bitbake: bitbake-user-manual: Fixed porno hack for hello world example

Someone hacked the http://hambedded site or it was moved and some
links to that site in the BB manual had been hijacked to point to
an entry portal for a pornography site.  Replaced the link with an
archived version that restores the integrity of the links.

(Bitbake rev: daa0aa05a04d8d20473a05b5b5878610e40ef820)

Signed-off-by: Scott Rifenbark <srifenbark@gmail.com>
Signed-off-by: Richard Purdie <richard.purdie@linuxfoundation.org>

.gitignore

@@ -1,32 +1,23 @@
 *.pyc
 *.pyo
 /*.patch
-/.repo/
-/build*/
+build*/
 pyshtables.py
 pstage/
 scripts/oe-git-proxy-socks
 sources/
 meta-*/
 !meta-skeleton
-!meta-selftest
+!meta-hob
 hob-image-*.bb
 *.swp
 *.orig
 *.rej
 *~
-!meta-poky
 !meta-yocto
 !meta-yocto-bsp
 !meta-yocto-imported
-/documentation/*/eclipse/
-/documentation/*/*.html
-/documentation/*/*.pdf
-/documentation/*/*.tgz
-/bitbake/doc/bitbake-user-manual/bitbake-user-manual.html
-/bitbake/doc/bitbake-user-manual/bitbake-user-manual.pdf
-/bitbake/doc/bitbake-user-manual/bitbake-user-manual.tgz
+documentation/user-manual/user-manual.html
+documentation/user-manual/user-manual.pdf
+documentation/user-manual/user-manual.tgz
 pull-*/
-bitbake/lib/toaster/contrib/tts/backlog.txt
-bitbake/lib/toaster/contrib/tts/log/*
-bitbake/lib/toaster/contrib/tts/.cache/*

.templateconf

@@ -1,2 +1,2 @@
 # Template settings
-TEMPLATECONF=${TEMPLATECONF:-meta-poky/conf}
+TEMPLATECONF=${TEMPLATECONF:-meta-yocto/conf}

README

@@ -0,0 +1,49 @@
+Poky
+====
+
+Poky is an integration of various components to form a complete prepackaged
+build system and development environment. It features support for building
+customised embedded device style images. There are reference demo images
+featuring a X11/Matchbox/GTK themed UI called Sato. The system supports
+cross-architecture application development using QEMU emulation and a
+standalone toolchain and SDK with IDE integration.
+
+Additional information on the specifics of hardware that Poky supports
+is available in README.hardware. Further hardware support can easily be added
+in the form of layers which extend the systems capabilities in a modular way.
+
+As an integration layer Poky consists of several upstream projects such as 
+BitBake, OpenEmbedded-Core, Yocto documentation and various sources of information 
+e.g. for the hardware support. Poky is in turn a component of the Yocto Project.
+
+The Yocto Project has extensive documentation about the system including a 
+reference manual which can be found at:
+    http://yoctoproject.org/documentation
+
+OpenEmbedded-Core is a layer containing the core metadata for current versions
+of OpenEmbedded. It is distro-less (can build a functional image with
+DISTRO = "nodistro") and contains only emulated machine support.
+
+For information about OpenEmbedded, see the OpenEmbedded website:
+    http://www.openembedded.org/
+
+Where to Send Patches
+=====================
+
+As Poky is an integration repository, patches against the various components
+should be sent to their respective upstreams.
+
+bitbake:
+    bitbake-devel@lists.openembedded.org
+
+meta-yocto:
+    poky@yoctoproject.org
+
+Most everything else should be sent to the OpenEmbedded Core mailing list.  If
+in doubt, check the oe-core git repository for the content you intend to modify.
+Before sending, be sure the patches apply cleanly to the current oe-core git
+repository.
+    openembedded-core@lists.openembedded.org
+
+Note: The scripts directory should be treated with extra care as it is a mix
+      of oe-core and poky-specific files.

README.LSB

@@ -1,26 +0,0 @@
-OE-Core aims to be able to provide basic LSB compatible images. There
-are some challenges for OE as LSB isn't always 100% relevant to its
-target embedded and IoT audiences. 
-
-One challenge is that the LSB spec is no longer being actively
-developed [https://github.com/LinuxStandardBase/lsb] and has 
-components which are end of life or significantly dated. OE 
-therefore provides compatibility with the following caveats:
-
-* Qt4 is provided by the separate meta-qt4 layer. Its noted that Qt4 
-  is end of life and this isn't something the core project regularly 
-  tests any longer. Users are recommended to group together to support
-  maintenance of that layer. [http://git.yoctoproject.org/cgit/cgit.cgi/meta-qt4/]
-
-* mailx has been dropped since its no longer being developed upstream 
-  and there are better, more modern replacements such as s-nail 
-  (http://sdaoden.eu/code.html) or mailutils (http://mailutils.org/).
-
-* A few perl modules that were required by LSB 4.x aren't provided:
-  libclass-isa, libenv, libdumpvalue, libfile-checktree,
-  libi18n-collate, libpod-plainer.
-
-* libpng 1.2 isn't provided; oe-core includes the latest release of libpng
-  instead.
-
-* pax (POSIX standard archive) tool is not provided.

README.OE-Core

@@ -1,29 +0,0 @@
-OpenEmbedded-Core
-=================
-
-OpenEmbedded-Core is a layer containing the core metadata for current versions
-of OpenEmbedded. It is distro-less (can build a functional image with
-DISTRO = "nodistro") and contains only emulated machine support.
-
-For information about OpenEmbedded, see the OpenEmbedded website:
-    http://www.openembedded.org/
-
-The Yocto Project has extensive documentation about OE including a reference manual
-which can be found at:
-    http://yoctoproject.org/documentation
-
-
-Contributing
-------------
-
-Please refer to
-http://www.openembedded.org/wiki/How_to_submit_a_patch_to_OpenEmbedded
-for guidelines on how to submit patches.
-
-Mailing list:
-
-    http://lists.openembedded.org/mailman/listinfo/openembedded-core
-
-Source code:
-
-    http://git.openembedded.org/openembedded-core/

README.hardware

@@ -1 +0,0 @@
-meta-yocto-bsp/README.hardware

README.hardware

@@ -0,0 +1,499 @@
+                          Poky Hardware README
+                          ====================
+
+This file gives details about using Poky with the reference machines
+supported out of the box. A full list of supported reference target machines
+can be found by looking in the following directories:
+
+   meta/conf/machine/
+   meta-yocto-bsp/conf/machine/
+
+If you are in doubt about using Poky/OpenEmbedded with your hardware, consult
+the documentation for your board/device.
+
+Support for additional devices is normally added by creating BSP layers - for
+more information please see the Yocto Board Support Package (BSP) Developer's
+Guide - documentation source is in documentation/bspguide or download the PDF
+from:
+
+   http://yoctoproject.org/documentation
+
+Support for physical reference hardware has now been split out into a
+meta-yocto-bsp layer which can be removed separately from other layers if not
+needed.
+
+
+QEMU Emulation Targets
+======================
+
+To simplify development, the build system supports building images to
+work with the QEMU emulator in system emulation mode. Several architectures
+are currently supported:
+
+  * ARM (qemuarm)
+  * x86 (qemux86)
+  * x86-64 (qemux86-64)
+  * PowerPC (qemuppc)
+  * MIPS (qemumips)
+
+Use of the QEMU images is covered in the Yocto Project Reference Manual.
+The appropriate MACHINE variable value corresponding to the target is given
+in brackets.
+
+
+Hardware Reference Boards
+=========================
+
+The following boards are supported by the meta-yocto-bsp layer:
+
+  * Texas Instruments Beaglebone (beaglebone)
+  * Freescale MPC8315E-RDB (mpc8315e-rdb)
+
+For more information see the board's section below. The appropriate MACHINE
+variable value corresponding to the board is given in brackets.
+
+Reference Board Maintenance
+===========================
+
+Send pull requests, patches, comments or questions about meta-yocto-bsps to poky@yoctoproject.org
+
+Maintainers: Kevin Hao <kexin.hao@windriver.com>
+             Bruce Ashfield <bruce.ashfield@windriver.com>
+
+Consumer Devices
+================
+
+The following consumer devices are supported by the meta-yocto-bsp layer:
+
+  * Intel x86 based PCs and devices (genericx86)
+  * Ubiquiti Networks EdgeRouter Lite (edgerouter)
+
+For more information see the device's section below. The appropriate MACHINE
+variable value corresponding to the device is given in brackets.
+
+
+
+                      Specific Hardware Documentation
+                      ===============================
+
+
+Intel x86 based PCs and devices (genericx86)
+==========================================
+
+The genericx86 MACHINE is tested on the following platforms:
+
+Intel Xeon/Core i-Series:
+  + Intel Romley Server: Sandy Bridge Xeon processor, C600 PCH (Patsburg), (Canoe Pass CRB)
+  + Intel Romley Server: Ivy Bridge Xeon processor, C600 PCH (Patsburg), (Intel SDP S2R3)
+  + Intel Crystal Forest Server: Sandy Bridge Xeon processor, DH89xx PCH (Cave Creek), (Stargo CRB)
+  + Intel Chief River Mobile: Ivy Bridge Mobile processor, QM77 PCH (Panther Point-M), (Emerald Lake II CRB, Sabino Canyon CRB)
+  + Intel Huron River Mobile: Sandy Bridge processor, QM67 PCH (Cougar Point), (Emerald Lake CRB, EVOC EC7-1817LNAR board)
+  + Intel Calpella Platform: Core i7 processor, QM57 PCH (Ibex Peak-M), (Red Fort CRB, Emerson MATXM CORE-411-B)
+  + Intel Nehalem/Westmere-EP Server: Xeon 56xx/55xx processors, 5520 chipset, ICH10R IOH (82801), (Hanlan Creek CRB)
+  + Intel Nehalem Workstation: Xeon 56xx/55xx processors, System SC5650SCWS (Greencity CRB)
+  + Intel Picket Post Server: Xeon 56xx/55xx processors (Jasper Forest), 3420 chipset (Ibex Peak), (Osage CRB)
+  + Intel Storage Platform: Sandy Bridge Xeon processor, C600 PCH (Patsburg), (Oak Creek Canyon CRB)
+  + Intel Shark Bay Client Platform: Haswell processor, LynxPoint PCH, (Walnut Canyon CRB, Lava Canyon CRB, Basking Ridge CRB, Flathead Creek CRB)
+  + Intel Shark Bay Ultrabook Platform: Haswell ULT processor, Lynx Point-LP PCH, (WhiteTip Mountain 1 CRB)
+
+Intel Atom platforms:
+  + Intel embedded Menlow: Intel Atom Z510/530 CPU, System Controller Hub US15W (Portwell NANO-8044)
+  + Intel Luna Pier: Intel Atom N4xx/D5xx series CPU (aka: Pineview-D & -M), 82801HM I/O Hub (ICH8M), (Advantech AIMB-212, Moon Creek CRB)
+  + Intel Queens Bay platform: Intel Atom E6xx CPU (aka: Tunnel Creek), Topcliff EG20T I/O Hub (Emerson NITX-315, Crown Bay CRB, Minnow Board)
+  + Intel Fish River Island platform: Intel Atom E6xx CPU (aka: Tunnel Creek), Topcliff EG20T I/O Hub (Kontron KM2M806)
+  + Intel Cedar Trail platform: Intel Atom N2000 & D2000 series CPU (aka: Cedarview), NM10 Express Chipset (Norco kit BIS-6630, Cedar Rock CRB)
+
+and is likely to work on many unlisted Atom/Core/Xeon based devices. The MACHINE
+type supports ethernet, wifi, sound, and Intel/vesa graphics by default in
+addition to common PC input devices, busses, and so on.  Note that it does not
+included the binary-only graphic drivers used on some Atom platforms, for
+accelerated graphics on these machines please refer to meta-intel.
+
+Depending on the device, it can boot from a traditional hard-disk, a USB device,
+or over the network. Writing generated images to physical media is
+straightforward with a caveat for USB devices. The following examples assume the
+target boot device is /dev/sdb, be sure to verify this and use the correct
+device as the following commands are run as root and are not reversable.
+
+USB Device:
+  1. Build a live image. This image type consists of a simple filesystem
+     without a partition table, which is suitable for USB keys, and with the
+     default setup for the genericx86 machine, this image type is built
+     automatically for any image you build. For example:
+
+     $ bitbake core-image-minimal
+
+  2. Use the "dd" utility to write the image to the raw block device. For
+     example:
+
+     # dd if=core-image-minimal-genericx86.hddimg of=/dev/sdb
+
+  If the device fails to boot with "Boot error" displayed, or apparently
+  stops just after the SYSLINUX version banner, it is likely the BIOS cannot
+  understand the physical layout of the disk (or rather it expects a
+  particular layout and cannot handle anything else). There are two possible
+  solutions to this problem:
+
+  1. Change the BIOS USB Device setting to HDD mode. The label will vary by
+     device, but the idea is to force BIOS to read the Cylinder/Head/Sector
+     geometry from the device.
+
+  2. Without such an option, the BIOS generally boots the device in USB-ZIP
+     mode. To write an image to a USB device that will be bootable in
+     USB-ZIP mode, carry out the following actions:
+
+     a. Determine the geometry of your USB device using fdisk:
+
+     # fdisk /dev/sdb
+     Command (m for help): p
+
+     Disk /dev/sdb: 4011 MB, 4011491328 bytes
+     124 heads, 62 sectors/track, 1019 cylinders, total 7834944 sectors
+     ...
+
+     Command (m for help): q
+
+     b. Configure the USB device for USB-ZIP mode:
+     
+     # mkdiskimage -4 /dev/sdb 1019 124 62
+
+     Where 1019, 124 and 62 are the cylinder, head and sectors/track counts
+     as reported by fdisk (substitute the values reported for your device).
+     When the operation has finished and the access LED (if any) on the
+     device stops flashing, remove and reinsert the device to allow the
+     kernel to detect the new partition layout.
+
+     c. Copy the contents of the image to the USB-ZIP mode device:
+
+     # mkdir /tmp/image
+     # mkdir /tmp/usbkey
+     # mount -o loop core-image-minimal-genericx86.hddimg  /tmp/image
+     # mount /dev/sdb4 /tmp/usbkey
+     # cp -rf /tmp/image/* /tmp/usbkey
+
+     d. Install the syslinux boot loader:
+
+     # syslinux /dev/sdb4
+
+     e. Unmount everything:
+
+     # umount /tmp/image
+     # umount /tmp/usbkey
+
+  Install the boot device in the target board and configure the BIOS to boot
+  from it.
+
+  For more details on the USB-ZIP scenario, see the syslinux documentation:
+  http://git.kernel.org/?p=boot/syslinux/syslinux.git;a=blob_plain;f=doc/usbkey.txt;hb=HEAD
+
+
+Texas Instruments Beaglebone (beaglebone)
+=========================================
+
+The Beaglebone is an ARM Cortex-A8 development board with USB, Ethernet, 2D/3D
+accelerated graphics, audio, serial, JTAG, and SD/MMC. The Black adds a faster
+CPU, more RAM, eMMC flash and a micro HDMI port. The beaglebone MACHINE is
+tested on the following platforms:
+
+  o Beaglebone Black A6
+  o Beaglebone A6 (the original "White" model)
+
+The Beaglebone Black has eMMC, while the White does not. Pressing the USER/BOOT
+button when powering on will temporarily change the boot order. But for the sake
+of simplicity, these instructions assume you have erased the eMMC on the Black,
+so its boot behavior matches that of the White and boots off of SD card. To do
+this, issue the following commands from the u-boot prompt:
+
+    # mmc dev 1
+    # mmc erase 0 512
+
+To further tailor these instructions for your board, please refer to the
+documentation at http://www.beagleboard.org/bone and http://www.beagleboard.org/black
+
+From a Linux system with access to the image files perform the following steps
+as root, replacing mmcblk0* with the SD card device on your machine (such as sdc
+if used via a usb card reader):
+
+  1. Partition and format an SD card:
+     # fdisk -lu /dev/mmcblk0
+
+     Disk /dev/mmcblk0: 3951 MB, 3951034368 bytes
+     255 heads, 63 sectors/track, 480 cylinders, total 7716864 sectors
+     Units = sectors of 1 * 512 = 512 bytes
+
+             Device Boot      Start         End      Blocks  Id System
+     /dev/mmcblk0p1   *          63      144584       72261   c Win95 FAT32 (LBA)
+     /dev/mmcblk0p2          144585      465884      160650  83 Linux
+
+     # mkfs.vfat -F 16 -n "boot" /dev/mmcblk0p1
+     # mke2fs -j -L "root" /dev/mmcblk0p2
+
+  The following assumes the SD card partitions 1 and 2 are mounted at
+  /media/boot and /media/root respectively. Removing the card and reinserting
+  it will do just that on most modern Linux desktop environments.
+
+  The files referenced below are made available after the build in
+  build/tmp/deploy/images.
+
+  2. Install the boot loaders
+     # cp MLO-beaglebone /media/boot/MLO
+     # cp u-boot-beaglebone.img /media/boot/u-boot.img
+
+  3. Install the root filesystem
+     # tar x -C /media/root -f core-image-$IMAGE_TYPE-beaglebone.tar.bz2
+
+  4. If using core-image-base or core-image-sato images, the SD card is ready
+     and rootfs already contains the kernel, modules and device tree (DTB)
+     files necessary to be booted with U-boot's default configuration, so
+     skip directly to step 8.
+     For core-image-minimal, proceed through next steps.
+
+  5. If using core-image-minimal rootfs, install the modules
+     # tar x -C /media/root -f modules-beaglebone.tgz
+
+  6. If using core-image-minimal rootfs, install the kernel uImage into /boot
+     directory of rootfs
+     # cp uImage-beaglebone.bin /media/root/boot/uImage
+
+  7. If using core-image-minimal rootfs, also install device tree (DTB) files
+     into /boot directory of rootfs
+     # cp uImage-am335x-bone.dtb /media/root/boot/am335x-bone.dtb
+     # cp uImage-am335x-boneblack.dtb /media/root/boot/am335x-boneblack.dtb
+
+  8. Unmount the SD partitions, insert the SD card into the Beaglebone, and
+     boot the Beaglebone
+
+
+Freescale MPC8315E-RDB (mpc8315e-rdb)
+=====================================
+
+The MPC8315 PowerPC reference platform (MPC8315E-RDB) is aimed at hardware and
+software development of network attached storage (NAS) and digital media server
+applications. The MPC8315E-RDB features the PowerQUICC II Pro processor, which
+includes a built-in security accelerator.
+
+(Note: you may find it easier to order MPC8315E-RDBA; this appears to be the
+same board in an enclosure with accessories. In any case it is fully
+compatible with the instructions given here.)
+
+Setup instructions
+------------------
+
+You will need the following:
+* NFS root setup on your workstation
+* TFTP server installed on your workstation
+* Straight-thru 9-conductor serial cable (DB9, M/F) connected from your 
+  PC to UART1
+* Ethernet connected to the first ethernet port on the board
+
+--- Preparation ---
+
+Note: if you have altered your board's ethernet MAC address(es) from the
+defaults, or you need to do so because you want multiple boards on the same
+network, then you will need to change the values in the dts file (patch
+linux/arch/powerpc/boot/dts/mpc8315erdb.dts within the kernel source). If
+you have left them at the factory default then you shouldn't need to do
+anything here.
+
+--- Booting from NFS root ---
+
+Load the kernel and dtb (device tree blob), and boot the system as follows:
+
+ 1. Get the kernel (uImage-mpc8315e-rdb.bin) and dtb (uImage-mpc8315e-rdb.dtb)
+    files from the tmp/deploy directory, and make them available on your TFTP
+    server.
+
+ 2. Connect the board's first serial port to your workstation and then start up
+    your favourite serial terminal so that you will be able to interact with
+    the serial console. If you don't have a favourite, picocom is suggested:
+
+  $ picocom /dev/ttyUSB0 -b 115200
+
+ 3. Power up or reset the board and press a key on the terminal when prompted
+    to get to the U-Boot command line
+
+ 4. Set up the environment in U-Boot:
+
+ => setenv ipaddr <board ip>
+ => setenv serverip <tftp server ip>
+ => setenv bootargs root=/dev/nfs rw nfsroot=<nfsroot ip>:<rootfs path> ip=<board ip>:<server ip>:<gateway ip>:255.255.255.0:mpc8315e:eth0:off console=ttyS0,115200
+
+ 5. Download the kernel and dtb, and boot:
+
+ => tftp 1000000 uImage-mpc8315e-rdb.bin
+ => tftp 2000000 uImage-mpc8315e-rdb.dtb
+ => bootm 1000000 - 2000000
+
+--- Booting from JFFS2 root ---
+
+ 1. First boot the board with NFS root.
+
+ 2. Erase the MTD partition which will be used as root:
+
+    $ flash_eraseall  /dev/mtd3
+
+ 3. Copy the JFFS2 image to the MTD partition:
+
+    $ flashcp core-image-minimal-mpc8315e-rdb.jffs2 /dev/mtd3
+
+ 4. Then reboot the board and set up the environment in U-Boot:
+
+    => setenv bootargs root=/dev/mtdblock3 rootfstype=jffs2 console=ttyS0,115200
+
+
+Ubiquiti Networks EdgeRouter Lite (edgerouter)
+==============================================
+
+The EdgeRouter Lite is part of the EdgeMax series. It is a MIPS64 router
+(based on the Cavium Octeon processor) with 512MB of RAM, which uses an
+internal USB pendrive for storage.
+
+Setup instructions
+------------------
+
+You will need the following:
+* NFS root setup on your workstation
+* TFTP server installed on your workstation
+* RJ45 -> serial ("rollover") cable connected from your PC to the CONSOLE
+  port on the board
+* Ethernet connected to the first ethernet port on the board
+
+--- Preparation ---
+
+Build an image (e.g. core-image-minimal) using "edgerouter" as the MACHINE.
+In the following instruction it is based on core-image-minimal. Another target
+may be similiar with it.
+
+--- Booting from NFS root ---
+
+Load the kernel, and boot the system as follows:
+
+ 1. Get the kernel (vmlinux) file from the tmp/deploy/images/edgerouter
+    directory, and make them available on your TFTP server.
+
+ 2. Connect the board's first serial port to your workstation and then start up
+    your favourite serial terminal so that you will be able to interact with
+    the serial console. If you don't have a favourite, picocom is suggested:
+
+  $ picocom /dev/ttyS0 -b 115200
+
+ 3. Power up or reset the board and press a key on the terminal when prompted
+    to get to the U-Boot command line
+
+ 4. Set up the environment in U-Boot:
+
+ => setenv ipaddr <board ip>
+ => setenv serverip <tftp server ip>
+
+ 5. Download the kernel and boot:
+
+ => tftp tftp $loadaddr vmlinux
+ => bootoctlinux $loadaddr coremask=0x3 root=/dev/nfs rw nfsroot=<nfsroot ip>:<rootfs path> ip=<board ip>:<server ip>:<gateway ip>:<netmask>:edgerouter:eth0:off mtdparts=phys_mapped_flash:512k(boot0),512k(boot1),64k@3072k(eeprom)
+
+--- Booting from USB root ---
+
+To boot from the USB disk, you either need to remove it from the edgerouter
+box and populate it from another computer, or use a previously booted NFS
+image and populate from the edgerouter itself.
+
+Type 1: Mounted USB disk
+------------------------
+
+To boot from the USB disk there are two available partitions on the factory
+USB storage. The rest of this guide assumes that these partitions are left
+intact. If you change the partition scheme, you must update your boot method
+appropriately.
+
+The standard partitions are:
+
+  - 1: vfat partition containing factory kernels
+  - 2: ext3 partition for the root filesystem.
+
+You can place the kernel on either partition 1, or partition 2, but the roofs
+must go on partition 2 (due to its size).
+
+Note: If you place the kernel on the ext3 partition, you must re-create the
+      ext3 filesystem, since the factory u-boot can only handle 128 byte inodes and
+      cannot read the partition otherwise.
+
+Steps:
+
+ 1. Remove the USB disk from the edgerouter and insert it into a computer
+    that has access to your build artifacts.
+
+ 2. Copy the kernel image to the USB storage (assuming discovered as 'sdb' on
+    the development machine):
+
+    2a) if booting from vfat
+ 
+        # mount /dev/sdb1 /mnt
+        # cp tmp/deploy/images/edgerouter/vmlinux /mnt
+        # umount /mnt
+
+    2b) if booting from ext3
+
+        # mkfs.ext3 -I 128 /dev/sdb2
+        # mount /dev/sdb2 /mnt
+        # mkdir /mnt/boot
+        # cp tmp/deploy/images/edgerouter/vmlinux /mnt/boot
+        # umount /mnt
+
+ 3. Extract the rootfs to the USB storage ext3 partition
+
+        # mount /dev/sdb2 /mnt
+        # tar -xvjpf core-image-minimal-XXX.tar.bz2 -C /mnt
+        # umount /mnt
+
+ 4. Reboot the board and press a key on the terminal when prompted to get to the U-Boot
+    command line:
+
+ 5. Load the kernel and boot:
+
+    5a) vfat boot
+
+         => fatload usb 0:1 $loadaddr vmlinux
+
+    5b) ext3 boot
+
+         => ext2load usb 0:2 $loadaddr boot/vmlinux
+ 
+    => bootoctlinux $loadaddr coremask=0x3 root=/dev/sda2 rw rootwait mtdparts=phys_mapped_flash:512k(boot0),512k(boot1),64k@3072k(eeprom)
+ 
+
+Type 2: NFS
+-----------
+
+Note: If you place the kernel on the ext3 partition, you must re-create the
+      ext3 filesystem, since the factory u-boot can only handle 128 byte inodes and
+      cannot read the partition otherwise.
+
+      These boot instructions assume that you have recreated the ext3 filesystem with
+      128 byte inodes, you have an updated uboot or you are running and image capable
+      of making the filesystem on the board itself.
+
+
+ 1. Boot from NFS root
+
+ 2. Mount the USB disk partition 2 and then extract the contents of
+    tmp/deploy/core-image-XXXX.tar.bz2 into it.
+
+    Before starting, copy core-image-minimal-xxx.tar.bz2 and vmlinux into
+    rootfs path on your workstation.
+
+    and then,
+  
+      # mount /dev/sda2 /media/sda2
+      # tar -xvjpf core-image-minimal-XXX.tar.bz2 -C /media/sda2
+      # cp vmlinux /media/sda2/boot/vmlinux
+      # umount /media/sda2
+      # reboot
+
+ 3. Reboot the board and press a key on the terminal when prompted to get to the U-Boot
+    command line:
+
+    # reboot
+
+ 4. Load the kernel and boot:
+
+      => ext2load usb 0:2 $loadaddr boot/vmlinux
+      => bootoctlinux $loadaddr coremask=0x3 root=/dev/sda2 rw rootwait mtdparts=phys_mapped_flash:512k(boot0),512k(boot1),64k@3072k(eeprom)

README.poky

@@ -1 +0,0 @@
-meta-poky/README.poky

README.qemu

@@ -1,15 +0,0 @@
-QEMU Emulation Targets
-======================
-
-To simplify development, the build system supports building images to
-work with the QEMU emulator in system emulation mode. Several architectures
-are currently supported in 32 and 64 bit variants:
-
-  * ARM (qemuarm + qemuarm64)
-  * x86 (qemux86 + qemux86-64)
-  * PowerPC (qemuppc only)
-  * MIPS (qemumips + qemumips64)
-
-Use of the QEMU images is covered in the Yocto Project Reference Manual.
-The appropriate MACHINE variable value corresponding to the target is given
-in brackets.

bitbake/.gitattributes

@@ -1,2 +0,0 @@
-*min.js binary
-*min.css binary

bitbake/LICENSE

@@ -5,15 +5,6 @@ The following external components are distributed with this software:
 * The Toaster Simple UI application is based upon the Django project template, the files of which are covered by the BSD license and are copyright (c) Django Software
 Foundation and individual contributors.
 
