
if callable(recursecb):
|
||||
# If a dependent hash changed, might as well print the line above and then defer to the changes in
|
||||
# that hash since in all likelyhood, they're the same changes this task also saw.
|
||||
recout = recursecb(dep, a[dep], b[dep])
|
||||
if recout:
|
||||
if collapsed:
|
||||
output.extend(recout)
|
||||
else:
|
||||
# If a dependent hash changed, might as well print the line above and then defer to the changes in
|
||||
# that hash since in all likelyhood, they're the same changes this task also saw.
|
||||
output = [output[-1]] + recout
|
||||
output = [output[-1]] + recout
|
||||
|
||||
a_taint = a_data.get('taint', None)
|
||||
b_taint = b_data.get('taint', None)
|
||||
if a_taint != b_taint:
|
||||
output.append(color_format("{color_title}Taint (by forced/invalidated task) changed{color_default} from %s to %s") % (a_taint, b_taint))
|
||||
output.append("Taint (by forced/invalidated task) changed from %s to %s" % (a_taint, b_taint))
|
||||
|
||||
return output
|
||||
|
||||
|
||||
def calc_basehash(sigdata):
|
||||
task = sigdata['task']
|
||||
basedata = sigdata['varvals'][task]
|
||||
|
||||
if basedata is None:
|
||||
basedata = ''
|
||||
|
||||
alldeps = sigdata['taskdeps']
|
||||
for dep in alldeps:
|
||||
basedata = basedata + dep
|
||||
val = sigdata['varvals'][dep]
|
||||
if val is not None:
|
||||
basedata = basedata + str(val)
|
||||
|
||||
return hashlib.md5(basedata.encode("utf-8")).hexdigest()
|
||||
|
||||
def calc_taskhash(sigdata):
|
||||
data = sigdata['basehash']
|
||||
|
||||
for dep in sigdata['runtaskdeps']:
|
||||
data = data + sigdata['runtaskhashes'][dep]
|
||||
|
||||
for c in sigdata['file_checksum_values']:
|
||||
if c[1]:
|
||||
data = data + c[1]
|
||||
|
||||
if 'taint' in sigdata:
|
||||
if 'nostamp:' in sigdata['taint']:
|
||||
data = data + sigdata['taint'][8:]
|
||||
else:
|
||||
data = data + sigdata['taint']
|
||||
|
||||
return hashlib.md5(data.encode("utf-8")).hexdigest()
|
||||
|
||||
|
||||
def dump_sigfile(a):
|
||||
output = []
|
||||
|
||||
with open(a, 'rb') as f:
|
||||
p1 = pickle.Unpickler(f)
|
||||
a_data = p1.load()
|
||||
p1 = pickle.Unpickler(open(a, "rb"))
|
||||
a_data = p1.load()
|
||||
|
||||
output.append("basewhitelist: %s" % (a_data['basewhitelist']))
|
||||
|
||||
@@ -717,13 +483,4 @@ def dump_sigfile(a):
|
||||
if 'taint' in a_data:
|
||||
output.append("Tainted (by forced/invalidated task): %s" % a_data['taint'])
|
||||
|
||||
if 'task' in a_data:
|
||||
computed_basehash = calc_basehash(a_data)
|
||||
output.append("Computed base hash is %s and from file %s" % (computed_basehash, a_data['basehash']))
|
||||
else:
|
||||
output.append("Unable to compute base hash")
|
||||
|
||||
computed_taskhash = calc_taskhash(a_data)
|
||||
output.append("Computed task hash is %s" % computed_taskhash)
|
||||
|
||||
return output
|
||||
|
||||
@@ -37,24 +37,27 @@ def re_match_strings(target, strings):
|
||||
return any(name == target or re.match(name, target)
|
||||
for name in strings)
|
||||
|
||||
class TaskEntry:
|
||||
def __init__(self):
|
||||
self.tdepends = []
|
||||
self.idepends = []
|
||||
self.irdepends = []
|
||||
|
||||
class TaskData:
|
||||
"""
|
||||
BitBake Task Data implementation
|
||||
"""
|
||||
def __init__(self, abort = True, skiplist = None, allowincomplete = False):
|
||||
def __init__(self, abort = True, tryaltconfigs = False, skiplist = None):
|
||||
self.build_names_index = []
|
||||
self.run_names_index = []
|
||||
self.fn_index = []
|
||||
|
||||
self.build_targets = {}
|
||||
self.run_targets = {}
|
||||
|
||||
self.external_targets = []
|
||||
|
||||
self.seenfns = []
|
||||
self.taskentries = {}
|
||||
self.tasks_fnid = []
|
||||
self.tasks_name = []
|
||||
self.tasks_tdepends = []
|
||||
self.tasks_idepends = []
|
||||
self.tasks_irdepends = []
|
||||
# Cache to speed up task ID lookups
|
||||
self.tasks_lookup = {}
|
||||
|
||||
self.depids = {}
|
||||
self.rdepids = {}
|
||||
@@ -63,13 +66,95 @@ class TaskData:
|
||||
|
||||
self.failed_deps = []
|
||||
self.failed_rdeps = []
|
||||
self.failed_fns = []
|
||||
self.failed_fnids = []
|
||||
|
||||
self.abort = abort
|
||||
self.allowincomplete = allowincomplete
|
||||
self.tryaltconfigs = tryaltconfigs
|
||||
|
||||
self.skiplist = skiplist
|
||||
|
||||
def getbuild_id(self, name):
|
||||
"""
|
||||
Return an ID number for the build target name.
|
||||
If it doesn't exist, create one.
|
||||
"""
|
||||
if not name in self.build_names_index:
|
||||
self.build_names_index.append(name)
|
||||
return len(self.build_names_index) - 1
|
||||
|
||||
return self.build_names_index.index(name)
|
||||
|
||||
def getrun_id(self, name):
|
||||
"""
|
||||
Return an ID number for the run target name.
|
||||
If it doesn't exist, create one.
|
||||
"""
|
||||
if not name in self.run_names_index:
|
||||
self.run_names_index.append(name)
|
||||
return len(self.run_names_index) - 1
|
||||
|
||||
return self.run_names_index.index(name)
|
||||
|
||||
def getfn_id(self, name):
|
||||
"""
|
||||
Return an ID number for the filename.
|
||||
If it doesn't exist, create one.
|
||||
"""
|
||||
if not name in self.fn_index:
|
||||
self.fn_index.append(name)
|
||||
return len(self.fn_index) - 1
|
||||
|
||||
return self.fn_index.index(name)
|
||||
|
||||
def gettask_ids(self, fnid):
|
||||
"""
|
||||
Return an array of the ID numbers matching a given fnid.
|
||||
"""
|
||||
ids = []
|
||||
if fnid in self.tasks_lookup:
|
||||
for task in self.tasks_lookup[fnid]:
|
||||
ids.append(self.tasks_lookup[fnid][task])
|
||||
return ids
|
||||
|
||||
def gettask_id_fromfnid(self, fnid, task):
|
||||
"""
|
||||
Return an ID number for the task matching fnid and task.
|
||||
"""
|
||||
if fnid in self.tasks_lookup:
|
||||
if task in self.tasks_lookup[fnid]:
|
||||
return self.tasks_lookup[fnid][task]
|
||||
|
||||
return None
|
||||
|
||||
def gettask_id(self, fn, task, create = True):
|
||||
"""
|
||||
Return an ID number for the task matching fn and task.
|
||||
If it doesn't exist, create one by default.
|
||||
Optionally return None instead.
|
||||
"""
|
||||
fnid = self.getfn_id(fn)
|
||||
|
||||
if fnid in self.tasks_lookup:
|
||||
if task in self.tasks_lookup[fnid]:
|
||||
return self.tasks_lookup[fnid][task]
|
||||
|
||||
if not create:
|
||||
return None
|
||||
|
||||
self.tasks_name.append(task)
|
||||
self.tasks_fnid.append(fnid)
|
||||
self.tasks_tdepends.append([])
|
||||
self.tasks_idepends.append([])
|
||||
self.tasks_irdepends.append([])
|
||||
|
||||
listid = len(self.tasks_name) - 1
|
||||
|
||||
if fnid not in self.tasks_lookup:
|
||||
self.tasks_lookup[fnid] = {}
|
||||
self.tasks_lookup[fnid][task] = listid
|
||||
|
||||
return listid
|
||||
|
||||
def add_tasks(self, fn, dataCache):
|
||||
"""
|
||||
Add tasks for a given fn to the database
|
||||
@@ -77,60 +162,58 @@ class TaskData:
|
||||
|
||||
task_deps = dataCache.task_deps[fn]
|
||||
|
||||
if fn in self.failed_fns:
|
||||
fnid = self.getfn_id(fn)
|
||||
|
||||
if fnid in self.failed_fnids:
|
||||
bb.msg.fatal("TaskData", "Trying to re-add a failed file? Something is broken...")
|
||||
|
||||
# Check if we've already seen this fn
|
||||
if fn in self.seenfns:
|
||||
if fnid in self.tasks_fnid:
|
||||
return
|
||||
|
||||
self.seenfns.append(fn)
|
||||
|
||||
self.add_extra_deps(fn, dataCache)
|
||||
|
||||
# Common code for dep_name/depends = 'depends'/idepends and 'rdepends'/irdepends
|
||||
def handle_deps(task, dep_name, depends, seen):
|
||||
if dep_name in task_deps and task in task_deps[dep_name]:
|
||||
ids = []
|
||||
for dep in task_deps[dep_name][task].split():
|
||||
if dep:
|
||||
parts = dep.split(":")
|
||||
if len(parts) != 2:
|
||||
bb.msg.fatal("TaskData", "Error for %s:%s[%s], dependency %s in '%s' does not contain exactly one ':' character.\n Task '%s' should be specified in the form 'packagename:task'" % (fn, task, dep_name, dep, task_deps[dep_name][task], dep_name))
|
||||
ids.append((parts[0], parts[1]))
|
||||
seen(parts[0])
|
||||
depends.extend(ids)
|
||||
|
||||
for task in task_deps['tasks']:
|
||||
|
||||
tid = "%s:%s" % (fn, task)
|
||||
self.taskentries[tid] = TaskEntry()
|
||||
|
||||
# Work out task dependencies
|
||||
parentids = []
|
||||
for dep in task_deps['parents'][task]:
|
||||
if dep not in task_deps['tasks']:
|
||||
bb.debug(2, "Not adding dependeny of %s on %s since %s does not exist" % (task, dep, dep))
|
||||
continue
|
||||
parentid = "%s:%s" % (fn, dep)
|
||||
parentid = self.gettask_id(fn, dep)
|
||||
parentids.append(parentid)
|
||||
self.taskentries[tid].tdepends.extend(parentids)
|
||||
taskid = self.gettask_id(fn, task)
|
||||
self.tasks_tdepends[taskid].extend(parentids)
|
||||
|
||||
# Touch all intertask dependencies
|
||||
handle_deps(task, 'depends', self.taskentries[tid].idepends, self.seen_build_target)
|
||||
handle_deps(task, 'rdepends', self.taskentries[tid].irdepends, self.seen_run_target)
|
||||
if 'depends' in task_deps and task in task_deps['depends']:
|
||||
ids = []
|
||||
for dep in task_deps['depends'][task].split():
|
||||
if dep:
|
||||
if ":" not in dep:
|
||||
bb.msg.fatal("TaskData", "Error for %s, dependency %s does not contain ':' character\n. Task 'depends' should be specified in the form 'packagename:task'" % (fn, dep))
|
||||
ids.append(((self.getbuild_id(dep.split(":")[0])), dep.split(":")[1]))
|
||||
self.tasks_idepends[taskid].extend(ids)
|
||||
if 'rdepends' in task_deps and task in task_deps['rdepends']:
|
||||
ids = []
|
||||
for dep in task_deps['rdepends'][task].split():
|
||||
if dep:
|
||||
if ":" not in dep:
|
||||
bb.msg.fatal("TaskData", "Error for %s, dependency %s does not contain ':' character\n. Task 'rdepends' should be specified in the form 'packagename:task'" % (fn, dep))
|
||||
ids.append(((self.getrun_id(dep.split(":")[0])), dep.split(":")[1]))
|
||||
self.tasks_irdepends[taskid].extend(ids)
|
||||
|
||||
|
||||
# Work out build dependencies
|
||||
if not fn in self.depids:
|
||||
dependids = set()
|
||||
if not fnid in self.depids:
|
||||
dependids = {}
|
||||
for depend in dataCache.deps[fn]:
|
||||
dependids.add(depend)
|
||||
self.depids[fn] = list(dependids)
|
||||
dependids[self.getbuild_id(depend)] = None
|
||||
self.depids[fnid] = dependids.keys()
|
||||
logger.debug(2, "Added dependencies %s for %s", str(dataCache.deps[fn]), fn)
|
||||
|
||||
# Work out runtime dependencies
|
||||
if not fn in self.rdepids:
|
||||
rdependids = set()
|
||||
if not fnid in self.rdepids:
|
||||
rdependids = {}
|
||||
rdepends = dataCache.rundeps[fn]
|
||||
rrecs = dataCache.runrecs[fn]
|
||||
rdependlist = []
|
||||
@@ -138,48 +221,33 @@ class TaskData:
|
||||
for package in rdepends:
|
||||
for rdepend in rdepends[package]:
|
||||
rdependlist.append(rdepend)
|
||||
rdependids.add(rdepend)
|
||||
rdependids[self.getrun_id(rdepend)] = None
|
||||
for package in rrecs:
|
||||
for rdepend in rrecs[package]:
|
||||
rreclist.append(rdepend)
|
||||
rdependids.add(rdepend)
|
||||
rdependids[self.getrun_id(rdepend)] = None
|
||||
if rdependlist:
|
||||
logger.debug(2, "Added runtime dependencies %s for %s", str(rdependlist), fn)
|
||||
if rreclist:
|
||||
logger.debug(2, "Added runtime recommendations %s for %s", str(rreclist), fn)
|
||||
self.rdepids[fn] = list(rdependids)
|
||||
self.rdepids[fnid] = rdependids.keys()
|
||||
|
||||
for dep in self.depids[fn]:
|
||||
self.seen_build_target(dep)
|
||||
for dep in self.depids[fnid]:
|
||||
if dep in self.failed_deps:
|
||||
self.fail_fn(fn)
|
||||
self.fail_fnid(fnid)
|
||||
return
|
||||
for dep in self.rdepids[fn]:
|
||||
self.seen_run_target(dep)
|
||||
for dep in self.rdepids[fnid]:
|
||||
if dep in self.failed_rdeps:
|
||||
self.fail_fn(fn)
|
||||
self.fail_fnid(fnid)
|
||||
return
|
||||
|
||||
def add_extra_deps(self, fn, dataCache):
|
||||
func = dataCache.extradepsfunc.get(fn, None)
|
||||
if func:
|
||||
bb.providers.buildWorldTargetList(dataCache)
|
||||
pn = dataCache.pkg_fn[fn]
|
||||
params = {'deps': dataCache.deps[fn],
|
||||
'world_target': dataCache.world_target,
|
||||
'pkg_pn': dataCache.pkg_pn,
|
||||
'self_pn': pn}
|
||||
funcname = '_%s_calculate_extra_depends' % pn.replace('-', '_')
|
||||
paramlist = ','.join(params.keys())
|
||||
func = 'def %s(%s):\n%s\n\n%s(%s)' % (funcname, paramlist, func, funcname, paramlist)
|
||||
bb.utils.better_exec(func, params)
|
||||
|
||||
|
||||
def have_build_target(self, target):
|
||||
"""
|
||||
Have we a build target matching this name?
|
||||
"""
|
||||
if target in self.build_targets and self.build_targets[target]:
|
||||
targetid = self.getbuild_id(target)
|
||||
|
||||
if targetid in self.build_targets:
|
||||
return True
|
||||
return False
|
||||
|
||||
@@ -187,54 +255,50 @@ class TaskData:
|
||||
"""
|
||||
Have we a runtime target matching this name?
|
||||
"""
|
||||
if target in self.run_targets and self.run_targets[target]:
|
||||
targetid = self.getrun_id(target)
|
||||
|
||||
if targetid in self.run_targets:
|
||||
return True
|
||||
return False
|
||||
|
||||
def seen_build_target(self, name):
|
||||
"""
|
||||
Maintain a list of build targets
|
||||
"""
|
||||
if name not in self.build_targets:
|
||||
self.build_targets[name] = []
|
||||
|
||||
def add_build_target(self, fn, item):
|
||||
"""
|
||||
Add a build target.
|
||||
If already present, append the provider fn to the list
|
||||
"""
|
||||
if item in self.build_targets:
|
||||
if fn in self.build_targets[item]:
|
||||
return
|
||||
self.build_targets[item].append(fn)
|
||||
return
|
||||
self.build_targets[item] = [fn]
|
||||
targetid = self.getbuild_id(item)
|
||||
fnid = self.getfn_id(fn)
|
||||
|
||||
def seen_run_target(self, name):
|
||||
"""
|
||||
Maintain a list of runtime build targets
|
||||
"""
|
||||
if name not in self.run_targets:
|
||||
self.run_targets[name] = []
|
||||
if targetid in self.build_targets:
|
||||
if fnid in self.build_targets[targetid]:
|
||||
return
|
||||
self.build_targets[targetid].append(fnid)
|
||||
return
|
||||
self.build_targets[targetid] = [fnid]
|
||||
|
||||
def add_runtime_target(self, fn, item):
|
||||
"""
|
||||
Add a runtime target.
|
||||
If already present, append the provider fn to the list
|
||||
"""
|
||||
if item in self.run_targets:
|
||||
if fn in self.run_targets[item]:
|
||||
return
|
||||
self.run_targets[item].append(fn)
|
||||
return
|
||||
self.run_targets[item] = [fn]
|
||||
targetid = self.getrun_id(item)
|
||||
fnid = self.getfn_id(fn)
|
||||
|
||||
def mark_external_target(self, target):
|
||||
if targetid in self.run_targets:
|
||||
if fnid in self.run_targets[targetid]:
|
||||
return
|
||||
self.run_targets[targetid].append(fnid)
|
||||
return
|
||||
self.run_targets[targetid] = [fnid]
|
||||
|
||||
def mark_external_target(self, item):
|
||||
"""
|
||||
Mark a build target as being externally requested
|
||||
"""
|
||||
if target not in self.external_targets:
|
||||
self.external_targets.append(target)
|
||||
targetid = self.getbuild_id(item)
|
||||
|
||||
if targetid not in self.external_targets:
|
||||
self.external_targets.append(targetid)
|
||||
|
||||
def get_unresolved_build_targets(self, dataCache):
|
||||
"""
|
||||
@@ -242,12 +306,12 @@ class TaskData:
|
||||
are unknown.
|
||||
"""
|
||||
unresolved = []
|
||||
for target in self.build_targets:
|
||||
for target in self.build_names_index:
|
||||
if re_match_strings(target, dataCache.ignored_dependencies):
|
||||
continue
|
||||
if target in self.failed_deps:
|
||||
if self.build_names_index.index(target) in self.failed_deps:
|
||||
continue
|
||||
if not self.build_targets[target]:
|
||||
if not self.have_build_target(target):
|
||||
unresolved.append(target)
|
||||
return unresolved
|
||||
|
||||
@@ -257,12 +321,12 @@ class TaskData:
|
||||
are unknown.
|
||||
"""
|
||||
unresolved = []
|
||||
for target in self.run_targets:
|
||||
for target in self.run_names_index:
|
||||
if re_match_strings(target, dataCache.ignored_dependencies):
|
||||
continue
|
||||
if target in self.failed_rdeps:
|
||||
if self.run_names_index.index(target) in self.failed_rdeps:
|
||||
continue
|
||||
if not self.run_targets[target]:
|
||||
if not self.have_runtime_target(target):
|
||||
unresolved.append(target)
|
||||
return unresolved
|
||||
|
||||
@@ -270,26 +334,50 @@ class TaskData:
|
||||
"""
|
||||
Return a list of providers of item
|
||||
"""
|
||||
return self.build_targets[item]
|
||||
targetid = self.getbuild_id(item)
|
||||
|
||||
def get_dependees(self, item):
|
||||
return self.build_targets[targetid]
|
||||
|
||||
def get_dependees(self, itemid):
|
||||
"""
|
||||
Return a list of targets which depend on item
|
||||
"""
|
||||
dependees = []
|
||||
for fn in self.depids:
|
||||
if item in self.depids[fn]:
|
||||
dependees.append(fn)
|
||||
for fnid in self.depids:
|
||||
if itemid in self.depids[fnid]:
|
||||
dependees.append(fnid)
|
||||
return dependees
|
||||
|
||||
def get_rdependees(self, item):
|
||||
def get_dependees_str(self, item):
|
||||
"""
|
||||
Return a list of targets which depend on item as a user readable string
|
||||
"""
|
||||
itemid = self.getbuild_id(item)
|
||||
dependees = []
|
||||
for fnid in self.depids:
|
||||
if itemid in self.depids[fnid]:
|
||||
dependees.append(self.fn_index[fnid])
|
||||
return dependees
|
||||
|
||||
def get_rdependees(self, itemid):
|
||||
"""
|
||||
Return a list of targets which depend on runtime item
|
||||
"""
|
||||
dependees = []
|
||||
for fn in self.rdepids:
|
||||
if item in self.rdepids[fn]:
|
||||
dependees.append(fn)
|
||||
for fnid in self.rdepids:
|
||||
if itemid in self.rdepids[fnid]:
|
||||
dependees.append(fnid)
|
||||
return dependees
|
||||
|
||||
def get_rdependees_str(self, item):
|
||||
"""
|
||||
Return a list of targets which depend on runtime item as a user readable string
|
||||
"""
|
||||
itemid = self.getrun_id(item)
|
||||
dependees = []
|
||||
for fnid in self.rdepids:
|
||||
if itemid in self.rdepids[fnid]:
|
||||
dependees.append(self.fn_index[fnid])
|
||||
return dependees
|
||||
|
||||
def get_reasons(self, item, runtime=False):
|
||||
@@ -325,7 +413,7 @@ class TaskData:
|
||||
except bb.providers.NoProvider:
|
||||
if self.abort:
|
||||
raise
|
||||
self.remove_buildtarget(item)
|
||||
self.remove_buildtarget(self.getbuild_id(item))
|
||||
|
||||
self.mark_external_target(item)
|
||||
|
||||
@@ -340,14 +428,7 @@ class TaskData:
|
||||
return
|
||||
|
||||
if not item in dataCache.providers:
|
||||
close_matches = self.get_close_matches(item, list(dataCache.providers.keys()))
|
||||
# Is it in RuntimeProviders ?
|
||||
all_p = bb.providers.getRuntimeProviders(dataCache, item)
|
||||
for fn in all_p:
|
||||
new = dataCache.pkg_fn[fn] + " RPROVIDES " + item
|
||||
if new not in close_matches:
|
||||
close_matches.append(new)
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees(item), reasons=self.get_reasons(item), close_matches=close_matches), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item), reasons=self.get_reasons(item), close_matches=self.get_close_matches(item, dataCache.providers.keys())), cfgData)
|
||||
raise bb.providers.NoProvider(item)
|
||||
|
||||
if self.have_build_target(item):
|
||||
@@ -356,10 +437,10 @@ class TaskData:
|
||||
all_p = dataCache.providers[item]
|
||||
|
||||
eligible, foundUnique = bb.providers.filterProviders(all_p, item, cfgData, dataCache)
|
||||
eligible = [p for p in eligible if not p in self.failed_fns]
|
||||
eligible = [p for p in eligible if not self.getfn_id(p) in self.failed_fnids]
|
||||
|
||||
if not eligible:
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees(item), reasons=["No eligible PROVIDERs exist for '%s'" % item]), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, dependees=self.get_dependees_str(item), reasons=["No eligible PROVIDERs exist for '%s'" % item]), cfgData)
|
||||
raise bb.providers.NoProvider(item)
|
||||
|
||||
if len(eligible) > 1 and foundUnique == False:
|
||||
@@ -371,7 +452,8 @@ class TaskData:
|
||||
self.consider_msgs_cache.append(item)
|
||||
|
||||
for fn in eligible:
|
||||
if fn in self.failed_fns:
|
||||
fnid = self.getfn_id(fn)
|
||||
if fnid in self.failed_fnids:
|
||||
continue
|
||||
logger.debug(2, "adding %s to satisfy %s", fn, item)
|
||||
self.add_build_target(fn, item)
|
||||
@@ -395,14 +477,14 @@ class TaskData:
|
||||
all_p = bb.providers.getRuntimeProviders(dataCache, item)
|
||||
|
||||
if not all_p:
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees(item), reasons=self.get_reasons(item, True)), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item), reasons=self.get_reasons(item, True)), cfgData)
|
||||
raise bb.providers.NoRProvider(item)
|
||||
|
||||
eligible, numberPreferred = bb.providers.filterProvidersRunTime(all_p, item, cfgData, dataCache)
|
||||
eligible = [p for p in eligible if not p in self.failed_fns]
|
||||
eligible = [p for p in eligible if not self.getfn_id(p) in self.failed_fnids]
|
||||
|
||||
if not eligible:
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees(item), reasons=["No eligible RPROVIDERs exist for '%s'" % item]), cfgData)
|
||||
bb.event.fire(bb.event.NoProvider(item, runtime=True, dependees=self.get_rdependees_str(item), reasons=["No eligible RPROVIDERs exist for '%s'" % item]), cfgData)
|
||||
raise bb.providers.NoRProvider(item)
|
||||
|
||||
if len(eligible) > 1 and numberPreferred == 0:
|
||||
@@ -424,80 +506,80 @@ class TaskData:
|
||||
|
||||
# run through the list until we find one that we can build
|
||||
for fn in eligible:
|
||||
if fn in self.failed_fns:
|
||||
fnid = self.getfn_id(fn)
|
||||
if fnid in self.failed_fnids:
|
||||
continue
|
||||
logger.debug(2, "adding '%s' to satisfy runtime '%s'", fn, item)
|
||||
self.add_runtime_target(fn, item)
|
||||
self.add_tasks(fn, dataCache)
|
||||
|
||||
def fail_fn(self, fn, missing_list=None):
|
||||
def fail_fnid(self, fnid, missing_list = []):
|
||||
"""
|
||||
Mark a file as failed (unbuildable)
|
||||
Remove any references from build and runtime provider lists
|
||||
|
||||
missing_list, A list of missing requirements for this target
|
||||
"""
|
||||
if fn in self.failed_fns:
|
||||
if fnid in self.failed_fnids:
|
||||
return
|
||||
if not missing_list:
|
||||
missing_list = []
|
||||
logger.debug(1, "File '%s' is unbuildable, removing...", fn)
|
||||
self.failed_fns.append(fn)
|
||||
logger.debug(1, "File '%s' is unbuildable, removing...", self.fn_index[fnid])
|
||||
self.failed_fnids.append(fnid)
|
||||
for target in self.build_targets:
|
||||
if fn in self.build_targets[target]:
|
||||
self.build_targets[target].remove(fn)
|
||||
if fnid in self.build_targets[target]:
|
||||
self.build_targets[target].remove(fnid)
|
||||
if len(self.build_targets[target]) == 0:
|
||||
self.remove_buildtarget(target, missing_list)
|
||||
for target in self.run_targets:
|
||||
if fn in self.run_targets[target]:
|
||||
self.run_targets[target].remove(fn)
|
||||
if fnid in self.run_targets[target]:
|
||||
self.run_targets[target].remove(fnid)
|
||||
if len(self.run_targets[target]) == 0:
|
||||
self.remove_runtarget(target, missing_list)
|
||||
|
||||
def remove_buildtarget(self, target, missing_list=None):
|
||||
def remove_buildtarget(self, targetid, missing_list = []):
|
||||
"""
|
||||
Mark a build target as failed (unbuildable)
|
||||
Trigger removal of any files that have this as a dependency
|
||||
"""
|
||||
if not missing_list:
|
||||
missing_list = [target]
|
||||
missing_list = [self.build_names_index[targetid]]
|
||||
else:
|
||||
missing_list = [target] + missing_list
|
||||
logger.verbose("Target '%s' is unbuildable, removing...\nMissing or unbuildable dependency chain was: %s", target, missing_list)
|
||||
self.failed_deps.append(target)
|
||||
dependees = self.get_dependees(target)
|
||||
for fn in dependees:
|
||||
self.fail_fn(fn, missing_list)
|
||||
for tid in self.taskentries:
|
||||
for (idepend, idependtask) in self.taskentries[tid].idepends:
|
||||
if idepend == target:
|
||||
fn = tid.rsplit(":",1)[0]
|
||||
self.fail_fn(fn, missing_list)
|
||||
missing_list = [self.build_names_index[targetid]] + missing_list
|
||||
logger.verbose("Target '%s' is unbuildable, removing...\nMissing or unbuildable dependency chain was: %s", self.build_names_index[targetid], missing_list)
|
||||
self.failed_deps.append(targetid)
|
||||
dependees = self.get_dependees(targetid)
|
||||
for fnid in dependees:
|
||||
self.fail_fnid(fnid, missing_list)
|
||||
for taskid in xrange(len(self.tasks_idepends)):
|
||||
idepends = self.tasks_idepends[taskid]
|
||||
for (idependid, idependtask) in idepends:
|
||||
if idependid == targetid:
|
||||
self.fail_fnid(self.tasks_fnid[taskid], missing_list)
|
||||
|
||||
if self.abort and target in self.external_targets:
|
||||
if self.abort and targetid in self.external_targets:
|
||||
target = self.build_names_index[targetid]
|
||||
logger.error("Required build target '%s' has no buildable providers.\nMissing or unbuildable dependency chain was: %s", target, missing_list)
|
||||
raise bb.providers.NoProvider(target)
|
||||
|
||||
def remove_runtarget(self, target, missing_list=None):
|
||||
def remove_runtarget(self, targetid, missing_list = []):
|
||||
"""
|
||||
Mark a run target as failed (unbuildable)
|
||||
Trigger removal of any files that have this as a dependency
|
||||
"""
|
||||
if not missing_list:
|
||||
missing_list = [target]
|
||||
missing_list = [self.run_names_index[targetid]]
|
||||
else:
|
||||
missing_list = [target] + missing_list
|
||||
missing_list = [self.run_names_index[targetid]] + missing_list
|
||||
|
||||
logger.info("Runtime target '%s' is unbuildable, removing...\nMissing or unbuildable dependency chain was: %s", target, missing_list)
|
||||
self.failed_rdeps.append(target)
|
||||
dependees = self.get_rdependees(target)
|
||||
for fn in dependees:
|
||||
self.fail_fn(fn, missing_list)
|
||||
for tid in self.taskentries:
|
||||
for (idepend, idependtask) in self.taskentries[tid].irdepends:
|
||||
if idepend == target:
|
||||
fn = tid.rsplit(":",1)[0]
|
||||
self.fail_fn(fn, missing_list)
|
||||
logger.info("Runtime target '%s' is unbuildable, removing...\nMissing or unbuildable dependency chain was: %s", self.run_names_index[targetid], missing_list)
|
||||
self.failed_rdeps.append(targetid)
|
||||
dependees = self.get_rdependees(targetid)
|
||||
for fnid in dependees:
|
||||
self.fail_fnid(fnid, missing_list)
|
||||
for taskid in xrange(len(self.tasks_irdepends)):
|
||||
irdepends = self.tasks_irdepends[taskid]
|
||||
for (idependid, idependtask) in irdepends:
|
||||
if idependid == targetid:
|
||||
self.fail_fnid(self.tasks_fnid[taskid], missing_list)
|
||||
|
||||
def add_unresolved(self, cfgData, dataCache):
|
||||
"""
|
||||
@@ -511,68 +593,59 @@ class TaskData:
|
||||
self.add_provider_internal(cfgData, dataCache, target)
|
||||
added = added + 1
|
||||
except bb.providers.NoProvider:
|
||||
if self.abort and target in self.external_targets and not self.allowincomplete:
|
||||
targetid = self.getbuild_id(target)
|
||||
if self.abort and targetid in self.external_targets:
|
||||
raise
|
||||
if not self.allowincomplete:
|
||||
self.remove_buildtarget(target)
|
||||
self.remove_buildtarget(targetid)
|
||||
for target in self.get_unresolved_run_targets(dataCache):
|
||||
try:
|
||||
self.add_rprovider(cfgData, dataCache, target)
|
||||
added = added + 1
|
||||
except (bb.providers.NoRProvider, bb.providers.MultipleRProvider):
|
||||
self.remove_runtarget(target)
|
||||
self.remove_runtarget(self.getrun_id(target))
|
||||
logger.debug(1, "Resolved " + str(added) + " extra dependencies")
|
||||
if added == 0:
|
||||
break
|
||||
# self.dump_data()
|
||||
|
||||
def get_providermap(self, prefix=None):
|
||||
provmap = {}
|
||||
for name in self.build_targets:
|
||||
if prefix and not name.startswith(prefix):
|
||||
continue
|
||||
if self.have_build_target(name):
|
||||
provider = self.get_provider(name)
|
||||
if provider:
|
||||
provmap[name] = provider[0]
|
||||
return provmap
|
||||
|
||||
def dump_data(self):
|
||||
"""
|
||||
Dump some debug information on the internal data structures
|
||||
"""
|
||||
logger.debug(3, "build_names:")
|
||||
logger.debug(3, ", ".join(self.build_targets))
|
||||
logger.debug(3, ", ".join(self.build_names_index))
|
||||
|
||||
logger.debug(3, "run_names:")
|
||||
logger.debug(3, ", ".join(self.run_targets))
|
||||
logger.debug(3, ", ".join(self.run_names_index))
|
||||
|
||||
logger.debug(3, "build_targets:")
|
||||
for target in self.build_targets:
|
||||
for buildid in xrange(len(self.build_names_index)):
|
||||
target = self.build_names_index[buildid]
|
||||
targets = "None"
|
||||
if target in self.build_targets:
|
||||
targets = self.build_targets[target]
|
||||
logger.debug(3, " %s: %s", target, targets)
|
||||
if buildid in self.build_targets:
|
||||
targets = self.build_targets[buildid]
|
||||
logger.debug(3, " (%s)%s: %s", buildid, target, targets)
|
||||
|
||||
logger.debug(3, "run_targets:")
|
||||
for target in self.run_targets:
|
||||
for runid in xrange(len(self.run_names_index)):
|
||||
target = self.run_names_index[runid]
|
||||
targets = "None"
|
||||
if target in self.run_targets:
|
||||
targets = self.run_targets[target]
|
||||
logger.debug(3, " %s: %s", target, targets)
|
||||
if runid in self.run_targets:
|
||||
targets = self.run_targets[runid]
|
||||
logger.debug(3, " (%s)%s: %s", runid, target, targets)
|
||||
|
||||
logger.debug(3, "tasks:")
|
||||
for tid in self.taskentries:
|
||||
logger.debug(3, " %s: %s %s %s",
|
||||
tid,
|
||||
self.taskentries[tid].idepends,
|
||||
self.taskentries[tid].irdepends,
|
||||
self.taskentries[tid].tdepends)
|
||||
for task in xrange(len(self.tasks_name)):
|
||||
logger.debug(3, " (%s)%s - %s: %s",
|
||||
task,
|
||||
self.fn_index[self.tasks_fnid[task]],
|
||||
self.tasks_name[task],
|
||||
self.tasks_tdepends[task])
|
||||
|
||||
logger.debug(3, "dependency ids (per fn):")
|
||||
for fn in self.depids:
|
||||
logger.debug(3, " %s: %s", fn, self.depids[fn])
|
||||
for fnid in self.depids:
|
||||
logger.debug(3, " %s %s: %s", fnid, self.fn_index[fnid], self.depids[fnid])
|
||||
|
||||
logger.debug(3, "runtime dependency ids (per fn):")
|
||||
for fn in self.rdepids:
|
||||
logger.debug(3, " %s: %s", fn, self.rdepids[fn])
|
||||
for fnid in self.rdepids:
|
||||
logger.debug(3, " %s %s: %s", fnid, self.fn_index[fnid], self.rdepids[fnid])
|
||||
|
||||
@@ -49,9 +49,6 @@ class ReferenceTest(unittest.TestCase):
|
||||
def assertExecs(self, execs):
|
||||
self.assertEqual(self.execs, execs)
|
||||
|
||||
def assertContains(self, contains):
|
||||
self.assertEqual(self.contains, contains)
|
||||
|
||||
class VariableReferenceTest(ReferenceTest):
|
||||
|
||||
def parseExpression(self, exp):
|
||||
@@ -71,7 +68,7 @@ class VariableReferenceTest(ReferenceTest):
|
||||
|
||||
def test_python_reference(self):
|
||||
self.setEmptyVars(["BAR"])
|
||||
self.parseExpression("${@d.getVar('BAR') + 'foo'}")
|
||||
self.parseExpression("${@bb.data.getVar('BAR', d, True) + 'foo'}")
|
||||
self.assertReferences(set(["BAR"]))
|
||||
|
||||
class ShellReferenceTest(ReferenceTest):
|
||||
@@ -194,8 +191,8 @@ class PythonReferenceTest(ReferenceTest):
|
||||
if hasattr(bb.utils, "_context"):
|
||||
self.context = bb.utils._context
|
||||
else:
|
||||
import builtins
|
||||
self.context = builtins.__dict__
|
||||
import __builtin__
|
||||
self.context = __builtin__.__dict__
|
||||
|
||||
def parseExpression(self, exp):
|
||||
parsedvar = self.d.expandWithRefs(exp, None)
|
||||
@@ -204,7 +201,6 @@ class PythonReferenceTest(ReferenceTest):
|
||||
|
||||
self.references = parsedvar.references | parser.references
|
||||
self.execs = parser.execs
|
||||
self.contains = parser.contains
|
||||
|
||||
@staticmethod
|
||||
def indent(value):
|
||||
@@ -213,17 +209,17 @@ be. These unit tests are testing snippets."""
|
||||
return " " + value
|
||||
|
||||
def test_getvar_reference(self):
|
||||
self.parseExpression("d.getVar('foo')")
|
||||
self.parseExpression("bb.data.getVar('foo', d, True)")
|
||||
self.assertReferences(set(["foo"]))
|
||||
self.assertExecs(set())
|
||||
|
||||
def test_getvar_computed_reference(self):
|
||||
self.parseExpression("d.getVar('f' + 'o' + 'o')")
|
||||
self.parseExpression("bb.data.getVar('f' + 'o' + 'o', d, True)")
|
||||
self.assertReferences(set())
|
||||
self.assertExecs(set())
|
||||
|
||||
def test_getvar_exec_reference(self):
|
||||
self.parseExpression("eval('d.getVar(\"foo\")')")
|
||||
self.parseExpression("eval('bb.data.getVar(\"foo\", d, True)')")
|
||||
self.assertReferences(set())
|
||||
self.assertExecs(set(["eval"]))
|
||||
|
||||
@@ -269,35 +265,15 @@ be. These unit tests are testing snippets."""
|
||||
self.assertExecs(set(["testget"]))
|
||||
del self.context["testget"]
|
||||
|
||||
def test_contains(self):
|
||||
self.parseExpression('bb.utils.contains("TESTVAR", "one", "true", "false", d)')
|
||||
self.assertContains({'TESTVAR': {'one'}})
|
||||
|
||||
def test_contains_multi(self):
|
||||
self.parseExpression('bb.utils.contains("TESTVAR", "one two", "true", "false", d)')
|
||||
self.assertContains({'TESTVAR': {'one two'}})
|
||||
|
||||
def test_contains_any(self):
|
||||
self.parseExpression('bb.utils.contains_any("TESTVAR", "hello", "true", "false", d)')
|
||||
self.assertContains({'TESTVAR': {'hello'}})
|
||||
|
||||
def test_contains_any_multi(self):
|
||||
self.parseExpression('bb.utils.contains_any("TESTVAR", "one two three", "true", "false", d)')
|
||||
self.assertContains({'TESTVAR': {'one', 'two', 'three'}})
|
||||
|
||||
def test_contains_filter(self):
|
||||
self.parseExpression('bb.utils.filter("TESTVAR", "hello there world", d)')
|
||||
self.assertContains({'TESTVAR': {'hello', 'there', 'world'}})
|
||||
|
||||
|
||||
class DependencyReferenceTest(ReferenceTest):
|
||||
|
||||
pydata = """
|
||||
d.getVar('somevar')
|
||||
bb.data.getVar('somevar', d, True)
|
||||
def test(d):
|
||||
foo = 'bar %s' % 'foo'
|
||||
def test2(d):
|
||||
d.getVar(foo)
|
||||
d.getVar(foo, True)
|
||||
d.getVar('bar', False)
|
||||
test2(d)
|
||||
|
||||
@@ -309,24 +285,19 @@ def a():
|
||||
|
||||
test(d)
|
||||
|
||||
d.expand(d.getVar("something", False))
|
||||
d.expand("${inexpand} somethingelse")
|
||||
d.getVar(a(), False)
|
||||
bb.data.expand(bb.data.getVar("something", False, d), d)
|
||||
bb.data.expand("${inexpand} somethingelse", d)
|
||||
bb.data.getVar(a(), d, False)
|
||||
"""
|
||||
|
||||
def test_python(self):
|
||||
self.d.setVar("FOO", self.pydata)
|
||||
self.setEmptyVars(["inexpand", "a", "test2", "test"])
|
||||
self.d.setVarFlags("FOO", {
|
||||
"func": True,
|
||||
"python": True,
|
||||
"lineno": 1,
|
||||
"filename": "example.bb",
|
||||
})
|
||||
self.d.setVarFlags("FOO", {"func": True, "python": True})
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEqual(deps, set(["somevar", "bar", "something", "inexpand", "test", "test2", "a"]))
|
||||
self.assertEquals(deps, set(["somevar", "bar", "something", "inexpand", "test", "test2", "a"]))
|
||||
|
||||
|
||||
shelldata = """
|
||||
@@ -373,7 +344,7 @@ esac
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEqual(deps, set(["somevar", "inverted"] + execs))
|
||||
self.assertEquals(deps, set(["somevar", "inverted"] + execs))
|
||||
|
||||
|
||||
def test_vardeps(self):
|
||||
@@ -383,7 +354,7 @@ esac
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEqual(deps, set(["oe_libinstall"]))
|
||||
self.assertEquals(deps, set(["oe_libinstall"]))
|
||||
|
||||
def test_vardeps_expand(self):
|
||||
self.d.setVar("oe_libinstall", "echo test")
|
||||
@@ -392,31 +363,7 @@ esac
|
||||
|
||||
deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), self.d)
|
||||
|
||||
self.assertEqual(deps, set(["oe_libinstall"]))
|
||||
|
||||
def test_contains_vardeps(self):
|
||||
expr = '${@bb.utils.filter("TESTVAR", "somevalue anothervalue", d)} \
|
||||
${@bb.utils.contains("TESTVAR", "testval testval2", "yetanothervalue", "", d)} \
|
||||
${@bb.utils.contains("TESTVAR", "testval2 testval3", "blah", "", d)} \
|
||||
${@bb.utils.contains_any("TESTVAR", "testval2 testval3", "lastone", "", d)}'
|
||||
parsedvar = self.d.expandWithRefs(expr, None)
|
||||
# Check contains
|
||||
self.assertEqual(parsedvar.contains, {'TESTVAR': {'testval2 testval3', 'anothervalue', 'somevalue', 'testval testval2', 'testval2', 'testval3'}})
|
||||
# Check dependencies
|
||||
self.d.setVar('ANOTHERVAR', expr)
|
||||
self.d.setVar('TESTVAR', 'anothervalue testval testval2')
|
||||
deps, values = bb.data.build_dependencies("ANOTHERVAR", set(self.d.keys()), set(), set(), self.d)
|
||||
self.assertEqual(sorted(values.splitlines()),
|
||||
sorted([expr,
|
||||
'TESTVAR{anothervalue} = Set',
|
||||
'TESTVAR{somevalue} = Unset',
|
||||
'TESTVAR{testval testval2} = Set',
|
||||
'TESTVAR{testval2 testval3} = Unset',
|
||||
'TESTVAR{testval2} = Set',
|
||||
'TESTVAR{testval3} = Unset'
|
||||
]))
|
||||
# Check final value
|
||||
self.assertEqual(self.d.getVar('ANOTHERVAR').split(), ['anothervalue', 'yetanothervalue', 'lastone'])
|
||||
self.assertEquals(deps, set(["oe_libinstall"]))
|
||||
|
||||
#Currently no wildcard support
|
||||
#def test_vardeps_wildcards(self):
|
||||
|
||||
@@ -34,14 +34,14 @@ class COWTestCase(unittest.TestCase):
|
||||
from bb.COW import COWDictBase
|
||||
a = COWDictBase.copy()
|
||||
|
||||
self.assertEqual(False, 'a' in a)
|
||||
self.assertEquals(False, a.has_key('a'))
|
||||
|
||||
a['a'] = 'a'
|
||||
a['b'] = 'b'
|
||||
self.assertEqual(True, 'a' in a)
|
||||
self.assertEqual(True, 'b' in a)
|
||||
self.assertEqual('a', a['a'] )
|
||||