-* Twitter Bootstrap (including Glyphicons), redistributed under the MIT license
+* Twitter Bootstrap (including Glyphicons), redistributed under the Apache License 2.0.
+
 * jQuery is redistributed under the MIT license.
-
-* Twitter typeahead.js redistributed under the MIT license. Note that the JS source has one small modification, so the full unminified file is currently included to make it obvious where this is.
-
-* jsrender is redistributed under the MIT license.
-
-* QUnit is redistributed under the MIT license.
-
-* Font Awesome fonts redistributed under the SIL Open Font License 1.1
-
-* simplediff is distributed under the zlib license.

bitbake/README

@@ -1,35 +0,0 @@
-Bitbake
-=======
-
-BitBake is a generic task execution engine that allows shell and Python tasks to be run
-efficiently and in parallel while working within complex inter-task dependency constraints.
-One of BitBake's main users, OpenEmbedded, takes this core and builds embedded Linux software
-stacks using a task-oriented approach.
-
-For information about Bitbake, see the OpenEmbedded website:
-    http://www.openembedded.org/
-
-Bitbake plain documentation can be found under the doc directory or its integrated
-html version at the Yocto Project website:
-    http://yoctoproject.org/documentation
-
-Contributing
-------------
-
-Please refer to
-http://www.openembedded.org/wiki/How_to_submit_a_patch_to_OpenEmbedded
-for guidelines on how to submit patches, just note that the latter documentation is intended
-for OpenEmbedded (and its core) not bitbake patches (bitbake-devel@lists.openembedded.org)
-but in general main guidelines apply. Once the commit(s) have been created, the way to send
-the patch is through git-send-email. For example, to send the last commit (HEAD) on current
-branch, type:
-
-    git send-email -M -1 --to bitbake-devel@lists.openembedded.org
-
-Mailing list:
-
-    http://lists.openembedded.org/mailman/listinfo/bitbake-devel
-
-Source code:
-
-    http://git.openembedded.org/bitbake/

bitbake/bin/bitbake

@@ -1,4 +1,4 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 # ex:ts=4:sw=4:sts=4:et
 # -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
 #
@@ -23,34 +23,369 @@
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
 import os
-import sys
-
+import sys, logging
 sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)),
                                 'lib'))
+
+import optparse
+import warnings
+from traceback import format_exception
 try:
     import bb
 except RuntimeError as exc:
     sys.exit(str(exc))
-
+from bb import event
+import bb.msg
+from bb import cooker
+from bb import ui
+from bb import server
 from bb import cookerdata
-from bb.main import bitbake_main, BitBakeConfigParameters, BBMainException
 
-if sys.getfilesystemencoding() != "utf-8":
-    sys.exit("Please use a locale setting which supports UTF-8 (such as LANG=en_US.UTF-8).\nPython can't change the filesystem locale after loading so we need a UTF-8 when Python starts or things won't work.")
+__version__ = "1.24.0"
+logger = logging.getLogger("BitBake")
 
-__version__ = "1.42.0"
+# Python multiprocessing requires /dev/shm
+if not os.access('/dev/shm', os.W_OK | os.X_OK):
+    sys.exit("FATAL: /dev/shm does not exist or is not writable")
+
+# Unbuffer stdout to avoid log truncation in the event
+# of an unorderly exit as well as to provide timely
+# updates to log files for use with tail
+try:
+    if sys.stdout.name == '<stdout>':
+        sys.stdout = os.fdopen(sys.stdout.fileno(), 'w', 0)
+except:
+    pass
+
+
+def get_ui(config):
+    if not config.ui:
+        # modify 'ui' attribute because it is also read by cooker
+        config.ui = os.environ.get('BITBAKE_UI', 'knotty')
+
+    interface = config.ui
+
+    try:
+        # Dynamically load the UI based on the ui name. Although we
+        # suggest a fixed set this allows you to have flexibility in which
+        # ones are available.
+        module = __import__("bb.ui", fromlist = [interface])
+        return getattr(module, interface)
+    except AttributeError:
+        sys.exit("FATAL: Invalid user interface '%s' specified.\n"
+                 "Valid interfaces: depexp, goggle, ncurses, hob, knotty [default]." % interface)
+
+
+# Display bitbake/OE warnings via the BitBake.Warnings logger, ignoring others"""
+warnlog = logging.getLogger("BitBake.Warnings")
+_warnings_showwarning = warnings.showwarning
+def _showwarning(message, category, filename, lineno, file=None, line=None):
+    if file is not None:
+        if _warnings_showwarning is not None:
+            _warnings_showwarning(message, category, filename, lineno, file, line)
+    else:
+        s = warnings.formatwarning(message, category, filename, lineno)
+        warnlog.warn(s)
+
+warnings.showwarning = _showwarning
+warnings.filterwarnings("ignore")
+warnings.filterwarnings("default", module="(<string>$|(oe|bb)\.)")
+warnings.filterwarnings("ignore", category=PendingDeprecationWarning)
+warnings.filterwarnings("ignore", category=ImportWarning)
+warnings.filterwarnings("ignore", category=DeprecationWarning, module="<string>$")
+warnings.filterwarnings("ignore", message="With-statements now directly support multiple context managers")
+
+class BitBakeConfigParameters(cookerdata.ConfigParameters):
+
+    def parseCommandLine(self):
+        parser = optparse.OptionParser(
+            version = "BitBake Build Tool Core version %s, %%prog version %s" % (bb.__version__, __version__),
+            usage = """%prog [options] [recipename/target ...]
+
+    Executes the specified task (default is 'build') for a given set of target recipes (.bb files).
+    It is assumed there is a conf/bblayers.conf available in cwd or in BBPATH which
+    will provide the layer, BBFILES and other configuration information.""")
+
+        parser.add_option("-b", "--buildfile", help = "Execute tasks from a specific .bb recipe directly. WARNING: Does not handle any dependencies from other recipes.",
+                   action = "store", dest = "buildfile", default = None)
+
+        parser.add_option("-k", "--continue", help = "Continue as much as possible after an error. While the target that failed and anything depending on it cannot be built, as much as possible will be built before stopping.",
+                   action = "store_false", dest = "abort", default = True)
+
+        parser.add_option("-a", "--tryaltconfigs", help = "Continue with builds by trying to use alternative providers where possible.",
+                   action = "store_true", dest = "tryaltconfigs", default = False)
+
+        parser.add_option("-f", "--force", help = "Force the specified targets/task to run (invalidating any existing stamp file).",
+                   action = "store_true", dest = "force", default = False)
+
+        parser.add_option("-c", "--cmd", help = "Specify the task to execute. The exact options available depend on the metadata. Some examples might be 'compile' or 'populate_sysroot' or 'listtasks' may give a list of the tasks available.",
+                   action = "store", dest = "cmd")
+
+        parser.add_option("-C", "--clear-stamp", help = "Invalidate the stamp for the specified task such as 'compile' and then run the default task for the specified target(s).",
+                    action = "store", dest = "invalidate_stamp")
+
+        parser.add_option("-r", "--read", help = "Read the specified file before bitbake.conf.",
+                   action = "append", dest = "prefile", default = [])
+
+        parser.add_option("-R", "--postread", help = "Read the specified file after bitbake.conf.",
+                          action = "append", dest = "postfile", default = [])
+
+        parser.add_option("-v", "--verbose", help = "Output more log message data to the terminal.",
+                   action = "store_true", dest = "verbose", default = False)
+
+        parser.add_option("-D", "--debug", help = "Increase the debug level. You can specify this more than once.",
+                   action = "count", dest="debug", default = 0)
+
+        parser.add_option("-n", "--dry-run", help = "Don't execute, just go through the motions.",
+                   action = "store_true", dest = "dry_run", default = False)
+
+        parser.add_option("-S", "--dump-signatures", help = "Dump out the signature construction information, with no task execution. The SIGNATURE_HANDLER parameter is passed to the handler. Two common values are none and printdiff but the handler may define more/less. none means only dump the signature, printdiff means compare the dumped signature with the cached one.",
+                   action = "append", dest = "dump_signatures", default = [], metavar="SIGNATURE_HANDLER")
+
+        parser.add_option("-p", "--parse-only", help = "Quit after parsing the BB recipes.",
+                   action = "store_true", dest = "parse_only", default = False)
+
+        parser.add_option("-s", "--show-versions", help = "Show current and preferred versions of all recipes.",
+                   action = "store_true", dest = "show_versions", default = False)
+
+        parser.add_option("-e", "--environment", help = "Show the global or per-recipe environment complete with information about where variables were set/changed.",
+                   action = "store_true", dest = "show_environment", default = False)
+
+        parser.add_option("-g", "--graphviz", help = "Save dependency tree information for the specified targets in the dot syntax.",
+                    action = "store_true", dest = "dot_graph", default = False)
+
+        parser.add_option("-I", "--ignore-deps", help = """Assume these dependencies don't exist and are already provided (equivalent to ASSUME_PROVIDED). Useful to make dependency graphs more appealing""",
+                    action = "append", dest = "extra_assume_provided", default = [])
+
+        parser.add_option("-l", "--log-domains", help = """Show debug logging for the specified logging domains""",
+                    action = "append", dest = "debug_domains", default = [])
+
+        parser.add_option("-P", "--profile", help = "Profile the command and save reports.",
+                   action = "store_true", dest = "profile", default = False)
+
+        parser.add_option("-u", "--ui", help = "The user interface to use (e.g. knotty, hob, depexp).",
+                   action = "store", dest = "ui")
+
+        parser.add_option("-t", "--servertype", help = "Choose which server to use, process or xmlrpc.",
+                   action = "store", dest = "servertype")
+
+        parser.add_option("", "--token", help = "Specify the connection token to be used when connecting to a remote server.",
+                   action = "store", dest = "xmlrpctoken")
+
+        parser.add_option("", "--revisions-changed", help = "Set the exit code depending on whether upstream floating revisions have changed or not.",
+                   action = "store_true", dest = "revisions_changed", default = False)
+
+        parser.add_option("", "--server-only", help = "Run bitbake without a UI, only starting a server (cooker) process.",
+                   action = "store_true", dest = "server_only", default = False)
+
+        parser.add_option("-B", "--bind", help = "The name/address for the bitbake server to bind to.",
+                   action = "store", dest = "bind", default = False)
+
+        parser.add_option("", "--no-setscene", help = "Do not run any setscene tasks. sstate will be ignored and everything needed, built.",
+                   action = "store_true", dest = "nosetscene", default = False)
+
+        parser.add_option("", "--remote-server", help = "Connect to the specified server.",
+                   action = "store", dest = "remote_server", default = False)
+
+        parser.add_option("-m", "--kill-server", help = "Terminate the remote server.",
+                    action = "store_true", dest = "kill_server", default = False)
+
+        parser.add_option("", "--observe-only", help = "Connect to a server as an observing-only client.",
+                   action = "store_true", dest = "observe_only", default = False)
+
+        parser.add_option("", "--status-only", help = "Check the status of the remote bitbake server.",
+                   action = "store_true", dest = "status_only", default = False)
+
+        options, targets = parser.parse_args(sys.argv)
+
+        # some environmental variables set also configuration options
+        if "BBSERVER" in os.environ:
+            options.servertype = "xmlrpc"
+            options.remote_server = os.environ["BBSERVER"]
+
+        if "BBTOKEN" in os.environ:
+            options.xmlrpctoken = os.environ["BBTOKEN"]
+
+        # if BBSERVER says to autodetect, let's do that
+        if options.remote_server:
+            [host, port] = options.remote_server.split(":", 2)
+            port = int(port)
+            # use automatic port if port set to -1, means read it from
+            # the bitbake.lock file; this is a bit tricky, but we always expect
+            # to be in the base of the build directory if we need to have a
+            # chance to start the server later, anyway
+            if port == -1:
+                lock_location = "./bitbake.lock"
+                # we try to read the address at all times; if the server is not started,
+                # we'll try to start it after the first connect fails, below
+                try:
+                    lf = open(lock_location, 'r')
+                    remotedef = lf.readline()
+                    [host, port] = remotedef.split(":")
+                    port = int(port)
+                    lf.close()
+                    options.remote_server = remotedef
+                except Exception as e:
+                    sys.exit("Failed to read bitbake.lock (%s), invalid port" % str(e))
+
+        return options, targets[1:]
+
+
+def start_server(servermodule, configParams, configuration, features):
+    server = servermodule.BitBakeServer()
+    if configParams.bind:
+        (host, port) = configParams.bind.split(':')
+        server.initServer((host, int(port)))
+        configuration.interface = [ server.serverImpl.host, server.serverImpl.port ]
+    else:
+        server.initServer()
+        configuration.interface = []
+
+    try:
+        configuration.setServerRegIdleCallback(server.getServerIdleCB())
+
+        cooker = bb.cooker.BBCooker(configuration, features)
+
+        server.addcooker(cooker)
+        server.saveConnectionDetails()
+    except Exception as e:
+        exc_info = sys.exc_info()
+        while hasattr(server, "event_queue"):
+            try:
+                import queue
+            except ImportError:
+                import Queue as queue
+            try:
+                event = server.event_queue.get(block=False)
+            except (queue.Empty, IOError):
+                break
+            if isinstance(event, logging.LogRecord):
+                logger.handle(event)
+        raise exc_info[1], None, exc_info[2]
+    server.detach()
+    cooker.lock.close()
+    return server
+
+
+
+def main():
+
+    configParams = BitBakeConfigParameters()
+    configuration = cookerdata.CookerConfiguration()
+    configuration.setConfigParameters(configParams)
+
+    ui_module = get_ui(configParams)
+
+    # Server type can be xmlrpc or process currently, if nothing is specified,
+    # the default server is process
+    if configParams.servertype:
+        server_type = configParams.servertype
+    else:
+        server_type = 'process'
+
+    try:
+        module = __import__("bb.server", fromlist = [server_type])
+        servermodule = getattr(module, server_type)
+    except AttributeError:
+        sys.exit("FATAL: Invalid server type '%s' specified.\n"
+                 "Valid interfaces: xmlrpc, process [default]." % server_type)
+
+    if configParams.server_only:
+        if configParams.servertype != "xmlrpc":
+            sys.exit("FATAL: If '--server-only' is defined, we must set the servertype as 'xmlrpc'.\n")
+        if not configParams.bind:
+            sys.exit("FATAL: The '--server-only' option requires a name/address to bind to with the -B option.\n")
+        if configParams.remote_server:
+            sys.exit("FATAL: The '--server-only' option conflicts with %s.\n" % 
+                ("the BBSERVER environment variable" if "BBSERVER" in os.environ else "the '--remote-server' option" ))
+
+    if configParams.bind and configParams.servertype != "xmlrpc":
+        sys.exit("FATAL: If '-B' or '--bind' is defined, we must set the servertype as 'xmlrpc'.\n")
+
+    if configParams.remote_server and configParams.servertype != "xmlrpc":
+        sys.exit("FATAL: If '--remote-server' is defined, we must set the servertype as 'xmlrpc'.\n")
+
+    if configParams.observe_only and (not configParams.remote_server or configParams.bind):
+        sys.exit("FATAL: '--observe-only' can only be used by UI clients connecting to a server.\n")
+
+    if configParams.kill_server and not configParams.remote_server:
+        sys.exit("FATAL: '--kill-server' can only be used to terminate a remote server")
+
+    if "BBDEBUG" in os.environ:
+        level = int(os.environ["BBDEBUG"])
+        if level > configuration.debug:
+            configuration.debug = level
+
+    bb.msg.init_msgconfig(configParams.verbose, configuration.debug,
+                         configuration.debug_domains)
+
+    # Ensure logging messages get sent to the UI as events
+    handler = bb.event.LogHandler()
+    if not configParams.status_only:
+        # In status only mode there are no logs and no UI
+        logger.addHandler(handler)
+
+    # Clear away any spurious environment variables while we stoke up the cooker
+    cleanedvars = bb.utils.clean_environment()
+
+    featureset = []
+    if not configParams.server_only:
+        # Collect the feature set for the UI
+        featureset = getattr(ui_module, "featureSet", [])
+
+    if not configParams.remote_server:
+        # we start a server with a given configuration
+        server = start_server(servermodule, configParams, configuration, featureset)
+        bb.event.ui_queue = []
+    else:
+        # we start a stub server that is actually a XMLRPClient that connects to a real server
+        server = servermodule.BitBakeXMLRPCClient(configParams.observe_only, configParams.xmlrpctoken)
+        server.saveConnectionDetails(configParams.remote_server)
+
+
+    if not configParams.server_only:
+        try:
+            server_connection = server.establishConnection(featureset)
+        except Exception as e:
+            if configParams.kill_server:
+                sys.exit(0)
+            bb.fatal("Could not connect to server %s: %s" % (configParams.remote_server, str(e)))
+
+        # Restore the environment in case the UI needs it
+        for k in cleanedvars:
+            os.environ[k] = cleanedvars[k]
+
+        logger.removeHandler(handler)
+
+
+        if configParams.status_only:
+            server_connection.terminate()
+            sys.exit(0)
+
+        if configParams.kill_server:
+            server_connection.connection.terminateServer()
+            bb.event.ui_queue = []
+            sys.exit(0)
+
+        try:
+            return ui_module.main(server_connection.connection, server_connection.events, configParams)
+        finally:
+            bb.event.ui_queue = []
+            server_connection.terminate()
+    else:
+        print("server address: %s, server port: %s" % (server.serverImpl.host, server.serverImpl.port))
+        return 0
+
+    return 1
 
 if __name__ == "__main__":
-    if __version__ != bb.__version__:
-        sys.exit("Bitbake core version and program version mismatch!")
     try:
-        sys.exit(bitbake_main(BitBakeConfigParameters(sys.argv),
-                              cookerdata.CookerConfiguration()))
-    except BBMainException as err:
-        sys.exit(err)
+        ret = main()
     except bb.BBHandledException:
-        sys.exit(1)
+        ret = 1
     except Exception:
+        ret = 1
         import traceback
         traceback.print_exc()
-        sys.exit(1)
+    sys.exit(ret)
+

bitbake/bin/bitbake-diffsigs

@@ -1,9 +1,9 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
-# bitbake-diffsigs / bitbake-dumpsig
-# BitBake task signature data dump and comparison utility
+# bitbake-diffsigs
+# BitBake task signature data comparison utility
 #
-# Copyright (C) 2012-2013, 2017 Intel Corporation
+# Copyright (C) 2012-2013 Intel Corporation
 #
 # This program is free software; you can redistribute it and/or modify
 # it under the terms of the GNU General Public License version 2 as
@@ -21,188 +21,102 @@
 import os
 import sys
 import warnings
-import argparse
+import fnmatch
+import optparse
 import logging
-import pickle
 
 sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
 
 import bb.tinfoil
 import bb.siggen
-import bb.msg
 
-myname = os.path.basename(sys.argv[0])
-logger = bb.msg.logger_create(myname)
+def logger_create(name, output=sys.stderr):
+    logger = logging.getLogger(name)
+    console = logging.StreamHandler(output)
+    format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
+    if output.isatty():
+        format.enable_color()
+    console.setFormatter(format)
+    logger.addHandler(console)
+    logger.setLevel(logging.INFO)
+    return logger
 
-is_dump = myname == 'bitbake-dumpsig'
+logger = logger_create('bitbake-diffsigs')
 
-def find_siginfo(tinfoil, pn, taskname, sigs=None):
-    result = None
-    tinfoil.set_event_mask(['bb.event.FindSigInfoResult',
-                            'logging.LogRecord',
-                            'bb.command.CommandCompleted',
-                            'bb.command.CommandFailed'])
-    ret = tinfoil.run_command('findSigInfo', pn, taskname, sigs)
-    if ret:
-        while True:
-            event = tinfoil.wait_event(1)
-            if event:
-                if isinstance(event, bb.command.CommandCompleted):
-                    break
-                elif isinstance(event, bb.command.CommandFailed):
-                    logger.error(str(event))
-                    sys.exit(2)
-                elif isinstance(event, bb.event.FindSigInfoResult):
-                    result = event.result
-                elif isinstance(event, logging.LogRecord):
-                    logger.handle(event)
-    else:
-        logger.error('No result returned from findSigInfo command')
-        sys.exit(2)
-    return result
+def find_compare_task(bbhandler, pn, taskname):
+    """ Find the most recent signature files for the specified PN/task and compare them """
 
-def find_siginfo_task(bbhandler, pn, taskname, sig1=None, sig2=None):
-    """ Find the most recent signature files for the specified PN/task """
+    if not hasattr(bb.siggen, 'find_siginfo'):
+        logger.error('Metadata does not support finding signature data files')
+        sys.exit(1)
 
     if not taskname.startswith('do_'):
         taskname = 'do_%s' % taskname
 
-    if sig1 and sig2:
-        sigfiles = find_siginfo(bbhandler, pn, taskname, [sig1, sig2])
-        if len(sigfiles) == 0:
-            logger.error('No sigdata files found matching %s %s matching either %s or %s' % (pn, taskname, sig1, sig2))
-            sys.exit(1)
-        elif not sig1 in sigfiles:
-            logger.error('No sigdata files found matching %s %s with signature %s' % (pn, taskname, sig1))
-            sys.exit(1)
-        elif not sig2 in sigfiles:
-            logger.error('No sigdata files found matching %s %s with signature %s' % (pn, taskname, sig2))
-            sys.exit(1)
-        latestfiles = [sigfiles[sig1], sigfiles[sig2]]
+    filedates = bb.siggen.find_siginfo(pn, taskname, None, bbhandler.config_data)
+    latestfiles = sorted(filedates.keys(), key=lambda f: filedates[f])[-2:]
+    if not latestfiles:
+        logger.error('No sigdata files found matching %s %s' % (pn, taskname))
+        sys.exit(1)
+    elif len(latestfiles) < 2:
+        logger.error('Only one matching sigdata file found for the specified task (%s %s)' % (pn, taskname))
+        sys.exit(1)
     else:
-        filedates = find_siginfo(bbhandler, pn, taskname)
-        latestfiles = sorted(filedates.keys(), key=lambda f: filedates[f])[-2:]
-        if not latestfiles:
-            logger.error('No sigdata files found matching %s %s' % (pn, taskname))
-            sys.exit(1)
+        # Define recursion callback
+        def recursecb(key, hash1, hash2):
+            hashes = [hash1, hash2]
+            hashfiles = bb.siggen.find_siginfo(key, None, hashes, bbhandler.config_data)
 
-    return latestfiles
+            recout = []
+            if len(hashfiles) == 2:
+                out2 = bb.siggen.compare_sigfiles(hashfiles[hash1], hashfiles[hash2], recursecb)
+                recout.extend(list('  ' + l for l in out2))
+            else:
+                recout.append("Unable to find matching sigdata for %s with hashes %s or %s" % (key, hash1, hash2))
+
+            return recout
+
+        # Recurse into signature comparison
+        output = bb.siggen.compare_sigfiles(latestfiles[0], latestfiles[1], recursecb)
+        if output:
+            print '\n'.join(output)
+    sys.exit(0)
 
 
-# Define recursion callback
-def recursecb(key, hash1, hash2):
-    hashes = [hash1, hash2]
-    hashfiles = find_siginfo(tinfoil, key, None, hashes)
 
-    recout = []
-    if len(hashfiles) == 0:
-        recout.append("Unable to find matching sigdata for %s with hashes %s or %s" % (key, hash1, hash2))
-    elif not hash1 in hashfiles:
-        recout.append("Unable to find matching sigdata for %s with hash %s" % (key, hash1))
-    elif not hash2 in hashfiles:
-        recout.append("Unable to find matching sigdata for %s with hash %s" % (key, hash2))
-    else:
-        out2 = bb.siggen.compare_sigfiles(hashfiles[hash1], hashfiles[hash2], recursecb, color=color)
-        for change in out2:
-            for line in change.splitlines():
-                recout.append('  ' + line)
+parser = optparse.OptionParser(
+    description = "Compares siginfo/sigdata files written out by BitBake",
+    usage = """
+  %prog -t recipename taskname
+  %prog sigdatafile1 sigdatafile2
+  %prog sigdatafile1""")
 
-    return recout
+parser.add_option("-t", "--task",
+        help = "find the signature data files for last two runs of the specified task and compare them",
+        action="store", dest="taskargs", nargs=2, metavar='recipename taskname')
 
-
-parser = argparse.ArgumentParser(
-    description=("Dumps" if is_dump else "Compares") + " siginfo/sigdata files written out by BitBake")
-
-parser.add_argument('-D', '--debug',
-                    help='Enable debug output',
-                    action='store_true')
-
-if is_dump:
-    parser.add_argument("-t", "--task",
-            help="find the signature data file for the last run of the specified task",
-            action="store", dest="taskargs", nargs=2, metavar=('recipename', 'taskname'))
-
-    parser.add_argument("sigdatafile1",
-            help="Signature file to dump. Not used when using -t/--task.",
-            action="store", nargs='?', metavar="sigdatafile")
-else:
-    parser.add_argument('-c', '--color',
-            help='Colorize the output (where %(metavar)s is %(choices)s)',
-            choices=['auto', 'always', 'never'], default='auto', metavar='color')
-
-    parser.add_argument('-d', '--dump',
-            help='Dump the last signature data instead of comparing (equivalent to using bitbake-dumpsig)',
-            action='store_true')
-
-    parser.add_argument("-t", "--task",
-            help="find the signature data files for the last two runs of the specified task and compare them",
-            action="store", dest="taskargs", nargs=2, metavar=('recipename', 'taskname'))
-
-    parser.add_argument("-s", "--signature",
-            help="With -t/--task, specify the signatures to look for instead of taking the last two",
-            action="store", dest="sigargs", nargs=2, metavar=('fromsig', 'tosig'))
-
-    parser.add_argument("sigdatafile1",
-            help="First signature file to compare (or signature file to dump, if second not specified). Not used when using -t/--task.",
-            action="store", nargs='?')
-
-    parser.add_argument("sigdatafile2",
-            help="Second signature file to compare",
-            action="store", nargs='?')
-
-options = parser.parse_args()
-if is_dump:
-    options.color = 'never'
-    options.dump = True
-    options.sigdatafile2 = None
-    options.sigargs = None
-
-if options.debug:
-    logger.setLevel(logging.DEBUG)
-
-color = (options.color == 'always' or (options.color == 'auto' and sys.stdout.isatty()))
+options, args = parser.parse_args(sys.argv)
 
 if options.taskargs:
-    with bb.tinfoil.Tinfoil() as tinfoil:
-        tinfoil.prepare(config_only=True)
-        if not options.dump and options.sigargs:
-            files = find_siginfo_task(tinfoil, options.taskargs[0], options.taskargs[1], options.sigargs[0], options.sigargs[1])
-        else:
-            files = find_siginfo_task(tinfoil, options.taskargs[0], options.taskargs[1])
-
-        if options.dump:
-            logger.debug("Signature file: %s" % files[-1])
-            output = bb.siggen.dump_sigfile(files[-1])
-        else:
-            if len(files) < 2:
-                logger.error('Only one matching sigdata file found for the specified task (%s %s)' % (options.taskargs[0], options.taskargs[1]))
-                sys.exit(1)
-
-            # Recurse into signature comparison
-            logger.debug("Signature file (previous): %s" % files[-2])
-            logger.debug("Signature file (latest): %s" % files[-1])
-            output = bb.siggen.compare_sigfiles(files[-2], files[-1], recursecb, color=color)
+    tinfoil = bb.tinfoil.Tinfoil()
+    tinfoil.prepare(config_only = True)
+    find_compare_task(tinfoil, options.taskargs[0], options.taskargs[1])
 else:
-    if options.sigargs:
-        logger.error('-s/--signature can only be used together with -t/--task')
-        sys.exit(1)
-    try:
-        if not options.dump and options.sigdatafile1 and options.sigdatafile2:
-            with bb.tinfoil.Tinfoil() as tinfoil:
-                tinfoil.prepare(config_only=True)
-                output = bb.siggen.compare_sigfiles(options.sigdatafile1, options.sigdatafile2, recursecb, color=color)
-        elif options.sigdatafile1:
-            output = bb.siggen.dump_sigfile(options.sigdatafile1)
-        else:
-            logger.error('Must specify signature file(s) or -t/--task')
-            parser.print_help()
+    if len(args) == 1:
+        parser.print_help()
+    else:
+        import cPickle
+        try:
+            if len(args) == 2:
+                output = bb.siggen.dump_sigfile(sys.argv[1])
+            else:
+                output = bb.siggen.compare_sigfiles(sys.argv[1], sys.argv[2])
+        except IOError as e:
+            logger.error(str(e))
+            sys.exit(1)
+        except cPickle.UnpicklingError, EOFError:
+            logger.error('Invalid signature data - ensure you are specifying sigdata/siginfo files')
             sys.exit(1)
-    except IOError as e:
-        logger.error(str(e))
-        sys.exit(1)
-    except (pickle.UnpicklingError, EOFError):
-        logger.error('Invalid signature data - ensure you are specifying sigdata/siginfo files')
-        sys.exit(1)
 