self.assertEqual('b', a['b'] )
|
||||
self.assertEquals(True, a.has_key('a'))
|
||||
self.assertEquals(True, a.has_key('b'))
|
||||
self.assertEquals('a', a['a'] )
|
||||
self.assertEquals('b', a['b'] )
|
||||
|
||||
def testCopyCopy(self):
|
||||
"""
|
||||
@@ -60,31 +60,31 @@ class COWTestCase(unittest.TestCase):
|
||||
c['a'] = 30
|
||||
|
||||
# test separation of the two instances
|
||||
self.assertEqual(False, 'c' in c)
|
||||
self.assertEqual(30, c['a'])
|
||||
self.assertEqual(10, b['a'])
|
||||
self.assertEquals(False, c.has_key('c'))
|
||||
self.assertEquals(30, c['a'])
|
||||
self.assertEquals(10, b['a'])
|
||||
|
||||
# test copy
|
||||
b_2 = b.copy()
|
||||
c_2 = c.copy()
|
||||
|
||||
self.assertEqual(False, 'c' in c_2)
|
||||
self.assertEqual(10, b_2['a'])
|
||||
self.assertEquals(False, c_2.has_key('c'))
|
||||
self.assertEquals(10, b_2['a'])
|
||||
|
||||
b_2['d'] = 40
|
||||
self.assertEqual(False, 'd' in c_2)
|
||||
self.assertEqual(True, 'd' in b_2)
|
||||
self.assertEqual(40, b_2['d'])
|
||||
self.assertEqual(False, 'd' in b)
|
||||
self.assertEqual(False, 'd' in c)
|
||||
self.assertEquals(False, c_2.has_key('d'))
|
||||
self.assertEquals(True, b_2.has_key('d'))
|
||||
self.assertEquals(40, b_2['d'])
|
||||
self.assertEquals(False, b.has_key('d'))
|
||||
self.assertEquals(False, c.has_key('d'))
|
||||
|
||||
c_2['d'] = 30
|
||||
self.assertEqual(True, 'd' in c_2)
|
||||
self.assertEqual(True, 'd' in b_2)
|
||||
self.assertEqual(30, c_2['d'])
|
||||
self.assertEqual(40, b_2['d'])
|
||||
self.assertEqual(False, 'd' in b)
|
||||
self.assertEqual(False, 'd' in c)
|
||||
self.assertEquals(True, c_2.has_key('d'))
|
||||
self.assertEquals(True, b_2.has_key('d'))
|
||||
self.assertEquals(30, c_2['d'])
|
||||
self.assertEquals(40, b_2['d'])
|
||||
self.assertEquals(False, b.has_key('d'))
|
||||
self.assertEquals(False, c.has_key('d'))
|
||||
|
||||
# test copy of the copy
|
||||
c_3 = c_2.copy()
|
||||
@@ -92,19 +92,19 @@ class COWTestCase(unittest.TestCase):
|
||||
b_3_2 = b_2.copy()
|
||||
|
||||
c_3['e'] = 4711
|
||||
self.assertEqual(4711, c_3['e'])
|
||||
self.assertEqual(False, 'e' in c_2)
|
||||
self.assertEqual(False, 'e' in b_3)
|
||||
self.assertEqual(False, 'e' in b_3_2)
|
||||
self.assertEqual(False, 'e' in b_2)
|
||||
self.assertEquals(4711, c_3['e'])
|
||||
self.assertEquals(False, c_2.has_key('e'))
|
||||
self.assertEquals(False, b_3.has_key('e'))
|
||||
self.assertEquals(False, b_3_2.has_key('e'))
|
||||
self.assertEquals(False, b_2.has_key('e'))
|
||||
|
||||
b_3['e'] = 'viel'
|
||||
self.assertEqual('viel', b_3['e'])
|
||||
self.assertEqual(4711, c_3['e'])
|
||||
self.assertEqual(False, 'e' in c_2)
|
||||
self.assertEqual(True, 'e' in b_3)
|
||||
self.assertEqual(False, 'e' in b_3_2)
|
||||
self.assertEqual(False, 'e' in b_2)
|
||||
self.assertEquals('viel', b_3['e'])
|
||||
self.assertEquals(4711, c_3['e'])
|
||||
self.assertEquals(False, c_2.has_key('e'))
|
||||
self.assertEquals(True, b_3.has_key('e'))
|
||||
self.assertEquals(False, b_3_2.has_key('e'))
|
||||
self.assertEquals(False, b_2.has_key('e'))
|
||||
|
||||
def testCow(self):
|
||||
from bb.COW import COWDictBase
|
||||
@@ -115,12 +115,12 @@ class COWTestCase(unittest.TestCase):
|
||||
|
||||
copy = c.copy()
|
||||
|
||||
self.assertEqual(1027, c['123'])
|
||||
self.assertEqual(4711, c['other'])
|
||||
self.assertEqual({'abc':10, 'bcd':20}, c['d'])
|
||||
self.assertEqual(1027, copy['123'])
|
||||
self.assertEqual(4711, copy['other'])
|
||||
self.assertEqual({'abc':10, 'bcd':20}, copy['d'])
|
||||
self.assertEquals(1027, c['123'])
|
||||
self.assertEquals(4711, c['other'])
|
||||
self.assertEquals({'abc':10, 'bcd':20}, c['d'])
|
||||
self.assertEquals(1027, copy['123'])
|
||||
self.assertEquals(4711, copy['other'])
|
||||
self.assertEquals({'abc':10, 'bcd':20}, copy['d'])
|
||||
|
||||
# cow it now
|
||||
copy['123'] = 1028
|
||||
@@ -128,9 +128,9 @@ class COWTestCase(unittest.TestCase):
|
||||
copy['d']['abc'] = 20
|
||||
|
||||
|
||||
self.assertEqual(1027, c['123'])
|
||||
self.assertEqual(4711, c['other'])
|
||||
self.assertEqual({'abc':10, 'bcd':20}, c['d'])
|
||||
self.assertEqual(1028, copy['123'])
|
||||
self.assertEqual(4712, copy['other'])
|
||||
self.assertEqual({'abc':20, 'bcd':20}, copy['d'])
|
||||
self.assertEquals(1027, c['123'])
|
||||
self.assertEquals(4711, c['other'])
|
||||
self.assertEquals({'abc':10, 'bcd':20}, c['d'])
|
||||
self.assertEquals(1028, copy['123'])
|
||||
self.assertEquals(4712, copy['other'])
|
||||
self.assertEquals({'abc':20, 'bcd':20}, copy['d'])
|
||||
|
||||
@@ -24,30 +24,6 @@ import unittest
|
||||
import bb
|
||||
import bb.data
|
||||
import bb.parse
|
||||
import logging
|
||||
|
||||
class LogRecord():
|
||||
def __enter__(self):
|
||||
logs = []
|
||||
class LogHandler(logging.Handler):
|
||||
def emit(self, record):
|
||||
logs.append(record)
|
||||
logger = logging.getLogger("BitBake")
|
||||
handler = LogHandler()
|
||||
self.handler = handler
|
||||
logger.addHandler(handler)
|
||||
return logs
|
||||
def __exit__(self, type, value, traceback):
|
||||
logger = logging.getLogger("BitBake")
|
||||
logger.removeHandler(self.handler)
|
||||
return
|
||||
|
||||
def logContains(item, logs):
|
||||
for l in logs:
|
||||
m = l.getMessage()
|
||||
if item in m:
|
||||
return True
|
||||
return False
|
||||
|
||||
class DataExpansions(unittest.TestCase):
|
||||
def setUp(self):
|
||||
@@ -77,14 +53,9 @@ class DataExpansions(unittest.TestCase):
|
||||
self.assertEqual(str(val), "boo value_of_foo")
|
||||
|
||||
def test_python_snippet_getvar(self):
|
||||
val = self.d.expand("${@d.getVar('foo') + ' ${bar}'}")
|
||||
val = self.d.expand("${@d.getVar('foo', True) + ' ${bar}'}")
|
||||
self.assertEqual(str(val), "value_of_foo value_of_bar")
|
||||
|
||||
def test_python_unexpanded(self):
|
||||
self.d.setVar("bar", "${unsetvar}")
|
||||
val = self.d.expand("${@d.getVar('foo') + ' ${bar}'}")
|
||||
self.assertEqual(str(val), "${@d.getVar('foo') + ' ${unsetvar}'}")
|
||||
|
||||
def test_python_snippet_syntax_error(self):
|
||||
self.d.setVar("FOO", "${@foo = 5}")
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
@@ -99,7 +70,7 @@ class DataExpansions(unittest.TestCase):
|
||||
self.assertRaises(bb.data_smart.ExpansionError, self.d.getVar, "FOO", True)
|
||||
|
||||
def test_value_containing_value(self):
|
||||
val = self.d.expand("${@d.getVar('foo') + ' ${bar}'}")
|
||||
val = self.d.expand("${@d.getVar('foo', True) + ' ${bar}'}")
|
||||
self.assertEqual(str(val), "value_of_foo value_of_bar")
|
||||
|
||||
def test_reference_undefined_var(self):
|
||||
@@ -109,7 +80,7 @@ class DataExpansions(unittest.TestCase):
|
||||
def test_double_reference(self):
|
||||
self.d.setVar("BAR", "bar value")
|
||||
self.d.setVar("FOO", "${BAR} foo ${BAR}")
|
||||
val = self.d.getVar("FOO")
|
||||
val = self.d.getVar("FOO", True)
|
||||
self.assertEqual(str(val), "bar value foo bar value")
|
||||
|
||||
def test_direct_recursion(self):
|
||||
@@ -129,32 +100,26 @@ class DataExpansions(unittest.TestCase):
|
||||
|
||||
def test_incomplete_varexp_single_quotes(self):
|
||||
self.d.setVar("FOO", "sed -i -e 's:IP{:I${:g' $pc")
|
||||
val = self.d.getVar("FOO")
|
||||
val = self.d.getVar("FOO", True)
|
||||
self.assertEqual(str(val), "sed -i -e 's:IP{:I${:g' $pc")
|
||||
|
||||
def test_nonstring(self):
|
||||
self.d.setVar("TEST", 5)
|
||||
val = self.d.getVar("TEST")
|
||||
val = self.d.getVar("TEST", True)
|
||||
self.assertEqual(str(val), "5")
|
||||
|
||||
def test_rename(self):
|
||||
self.d.renameVar("foo", "newfoo")
|
||||
self.assertEqual(self.d.getVar("newfoo", False), "value_of_foo")
|
||||
self.assertEqual(self.d.getVar("foo", False), None)
|
||||
self.assertEqual(self.d.getVar("newfoo"), "value_of_foo")
|
||||
self.assertEqual(self.d.getVar("foo"), None)
|
||||
|
||||
def test_deletion(self):
|
||||
self.d.delVar("foo")
|
||||
self.assertEqual(self.d.getVar("foo", False), None)
|
||||
self.assertEqual(self.d.getVar("foo"), None)
|
||||
|
||||
def test_keys(self):
|
||||
keys = list(self.d.keys())
|
||||
self.assertCountEqual(keys, ['value_of_foo', 'foo', 'bar'])
|
||||
|
||||
def test_keys_deletion(self):
|
||||
newd = bb.data.createCopy(self.d)
|
||||
newd.delVar("bar")
|
||||
keys = list(newd.keys())
|
||||
self.assertCountEqual(keys, ['value_of_foo', 'foo'])
|
||||
keys = self.d.keys()
|
||||
self.assertEqual(keys, ['value_of_foo', 'foo', 'bar'])
|
||||
|
||||
class TestNestedExpansions(unittest.TestCase):
|
||||
def setUp(self):
|
||||
@@ -201,28 +166,28 @@ class TestMemoize(unittest.TestCase):
|
||||
def test_memoized(self):
|
||||
d = bb.data.init()
|
||||
d.setVar("FOO", "bar")
|
||||
self.assertTrue(d.getVar("FOO", False) is d.getVar("FOO", False))
|
||||
self.assertTrue(d.getVar("FOO") is d.getVar("FOO"))
|
||||
|
||||
def test_not_memoized(self):
|
||||
d1 = bb.data.init()
|
||||
d2 = bb.data.init()
|
||||
d1.setVar("FOO", "bar")
|
||||
d2.setVar("FOO", "bar2")
|
||||
self.assertTrue(d1.getVar("FOO", False) is not d2.getVar("FOO", False))
|
||||
self.assertTrue(d1.getVar("FOO") is not d2.getVar("FOO"))
|
||||
|
||||
def test_changed_after_memoized(self):
|
||||
d = bb.data.init()
|
||||
d.setVar("foo", "value of foo")
|
||||
self.assertEqual(str(d.getVar("foo", False)), "value of foo")
|
||||
self.assertEqual(str(d.getVar("foo")), "value of foo")
|
||||
d.setVar("foo", "second value of foo")
|
||||
self.assertEqual(str(d.getVar("foo", False)), "second value of foo")
|
||||
self.assertEqual(str(d.getVar("foo")), "second value of foo")
|
||||
|
||||
def test_same_value(self):
|
||||
d = bb.data.init()
|
||||
d.setVar("foo", "value of")
|
||||
d.setVar("bar", "value of")
|
||||
self.assertEqual(d.getVar("foo", False),
|
||||
d.getVar("bar", False))
|
||||
self.assertEqual(d.getVar("foo"),
|
||||
d.getVar("bar"))
|
||||
|
||||
class TestConcat(unittest.TestCase):
|
||||
def setUp(self):
|
||||
@@ -234,19 +199,19 @@ class TestConcat(unittest.TestCase):
|
||||
def test_prepend(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.prependVar("TEST", "${FOO}:")
|
||||
self.assertEqual(self.d.getVar("TEST"), "foo:val")
|
||||
self.assertEqual(self.d.getVar("TEST", True), "foo:val")
|
||||
|
||||
def test_append(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.appendVar("TEST", ":${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST"), "val:bar")
|
||||
self.assertEqual(self.d.getVar("TEST", True), "val:bar")
|
||||
|
||||
def test_multiple_append(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.prependVar("TEST", "${FOO}:")
|
||||
self.d.appendVar("TEST", ":val2")
|
||||
self.d.appendVar("TEST", ":${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST"), "foo:val:val2:bar")
|
||||
self.assertEqual(self.d.getVar("TEST", True), "foo:val:val2:bar")
|
||||
|
||||
class TestConcatOverride(unittest.TestCase):
|
||||
def setUp(self):
|
||||
@@ -258,66 +223,55 @@ class TestConcatOverride(unittest.TestCase):
|
||||
def test_prepend(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.setVar("TEST_prepend", "${FOO}:")
|
||||
self.assertEqual(self.d.getVar("TEST"), "foo:val")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "foo:val")
|
||||
|
||||
def test_append(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.setVar("TEST_append", ":${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST"), "val:bar")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "val:bar")
|
||||
|
||||
def test_multiple_append(self):
|
||||
self.d.setVar("TEST", "${VAL}")
|
||||
self.d.setVar("TEST_prepend", "${FOO}:")
|
||||
self.d.setVar("TEST_append", ":val2")
|
||||
self.d.setVar("TEST_append", ":${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST"), "foo:val:val2:bar")
|
||||
|
||||
def test_append_unset(self):
|
||||
self.d.setVar("TEST_prepend", "${FOO}:")
|
||||
self.d.setVar("TEST_append", ":val2")
|
||||
self.d.setVar("TEST_append", ":${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST"), "foo::val2:bar")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "foo:val:val2:bar")
|
||||
|
||||
def test_remove(self):
|
||||
self.d.setVar("TEST", "${VAL} ${BAR}")
|
||||
self.d.setVar("TEST_remove", "val")
|
||||
self.assertEqual(self.d.getVar("TEST"), "bar")
|
||||
|
||||
def test_remove_cleared(self):
|
||||
self.d.setVar("TEST", "${VAL} ${BAR}")
|
||||
self.d.setVar("TEST_remove", "val")
|
||||
self.d.setVar("TEST", "${VAL} ${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST"), "val bar")
|
||||
|
||||
# Ensure the value is unchanged if we have an inactive remove override
|
||||
# (including that whitespace is preserved)
|
||||
def test_remove_inactive_override(self):
|
||||
self.d.setVar("TEST", "${VAL} ${BAR} 123")
|
||||
self.d.setVar("TEST_remove_inactiveoverride", "val")
|
||||
self.assertEqual(self.d.getVar("TEST"), "val bar 123")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "bar")
|
||||
|
||||
def test_doubleref_remove(self):
|
||||
self.d.setVar("TEST", "${VAL} ${BAR}")
|
||||
self.d.setVar("TEST_remove", "val")
|
||||
self.d.setVar("TEST_TEST", "${TEST} ${TEST}")
|
||||
self.assertEqual(self.d.getVar("TEST_TEST"), "bar bar")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST_TEST", True), "bar bar")
|
||||
|
||||
def test_empty_remove(self):
|
||||
self.d.setVar("TEST", "")
|
||||
self.d.setVar("TEST_remove", "val")
|
||||
self.assertEqual(self.d.getVar("TEST"), "")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "")
|
||||
|
||||
def test_remove_expansion(self):
|
||||
self.d.setVar("BAR", "Z")
|
||||
self.d.setVar("TEST", "${BAR}/X Y")
|
||||
self.d.setVar("TEST_remove", "${BAR}/X")
|
||||
self.assertEqual(self.d.getVar("TEST"), "Y")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "Y")
|
||||
|
||||
def test_remove_expansion_items(self):
|
||||
self.d.setVar("TEST", "A B C D")
|
||||
self.d.setVar("BAR", "B D")
|
||||
self.d.setVar("TEST_remove", "${BAR}")
|
||||
self.assertEqual(self.d.getVar("TEST"), "A C")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "A C")
|
||||
|
||||
class TestOverrides(unittest.TestCase):
|
||||
def setUp(self):
|
||||
@@ -326,67 +280,21 @@ class TestOverrides(unittest.TestCase):
|
||||
self.d.setVar("TEST", "testvalue")
|
||||
|
||||
def test_no_override(self):
|
||||
self.assertEqual(self.d.getVar("TEST"), "testvalue")
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "testvalue")
|
||||
|
||||
def test_one_override(self):
|
||||
self.d.setVar("TEST_bar", "testvalue2")
|
||||
self.assertEqual(self.d.getVar("TEST"), "testvalue2")
|
||||
|
||||
def test_one_override_unset(self):
|
||||
self.d.setVar("TEST2_bar", "testvalue2")
|
||||
|
||||
self.assertEqual(self.d.getVar("TEST2"), "testvalue2")
|
||||
self.assertCountEqual(list(self.d.keys()), ['TEST', 'TEST2', 'OVERRIDES', 'TEST2_bar'])
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "testvalue2")
|
||||
|
||||
def test_multiple_override(self):
|
||||
self.d.setVar("TEST_bar", "testvalue2")
|
||||
self.d.setVar("TEST_local", "testvalue3")
|
||||
self.d.setVar("TEST_foo", "testvalue4")
|
||||
self.assertEqual(self.d.getVar("TEST"), "testvalue3")
|
||||
self.assertCountEqual(list(self.d.keys()), ['TEST', 'TEST_foo', 'OVERRIDES', 'TEST_bar', 'TEST_local'])
|
||||
bb.data.update_data(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST", True), "testvalue3")
|
||||
|
||||
def test_multiple_combined_overrides(self):
|
||||
self.d.setVar("TEST_local_foo_bar", "testvalue3")
|
||||
self.assertEqual(self.d.getVar("TEST"), "testvalue3")
|
||||
|
||||
def test_multiple_overrides_unset(self):
|
||||
self.d.setVar("TEST2_local_foo_bar", "testvalue3")
|
||||
self.assertEqual(self.d.getVar("TEST2"), "testvalue3")
|
||||
|
||||
def test_keyexpansion_override(self):
|
||||
self.d.setVar("LOCAL", "local")
|
||||
self.d.setVar("TEST_bar", "testvalue2")
|
||||
self.d.setVar("TEST_${LOCAL}", "testvalue3")
|
||||
self.d.setVar("TEST_foo", "testvalue4")
|
||||
bb.data.expandKeys(self.d)
|
||||
self.assertEqual(self.d.getVar("TEST"), "testvalue3")
|
||||
|
||||
def test_rename_override(self):
|
||||
self.d.setVar("ALTERNATIVE_ncurses-tools_class-target", "a")
|
||||
self.d.setVar("OVERRIDES", "class-target")
|
||||
self.d.renameVar("ALTERNATIVE_ncurses-tools", "ALTERNATIVE_lib32-ncurses-tools")
|
||||
self.assertEqual(self.d.getVar("ALTERNATIVE_lib32-ncurses-tools"), "a")
|
||||
|
||||
def test_underscore_override(self):
|
||||
self.d.setVar("TEST_bar", "testvalue2")
|
||||
self.d.setVar("TEST_some_val", "testvalue3")
|
||||
self.d.setVar("TEST_foo", "testvalue4")
|
||||
self.d.setVar("OVERRIDES", "foo:bar:some_val")
|
||||
self.assertEqual(self.d.getVar("TEST"), "testvalue3")
|
||||
|
||||
class TestKeyExpansion(unittest.TestCase):
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
self.d.setVar("FOO", "foo")
|
||||
self.d.setVar("BAR", "foo")
|
||||
|
||||
def test_keyexpand(self):
|
||||
self.d.setVar("VAL_${FOO}", "A")
|
||||
self.d.setVar("VAL_${BAR}", "B")
|
||||
with LogRecord() as logs:
|
||||
bb.data.expandKeys(self.d)
|
||||
self.assertTrue(logContains("Variable key VAL_${FOO} (A) replaces original key VAL_foo (B)", logs))
|
||||
self.assertEqual(self.d.getVar("VAL_foo"), "A")
|
||||
|
||||
class TestFlags(unittest.TestCase):
|
||||
def setUp(self):
|
||||
@@ -396,13 +304,13 @@ class TestFlags(unittest.TestCase):
|
||||
self.d.setVarFlag("foo", "flag2", "value of flag2")
|
||||
|
||||
def test_setflag(self):
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag1", False), "value of flag1")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag2", False), "value of flag2")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag1"), "value of flag1")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag2"), "value of flag2")
|
||||
|
||||
def test_delflag(self):
|
||||
self.d.delVarFlag("foo", "flag2")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag1", False), "value of flag1")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag2", False), None)
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag1"), "value of flag1")
|
||||
self.assertEqual(self.d.getVarFlag("foo", "flag2"), None)
|
||||
|
||||
|
||||
class Contains(unittest.TestCase):
|
||||
@@ -441,167 +349,3 @@ class Contains(unittest.TestCase):
|
||||
|
||||
self.assertFalse(bb.utils.contains_any("SOMEFLAG", "x", True, False, self.d))
|
||||
self.assertFalse(bb.utils.contains_any("SOMEFLAG", "x y z", True, False, self.d))
|
||||
|
||||
|
||||
class Serialize(unittest.TestCase):
|
||||
|
||||
def test_serialize(self):
|
||||
import tempfile
|
||||
import pickle
|
||||
d = bb.data.init()
|
||||
d.enableTracking()
|
||||
d.setVar('HELLO', 'world')
|
||||
d.setVarFlag('HELLO', 'other', 'planet')
|
||||
with tempfile.NamedTemporaryFile(delete=False) as tmpfile:
|
||||
tmpfilename = tmpfile.name
|
||||
pickle.dump(d, tmpfile)
|
||||
|
||||
with open(tmpfilename, 'rb') as f:
|
||||
newd = pickle.load(f)
|
||||
|
||||
os.remove(tmpfilename)
|
||||
|
||||
self.assertEqual(d, newd)
|
||||
self.assertEqual(newd.getVar('HELLO'), 'world')
|
||||
self.assertEqual(newd.getVarFlag('HELLO', 'other'), 'planet')
|
||||
|
||||
|
||||
# Remote datastore tests
|
||||
# These really only test the interface, since in actual usage we have a
|
||||
# tinfoil connector that does everything over RPC, and this doesn't test
|
||||
# that.
|
||||
|
||||
class TestConnector:
|
||||
d = None
|
||||
def __init__(self, d):
|
||||
self.d = d
|
||||
def getVar(self, name):
|
||||
return self.d._findVar(name)
|
||||
def getKeys(self):
|
||||
return set(self.d.keys())
|
||||
def getVarHistory(self, name):
|
||||
return self.d.varhistory.variable(name)
|
||||
def expandPythonRef(self, varname, expr, d):
|
||||
localdata = self.d.createCopy()
|
||||
for key in d.localkeys():
|
||||
localdata.setVar(d.getVar(key))
|
||||
varparse = bb.data_smart.VariableParse(varname, localdata)
|
||||
return varparse.python_sub(expr)
|
||||
def setVar(self, name, value):
|
||||
self.d.setVar(name, value)
|
||||
def setVarFlag(self, name, flag, value):
|
||||
self.d.setVarFlag(name, flag, value)
|
||||
def delVar(self, name):
|
||||
self.d.delVar(name)
|
||||
return False
|
||||
def delVarFlag(self, name, flag):
|
||||
self.d.delVarFlag(name, flag)
|
||||
return False
|
||||
def renameVar(self, name, newname):
|
||||
self.d.renameVar(name, newname)
|
||||
return False
|
||||
|
||||
class Remote(unittest.TestCase):
|
||||
def test_remote(self):
|
||||
|
||||
d1 = bb.data.init()
|
||||
d1.enableTracking()
|
||||
d2 = bb.data.init()
|
||||
d2.enableTracking()
|
||||
connector = TestConnector(d1)
|
||||
|
||||
d2.setVar('_remote_data', connector)
|
||||
|
||||
d1.setVar('HELLO', 'world')
|
||||
d1.setVarFlag('OTHER', 'flagname', 'flagvalue')
|
||||
self.assertEqual(d2.getVar('HELLO'), 'world')
|
||||
self.assertEqual(d2.expand('${HELLO}'), 'world')
|
||||
self.assertEqual(d2.expand('${@d.getVar("HELLO")}'), 'world')
|
||||
self.assertIn('flagname', d2.getVarFlags('OTHER'))
|
||||
self.assertEqual(d2.getVarFlag('OTHER', 'flagname'), 'flagvalue')
|
||||
self.assertEqual(d1.varhistory.variable('HELLO'), d2.varhistory.variable('HELLO'))
|
||||
# Test setVar on client side affects server
|
||||
d2.setVar('HELLO', 'other-world')
|
||||
self.assertEqual(d1.getVar('HELLO'), 'other-world')
|
||||
# Test setVarFlag on client side affects server
|
||||
d2.setVarFlag('HELLO', 'flagname', 'flagvalue')
|
||||
self.assertEqual(d1.getVarFlag('HELLO', 'flagname'), 'flagvalue')
|
||||
# Test client side data is incorporated in python expansion (which is done on server)
|
||||
d2.setVar('FOO', 'bar')
|
||||
self.assertEqual(d2.expand('${@d.getVar("FOO")}'), 'bar')
|
||||
# Test overrides work
|
||||
d1.setVar('FOO_test', 'baz')
|
||||
d1.appendVar('OVERRIDES', ':test')
|
||||
self.assertEqual(d2.getVar('FOO'), 'baz')
|
||||
|
||||
|
||||
# Remote equivalents of local test classes
|
||||
# Note that these aren't perfect since we only test in one direction
|
||||
|
||||
class RemoteDataExpansions(DataExpansions):
|
||||
def setUp(self):
|
||||
self.d1 = bb.data.init()
|
||||
self.d = bb.data.init()
|
||||
self.d1["foo"] = "value_of_foo"
|
||||
self.d1["bar"] = "value_of_bar"
|
||||
self.d1["value_of_foo"] = "value_of_'value_of_foo'"
|
||||
connector = TestConnector(self.d1)
|
||||
self.d.setVar('_remote_data', connector)
|
||||
|
||||
class TestRemoteNestedExpansions(TestNestedExpansions):
|
||||
def setUp(self):
|
||||
self.d1 = bb.data.init()
|
||||
self.d = bb.data.init()
|
||||
self.d1["foo"] = "foo"
|
||||
self.d1["bar"] = "bar"
|
||||
self.d1["value_of_foobar"] = "187"
|
||||
connector = TestConnector(self.d1)
|
||||
self.d.setVar('_remote_data', connector)
|
||||
|
||||
class TestRemoteConcat(TestConcat):
|
||||
def setUp(self):
|
||||
self.d1 = bb.data.init()
|
||||
self.d = bb.data.init()
|
||||
self.d1.setVar("FOO", "foo")
|
||||
self.d1.setVar("VAL", "val")
|
||||
self.d1.setVar("BAR", "bar")
|
||||
connector = TestConnector(self.d1)
|
||||
self.d.setVar('_remote_data', connector)
|
||||
|
||||
class TestRemoteConcatOverride(TestConcatOverride):
|
||||
def setUp(self):
|
||||
self.d1 = bb.data.init()
|
||||
self.d = bb.data.init()
|
||||
self.d1.setVar("FOO", "foo")
|
||||
self.d1.setVar("VAL", "val")
|
||||
self.d1.setVar("BAR", "bar")
|
||||
connector = TestConnector(self.d1)
|
||||
self.d.setVar('_remote_data', connector)
|
||||
|
||||
class TestRemoteOverrides(TestOverrides):
|
||||
def setUp(self):
|
||||
self.d1 = bb.data.init()
|
||||
self.d = bb.data.init()
|
||||
self.d1.setVar("OVERRIDES", "foo:bar:local")
|
||||
self.d1.setVar("TEST", "testvalue")
|
||||
connector = TestConnector(self.d1)
|
||||
self.d.setVar('_remote_data', connector)
|
||||
|
||||
class TestRemoteKeyExpansion(TestKeyExpansion):
|
||||
def setUp(self):
|
||||
self.d1 = bb.data.init()
|
||||
self.d = bb.data.init()
|
||||
self.d1.setVar("FOO", "foo")
|
||||
self.d1.setVar("BAR", "foo")
|
||||
connector = TestConnector(self.d1)
|
||||
self.d.setVar('_remote_data', connector)
|
||||
|
||||
class TestRemoteFlags(TestFlags):
|
||||
def setUp(self):
|
||||
self.d1 = bb.data.init()
|
||||
self.d = bb.data.init()
|
||||
self.d1.setVar("foo", "value of foo")
|
||||
self.d1.setVarFlag("foo", "flag1", "value of flag1")
|
||||
self.d1.setVarFlag("foo", "flag2", "value of flag2")
|
||||
connector = TestConnector(self.d1)
|
||||
self.d.setVar('_remote_data', connector)
|
||||
|
||||
@@ -1,986 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# BitBake Tests for the Event implementation (event.py)
|
||||
#
|
||||
# Copyright (C) 2017 Intel Corporation
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import bb
|
||||
import logging
|
||||
import bb.compat
|
||||
import bb.event
|
||||
import importlib
|
||||
import threading
|
||||
import time
|
||||
import pickle
|
||||
from unittest.mock import Mock
|
||||
from unittest.mock import call
|
||||
from bb.msg import BBLogFormatter
|
||||
|
||||
|
||||
class EventQueueStubBase(object):
|
||||
""" Base class for EventQueueStub classes """
|
||||
def __init__(self):
|
||||
self.event_calls = []
|
||||
return
|
||||
|
||||
def _store_event_data_string(self, event):
|
||||
if isinstance(event, logging.LogRecord):
|
||||
formatter = BBLogFormatter("%(levelname)s: %(message)s")
|
||||
self.event_calls.append(formatter.format(event))
|
||||
else:
|
||||
self.event_calls.append(bb.event.getName(event))
|
||||
return
|
||||
|
||||
|
||||
class EventQueueStub(EventQueueStubBase):
|
||||
""" Class used as specification for UI event handler queue stub objects """
|
||||
def __init__(self):
|
||||
super(EventQueueStub, self).__init__()
|
||||
|
||||
def send(self, event):
|
||||
super(EventQueueStub, self)._store_event_data_string(event)
|
||||
|
||||
|
||||
class PickleEventQueueStub(EventQueueStubBase):
|
||||
""" Class used as specification for UI event handler queue stub objects
|
||||
with sendpickle method """
|
||||
def __init__(self):
|
||||
super(PickleEventQueueStub, self).__init__()
|
||||
|
||||
def sendpickle(self, pickled_event):
|
||||
event = pickle.loads(pickled_event)
|
||||
super(PickleEventQueueStub, self)._store_event_data_string(event)
|
||||
|
||||
|
||||
class UIClientStub(object):
|
||||
""" Class used as specification for UI event handler stub objects """
|
||||
def __init__(self):
|
||||
self.event = None
|
||||
|
||||
|
||||
class EventHandlingTest(unittest.TestCase):
|
||||
""" Event handling test class """
|
||||
|
||||
|
||||
def setUp(self):
|
||||
self._test_process = Mock()
|
||||
ui_client1 = UIClientStub()
|
||||
ui_client2 = UIClientStub()
|
||||
self._test_ui1 = Mock(wraps=ui_client1)
|
||||
self._test_ui2 = Mock(wraps=ui_client2)
|
||||
importlib.reload(bb.event)
|
||||
|
||||
def _create_test_handlers(self):
|
||||
""" Method used to create a test handler ordered dictionary """
|
||||
test_handlers = bb.compat.OrderedDict()
|
||||
test_handlers["handler1"] = self._test_process.handler1
|
||||
test_handlers["handler2"] = self._test_process.handler2
|
||||
return test_handlers
|
||||
|
||||
def test_class_handlers(self):
|
||||
""" Test set_class_handlers and get_class_handlers methods """
|
||||
test_handlers = self._create_test_handlers()
|
||||
bb.event.set_class_handlers(test_handlers)
|
||||
self.assertEqual(test_handlers,
|
||||
bb.event.get_class_handlers())
|
||||
|
||||
def test_handlers(self):
|
||||
""" Test set_handlers and get_handlers """
|
||||
test_handlers = self._create_test_handlers()
|
||||
bb.event.set_handlers(test_handlers)
|
||||
self.assertEqual(test_handlers,
|
||||
bb.event.get_handlers())
|
||||
|
||||
def test_clean_class_handlers(self):
|
||||
""" Test clean_class_handlers method """
|
||||
cleanDict = bb.compat.OrderedDict()
|
||||
self.assertEqual(cleanDict,
|
||||
bb.event.clean_class_handlers())
|
||||
|
||||
def test_register(self):
|
||||
""" Test register method for class handlers """
|
||||
result = bb.event.register("handler", self._test_process.handler)
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
handlers_dict = bb.event.get_class_handlers()
|
||||
self.assertIn("handler", handlers_dict)
|
||||
|
||||
def test_already_registered(self):
|
||||
""" Test detection of an already registed class handler """
|
||||
bb.event.register("handler", self._test_process.handler)
|
||||
handlers_dict = bb.event.get_class_handlers()
|
||||
self.assertIn("handler", handlers_dict)
|
||||
result = bb.event.register("handler", self._test_process.handler)
|
||||
self.assertEqual(result, bb.event.AlreadyRegistered)
|
||||
|
||||
def test_register_from_string(self):
|
||||
""" Test register method receiving code in string """
|
||||
result = bb.event.register("string_handler", " return True")
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
handlers_dict = bb.event.get_class_handlers()
|
||||
self.assertIn("string_handler", handlers_dict)
|
||||
|
||||
def test_register_with_mask(self):
|
||||
""" Test register method with event masking """
|
||||
mask = ["bb.event.OperationStarted",
|
||||
"bb.event.OperationCompleted"]
|
||||
result = bb.event.register("event_handler",
|
||||
self._test_process.event_handler,
|
||||
mask)
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
handlers_dict = bb.event.get_class_handlers()
|
||||
self.assertIn("event_handler", handlers_dict)
|
||||
|
||||
def test_remove(self):
|
||||
""" Test remove method for class handlers """
|
||||
test_handlers = self._create_test_handlers()
|
||||
bb.event.set_class_handlers(test_handlers)
|
||||
count = len(test_handlers)
|
||||
bb.event.remove("handler1", None)
|
||||
test_handlers = bb.event.get_class_handlers()
|
||||
self.assertEqual(len(test_handlers), count - 1)
|
||||
with self.assertRaises(KeyError):
|
||||
bb.event.remove("handler1", None)
|
||||
|
||||
def test_execute_handler(self):
|
||||
""" Test execute_handler method for class handlers """
|
||||
mask = ["bb.event.OperationProgress"]
|
||||
result = bb.event.register("event_handler",
|
||||
self._test_process.event_handler,
|
||||
mask)
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
event = bb.event.OperationProgress(current=10, total=100)
|
||||
bb.event.execute_handler("event_handler",
|
||||
self._test_process.event_handler,
|
||||
event,
|
||||
None)
|
||||
self._test_process.event_handler.assert_called_once_with(event)
|
||||
|
||||
def test_fire_class_handlers(self):
|
||||
""" Test fire_class_handlers method """
|
||||
mask = ["bb.event.OperationStarted"]
|
||||
result = bb.event.register("event_handler1",
|
||||
self._test_process.event_handler1,
|
||||
mask)
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
result = bb.event.register("event_handler2",
|
||||
self._test_process.event_handler2,
|
||||
"*")
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
event1 = bb.event.OperationStarted()
|
||||
event2 = bb.event.OperationCompleted(total=123)
|
||||
bb.event.fire_class_handlers(event1, None)
|
||||
bb.event.fire_class_handlers(event2, None)
|
||||
bb.event.fire_class_handlers(event2, None)
|
||||
expected_event_handler1 = [call(event1)]
|
||||
expected_event_handler2 = [call(event1),
|
||||
call(event2),
|
||||
call(event2)]
|
||||
self.assertEqual(self._test_process.event_handler1.call_args_list,
|
||||
expected_event_handler1)
|
||||
self.assertEqual(self._test_process.event_handler2.call_args_list,
|
||||
expected_event_handler2)
|
||||
|
||||
def test_class_handler_filters(self):
|
||||
""" Test filters for class handlers """
|
||||
mask = ["bb.event.OperationStarted"]
|
||||
result = bb.event.register("event_handler1",
|
||||
self._test_process.event_handler1,
|
||||
mask)
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
result = bb.event.register("event_handler2",
|
||||
self._test_process.event_handler2,
|
||||
"*")
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
bb.event.set_eventfilter(
|
||||
lambda name, handler, event, d :
|
||||
name == 'event_handler2' and
|
||||
bb.event.getName(event) == "OperationStarted")
|
||||
event1 = bb.event.OperationStarted()
|
||||
event2 = bb.event.OperationCompleted(total=123)
|
||||
bb.event.fire_class_handlers(event1, None)
|
||||
bb.event.fire_class_handlers(event2, None)
|
||||
bb.event.fire_class_handlers(event2, None)
|
||||
expected_event_handler1 = []
|
||||
expected_event_handler2 = [call(event1)]
|
||||
self.assertEqual(self._test_process.event_handler1.call_args_list,
|
||||
expected_event_handler1)
|
||||
self.assertEqual(self._test_process.event_handler2.call_args_list,
|
||||
expected_event_handler2)
|
||||
|
||||
def test_change_handler_event_mapping(self):
|
||||
""" Test changing the event mapping for class handlers """
|
||||
event1 = bb.event.OperationStarted()
|
||||
event2 = bb.event.OperationCompleted(total=123)
|
||||
|
||||
# register handler for all events
|
||||
result = bb.event.register("event_handler1",
|
||||
self._test_process.event_handler1,
|
||||
"*")
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
bb.event.fire_class_handlers(event1, None)
|
||||
bb.event.fire_class_handlers(event2, None)
|
||||
expected = [call(event1), call(event2)]
|
||||
self.assertEqual(self._test_process.event_handler1.call_args_list,
|
||||
expected)
|
||||
|
||||
# unregister handler and register it only for OperationStarted
|
||||
bb.event.remove("event_handler1",
|
||||
self._test_process.event_handler1)
|
||||
mask = ["bb.event.OperationStarted"]
|
||||
result = bb.event.register("event_handler1",
|
||||
self._test_process.event_handler1,
|
||||
mask)
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
bb.event.fire_class_handlers(event1, None)
|
||||
bb.event.fire_class_handlers(event2, None)
|
||||
expected = [call(event1), call(event2), call(event1)]
|
||||
self.assertEqual(self._test_process.event_handler1.call_args_list,
|
||||
expected)
|
||||
|
||||
# unregister handler and register it only for OperationCompleted
|
||||
bb.event.remove("event_handler1",
|
||||
self._test_process.event_handler1)
|
||||
mask = ["bb.event.OperationCompleted"]
|
||||
result = bb.event.register("event_handler1",
|
||||
self._test_process.event_handler1,
|
||||
mask)
|
||||
self.assertEqual(result, bb.event.Registered)
|
||||
bb.event.fire_class_handlers(event1, None)
|
||||
bb.event.fire_class_handlers(event2, None)
|
||||
expected = [call(event1), call(event2), call(event1), call(event2)]
|
||||
self.assertEqual(self._test_process.event_handler1.call_args_list,
|
||||
expected)
|
||||
|
||||
def test_register_UIHhandler(self):
|
||||
""" Test register_UIHhandler method """
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
self.assertEqual(result, 1)
|
||||
|
||||
def test_UIHhandler_already_registered(self):
|
||||
""" Test registering an UIHhandler already existing """
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
self.assertEqual(result, 1)
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
self.assertEqual(result, 2)
|
||||
|
||||
def test_unregister_UIHhandler(self):
|
||||
""" Test unregister_UIHhandler method """
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
self.assertEqual(result, 1)
|
||||
result = bb.event.unregister_UIHhandler(1)
|
||||
self.assertIs(result, None)
|
||||
|
||||
def test_fire_ui_handlers(self):
|
||||
""" Test fire_ui_handlers method """
|
||||
self._test_ui1.event = Mock(spec_set=EventQueueStub)
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
self.assertEqual(result, 1)
|
||||
self._test_ui2.event = Mock(spec_set=PickleEventQueueStub)
|
||||
result = bb.event.register_UIHhandler(self._test_ui2, mainui=True)
|
||||
self.assertEqual(result, 2)
|
||||
event1 = bb.event.OperationStarted()
|
||||
bb.event.fire_ui_handlers(event1, None)
|
||||
expected = [call(event1)]
|
||||
self.assertEqual(self._test_ui1.event.send.call_args_list,
|
||||
expected)
|
||||
expected = [call(pickle.dumps(event1))]
|
||||
self.assertEqual(self._test_ui2.event.sendpickle.call_args_list,
|
||||
expected)
|
||||
|
||||
def test_ui_handler_mask_filter(self):
|
||||
""" Test filters for UI handlers """
|
||||
mask = ["bb.event.OperationStarted"]
|
||||
debug_domains = {}
|
||||
self._test_ui1.event = Mock(spec_set=EventQueueStub)
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
bb.event.set_UIHmask(result, logging.INFO, debug_domains, mask)
|
||||
self._test_ui2.event = Mock(spec_set=PickleEventQueueStub)
|
||||
result = bb.event.register_UIHhandler(self._test_ui2, mainui=True)
|
||||
bb.event.set_UIHmask(result, logging.INFO, debug_domains, mask)
|
||||
|
||||
event1 = bb.event.OperationStarted()
|
||||
event2 = bb.event.OperationCompleted(total=1)
|
||||
|
||||
bb.event.fire_ui_handlers(event1, None)
|
||||
bb.event.fire_ui_handlers(event2, None)
|
||||
expected = [call(event1)]
|
||||
self.assertEqual(self._test_ui1.event.send.call_args_list,
|
||||
expected)
|
||||
expected = [call(pickle.dumps(event1))]
|
||||
self.assertEqual(self._test_ui2.event.sendpickle.call_args_list,
|
||||
expected)
|
||||
|
||||
def test_ui_handler_log_filter(self):
|
||||
""" Test log filters for UI handlers """
|
||||
mask = ["*"]
|
||||
debug_domains = {'BitBake.Foo': logging.WARNING}
|
||||
|
||||
self._test_ui1.event = EventQueueStub()
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
bb.event.set_UIHmask(result, logging.ERROR, debug_domains, mask)
|
||||
self._test_ui2.event = PickleEventQueueStub()
|
||||
result = bb.event.register_UIHhandler(self._test_ui2, mainui=True)
|
||||
bb.event.set_UIHmask(result, logging.ERROR, debug_domains, mask)
|
||||
|
||||
event1 = bb.event.OperationStarted()
|
||||
bb.event.fire_ui_handlers(event1, None) # All events match
|
||||
|
||||
event_log_handler = bb.event.LogHandler()
|
||||
logger = logging.getLogger("BitBake")
|
||||
logger.addHandler(event_log_handler)
|
||||
logger1 = logging.getLogger("BitBake.Foo")
|
||||
logger1.warning("Test warning LogRecord1") # Matches debug_domains level
|
||||
logger1.info("Test info LogRecord") # Filtered out
|
||||
logger2 = logging.getLogger("BitBake.Bar")
|
||||
logger2.error("Test error LogRecord") # Matches filter base level
|
||||
logger2.warning("Test warning LogRecord2") # Filtered out
|
||||
logger.removeHandler(event_log_handler)
|
||||
|
||||
expected = ['OperationStarted',
|
||||
'WARNING: Test warning LogRecord1',
|
||||
'ERROR: Test error LogRecord']
|
||||
self.assertEqual(self._test_ui1.event.event_calls, expected)
|
||||
self.assertEqual(self._test_ui2.event.event_calls, expected)
|
||||
|
||||
def test_fire(self):
|
||||
""" Test fire method used to trigger class and ui event handlers """
|
||||
mask = ["bb.event.ConfigParsed"]
|
||||
result = bb.event.register("event_handler1",
|
||||
self._test_process.event_handler1,
|
||||
mask)
|
||||
|
||||
self._test_ui1.event = Mock(spec_set=EventQueueStub)
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
self.assertEqual(result, 1)
|
||||
|
||||
event1 = bb.event.ConfigParsed()
|
||||
bb.event.fire(event1, None)
|
||||
expected = [call(event1)]
|
||||
self.assertEqual(self._test_process.event_handler1.call_args_list,
|
||||
expected)
|
||||
self.assertEqual(self._test_ui1.event.send.call_args_list,
|
||||
expected)
|
||||
|
||||
def test_fire_from_worker(self):
|
||||
""" Test fire_from_worker method """
|
||||
self._test_ui1.event = Mock(spec_set=EventQueueStub)
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
self.assertEqual(result, 1)
|
||||
event1 = bb.event.ConfigParsed()
|
||||
bb.event.fire_from_worker(event1, None)
|
||||
expected = [call(event1)]
|
||||
self.assertEqual(self._test_ui1.event.send.call_args_list,
|
||||
expected)
|
||||
|
||||
def test_worker_fire(self):
|
||||
""" Test the triggering of bb.event.worker_fire callback """
|
||||
bb.event.worker_fire = Mock()
|
||||
event = bb.event.Event()
|
||||
bb.event.fire(event, None)
|
||||
expected = [call(event, None)]
|
||||
self.assertEqual(bb.event.worker_fire.call_args_list, expected)
|
||||
|
||||
def test_print_ui_queue(self):
|
||||
""" Test print_ui_queue method """
|
||||
event1 = bb.event.OperationStarted()
|
||||
event2 = bb.event.OperationCompleted(total=123)
|
||||
bb.event.fire(event1, None)
|
||||
bb.event.fire(event2, None)
|
||||
event_log_handler = bb.event.LogHandler()
|
||||
logger = logging.getLogger("BitBake")
|
||||
logger.addHandler(event_log_handler)
|
||||
logger.info("Test info LogRecord")
|
||||
logger.warning("Test warning LogRecord")
|
||||
with self.assertLogs("BitBake", level="INFO") as cm:
|
||||
bb.event.print_ui_queue()
|
||||
logger.removeHandler(event_log_handler)
|
||||
self.assertEqual(cm.output,
|
||||
["INFO:BitBake:Test info LogRecord",
|
||||
"WARNING:BitBake:Test warning LogRecord"])
|
||||
|
||||
def _set_threadlock_test_mockups(self):
|
||||
""" Create UI event handler mockups used in enable and disable
|
||||
threadlock tests """
|
||||
def ui1_event_send(event):
|
||||
if type(event) is bb.event.ConfigParsed:
|
||||
self._threadlock_test_calls.append("w1_ui1")
|
||||
if type(event) is bb.event.OperationStarted:
|
||||
self._threadlock_test_calls.append("w2_ui1")
|
||||
time.sleep(2)
|
||||
|
||||
def ui2_event_send(event):
|
||||
if type(event) is bb.event.ConfigParsed:
|
||||
self._threadlock_test_calls.append("w1_ui2")
|
||||
if type(event) is bb.event.OperationStarted:
|
||||
self._threadlock_test_calls.append("w2_ui2")
|
||||
time.sleep(2)
|
||||
|
||||
self._threadlock_test_calls = []
|
||||
self._test_ui1.event = EventQueueStub()
|
||||
self._test_ui1.event.send = ui1_event_send
|
||||
result = bb.event.register_UIHhandler(self._test_ui1, mainui=True)
|
||||
self.assertEqual(result, 1)
|
||||
self._test_ui2.event = EventQueueStub()
|
||||
self._test_ui2.event.send = ui2_event_send
|
||||
result = bb.event.register_UIHhandler(self._test_ui2, mainui=True)
|
||||
self.assertEqual(result, 2)
|
||||
|
||||
def _set_and_run_threadlock_test_workers(self):
|
||||
""" Create and run the workers used to trigger events in enable and
|
||||
disable threadlock tests """
|
||||
worker1 = threading.Thread(target=self._thread_lock_test_worker1)
|
||||
worker2 = threading.Thread(target=self._thread_lock_test_worker2)
|
||||
worker1.start()
|
||||
time.sleep(1)
|
||||
worker2.start()
|
||||
worker1.join()
|
||||
worker2.join()
|
||||
|
||||
def _thread_lock_test_worker1(self):
|
||||
""" First worker used to fire the ConfigParsed event for enable and
|
||||
disable threadlocks tests """
|
||||
bb.event.fire(bb.event.ConfigParsed(), None)
|
||||
|
||||
def _thread_lock_test_worker2(self):
|
||||
""" Second worker used to fire the OperationStarted event for enable
|
||||
and disable threadlocks tests """
|
||||
bb.event.fire(bb.event.OperationStarted(), None)
|
||||
|
||||
def test_enable_threadlock(self):
|
||||
""" Test enable_threadlock method """
|
||||
self._set_threadlock_test_mockups()
|
||||
bb.event.enable_threadlock()
|
||||
self._set_and_run_threadlock_test_workers()