-if output:
-    print('\n'.join(output))
+        if output:
+            print '\n'.join(output)

bitbake/bin/bitbake-dumpsig

@@ -1 +0,0 @@
-bitbake-diffsigs

bitbake/bin/bitbake-dumpsig

@@ -0,0 +1,65 @@
+#!/usr/bin/env python
+
+# bitbake-dumpsig
+# BitBake task signature dump utility
+#
+# Copyright (C) 2013 Intel Corporation
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+import os
+import sys
+import warnings
+import optparse
+import logging
+
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
+
+import bb.siggen
+
+def logger_create(name, output=sys.stderr):
+    logger = logging.getLogger(name)
+    console = logging.StreamHandler(output)
+    format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
+    if output.isatty():
+        format.enable_color()
+    console.setFormatter(format)
+    logger.addHandler(console)
+    logger.setLevel(logging.INFO)
+    return logger
+
+logger = logger_create('bitbake-dumpsig')
+
+parser = optparse.OptionParser(
+    description = "Dumps siginfo/sigdata files written out by BitBake",
+    usage = """
+  %prog sigdatafile""")
+
+options, args = parser.parse_args(sys.argv)
+
+if len(args) == 1:
+    parser.print_help()
+else:
+    import cPickle
+    try:
+        output = bb.siggen.dump_sigfile(args[1])
+    except IOError as e:
+        logger.error(str(e))
+        sys.exit(1)
+    except cPickle.UnpicklingError, EOFError:
+        logger.error('Invalid signature data - ensure you are specifying a sigdata/siginfo file')
+        sys.exit(1)
+
+    if output:
+        print '\n'.join(output)

bitbake/bin/bitbake-hashserv

@@ -1,67 +0,0 @@
-#! /usr/bin/env python3
-#
-# Copyright (C) 2018 Garmin Ltd.
-#
-# This program is free software; you can redistribute it and/or modify
-# it under the terms of the GNU General Public License version 2 as
-# published by the Free Software Foundation.
-#
-# This program is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-# GNU General Public License for more details.
-#
-# You should have received a copy of the GNU General Public License along
-# with this program; if not, write to the Free Software Foundation, Inc.,
-# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-import os
-import sys
-import logging
-import argparse
-import sqlite3
-
-sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)),'lib'))
-
-import hashserv
-
-VERSION = "1.0.0"
-
-DEFAULT_HOST = ''
-DEFAULT_PORT = 8686
-
-def main():
-    parser = argparse.ArgumentParser(description='HTTP Equivalence Reference Server. Version=%s' % VERSION)
-    parser.add_argument('--address', default=DEFAULT_HOST, help='Bind address (default "%(default)s")')
-    parser.add_argument('--port', type=int, default=DEFAULT_PORT, help='Bind port (default %(default)d)')
-    parser.add_argument('--prefix', default='', help='HTTP path prefix (default "%(default)s")')
-    parser.add_argument('--database', default='./hashserv.db', help='Database file (default "%(default)s")')
-    parser.add_argument('--log', default='WARNING', help='Set logging level')
-
-    args = parser.parse_args()
-
-    logger = logging.getLogger('hashserv')
-
-    level = getattr(logging, args.log.upper(), None)
-    if not isinstance(level, int):
-        raise ValueError('Invalid log level: %s' % args.log)
-
-    logger.setLevel(level)
-    console = logging.StreamHandler()
-    console.setLevel(level)
-    logger.addHandler(console)
-
-    db = sqlite3.connect(args.database)
-
-    server = hashserv.create_server((args.address, args.port), db, args.prefix)
-    server.serve_forever()
-    return 0
-
-if __name__ == '__main__':
-    try:
-        ret = main()
-    except Exception:
-        ret = 1
-        import traceback
-        traceback.print_exc()
-    sys.exit(ret)
-

bitbake/bin/bitbake-layers

@@ -1,11 +1,11 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 # This script has subcommands which operate against your bitbake layers, either
 # displaying useful information, or acting against them.
 # See the help output for details on available commands.
 
 # Copyright (C) 2011 Mentor Graphics Corporation
-# Copyright (C) 2011-2015 Intel Corporation
+# Copyright (C) 2012 Intel Corporation
 #
 # This program is free software; you can redistribute it and/or modify
 # it under the terms of the GNU General Public License version 2 as
@@ -20,91 +20,739 @@
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
+import cmd
 import logging
 import os
 import sys
-import argparse
-import signal
+import fnmatch
+from collections import defaultdict
+import re
 
 bindir = os.path.dirname(__file__)
 topdir = os.path.dirname(bindir)
 sys.path[0:0] = [os.path.join(topdir, 'lib')]
 
+import bb.cache
+import bb.cooker
+import bb.providers
+import bb.utils
 import bb.tinfoil
-import bb.msg
-
-logger = bb.msg.logger_create('bitbake-layers', sys.stdout)
-
-def main():
-    signal.signal(signal.SIGPIPE, signal.SIG_DFL)
-    parser = argparse.ArgumentParser(
-        description="BitBake layers utility",
-        epilog="Use %(prog)s <subcommand> --help to get help on a specific command",
-        add_help=False)
-    parser.add_argument('-d', '--debug', help='Enable debug output', action='store_true')
-    parser.add_argument('-q', '--quiet', help='Print only errors', action='store_true')
-    parser.add_argument('-F', '--force', help='Force add without recipe parse verification', action='store_true')
-    parser.add_argument('--color', choices=['auto', 'always', 'never'], default='auto', help='Colorize output (where %(metavar)s is %(choices)s)', metavar='COLOR')
-
-    global_args, unparsed_args = parser.parse_known_args()
-
-    # Help is added here rather than via add_help=True, as we don't want it to
-    # be handled by parse_known_args()
-    parser.add_argument('-h', '--help', action='help', default=argparse.SUPPRESS,
-                        help='show this help message and exit')
-    subparsers = parser.add_subparsers(title='subcommands', metavar='<subcommand>')
-    subparsers.required = True
-
-    if global_args.debug:
-        logger.setLevel(logging.DEBUG)
-    elif global_args.quiet:
-        logger.setLevel(logging.ERROR)
-
-    # Need to re-run logger_create with color argument
-    # (will be the same logger since it has the same name)
-    bb.msg.logger_create('bitbake-layers', output=sys.stdout, color=global_args.color)
-
-    plugins = []
-    tinfoil = bb.tinfoil.Tinfoil(tracking=True)
-    tinfoil.logger.setLevel(logger.getEffectiveLevel())
-    try:
-        tinfoil.prepare(True)
-        for path in ([topdir] +
-                    tinfoil.config_data.getVar('BBPATH').split(':')):
-            pluginpath = os.path.join(path, 'lib', 'bblayers')
-            bb.utils.load_plugins(logger, plugins, pluginpath)
-
-        registered = False
-        for plugin in plugins:
-            if hasattr(plugin, 'register_commands'):
-                registered = True
-                plugin.register_commands(subparsers)
-            if hasattr(plugin, 'tinfoil_init'):
-                plugin.tinfoil_init(tinfoil)
-
-        if not registered:
-            logger.error("No commands registered - missing plugins?")
-            sys.exit(1)
-
-        args = parser.parse_args(unparsed_args, namespace=global_args)
-
-        if getattr(args, 'parserecipes', False):
-            tinfoil.config_data.disableTracking()
-            tinfoil.parse_recipes()
-            tinfoil.config_data.enableTracking()
-
-        return args.func(args)
-    finally:
-        tinfoil.shutdown()
 
 
-if __name__ == "__main__":
-    try:
-        ret = main()
-    except bb.BBHandledException:
-        ret = 1
-    except Exception:
-        ret = 1
-        import traceback
-        traceback.print_exc()
-    sys.exit(ret)
+logger = logging.getLogger('BitBake')
+
+
+def main(args):
+    cmds = Commands()
+    if args:
+        # Allow user to specify e.g. show-layers instead of show_layers
+        args = [args[0].replace('-', '_')] + args[1:]
+        cmds.onecmd(' '.join(args))
+    else:
+        cmds.do_help('')
+    return cmds.returncode
+
+
+class Commands(cmd.Cmd):
+    def __init__(self):
+        self.bbhandler = None
+        self.returncode = 0
+        self.bblayers = []
+        cmd.Cmd.__init__(self)
+
+    def init_bbhandler(self, config_only = False):
+        if not self.bbhandler:
+            self.bbhandler = bb.tinfoil.Tinfoil()
+            self.bblayers = (self.bbhandler.config_data.getVar('BBLAYERS', True) or "").split()
+            self.bbhandler.prepare(config_only)
+
+    def default(self, line):
+        """Handle unrecognised commands"""
+        sys.stderr.write("Unrecognised command or option\n")
+        self.do_help('')
+
+    def do_help(self, topic):
+        """display general help or help on a specified command"""
+        if topic:
+            sys.stdout.write('%s: ' % topic)
+            cmd.Cmd.do_help(self, topic.replace('-', '_'))
+        else:
+            sys.stdout.write("usage: bitbake-layers <command> [arguments]\n\n")
+            sys.stdout.write("Available commands:\n")
+            procnames = list(set(self.get_names()))
+            for procname in procnames:
+                if procname[:3] == 'do_':
+                    sys.stdout.write("  %s\n" % procname[3:].replace('_', '-'))
+                    doc = getattr(self, procname).__doc__
+                    if doc:
+                        sys.stdout.write("    %s\n" % doc.splitlines()[0])
+
+    def do_show_layers(self, args):
+        """show current configured layers"""
+        self.init_bbhandler(config_only = True)
+        logger.plain("%s  %s  %s" % ("layer".ljust(20), "path".ljust(40), "priority"))
+        logger.plain('=' * 74)
+        for layerdir in self.bblayers:
+            layername = self.get_layer_name(layerdir)
+            layerpri = 0
+            for layer, _, regex, pri in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
+                if regex.match(os.path.join(layerdir, 'test')):
+                    layerpri = pri
+                    break
+
+            logger.plain("%s  %s  %d" % (layername.ljust(20), layerdir.ljust(40), layerpri))
+
+
+    def version_str(self, pe, pv, pr = None):
+        verstr = "%s" % pv
+        if pr:
+            verstr = "%s-%s" % (verstr, pr)
+        if pe:
+            verstr = "%s:%s" % (pe, verstr)
+        return verstr
+
+
+    def do_show_overlayed(self, args):
+        """list overlayed recipes (where the same recipe exists in another layer)
+
+usage: show-overlayed [-f] [-s]
+
+Lists the names of overlayed recipes and the available versions in each
+layer, with the preferred version first. Note that skipped recipes that
+are overlayed will also be listed, with a " (skipped)" suffix.
+
+Options:
+  -f   instead of the default formatting, list filenames of higher priority
+       recipes with the ones they overlay indented underneath
+  -s   only list overlayed recipes where the version is the same
+"""
+        self.init_bbhandler()
+
+        show_filenames = False
+        show_same_ver_only = False
+        for arg in args.split():
+            if arg == '-f':
+                show_filenames = True
+            elif arg == '-s':
+                show_same_ver_only = True
+            else:
+                sys.stderr.write("show-overlayed: invalid option %s\n" % arg)
+                self.do_help('')
+                return
+
+        items_listed = self.list_recipes('Overlayed recipes', None, True, show_same_ver_only, show_filenames, True)
+
+        # Check for overlayed .bbclass files
+        classes = defaultdict(list)
+        for layerdir in self.bblayers:
+            classdir = os.path.join(layerdir, 'classes')
+            if os.path.exists(classdir):
+                for classfile in os.listdir(classdir):
+                    if os.path.splitext(classfile)[1] == '.bbclass':
+                        classes[classfile].append(classdir)
+
+        # Locating classes and other files is a bit more complicated than recipes -
+        # layer priority is not a factor; instead BitBake uses the first matching
+        # file in BBPATH, which is manipulated directly by each layer's
+        # conf/layer.conf in turn, thus the order of layers in bblayers.conf is a
+        # factor - however, each layer.conf is free to either prepend or append to
+        # BBPATH (or indeed do crazy stuff with it). Thus the order in BBPATH might
+        # not be exactly the order present in bblayers.conf either.
+        bbpath = str(self.bbhandler.config_data.getVar('BBPATH', True))
+        overlayed_class_found = False
+        for (classfile, classdirs) in classes.items():
+            if len(classdirs) > 1:
+                if not overlayed_class_found:
+                    logger.plain('=== Overlayed classes ===')
+                    overlayed_class_found = True
+
+                mainfile = bb.utils.which(bbpath, os.path.join('classes', classfile))
+                if show_filenames:
+                    logger.plain('%s' % mainfile)
+                else:
+                    # We effectively have to guess the layer here
+                    logger.plain('%s:' % classfile)
+                    mainlayername = '?'
+                    for layerdir in self.bblayers:
+                        classdir = os.path.join(layerdir, 'classes')
+                        if mainfile.startswith(classdir):
+                            mainlayername = self.get_layer_name(layerdir)
+                    logger.plain('  %s' % mainlayername)
+                for classdir in classdirs:
+                    fullpath = os.path.join(classdir, classfile)
+                    if fullpath != mainfile:
+                        if show_filenames:
+                            print('  %s' % fullpath)
+                        else:
+                            print('  %s' % self.get_layer_name(os.path.dirname(classdir)))
+
+        if overlayed_class_found:
+            items_listed = True;
+
+        if not items_listed:
+            logger.plain('No overlayed files found.')
+
+
+    def do_show_recipes(self, args):
+        """list available recipes, showing the layer they are provided by
+
+usage: show-recipes [-f] [-m] [pnspec]
+
+Lists the names of overlayed recipes and the available versions in each
+layer, with the preferred version first. Optionally you may specify
+pnspec to match a specified recipe name (supports wildcards). Note that
+skipped recipes will also be listed, with a " (skipped)" suffix.
+
+Options:
+  -f   instead of the default formatting, list filenames of higher priority
+       recipes with other available recipes indented underneath
+  -m   only list where multiple recipes (in the same layer or different
+       layers) exist for the same recipe name
+"""
+        self.init_bbhandler()
+
+        show_filenames = False
+        show_multi_provider_only = False
+        pnspec = None
+        title = 'Available recipes:'
+        for arg in args.split():
+            if arg == '-f':
+                show_filenames = True
+            elif arg == '-m':
+                show_multi_provider_only = True
+            elif not arg.startswith('-'):
+                pnspec = arg
+                title = 'Available recipes matching %s:' % pnspec
+            else:
+                sys.stderr.write("show-recipes: invalid option %s\n" % arg)
+                self.do_help('')
+                return
+        self.list_recipes(title, pnspec, False, False, show_filenames, show_multi_provider_only)
+
+
+    def list_recipes(self, title, pnspec, show_overlayed_only, show_same_ver_only, show_filenames, show_multi_provider_only):
+        pkg_pn = self.bbhandler.cooker.recipecache.pkg_pn
+        (latest_versions, preferred_versions) = bb.providers.findProviders(self.bbhandler.config_data, self.bbhandler.cooker.recipecache, pkg_pn)
+        allproviders = bb.providers.allProviders(self.bbhandler.cooker.recipecache)
+
+        # Ensure we list skipped recipes
+        # We are largely guessing about PN, PV and the preferred version here,
+        # but we have no choice since skipped recipes are not fully parsed
+        skiplist = self.bbhandler.cooker.skiplist.keys()
+        skiplist.sort( key=lambda fileitem: self.bbhandler.cooker.collection.calc_bbfile_priority(fileitem) )
+        skiplist.reverse()
+        for fn in skiplist:
+            recipe_parts = os.path.splitext(os.path.basename(fn))[0].split('_')
+            p = recipe_parts[0]
+            if len(recipe_parts) > 1:
+                ver = (None, recipe_parts[1], None)
+            else:
+                ver = (None, 'unknown', None)
+            allproviders[p].append((ver, fn))
+            if not p in pkg_pn:
+                pkg_pn[p] = 'dummy'
+                preferred_versions[p] = (ver, fn)
+
+        def print_item(f, pn, ver, layer, ispref):
+            if f in skiplist:
+                skipped = ' (skipped)'
+            else:
+                skipped = ''
+            if show_filenames:
+                if ispref:
+                    logger.plain("%s%s", f, skipped)
+                else:
+                    logger.plain("  %s%s", f, skipped)
+            else:
+                if ispref:
+                    logger.plain("%s:", pn)
+                logger.plain("  %s %s%s", layer.ljust(20), ver, skipped)
+
+        preffiles = []
+        items_listed = False
+        for p in sorted(pkg_pn):
+            if pnspec:
+                if not fnmatch.fnmatch(p, pnspec):
+                    continue
+
+            if len(allproviders[p]) > 1 or not show_multi_provider_only:
+                pref = preferred_versions[p]
+                preffile = bb.cache.Cache.virtualfn2realfn(pref[1])[0]
+                if preffile not in preffiles:
+                    preflayer = self.get_file_layer(preffile)
+                    multilayer = False
+                    same_ver = True
+                    provs = []
+                    for prov in allproviders[p]:
+                        provfile = bb.cache.Cache.virtualfn2realfn(prov[1])[0]
+                        provlayer = self.get_file_layer(provfile)
+                        provs.append((provfile, provlayer, prov[0]))
+                        if provlayer != preflayer:
+                            multilayer = True
+                        if prov[0] != pref[0]:
+                            same_ver = False
+
+                    if (multilayer or not show_overlayed_only) and (same_ver or not show_same_ver_only):
+                        if not items_listed:
+                            logger.plain('=== %s ===' % title)
+                            items_listed = True
+                        print_item(preffile, p, self.version_str(pref[0][0], pref[0][1]), preflayer, True)
+                        for (provfile, provlayer, provver) in provs:
+                            if provfile != preffile:
+                                print_item(provfile, p, self.version_str(provver[0], provver[1]), provlayer, False)
+                        # Ensure we don't show two entries for BBCLASSEXTENDed recipes
+                        preffiles.append(preffile)
+
+        return items_listed
+
+
+    def do_flatten(self, args):
+        """flattens layer configuration into a separate output directory.
+
+usage: flatten [layer1 layer2 [layer3]...] <outputdir>
+
+Takes the specified layers (or all layers in the current layer
+configuration if none are specified) and builds a "flattened" directory
+containing the contents of all layers, with any overlayed recipes removed
+and bbappends appended to the corresponding recipes. Note that some manual
+cleanup may still be necessary afterwards, in particular:
+
+* where non-recipe files (such as patches) are overwritten (the flatten
+  command will show a warning for these)
+* where anything beyond the normal layer setup has been added to
+  layer.conf (only the lowest priority number layer's layer.conf is used)
+* overridden/appended items from bbappends will need to be tidied up
+* when the flattened layers do not have the same directory structure (the
+  flatten command should show a warning when this will cause a problem)
+
+Warning: if you flatten several layers where another layer is intended to
+be used "inbetween" them (in layer priority order) such that recipes /
+bbappends in the layers interact, and then attempt to use the new output
+layer together with that other layer, you may no longer get the same
+build results (as the layer priority order has effectively changed).
+"""
+        arglist = args.split()
+        if len(arglist) < 1:
+            logger.error('Please specify an output directory')
+            self.do_help('flatten')
+            return
+
+        if len(arglist) == 2:
+            logger.error('If you specify layers to flatten you must specify at least two')
+            self.do_help('flatten')
+            return
+
+        outputdir = arglist[-1]
+        if os.path.exists(outputdir) and os.listdir(outputdir):
+            logger.error('Directory %s exists and is non-empty, please clear it out first' % outputdir)
+            return
+
+        self.init_bbhandler()
+        layers = self.bblayers
+        if len(arglist) > 2:
+            layernames = arglist[:-1]
+            found_layernames = []
+            found_layerdirs = []
+            for layerdir in layers:
+                layername = self.get_layer_name(layerdir)
+                if layername in layernames:
+                    found_layerdirs.append(layerdir)
+                    found_layernames.append(layername)
+
+            for layername in layernames:
+                if not layername in found_layernames:
+                    logger.error('Unable to find layer %s in current configuration, please run "%s show-layers" to list configured layers' % (layername, os.path.basename(sys.argv[0])))
+                    return
+            layers = found_layerdirs
+        else:
+            layernames = []
+
+        # Ensure a specified path matches our list of layers
+        def layer_path_match(path):
+            for layerdir in layers:
+                if path.startswith(os.path.join(layerdir, '')):
+                    return layerdir
+            return None
+
+        appended_recipes = []
+        for layer in layers:
+            overlayed = []
+            for f in self.bbhandler.cooker.collection.overlayed.iterkeys():
+                for of in self.bbhandler.cooker.collection.overlayed[f]:
+                    if of.startswith(layer):
+                        overlayed.append(of)
+
+            logger.plain('Copying files from %s...' % layer )
+            for root, dirs, files in os.walk(layer):
+                for f1 in files:
+                    f1full = os.sep.join([root, f1])
+                    if f1full in overlayed:
+                        logger.plain('  Skipping overlayed file %s' % f1full )
+                    else:
+                        ext = os.path.splitext(f1)[1]
+                        if ext != '.bbappend':
+                            fdest = f1full[len(layer):]
+                            fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
+                            bb.utils.mkdirhier(os.path.dirname(fdest))
+                            if os.path.exists(fdest):
+                                if f1 == 'layer.conf' and root.endswith('/conf'):
+                                    logger.plain('  Skipping layer config file %s' % f1full )
+                                    continue
+                                else:
+                                    logger.warn('Overwriting file %s', fdest)
+                            bb.utils.copyfile(f1full, fdest)
+                            if ext == '.bb':
+                                if f1 in self.bbhandler.cooker.collection.appendlist:
+                                    appends = self.bbhandler.cooker.collection.appendlist[f1]
+                                    if appends:
+                                        logger.plain('  Applying appends to %s' % fdest )
+                                        for appendname in appends:
+                                            if layer_path_match(appendname):
+                                                self.apply_append(appendname, fdest)
+                                    appended_recipes.append(f1)
+
+        # Take care of when some layers are excluded and yet we have included bbappends for those recipes
+        for recipename in self.bbhandler.cooker.collection.appendlist.iterkeys():
+            if recipename not in appended_recipes:
+                appends = self.bbhandler.cooker.collection.appendlist[recipename]
+                first_append = None
+                for appendname in appends:
+                    layer = layer_path_match(appendname)
+                    if layer:
+                        if first_append:
+                            self.apply_append(appendname, first_append)
+                        else:
+                            fdest = appendname[len(layer):]
+                            fdest = os.path.normpath(os.sep.join([outputdir,fdest]))
+                            bb.utils.mkdirhier(os.path.dirname(fdest))
+                            bb.utils.copyfile(appendname, fdest)
+                            first_append = fdest
+
+        # Get the regex for the first layer in our list (which is where the conf/layer.conf file will
+        # have come from)
+        first_regex = None
+        layerdir = layers[0]
+        for layername, pattern, regex, _ in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
+            if regex.match(os.path.join(layerdir, 'test')):
+                first_regex = regex
+                break
+
+        if first_regex:
+            # Find the BBFILES entries that match (which will have come from this conf/layer.conf file)
+            bbfiles = str(self.bbhandler.config_data.getVar('BBFILES', True)).split()
+            bbfiles_layer = []
+            for item in bbfiles:
+                if first_regex.match(item):
+                    newpath = os.path.join(outputdir, item[len(layerdir)+1:])
+                    bbfiles_layer.append(newpath)
+
+            if bbfiles_layer:
+                # Check that all important layer files match BBFILES
+                for root, dirs, files in os.walk(outputdir):
+                    for f1 in files:
+                        ext = os.path.splitext(f1)[1]
+                        if ext in ['.bb', '.bbappend']:
+                            f1full = os.sep.join([root, f1])
+                            entry_found = False
+                            for item in bbfiles_layer:
+                                if fnmatch.fnmatch(f1full, item):
+                                    entry_found = True
+                                    break
+                            if not entry_found:
+                                logger.warning("File %s does not match the flattened layer's BBFILES setting, you may need to edit conf/layer.conf or move the file elsewhere" % f1full)
+
+    def get_file_layer(self, filename):
+        for layer, _, regex, _ in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
+            if regex.match(filename):
+                for layerdir in self.bblayers:
+                    if regex.match(os.path.join(layerdir, 'test')) and re.match(layerdir, filename):
+                        return self.get_layer_name(layerdir)
+        return "?"
+
+    def get_file_layerdir(self, filename):
+        for layer, _, regex, _ in self.bbhandler.cooker.recipecache.bbfile_config_priorities:
+            if regex.match(filename):
+                for layerdir in self.bblayers:
+                    if regex.match(os.path.join(layerdir, 'test')) and re.match(layerdir, filename):
+                        return layerdir
+        return "?"
+
+    def remove_layer_prefix(self, f):
+        """Remove the layer_dir prefix, e.g., f = /path/to/layer_dir/foo/blah, the
+           return value will be: layer_dir/foo/blah"""
+        f_layerdir = self.get_file_layerdir(f)
+        prefix = os.path.join(os.path.dirname(f_layerdir), '')
+        return f[len(prefix):] if f.startswith(prefix) else f
+
+    def get_layer_name(self, layerdir):
+        return os.path.basename(layerdir.rstrip(os.sep))
+
+    def apply_append(self, appendname, recipename):
+        appendfile = open(appendname, 'r')
+        recipefile = open(recipename, 'a')
+        recipefile.write('\n')
+        recipefile.write('##### bbappended from %s #####\n' % self.get_file_layer(appendname))
+        recipefile.writelines(appendfile.readlines())
+        recipefile.close()
+        appendfile.close()
+
+    def do_show_appends(self, args):
+        """list bbappend files and recipe files they apply to
+
+usage: show-appends
+
+Recipes are listed with the bbappends that apply to them as subitems.
+"""
+        self.init_bbhandler()
+        if not self.bbhandler.cooker.collection.appendlist:
+            logger.plain('No append files found')
+            return
+
+        logger.plain('=== Appended recipes ===')
+
+        pnlist = list(self.bbhandler.cooker_data.pkg_pn.keys())
+        pnlist.sort()
+        for pn in pnlist:
+            self.show_appends_for_pn(pn)
+
+        self.show_appends_for_skipped()
+
+    def show_appends_for_pn(self, pn):
+        filenames = self.bbhandler.cooker_data.pkg_pn[pn]
+
+        best = bb.providers.findBestProvider(pn,
+                                             self.bbhandler.config_data,
+                                             self.bbhandler.cooker_data,
+                                             self.bbhandler.cooker_data.pkg_pn)
+        best_filename = os.path.basename(best[3])
+
+        self.show_appends_output(filenames, best_filename)
+
+    def show_appends_for_skipped(self):
+        filenames = [os.path.basename(f)
+                    for f in self.bbhandler.cooker.skiplist.iterkeys()]
+        self.show_appends_output(filenames, None, " (skipped)")
+
+    def show_appends_output(self, filenames, best_filename, name_suffix = ''):
+        appended, missing = self.get_appends_for_files(filenames)
+        if appended:
+            for basename, appends in appended:
+                logger.plain('%s%s:', basename, name_suffix)
+                for append in appends:
+                    logger.plain('  %s', append)
+
+            if best_filename:
+                if best_filename in missing:
+                    logger.warn('%s: missing append for preferred version',
+                                best_filename)
+                    self.returncode |= 1
+
+
+    def get_appends_for_files(self, filenames):
+        appended, notappended = [], []
+        for filename in filenames:
+            _, cls = bb.cache.Cache.virtualfn2realfn(filename)
+            if cls:
+                continue
+
+            basename = os.path.basename(filename)
+            appends = self.bbhandler.cooker.collection.get_file_appends(basename)
+            if appends:
+                appended.append((basename, list(appends)))
+            else:
+                notappended.append(basename)
+        return appended, notappended
+
+    def do_show_cross_depends(self, args):
+        """figure out the dependency between recipes that crosses a layer boundary.
+
+usage: show-cross-depends [-f] [-i layer1[,layer2[,layer3...]]]
+
+Figure out the dependency between recipes that crosses a layer boundary.
+
+Options:
+  -f   show full file path
+  -i   ignore dependencies on items in the specified layer(s)
+
+NOTE:
+The .bbappend file can impact the dependency.
+"""
+        import optparse
+
+        parser = optparse.OptionParser(usage="show-cross-depends [-f] [-i layer1[,layer2[,layer3...]]]")
+        parser.add_option("-f", "",
+                action="store_true", dest="show_filenames")
+        parser.add_option("-i", "",
+                action="store", dest="ignore_layers", default="")
+
+        options, args = parser.parse_args(sys.argv)
+        ignore_layers = options.ignore_layers.split(',')
+
+        self.init_bbhandler()
+
+        pkg_fn = self.bbhandler.cooker_data.pkg_fn
+        bbpath = str(self.bbhandler.config_data.getVar('BBPATH', True))
+        self.require_re = re.compile(r"require\s+(.+)")
+        self.include_re = re.compile(r"include\s+(.+)")
+        self.inherit_re = re.compile(r"inherit\s+(.+)")
+
+        global_inherit = (self.bbhandler.config_data.getVar('INHERIT', True) or "").split()
+
+        # The bb's DEPENDS and RDEPENDS
+        for f in pkg_fn:
+            f = bb.cache.Cache.virtualfn2realfn(f)[0]
+            # Get the layername that the file is in
+            layername = self.get_file_layer(f)
+
+            # The DEPENDS
+            deps = self.bbhandler.cooker_data.deps[f]
+            for pn in deps:
+                if pn in self.bbhandler.cooker_data.pkg_pn:
+                    best = bb.providers.findBestProvider(pn,
+                            self.bbhandler.config_data,
+                            self.bbhandler.cooker_data,
+                            self.bbhandler.cooker_data.pkg_pn)
+                    self.check_cross_depends("DEPENDS", layername, f, best[3], options.show_filenames, ignore_layers)
+
+            # The RDPENDS
+            all_rdeps = self.bbhandler.cooker_data.rundeps[f].values()
+            # Remove the duplicated or null one.
+            sorted_rdeps = {}
+            # The all_rdeps is the list in list, so we need two for loops
+            for k1 in all_rdeps:
+                for k2 in k1:
+                    sorted_rdeps[k2] = 1
+            all_rdeps = sorted_rdeps.keys()
+            for rdep in all_rdeps:
+                all_p = bb.providers.getRuntimeProviders(self.bbhandler.cooker_data, rdep)
+                if all_p:
+                    if f in all_p:
+                        # The recipe provides this one itself, ignore
+                        continue
+                    best = bb.providers.filterProvidersRunTime(all_p, rdep,
+                                    self.bbhandler.config_data,
+                                    self.bbhandler.cooker_data)[0][0]
+                    self.check_cross_depends("RDEPENDS", layername, f, best, options.show_filenames, ignore_layers)
+
+            # The RRECOMMENDS
+            all_rrecs = self.bbhandler.cooker_data.runrecs[f].values()
+            # Remove the duplicated or null one.
+            sorted_rrecs = {}
+            # The all_rrecs is the list in list, so we need two for loops
+            for k1 in all_rrecs:
+                for k2 in k1:
+                    sorted_rrecs[k2] = 1
+            all_rrecs = sorted_rrecs.keys()
+            for rrec in all_rrecs:
+                all_p = bb.providers.getRuntimeProviders(self.bbhandler.cooker_data, rrec)
+                if all_p:
+                    if f in all_p:
+                        # The recipe provides this one itself, ignore
+                        continue
+                    best = bb.providers.filterProvidersRunTime(all_p, rrec,
+                                    self.bbhandler.config_data,
+                                    self.bbhandler.cooker_data)[0][0]
+                    self.check_cross_depends("RRECOMMENDS", layername, f, best, options.show_filenames, ignore_layers)
+
+            # The inherit class
+            cls_re = re.compile('classes/')
+            if f in self.bbhandler.cooker_data.inherits:
+                inherits = self.bbhandler.cooker_data.inherits[f]
+                for cls in inherits:
+                    # The inherits' format is [classes/cls, /path/to/classes/cls]
+                    # ignore the classes/cls.
+                    if not cls_re.match(cls):
+                        classname = os.path.splitext(os.path.basename(cls))[0]
+                        if classname in global_inherit:
+                            continue
+                        inherit_layername = self.get_file_layer(cls)
+                        if inherit_layername != layername and not inherit_layername in ignore_layers:
+                            if not options.show_filenames:
+                                f_short = self.remove_layer_prefix(f)
+                                cls = self.remove_layer_prefix(cls)
+                            else:
+                                f_short = f
+                            logger.plain("%s inherits %s" % (f_short, cls))
+
+            # The 'require/include xxx' in the bb file
+            pv_re = re.compile(r"\${PV}")
+            fnfile = open(f, 'r')
+            line = fnfile.readline()
+            while line:
+                m, keyword = self.match_require_include(line)
+                # Found the 'require/include xxxx'
+                if m:
+                    needed_file = m.group(1)
+                    # Replace the ${PV} with the real PV
+                    if pv_re.search(needed_file) and f in self.bbhandler.cooker_data.pkg_pepvpr:
+                        pv = self.bbhandler.cooker_data.pkg_pepvpr[f][1]
+                        needed_file = re.sub(r"\${PV}", pv, needed_file)
+                    self.print_cross_files(bbpath, keyword, layername, f, needed_file, options.show_filenames, ignore_layers)
+                line = fnfile.readline()
+            fnfile.close()
+
+        # The "require/include xxx" in conf/machine/*.conf, .inc and .bbclass
+        conf_re = re.compile(".*/conf/machine/[^\/]*\.conf$")
+        inc_re = re.compile(".*\.inc$")
+        # The "inherit xxx" in .bbclass
+        bbclass_re = re.compile(".*\.bbclass$")
+        for layerdir in self.bblayers:
+            layername = self.get_layer_name(layerdir)
+            for dirpath, dirnames, filenames in os.walk(layerdir):
+                for name in filenames:
+                    f = os.path.join(dirpath, name)
+                    s = conf_re.match(f) or inc_re.match(f) or bbclass_re.match(f)
+                    if s:
+                        ffile = open(f, 'r')
+                        line = ffile.readline()
+                        while line:
+                            m, keyword = self.match_require_include(line)
+                            # Only bbclass has the "inherit xxx" here.
+                            bbclass=""
+                            if not m and f.endswith(".bbclass"):
+                                m, keyword = self.match_inherit(line)
+                                bbclass=".bbclass"
+                            # Find a 'require/include xxxx'
+                            if m:
+                                self.print_cross_files(bbpath, keyword, layername, f, m.group(1) + bbclass, options.show_filenames, ignore_layers)
+                            line = ffile.readline()
+                        ffile.close()
+
+    def print_cross_files(self, bbpath, keyword, layername, f, needed_filename, show_filenames, ignore_layers):
+        """Print the depends that crosses a layer boundary"""
+        needed_file = bb.utils.which(bbpath, needed_filename)
+        if needed_file:
+            # Which layer is this file from
+            needed_layername = self.get_file_layer(needed_file)
+            if needed_layername != layername and not needed_layername in ignore_layers:
+                if not show_filenames:
+                    f = self.remove_layer_prefix(f)
+                    needed_file = self.remove_layer_prefix(needed_file)
+                logger.plain("%s %s %s" %(f, keyword, needed_file))
+
+    def match_inherit(self, line):
+        """Match the inherit xxx line"""
+        return (self.inherit_re.match(line), "inherits")
+
+    def match_require_include(self, line):
+        """Match the require/include xxx line"""
+        m = self.require_re.match(line)
+        keyword = "requires"
+        if not m:
+            m = self.include_re.match(line)
+            keyword = "includes"
+        return (m, keyword)
+
+    def check_cross_depends(self, keyword, layername, f, needed_file, show_filenames, ignore_layers):
+        """Print the DEPENDS/RDEPENDS file that crosses a layer boundary"""
+        best_realfn = bb.cache.Cache.virtualfn2realfn(needed_file)[0]
+        needed_layername = self.get_file_layer(best_realfn)
+        if needed_layername != layername and not needed_layername in ignore_layers:
+            if not show_filenames:
+                f = self.remove_layer_prefix(f)
+                best_realfn = self.remove_layer_prefix(best_realfn)
+
+            logger.plain("%s %s %s" % (f, keyword, best_realfn))
+
+if __name__ == '__main__':
+    sys.exit(main(sys.argv[1:]) or 0)