|
||||
# Calls to UI handlers should be in order as all the registered
|
||||
# handlers for the event coming from the first worker should be
|
||||
# called before processing the event from the second worker.
|
||||
self.assertEqual(self._threadlock_test_calls,
|
||||
["w1_ui1", "w1_ui2", "w2_ui1", "w2_ui2"])
|
||||
|
||||
|
||||
def test_disable_threadlock(self):
|
||||
""" Test disable_threadlock method """
|
||||
self._set_threadlock_test_mockups()
|
||||
bb.event.disable_threadlock()
|
||||
self._set_and_run_threadlock_test_workers()
|
||||
# Calls to UI handlers should be intertwined together. Thanks to the
|
||||
# delay in the registered handlers for the event coming from the first
|
||||
# worker, the event coming from the second worker starts being
|
||||
# processed before finishing handling the first worker event.
|
||||
self.assertEqual(self._threadlock_test_calls,
|
||||
["w1_ui1", "w2_ui1", "w1_ui2", "w2_ui2"])
|
||||
|
||||
|
||||
class EventClassesTest(unittest.TestCase):
|
||||
""" Event classes test class """
|
||||
|
||||
_worker_pid = 54321
|
||||
|
||||
def setUp(self):
|
||||
bb.event.worker_pid = EventClassesTest._worker_pid
|
||||
|
||||
def test_Event(self):
|
||||
""" Test the Event base class """
|
||||
event = bb.event.Event()
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_HeartbeatEvent(self):
|
||||
""" Test the HeartbeatEvent class """
|
||||
time = 10
|
||||
event = bb.event.HeartbeatEvent(time)
|
||||
self.assertEqual(event.time, time)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_OperationStarted(self):
|
||||
""" Test OperationStarted event class """
|
||||
msg = "Foo Bar"
|
||||
event = bb.event.OperationStarted(msg)
|
||||
self.assertEqual(event.msg, msg)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_OperationCompleted(self):
|
||||
""" Test OperationCompleted event class """
|
||||
msg = "Foo Bar"
|
||||
total = 123
|
||||
event = bb.event.OperationCompleted(total, msg)
|
||||
self.assertEqual(event.msg, msg)
|
||||
self.assertEqual(event.total, total)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_OperationProgress(self):
|
||||
""" Test OperationProgress event class """
|
||||
msg = "Foo Bar"
|
||||
total = 123
|
||||
current = 111
|
||||
event = bb.event.OperationProgress(current, total, msg)
|
||||
self.assertEqual(event.msg, msg + ": %s/%s" % (current, total))
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ConfigParsed(self):
|
||||
""" Test the ConfigParsed class """
|
||||
event = bb.event.ConfigParsed()
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_MultiConfigParsed(self):
|
||||
""" Test MultiConfigParsed event class """
|
||||
mcdata = {"foobar": "Foo Bar"}
|
||||
event = bb.event.MultiConfigParsed(mcdata)
|
||||
self.assertEqual(event.mcdata, mcdata)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_RecipeEvent(self):
|
||||
""" Test RecipeEvent event base class """
|
||||
callback = lambda a: 2 * a
|
||||
event = bb.event.RecipeEvent(callback)
|
||||
self.assertEqual(event.fn(1), callback(1))
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_RecipePreFinalise(self):
|
||||
""" Test RecipePreFinalise event class """
|
||||
callback = lambda a: 2 * a
|
||||
event = bb.event.RecipePreFinalise(callback)
|
||||
self.assertEqual(event.fn(1), callback(1))
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_RecipeTaskPreProcess(self):
|
||||
""" Test RecipeTaskPreProcess event class """
|
||||
callback = lambda a: 2 * a
|
||||
tasklist = [("foobar", callback)]
|
||||
event = bb.event.RecipeTaskPreProcess(callback, tasklist)
|
||||
self.assertEqual(event.fn(1), callback(1))
|
||||
self.assertEqual(event.tasklist, tasklist)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_RecipeParsed(self):
|
||||
""" Test RecipeParsed event base class """
|
||||
callback = lambda a: 2 * a
|
||||
event = bb.event.RecipeParsed(callback)
|
||||
self.assertEqual(event.fn(1), callback(1))
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_StampUpdate(self):
|
||||
targets = ["foo", "bar"]
|
||||
stampfns = [lambda:"foobar"]
|
||||
event = bb.event.StampUpdate(targets, stampfns)
|
||||
self.assertEqual(event.targets, targets)
|
||||
self.assertEqual(event.stampPrefix, stampfns)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_BuildBase(self):
|
||||
""" Test base class for bitbake build events """
|
||||
name = "foo"
|
||||
pkgs = ["bar"]
|
||||
failures = 123
|
||||
event = bb.event.BuildBase(name, pkgs, failures)
|
||||
self.assertEqual(event.name, name)
|
||||
self.assertEqual(event.pkgs, pkgs)
|
||||
self.assertEqual(event.getFailures(), failures)
|
||||
name = event.name = "bar"
|
||||
pkgs = event.pkgs = ["foo"]
|
||||
self.assertEqual(event.name, name)
|
||||
self.assertEqual(event.pkgs, pkgs)
|
||||
self.assertEqual(event.getFailures(), failures)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_BuildInit(self):
|
||||
""" Test class for bitbake build invocation events """
|
||||
event = bb.event.BuildInit()
|
||||
self.assertEqual(event.name, None)
|
||||
self.assertEqual(event.pkgs, [])
|
||||
self.assertEqual(event.getFailures(), 0)
|
||||
name = event.name = "bar"
|
||||
pkgs = event.pkgs = ["foo"]
|
||||
self.assertEqual(event.name, name)
|
||||
self.assertEqual(event.pkgs, pkgs)
|
||||
self.assertEqual(event.getFailures(), 0)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_BuildStarted(self):
|
||||
""" Test class for build started events """
|
||||
name = "foo"
|
||||
pkgs = ["bar"]
|
||||
failures = 123
|
||||
event = bb.event.BuildStarted(name, pkgs, failures)
|
||||
self.assertEqual(event.name, name)
|
||||
self.assertEqual(event.pkgs, pkgs)
|
||||
self.assertEqual(event.getFailures(), failures)
|
||||
self.assertEqual(event.msg, "Building Started")
|
||||
name = event.name = "bar"
|
||||
pkgs = event.pkgs = ["foo"]
|
||||
msg = event.msg = "foobar"
|
||||
self.assertEqual(event.name, name)
|
||||
self.assertEqual(event.pkgs, pkgs)
|
||||
self.assertEqual(event.getFailures(), failures)
|
||||
self.assertEqual(event.msg, msg)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_BuildCompleted(self):
|
||||
""" Test class for build completed events """
|
||||
total = 1000
|
||||
name = "foo"
|
||||
pkgs = ["bar"]
|
||||
failures = 123
|
||||
interrupted = 1
|
||||
event = bb.event.BuildCompleted(total, name, pkgs, failures,
|
||||
interrupted)
|
||||
self.assertEqual(event.name, name)
|
||||
self.assertEqual(event.pkgs, pkgs)
|
||||
self.assertEqual(event.getFailures(), failures)
|
||||
self.assertEqual(event.msg, "Building Failed")
|
||||
event2 = bb.event.BuildCompleted(total, name, pkgs)
|
||||
self.assertEqual(event2.name, name)
|
||||
self.assertEqual(event2.pkgs, pkgs)
|
||||
self.assertEqual(event2.getFailures(), 0)
|
||||
self.assertEqual(event2.msg, "Building Succeeded")
|
||||
self.assertEqual(event2.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_DiskFull(self):
|
||||
""" Test DiskFull event class """
|
||||
dev = "/dev/foo"
|
||||
type = "ext4"
|
||||
freespace = "104M"
|
||||
mountpoint = "/"
|
||||
event = bb.event.DiskFull(dev, type, freespace, mountpoint)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_MonitorDiskEvent(self):
|
||||
""" Test MonitorDiskEvent class """
|
||||
available_bytes = 10000000
|
||||
free_bytes = 90000000
|
||||
total_bytes = 1000000000
|
||||
du = bb.event.DiskUsageSample(available_bytes, free_bytes,
|
||||
total_bytes)
|
||||
event = bb.event.MonitorDiskEvent(du)
|
||||
self.assertEqual(event.disk_usage.available_bytes, available_bytes)
|
||||
self.assertEqual(event.disk_usage.free_bytes, free_bytes)
|
||||
self.assertEqual(event.disk_usage.total_bytes, total_bytes)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_NoProvider(self):
|
||||
""" Test NoProvider event class """
|
||||
item = "foobar"
|
||||
event1 = bb.event.NoProvider(item)
|
||||
self.assertEqual(event1.getItem(), item)
|
||||
self.assertEqual(event1.isRuntime(), False)
|
||||
self.assertEqual(str(event1), "Nothing PROVIDES 'foobar'")
|
||||
runtime = True
|
||||
dependees = ["foo", "bar"]
|
||||
reasons = None
|
||||
close_matches = ["foibar", "footbar"]
|
||||
event2 = bb.event.NoProvider(item, runtime, dependees, reasons,
|
||||
close_matches)
|
||||
self.assertEqual(event2.isRuntime(), True)
|
||||
expected = ("Nothing RPROVIDES 'foobar' (but foo, bar RDEPENDS"
|
||||
" on or otherwise requires it). Close matches:\n"
|
||||
" foibar\n"
|
||||
" footbar")
|
||||
self.assertEqual(str(event2), expected)
|
||||
reasons = ["Item does not exist on database"]
|
||||
close_matches = ["foibar", "footbar"]
|
||||
event3 = bb.event.NoProvider(item, runtime, dependees, reasons,
|
||||
close_matches)
|
||||
expected = ("Nothing RPROVIDES 'foobar' (but foo, bar RDEPENDS"
|
||||
" on or otherwise requires it)\n"
|
||||
"Item does not exist on database")
|
||||
self.assertEqual(str(event3), expected)
|
||||
self.assertEqual(event3.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_MultipleProviders(self):
|
||||
""" Test MultipleProviders event class """
|
||||
item = "foobar"
|
||||
candidates = ["foobarv1", "foobars"]
|
||||
event1 = bb.event.MultipleProviders(item, candidates)
|
||||
self.assertEqual(event1.isRuntime(), False)
|
||||
self.assertEqual(event1.getItem(), item)
|
||||
self.assertEqual(event1.getCandidates(), candidates)
|
||||
expected = ("Multiple providers are available for foobar (foobarv1,"
|
||||
" foobars)\n"
|
||||
"Consider defining a PREFERRED_PROVIDER entry to match "
|
||||
"foobar")
|
||||
self.assertEqual(str(event1), expected)
|
||||
runtime = True
|
||||
event2 = bb.event.MultipleProviders(item, candidates, runtime)
|
||||
self.assertEqual(event2.isRuntime(), runtime)
|
||||
expected = ("Multiple providers are available for runtime foobar "
|
||||
"(foobarv1, foobars)\n"
|
||||
"Consider defining a PREFERRED_RPROVIDER entry to match "
|
||||
"foobar")
|
||||
self.assertEqual(str(event2), expected)
|
||||
self.assertEqual(event2.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ParseStarted(self):
|
||||
""" Test ParseStarted event class """
|
||||
total = 123
|
||||
event = bb.event.ParseStarted(total)
|
||||
self.assertEqual(event.msg, "Recipe parsing Started")
|
||||
self.assertEqual(event.total, total)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ParseCompleted(self):
|
||||
""" Test ParseCompleted event class """
|
||||
cached = 10
|
||||
parsed = 13
|
||||
skipped = 7
|
||||
virtuals = 2
|
||||
masked = 1
|
||||
errors = 0
|
||||
total = 23
|
||||
event = bb.event.ParseCompleted(cached, parsed, skipped, masked,
|
||||
virtuals, errors, total)
|
||||
self.assertEqual(event.msg, "Recipe parsing Completed")
|
||||
expected = [cached, parsed, skipped, virtuals, masked, errors,
|
||||
cached + parsed, total]
|
||||
actual = [event.cached, event.parsed, event.skipped, event.virtuals,
|
||||
event.masked, event.errors, event.sofar, event.total]
|
||||
self.assertEqual(str(actual), str(expected))
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ParseProgress(self):
|
||||
""" Test ParseProgress event class """
|
||||
current = 10
|
||||
total = 100
|
||||
event = bb.event.ParseProgress(current, total)
|
||||
self.assertEqual(event.msg,
|
||||
"Recipe parsing" + ": %s/%s" % (current, total))
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_CacheLoadStarted(self):
|
||||
""" Test CacheLoadStarted event class """
|
||||
total = 123
|
||||
event = bb.event.CacheLoadStarted(total)
|
||||
self.assertEqual(event.msg, "Loading cache Started")
|
||||
self.assertEqual(event.total, total)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_CacheLoadProgress(self):
|
||||
""" Test CacheLoadProgress event class """
|
||||
current = 10
|
||||
total = 100
|
||||
event = bb.event.CacheLoadProgress(current, total)
|
||||
self.assertEqual(event.msg,
|
||||
"Loading cache" + ": %s/%s" % (current, total))
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_CacheLoadCompleted(self):
|
||||
""" Test CacheLoadCompleted event class """
|
||||
total = 23
|
||||
num_entries = 12
|
||||
event = bb.event.CacheLoadCompleted(total, num_entries)
|
||||
self.assertEqual(event.msg, "Loading cache Completed")
|
||||
expected = [total, num_entries]
|
||||
actual = [event.total, event.num_entries]
|
||||
self.assertEqual(str(actual), str(expected))
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_TreeDataPreparationStarted(self):
|
||||
""" Test TreeDataPreparationStarted event class """
|
||||
event = bb.event.TreeDataPreparationStarted()
|
||||
self.assertEqual(event.msg, "Preparing tree data Started")
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_TreeDataPreparationProgress(self):
|
||||
""" Test TreeDataPreparationProgress event class """
|
||||
current = 10
|
||||
total = 100
|
||||
event = bb.event.TreeDataPreparationProgress(current, total)
|
||||
self.assertEqual(event.msg,
|
||||
"Preparing tree data" + ": %s/%s" % (current, total))
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_TreeDataPreparationCompleted(self):
|
||||
""" Test TreeDataPreparationCompleted event class """
|
||||
total = 23
|
||||
event = bb.event.TreeDataPreparationCompleted(total)
|
||||
self.assertEqual(event.msg, "Preparing tree data Completed")
|
||||
self.assertEqual(event.total, total)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_DepTreeGenerated(self):
|
||||
""" Test DepTreeGenerated event class """
|
||||
depgraph = Mock()
|
||||
event = bb.event.DepTreeGenerated(depgraph)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_TargetsTreeGenerated(self):
|
||||
""" Test TargetsTreeGenerated event class """
|
||||
model = Mock()
|
||||
event = bb.event.TargetsTreeGenerated(model)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ReachableStamps(self):
|
||||
""" Test ReachableStamps event class """
|
||||
stamps = [Mock(), Mock()]
|
||||
event = bb.event.ReachableStamps(stamps)
|
||||
self.assertEqual(event.stamps, stamps)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_FilesMatchingFound(self):
|
||||
""" Test FilesMatchingFound event class """
|
||||
pattern = "foo.*bar"
|
||||
matches = ["foobar"]
|
||||
event = bb.event.FilesMatchingFound(pattern, matches)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ConfigFilesFound(self):
|
||||
""" Test ConfigFilesFound event class """
|
||||
variable = "FOO_BAR"
|
||||
values = ["foo", "bar"]
|
||||
event = bb.event.ConfigFilesFound(variable, values)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ConfigFilePathFound(self):
|
||||
""" Test ConfigFilePathFound event class """
|
||||
path = "/foo/bar"
|
||||
event = bb.event.ConfigFilePathFound(path)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_message_classes(self):
|
||||
""" Test message event classes """
|
||||
msg = "foobar foo bar"
|
||||
event = bb.event.MsgBase(msg)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
event = bb.event.MsgDebug(msg)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
event = bb.event.MsgNote(msg)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
event = bb.event.MsgWarn(msg)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
event = bb.event.MsgError(msg)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
event = bb.event.MsgFatal(msg)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
event = bb.event.MsgPlain(msg)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_LogExecTTY(self):
|
||||
""" Test LogExecTTY event class """
|
||||
msg = "foo bar"
|
||||
prog = "foo.sh"
|
||||
sleep_delay = 10
|
||||
retries = 3
|
||||
event = bb.event.LogExecTTY(msg, prog, sleep_delay, retries)
|
||||
self.assertEqual(event.msg, msg)
|
||||
self.assertEqual(event.prog, prog)
|
||||
self.assertEqual(event.sleep_delay, sleep_delay)
|
||||
self.assertEqual(event.retries, retries)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def _throw_zero_division_exception(self):
|
||||
a = 1 / 0
|
||||
return
|
||||
|
||||
def _worker_handler(self, event, d):
|
||||
self._returned_event = event
|
||||
return
|
||||
|
||||
def test_LogHandler(self):
|
||||
""" Test LogHandler class """
|
||||
logger = logging.getLogger("TestEventClasses")
|
||||
logger.propagate = False
|
||||
handler = bb.event.LogHandler(logging.INFO)
|
||||
logger.addHandler(handler)
|
||||
bb.event.worker_fire = self._worker_handler
|
||||
try:
|
||||
self._throw_zero_division_exception()
|
||||
except ZeroDivisionError as ex:
|
||||
logger.exception(ex)
|
||||
event = self._returned_event
|
||||
try:
|
||||
pe = pickle.dumps(event)
|
||||
newevent = pickle.loads(pe)
|
||||
except:
|
||||
self.fail('Logged event is not serializable')
|
||||
self.assertEqual(event.taskpid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_MetadataEvent(self):
|
||||
""" Test MetadataEvent class """
|
||||
eventtype = "footype"
|
||||
eventdata = {"foo": "bar"}
|
||||
event = bb.event.MetadataEvent(eventtype, eventdata)
|
||||
self.assertEqual(event.type, eventtype)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ProcessStarted(self):
|
||||
""" Test ProcessStarted class """
|
||||
processname = "foo"
|
||||
total = 9783128974
|
||||
event = bb.event.ProcessStarted(processname, total)
|
||||
self.assertEqual(event.processname, processname)
|
||||
self.assertEqual(event.total, total)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ProcessProgress(self):
|
||||
""" Test ProcessProgress class """
|
||||
processname = "foo"
|
||||
progress = 243224
|
||||
event = bb.event.ProcessProgress(processname, progress)
|
||||
self.assertEqual(event.processname, processname)
|
||||
self.assertEqual(event.progress, progress)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_ProcessFinished(self):
|
||||
""" Test ProcessFinished class """
|
||||
processname = "foo"
|
||||
total = 1242342344
|
||||
event = bb.event.ProcessFinished(processname)
|
||||
self.assertEqual(event.processname, processname)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_SanityCheck(self):
|
||||
""" Test SanityCheck class """
|
||||
event1 = bb.event.SanityCheck()
|
||||
self.assertEqual(event1.generateevents, True)
|
||||
self.assertEqual(event1.pid, EventClassesTest._worker_pid)
|
||||
generateevents = False
|
||||
event2 = bb.event.SanityCheck(generateevents)
|
||||
self.assertEqual(event2.generateevents, generateevents)
|
||||
self.assertEqual(event2.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_SanityCheckPassed(self):
|
||||
""" Test SanityCheckPassed class """
|
||||
event = bb.event.SanityCheckPassed()
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_SanityCheckFailed(self):
|
||||
""" Test SanityCheckFailed class """
|
||||
msg = "The sanity test failed."