bitbake/bin/bitbake-prserv

@@ -1,4 +1,4 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 import os
 import sys,logging
 import optparse
@@ -50,6 +50,6 @@ if __name__ == "__main__":
     except Exception:
         ret = 1
         import traceback
-        traceback.print_exc()
+        traceback.print_exc(5)
     sys.exit(ret)
 

bitbake/bin/bitbake-selftest

@@ -1,4 +1,4 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 #
 # Copyright (C) 2012 Richard Purdie
 #
@@ -22,60 +22,28 @@ sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)), 'lib
 import unittest
 try:
     import bb
-    import hashserv
-    import layerindexlib
 except RuntimeError as exc:
     sys.exit(str(exc))
 
-tests = ["bb.tests.codeparser",
-         "bb.tests.cooker",
-         "bb.tests.cow",
-         "bb.tests.data",
-         "bb.tests.event",
-         "bb.tests.fetch",
-         "bb.tests.parse",
-         "bb.tests.persist_data",
-         "bb.tests.utils",
-         "hashserv.tests",
-         "layerindexlib.tests.layerindexobj",
-         "layerindexlib.tests.restapi",
-         "layerindexlib.tests.cooker"]
+def usage():
+    print('usage: %s [testname1 [testname2]...]' % os.path.basename(sys.argv[0]))
+
+if len(sys.argv) > 1:
+    if '--help' in sys.argv[1:]:
+        usage()
+        sys.exit(0)
+
+    tests = sys.argv[1:]
+else:
+    tests = ["bb.tests.codeparser",
+             "bb.tests.cow",
+             "bb.tests.data",
+             "bb.tests.fetch",
+             "bb.tests.utils"]
 
 for t in tests:
     t = '.'.join(t.split('.')[:3])
     __import__(t)
 
+unittest.main(argv=["bitbake-selftest"] + tests)
 
-# Set-up logging
-class StdoutStreamHandler(logging.StreamHandler):
-    """Special handler so that unittest is able to capture stdout"""
-    def __init__(self):
-        # Override __init__() because we don't want to set self.stream here
-        logging.Handler.__init__(self)
-
-    @property
-    def stream(self):
-        # We want to dynamically write wherever sys.stdout is pointing to
-        return sys.stdout
-
-
-handler = StdoutStreamHandler()
-bb.logger.addHandler(handler)
-bb.logger.setLevel(logging.DEBUG)
-
-
-ENV_HELP = """\
-Environment variables:
-  BB_SKIP_NETTESTS      set to 'yes' in order to skip tests using network
-                        connection
-  BB_TMPDIR_NOCLEAN     set to 'yes' to preserve test tmp directories
-"""
-
-class main(unittest.main):
-    def _print_help(self, *args, **kwargs):
-        super(main, self)._print_help(*args, **kwargs)
-        print(ENV_HELP)
-
-
-if __name__ == '__main__':
-        main(defaultTest=tests, buffer=True)

bitbake/bin/bitbake-worker

@@ -1,4 +1,4 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 import os
 import sys
@@ -10,14 +10,6 @@ import bb
 import select
 import errno
 import signal
-import pickle
-import traceback
-import queue
-from multiprocessing import Lock
-from threading import Thread
-
-if sys.getfilesystemencoding() != "utf-8":
-    sys.exit("Please use a locale setting which supports UTF-8 (such as LANG=en_US.UTF-8).\nPython can't change the filesystem locale after loading so we need a UTF-8 when Python starts or things won't work.")
 
 # Users shouldn't be running this code directly
 if len(sys.argv) != 2 or not sys.argv[1].startswith("decafbad"):
@@ -25,33 +17,24 @@ if len(sys.argv) != 2 or not sys.argv[1].startswith("decafbad"):
     sys.exit(1)
 
 profiling = False
-if sys.argv[1].startswith("decafbadbad"):
+if sys.argv[1] == "decafbadbad":
     profiling = True
     try:
         import cProfile as profile
     except:
         import profile
 
-# Unbuffer stdout to avoid log truncation in the event
-# of an unorderly exit as well as to provide timely
-# updates to log files for use with tail
-try:
-    if sys.stdout.name == '<stdout>':
-        import fcntl
-        fl = fcntl.fcntl(sys.stdout.fileno(), fcntl.F_GETFL)
-        fl |= os.O_SYNC 
-        fcntl.fcntl(sys.stdout.fileno(), fcntl.F_SETFL, fl)
-        #sys.stdout = os.fdopen(sys.stdout.fileno(), 'w', 0)
-except:
-    pass
-
 logger = logging.getLogger("BitBake")
 
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    bb.msg.note(1, bb.msg.domain.Cache, "Importing cPickle failed. Falling back to a very slow implementation.")
+
+
 worker_pipe = sys.stdout.fileno()
 bb.utils.nonblockingfd(worker_pipe)
-# Need to guard against multiprocessing being used in child processes
-# and multiple processes trying to write to the parent at the same time
-worker_pipe_lock = None
 
 handler = bb.event.LogHandler()
 logger.addHandler(handler)
@@ -66,61 +49,36 @@ if 0:
     consolelog.setFormatter(conlogformat)
     logger.addHandler(consolelog)
 
-worker_queue = queue.Queue()
+worker_queue = ""
 
 def worker_fire(event, d):
-    data = b"<event>" + pickle.dumps(event) + b"</event>"
+    data = "<event>" + pickle.dumps(event) + "</event>"
     worker_fire_prepickled(data)
 
 def worker_fire_prepickled(event):
     global worker_queue
 
-    worker_queue.put(event)
+    worker_queue = worker_queue + event
+    worker_flush()
 
-#
-# We can end up with write contention with the cooker, it can be trying to send commands
-# and we can be trying to send event data back. Therefore use a separate thread for writing 
-# back data to cooker.
-#
-worker_thread_exit = False
+def worker_flush():
+    global worker_queue, worker_pipe
 
-def worker_flush(worker_queue):
-    worker_queue_int = b""
-    global worker_pipe, worker_thread_exit
+    if not worker_queue:
+        return
 
-    while True:
-        try:
-            worker_queue_int = worker_queue_int + worker_queue.get(True, 1)
-        except queue.Empty:
-            pass
-        while (worker_queue_int or not worker_queue.empty()):
-            try:
-                (_, ready, _) = select.select([], [worker_pipe], [], 1)
-                if not worker_queue.empty():
-                    worker_queue_int = worker_queue_int + worker_queue.get()
-                written = os.write(worker_pipe, worker_queue_int)
-                worker_queue_int = worker_queue_int[written:]
-            except (IOError, OSError) as e:
-                if e.errno != errno.EAGAIN and e.errno != errno.EPIPE:
-                    raise
-        if worker_thread_exit and worker_queue.empty() and not worker_queue_int:
-            return
-
-worker_thread = Thread(target=worker_flush, args=(worker_queue,))
-worker_thread.start()
+    try:
+        written = os.write(worker_pipe, worker_queue)
+        worker_queue = worker_queue[written:]
+    except (IOError, OSError) as e:
+        if e.errno != errno.EAGAIN:
+            raise
 
 def worker_child_fire(event, d):
     global worker_pipe
-    global worker_pipe_lock
 
-    data = b"<event>" + pickle.dumps(event) + b"</event>"
-    try:
-        worker_pipe_lock.acquire()
-        worker_pipe.write(data)
-        worker_pipe_lock.release()
-    except IOError:
-        sigterm_handler(None, None)
-        raise
+    data = "<event>" + pickle.dumps(event) + "</event>"
+    worker_pipe.write(data)
 
 bb.event.worker_fire = worker_fire
 
@@ -136,7 +94,7 @@ def sigterm_handler(signum, frame):
     os.killpg(0, signal.SIGTERM)
     sys.exit()
 
-def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskhash, unihash, appends, taskdepdata, extraconfigdata, quieterrors=False, dry_run_exec=False):
+def fork_off_task(cfg, data, workerdata, fn, task, taskname, appends, taskdepdata, quieterrors=False):
     # We need to setup the environment BEFORE the fork, since
     # a fork() or exec*() activates PSEUDO...
 
@@ -152,10 +110,8 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskha
         except TypeError:
              umask = taskdep['umask'][taskname]
 
-    dry_run = cfg.dry_run or dry_run_exec
-
     # We can't use the fakeroot environment in a dry run as it possibly hasn't been built
-    if 'fakeroot' in taskdep and taskname in taskdep['fakeroot'] and not dry_run:
+    if 'fakeroot' in taskdep and taskname in taskdep['fakeroot'] and not cfg.dry_run:
         envvars = (workerdata["fakerootenv"][fn] or "").split()
         for key, value in (var.split('=') for var in envvars):
             envbackup[key] = os.environ.get(key)
@@ -183,26 +139,22 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskha
         pipeout = os.fdopen(pipeout, 'wb', 0)
         pid = os.fork()
     except OSError as e:
-        logger.critical("fork failed: %d (%s)" % (e.errno, e.strerror))
-        sys.exit(1)
+        bb.msg.fatal("RunQueue", "fork failed: %d (%s)" % (e.errno, e.strerror))
 
     if pid == 0:
         def child():
             global worker_pipe
-            global worker_pipe_lock
             pipein.close()
 
             signal.signal(signal.SIGTERM, sigterm_handler)
             # Let SIGHUP exit as SIGTERM
             signal.signal(signal.SIGHUP, sigterm_handler)
-            bb.utils.signal_on_parent_exit("SIGTERM")
 
             # Save out the PID so that the event can include it the
             # events
             bb.event.worker_pid = os.getpid()
             bb.event.worker_fire = worker_child_fire
             worker_pipe = pipeout
-            worker_pipe_lock = Lock()
 
             # Make the child the process group leader and ensure no
             # child process will be controlled by the current terminal
@@ -216,59 +168,37 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskha
             if umask:
                 os.umask(umask)
 
+            data.setVar("BB_WORKERCONTEXT", "1")
+            data.setVar("BB_TASKDEPDATA", taskdepdata)
+            data.setVar("BUILDNAME", workerdata["buildname"])
+            data.setVar("DATE", workerdata["date"])
+            data.setVar("TIME", workerdata["time"])
+            bb.parse.siggen.set_taskdata(workerdata["sigdata"])
+            ret = 0
             try:
-                bb_cache = bb.cache.NoCache(databuilder)
-                (realfn, virtual, mc) = bb.cache.virtualfn2realfn(fn)
-                the_data = databuilder.mcdata[mc]
-                the_data.setVar("BB_WORKERCONTEXT", "1")
-                the_data.setVar("BB_TASKDEPDATA", taskdepdata)
-                if cfg.limited_deps:
-                    the_data.setVar("BB_LIMITEDDEPS", "1")
-                the_data.setVar("BUILDNAME", workerdata["buildname"])
-                the_data.setVar("DATE", workerdata["date"])
-                the_data.setVar("TIME", workerdata["time"])
-                for varname, value in extraconfigdata.items():
-                    the_data.setVar(varname, value)
-
-                bb.parse.siggen.set_taskdata(workerdata["sigdata"])
-                ret = 0
-
-                the_data = bb_cache.loadDataFull(fn, appends)
-                the_data.setVar('BB_TASKHASH', taskhash)
-                the_data.setVar('BB_UNIHASH', unihash)
-
-                bb.utils.set_process_name("%s:%s" % (the_data.getVar("PN"), taskname.replace("do_", "")))
+                the_data = bb.cache.Cache.loadDataFull(fn, appends, data)
+                the_data.setVar('BB_TASKHASH', workerdata["runq_hash"][task])
 
                 # exported_vars() returns a generator which *cannot* be passed to os.environ.update() 
                 # successfully. We also need to unset anything from the environment which shouldn't be there 
                 exports = bb.data.exported_vars(the_data)
-
                 bb.utils.empty_environment()
                 for e, v in exports:
                     os.environ[e] = v
-
                 for e in fakeenv:
                     os.environ[e] = fakeenv[e]
                     the_data.setVar(e, fakeenv[e])
                     the_data.setVarFlag(e, 'export', "1")
 
-                task_exports = the_data.getVarFlag(taskname, 'exports')
-                if task_exports:
-                    for e in task_exports.split():
-                        the_data.setVarFlag(e, 'export', '1')
-                        v = the_data.getVar(e)
-                        if v is not None:
-                            os.environ[e] = v
-
                 if quieterrors:
                     the_data.setVarFlag(taskname, "quieterrors", "1")
 
-            except Exception:
+            except Exception as exc:
                 if not quieterrors:
-                    logger.critical(traceback.format_exc())
+                    logger.critical(str(exc))
                 os._exit(1)
             try:
-                if dry_run:
+                if cfg.dry_run:
                     return 0
                 return bb.build.exec_task(fn, taskname, the_data, cfg.profile)
             except:
@@ -285,7 +215,7 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskha
                 bb.utils.process_profilelog(profname)
                 os._exit(ret)
     else:
-        for key, value in iter(envbackup.items()):
+        for key, value in envbackup.iteritems():
             if value is None:
                 del os.environ[key]
             else:
@@ -302,22 +232,22 @@ class runQueueWorkerPipe():
         if pipeout:
             pipeout.close()
         bb.utils.nonblockingfd(self.input)
-        self.queue = b""
+        self.queue = ""
 
     def read(self):
         start = len(self.queue)
         try:
-            self.queue = self.queue + (self.input.read(102400) or b"")
+            self.queue = self.queue + self.input.read(102400)
         except (OSError, IOError) as e:
             if e.errno != errno.EAGAIN:
                 raise
 
         end = len(self.queue)
-        index = self.queue.find(b"</event>")
+        index = self.queue.find("</event>")
         while index != -1:
             worker_fire_prepickled(self.queue[:index+8])
             self.queue = self.queue[index+8:]
-            index = self.queue.find(b"</event>")
+            index = self.queue.find("</event>")
         return (end > start)
 
     def close(self):
@@ -333,27 +263,22 @@ class BitbakeWorker(object):
     def __init__(self, din):
         self.input = din
         bb.utils.nonblockingfd(self.input)
-        self.queue = b""
+        self.queue = ""
         self.cookercfg = None
         self.databuilder = None
         self.data = None
-        self.extraconfigdata = None
         self.build_pids = {}
         self.build_pipes = {}
     
         signal.signal(signal.SIGTERM, self.sigterm_exception)
         # Let SIGHUP exit as SIGTERM
         signal.signal(signal.SIGHUP, self.sigterm_exception)
-        if "beef" in sys.argv[1]:
-            bb.utils.set_process_name("Worker (Fakeroot)")
-        else:
-            bb.utils.set_process_name("Worker")
 
     def sigterm_exception(self, signum, stackframe):
         if signum == signal.SIGTERM:
-            bb.warn("Worker received SIGTERM, shutting down...")
+            bb.warn("Worker recieved SIGTERM, shutting down...")
         elif signum == signal.SIGHUP:
-            bb.warn("Worker received SIGHUP, shutting down...")
+            bb.warn("Worker recieved SIGHUP, shutting down...")
         self.handle_finishnow(None)
         signal.signal(signal.SIGTERM, signal.SIG_DFL)
         os.kill(os.getpid(), signal.SIGTERM)
@@ -361,39 +286,34 @@ class BitbakeWorker(object):
     def serve(self):        
         while True:
             (ready, _, _) = select.select([self.input] + [i.input for i in self.build_pipes.values()], [] , [], 1)
-            if self.input in ready:
+            if self.input in ready or len(self.queue):
+                start = len(self.queue)
                 try:
-                    r = self.input.read()
-                    if len(r) == 0:
-                        # EOF on pipe, server must have terminated
-                        self.sigterm_exception(signal.SIGTERM, None)
-                    self.queue = self.queue + r
+                    self.queue = self.queue + self.input.read()
                 except (OSError, IOError):
                     pass
-            if len(self.queue):
-                self.handle_item(b"cookerconfig", self.handle_cookercfg)
-                self.handle_item(b"extraconfigdata", self.handle_extraconfigdata)
-                self.handle_item(b"workerdata", self.handle_workerdata)
-                self.handle_item(b"runtask", self.handle_runtask)
-                self.handle_item(b"finishnow", self.handle_finishnow)
-                self.handle_item(b"ping", self.handle_ping)
-                self.handle_item(b"quit", self.handle_quit)
+                end = len(self.queue)
+                self.handle_item("cookerconfig", self.handle_cookercfg)
+                self.handle_item("workerdata", self.handle_workerdata)
+                self.handle_item("runtask", self.handle_runtask)
+                self.handle_item("finishnow", self.handle_finishnow)
+                self.handle_item("ping", self.handle_ping)
+                self.handle_item("quit", self.handle_quit)
 
             for pipe in self.build_pipes:
-                if self.build_pipes[pipe].input in ready:
-                    self.build_pipes[pipe].read()
+                self.build_pipes[pipe].read()
             if len(self.build_pids):
-                while self.process_waitpid():
-                    continue
+                self.process_waitpid()
+            worker_flush()
 
 
     def handle_item(self, item, func):
-        if self.queue.startswith(b"<" + item + b">"):
-            index = self.queue.find(b"</" + item + b">")
+        if self.queue.startswith("<" + item + ">"):
+            index = self.queue.find("</" + item + ">")
             while index != -1:
                 func(self.queue[(len(item) + 2):index])
                 self.queue = self.queue[(index + len(item) + 3):]
-                index = self.queue.find(b"</" + item + b">")
+                index = self.queue.find("</" + item + ">")
 
     def handle_cookercfg(self, data):
         self.cookercfg = pickle.loads(data)
@@ -401,22 +321,18 @@ class BitbakeWorker(object):
         self.databuilder.parseBaseConfiguration()
         self.data = self.databuilder.data
 