|
||||
event1 = bb.event.SanityCheckFailed(msg)
|
||||
self.assertEqual(event1.pid, EventClassesTest._worker_pid)
|
||||
network_error = True
|
||||
event2 = bb.event.SanityCheckFailed(msg, network_error)
|
||||
self.assertEqual(event2.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_network_event_classes(self):
|
||||
""" Test network event classes """
|
||||
event1 = bb.event.NetworkTest()
|
||||
generateevents = False
|
||||
self.assertEqual(event1.pid, EventClassesTest._worker_pid)
|
||||
event2 = bb.event.NetworkTest(generateevents)
|
||||
self.assertEqual(event2.pid, EventClassesTest._worker_pid)
|
||||
event3 = bb.event.NetworkTestPassed()
|
||||
self.assertEqual(event3.pid, EventClassesTest._worker_pid)
|
||||
event4 = bb.event.NetworkTestFailed()
|
||||
self.assertEqual(event4.pid, EventClassesTest._worker_pid)
|
||||
|
||||
def test_FindSigInfoResult(self):
|
||||
""" Test FindSigInfoResult event class """
|
||||
result = [Mock()]
|
||||
event = bb.event.FindSigInfoResult(result)
|
||||
self.assertEqual(event.result, result)
|
||||
self.assertEqual(event.pid, EventClassesTest._worker_pid)
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,185 +0,0 @@
|
||||
# ex:ts=4:sw=4:sts=4:et
|
||||
# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# BitBake Test for lib/bb/parse/
|
||||
#
|
||||
# Copyright (C) 2015 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
# published by the Free Software Foundation.
|
||||
#
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU General Public License for more details.
|
||||
#
|
||||
# You should have received a copy of the GNU General Public License along
|
||||
# with this program; if not, write to the Free Software Foundation, Inc.,
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
#
|
||||
|
||||
import unittest
|
||||
import tempfile
|
||||
import logging
|
||||
import bb
|
||||
import os
|
||||
|
||||
logger = logging.getLogger('BitBake.TestParse')
|
||||
|
||||
import bb.parse
|
||||
import bb.data
|
||||
import bb.siggen
|
||||
|
||||
class ParseTest(unittest.TestCase):
|
||||
|
||||
testfile = """
|
||||
A = "1"
|
||||
B = "2"
|
||||
do_install() {
|
||||
echo "hello"
|
||||
}
|
||||
|
||||
C = "3"
|
||||
"""
|
||||
|
||||
def setUp(self):
|
||||
self.d = bb.data.init()
|
||||
bb.parse.siggen = bb.siggen.init(self.d)
|
||||
|
||||
def parsehelper(self, content, suffix = ".bb"):
|
||||
|
||||
f = tempfile.NamedTemporaryFile(suffix = suffix)
|
||||
f.write(bytes(content, "utf-8"))
|
||||
f.flush()
|
||||
os.chdir(os.path.dirname(f.name))
|
||||
return f
|
||||
|
||||
def test_parse_simple(self):
|
||||
f = self.parsehelper(self.testfile)
|
||||
d = bb.parse.handle(f.name, self.d)['']
|
||||
self.assertEqual(d.getVar("A"), "1")
|
||||
self.assertEqual(d.getVar("B"), "2")
|
||||
self.assertEqual(d.getVar("C"), "3")
|
||||
|
||||
def test_parse_incomplete_function(self):
|
||||
testfileB = self.testfile.replace("}", "")
|
||||
f = self.parsehelper(testfileB)
|
||||
with self.assertRaises(bb.parse.ParseError):
|
||||
d = bb.parse.handle(f.name, self.d)['']
|
||||
|
||||
unsettest = """
|
||||
A = "1"
|
||||
B = "2"
|
||||
B[flag] = "3"
|
||||
|
||||
unset A
|
||||
unset B[flag]
|
||||
"""
|
||||
|
||||
def test_parse_unset(self):
|
||||
f = self.parsehelper(self.unsettest)
|
||||
d = bb.parse.handle(f.name, self.d)['']
|
||||
self.assertEqual(d.getVar("A"), None)
|
||||
self.assertEqual(d.getVarFlag("A","flag"), None)
|
||||
self.assertEqual(d.getVar("B"), "2")
|
||||
|
||||
exporttest = """
|
||||
A = "a"
|
||||
export B = "b"
|
||||
export C
|
||||
exportD = "d"
|
||||
"""
|
||||
|
||||
def test_parse_exports(self):
|
||||
f = self.parsehelper(self.exporttest)
|
||||
d = bb.parse.handle(f.name, self.d)['']
|
||||
self.assertEqual(d.getVar("A"), "a")
|
||||
self.assertIsNone(d.getVarFlag("A", "export"))
|
||||
self.assertEqual(d.getVar("B"), "b")
|
||||
self.assertEqual(d.getVarFlag("B", "export"), 1)
|
||||
self.assertIsNone(d.getVar("C"))
|
||||
self.assertEqual(d.getVarFlag("C", "export"), 1)
|
||||
self.assertIsNone(d.getVar("D"))
|
||||
self.assertIsNone(d.getVarFlag("D", "export"))
|
||||
self.assertEqual(d.getVar("exportD"), "d")
|
||||
self.assertIsNone(d.getVarFlag("exportD", "export"))
|
||||
|
||||
|
||||
overridetest = """
|
||||
RRECOMMENDS_${PN} = "a"
|
||||
RRECOMMENDS_${PN}_libc = "b"
|
||||
OVERRIDES = "libc:${PN}"
|
||||
PN = "gtk+"
|
||||
"""
|
||||
|
||||
def test_parse_overrides(self):
|
||||
f = self.parsehelper(self.overridetest)
|
||||
d = bb.parse.handle(f.name, self.d)['']
|
||||
self.assertEqual(d.getVar("RRECOMMENDS"), "b")
|
||||
bb.data.expandKeys(d)
|
||||
self.assertEqual(d.getVar("RRECOMMENDS"), "b")
|
||||
d.setVar("RRECOMMENDS_gtk+", "c")
|
||||
self.assertEqual(d.getVar("RRECOMMENDS"), "c")
|
||||
|
||||
overridetest2 = """
|
||||
EXTRA_OECONF = ""
|
||||
EXTRA_OECONF_class-target = "b"
|
||||
EXTRA_OECONF_append = " c"
|
||||
"""
|
||||
|
||||
def test_parse_overrides(self):
|
||||
f = self.parsehelper(self.overridetest2)
|
||||
d = bb.parse.handle(f.name, self.d)['']
|
||||
d.appendVar("EXTRA_OECONF", " d")
|
||||
d.setVar("OVERRIDES", "class-target")
|
||||
self.assertEqual(d.getVar("EXTRA_OECONF"), "b c d")
|
||||
|
||||
overridetest3 = """
|
||||
DESCRIPTION = "A"
|
||||
DESCRIPTION_${PN}-dev = "${DESCRIPTION} B"
|
||||
PN = "bc"
|
||||
"""
|
||||
|
||||
def test_parse_combinations(self):
|
||||
f = self.parsehelper(self.overridetest3)
|
||||
d = bb.parse.handle(f.name, self.d)['']
|
||||
bb.data.expandKeys(d)
|
||||
self.assertEqual(d.getVar("DESCRIPTION_bc-dev"), "A B")
|
||||
d.setVar("DESCRIPTION", "E")
|
||||
d.setVar("DESCRIPTION_bc-dev", "C D")
|
||||
d.setVar("OVERRIDES", "bc-dev")
|
||||
self.assertEqual(d.getVar("DESCRIPTION"), "C D")
|
||||
|
||||
|
||||
classextend = """
|
||||
VAR_var_override1 = "B"
|
||||
EXTRA = ":override1"
|
||||
OVERRIDES = "nothing${EXTRA}"
|
||||
|
||||
BBCLASSEXTEND = "###CLASS###"
|
||||
"""
|
||||
classextend_bbclass = """
|
||||
EXTRA = ""
|
||||
python () {
|
||||
d.renameVar("VAR_var", "VAR_var2")
|
||||
}
|
||||
"""
|
||||
|
||||
#
|
||||
# Test based upon a real world data corruption issue. One
|
||||
# data store changing a variable poked through into a different data
|
||||
# store. This test case replicates that issue where the value 'B' would
|
||||
# become unset/disappear.
|
||||
#
|
||||
def test_parse_classextend_contamination(self):
|
||||
cls = self.parsehelper(self.classextend_bbclass, suffix=".bbclass")
|
||||
#clsname = os.path.basename(cls.name).replace(".bbclass", "")
|
||||
self.classextend = self.classextend.replace("###CLASS###", cls.name)
|
||||
f = self.parsehelper(self.classextend)
|
||||
alldata = bb.parse.handle(f.name, self.d)
|
||||
d1 = alldata['']
|
||||
d2 = alldata[cls.name]
|
||||
self.assertEqual(d1.getVar("VAR_var"), "B")
|
||||
self.assertEqual(d2.getVar("VAR_var"), None)
|
||||
|
||||
@@ -22,8 +22,6 @@
|
||||
import unittest
|
||||
import bb
|
||||
import os
|
||||
import tempfile
|
||||
import re
|
||||
|
||||
class VerCmpString(unittest.TestCase):
|
||||
|
||||
@@ -38,10 +36,6 @@ class VerCmpString(unittest.TestCase):
|
||||
self.assertTrue(result < 0)
|
||||
result = bb.utils.vercmp_string('1.1', '1_p2')
|
||||
self.assertTrue(result < 0)
|
||||
result = bb.utils.vercmp_string('1.0', '1.0+1.1-beta1')
|
||||
self.assertTrue(result < 0)
|
||||
result = bb.utils.vercmp_string('1.1', '1.0+1.1-beta1')
|
||||
self.assertTrue(result > 0)
|
||||
|
||||
def test_explode_dep_versions(self):
|
||||
correctresult = {"foo" : ["= 1.10"]}
|
||||
@@ -107,497 +101,3 @@ class Path(unittest.TestCase):
|
||||
for arg1, correctresult in checkitems:
|
||||
result = bb.utils._check_unsafe_delete_path(arg1)
|
||||
self.assertEqual(result, correctresult, '_check_unsafe_delete_path("%s") != %s' % (arg1, correctresult))
|
||||
|
||||
|
||||
class EditMetadataFile(unittest.TestCase):
|
||||
_origfile = """
|
||||
# A comment
|
||||
HELLO = "oldvalue"
|
||||
|
||||
THIS = "that"
|
||||
|
||||
# Another comment
|
||||
NOCHANGE = "samevalue"
|
||||
OTHER = 'anothervalue'
|
||||
|
||||
MULTILINE = "a1 \\
|
||||
a2 \\
|
||||
a3"
|
||||
|
||||
MULTILINE2 := " \\
|
||||
b1 \\
|
||||
b2 \\
|
||||
b3 \\
|
||||
"
|
||||
|
||||
|
||||
MULTILINE3 = " \\
|
||||
c1 \\
|
||||
c2 \\
|
||||
c3 \\
|
||||
"
|
||||
|
||||
do_functionname() {
|
||||
command1 ${VAL1} ${VAL2}
|
||||
command2 ${VAL3} ${VAL4}
|
||||
}
|
||||
"""
|
||||
def _testeditfile(self, varvalues, compareto, dummyvars=None):
|
||||
if dummyvars is None:
|
||||
dummyvars = []
|
||||
with tempfile.NamedTemporaryFile('w', delete=False) as tf:
|
||||
tf.write(self._origfile)
|
||||
tf.close()
|
||||
try:
|
||||
varcalls = []
|
||||
def handle_file(varname, origvalue, op, newlines):
|
||||
self.assertIn(varname, varvalues, 'Callback called for variable %s not in the list!' % varname)
|
||||
self.assertNotIn(varname, dummyvars, 'Callback called for variable %s in dummy list!' % varname)
|
||||
varcalls.append(varname)
|
||||
return varvalues[varname]
|
||||
|
||||
bb.utils.edit_metadata_file(tf.name, varvalues.keys(), handle_file)
|
||||
with open(tf.name) as f:
|
||||
modfile = f.readlines()
|
||||
# Ensure the output matches the expected output
|
||||
self.assertEqual(compareto.splitlines(True), modfile)
|
||||
# Ensure the callback function was called for every variable we asked for
|
||||
# (plus allow testing behaviour when a requested variable is not present)
|
||||
self.assertEqual(sorted(varvalues.keys()), sorted(varcalls + dummyvars))
|
||||
finally:
|
||||
os.remove(tf.name)
|
||||
|
||||
|
||||
def test_edit_metadata_file_nochange(self):
|
||||
# Test file doesn't get modified with nothing to do
|
||||
self._testeditfile({}, self._origfile)
|
||||
# Test file doesn't get modified with only dummy variables
|
||||
self._testeditfile({'DUMMY1': ('should_not_set', None, 0, True),
|
||||
'DUMMY2': ('should_not_set_again', None, 0, True)}, self._origfile, dummyvars=['DUMMY1', 'DUMMY2'])
|
||||
# Test file doesn't get modified with some the same values
|
||||
self._testeditfile({'THIS': ('that', None, 0, True),
|
||||
'OTHER': ('anothervalue', None, 0, True),
|
||||
'MULTILINE3': (' c1 c2 c3 ', None, 4, False)}, self._origfile)
|
||||
|
||||
def test_edit_metadata_file_1(self):
|
||||
|
||||
newfile1 = """
|
||||
# A comment
|
||||
HELLO = "newvalue"
|
||||
|
||||
THIS = "that"
|
||||
|
||||
# Another comment
|
||||
NOCHANGE = "samevalue"
|
||||
OTHER = 'anothervalue'
|
||||
|
||||
MULTILINE = "a1 \\
|
||||
a2 \\
|
||||
a3"
|
||||
|
||||
MULTILINE2 := " \\
|
||||
b1 \\
|
||||
b2 \\
|
||||
b3 \\
|
||||
"
|
||||
|
||||
|
||||
MULTILINE3 = " \\
|
||||
c1 \\
|
||||
c2 \\
|
||||
c3 \\
|
||||
"
|
||||
|
||||
do_functionname() {
|
||||
command1 ${VAL1} ${VAL2}
|
||||
command2 ${VAL3} ${VAL4}
|
||||
}
|
||||
"""
|
||||
self._testeditfile({'HELLO': ('newvalue', None, 4, True)}, newfile1)
|
||||
|
||||
|
||||
def test_edit_metadata_file_2(self):
|
||||
|
||||
newfile2 = """
|
||||
# A comment
|
||||
HELLO = "oldvalue"
|
||||
|
||||
THIS = "that"
|
||||
|
||||
# Another comment
|
||||
NOCHANGE = "samevalue"
|
||||
OTHER = 'anothervalue'
|
||||
|
||||
MULTILINE = " \\
|
||||
d1 \\
|
||||
d2 \\
|
||||
d3 \\
|
||||
"
|
||||
|
||||
MULTILINE2 := " \\
|
||||
b1 \\
|
||||
b2 \\
|
||||
b3 \\
|
||||
"
|
||||
|
||||
|
||||
MULTILINE3 = "nowsingle"
|
||||
|
||||
do_functionname() {
|
||||
command1 ${VAL1} ${VAL2}
|
||||
command2 ${VAL3} ${VAL4}
|
||||
}
|
||||
"""
|
||||
self._testeditfile({'MULTILINE': (['d1','d2','d3'], None, 4, False),
|
||||
'MULTILINE3': ('nowsingle', None, 4, True),
|
||||
'NOTPRESENT': (['a', 'b'], None, 4, False)}, newfile2, dummyvars=['NOTPRESENT'])
|
||||
|
||||
|
||||
def test_edit_metadata_file_3(self):
|
||||
|
||||
newfile3 = """
|
||||
# A comment
|
||||
HELLO = "oldvalue"
|
||||
|
||||
# Another comment
|
||||
NOCHANGE = "samevalue"
|
||||
OTHER = "yetanothervalue"
|
||||
|
||||
MULTILINE = "e1 \\
|
||||
e2 \\
|
||||
e3 \\
|
||||
"
|
||||
|
||||
MULTILINE2 := "f1 \\
|
||||
\tf2 \\
|
||||
\t"
|
||||
|
||||
|
||||
MULTILINE3 = " \\
|
||||
c1 \\
|
||||
c2 \\
|
||||
c3 \\
|
||||
"
|
||||
|
||||
do_functionname() {
|
||||
othercommand_one a b c
|
||||
othercommand_two d e f
|
||||
}
|
||||
"""
|
||||
|
||||
self._testeditfile({'do_functionname()': (['othercommand_one a b c', 'othercommand_two d e f'], None, 4, False),
|
||||
'MULTILINE2': (['f1', 'f2'], None, '\t', True),
|
||||
'MULTILINE': (['e1', 'e2', 'e3'], None, -1, True),
|
||||
'THIS': (None, None, 0, False),
|
||||
'OTHER': ('yetanothervalue', None, 0, True)}, newfile3)
|
||||
|
||||
|
||||
def test_edit_metadata_file_4(self):
|
||||
|
||||
newfile4 = """
|
||||
# A comment
|
||||
HELLO = "oldvalue"
|
||||
|
||||
THIS = "that"
|
||||
|
||||
# Another comment
|
||||
OTHER = 'anothervalue'
|
||||
|
||||
MULTILINE = "a1 \\
|
||||
a2 \\
|
||||
a3"
|
||||
|
||||
MULTILINE2 := " \\
|
||||
b1 \\
|
||||
b2 \\
|
||||
b3 \\
|
||||
"
|
||||
|
||||
|
||||
"""
|
||||
|
||||
self._testeditfile({'NOCHANGE': (None, None, 0, False),
|
||||
'MULTILINE3': (None, None, 0, False),
|
||||
'THIS': ('that', None, 0, False),
|
||||
'do_functionname()': (None, None, 0, False)}, newfile4)
|
||||
|
||||
|
||||
def test_edit_metadata(self):
|
||||
newfile5 = """
|
||||
# A comment
|
||||
HELLO = "hithere"
|
||||
|
||||
# A new comment
|
||||
THIS += "that"
|
||||
|
||||
# Another comment
|
||||
NOCHANGE = "samevalue"
|
||||
OTHER = 'anothervalue'
|
||||
|
||||
MULTILINE = "a1 \\
|
||||
a2 \\
|
||||
a3"
|
||||
|
||||
MULTILINE2 := " \\
|
||||
b1 \\
|
||||
b2 \\
|
||||
b3 \\
|
||||
"
|
||||
|
||||
|
||||
MULTILINE3 = " \\
|
||||
c1 \\
|
||||
c2 \\
|
||||
c3 \\
|
||||
"
|
||||
|
||||
NEWVAR = "value"
|
||||
|
||||
do_functionname() {
|
||||
command1 ${VAL1} ${VAL2}
|
||||
command2 ${VAL3} ${VAL4}
|
||||
}
|
||||
"""
|
||||
|
||||
|
||||
def handle_var(varname, origvalue, op, newlines):
|
||||
if varname == 'THIS':
|
||||
newlines.append('# A new comment\n')
|
||||
elif varname == 'do_functionname()':
|
||||
newlines.append('NEWVAR = "value"\n')
|
||||
newlines.append('\n')
|
||||
valueitem = varvalues.get(varname, None)
|
||||
if valueitem:
|
||||
return valueitem
|
||||
else:
|
||||
return (origvalue, op, 0, True)
|
||||
|
||||
varvalues = {'HELLO': ('hithere', None, 0, True), 'THIS': ('that', '+=', 0, True)}
|
||||
varlist = ['HELLO', 'THIS', 'do_functionname()']
|
||||
(updated, newlines) = bb.utils.edit_metadata(self._origfile.splitlines(True), varlist, handle_var)
|
||||
self.assertTrue(updated, 'List should be updated but isn\'t')
|
||||
self.assertEqual(newlines, newfile5.splitlines(True))
|
||||
|
||||
# Make sure the orig value matches what we expect it to be
|
||||
def test_edit_metadata_origvalue(self):
|
||||
origfile = """
|
||||
MULTILINE = " stuff \\
|
||||
morestuff"
|
||||
"""
|
||||
expected_value = "stuff morestuff"
|
||||
global value_in_callback
|
||||
value_in_callback = ""
|
||||
|
||||
def handle_var(varname, origvalue, op, newlines):
|
||||
global value_in_callback
|
||||
value_in_callback = origvalue
|
||||
return (origvalue, op, -1, False)
|
||||
|
||||
bb.utils.edit_metadata(origfile.splitlines(True),
|
||||
['MULTILINE'],
|
||||
handle_var)
|
||||
|
||||
testvalue = re.sub('\s+', ' ', value_in_callback.strip())
|
||||
self.assertEqual(expected_value, testvalue)
|
||||
|
||||
class EditBbLayersConf(unittest.TestCase):
|
||||
|
||||
def _test_bblayers_edit(self, before, after, add, remove, notadded, notremoved):
|
||||
with tempfile.NamedTemporaryFile('w', delete=False) as tf:
|
||||
tf.write(before)
|
||||
tf.close()
|
||||
try:
|
||||
actual_notadded, actual_notremoved = bb.utils.edit_bblayers_conf(tf.name, add, remove)
|
||||
with open(tf.name) as f:
|
||||
actual_after = f.readlines()
|
||||
self.assertEqual(after.splitlines(True), actual_after)
|
||||
self.assertEqual(notadded, actual_notadded)
|
||||
self.assertEqual(notremoved, actual_notremoved)
|
||||
finally:
|
||||
os.remove(tf.name)
|
||||
|
||||
|
||||
def test_bblayers_remove(self):
|
||||
before = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS = " \
|
||||
/home/user/path/layer1 \
|
||||
/home/user/path/layer2 \
|
||||
/home/user/path/subpath/layer3 \
|
||||
/home/user/path/layer4 \
|
||||
"
|
||||
"""
|
||||
after = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS = " \
|
||||
/home/user/path/layer1 \
|
||||
/home/user/path/subpath/layer3 \
|
||||
/home/user/path/layer4 \
|
||||
"
|
||||
"""
|
||||
self._test_bblayers_edit(before, after,
|
||||
None,
|
||||
'/home/user/path/layer2',
|
||||
[],
|
||||
[])
|
||||
|
||||
|
||||
def test_bblayers_add(self):
|
||||
before = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS = " \
|
||||
/home/user/path/layer1 \
|
||||
/home/user/path/layer2 \
|
||||
/home/user/path/subpath/layer3 \
|
||||
/home/user/path/layer4 \
|
||||
"
|
||||
"""
|
||||
after = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS = " \
|
||||
/home/user/path/layer1 \
|
||||
/home/user/path/layer2 \
|
||||
/home/user/path/subpath/layer3 \
|
||||
/home/user/path/layer4 \
|
||||
/other/path/to/layer5 \
|
||||
"
|
||||
"""
|
||||
self._test_bblayers_edit(before, after,
|
||||
'/other/path/to/layer5/',
|
||||
None,
|
||||
[],
|
||||
[])
|
||||
|
||||
|
||||
def test_bblayers_add_remove(self):
|
||||
before = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS = " \
|
||||
/home/user/path/layer1 \
|
||||
/home/user/path/layer2 \
|
||||
/home/user/path/subpath/layer3 \
|
||||
/home/user/path/layer4 \
|
||||
"
|
||||
"""
|
||||
after = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS = " \
|
||||
/home/user/path/layer1 \
|
||||
/home/user/path/layer2 \
|
||||
/home/user/path/layer4 \
|
||||
/other/path/to/layer5 \
|
||||
"
|
||||
"""
|
||||
self._test_bblayers_edit(before, after,
|
||||
['/other/path/to/layer5', '/home/user/path/layer2/'], '/home/user/path/subpath/layer3/',
|
||||
['/home/user/path/layer2'],
|
||||
[])
|
||||
|
||||
|
||||
def test_bblayers_add_remove_home(self):
|
||||
before = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS = " \
|
||||
~/path/layer1 \
|
||||
~/path/layer2 \
|
||||