-    def handle_extraconfigdata(self, data):
-        self.extraconfigdata = pickle.loads(data)
-
     def handle_workerdata(self, data):
         self.workerdata = pickle.loads(data)
         bb.msg.loggerDefaultDebugLevel = self.workerdata["logdefaultdebug"]
         bb.msg.loggerDefaultVerbose = self.workerdata["logdefaultverbose"]
         bb.msg.loggerVerboseLogs = self.workerdata["logdefaultverboselogs"]
         bb.msg.loggerDefaultDomains = self.workerdata["logdefaultdomain"]
-        for mc in self.databuilder.mcdata:
-            self.databuilder.mcdata[mc].setVar("PRSERV_HOST", self.workerdata["prhost"])
+        self.data.setVar("PRSERV_HOST", self.workerdata["prhost"])
 
     def handle_ping(self, _):
         workerlog_write("Handling ping\n")
 
-        logger.warning("Pong from bitbake-worker!")
+        logger.warn("Pong from bitbake-worker!")
 
     def handle_quit(self, data):
         workerlog_write("Handling quit\n")
@@ -426,10 +342,10 @@ class BitbakeWorker(object):
         sys.exit(0)
 
     def handle_runtask(self, data):
-        fn, task, taskname, taskhash, unihash, quieterrors, appends, taskdepdata, dry_run_exec = pickle.loads(data)
+        fn, task, taskname, quieterrors, appends, taskdepdata = pickle.loads(data)
         workerlog_write("Handling runtask %s %s %s\n" % (task, fn, taskname))
 
-        pid, pipein, pipeout = fork_off_task(self.cookercfg, self.data, self.databuilder, self.workerdata, fn, task, taskname, taskhash, unihash, appends, taskdepdata, self.extraconfigdata, quieterrors, dry_run_exec)
+        pid, pipein, pipeout = fork_off_task(self.cookercfg, self.data, self.workerdata, fn, task, taskname, appends, taskdepdata, quieterrors)
 
         self.build_pids[pid] = task
         self.build_pipes[pid] = runQueueWorkerPipe(pipein, pipeout)
@@ -442,9 +358,9 @@ class BitbakeWorker(object):
         try:
             pid, status = os.waitpid(-1, os.WNOHANG)
             if pid == 0 or os.WIFSTOPPED(status):
-                return False
+                return None
         except OSError:
-            return False
+            return None
 
         workerlog_write("Exit code of %s for pid %s\n" % (status, pid))
 
@@ -461,14 +377,12 @@ class BitbakeWorker(object):
         self.build_pipes[pid].close()
         del self.build_pipes[pid]
 
-        worker_fire_prepickled(b"<exitcode>" + pickle.dumps((task, status)) + b"</exitcode>")
-
-        return True
+        worker_fire_prepickled("<exitcode>" + pickle.dumps((task, status)) + "</exitcode>")
 
     def handle_finishnow(self, _):
         if self.build_pids:
             logger.info("Sending SIGTERM to remaining %s tasks", len(self.build_pids))
-            for k, v in iter(self.build_pids.items()):
+            for k, v in self.build_pids.iteritems():
                 try:
                     os.kill(-k, signal.SIGTERM)
                     os.waitpid(-1, 0)
@@ -478,7 +392,7 @@ class BitbakeWorker(object):
             self.build_pipes[pipe].read()
 
 try:
-    worker = BitbakeWorker(os.fdopen(sys.stdin.fileno(), 'rb'))
+    worker = BitbakeWorker(sys.stdin)
     if not profiling:
         worker.serve()
     else:
@@ -494,9 +408,8 @@ except BaseException as e:
         import traceback
         sys.stderr.write(traceback.format_exc())
         sys.stderr.write(str(e))
-
-worker_thread_exit = True
-worker_thread.join()
-
+while len(worker_queue):
+    worker_flush()
 workerlog_write("exitting")
 sys.exit(0)
+

bitbake/bin/bitdoc

@@ -1,4 +1,4 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 # ex:ts=4:sw=4:sts=4:et
 # -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
 #
@@ -462,7 +462,7 @@ def main():
     state_group = 2
 
     for key in bb.data.keys(documentation):
-        data   = documentation.getVarFlag(key, "doc", False)
+        data   = documentation.getVarFlag(key, "doc")
         if not data:
             continue
 

bitbake/bin/git-make-shallow

@@ -1,165 +0,0 @@
-#!/usr/bin/env python3
-"""git-make-shallow: make the current git repository shallow
-
-Remove the history of the specified revisions, then optionally filter the
-available refs to those specified.
-"""
-
-import argparse
-import collections
-import errno
-import itertools
-import os
-import subprocess
-import sys
-
-version = 1.0
-
-
-def main():
-    if sys.version_info < (3, 4, 0):
-        sys.exit('Python 3.4 or greater is required')
-
-    git_dir = check_output(['git', 'rev-parse', '--git-dir']).rstrip()
-    shallow_file = os.path.join(git_dir, 'shallow')
-    if os.path.exists(shallow_file):
-        try:
-            check_output(['git', 'fetch', '--unshallow'])
-        except subprocess.CalledProcessError:
-            try:
-                os.unlink(shallow_file)
-            except OSError as exc:
-                if exc.errno != errno.ENOENT:
-                    raise
-
-    args = process_args()
-    revs = check_output(['git', 'rev-list'] + args.revisions).splitlines()
-
-    make_shallow(shallow_file, args.revisions, args.refs)
-
-    ref_revs = check_output(['git', 'rev-list'] + args.refs).splitlines()
-    remaining_history = set(revs) & set(ref_revs)
-    for rev in remaining_history:
-        if check_output(['git', 'rev-parse', '{}^@'.format(rev)]):
-            sys.exit('Error: %s was not made shallow' % rev)
-
-    filter_refs(args.refs)
-
-    if args.shrink:
-        shrink_repo(git_dir)
-        subprocess.check_call(['git', 'fsck', '--unreachable'])
-
-
-def process_args():
-    # TODO: add argument to automatically keep local-only refs, since they
-    # can't be easily restored with a git fetch.
-    parser = argparse.ArgumentParser(description='Remove the history of the specified revisions, then optionally filter the available refs to those specified.')
-    parser.add_argument('--ref', '-r', metavar='REF', action='append', dest='refs', help='remove all but the specified refs (cumulative)')
-    parser.add_argument('--shrink', '-s', action='store_true', help='shrink the git repository by repacking and pruning')
-    parser.add_argument('revisions', metavar='REVISION', nargs='+', help='a git revision/commit')
-    if len(sys.argv) < 2:
-        parser.print_help()
-        sys.exit(2)
-
-    args = parser.parse_args()
-
-    if args.refs:
-        args.refs = check_output(['git', 'rev-parse', '--symbolic-full-name'] + args.refs).splitlines()
-    else:
-        args.refs = get_all_refs(lambda r, t, tt: t == 'commit' or tt == 'commit')
-
-    args.refs = list(filter(lambda r: not r.endswith('/HEAD'), args.refs))
-    args.revisions = check_output(['git', 'rev-parse'] + ['%s^{}' % i for i in args.revisions]).splitlines()
-    return args
-
-
-def check_output(cmd, input=None):
-    return subprocess.check_output(cmd, universal_newlines=True, input=input)
-
-
-def make_shallow(shallow_file, revisions, refs):
-    """Remove the history of the specified revisions."""
-    for rev in follow_history_intersections(revisions, refs):
-        print("Processing %s" % rev)
-        with open(shallow_file, 'a') as f:
-            f.write(rev + '\n')
-
-
-def get_all_refs(ref_filter=None):
-    """Return all the existing refs in this repository, optionally filtering the refs."""
-    ref_output = check_output(['git', 'for-each-ref', '--format=%(refname)\t%(objecttype)\t%(*objecttype)'])
-    ref_split = [tuple(iter_extend(l.rsplit('\t'), 3)) for l in ref_output.splitlines()]
-    if ref_filter:
-        ref_split = (e for e in ref_split if ref_filter(*e))
-    refs = [r[0] for r in ref_split]
-    return refs
-
-
-def iter_extend(iterable, length, obj=None):
-    """Ensure that iterable is the specified length by extending with obj."""
-    return itertools.islice(itertools.chain(iterable, itertools.repeat(obj)), length)
-
-
-def filter_refs(refs):
-    """Remove all but the specified refs from the git repository."""
-    all_refs = get_all_refs()
-    to_remove = set(all_refs) - set(refs)
-    if to_remove:
-        check_output(['xargs', '-0', '-n', '1', 'git', 'update-ref', '-d', '--no-deref'],
-                     input=''.join(l + '\0' for l in to_remove))
-
-
-def follow_history_intersections(revisions, refs):
-    """Determine all the points where the history of the specified revisions intersects the specified refs."""
-    queue = collections.deque(revisions)
-    seen = set()
-
-    for rev in iter_except(queue.popleft, IndexError):
-        if rev in seen:
-            continue
-
-        parents = check_output(['git', 'rev-parse', '%s^@' % rev]).splitlines()
-
-        yield rev
-        seen.add(rev)
-
-        if not parents:
-            continue
-
-        check_refs = check_output(['git', 'merge-base', '--independent'] + sorted(refs)).splitlines()
-        for parent in parents:
-            for ref in check_refs:
-                print("Checking %s vs %s" % (parent, ref))
-                try:
-                    merge_base = check_output(['git', 'merge-base', parent, ref]).rstrip()
-                except subprocess.CalledProcessError:
-                    continue
-                else:
-                    queue.append(merge_base)
-
-
-def iter_except(func, exception, start=None):
-    """Yield a function repeatedly until it raises an exception."""
-    try:
-        if start is not None:
-            yield start()
-        while True:
-            yield func()
-    except exception:
-        pass
-
-
-def shrink_repo(git_dir):
-    """Shrink the newly shallow repository, removing the unreachable objects."""
-    subprocess.check_call(['git', 'reflog', 'expire', '--expire-unreachable=now', '--all'])
-    subprocess.check_call(['git', 'repack', '-ad'])
-    try:
-        os.unlink(os.path.join(git_dir, 'objects', 'info', 'alternates'))
-    except OSError as exc:
-        if exc.errno != errno.ENOENT:
-            raise
-    subprocess.check_call(['git', 'prune', '--expire', 'now'])
-
-
-if __name__ == '__main__':
-    main()

bitbake/bin/image-writer

@@ -0,0 +1,122 @@
+#!/usr/bin/env python
+
+# Copyright (c) 2012 Wind River Systems, Inc.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
+# See the GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+
+import os
+import sys
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname( \
+                                    os.path.abspath(__file__))), 'lib'))
+try:
+    import bb
+except RuntimeError as exc:
+    sys.exit(str(exc))
+
+import gtk
+import optparse
+import pygtk
+
+from bb.ui.crumbs.hobwidget import HobAltButton, HobButton
+from bb.ui.crumbs.hig.crumbsmessagedialog import CrumbsMessageDialog
+from bb.ui.crumbs.hig.deployimagedialog import DeployImageDialog
+from bb.ui.crumbs.hig.imageselectiondialog import ImageSelectionDialog
+
+# I put all the fs bitbake supported here. Need more test.
+DEPLOYABLE_IMAGE_TYPES = ["jffs2", "cramfs", "ext2", "ext3", "btrfs", "squashfs", "ubi", "vmdk"]
+Title = "USB Image Writer"
+
+class DeployWindow(gtk.Window):
+    def __init__(self, image_path=''):
+        super(DeployWindow, self).__init__()
+
+        if len(image_path) > 0:
+            valid = True
+            if not os.path.exists(image_path):
+                valid = False
+                lbl = "<b>Invalid image file path: %s.</b>\nPress <b>Select Image</b> to select an image." % image_path
+            else:
+                image_path = os.path.abspath(image_path)
+                extend_name = os.path.splitext(image_path)[1][1:]
+                if extend_name not in DEPLOYABLE_IMAGE_TYPES:
+                    valid = False
+                    lbl = "<b>Undeployable imge type: %s</b>\nPress <b>Select Image</b> to select an image." % extend_name
+
+            if not valid:
+                image_path = ''
+                crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
+                button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
+                HobButton.style_button(button)
+                crumbs_dialog.run()
+                crumbs_dialog.destroy()
+
+        self.deploy_dialog = DeployImageDialog(Title, image_path, self,
+                                        gtk.DIALOG_MODAL | gtk.DIALOG_DESTROY_WITH_PARENT
+                                        | gtk.DIALOG_NO_SEPARATOR, None, standalone=True)
+        close_button = self.deploy_dialog.add_button("Close", gtk.RESPONSE_NO)
+        HobAltButton.style_button(close_button)
+        close_button.connect('clicked', gtk.main_quit)
+
+        write_button = self.deploy_dialog.add_button("Write USB image", gtk.RESPONSE_YES)
+        HobAltButton.style_button(write_button)
+
+        self.deploy_dialog.connect('select_image_clicked', self.select_image_clicked_cb)
+        self.deploy_dialog.connect('destroy', gtk.main_quit)
+        response = self.deploy_dialog.show()
+
+    def select_image_clicked_cb(self, dialog):
+        cwd = os.getcwd()
+        dialog = ImageSelectionDialog(cwd, DEPLOYABLE_IMAGE_TYPES, Title, self, gtk.FILE_CHOOSER_ACTION_SAVE )
+        button = dialog.add_button("Cancel", gtk.RESPONSE_NO)
+        HobAltButton.style_button(button)
+        button = dialog.add_button("Open", gtk.RESPONSE_YES)
+        HobAltButton.style_button(button)
+        response = dialog.run()
+
+        if response == gtk.RESPONSE_YES:
+            if not dialog.image_names:
+                lbl = "<b>No selections made</b>\nClicked the radio button to select a image."
+                crumbs_dialog = CrumbsMessageDialog(self, lbl, gtk.STOCK_DIALOG_INFO)
+                button = crumbs_dialog.add_button("Close", gtk.RESPONSE_OK)
+                HobButton.style_button(button)
+                crumbs_dialog.run()
+                crumbs_dialog.destroy()
+                dialog.destroy()
+                return
+
+            # get the full path of image
+            image_path = os.path.join(dialog.image_folder, dialog.image_names[0])
+            self.deploy_dialog.set_image_text_buffer(image_path)
+            self.deploy_dialog.set_image_path(image_path)
+
+        dialog.destroy()
+
+def main():
+    parser = optparse.OptionParser(
+                usage = """%prog [-h] [image_file]
+
+%prog writes bootable images to USB devices. You can
+provide the image file on the command line or select it using the GUI.""")
+
+    options, args = parser.parse_args(sys.argv)
+    image_file = args[1] if len(args) > 1 else ''
+    dw = DeployWindow(image_file)
+
+if __name__ == '__main__':
+    try:
+        main()
+        gtk.main()
+    except Exception:
+        import traceback
+        traceback.print_exc(3)

bitbake/bin/toaster

@@ -1,8 +1,5 @@
-#!/bin/echo ERROR: This script needs to be sourced. Please run as .
-
-# toaster - shell script to start Toaster
-
-# Copyright (C) 2013-2015 Intel Corp.
+#!/bin/bash
+# (c) 2013 Intel Corp.
 
 # This program is free software; you can redistribute it and/or modify
 # it under the terms of the GNU General Public License as published by
@@ -15,307 +12,256 @@
 # GNU General Public License for more details.
 #
 # You should have received a copy of the GNU General Public License
-# along with this program. If not, see http://www.gnu.org/licenses/.
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
 
-HELP="
-Usage: source toaster start|stop [webport=<address:port>] [noweb] [nobuild] [toasterdir]
-    Optional arguments:
-        [nobuild] Setup the environment for capturing builds with toaster but disable managed builds
-        [noweb] Setup the environment for capturing builds with toaster but don't start the web server
-        [webport] Set the development server (default: localhost:8000)
-        [toasterdir] Set absolute path to be used as TOASTER_DIR (default: BUILDDIR/../)
-"
 
-custom_extention()
+# This script can be run in two modes.
+
+# When used with "source", from a build directory,
+# it enables toaster event logging and starts the bitbake resident server.
+# use as:  source toaster [start|stop] [noweb] [noui]
+
+# When it is called as a stand-alone script, it starts just the
+# web server, and the building shall be done through the web interface.
+# As script, it will not return to the command prompt. Stop with Ctrl-C.
+
+# Helper function to kill a background toaster development server
+
+function webserverKillAll()
 {
-    custom_extension=$BBBASEDIR/lib/toaster/orm/fixtures/custom_toaster_append.sh
-    if [ -f $custom_extension ] ; then
-        $custom_extension $*
-    fi
+	local pidfile
+	for pidfile in ${BUILDDIR}/.toastermain.pid; do
+		if [ -f ${pidfile} ]; then
+		while kill -0 $(< ${pidfile}) 2>/dev/null; do
+			kill -SIGTERM -$(< ${pidfile}) 2>/dev/null
+			sleep 1;
+			# Kill processes if they are still running - may happen in interactive shells
+			ps fux | grep "python.*manage.py" | awk '{print $2}' | xargs kill
+		done;
+		rm  ${pidfile}
+		fi
+	done
 }
 
-databaseCheck()
+function webserverStartAll()
 {
-    retval=0
-    # you can always add a superuser later via
-    # ../bitbake/lib/toaster/manage.py createsuperuser --username=<ME>
-    $MANAGE migrate --noinput || retval=1
-
-    if [ $retval -eq 1 ]; then
-        echo "Failed migrations, aborting system start" 1>&2
-        return $retval
-    fi
-    # Make sure that checksettings can pick up any value for TEMPLATECONF
-    export TEMPLATECONF
-    $MANAGE checksettings --traceback || retval=1
-
-    if [ $retval -eq 1 ]; then
-        printf "\nError while checking settings; aborting\n"
-        return $retval
-    fi
-
-    return $retval
-}
-
-webserverKillAll()
-{
-    local pidfile
-    if [ -f ${BUILDDIR}/.toastermain.pid ] ; then
-        custom_extention web_stop_postpend
-    else
-        custom_extention noweb_stop_postpend
-    fi
-    for pidfile in ${BUILDDIR}/.toastermain.pid ${BUILDDIR}/.runbuilds.pid; do
-        if [ -f ${pidfile} ]; then
-            pid=`cat ${pidfile}`
-            while kill -0 $pid 2>/dev/null; do
-                kill -SIGTERM $pid 2>/dev/null
-                sleep 1
-            done
-            rm  ${pidfile}
+	# do not start if toastermain points to a valid process
+	if ! cat "${BUILDDIR}/.toastermain.pid" 2>/dev/null | xargs -I{} kill -0 {} ; then
+            retval=1
+            rm "${BUILDDIR}/.toastermain.pid"
         fi
-    done
+
+        retval=0
+        python $BBBASEDIR/lib/toaster/manage.py syncdb || retval=1
+        python $BBBASEDIR/lib/toaster/manage.py migrate orm || retval=2
+        if [ $retval -eq 1 ]; then
+                echo "Failed db sync, stopping system start" 1>&2
+        elif [ $retval -eq 2 ]; then
+            echo -e "\nError on migration, trying to recover... \n"
+            python $BBBASEDIR/lib/toaster/manage.py migrate orm 0001_initial --fake
+            retval=0
+            python $BBBASEDIR/lib/toaster/manage.py migrate orm || retval=1
+        fi
+	if [ "x$TOASTER_MANAGED" == "x1" ]; then
+	        python $BBBASEDIR/lib/toaster/manage.py migrate bldcontrol || retval=1
+		python $BBBASEDIR/lib/toaster/manage.py checksettings  --traceback || retval=1
+	fi
+        if [ $retval -eq 0 ]; then
+	    echo "Starting webserver"
+            python $BBBASEDIR/lib/toaster/manage.py runserver 0.0.0.0:8000 </dev/null >${BUILDDIR}/toaster_web.log 2>&1 & echo $! >${BUILDDIR}/.toastermain.pid
+            sleep 1
+            if ! cat "${BUILDDIR}/.toastermain.pid" | xargs -I{} kill -0 {} ; then
+                retval=1
+                rm "${BUILDDIR}/.toastermain.pid"
+            fi
+        fi
+        return $retval
 }
 
-webserverStartAll()
+# Helper functions to add a special configuration file
+
+function addtoConfiguration()
 {
-    # do not start if toastermain points to a valid process
-    if ! cat "${BUILDDIR}/.toastermain.pid" 2>/dev/null | xargs -I{} kill -0 {} ; then
-        retval=1
-        rm "${BUILDDIR}/.toastermain.pid"
-    fi
-
-    retval=0
-
-    # check the database
-    databaseCheck || return 1
-
-    echo "Starting webserver..."
-
-    $MANAGE runserver --noreload "$ADDR_PORT" \
-           </dev/null >>${BUILDDIR}/toaster_web.log 2>&1 \
-           & echo $! >${BUILDDIR}/.toastermain.pid
-
-    sleep 1
-
-    if ! cat "${BUILDDIR}/.toastermain.pid" | xargs -I{} kill -0 {} ; then
-        retval=1
-        rm "${BUILDDIR}/.toastermain.pid"
-    else
-        echo "Toaster development webserver started at http://$ADDR_PORT"
-        echo -e "\nYou can now run 'bitbake <target>' on the command line and monitor your build in Toaster.\nYou can also use a Toaster project to configure and run a build.\n"
-        custom_extention web_start_postpend $ADDR_PORT
-    fi
-
-    return $retval
+        echo "#Created by toaster start script" > ${BUILDDIR}/conf/$2
+        echo $1 >> ${BUILDDIR}/conf/$2
 }
 
 INSTOPSYSTEM=0
 
 # define the stop command
-stop_system()
+function stop_system()
 {
     # prevent reentry
-    if [ $INSTOPSYSTEM -eq 1 ]; then return; fi
+    if [ $INSTOPSYSTEM == 1 ]; then return; fi
     INSTOPSYSTEM=1
+    if [ -f ${BUILDDIR}/.toasterui.pid ]; then
+        kill $(< ${BUILDDIR}/.toasterui.pid ) 2>/dev/null
+        rm ${BUILDDIR}/.toasterui.pid
+    fi
+    BBSERVER=0.0.0.0:8200 bitbake -m
+    unset BBSERVER
     webserverKillAll
-    # unset exported variables
-    unset TOASTER_DIR
-    unset BITBAKE_UI
-    unset BBBASEDIR
+    # force stop any misbehaving bitbake server
+    lsof bitbake.lock | awk '{print $2}' | grep "[0-9]\+" | xargs -n1 -r kill
     trap - SIGHUP
     #trap - SIGCHLD
     INSTOPSYSTEM=0
 }
 
-verify_prereq() {
-    # Verify Django version
-    reqfile=$(python3 -c "import os; print(os.path.realpath('$BBBASEDIR/toaster-requirements.txt'))")
-    exp='s/Django\([><=]\+\)\([^,]\+\),\([><=]\+\)\(.\+\)/'
-    # expand version parts to 2 digits to support 1.10.x > 1.8
-    # (note:helper functions hard to insert in-line)
-    exp=$exp'import sys,django;'
-    exp=$exp'version=["%02d" % int(n) for n in django.get_version().split(".")];'
-    exp=$exp'vmin=["%02d" % int(n) for n in "\2".split(".")];'
-    exp=$exp'vmax=["%02d" % int(n) for n in "\4".split(".")];'
-    exp=$exp'sys.exit(not (version \1 vmin and version \3 vmax))'
-    exp=$exp'/p'
-    if ! sed -n "$exp" $reqfile | python3 - ; then
-        req=`grep ^Django $reqfile`
-        echo "This program needs $req"
-        echo "Please install with pip3 install -r $reqfile"
-        return 2
-    fi
-
-    return 0
+function check_pidbyfile() {
+    [ -e $1 ] && kill -0 $(< $1) 2>/dev/null
 }
 
-# read command line parameters
-if [ -n "$BASH_SOURCE" ] ; then
-    TOASTER=${BASH_SOURCE}
-elif [ -n "$ZSH_NAME" ] ; then
-    TOASTER=${(%):-%x}
-else
-    TOASTER=$0
-fi
 
-export BBBASEDIR=`dirname $TOASTER`/..
-MANAGE="python3 $BBBASEDIR/lib/toaster/manage.py"
-if [ -z "$OE_ROOT" ]; then
-    OE_ROOT=`dirname $TOASTER`/../..
-fi
-
-# this is the configuraton file we are using for toaster
-# we are using the same logic that oe-setup-builddir uses
-# (based on TEMPLATECONF and .templateconf) to determine
-# which toasterconf.json to use.
-# note: There are a number of relative path assumptions
-# in the local layers that currently make using an arbitrary
-# toasterconf.json difficult.
-
-. $OE_ROOT/.templateconf
-if [ -n "$TEMPLATECONF" ]; then
-    if [ ! -d "$TEMPLATECONF" ]; then
-        # Allow TEMPLATECONF=meta-xyz/conf as a shortcut
-        if [ -d "$OE_ROOT/$TEMPLATECONF" ]; then
-            TEMPLATECONF="$OE_ROOT/$TEMPLATECONF"
-        fi
+function notify_chldexit() {
+    if [ $NOTOASTERUI == 0 ]; then
+        check_pidbyfile ${BUILDDIR}/.toasterui.pid && return
+        stop_system
     fi
+}
+
+
+BBBASEDIR=`dirname ${BASH_SOURCE}`/..
+RUNNING=0
+
+if [ -z "$ZSH_NAME" ] && [ `basename \"$0\"` = `basename \"$BASH_SOURCE\"` ]; then
+    # We are called as standalone. We refuse to run in a build environment - we need the interactive mode for that.
+    # Start just the web server, point the web browser to the interface, and start any Django services.
+
+    if [ -n "$BUILDDIR" ]; then
+        echo -e "Error: build/ directory detected. Toaster will not start in managed mode if a build environment is detected.\nUse a clean terminal to start Toaster." 1>&2;
+        exit 1;
+    fi
+
+    # Define a fake builddir where only the pid files are actually created. No real builds will take place here.
+    BUILDDIR=/tmp
+    RUNNING=1
+    function trap_ctrlc() {
+        echo "** Stopping system"
+        webserverKillAll
+        RUNNING=0
+    }
+    TOASTER_MANAGED=1
+    export TOASTER_MANAGED=1
+    if ! webserverStartAll; then
+        echo "Failed to start the web server, stopping" 1>&2;
+        exit 1;
+    fi
+    xdg-open http://0.0.0.0:8000/ >/dev/null 2>&1 &
+    trap trap_ctrlc SIGINT
+    echo "Running. Stop with Ctrl-C"
+    while [ $RUNNING -gt 0 ]; do
+	python $BBBASEDIR/lib/toaster/manage.py runbuilds
+	sleep 1
+    done
+    echo "**** Exit"
+    exit 0
 fi
 
-unset OE_ROOT
-
-
-WEBSERVER=1
-export TOASTER_BUILDSERVER=1
-ADDR_PORT="localhost:8000"
-TOASTERDIR=`dirname $BUILDDIR`
-unset CMD
-for param in $*; do
-    case $param in
-    noweb )
-            WEBSERVER=0
-    ;;
-    nobuild )
-            TOASTER_BUILDSERVER=0
-    ;;
-    start )
-            CMD=$param
-    ;;
-    stop )
-            CMD=$param
-    ;;
-    webport=*)
-            ADDR_PORT="${param#*=}"
-            # Split the addr:port string
-            ADDR=`echo $ADDR_PORT | cut -f 1 -d ':'`
-            PORT=`echo $ADDR_PORT | cut -f 2 -d ':'`
-            # If only a port has been speified then set address to localhost.
-            if [ $ADDR = $PORT ] ; then
-                ADDR_PORT="localhost:$PORT"
-            fi
-    ;;
-    toasterdir=*)
-            TOASTERDIR="${param#*=}"
-    ;;
-    --help)
-            echo "$HELP"
-            return 0
-    ;;
-    *)
-            echo "$HELP"
-            return 1
-    ;;
-
-    esac
-done
-
-if [ `basename \"$0\"` = `basename \"${TOASTER}\"` ]; then
-    echo "Error: This script needs to be sourced. Please run as . $TOASTER"
-    return 1
-fi
-
-verify_prereq || return 1
-
 # We make sure we're running in the current shell and in a good environment
-if [ -z "$BUILDDIR" ] ||  ! which bitbake >/dev/null 2>&1 ; then
-    echo "Error: Build environment is not setup or bitbake is not in path." 1>&2
+if [ -z "$BUILDDIR" ] || [ -z `which bitbake` ]; then
+    echo "Error: Build environment is not setup or bitbake is not in path." 1>&2;
     return 2
 fi
 
-# this defines the dir toaster will use for
-# 1) clones of layers (in _toaster_clones )
-# 2) the build dir (in build)
-# 3) the sqlite db if that is being used.
-# 4) pid's we need to clean up on exit/shutdown
-export TOASTER_DIR=$TOASTERDIR
-export BB_ENV_EXTRAWHITE="$BB_ENV_EXTRAWHITE TOASTER_DIR"
+
+
+# Verify prerequisites
+
+if ! echo "import django; print (1,) == django.VERSION[0:1] and django.VERSION[1:2][0] in (5,6)" | python 2>/dev/null | grep True >/dev/null; then
+    echo -e "This program needs Django 1.5 or 1.6. Please install with\n\npip install django==1.6"
+    return 2
+fi
+
+if ! echo "import south; print [0,8,4] ==  map(int,south.__version__.split(\".\"))" | python 2>/dev/null | grep True >/dev/null; then
+    echo -e "This program needs South 0.8.4. Please install with\n\npip install south==0.8.4"
+    return 2
+fi
+
+
+
+
 
 # Determine the action. If specified by arguments, fine, if not, toggle it
-if [ "$CMD" = "start" ] ; then
-    if [ -n "$BBSERVER" ]; then
-	echo " Toaster is already running. Exiting..."
-	return 1
-fi
-elif [ "$CMD" = "" ]; then
-    echo "No command specified"
-    echo "$HELP"
-    return 1
+if [ "x$1" == "xstart" ] || [ "x$1" == "xstop" ]; then
+    CMD="$1"
+else
+    if [ -z "$BBSERVER" ]; then
+        CMD="start"
+    else
+        CMD="stop"
+    fi;
 fi
 
+NOTOASTERUI=0
+WEBSERVER=1
+for param in $*; do
+    case $param in
+    noui )
+            NOTOASTERUI=1
+    ;;
+    noweb )
+            WEBSERVER=0
+    ;;
+    esac
+done
+
 echo "The system will $CMD."
 
+# Make sure it's safe to run by checking bitbake lock
+
+lock=1
+if [ -e $BUILDDIR/bitbake.lock ]; then
+    (flock -n 200 ) 200<$BUILDDIR/bitbake.lock || lock=0
+fi
+
+if [ ${CMD} == "start" ] && ( [ $lock -eq 0 ] || [ -e $BUILDDIR/.toastermain.pid ] ); then
+    echo "Error: bitbake lock state error. File locks show that the system is on." 2>&1
+    echo "If you see problems, stop and then start the system again." 2>&1
+    return 3
+fi
+
+
 # Execute the commands
-custom_extention toaster_prepend $CMD $ADDR_PORT
 
 case $CMD in
     start )
-        # check if addr:port is not in use
-        if [ "$CMD" == 'start' ]; then
-            if [ $WEBSERVER -gt 0 ]; then
-                $MANAGE checksocket "$ADDR_PORT" || return 1
-            fi
-        fi
-
-        # Create configuration file
-        conf=${BUILDDIR}/conf/local.conf
-        line='INHERIT+="toaster buildhistory"'
-        grep -q "$line" $conf || echo $line >> $conf
-
-        if [ $WEBSERVER -eq 0 ] ; then
-            # Do not update the database for "noweb" unless
-            # it does not yet exist
-            if [ ! -f "$TOASTER_DIR/toaster.sqlite" ] ; then
-                if ! databaseCheck; then
-                    echo "Failed ${CMD}."
-                    return 4
-                fi
-            fi
-            custom_extention noweb_start_postpend $ADDR_PORT
-        fi
+        start_success=1
+        addtoConfiguration "INHERIT+=\"toaster buildhistory\"" toaster.conf
         if [ $WEBSERVER -gt 0 ] && ! webserverStartAll; then
             echo "Failed ${CMD}."
             return 4
         fi
-        export BITBAKE_UI='toasterui'
-        if [ $TOASTER_BUILDSERVER -eq 1 ] ; then
-            $MANAGE runbuilds \
-               </dev/null >>${BUILDDIR}/toaster_runbuilds.log 2>&1 \
-               & echo $! >${BUILDDIR}/.runbuilds.pid
+        unset BBSERVER
+        bitbake --postread conf/toaster.conf --server-only -t xmlrpc -B 0.0.0.0:8200
+        if [ $? -ne 0 ]; then
+            start_success=0
+            echo "Bitbake server start failed"
         else
-            echo "Toaster build server not started."
+            export BBSERVER=0.0.0.0:8200
+            if [ $NOTOASTERUI == 0 ]; then        # we start the TOASTERUI only if not inhibited
+                bitbake --observe-only -u toasterui >${BUILDDIR}/toaster_ui.log 2>&1 & echo $! >${BUILDDIR}/.toasterui.pid
+            fi
         fi
-
-        # set fail safe stop system on terminal exit
+        if [ $start_success -eq 1 ]; then
+            # set fail safe stop system on terminal exit
+            trap stop_system SIGHUP
+            echo "Successful ${CMD}."
+        else
+            # failed start, do stop
+            stop_system
+            echo "Failed ${CMD}."
+        fi
+        # stop system on terminal exit
+        set -o monitor
         trap stop_system SIGHUP
-        echo "Successful ${CMD}."
-        custom_extention toaster_postpend $CMD $ADDR_PORT
-        return 0
+        #trap notify_chldexit SIGCHLD
     ;;
     stop )
         stop_system
         echo "Successful ${CMD}."
     ;;
 esac
-custom_extention toaster_postpend $CMD $ADDR_PORT
+
 

bitbake/bin/toaster-eventreplay

@@ -1,126 +0,0 @@
-#!/usr/bin/env python3
-# ex:ts=4:sw=4:sts=4:et
-# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
-#
-# Copyright (C) 2014        Alex Damian
-#
-# This file re-uses code spread throughout other Bitbake source files.
-# As such, all other copyrights belong to their own right holders.
-#
-#
-# This program is free software; you can redistribute it and/or modify
-# it under the terms of the GNU General Public License version 2 as
-# published by the Free Software Foundation.
-#
-# This program is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-# GNU General Public License for more details.
-#
-# You should have received a copy of the GNU General Public License along
-# with this program; if not, write to the Free Software Foundation, Inc.,
-# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
-"""
-This command takes a filename as a single parameter. The filename is read
-as a build eventlog, and the ToasterUI is used to process events in the file
-and log data in the database
-"""
-
-import os
-import sys
-import json
-import pickle
-import codecs
-
-from collections import namedtuple
-
-# mangle syspath to allow easy import of modules
-from os.path import join, dirname, abspath
-sys.path.insert(0, join(dirname(dirname(abspath(__file__))), 'lib'))
-
-import bb.cooker
-from bb.ui import toasterui
-
-class EventPlayer:
-    """Emulate a connection to a bitbake server."""
-
-    def __init__(self, eventfile, variables):
-        self.eventfile = eventfile
-        self.variables = variables
-        self.eventmask = []
-
-    def waitEvent(self, _timeout):
-        """Read event from the file."""
-        line = self.eventfile.readline().strip()
-        if not line:
-            return
-        try:
-            event_str = json.loads(line)['vars'].encode('utf-8')
-            event = pickle.loads(codecs.decode(event_str, 'base64'))
-            event_name = "%s.%s" % (event.__module__, event.__class__.__name__)
-            if event_name not in self.eventmask:
-                return
-            return event
-        except ValueError as err:
-            print("Failed loading ", line)
-            raise err
-
-    def runCommand(self, command_line):
-        """Emulate running a command on the server."""
-        name = command_line[0]
-
-        if name == "getVariable":
-            var_name = command_line[1]
-            variable = self.variables.get(var_name)
-            if variable:
-                return variable['v'], None
-            return None, "Missing variable %s" % var_name
-
-        elif name == "getAllKeysWithFlags":
-            dump = {}
-            flaglist = command_line[1]
-            for key, val in self.variables.items():
-                try:
-                    if not key.startswith("__"):
-                        dump[key] = {
-                            'v': val['v'],
-                            'history' : val['history'],
-                        }
-                        for flag in flaglist:
-                            dump[key][flag] = val[flag]
-                except Exception as err:
-                    print(err)
-            return (dump, None)
-
-        elif name == 'setEventMask':
-            self.eventmask = command_line[-1]
-            return True, None
-
-        else:
-            raise Exception("Command %s not implemented" % command_line[0])
-
-    def getEventHandle(self):
-        """
-        This method is called by toasterui.
-        The return value is passed to self.runCommand but not used there.
-        """
-        pass
-
-def main(argv):
-    with open(argv[-1]) as eventfile:
-        # load variables from the first line
-        variables = json.loads(eventfile.readline().strip())['allvariables']
-
-        params = namedtuple('ConfigParams', ['observe_only'])(True)
-        player = EventPlayer(eventfile, variables)
-
-        return toasterui.main(player, player, params)
-
-# run toaster ui on our mock bitbake class
-if __name__ == "__main__":
-    if len(sys.argv) != 2:
-        print("Usage: %s <event file>" % os.path.basename(sys.argv[0]))
-        sys.exit(1)
-
-    sys.exit(main(sys.argv))

bitbake/contrib/dump_cache.py

@@ -1,8 +1,8 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 # ex:ts=4:sw=4:sts=4:et
 # -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
 #
-# Copyright (C) 2012, 2018 Wind River Systems, Inc.
+# Copyright (C) 2012 Wind River Systems, Inc.
 #
 # This program is free software; you can redistribute it and/or modify
 # it under the terms of the GNU General Public License version 2 as
@@ -18,68 +18,51 @@
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
 #
-# Used for dumping the bb_cache.dat
+# This is used for dumping the bb_cache.dat, the output format is:
+# recipe_path PN PV PACKAGES
 #
 import os
 import sys
-import argparse
+import warnings
 
 # For importing bb.cache
 sys.path.insert(0, os.path.join(os.path.abspath(os.path.dirname(sys.argv[0])), '../lib'))
 from bb.cache import CoreRecipeInfo
 
-import pickle
+import cPickle as pickle
 
-class DumpCache(object):
-    def __init__(self):
-        parser = argparse.ArgumentParser(
-            description="bb_cache.dat's dumper",
-            epilog="Use %(prog)s --help to get help")
-        parser.add_argument("-r", "--recipe",
-            help="specify the recipe, default: all recipes", action="store")
-        parser.add_argument("-m", "--members",
-            help = "specify the member, use comma as separator for multiple ones, default: all members", action="store", default="")
-        parser.add_argument("-s", "--skip",
-            help = "skip skipped recipes", action="store_true")
-        parser.add_argument("cachefile",
-            help = "specify bb_cache.dat", nargs = 1, action="store", default="")
+def main(argv=None):
+    """
+    Get the mapping for the target recipe.
+    """
+    if len(argv) != 1:
+        print >>sys.stderr, "Error, need one argument!"
+        return 2
 
-        self.args = parser.parse_args()
+    cachefile = argv[0]
 
-    def main(self):
-        with open(self.args.cachefile[0], "rb") as cachefile:
-            pickled = pickle.Unpickler(cachefile)
-            while True:
-                try:
-                    key = pickled.load()
-                    val = pickled.load()
-                except Exception:
-                    break
-                if isinstance(val, CoreRecipeInfo):
-                    pn = val.pn
+    with open(cachefile, "rb") as cachefile:
+        pickled = pickle.Unpickler(cachefile)
+        while cachefile:
+            try:
+                key = pickled.load()
+                val = pickled.load()
+            except Exception:
+                break
+            if isinstance(val, CoreRecipeInfo) and (not val.skipped):
+                pn = val.pn
+                # Filter out the native recipes.
+                if key.startswith('virtual:native:') or pn.endswith("-native"):
+                    continue
 
-                    if self.args.recipe and self.args.recipe != pn:
-                        continue
+                # 1.0 is the default version for a no PV recipe.
+                if val.__dict__.has_key("pv"):
+                    pv = val.pv
+                else:
+                    pv = "1.0"
 
-                    if self.args.skip and val.skipped:
-                        continue
-
-                    if self.args.members:
-                        out = key
-                        for member in self.args.members.split(','):
-                            out += ": %s" % val.__dict__.get(member)
-                        print("%s" % out)
-                    else:
-                        print("%s: %s" % (key, val.__dict__))
-                elif not self.args.recipe:
-                    print("%s %s" % (key, val))
+                print("%s %s %s %s" % (key, pn, pv, ' '.join(val.packages)))
 
 if __name__ == "__main__":
-    try:
-        dump = DumpCache()
-        ret = dump.main()
-    except Exception as esc:
-        ret = 1
-        import traceback
-        traceback.print_exc()
-    sys.exit(ret)
+    sys.exit(main(sys.argv[1:]))
+

bitbake/doc/Makefile

@@ -11,7 +11,7 @@
 #    validate: validates
 #    clean:    removes files
 #
-# The Makefile generates an HTML version of every document.  The
+# The Makefile generates an HTML and PDF version of every document.  The
 # variable DOC indicates the folder name for a given manual.
 #
 # To build a manual, you must invoke 'make' with the DOC argument.
@@ -21,8 +21,8 @@
 #     make DOC=bitbake-user-manual
 #     make pdf DOC=bitbake-user-manual
 #
-# The first example generates the HTML version of the User Manual.
-# The second example generates the PDF version of the User Manual.
+# The first example generates the HTML and PDF versions of the User Manual.
+# The second example generates the HTML version only of the User Manual.
 #
 
 ifeq ($(DOC),bitbake-user-manual)
@@ -31,9 +31,9 @@ XSLTOPTS = --stringparam html.stylesheet bitbake-user-manual-style.css \
            --stringparam  section.autolabel 1 \
            --stringparam  section.label.includes.component.label 1 \
            --xinclude
-ALLPREQ = html tarball
-TARFILES = bitbake-user-manual-style.css bitbake-user-manual.html figures/bitbake-title.png
-MANUALS = $(DOC)/$(DOC).html
+ALLPREQ = html pdf tarball
+TARFILES = bitbake-user-manual-style.css bitbake-user-manual.html bitbake-user-manual.pdf figures/bitbake-title.png
+MANUALS = $(DOC)/$(DOC).html $(DOC)/$(DOC).pdf
 FIGURES = figures
 STYLESHEET = $(DOC)/*.css
 

bitbake/doc/bitbake-user-manual/bitbake-user-manual-customization.xsl

@@ -1,15 +1,7 @@
 <?xml version='1.0'?>
 <xsl:stylesheet xmlns:xsl="http://www.w3.org/1999/XSL/Transform" xmlns="http://www.w3.org/1999/xhtml" xmlns:fo="http://www.w3.org/1999/XSL/Format" version="1.0">
 
-  <xsl:import href="http://downloads.yoctoproject.org/mirror/docbook-mirror/docbook-xsl-1.76.1/xhtml/docbook.xsl" />
-
-<!--
-
-  <xsl:import href="../template/1.76.1/docbook-xsl-1.76.1/xhtml/docbook.xsl" />
-
-  <xsl:import href="http://docbook.sourceforge.net/release/xsl/1.76.1/xhtml/docbook.xsl" />
-
--->
+  <xsl:import href="http://docbook.sourceforge.net/release/xsl/current/xhtml/docbook.xsl" />
 
   <xsl:include href="../template/permalinks.xsl"/>
   <xsl:include href="../template/section.title.xsl"/>

bitbake/doc/bitbake-user-manual/bitbake-user-manual-execution.xml

@@ -21,7 +21,7 @@
         The execution process is launched using the following command
         form:
         <literallayout class='monospaced'>
-     $ bitbake <replaceable>target</replaceable>
+     $ bitbake &lt;target&gt;
         </literallayout>
         For information on the BitBake command and its options,
         see
@@ -31,22 +31,20 @@
             <para>
                 Prior to executing BitBake, you should take advantage of available
                 parallel thread execution on your build host by setting the
-                <link linkend='var-bb-BB_NUMBER_THREADS'><filename>BB_NUMBER_THREADS</filename></link>
+                <link linkend='var-BB_NUMBER_THREADS'><filename>BB_NUMBER_THREADS</filename></link>
                 variable in your project's <filename>local.conf</filename>
                 configuration file.
             </para>
 
             <para>
-                A common method to determine this value for your build host is to run
-                the following:
+                A common way to determine this value for your build host is to run:
                 <literallayout class='monospaced'>
      $ grep processor /proc/cpuinfo
                 </literallayout>
-                This command returns the number of processors, which takes into
-                account hyper-threading.
-                Thus, a quad-core build host with hyper-threading most likely
-                shows eight processors, which is the value you would then assign to
-                <filename>BB_NUMBER_THREADS</filename>.
+                and count the number of processors displayed. Note that the number of
+                processors will take into account hyper-threading, so that a quad-core
+                build host with hyper-threading will most likely show eight processors,
+                which is the value you would then assign to that variable.
             </para>
 
             <para>
@@ -87,9 +85,9 @@
         <para>
             The <filename>layer.conf</filename> files are used to
             construct key variables such as
-            <link linkend='var-bb-BBPATH'><filename>BBPATH</filename></link>
+            <link linkend='var-BBPATH'><filename>BBPATH</filename></link>
             and
-            <link linkend='var-bb-BBFILES'><filename>BBFILES</filename></link>.
+            <link linkend='var-BBFILES'><filename>BBFILES</filename></link>.
             <filename>BBPATH</filename> is used to search for
             configuration and class files under the
             <filename>conf</filename> and <filename>classes</filename>
@@ -116,35 +114,16 @@
             Prior to parsing configuration files, Bitbake looks
             at certain variables, including:
             <itemizedlist>
+                <listitem><para><link linkend='var-BB_ENV_WHITELIST'><filename>BB_ENV_WHITELIST</filename></link></para></listitem>
+                <listitem><para><link linkend='var-BB_PRESERVE_ENV'><filename>BB_PRESERVE_ENV</filename></link></para></listitem>
+                <listitem><para><link linkend='var-BB_ENV_EXTRAWHITE'><filename>BB_ENV_EXTRAWHITE</filename></link></para></listitem>
                 <listitem><para>
-                    <link linkend='var-bb-BB_ENV_WHITELIST'><filename>BB_ENV_WHITELIST</filename></link>
-                    </para></listitem>
-                <listitem><para>
-                    <link linkend='var-bb-BB_ENV_EXTRAWHITE'><filename>BB_ENV_EXTRAWHITE</filename></link>
-                    </para></listitem>
-                <listitem><para>
-                    <link linkend='var-bb-BB_PRESERVE_ENV'><filename>BB_PRESERVE_ENV</filename></link>
-                    </para></listitem>
-                <listitem><para>
-                    <link linkend='var-bb-BB_ORIGENV'><filename>BB_ORIGENV</filename></link>
-                    </para></listitem>
-                <listitem><para>
-                    <link linkend='var-bb-BITBAKE_UI'><filename>BITBAKE_UI</filename></link>
+                    <link linkend='var-BITBAKE_UI'><filename>BITBAKE_UI</filename></link>
                     </para></listitem>
             </itemizedlist>
-            The first four variables in this list relate to how BitBake treats shell
-            environment variables during task execution.
-            By default, BitBake cleans the environment variables and provides tight
-            control over the shell execution environment.
-            However, through the use of these first four variables, you can
-            apply your control regarding the
-            environment variables allowed to be used by BitBake in the shell
-            during execution of tasks.
-            See the
-            "<link linkend='passing-information-into-the-build-task-environment'>Passing Information Into the Build Task Environment</link>"
-            section and the information about these variables in the
-            variable glossary for more information on how they work and
-            on how to use them.
+            You can find information on how to pass environment variables into the BitBake
+            execution environment in the
+            "<link linkend='passing-information-into-the-build-task-environment'>Passing Information Into the Build Task Environment</link>" section.
         </para>
 
         <para>
@@ -156,7 +135,7 @@
             BitBake first searches the current working directory for an
             optional <filename>conf/bblayers.conf</filename> configuration file.
             This file is expected to contain a
-            <link linkend='var-bb-BBLAYERS'><filename>BBLAYERS</filename></link>
+            <link linkend='var-BBLAYERS'><filename>BBLAYERS</filename></link>
             variable that is a space-delimited list of 'layer' directories.
             Recall that if BitBake cannot find a <filename>bblayers.conf</filename>
             file, then it is assumed the user has set the <filename>BBPATH</filename>
@@ -166,10 +145,10 @@
         <para>
             For each directory (layer) in this list, a <filename>conf/layer.conf</filename>
             file is located and parsed with the
-            <link linkend='var-bb-LAYERDIR'><filename>LAYERDIR</filename></link>
+            <link linkend='var-LAYERDIR'><filename>LAYERDIR</filename></link>
             variable being set to the directory where the layer was found.
             The idea is these files automatically set up
-            <link linkend='var-bb-BBPATH'><filename>BBPATH</filename></link>
+            <link linkend='var-BBPATH'><filename>BBPATH</filename></link>
             and other variables correctly for a given build directory.
         </para>
 
@@ -189,7 +168,7 @@
             depending on the environment variables previously
             mentioned or set in the configuration files.
             The
-            "<link linkend='ref-bb-variables-glos'>Variables Glossary</link>"
+            "<link linkend='ref-variables-glos'>Variables Glossary</link>"
             chapter presents a full list of variables.
         </para>
 
@@ -204,7 +183,7 @@
         <para>
             The <filename>base.bbclass</filename> file is always included.
             Other classes that are specified in the configuration using the
-            <link linkend='var-bb-INHERIT'><filename>INHERIT</filename></link>
+            <link linkend='var-INHERIT'><filename>INHERIT</filename></link>
             variable are also included.
             BitBake searches for class files in a
             <filename>classes</filename> subdirectory under
@@ -270,7 +249,7 @@
 
         <para>
             During the configuration phase, BitBake will have set
-            <link linkend='var-bb-BBFILES'><filename>BBFILES</filename></link>.
+            <link linkend='var-BBFILES'><filename>BBFILES</filename></link>.
             BitBake now uses it to construct a list of recipes to parse,
             along with any append files (<filename>.bbappend</filename>)
             to apply.
@@ -292,7 +271,7 @@
             Any inherit statements cause BitBake to find and
             then parse class files (<filename>.bbclass</filename>)
             using
-            <link linkend='var-bb-BBPATH'><filename>BBPATH</filename></link>
+            <link linkend='var-BBPATH'><filename>BBPATH</filename></link>
             as the search path.
             Finally, BitBake parses in order any append files found in
             <filename>BBFILES</filename>.
@@ -303,11 +282,11 @@
             pieces of metadata.
             For example, in <filename>bitbake.conf</filename> the recipe
             name and version are used to set the variables
-            <link linkend='var-bb-PN'><filename>PN</filename></link> and
-            <link linkend='var-bb-PV'><filename>PV</filename></link>:
+            <link linkend='var-PN'><filename>PN</filename></link> and
+            <link linkend='var-PV'><filename>PV</filename></link>:
             <literallayout class='monospaced'>
-     PN = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE', False),d)[0] or 'defaultpkgname'}"
-     PV = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE', False),d)[1] or '1.0'}"
+     PN = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE'),d)[0] or 'defaultpkgname'}"
+     PV = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE'),d)[1] or '1.0'}"
             </literallayout>
             In this example, a recipe called "something_1.2.3.bb" would set
             <filename>PN</filename> to "something" and
@@ -336,7 +315,7 @@
             recipe information.
             The validity of this cache is determined by first computing a
             checksum of the base configuration data (see
-            <link linkend='var-bb-BB_HASHCONFIG_WHITELIST'><filename>BB_HASHCONFIG_WHITELIST</filename></link>)
+            <link linkend='var-BB_HASHCONFIG_WHITELIST'><filename>BB_HASHCONFIG_WHITELIST</filename></link>)
             and then checking if the checksum matches.
             If that checksum matches what is in the cache and the recipe
             and class files have not changed, Bitbake is able to use
@@ -384,9 +363,9 @@
             the recipe can be known.
             Each recipe's <filename>PROVIDES</filename> list is created
             implicitly through the recipe's
-            <link linkend='var-bb-PN'><filename>PN</filename></link> variable
+            <link linkend='var-PN'><filename>PN</filename></link> variable
             and explicitly through the recipe's
-            <link linkend='var-bb-PROVIDES'><filename>PROVIDES</filename></link>
+            <link linkend='var-PROVIDES'><filename>PROVIDES</filename></link>
             variable, which is optional.
         </para>
 
@@ -427,7 +406,7 @@
      PREFERRED_PROVIDER_virtual/kernel = "linux-yocto"
             </literallayout>
             The default
-            <link linkend='var-bb-PREFERRED_PROVIDER'><filename>PREFERRED_PROVIDER</filename></link>
+            <link linkend='var-PREFERRED_PROVIDER'><filename>PREFERRED_PROVIDER</filename></link>
             is the provider with the same name as the target.
             Bitbake iterates through each target it needs to build and
             resolves them and their dependencies using this process.
@@ -439,10 +418,10 @@
             BitBake defaults to the highest version of a provider.
             Version comparisons are made using the same method as Debian.
             You can use the
-            <link linkend='var-bb-PREFERRED_VERSION'><filename>PREFERRED_VERSION</filename></link>
+            <link linkend='var-PREFERRED_VERSION'><filename>PREFERRED_VERSION</filename></link>
             variable to specify a particular version.
             You can influence the order by using the
-            <link linkend='var-bb-DEFAULT_PREFERENCE'><filename>DEFAULT_PREFERENCE</filename></link>
+            <link linkend='var-DEFAULT_PREFERENCE'><filename>DEFAULT_PREFERENCE</filename></link>
             variable.
         </para>
 