~/otherpath/layer3 \
|
||||
~/path/layer4 \
|
||||
"
|
||||
"""
|
||||
after = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS = " \
|
||||
~/path/layer2 \
|
||||
~/path/layer4 \
|
||||
~/path2/layer5 \
|
||||
"
|
||||
"""
|
||||
self._test_bblayers_edit(before, after,
|
||||
[os.environ['HOME'] + '/path/layer4', '~/path2/layer5'],
|
||||
[os.environ['HOME'] + '/otherpath/layer3', '~/path/layer1', '~/path/notinlist'],
|
||||
[os.environ['HOME'] + '/path/layer4'],
|
||||
['~/path/notinlist'])
|
||||
|
||||
|
||||
def test_bblayers_add_remove_plusequals(self):
|
||||
before = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS += " \
|
||||
/home/user/path/layer1 \
|
||||
/home/user/path/layer2 \
|
||||
"
|
||||
"""
|
||||
after = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS += " \
|
||||
/home/user/path/layer2 \
|
||||
/home/user/path/layer3 \
|
||||
"
|
||||
"""
|
||||
self._test_bblayers_edit(before, after,
|
||||
'/home/user/path/layer3',
|
||||
'/home/user/path/layer1',
|
||||
[],
|
||||
[])
|
||||
|
||||
|
||||
def test_bblayers_add_remove_plusequals2(self):
|
||||
before = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS += " \
|
||||
/home/user/path/layer1 \
|
||||
/home/user/path/layer2 \
|
||||
/home/user/path/layer3 \
|
||||
"
|
||||
BBLAYERS += "/home/user/path/layer4"
|
||||
BBLAYERS += "/home/user/path/layer5"
|
||||
"""
|
||||
after = r"""
|
||||
# A comment
|
||||
|
||||
BBPATH = "${TOPDIR}"
|
||||
BBFILES ?= ""
|
||||
BBLAYERS += " \
|
||||
/home/user/path/layer2 \
|
||||
/home/user/path/layer3 \
|
||||
"
|
||||
BBLAYERS += "/home/user/path/layer5"
|
||||
BBLAYERS += "/home/user/otherpath/layer6"
|
||||
"""
|
||||
self._test_bblayers_edit(before, after,
|
||||
['/home/user/otherpath/layer6', '/home/user/path/layer3'], ['/home/user/path/layer1', '/home/user/path/layer4', '/home/user/path/layer7'],
|
||||
['/home/user/path/layer3'],
|
||||
['/home/user/path/layer7'])
|
||||
|
||||
@@ -1,8 +1,7 @@
|
||||
# tinfoil: a simple wrapper around cooker for bitbake-based command-line utilities
|
||||
#
|
||||
# Copyright (C) 2012-2017 Intel Corporation
|
||||
# Copyright (C) 2012 Intel Corporation
|
||||
# Copyright (C) 2011 Mentor Graphics Corporation
|
||||
# Copyright (C) 2006-2012 Richard Purdie
|
||||
#
|
||||
# This program is free software; you can redistribute it and/or modify
|
||||
# it under the terms of the GNU General Public License version 2 as
|
||||
@@ -18,883 +17,88 @@
|
||||
# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
||||
|
||||
import logging
|
||||
import warnings
|
||||
import os
|
||||
import sys
|
||||
import atexit
|
||||
import re
|
||||
from collections import OrderedDict, defaultdict
|
||||
|
||||
import bb.cache
|
||||
import bb.cooker
|
||||
import bb.providers
|
||||
import bb.taskdata
|
||||
import bb.utils
|
||||
import bb.command
|
||||
import bb.remotedata
|
||||
from bb.cooker import state, BBCooker, CookerFeatures
|
||||
from bb.cookerdata import CookerConfiguration, ConfigParameters
|
||||
from bb.main import setup_bitbake, BitBakeConfigParameters, BBMainException
|
||||
import bb.fetch2
|
||||
|
||||
|
||||
# We need this in order to shut down the connection to the bitbake server,
|
||||
# otherwise the process will never properly exit
|
||||
_server_connections = []
|
||||
def _terminate_connections():
|
||||
for connection in _server_connections:
|
||||
connection.terminate()
|
||||
atexit.register(_terminate_connections)
|
||||
|
||||
class TinfoilUIException(Exception):
|
||||
"""Exception raised when the UI returns non-zero from its main function"""
|
||||
def __init__(self, returncode):
|
||||
self.returncode = returncode
|
||||
def __repr__(self):
|
||||
return 'UI module main returned %d' % self.returncode
|
||||
|
||||
class TinfoilCommandFailed(Exception):
|
||||
"""Exception raised when run_command fails"""
|
||||
|
||||
class TinfoilDataStoreConnector:
|
||||
"""Connector object used to enable access to datastore objects via tinfoil"""
|
||||
|
||||
def __init__(self, tinfoil, dsindex):
|
||||
self.tinfoil = tinfoil
|
||||
self.dsindex = dsindex
|
||||
def getVar(self, name):
|
||||
value = self.tinfoil.run_command('dataStoreConnectorFindVar', self.dsindex, name)
|
||||
overrides = None
|
||||
if isinstance(value, dict):
|
||||
if '_connector_origtype' in value:
|
||||
value['_content'] = self.tinfoil._reconvert_type(value['_content'], value['_connector_origtype'])
|
||||
del value['_connector_origtype']
|
||||
if '_connector_overrides' in value:
|
||||
overrides = value['_connector_overrides']
|
||||
del value['_connector_overrides']
|
||||
return value, overrides
|
||||
def getKeys(self):
|
||||
return set(self.tinfoil.run_command('dataStoreConnectorGetKeys', self.dsindex))
|
||||
def getVarHistory(self, name):
|
||||
return self.tinfoil.run_command('dataStoreConnectorGetVarHistory', self.dsindex, name)
|
||||
def expandPythonRef(self, varname, expr, d):
|
||||
ds = bb.remotedata.RemoteDatastores.transmit_datastore(d)
|
||||
ret = self.tinfoil.run_command('dataStoreConnectorExpandPythonRef', ds, varname, expr)
|
||||
return ret
|
||||
def setVar(self, varname, value):
|
||||
if self.dsindex is None:
|
||||
self.tinfoil.run_command('setVariable', varname, value)
|
||||
else:
|
||||
# Not currently implemented - indicate that setting should
|
||||
# be redirected to local side
|
||||
return True
|
||||
def setVarFlag(self, varname, flagname, value):
|
||||
if self.dsindex is None:
|
||||
self.tinfoil.run_command('dataStoreConnectorSetVarFlag', self.dsindex, varname, flagname, value)
|
||||
else:
|
||||
# Not currently implemented - indicate that setting should
|
||||
# be redirected to local side
|
||||
return True
|
||||
def delVar(self, varname):
|
||||
if self.dsindex is None:
|
||||
self.tinfoil.run_command('dataStoreConnectorDelVar', self.dsindex, varname)
|
||||
else:
|
||||
# Not currently implemented - indicate that setting should
|
||||
# be redirected to local side
|
||||
return True
|
||||
def delVarFlag(self, varname, flagname):
|
||||
if self.dsindex is None:
|
||||
self.tinfoil.run_command('dataStoreConnectorDelVar', self.dsindex, varname, flagname)
|
||||
else:
|
||||
# Not currently implemented - indicate that setting should
|
||||
# be redirected to local side
|
||||
return True
|
||||
def renameVar(self, name, newname):
|
||||
if self.dsindex is None:
|
||||
self.tinfoil.run_command('dataStoreConnectorRenameVar', self.dsindex, name, newname)
|
||||
else:
|
||||
# Not currently implemented - indicate that setting should
|
||||
# be redirected to local side
|
||||
return True
|
||||
|
||||
class TinfoilCookerAdapter:
|
||||
"""
|
||||
Provide an adapter for existing code that expects to access a cooker object via Tinfoil,
|
||||
since now Tinfoil is on the client side it no longer has direct access.
|
||||
"""
|
||||
|
||||
class TinfoilCookerCollectionAdapter:
|
||||
""" cooker.collection adapter """
|
||||
def __init__(self, tinfoil):
|
||||
self.tinfoil = tinfoil
|
||||
def get_file_appends(self, fn):
|
||||
return self.tinfoil.get_file_appends(fn)
|
||||
def __getattr__(self, name):
|
||||
if name == 'overlayed':
|
||||
return self.tinfoil.get_overlayed_recipes()
|
||||
elif name == 'bbappends':
|
||||
return self.tinfoil.run_command('getAllAppends')
|
||||
else:
|
||||
raise AttributeError("%s instance has no attribute '%s'" % (self.__class__.__name__, name))
|
||||
|
||||
class TinfoilRecipeCacheAdapter:
|
||||
""" cooker.recipecache adapter """
|
||||
def __init__(self, tinfoil):
|
||||
self.tinfoil = tinfoil
|
||||
self._cache = {}
|
||||
|
||||
def get_pkg_pn_fn(self):
|
||||
pkg_pn = defaultdict(list, self.tinfoil.run_command('getRecipes') or [])
|
||||
pkg_fn = {}
|
||||
for pn, fnlist in pkg_pn.items():
|
||||
for fn in fnlist:
|
||||
pkg_fn[fn] = pn
|
||||
self._cache['pkg_pn'] = pkg_pn
|
||||
self._cache['pkg_fn'] = pkg_fn
|
||||
|
||||
def __getattr__(self, name):
|
||||
# Grab these only when they are requested since they aren't always used
|
||||
if name in self._cache:
|
||||
return self._cache[name]
|
||||
elif name == 'pkg_pn':
|
||||
self.get_pkg_pn_fn()
|
||||
return self._cache[name]
|
||||
elif name == 'pkg_fn':
|
||||
self.get_pkg_pn_fn()
|
||||
return self._cache[name]
|
||||
elif name == 'deps':
|
||||
attrvalue = defaultdict(list, self.tinfoil.run_command('getRecipeDepends') or [])
|
||||
elif name == 'rundeps':
|
||||
attrvalue = defaultdict(lambda: defaultdict(list), self.tinfoil.run_command('getRuntimeDepends') or [])
|
||||
elif name == 'runrecs':
|
||||
attrvalue = defaultdict(lambda: defaultdict(list), self.tinfoil.run_command('getRuntimeRecommends') or [])
|
||||
elif name == 'pkg_pepvpr':
|
||||
attrvalue = self.tinfoil.run_command('getRecipeVersions') or {}
|
||||
elif name == 'inherits':
|
||||
attrvalue = self.tinfoil.run_command('getRecipeInherits') or {}
|
||||
elif name == 'bbfile_priority':
|
||||
attrvalue = self.tinfoil.run_command('getBbFilePriority') or {}
|
||||
elif name == 'pkg_dp':
|
||||
attrvalue = self.tinfoil.run_command('getDefaultPreference') or {}
|
||||
elif name == 'fn_provides':
|
||||
attrvalue = self.tinfoil.run_command('getRecipeProvides') or {}
|
||||
elif name == 'packages':
|
||||
attrvalue = self.tinfoil.run_command('getRecipePackages') or {}
|
||||
elif name == 'packages_dynamic':
|
||||
attrvalue = self.tinfoil.run_command('getRecipePackagesDynamic') or {}
|
||||
elif name == 'rproviders':
|
||||
attrvalue = self.tinfoil.run_command('getRProviders') or {}
|
||||
else:
|
||||
raise AttributeError("%s instance has no attribute '%s'" % (self.__class__.__name__, name))
|
||||
|
||||
self._cache[name] = attrvalue
|
||||
return attrvalue
|
||||
|
||||
def __init__(self, tinfoil):
|
||||
self.tinfoil = tinfoil
|
||||
self.collection = self.TinfoilCookerCollectionAdapter(tinfoil)
|
||||
self.recipecaches = {}
|
||||
# FIXME all machines
|
||||
self.recipecaches[''] = self.TinfoilRecipeCacheAdapter(tinfoil)
|
||||
self._cache = {}
|
||||
def __getattr__(self, name):
|
||||
# Grab these only when they are requested since they aren't always used
|
||||
if name in self._cache:
|
||||
return self._cache[name]
|
||||
elif name == 'skiplist':
|
||||
attrvalue = self.tinfoil.get_skipped_recipes()
|
||||
elif name == 'bbfile_config_priorities':
|
||||
ret = self.tinfoil.run_command('getLayerPriorities')
|
||||
bbfile_config_priorities = []
|
||||
for collection, pattern, regex, pri in ret:
|
||||
bbfile_config_priorities.append((collection, pattern, re.compile(regex), pri))
|
||||
|
||||
attrvalue = bbfile_config_priorities
|
||||
else:
|
||||
raise AttributeError("%s instance has no attribute '%s'" % (self.__class__.__name__, name))
|
||||
|
||||
self._cache[name] = attrvalue
|
||||
return attrvalue
|
||||
|
||||
def findBestProvider(self, pn):
|
||||
return self.tinfoil.find_best_provider(pn)
|
||||
|
||||
|
||||
class TinfoilRecipeInfo:
|
||||
"""
|
||||
Provides a convenient representation of the cached information for a single recipe.
|
||||
Some attributes are set on construction, others are read on-demand (which internally
|
||||
may result in a remote procedure call to the bitbake server the first time).
|
||||
Note that only information which is cached is available through this object - if
|
||||
you need other variable values you will need to parse the recipe using
|
||||
Tinfoil.parse_recipe().
|
||||
"""
|
||||
def __init__(self, recipecache, d, pn, fn, fns):
|
||||
self._recipecache = recipecache
|
||||
self._d = d
|
||||
self.pn = pn
|
||||
self.fn = fn
|
||||
self.fns = fns
|
||||
self.inherit_files = recipecache.inherits[fn]
|
||||
self.depends = recipecache.deps[fn]
|
||||
(self.pe, self.pv, self.pr) = recipecache.pkg_pepvpr[fn]
|
||||
self._cached_packages = None
|
||||
self._cached_rprovides = None
|
||||
self._cached_packages_dynamic = None
|
||||
|
||||
def __getattr__(self, name):
|
||||
if name == 'alternates':
|
||||
return [x for x in self.fns if x != self.fn]
|
||||
elif name == 'rdepends':
|
||||
return self._recipecache.rundeps[self.fn]
|
||||
elif name == 'rrecommends':
|
||||
return self._recipecache.runrecs[self.fn]
|
||||
elif name == 'provides':
|
||||
return self._recipecache.fn_provides[self.fn]
|
||||
elif name == 'packages':
|
||||
if self._cached_packages is None:
|
||||
self._cached_packages = []
|
||||
for pkg, fns in self._recipecache.packages.items():
|
||||
if self.fn in fns:
|
||||
self._cached_packages.append(pkg)
|
||||
return self._cached_packages
|
||||
elif name == 'packages_dynamic':
|
||||
if self._cached_packages_dynamic is None:
|
||||
self._cached_packages_dynamic = []
|
||||
for pkg, fns in self._recipecache.packages_dynamic.items():
|
||||
if self.fn in fns:
|
||||
self._cached_packages_dynamic.append(pkg)
|
||||
return self._cached_packages_dynamic
|
||||
elif name == 'rprovides':
|
||||
if self._cached_rprovides is None:
|
||||
self._cached_rprovides = []
|
||||
for pkg, fns in self._recipecache.rproviders.items():
|
||||
if self.fn in fns:
|
||||
self._cached_rprovides.append(pkg)
|
||||
return self._cached_rprovides
|
||||
else:
|
||||
raise AttributeError("%s instance has no attribute '%s'" % (self.__class__.__name__, name))
|
||||
def inherits(self, only_recipe=False):
|
||||
"""
|
||||
Get the inherited classes for a recipe. Returns the class names only.
|
||||
Parameters:
|
||||
only_recipe: True to return only the classes inherited by the recipe
|
||||
itself, False to return all classes inherited within
|
||||
the context for the recipe (which includes globally
|
||||
inherited classes).
|
||||
"""
|
||||
if only_recipe:
|
||||
global_inherit = [x for x in (self._d.getVar('BBINCLUDED') or '').split() if x.endswith('.bbclass')]
|
||||
else:
|
||||
global_inherit = []
|
||||
for clsfile in self.inherit_files:
|
||||
if only_recipe and clsfile in global_inherit:
|
||||
continue
|
||||
clsname = os.path.splitext(os.path.basename(clsfile))[0]
|
||||
yield clsname
|
||||
def __str__(self):
|
||||
return '%s' % self.pn
|
||||
|
||||
|
||||
class Tinfoil:
|
||||
"""
|
||||
Tinfoil - an API for scripts and utilities to query
|
||||
BitBake internals and perform build operations.
|
||||
"""
|
||||
def __init__(self, output=sys.stdout, tracking=False):
|
||||
# Needed to avoid deprecation warnings with python 2.6
|
||||
warnings.filterwarnings("ignore", category=DeprecationWarning)
|
||||
|
||||
def __init__(self, output=sys.stdout, tracking=False, setup_logging=True):
|
||||
"""
|
||||
Create a new tinfoil object.
|
||||
Parameters:
|
||||
output: specifies where console output should be sent. Defaults
|
||||
to sys.stdout.
|
||||
tracking: True to enable variable history tracking, False to
|
||||
disable it (default). Enabling this has a minor
|
||||
performance impact so typically it isn't enabled
|
||||
unless you need to query variable history.
|
||||
setup_logging: True to setup a logger so that things like
|
||||
bb.warn() will work immediately and timeout warnings
|
||||
are visible; False to let BitBake do this itself.
|
||||
"""
|
||||
# Set up logging
|
||||
self.logger = logging.getLogger('BitBake')
|
||||
self.config_data = None
|
||||
self.cooker = None
|
||||
self.tracking = tracking
|
||||
self.ui_module = None
|
||||
self.server_connection = None
|
||||
self.recipes_parsed = False
|
||||
self.quiet = 0
|
||||
self.oldhandlers = self.logger.handlers[:]
|
||||
if setup_logging:
|
||||
# This is the *client-side* logger, nothing to do with
|
||||
# logging messages from the server
|
||||
bb.msg.logger_create('BitBake', output)
|
||||
self.localhandlers = []
|
||||
for handler in self.logger.handlers:
|
||||
if handler not in self.oldhandlers:
|
||||
self.localhandlers.append(handler)
|
||||
console = logging.StreamHandler(output)
|
||||
bb.msg.addDefaultlogFilter(console)
|
||||
format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
|
||||
if output.isatty():
|
||||
format.enable_color()
|
||||
console.setFormatter(format)
|
||||
self.logger.addHandler(console)
|
||||
|
||||
def __enter__(self):
|
||||
return self
|
||||
self.config = CookerConfiguration()
|
||||
configparams = TinfoilConfigParameters(parse_only=True)
|
||||
self.config.setConfigParameters(configparams)
|
||||
self.config.setServerRegIdleCallback(self.register_idle_function)
|
||||
features = []
|
||||
if tracking:
|
||||
features.append(CookerFeatures.BASEDATASTORE_TRACKING)
|
||||
self.cooker = BBCooker(self.config, features)
|
||||
self.config_data = self.cooker.data
|
||||
bb.providers.logger.setLevel(logging.ERROR)
|
||||
self.cooker_data = None
|
||||
|
||||
def __exit__(self, type, value, traceback):
|
||||
self.shutdown()
|
||||
|
||||
def prepare(self, config_only=False, config_params=None, quiet=0, extra_features=None):
|
||||
"""
|
||||
Prepares the underlying BitBake system to be used via tinfoil.
|
||||
This function must be called prior to calling any of the other
|
||||
functions in the API.
|
||||
NOTE: if you call prepare() you must absolutely call shutdown()
|
||||
before your code terminates. You can use a "with" block to ensure
|
||||
this happens e.g.
|
||||
|
||||
with bb.tinfoil.Tinfoil() as tinfoil:
|
||||
tinfoil.prepare()
|
||||
...
|
||||
|
||||
Parameters:
|
||||
config_only: True to read only the configuration and not load
|
||||
the cache / parse recipes. This is useful if you just
|
||||
want to query the value of a variable at the global
|
||||
level or you want to do anything else that doesn't
|
||||
involve knowing anything about the recipes in the
|
||||
current configuration. False loads the cache / parses
|
||||
recipes.
|
||||
config_params: optionally specify your own configuration
|
||||
parameters. If not specified an instance of
|
||||
TinfoilConfigParameters will be created internally.
|
||||
quiet: quiet level controlling console output - equivalent
|
||||
to bitbake's -q/--quiet option. Default of 0 gives
|
||||
the same output level as normal bitbake execution.
|
||||
extra_features: extra features to be added to the feature
|
||||
set requested from the server. See
|
||||
CookerFeatures._feature_list for possible
|
||||
features.
|
||||
"""
|
||||
self.quiet = quiet
|
||||
|
||||
if self.tracking:
|
||||
extrafeatures = [bb.cooker.CookerFeatures.BASEDATASTORE_TRACKING]
|
||||
else:
|
||||
extrafeatures = []
|
||||
|
||||
if extra_features:
|
||||
extrafeatures += extra_features
|
||||
|
||||
if not config_params:
|
||||
config_params = TinfoilConfigParameters(config_only=config_only, quiet=quiet)
|
||||
|
||||
cookerconfig = CookerConfiguration()
|
||||
cookerconfig.setConfigParameters(config_params)
|
||||
|
||||
if not config_only:
|
||||
# Disable local loggers because the UI module is going to set up its own
|
||||
for handler in self.localhandlers:
|
||||
self.logger.handlers.remove(handler)
|
||||
self.localhandlers = []
|
||||
|
||||
self.server_connection, ui_module = setup_bitbake(config_params,
|
||||
cookerconfig,
|
||||
extrafeatures)
|
||||
|
||||
self.ui_module = ui_module
|
||||
|
||||
# Ensure the path to bitbake's bin directory is in PATH so that things like
|
||||
# bitbake-worker can be run (usually this is the case, but it doesn't have to be)
|
||||
path = os.getenv('PATH').split(':')
|
||||
bitbakebinpath = os.path.abspath(os.path.join(os.path.dirname(os.path.abspath(__file__)), '..', '..', 'bin'))
|
||||
for entry in path:
|
||||
if entry.endswith(os.sep):
|
||||
entry = entry[:-1]
|
||||
if os.path.abspath(entry) == bitbakebinpath:
|
||||
break
|
||||
else:
|
||||
path.insert(0, bitbakebinpath)
|
||||
os.environ['PATH'] = ':'.join(path)
|
||||
|
||||
if self.server_connection:
|
||||
_server_connections.append(self.server_connection)
|
||||
if config_only:
|
||||
config_params.updateToServer(self.server_connection.connection, os.environ.copy())
|
||||
self.run_command('parseConfiguration')
|
||||
else:
|
||||
self.run_actions(config_params)
|
||||
self.recipes_parsed = True
|
||||
|
||||
self.config_data = bb.data.init()
|
||||
connector = TinfoilDataStoreConnector(self, None)
|
||||
self.config_data.setVar('_remote_data', connector)
|
||||
self.cooker = TinfoilCookerAdapter(self)
|
||||
self.cooker_data = self.cooker.recipecaches['']
|
||||
else:
|
||||
raise Exception('Failed to start bitbake server')
|
||||
|
||||
def run_actions(self, config_params):
|
||||
"""
|
||||
Run the actions specified in config_params through the UI.
|
||||
"""
|
||||
ret = self.ui_module.main(self.server_connection.connection, self.server_connection.events, config_params)
|
||||
if ret:
|
||||
raise TinfoilUIException(ret)
|
||||
def register_idle_function(self, function, data):
|
||||
pass
|
||||
|
||||
def parseRecipes(self):
|
||||
"""
|
||||
Legacy function - use parse_recipes() instead.
|
||||
"""
|
||||
self.parse_recipes()
|
||||
sys.stderr.write("Parsing recipes..")
|
||||
self.logger.setLevel(logging.WARNING)
|
||||
|
||||
def parse_recipes(self):
|
||||
"""
|
||||
Load information on all recipes. Normally you should specify
|
||||
config_only=False when calling prepare() instead of using this
|
||||
function; this function is designed for situations where you need
|
||||
to initialise Tinfoil and use it with config_only=True first and
|
||||
then conditionally call this function to parse recipes later.
|
||||
"""
|
||||
config_params = TinfoilConfigParameters(config_only=False)
|
||||
self.run_actions(config_params)
|
||||
self.recipes_parsed = True
|
||||
|
||||
def run_command(self, command, *params):
|
||||
"""
|
||||
Run a command on the server (as implemented in bb.command).
|
||||
Note that there are two types of command - synchronous and
|
||||
asynchronous; in order to receive the results of asynchronous
|
||||
commands you will need to set an appropriate event mask
|
||||
using set_event_mask() and listen for the result using
|
||||
wait_event() - with the correct event mask you'll at least get
|
||||
bb.command.CommandCompleted and possibly other events before
|
||||
that depending on the command.
|
||||
"""
|
||||
if not self.server_connection:
|
||||
raise Exception('Not connected to server (did you call .prepare()?)')
|
||||
|
||||
commandline = [command]
|
||||
if params:
|
||||
commandline.extend(params)
|
||||
result = self.server_connection.connection.runCommand(commandline)
|
||||
if result[1]:
|
||||
raise TinfoilCommandFailed(result[1])
|
||||
return result[0]
|
||||
|
||||
def set_event_mask(self, eventlist):
|
||||
"""Set the event mask which will be applied within wait_event()"""
|
||||
if not self.server_connection:
|
||||
raise Exception('Not connected to server (did you call .prepare()?)')
|
||||
llevel, debug_domains = bb.msg.constructLogOptions()
|
||||
ret = self.run_command('setEventMask', self.server_connection.connection.getEventHandle(), llevel, debug_domains, eventlist)
|
||||
if not ret:
|
||||
raise Exception('setEventMask failed')
|
||||
|
||||
def wait_event(self, timeout=0):
|
||||
"""
|
||||
Wait for an event from the server for the specified time.
|
||||
A timeout of 0 means don't wait if there are no events in the queue.
|
||||
Returns the next event in the queue or None if the timeout was
|
||||
reached. Note that in order to recieve any events you will
|
||||
first need to set the internal event mask using set_event_mask()
|
||||
(otherwise whatever event mask the UI set up will be in effect).
|
||||
"""
|
||||
if not self.server_connection:
|
||||
raise Exception('Not connected to server (did you call .prepare()?)')
|
||||
return self.server_connection.events.waitEvent(timeout)
|
||||
|
||||
def get_overlayed_recipes(self):
|
||||
"""
|
||||
Find recipes which are overlayed (i.e. where recipes exist in multiple layers)
|
||||
"""
|
||||
return defaultdict(list, self.run_command('getOverlayedRecipes'))
|
||||
|
||||
def get_skipped_recipes(self):
|
||||
"""
|
||||
Find recipes which were skipped (i.e. SkipRecipe was raised
|
||||
during parsing).
|
||||
"""
|
||||
return OrderedDict(self.run_command('getSkippedRecipes'))
|
||||
|
||||
def get_all_providers(self):
|
||||
return defaultdict(list, self.run_command('allProviders'))
|
||||
|
||||
def find_providers(self):
|
||||
return self.run_command('findProviders')
|
||||
|
||||
def find_best_provider(self, pn):
|
||||
return self.run_command('findBestProvider', pn)
|
||||
|
||||
def get_runtime_providers(self, rdep):
|
||||
return self.run_command('getRuntimeProviders', rdep)
|
||||
|
||||
def get_recipe_file(self, pn):
|
||||
"""
|
||||
Get the file name for the specified recipe/target. Raises
|
||||
bb.providers.NoProvider if there is no match or the recipe was
|
||||
skipped.
|
||||
"""
|
||||
best = self.find_best_provider(pn)
|
||||
if not best or (len(best) > 3 and not best[3]):
|
||||
skiplist = self.get_skipped_recipes()
|
||||
taskdata = bb.taskdata.TaskData(None, skiplist=skiplist)
|
||||
skipreasons = taskdata.get_reasons(pn)
|
||||
if skipreasons:
|
||||
raise bb.providers.NoProvider('%s is unavailable:\n %s' % (pn, ' \n'.join(skipreasons)))
|
||||
else:
|
||||
raise bb.providers.NoProvider('Unable to find any recipe file matching "%s"' % pn)
|
||||
return best[3]
|
||||
|
||||
def get_file_appends(self, fn):
|
||||
"""
|
||||
Find the bbappends for a recipe file
|
||||
"""
|
||||
return self.run_command('getFileAppends', fn)
|
||||
|
||||
def all_recipes(self, mc='', sort=True):
|
||||
"""
|
||||
Enable iterating over all recipes in the current configuration.
|
||||
Returns an iterator over TinfoilRecipeInfo objects created on demand.
|
||||
Parameters:
|
||||
mc: The multiconfig, default of '' uses the main configuration.
|
||||
sort: True to sort recipes alphabetically (default), False otherwise
|
||||
"""
|
||||
recipecache = self.cooker.recipecaches[mc]
|
||||
if sort:
|
||||
recipes = sorted(recipecache.pkg_pn.items())
|
||||
else:
|
||||
recipes = recipecache.pkg_pn.items()
|
||||
for pn, fns in recipes:
|
||||
prov = self.find_best_provider(pn)
|
||||
recipe = TinfoilRecipeInfo(recipecache,
|
||||
self.config_data,
|
||||
pn=pn,
|
||||
fn=prov[3],
|
||||
fns=fns)
|
||||
yield recipe
|
||||
|
||||
def all_recipe_files(self, mc='', variants=True, preferred_only=False):
|
||||
"""
|
||||
Enable iterating over all recipe files in the current configuration.
|
||||
Returns an iterator over file paths.
|
||||
Parameters:
|
||||
mc: The multiconfig, default of '' uses the main configuration.
|
||||
variants: True to include variants of recipes created through
|
||||
BBCLASSEXTEND (default) or False to exclude them
|
||||
preferred_only: True to include only the preferred recipe where
|
||||
multiple exist providing the same PN, False to list
|
||||
all recipes
|
||||
"""
|
||||
recipecache = self.cooker.recipecaches[mc]
|
||||
if preferred_only:
|
||||
files = []
|
||||
for pn in recipecache.pkg_pn.keys():
|
||||
prov = self.find_best_provider(pn)
|
||||
files.append(prov[3])
|
||||
else:
|
||||
files = recipecache.pkg_fn.keys()
|
||||
for fn in sorted(files):
|
||||
if not variants and fn.startswith('virtual:'):
|
||||
continue
|
||||
yield fn
|
||||
|
||||
|
||||
def get_recipe_info(self, pn, mc=''):
|
||||
"""
|
||||
Get information on a specific recipe in the current configuration by name (PN).
|
||||
Returns a TinfoilRecipeInfo object created on demand.
|
||||
Parameters:
|
||||
mc: The multiconfig, default of '' uses the main configuration.
|
||||
"""
|
||||
recipecache = self.cooker.recipecaches[mc]
|
||||
prov = self.find_best_provider(pn)
|
||||
fn = prov[3]
|
||||
if fn:
|
||||
actual_pn = recipecache.pkg_fn[fn]
|
||||
recipe = TinfoilRecipeInfo(recipecache,
|
||||
self.config_data,
|
||||
pn=actual_pn,
|
||||
fn=fn,
|
||||
fns=recipecache.pkg_pn[actual_pn])
|
||||
return recipe
|
||||
else:
|
||||
return None
|
||||
|
||||
def parse_recipe(self, pn):
|
||||
"""
|
||||
Parse the specified recipe and return a datastore object
|
||||
representing the environment for the recipe.
|
||||
"""
|
||||
fn = self.get_recipe_file(pn)
|
||||
return self.parse_recipe_file(fn)
|
||||
|
||||
def parse_recipe_file(self, fn, appends=True, appendlist=None, config_data=None):
|
||||
"""
|
||||
Parse the specified recipe file (with or without bbappends)
|
||||
and return a datastore object representing the environment
|
||||
for the recipe.
|
||||
Parameters:
|
||||
fn: recipe file to parse - can be a file path or virtual
|
||||
specification
|
||||
appends: True to apply bbappends, False otherwise
|
||||
appendlist: optional list of bbappend files to apply, if you
|
||||
want to filter them
|
||||
config_data: custom config datastore to use. NOTE: if you
|
||||
specify config_data then you cannot use a virtual
|
||||
specification for fn.
|
||||
"""
|
||||
if self.tracking:
|
||||
# Enable history tracking just for the parse operation
|
||||
self.run_command('enableDataTracking')
|
||||
try:
|
||||
if appends and appendlist == []:
|
||||
appends = False
|
||||
if config_data:
|
||||
dctr = bb.remotedata.RemoteDatastores.transmit_datastore(config_data)
|
||||
dscon = self.run_command('parseRecipeFile', fn, appends, appendlist, dctr)
|
||||
while self.cooker.state in (state.initial, state.parsing):
|
||||
self.cooker.updateCache()
|
||||
except KeyboardInterrupt:
|
||||
self.cooker.shutdown()
|
||||
self.cooker.updateCache()
|
||||
sys.exit(2)
|
||||
|
||||
self.logger.setLevel(logging.INFO)
|
||||
sys.stderr.write("done.\n")
|
||||
|
||||
self.cooker_data = self.cooker.recipecache
|
||||
|
||||
def prepare(self, config_only = False):
|
||||
if not self.cooker_data:
|
||||
if config_only:
|
||||
self.cooker.parseConfiguration()
|
||||
self.cooker_data = self.cooker.recipecache
|
||||
else:
|
||||
dscon = self.run_command('parseRecipeFile', fn, appends, appendlist)
|
||||
if dscon:
|
||||
return self._reconvert_type(dscon, 'DataStoreConnectionHandle')
|
||||
else:
|
||||
return None
|
||||
finally:
|
||||
if self.tracking:
|
||||
self.run_command('disableDataTracking')
|
||||
|
||||
def build_file(self, buildfile, task, internal=True):
|
||||
"""
|
||||
Runs the specified task for just a single recipe (i.e. no dependencies).
|
||||
This is equivalent to bitbake -b, except with the default internal=True
|
||||
no warning about dependencies will be produced, normal info messages
|
||||
from the runqueue will be silenced and BuildInit, BuildStarted and
|
||||
BuildCompleted events will not be fired.
|
||||
"""
|
||||
return self.run_command('buildFile', buildfile, task, internal)
|
||||
|
||||
def build_targets(self, targets, task=None, handle_events=True, extra_events=None, event_callback=None):
|
||||
"""
|
||||
Builds the specified targets. This is equivalent to a normal invocation
|
||||
of bitbake. Has built-in event handling which is enabled by default and
|
||||
can be extended if needed.
|
||||
Parameters:
|
||||
targets:
|
||||
One or more targets to build. Can be a list or a
|
||||
space-separated string.
|
||||
task:
|
||||
The task to run; if None then the value of BB_DEFAULT_TASK
|
||||
will be used. Default None.
|
||||
handle_events:
|
||||
True to handle events in a similar way to normal bitbake
|
||||
invocation with knotty; False to return immediately (on the
|
||||
assumption that the caller will handle the events instead).
|
||||
Default True.
|
||||
extra_events:
|
||||
An optional list of events to add to the event mask (if
|
||||
handle_events=True). If you add events here you also need
|
||||
to specify a callback function in event_callback that will
|
||||
handle the additional events. Default None.
|
||||
event_callback:
|
||||
An optional function taking a single parameter which
|
||||
will be called first upon receiving any event (if
|
||||
handle_events=True) so that the caller can override or
|
||||
extend the event handling. Default None.
|
||||
"""
|
||||
if isinstance(targets, str):
|
||||
targets = targets.split()
|
||||
if not task:
|
||||
task = self.config_data.getVar('BB_DEFAULT_TASK')
|
||||
|
||||
if handle_events:
|
||||
# A reasonable set of default events matching up with those we handle below
|
||||
eventmask = [
|
||||
'bb.event.BuildStarted',
|
||||
'bb.event.BuildCompleted',
|
||||
'logging.LogRecord',
|
||||
'bb.event.NoProvider',
|
||||
'bb.command.CommandCompleted',
|
||||
'bb.command.CommandFailed',
|
||||
'bb.build.TaskStarted',
|
||||
'bb.build.TaskFailed',
|
||||
'bb.build.TaskSucceeded',
|
||||
'bb.build.TaskFailedSilent',
|
||||
'bb.build.TaskProgress',
|
||||
'bb.runqueue.runQueueTaskStarted',
|
||||
'bb.runqueue.sceneQueueTaskStarted',
|
||||
'bb.event.ProcessStarted',
|
||||
'bb.event.ProcessProgress',
|
||||
'bb.event.ProcessFinished',
|
||||
]
|
||||
if extra_events:
|
||||
eventmask.extend(extra_events)
|
||||
ret = self.set_event_mask(eventmask)
|
||||
|
||||
includelogs = self.config_data.getVar('BBINCLUDELOGS')
|
||||
loglines = self.config_data.getVar('BBINCLUDELOGS_LINES')
|
||||
|
||||
ret = self.run_command('buildTargets', targets, task)
|
||||
if handle_events:
|
||||
result = False
|
||||
# Borrowed from knotty, instead somewhat hackily we use the helper
|
||||
# as the object to store "shutdown" on
|
||||
helper = bb.ui.uihelper.BBUIHelper()
|
||||
# We set up logging optionally in the constructor so now we need to
|
||||
# grab the handlers to pass to TerminalFilter
|
||||
console = None
|
||||
errconsole = None
|
||||
for handler in self.logger.handlers:
|
||||
if isinstance(handler, logging.StreamHandler):
|
||||
if handler.stream == sys.stdout:
|
||||
console = handler
|
||||
elif handler.stream == sys.stderr:
|
||||
errconsole = handler
|
||||
format_str = "%(levelname)s: %(message)s"
|
||||
format = bb.msg.BBLogFormatter(format_str)
|
||||
helper.shutdown = 0
|
||||
parseprogress = None
|
||||
termfilter = bb.ui.knotty.TerminalFilter(helper, helper, console, errconsole, format, quiet=self.quiet)
|
||||
try:
|
||||
while True:
|
||||
try:
|
||||
event = self.wait_event(0.25)
|
||||
if event:
|
||||
if event_callback and event_callback(event):
|
||||
continue
|
||||
if helper.eventHandler(event):
|
||||
if isinstance(event, bb.build.TaskFailedSilent):
|
||||
logger.warning("Logfile for failed setscene task is %s" % event.logfile)
|
||||
elif isinstance(event, bb.build.TaskFailed):
|
||||
bb.ui.knotty.print_event_log(event, includelogs, loglines, termfilter)
|
||||
continue
|
||||
if isinstance(event, bb.event.ProcessStarted):
|
||||
if self.quiet > 1:
|
||||
continue
|
||||
parseprogress = bb.ui.knotty.new_progress(event.processname, event.total)
|
||||
parseprogress.start(False)
|
||||
continue
|
||||
if isinstance(event, bb.event.ProcessProgress):
|
||||
if self.quiet > 1:
|
||||
continue
|
||||
if parseprogress:
|
||||
parseprogress.update(event.progress)
|
||||
else:
|
||||
bb.warn("Got ProcessProgress event for someting that never started?")
|
||||
continue
|
||||
if isinstance(event, bb.event.ProcessFinished):
|
||||
if self.quiet > 1:
|
||||
continue
|
||||
if parseprogress:
|
||||
parseprogress.finish()
|
||||
parseprogress = None
|
||||
continue
|
||||
if isinstance(event, bb.command.CommandCompleted):
|
||||
result = True
|
||||
break
|
||||
if isinstance(event, bb.command.CommandFailed):
|
||||
self.logger.error(str(event))
|
||||
result = False
|
||||
break
|
||||
if isinstance(event, logging.LogRecord):
|
||||
if event.taskpid == 0 or event.levelno > logging.INFO:
|
||||
self.logger.handle(event)
|
||||
continue
|
||||
if isinstance(event, bb.event.NoProvider):
|
||||
self.logger.error(str(event))
|
||||
result = False
|
||||
break
|
||||
|
||||
elif helper.shutdown > 1:
|
||||
break
|
||||
termfilter.updateFooter()
|
||||
except KeyboardInterrupt:
|
||||
termfilter.clearFooter()
|
||||
if helper.shutdown == 1:
|
||||
print("\nSecond Keyboard Interrupt, stopping...\n")
|
||||
ret = self.run_command("stateForceShutdown")
|
||||
if ret and ret[2]:
|
||||
self.logger.error("Unable to cleanly stop: %s" % ret[2])
|
||||
elif helper.shutdown == 0:
|
||||
print("\nKeyboard Interrupt, closing down...\n")
|
||||
interrupted = True
|
||||
ret = self.run_command("stateShutdown")
|
||||
if ret and ret[2]:
|
||||
self.logger.error("Unable to cleanly shutdown: %s" % ret[2])
|
||||
helper.shutdown = helper.shutdown + 1
|
||||
termfilter.clearFooter()
|
||||
finally:
|
||||
termfilter.finish()
|
||||
if helper.failed_tasks:
|
||||
result = False
|
||||
return result
|
||||
else:
|
||||
return ret
|
||||
self.parseRecipes()
|
||||
|
||||
def shutdown(self):
|
||||
"""
|
||||
Shut down tinfoil. Disconnects from the server and gracefully
|
||||
releases any associated resources. You must call this function if
|
||||
prepare() has been called, or use a with... block when you create
|
||||
the tinfoil object which will ensure that it gets called.
|
||||
"""
|
||||
if self.server_connection:
|
||||
self.run_command('clientComplete')
|
||||
_server_connections.remove(self.server_connection)
|
||||
bb.event.ui_queue = []
|
||||
self.server_connection.terminate()
|
||||
self.server_connection = None
|
||||
self.cooker.shutdown(force=True)
|
||||
self.cooker.post_serve()
|
||||
self.cooker.unlockBitbake()
|
||||
|
||||
# Restore logging handlers to how it looked when we started
|
||||
if self.oldhandlers:
|
||||
for handler in self.logger.handlers:
|
||||
if handler not in self.oldhandlers:
|
||||
self.logger.handlers.remove(handler)
|
||||
class TinfoilConfigParameters(ConfigParameters):
|
||||
|
||||
def _reconvert_type(self, obj, origtypename):
|
||||
"""
|
||||
Convert an object back to the right type, in the case
|
||||
that marshalling has changed it (especially with xmlrpc)
|
||||
"""
|
||||
supported_types = {
|
||||
'set': set,
|
||||
'DataStoreConnectionHandle': bb.command.DataStoreConnectionHandle,
|
||||
}
|
||||
|
||||
origtype = supported_types.get(origtypename, None)
|
||||
if origtype is None:
|
||||
raise Exception('Unsupported type "%s"' % origtypename)
|
||||
if type(obj) == origtype:
|
||||
newobj = obj
|
||||
elif isinstance(obj, dict):
|
||||
# New style class
|
||||
newobj = origtype()
|
||||
for k,v in obj.items():
|
||||
setattr(newobj, k, v)
|
||||
else:
|
||||
# Assume we can coerce the type
|
||||
newobj = origtype(obj)
|
||||
|
||||
if isinstance(newobj, bb.command.DataStoreConnectionHandle):
|
||||
connector = TinfoilDataStoreConnector(self, newobj.dsindex)
|
||||
newobj = bb.data.init()
|
||||
newobj.setVar('_remote_data', connector)
|
||||
|
||||
return newobj
|
||||
|
||||
|
||||
class TinfoilConfigParameters(BitBakeConfigParameters):
|
||||
|
||||
def __init__(self, config_only, **options):
|
||||
def __init__(self, **options):
|
||||
self.initial_options = options
|
||||
# Apply some sane defaults
|
||||
if not 'parse_only' in options:
|
||||
self.initial_options['parse_only'] = not config_only
|
||||
#if not 'status_only' in options:
|
||||
# self.initial_options['status_only'] = config_only
|
||||
if not 'ui' in options:
|
||||
self.initial_options['ui'] = 'knotty'
|
||||
if not 'argv' in options:
|
||||
self.initial_options['argv'] = []
|
||||
|
||||
super(TinfoilConfigParameters, self).__init__()
|
||||
|
||||
def parseCommandLine(self, argv=None):
|
||||
# We don't want any parameters parsed from the command line
|
||||
opts = super(TinfoilConfigParameters, self).parseCommandLine([])
|
||||
for key, val in self.initial_options.items():
|
||||
setattr(opts[0], key, val)
|
||||
return opts
|
||||
def parseCommandLine(self):
|
||||
class DummyOptions:
|
||||
def __init__(self, initial_options):
|
||||
for key, val in initial_options.items():
|
||||
setattr(self, key, val)
|
||||
|
||||
return DummyOptions(self.initial_options), None
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user