@@ -464,7 +443,7 @@
             BitBake defaults to selecting the most recent
             version, unless otherwise specified.
             If the recipe in question has a
-            <link linkend='var-bb-DEFAULT_PREFERENCE'><filename>DEFAULT_PREFERENCE</filename></link>
+            <link linkend='var-DEFAULT_PREFERENCE'><filename>DEFAULT_PREFERENCE</filename></link>
             set lower than the other recipes (default is 0), then
             it will not be selected.
             This allows the person or persons maintaining
@@ -475,9 +454,9 @@
 
         <para>
             If the first recipe is named <filename>a_1.1.bb</filename>, then the
-            <link linkend='var-bb-PN'><filename>PN</filename></link> variable
+            <link linkend='var-PN'><filename>PN</filename></link> variable
             will be set to “a”, and the
-            <link linkend='var-bb-PV'><filename>PV</filename></link>
+            <link linkend='var-PV'><filename>PV</filename></link>
             variable will be set to 1.1.
         </para>
 
@@ -532,11 +511,11 @@
         <para>
             Dependencies are defined through several variables.
             You can find information about variables BitBake uses in
-            the <link linkend='ref-bb-variables-glos'>Variables Glossary</link>
+            the <link linkend='ref-variables-glos'>Variables Glossary</link>
             near the end of this manual.
             At a basic level, it is sufficient to know that BitBake uses the
-            <link linkend='var-bb-DEPENDS'><filename>DEPENDS</filename></link> and
-            <link linkend='var-bb-RDEPENDS'><filename>RDEPENDS</filename></link> variables when
+            <link linkend='var-DEPENDS'><filename>DEPENDS</filename></link> and
+            <link linkend='var-RDEPENDS'><filename>RDEPENDS</filename></link> variables when
             calculating dependencies.
         </para>
 
@@ -560,7 +539,7 @@
 
         <para>
             The build now starts with BitBake forking off threads up to the limit set in the
-            <link linkend='var-bb-BB_NUMBER_THREADS'><filename>BB_NUMBER_THREADS</filename></link>
+            <link linkend='var-BB_NUMBER_THREADS'><filename>BB_NUMBER_THREADS</filename></link>
             variable.
             BitBake continues to fork threads as long as there are tasks ready to run,
             those tasks have all their dependencies met, and the thread threshold has not been
@@ -574,7 +553,7 @@
 
         <para>
             As each task completes, a timestamp is written to the directory specified by the
-            <link linkend='var-bb-STAMP'><filename>STAMP</filename></link> variable.
+            <link linkend='var-STAMP'><filename>STAMP</filename></link> variable.
             On subsequent runs, BitBake looks in the build directory within
             <filename>tmp/stamps</filename> and does not rerun
             tasks that are already completed unless a timestamp is found to be invalid.
@@ -596,7 +575,7 @@
             "<link linkend='checksums'>Checksums (Signatures)</link>"
             section for information).
             It is also possible to append extra metadata to the stamp using
-            the <filename>[stamp-extra-info]</filename> task flag.
+            the "stamp-extra-info" task flag.
             For example, OpenEmbedded uses this flag to make some tasks machine-specific.
         </para>
 
@@ -618,7 +597,7 @@
         <para>
             Tasks can be either a shell task or a Python task.
             For shell tasks, BitBake writes a shell script to
-            <filename>${</filename><link linkend='var-bb-T'><filename>T</filename></link><filename>}/run.do_taskname.pid</filename>
+            <filename>${</filename><link linkend='var-T'><filename>T</filename></link><filename>}/run.do_taskname.pid</filename>
             and then executes the script.
             The generated shell script contains all the exported variables,
             and the shell functions with all variables expanded.
@@ -645,16 +624,15 @@
             behavior:
             <itemizedlist>
                 <listitem><para>
-                    <link linkend='var-bb-BB_SCHEDULER'><filename>BB_SCHEDULER</filename></link>
+                    <link linkend='var-BB_SCHEDULER'><filename>BB_SCHEDULER</filename></link>
                     </para></listitem>
                 <listitem><para>
-                    <link linkend='var-bb-BB_SCHEDULERS'><filename>BB_SCHEDULERS</filename></link>
+                    <link linkend='var-BB_SCHEDULERS'><filename>BB_SCHEDULERS</filename></link>
                     </para></listitem>
             </itemizedlist>
             It is possible to have functions run before and after a task's main
             function.
-            This is done using the <filename>[prefuncs]</filename>
-            and <filename>[postfuncs]</filename> flags of the task
+            This is done using the "prefuncs" and "postfuncs" flags of the task
             that lists the functions to run.
         </para>
     </section>
@@ -684,7 +662,7 @@
             The simplistic approach for excluding the working directory is to set
             it to some fixed value and create the checksum for the "run" script.
             BitBake goes one step better and uses the
-            <link linkend='var-bb-BB_HASHBASE_WHITELIST'><filename>BB_HASHBASE_WHITELIST</filename></link>
+            <link linkend='var-BB_HASHBASE_WHITELIST'><filename>BB_HASHBASE_WHITELIST</filename></link>
             variable to define a list of variables that should never be included
             when generating the signatures.
         </para>
@@ -781,7 +759,7 @@
             The code in <filename>meta/lib/oe/sstatesig.py</filename> shows two examples
             of this and also illustrates how you can insert your own policy into the system
             if so desired.
-            This file defines the two basic signature generators OpenEmbedded-Core
+            This file defines the two basic signature generators OpenEmbedded Core
             uses:  "OEBasic" and "OEBasicHash".
             By default, there is a dummy "noop" signature handler enabled in BitBake.
             This means that behavior is unchanged from previous versions.
@@ -795,7 +773,7 @@
             This results in any metadata change that changes the task hash, automatically
             causing the task to be run again.
             This removes the need to bump
-            <link linkend='var-bb-PR'><filename>PR</filename></link>
+            <link linkend='var-PR'><filename>PR</filename></link>
             values, and changes to metadata automatically ripple across the build.
         </para>
 
@@ -804,13 +782,13 @@
             make some dependency and hash information available to the build.
             This information includes:
             <itemizedlist>
-                <listitem><para><filename>BB_BASEHASH_task-</filename><replaceable>taskname</replaceable>:
+                <listitem><para><filename>BB_BASEHASH_task-&lt;taskname&gt;</filename>:
                     The base hashes for each task in the recipe.
                     </para></listitem>
-                <listitem><para><filename>BB_BASEHASH_</filename><replaceable>filename</replaceable><filename>:</filename><replaceable>taskname</replaceable>:
+                <listitem><para><filename>BB_BASEHASH_&lt;filename:taskname&gt;</filename>:
                     The base hashes for each dependent task.
                     </para></listitem>
-                <listitem><para><filename>BBHASHDEPS_</filename><replaceable>filename</replaceable><filename>:</filename><replaceable>taskname</replaceable>:
+                <listitem><para><filename>BBHASHDEPS_&lt;filename:taskname&gt;</filename>:
                     The task dependencies for each task.
                     </para></listitem>
                 <listitem><para><filename>BB_TASKHASH</filename>:
@@ -828,7 +806,7 @@
             itself.
             The simplest parameter to pass is "none", which causes a
             set of signature information to be written out into
-            <filename>STAMPS_DIR</filename>
+            <filename>STAMP_DIR</filename>
             corresponding to the targets specified.
             The other currently available parameter is "printdiff",
             which causes BitBake to try to establish the closest
@@ -884,7 +862,7 @@
 
         <para>
             BitBake first calls the function defined by the
-            <link linkend='var-bb-BB_HASHCHECK_FUNCTION'><filename>BB_HASHCHECK_FUNCTION</filename></link>
+            <link linkend='var-BB_HASHCHECK_FUNCTION'><filename>BB_HASHCHECK_FUNCTION</filename></link>
             variable with a list of tasks and corresponding
             hashes it wants to build.
             This function is designed to be fast and returns a list
@@ -908,7 +886,7 @@
             For example, it is pointless to obtain a compiler if you
             already have the compiled binary.
             To handle this, BitBake calls the
-            <link linkend='var-bb-BB_SETSCENE_DEPVALID'><filename>BB_SETSCENE_DEPVALID</filename></link>
+            <link linkend='var-BB_SETSCENE_DEPVALID'><filename>BB_SETSCENE_DEPVALID</filename></link>
             function for each successful setscene task to know whether or not it needs
             to obtain the dependencies of that task.
         </para>
@@ -916,7 +894,7 @@
         <para>
             Finally, after all the setscene tasks have executed, BitBake calls the
             function listed in
-            <link linkend='var-bb-BB_SETSCENE_VERIFY_FUNCTION2'><filename>BB_SETSCENE_VERIFY_FUNCTION2</filename></link>
+            <link linkend='var-BB_SETSCENE_VERIFY_FUNCTION'><filename>BB_SETSCENE_VERIFY_FUNCTION</filename></link>
             with the list of tasks BitBake thinks has been "covered".
             The metadata can then ensure that this list is correct and can
             inform BitBake that it wants specific tasks to be run regardless

bitbake/doc/bitbake-user-manual/bitbake-user-manual-fetching.xml

@@ -38,13 +38,13 @@
             The code to execute the first part of this process, a fetch,
             looks something like the following:
             <literallayout class='monospaced'>
-     src_uri = (d.getVar('SRC_URI') or "").split()
+     src_uri = (d.getVar('SRC_URI', True) or "").split()
      fetcher = bb.fetch2.Fetch(src_uri, d)
      fetcher.download()
             </literallayout>
             This code sets up an instance of the fetch class.
             The instance uses a space-separated list of URLs from the
-            <link linkend='var-bb-SRC_URI'><filename>SRC_URI</filename></link>
+            <link linkend='var-SRC_URI'><filename>SRC_URI</filename></link>
             variable and then calls the <filename>download</filename>
             method to download the files.
         </para>
@@ -52,7 +52,7 @@
         <para>
             The instantiation of the fetch class is usually followed by:
             <literallayout class='monospaced'>
-     rootdir = l.getVar('WORKDIR')
+     rootdir = l.getVar('WORKDIR', True)
      fetcher.unpack(rootdir)
             </literallayout>
             This code unpacks the downloaded files to the
@@ -78,7 +78,7 @@
                 <listitem><para><emphasis>Pre-mirror Sites:</emphasis>
                     BitBake first uses pre-mirrors to try and find source files.
                     These locations are defined using the
-                    <link linkend='var-bb-PREMIRRORS'><filename>PREMIRRORS</filename></link>
+                    <link linkend='var-PREMIRRORS'><filename>PREMIRRORS</filename></link>
                     variable.
                     </para></listitem>
                 <listitem><para><emphasis>Source URI:</emphasis>
@@ -88,7 +88,7 @@
                 <listitem><para><emphasis>Mirror Sites:</emphasis>
                     If fetch failures occur, BitBake next uses mirror locations as
                     defined by the
-                    <link linkend='var-bb-MIRRORS'><filename>MIRRORS</filename></link>
+                    <link linkend='var-MIRRORS'><filename>MIRRORS</filename></link>
                     variable.
                     </para></listitem>
             </itemizedlist>
@@ -144,7 +144,7 @@
             Any source files that are not local (i.e.
             downloaded from the Internet) are placed into the download
             directory, which is specified by the
-            <link linkend='var-bb-DL_DIR'><filename>DL_DIR</filename></link>
+            <link linkend='var-DL_DIR'><filename>DL_DIR</filename></link>
             variable.
         </para>
 
@@ -157,8 +157,8 @@
             <filename>SRC_URI</filename> variable with the appropriate
             varflags as follows:
             <literallayout class='monospaced'>
-     SRC_URI[md5sum] = "<replaceable>value</replaceable>"
-     SRC_URI[sha256sum] = "<replaceable>value</replaceable>"
+     SRC_URI[md5sum] = "value"
+     SRC_URI[sha256sum] = "value"
             </literallayout>
             You can also specify the checksums as parameters on the
             <filename>SRC_URI</filename> as shown below:
@@ -184,11 +184,11 @@
 
         <para>
             If
-            <link linkend='var-bb-BB_STRICT_CHECKSUM'><filename>BB_STRICT_CHECKSUM</filename></link>
+            <link linkend='var-BB_STRICT_CHECKSUM'><filename>BB_STRICT_CHECKSUM</filename></link>
             is set, any download without a checksum triggers an
             error message.
             The
-            <link linkend='var-bb-BB_NO_NETWORK'><filename>BB_NO_NETWORK</filename></link>
+            <link linkend='var-BB_NO_NETWORK'><filename>BB_NO_NETWORK</filename></link>
             variable can be used to make any attempted network access a fatal
             error, which is useful for checking that mirrors are complete
             as well as other things.
@@ -265,11 +265,20 @@
                 The filename you specify within the URL can be
                 either an absolute or relative path to a file.
                 If the filename is relative, the contents of the
-                <link linkend='var-bb-FILESPATH'><filename>FILESPATH</filename></link>
+                <link linkend='var-FILESPATH'><filename>FILESPATH</filename></link>
                 variable is used in the same way
                 <filename>PATH</filename> is used to find executables.
+                Failing that,
+                <link linkend='var-FILESDIR'><filename>FILESDIR</filename></link>
+                is used to find the appropriate relative file.
+                <note>
+                    <filename>FILESDIR</filename> is deprecated and can
+                    be replaced with <filename>FILESPATH</filename>.
+                    Because <filename>FILESDIR</filename> is likely to be
+                    removed, you should not use this variable in any new code.
+                </note>
                 If the file cannot be found, it is assumed that it is available in
-                <link linkend='var-bb-DL_DIR'><filename>DL_DIR</filename></link>
+                <link linkend='var-DL_DIR'><filename>DL_DIR</filename></link>
                 by the time the <filename>download()</filename> method is called.
             </para>
 
@@ -304,7 +313,7 @@
                 allows the name of the downloaded file to be specified.
                 Specifying the name of the downloaded file is useful
                 for avoiding collisions in
-                <link linkend='var-bb-DL_DIR'><filename>DL_DIR</filename></link>
+                <link linkend='var-DL_DIR'><filename>DL_DIR</filename></link>
                 when dealing with multiple files that have the same name.
             </para>
 
@@ -316,25 +325,6 @@
      SRC_URI = "ftp://you@oe.handhelds.org/home/you/secret.plan"
                 </literallayout>
             </para>
-            <note>
-               Because URL parameters are delimited by semi-colons, this can
-               introduce ambiguity when parsing URLs that also contain semi-colons,
-               for example:
-                <literallayout class='monospaced'>
-     SRC_URI = "http://abc123.org/git/?p=gcc/gcc.git;a=snapshot;h=a5dd47"
-                </literallayout>
-               Such URLs should should be modified by replacing semi-colons with '&amp;' characters:
-               <literallayout class='monospaced'>
-     SRC_URI = "http://abc123.org/git/?p=gcc/gcc.git&amp;a=snapshot&amp;h=a5dd47"
-                </literallayout>
-                In most cases this should work. Treating semi-colons and '&amp;' in queries
-                identically is recommended by the World Wide Web Consortium (W3C).
-                Note that due to the nature of the URL, you may have to specify the name
-                of the downloaded file as well:
-              <literallayout class='monospaced'>
-     SRC_URI = "http://abc123.org/git/?p=gcc/gcc.git&amp;a=snapshot&amp;h=a5dd47;downloadfilename=myfile.bz2"
-                </literallayout>
-            </note>
         </section>
 
         <section id='cvs-fetcher'>
@@ -355,7 +345,7 @@
                         A special value of "now" causes the checkout to
                         be updated on every build.
                         </para></listitem>
-                    <listitem><para><emphasis><link linkend='var-bb-CVSDIR'><filename>CVSDIR</filename></link>:</emphasis>
+                    <listitem><para><emphasis><filename>CVSDIR</filename>:</emphasis>
                         Specifies where a temporary checkout is saved.
                         The location is often <filename>DL_DIR/cvs</filename>.
                         </para></listitem>
@@ -376,8 +366,7 @@
                 The supported parameters are as follows:
                 <itemizedlist>
                     <listitem><para><emphasis>"method":</emphasis>
-                        The protocol over which to communicate with the CVS
-                        server.
+                        The protocol over which to communicate with the CVS server.
                         By default, this protocol is "pserver".
                         If "method" is set to "ext", BitBake examines the
                         "rsh" parameter and sets <filename>CVS_RSH</filename>.
@@ -395,7 +384,7 @@
                     <listitem><para><emphasis>"date":</emphasis>
                         Specifies a date.
                         If no "date" is specified, the
-                        <link linkend='var-bb-SRCDATE'><filename>SRCDATE</filename></link>
+                        <link linkend='var-SRCDATE'><filename>SRCDATE</filename></link>
                         of the configuration is used to checkout a specific date.
                         The special value of "now" causes the checkout to be
                         updated on every build.
@@ -405,8 +394,7 @@
                         Effectively, you are renaming the output directory
                         to which the module is unpacked.
                         You are forcing the module into a special
-                        directory relative to
-                        <link linkend='var-bb-CVSDIR'><filename>CVSDIR</filename></link>.
+                        directory relative to <filename>CVSDIR</filename>.
                         </para></listitem>
                     <listitem><para><emphasis>"rsh"</emphasis>
                         Used in conjunction with the "method" parameter.
@@ -447,9 +435,9 @@
                 The executable used is specified by
                 <filename>FETCHCMD_svn</filename>, which defaults
                 to "svn".
-                The fetcher's temporary working directory is set by
-                <link linkend='var-bb-SVNDIR'><filename>SVNDIR</filename></link>,
-                which is usually <filename>DL_DIR/svn</filename>.
+                The fetcher's temporary working directory is set
+                by <filename>SVNDIR</filename>, which is usually
+                <filename>DL_DIR/svn</filename>.
             </para>
 
             <para>
@@ -461,29 +449,25 @@
                         You can think of this parameter as the top-level
                         directory of the repository data you want.
                         </para></listitem>
-                    <listitem><para><emphasis>"path_spec":</emphasis>
-                        A specific directory in which to checkout the
-                        specified svn module.
-                        </para></listitem>
                     <listitem><para><emphasis>"protocol":</emphasis>
                         The protocol to use, which defaults to "svn".
-                        If "protocol" is set to "svn+ssh", the "ssh"
-                        parameter is also used.
+                        Other options are "svn+ssh" and "rsh".
+                        For "rsh", the "rsh" parameter is also used.
                         </para></listitem>
                     <listitem><para><emphasis>"rev":</emphasis>
                         The revision of the source code to checkout.
                         </para></listitem>
+                    <listitem><para><emphasis>"date":</emphasis>
+                        The date of the source code to checkout.
+                        Specific revisions are generally much safer to checkout
+                        rather than by date as they do not involve timezones
+                        (e.g. they are much more deterministic).
+                        </para></listitem>
                     <listitem><para><emphasis>"scmdata":</emphasis>
                         Causes the “.svn” directories to be available during
                         compile-time when set to "keep".
                         By default, these directories are removed.
                         </para></listitem>
-                    <listitem><para><emphasis>"ssh":</emphasis>
-                        An optional parameter used when "protocol" is set
-                        to "svn+ssh".
-                        You can use this parameter to specify the ssh
-                        program used by svn.
-                        </para></listitem>
                     <listitem><para><emphasis>"transportuser":</emphasis>
                         When required, sets the username for the transport.
                         By default, this parameter is empty.
@@ -492,11 +476,10 @@
                         command.
                         </para></listitem>
                 </itemizedlist>
-                Following are three examples using svn:
+                Following are two examples using svn:
                 <literallayout class='monospaced'>
-     SRC_URI = "svn://myrepos/proj1;module=vip;protocol=http;rev=667"
-     SRC_URI = "svn://myrepos/proj1;module=opie;protocol=svn+ssh"
-     SRC_URI = "svn://myrepos/proj1;module=trunk;protocol=http;path_spec=${MY_DIR}/proj1"
+     SRC_URI = "svn://svn.oe.handhelds.org/svn;module=vip;proto=http;rev=667"
+     SRC_URI = "svn://svn.oe.handhelds.org/svn/;module=opie;proto=svn+ssh;date=20060126"
                 </literallayout>
             </para>
         </section>
@@ -508,9 +491,8 @@
                 This fetcher submodule fetches code from the Git
                 source control system.
                 The fetcher works by creating a bare clone of the
-                remote into
-                <link linkend='var-bb-GITDIR'><filename>GITDIR</filename></link>,
-                which is usually <filename>DL_DIR/git2</filename>.
+                remote into <filename>GITDIR</filename>, which is
+                usually <filename>DL_DIR/git2</filename>.
                 This bare clone is then cloned into the work directory during the
                 unpack stage when a specific tree is checked out.
                 This is done using alternates and by reference to
@@ -588,14 +570,6 @@
                         The name of the path in which to place the checkout.
                         By default, the path is <filename>git/</filename>.
                         </para></listitem>
-                    <listitem><para><emphasis>"usehead":</emphasis>
-                        Enables local <filename>git://</filename> URLs to use the
-                        current branch HEAD as the revision for use with
-                        <filename>AUTOREV</filename>.
-                        The "usehead" parameter implies no branch and only works
-                        when the transfer protocol is
-                        <filename>file://</filename>.
-                        </para></listitem>
                 </itemizedlist>
                 Here are some example URLs:
                 <literallayout class='monospaced'>
@@ -612,7 +586,7 @@
                 This fetcher submodule inherits from the
                 <link linkend='git-fetcher'>Git fetcher</link> and extends
                 that fetcher's behavior by fetching a repository's submodules.
-                <link linkend='var-bb-SRC_URI'><filename>SRC_URI</filename></link>
+                <link linkend='var-SRC_URI'><filename>SRC_URI</filename></link>
                 is passed to the Git fetcher as described in the
                 "<link linkend='git-fetcher'>Git Fetcher (<filename>git://</filename>)</link>"
                 section.
@@ -628,9 +602,7 @@
                         The Git Submodules fetcher is not a complete fetcher
                         implementation.
                         The fetcher has known issues where it does not use the
-                        normal source mirroring infrastructure properly. Further,
-                        the submodule sources it fetches are not visible to the
-                        licensing and source archiving infrastructures.
+                        normal source mirroring infrastructure properly.
                     </para>
                 </note>
             </para>
@@ -647,14 +619,14 @@
 
             <para>
                 To use this fetcher, make sure your recipe has proper
-                <link linkend='var-bb-SRC_URI'><filename>SRC_URI</filename></link>,
-                <link linkend='var-bb-SRCREV'><filename>SRCREV</filename></link>, and
-                <link linkend='var-bb-PV'><filename>PV</filename></link> settings.
+                <link linkend='var-SRC_URI'><filename>SRC_URI</filename></link>,
+                <link linkend='var-SRCREV'><filename>SRCREV</filename></link>, and
+                <link linkend='var-PV'><filename>PV</filename></link> settings.
                 Here is an example:
                 <literallayout class='monospaced'>
      SRC_URI = "ccrc://cc.example.org/ccrc;vob=/example_vob;module=/example_module"
      SRCREV = "EXAMPLE_CLEARCASE_TAG"
-     PV = "${@d.getVar("SRCREV", False).replace("/", "+")}"
+     PV = "${@d.getVar("SRCREV").replace("/", "+")}"
                 </literallayout>
                 The fetcher uses the <filename>rcleartool</filename> or
                 <filename>cleartool</filename> remote client, depending on
@@ -672,19 +644,13 @@
                         </para></listitem>
                     <listitem><para><emphasis><filename>module</filename></emphasis>:
                         The module, which must include the
-                        prepending "/" character, in the selected VOB.
-                        <note>
-                            The <filename>module</filename> and <filename>vob</filename>
-                            options are combined to create the <filename>load</filename> rule in
-                            the view config spec.
-                            As an example, consider the <filename>vob</filename> and
-                            <filename>module</filename> values from the
-                            <filename>SRC_URI</filename> statement at the start of this section.
-                            Combining those values results in the following:
-                            <literallayout class='monospaced'>
-     load /example_vob/example_module
-                            </literallayout>
-                        </note>
+                        prepending "/" character, in the selected VOB
+                        The <filename>module</filename> and <filename>vob</filename>
+                        options are combined to create the following load rule in
+                        the view config spec:
+                        <literallayout class='monospaced'>
+     load &lt;vob&gt;&lt;module&gt;
+                        </literallayout>
                         </para></listitem>
                     <listitem><para><emphasis><filename>proto</filename></emphasis>:
                         The protocol, which can be either <filename>http</filename> or
@@ -723,105 +689,6 @@
             </para>
         </section>
 
-        <section id='perforce-fetcher'>
-            <title>Perforce Fetcher (<filename>p4://</filename>)</title>
-
-            <para>
-                This fetcher submodule fetches code from the
-                <ulink url='https://www.perforce.com/'>Perforce</ulink>
-                source control system.
-                The executable used is specified by
-                <filename>FETCHCMD_p4</filename>, which defaults
-                to "p4".
-                The fetcher's temporary working directory is set by
-                <link linkend='var-bb-P4DIR'><filename>P4DIR</filename></link>,
-                which defaults to "DL_DIR/p4".
-            </para>
-
-            <para>
-                To use this fetcher, make sure your recipe has proper
-                <link linkend='var-bb-SRC_URI'><filename>SRC_URI</filename></link>,
-                <link linkend='var-bb-SRCREV'><filename>SRCREV</filename></link>, and
-                <link linkend='var-bb-PV'><filename>PV</filename></link> values.
-                The p4 executable is able to use the config file defined by your
-                system's <filename>P4CONFIG</filename> environment variable in
-                order to define the Perforce server URL and port, username, and
-                password if you do not wish to keep those values in a recipe
-                itself.
-                If you choose not to use <filename>P4CONFIG</filename>,
-                or to explicitly set variables that <filename>P4CONFIG</filename>
-                can contain, you can specify the <filename>P4PORT</filename> value,
-                which is the server's URL and port number, and you can
-                specify a username and password directly in your recipe within
-                <filename>SRC_URI</filename>.
-            </para>
-
-            <para>
-                Here is an example that relies on <filename>P4CONFIG</filename>
-                to specify the server URL and port, username, and password, and
-                fetches the Head Revision:
-                <literallayout class='monospaced'>
-    SRC_URI = "p4://example-depot/main/source/..."
-    SRCREV = "${AUTOREV}"
-    PV = "p4-${SRCPV}"
-    S = "${WORKDIR}/p4"
-                </literallayout>
-            </para>
-
-            <para>
-                Here is an example that specifies the server URL and port,
-                username, and password, and fetches a Revision based on a Label:
-                <literallayout class='monospaced'>
-    P4PORT = "tcp:p4server.example.net:1666"
-    SRC_URI = "p4://user:passwd@example-depot/main/source/..."
-    SRCREV = "release-1.0"
-    PV = "p4-${SRCPV}"
-    S = "${WORKDIR}/p4"
-                </literallayout>
-                <note>
-                    You should always set <filename>S</filename>
-                    to <filename>"${WORKDIR}/p4"</filename> in your recipe.
-                </note>
-            </para>
-        </section>
-
-        <section id='repo-fetcher'>
-            <title>Repo Fetcher (<filename>repo://</filename>)</title>
-
-            <para>
-                This fetcher submodule fetches code from
-                <filename>google-repo</filename> source control system.
-                The fetcher works by initiating and syncing sources of the
-                repository into
-                <link linkend='var-bb-REPODIR'><filename>REPODIR</filename></link>,
-                which is usually
-                <link linkend='var-bb-DL_DIR'><filename>DL_DIR</filename></link><filename>/repo</filename>.
-            </para>
-
-            <para>
-                This fetcher supports the following parameters:
-                <itemizedlist>
-                    <listitem><para>
-                        <emphasis>"protocol":</emphasis>
-                        Protocol to fetch the repository manifest (default: git).
-                        </para></listitem>
-                    <listitem><para>
-                        <emphasis>"branch":</emphasis>
-                        Branch or tag of repository to get (default: master).
-                        </para></listitem>
-                    <listitem><para>
-                        <emphasis>"manifest":</emphasis>
-                        Name of the manifest file (default: <filename>default.xml</filename>).
-                        </para></listitem>
-                </itemizedlist>
-                Here are some example URLs:
-                <literallayout class='monospaced'>
-    SRC_URI = "repo://REPOROOT;protocol=git;branch=some_branch;manifest=my_manifest.xml"
-    SRC_URI = "repo://REPOROOT;protocol=file;branch=some_branch;manifest=my_manifest.xml"
-                </literallayout>
-            </para>
-        </section>
-
         <section id='other-fetchers'>
             <title>Other Fetchers</title>
 
@@ -831,6 +698,9 @@
                     <listitem><para>
                         Bazaar (<filename>bzr://</filename>)
                         </para></listitem>
+                    <listitem><para>
+                        Perforce (<filename>p4://</filename>)
+                        </para></listitem>
                     <listitem><para>
                         Trees using Git Annex (<filename>gitannex://</filename>)
                         </para></listitem>
@@ -840,6 +710,9 @@
                     <listitem><para>
                         Secure Shell (<filename>ssh://</filename>)
                         </para></listitem>
+                    <listitem><para>
+                        Repo (<filename>repo://</filename>)
+                        </para></listitem>
                     <listitem><para>
                         OSC (<filename>osc://</filename>)
                         </para></listitem>

bitbake/doc/bitbake-user-manual/bitbake-user-manual-hello.xml

@@ -47,6 +47,7 @@
      -rw-rw-r--. 1 wmat wmat   849 Nov 26 04:55 HEADER
      drwxrwxr-x. 5 wmat wmat  4096 Jan 31 13:44 lib
      -rw-rw-r--. 1 wmat wmat   195 Nov 26 04:55 MANIFEST.in
+     -rwxrwxr-x. 1 wmat wmat  3195 Jan 31 11:57 setup.py
      -rw-rw-r--. 1 wmat wmat  2887 Nov 26 04:55 TODO
             </literallayout>
         </para>
@@ -128,8 +129,15 @@
         </para>
 
         <note>
-            This example was inspired by and drew heavily from
-            <ulink url="http://www.mail-archive.com/yocto@yoctoproject.org/msg09379.html">Mailing List post - The BitBake equivalent of "Hello, World!"</ulink>.
+            This example was inspired by and drew heavily from these sources:
+            <itemizedlist>
+                <listitem><para>
+                    <ulink url="http://www.mail-archive.com/yocto@yoctoproject.org/msg09379.html">Mailing List post - The BitBake equivalent of "Hello, World!"</ulink>
+                    </para></listitem>
+                <listitem><para>
+                    <ulink url="https://web.archive.org/web/20150325165911/http://hambedded.org/blog/2012/11/24/from-bitbake-hello-world-to-an-image/">Hambedded Linux blog post - From Bitbake Hello World to an Image</ulink>
+                    </para></listitem>
+            </itemizedlist>
         </note>
 
         <para>
@@ -194,7 +202,7 @@
                 <para>
                 When you run BitBake, it begins looking for metadata files.
                 The
-                <link linkend='var-bb-BBPATH'><filename>BBPATH</filename></link>
+                <link linkend='var-BBPATH'><filename>BBPATH</filename></link>
                 variable is what tells BitBake where to look for those files.
                 <filename>BBPATH</filename> is not set and you need to set it.
                 Without <filename>BBPATH</filename>, Bitbake cannot
@@ -213,7 +221,7 @@
                 <para>From your shell, enter the following commands to set and
                 export the <filename>BBPATH</filename> variable:
                 <literallayout class='monospaced'>
-     $ BBPATH="<replaceable>projectdirectory</replaceable>"
+     $ BBPATH="&lt;projectdirectory&gt;"
      $ export BBPATH
                 </literallayout>
                 Use your actual project directory in the command.
@@ -260,9 +268,9 @@
                 files.
                 For this example, you need to create the file in your project directory
                 and define some key BitBake variables.
-                For more information on the <filename>bitbake.conf</filename> file,
+                For more information on the <filename>bitbake.conf</filename>,
                 see
-                <ulink url='http://git.openembedded.org/bitbake/tree/conf/bitbake.conf'></ulink>.
+                <ulink url='https://web.archive.org/web/20150325165911/http://hambedded.org/blog/2012/11/24/from-bitbake-hello-world-to-an-image/#an-overview-of-bitbakeconf'></ulink>
                 </para>
                 <para>Use the following commands to create the <filename>conf</filename>
                 directory in the project directory:
@@ -273,32 +281,14 @@
                 some editor to create the <filename>bitbake.conf</filename>
                 so that it contains the following:
                 <literallayout class='monospaced'>
-     <link linkend='var-bb-PN'>PN</link>  = "${@bb.parse.BBHandler.vars_from_file(d.getVar('FILE', False),d)[0] or 'defaultpkgname'}"
+     TMPDIR  = "${<link linkend='var-TOPDIR'>TOPDIR</link>}/tmp"
+     <link linkend='var-CACHE'>CACHE</link>   = "${TMPDIR}/cache"
+     <link linkend='var-STAMP'>STAMP</link>   = "${TMPDIR}/stamps"
+     <link linkend='var-T'>T</link>       = "${TMPDIR}/work"
+     <link linkend='var-B'>B</link>       = "${TMPDIR}"
                 </literallayout>
-                <literallayout class='monospaced'>
-     TMPDIR  = "${<link linkend='var-bb-TOPDIR'>TOPDIR</link>}/tmp"
-     <link linkend='var-bb-CACHE'>CACHE</link>   = "${TMPDIR}/cache"
-     <link linkend='var-bb-STAMP'>STAMP</link>   = "${TMPDIR}/${PN}/stamps"
-     <link linkend='var-bb-T'>T</link>       = "${TMPDIR}/${PN}/work"
-     <link linkend='var-bb-B'>B</link>       = "${TMPDIR}/${PN}"
-                </literallayout>
-                <note>
-                    Without a value for <filename>PN</filename>, the
-                    variables <filename>STAMP</filename>,
-                    <filename>T</filename>, and <filename>B</filename>,
-                    prevent more than one recipe from working. You can fix
-                    this by either setting <filename>PN</filename> to have
-                    a value similar to what OpenEmbedded and BitBake use
-                    in the default <filename>bitbake.conf</filename> file
-                    (see previous example). Or, by manually updating each
-                    recipe to set <filename>PN</filename>. You will also
-                    need to include <filename>PN</filename> as part of the
-                    <filename>STAMP</filename>, <filename>T</filename>, and
-                    <filename>B</filename> variable definitions in the
-                    <filename>local.conf</filename> file.
-                </note>
                 The <filename>TMPDIR</filename> variable establishes a directory
-                that BitBake uses for build output and intermediate files other
+                that BitBake uses for build output and intermediate files (other
                 than the cached information used by the
                 <link linkend='setscene'>Setscene</link> process.
                 Here, the <filename>TMPDIR</filename> directory is set to
@@ -318,19 +308,19 @@
                 file exists, you can run the <filename>bitbake</filename>
                 command again:
                 <literallayout class='monospaced'>
-     $ bitbake
-     ERROR: Traceback (most recent call last):
-       File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 163, in wrapped
-         return func(fn, *args)
-       File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 177, in _inherit
-         bb.parse.BBHandler.inherit(bbclass, "configuration INHERITs", 0, data)
-       File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/BBHandler.py", line 92, in inherit
-         include(fn, file, lineno, d, "inherit")
-       File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/ConfHandler.py", line 100, in include
-         raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
-     ParseError: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
+$ bitbake
+ERROR: Traceback (most recent call last):
+  File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 163, in wrapped
+    return func(fn, *args)
+  File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 177, in _inherit
+    bb.parse.BBHandler.inherit(bbclass, "configuration INHERITs", 0, data)
+  File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/BBHandler.py", line 92, in inherit
+    include(fn, file, lineno, d, "inherit")
+  File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/ConfHandler.py", line 100, in include
+    raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
+ParseError: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
 
-     ERROR: Unable to parse base: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
+ERROR: Unable to parse base: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
                 </literallayout>
                 In the sample output, BitBake could not find the
                 <filename>classes/base.bbclass</filename> file.
@@ -363,6 +353,9 @@
                 Of course, the <filename>base.bbclass</filename> can have much
                 more depending on which build environments BitBake is
                 supporting.
+                For more information on the <filename>base.bbclass</filename> file,
+                you can look at
+                <ulink url='https://web.archive.org/web/20150325165911/http://hambedded.org/blog/2012/11/24/from-bitbake-hello-world-to-an-image/#tasks'></ulink>.
                 </para></listitem>
             <listitem><para><emphasis>Run Bitbake:</emphasis>
                 After making sure that the <filename>classes/base.bbclass</filename>
@@ -383,10 +376,10 @@
                 code separate from the general metadata used by BitBake.
                 Thus, this example creates and uses a layer called "mylayer".
                 <note>
-                    You can find additional information on layers in the
-                    "<link linkend='layers'>Layers</link>" section.
-                </note></para>
-
+                    You can find additional information on adding a layer at
+                    <ulink url='https://web.archive.org/web/20150325165911/http://hambedded.org/blog/2012/11/24/from-bitbake-hello-world-to-an-image/#adding-an-example-layer'></ulink>.
+                </note>
+                </para>
                 <para>Minimally, you need a recipe file and a layer configuration
                 file in your layer.
                 The configuration file needs to be in the <filename>conf</filename>
@@ -402,12 +395,12 @@
                 Move to the <filename>conf</filename> directory and create a
                 <filename>layer.conf</filename> file that has the following:
                 <literallayout class='monospaced'>
-     BBPATH .= ":${<link linkend='var-bb-LAYERDIR'>LAYERDIR</link>}"
+     BBPATH .= ":${<link linkend='var-LAYERDIR'>LAYERDIR</link>}"
 
-     <link linkend='var-bb-BBFILES'>BBFILES</link> += "${LAYERDIR}/*.bb"
+     <link linkend='var-BBFILES'>BBFILES</link> += "${LAYERDIR}/*.bb"
 
-     <link linkend='var-bb-BBFILE_COLLECTIONS'>BBFILE_COLLECTIONS</link> += "mylayer"
-     <link linkend='var-bb-BBFILE_PATTERN'>BBFILE_PATTERN_mylayer</link> := "^${LAYERDIR_RE}/"
+     <link linkend='var-BBFILE_COLLECTIONS'>BBFILE_COLLECTIONS</link> += "mylayer"
+     <link linkend='var-BBFILE_PATTERN'>BBFILE_PATTERN_mylayer</link> := "^${LAYERDIR}/"
                 </literallayout>
                 For information on these variables, click the links
                 to go to the definitions in the glossary.</para>
@@ -416,9 +409,9 @@
                 a recipe file named <filename>printhello.bb</filename> that
                 has the following:
                 <literallayout class='monospaced'>
-     <link linkend='var-bb-DESCRIPTION'>DESCRIPTION</link> = "Prints Hello World"
-     <link linkend='var-bb-PN'>PN</link> = 'printhello'
-     <link linkend='var-bb-PV'>PV</link> = '1'
+     <link linkend='var-DESCRIPTION'>DESCRIPTION</link> = "Prints Hello World"
+     <link linkend='var-PN'>PN</link> = 'printhello'
+     <link linkend='var-PV'>PV</link> = '1'
 
      python do_build() {
         bb.plain("********************");
@@ -478,7 +471,7 @@
      Time: 00:00:00
      Parsing of 1 .bb files complete (0 cached, 1 parsed). 1 targets, 0 skipped, 0 masked, 0 errors.
      NOTE: Resolving any missing task queue dependencies
-     NOTE: Preparing RunQueue
+     NOTE: Preparing runqueue
      NOTE: Executing RunQueue Tasks
      ********************
      *                  *

bitbake/doc/bitbake-user-manual/bitbake-user-manual-intro.xml

@@ -342,14 +342,13 @@
 
             <para>
                 When you name an append file, you can use the
-                "<filename>%</filename>" wildcard character to allow for matching
-                recipe names.
+                wildcard character (%) to allow for matching recipe names.
                 For example, suppose you have an append file named
                 as follows:
                 <literallayout class='monospaced'>
      busybox_1.21.%.bbappend
                 </literallayout>
-                That append file would match any <filename>busybox_1.21.</filename><replaceable>x</replaceable><filename>.bb</filename>
+                That append file would match any <filename>busybox_1.21.x.bb</filename>
                 version of the recipe.
                 So, the append file would match the following recipe names:
                 <literallayout class='monospaced'>
@@ -357,14 +356,6 @@
      busybox_1.21.2.bb
      busybox_1.21.3.bb
                 </literallayout>
-                <note><title>Important</title>
-                    The use of the "<filename>%</filename>" character
-                    is limited in that it only works directly in front of the
-                    <filename>.bbappend</filename> portion of the append file's
-                    name.
-                    You cannot use the wildcard character in any other
-                    location of the name.
-                </note>
                 If the <filename>busybox</filename> recipe was updated to
                 <filename>busybox_1.3.0.bb</filename>, the append name would not
                 match.
@@ -449,7 +440,7 @@
                     Build Checkout:</emphasis>
                     A final possibility for getting a copy of BitBake is that it
                     already comes with your checkout of a larger Bitbake-based build
-                    system, such as Poky.
+                    system, such as Poky or Yocto Project.
                     Rather than manually checking out individual layers and
                     gluing them together yourself, you can check
                     out an entire build system.
@@ -480,7 +471,7 @@
                 Following is the usage and syntax for BitBake:
                 <literallayout class='monospaced'>
      $ bitbake -h
-     Usage: bitbake [options] [recipename/target recipe:do_task ...]
+     Usage: bitbake [options] [recipename/target ...]
 
          Executes the specified task (default is 'build') for a given set of target recipes (.bb files).
          It is assumed there is a conf/bblayers.conf available in cwd or in BBPATH which
@@ -497,6 +488,8 @@
                              target that failed and anything depending on it cannot
                              be built, as much as possible will be built before
                              stopping.
+       -a, --tryaltconfigs   Continue with builds by trying to use alternative
+                             providers where possible.
        -f, --force           Force the specified targets/task to run (invalidating
                              any existing stamp file).
        -c CMD, --cmd=CMD     Specify the task to execute. The exact options
@@ -511,20 +504,9 @@
                              Read the specified file before bitbake.conf.
        -R POSTFILE, --postread=POSTFILE
                              Read the specified file after bitbake.conf.
-       -v, --verbose         Enable tracing of shell tasks (with 'set -x'). Also
-                             print bb.note(...) messages to stdout (in addition to
-                             writing them to ${T}/log.do_&lt;task&gt;).
+       -v, --verbose         Output more log message data to the terminal.
        -D, --debug           Increase the debug level. You can specify this more
-                             than once. -D sets the debug level to 1, where only
-                             bb.debug(1, ...) messages are printed to stdout; -DD
-                             sets the debug level to 2, where both bb.debug(1, ...)
-                             and bb.debug(2, ...) messages are printed; etc.
-                             Without -D, no debug messages are printed. Note that
-                             -D only affects output to stdout. All debug messages
-                             are written to ${T}/log.do_taskname, regardless of the
-                             debug level.
-       -q, --quiet           Output less log message data to the terminal. You can
-                             specify this more than once.
+                             than once.
        -n, --dry-run         Don't execute, just go through the motions.
        -S SIGNATURE_HANDLER, --dump-signatures=SIGNATURE_HANDLER
                              Dump out the signature construction information, with
@@ -547,38 +529,23 @@
        -l DEBUG_DOMAINS, --log-domains=DEBUG_DOMAINS
                              Show debug logging for the specified logging domains
        -P, --profile         Profile the command and save reports.
-       -u UI, --ui=UI        The user interface to use (knotty, ncurses or taskexp
-                             - default knotty).
+       -u UI, --ui=UI        The user interface to use (e.g. knotty, hob, depexp).
+       -t SERVERTYPE, --servertype=SERVERTYPE
+                             Choose which server to use, process or xmlrpc.
        --token=XMLRPCTOKEN   Specify the connection token to be used when
                              connecting to a remote server.
        --revisions-changed   Set the exit code depending on whether upstream
                              floating revisions have changed or not.
        --server-only         Run bitbake without a UI, only starting a server
                              (cooker) process.
-       -B BIND, --bind=BIND  The name/address for the bitbake xmlrpc server to bind
-                             to.
-       -T SERVER_TIMEOUT, --idle-timeout=SERVER_TIMEOUT
-                             Set timeout to unload bitbake server due to
-                             inactivity, set to -1 means no unload, default:
-                             Environment variable BB_SERVER_TIMEOUT.
+       -B BIND, --bind=BIND  The name/address for the bitbake server to bind to.
        --no-setscene         Do not run any setscene tasks. sstate will be ignored
                              and everything needed, built.
-       --setscene-only       Only run setscene tasks, don't run any real tasks.
        --remote-server=REMOTE_SERVER
                              Connect to the specified server.
-       -m, --kill-server     Terminate any running bitbake server.
+       -m, --kill-server     Terminate the remote server.
        --observe-only        Connect to a server as an observing-only client.
        --status-only         Check the status of the remote bitbake server.
-       -w WRITEEVENTLOG, --write-log=WRITEEVENTLOG
-                             Writes the event log of the build to a bitbake event
-                             json file. Use '' (empty string) to assign the name
-                             automatically.
-       --runall=RUNALL       Run the specified task for any recipe in the taskgraph
-                             of the specified target (even if it wouldn't otherwise
-                             have run).
-       --runonly=RUNONLY     Run only the specified task within the taskgraph of
-                             the specified targets (and any task dependencies those
-                             tasks may have).
                 </literallayout>
             </para>
         </section>
@@ -661,25 +628,6 @@
                 </para>
             </section>
 
-            <section id='executing-a-list-of-task-and-recipe-combinations'>
-                <title>Executing a List of Task and Recipe Combinations</title>
-
-                <para>
-                    The BitBake command line supports specifying different
-                    tasks for individual targets when you specify multiple
-                    targets.
-                    For example, suppose you had two targets (or recipes)
-                    <filename>myfirstrecipe</filename> and
-                    <filename>mysecondrecipe</filename> and you needed
-                    BitBake to run <filename>taskA</filename> for the first
-                    recipe and <filename>taskB</filename> for the second
-                    recipe:
-                    <literallayout class='monospaced'>
-     $ bitbake myfirstrecipe:do_taskA mysecondrecipe:do_taskB
-                    </literallayout>
-                </para>
-            </section>
-
             <section id='generating-dependency-graphs'>
                 <title>Generating Dependency Graphs</title>
 
@@ -692,21 +640,21 @@
                 </para>
 
                 <para>
-                    When you generate a dependency graph, BitBake writes three files
+                    When you generate a dependency graph, BitBake writes four files
                     to the current working directory:
                     <itemizedlist>
-                        <listitem><para>
-                            <emphasis><filename>recipe-depends.dot</filename>:</emphasis>
-                            Shows dependencies between recipes (i.e. a collapsed version of
-                            <filename>task-depends.dot</filename>).
+                        <listitem><para><emphasis><filename>package-depends.dot</filename>:</emphasis>
+                            Shows BitBake's knowledge of dependencies between
+                            runtime targets.
                             </para></listitem>
-                        <listitem><para>
-                            <emphasis><filename>task-depends.dot</filename>:</emphasis>
+                        <listitem><para><emphasis><filename>pn-depends.dot</filename>:</emphasis>
+                            Shows dependencies between build-time targets
+                            (i.e. recipes).
+                            </para></listitem>
+                        <listitem><para><emphasis><filename>task-depends.dot</filename>:</emphasis>
                             Shows dependencies between tasks.
-                            These dependencies match BitBake's internal task execution list.
                             </para></listitem>
-                        <listitem><para>
-                            <emphasis><filename>pn-buildlist</filename>:</emphasis>
+                        <listitem><para><emphasis><filename>pn-buildlist</filename>:</emphasis>
                             Shows a simple list of targets that are to be built.
                             </para></listitem>
                     </itemizedlist>
@@ -732,163 +680,6 @@
                     </literallayout>
                 </para>
             </section>
-
-            <section id='executing-a-multiple-configuration-build'>
-                <title>Executing a Multiple Configuration Build</title>
-
-                <para>
-                    BitBake is able to build multiple images or packages
-                    using a single command where the different targets
-                    require different configurations (multiple configuration
-                    builds).
-                    Each target, in this scenario, is referred to as a
-                    "multiconfig".
-                </para>
-
-                <para>
-                    To accomplish a multiple configuration build, you must
-                    define each target's configuration separately using
-                    a parallel configuration file in the build directory.
-                    The location for these multiconfig configuration files
-                    is specific.
-                    They must reside in the current build directory in
-                    a sub-directory of <filename>conf</filename> named
-                    <filename>multiconfig</filename>.
-                    Following is an example for two separate targets:
-                    <imagedata fileref="figures/bb_multiconfig_files.png" align="center" width="4in" depth="3in" />
-                </para>
-
-                <para>
-                    The reason for this required file hierarchy
-                    is because the <filename>BBPATH</filename> variable
-                    is not constructed until the layers are parsed.
-                    Consequently, using the configuration file as a
-                    pre-configuration file is not possible unless it is
-                    located in the current working directory.
-                </para>
-
-                <para>
-                    Minimally, each configuration file must define the
-                    machine and the temporary directory BitBake uses
-                    for the build.
-                    Suggested practice dictates that you do not
-                    overlap the temporary directories used during the
-                    builds.
-                </para>
-
-                <para>
-                    Aside from separate configuration files for each
-                    target, you must also enable BitBake to perform multiple
-                    configuration builds.
-                    Enabling is accomplished by setting the
-                    <link linkend='var-bb-BBMULTICONFIG'><filename>BBMULTICONFIG</filename></link>
-                    variable in the <filename>local.conf</filename>
-                    configuration file.
-                    As an example, suppose you had configuration files
-                    for <filename>target1</filename> and
-                    <filename>target2</filename> defined in the build
-                    directory.
-                    The following statement in the
-                    <filename>local.conf</filename> file both enables
-                    BitBake to perform multiple configuration builds and
-                    specifies the two multiconfigs:
-                    <literallayout class='monospaced'>
-     BBMULTICONFIG = "target1 target2"
-                    </literallayout>
-                </para>
-
-                <para>
-                    Once the target configuration files are in place and
-                    BitBake has been enabled to perform multiple configuration
-                    builds, use the following command form to start the
-                    builds:
-                    <literallayout class='monospaced'>
-     $ bitbake [multiconfig:<replaceable>multiconfigname</replaceable>:]<replaceable>target</replaceable> [[[multiconfig:<replaceable>multiconfigname</replaceable>:]<replaceable>target</replaceable>] ... ]
-                    </literallayout>
-                    Here is an example for two multiconfigs:
-                    <filename>target1</filename> and
-                    <filename>target2</filename>:
-                    <literallayout class='monospaced'>
-     $ bitbake multiconfig:target1:<replaceable>target</replaceable> multiconfig:target2:<replaceable>target</replaceable>
-                    </literallayout>
-                </para>
-            </section>
-
-            <section id='bb-enabling-multiple-configuration-build-dependencies'>
-                <title>Enabling Multiple Configuration Build Dependencies</title>
-
-                <para>
-                    Sometimes dependencies can exist between targets
-                    (multiconfigs) in a multiple configuration build.
-                    For example, suppose that in order to build an image
-                    for a particular architecture, the root filesystem of
-                    another build for a different architecture needs to
-                    exist.
-                    In other words, the image for the first multiconfig depends
-                    on the root filesystem of the second multiconfig.
-                    This dependency is essentially that the task in the recipe
-                    that builds one multiconfig is dependent on the
-                    completion of the task in the recipe that builds
-                    another multiconfig.
-                </para>
-
-                <para>
-                    To enable dependencies in a multiple configuration
-                    build, you must declare the dependencies in the recipe
-                    using the following statement form:
-                    <literallayout class='monospaced'>
-     <replaceable>task_or_package</replaceable>[mcdepends] = "multiconfig:<replaceable>from_multiconfig</replaceable>:<replaceable>to_multiconfig</replaceable>:<replaceable>recipe_name</replaceable>:<replaceable>task_on_which_to_depend</replaceable>"
-                    </literallayout>
-                    To better show how to use this statement, consider an
-                    example with two multiconfigs: <filename>target1</filename>
-                    and <filename>target2</filename>:
-                    <literallayout class='monospaced'>
-     <replaceable>image_task</replaceable>[mcdepends] = "multiconfig:target1:target2:<replaceable>image2</replaceable>:<replaceable>rootfs_task</replaceable>"
-                    </literallayout>
-                    In this example, the
-                    <replaceable>from_multiconfig</replaceable> is "target1" and
-                    the <replaceable>to_multiconfig</replaceable> is "target2".
-                    The task on which the image whose recipe contains
-                    <replaceable>image_task</replaceable> depends on the
-                    completion of the <replaceable>rootfs_task</replaceable>
-                    used to build out <replaceable>image2</replaceable>, which
-                    is associated with the "target2" multiconfig.
-               </para>
-
-               <para>
-                   Once you set up this dependency, you can build the
-                   "target1" multiconfig using a BitBake command as follows:
-                   <literallayout class='monospaced'>
-     $ bitbake multiconfig:target1:<replaceable>image1</replaceable>
-                   </literallayout>
-                   This command executes all the tasks needed to create
-                   <replaceable>image1</replaceable> for the "target1"
-                   multiconfig.
-                   Because of the dependency, BitBake also executes through
-                   the <replaceable>rootfs_task</replaceable> for the "target2"
-                   multiconfig build.
-               </para>
-
-               <para>
-                   Having a recipe depend on the root filesystem of another
-                   build might not seem that useful.
-                   Consider this change to the statement in the
-                   <replaceable>image1</replaceable> recipe:
-                   <literallayout class='monospaced'>
-     <replaceable>image_task</replaceable>[mcdepends] = "multiconfig:target1:target2:<replaceable>image2</replaceable>:<replaceable>image_task</replaceable>"
-                   </literallayout>
-                   In this case, BitBake must create
-                   <replaceable>image2</replaceable> for the "target2"
-                   build since the "target1" build depends on it.
-               </para>
-
-               <para>
-                   Because "target1" and "target2" are enabled for multiple
-                   configuration builds and have separate configuration
-                   files, BitBake places the artifacts for each build in the
-                   respective temporary build directories.
-               </para>
-            </section>
         </section>
     </section>
 </chapter>

bitbake/doc/bitbake-user-manual/bitbake-user-manual.xml

@@ -56,7 +56,7 @@
 -->
 
         <copyright>
-            <year>2004-2018</year>
+            <year>2004-2015</year>
             <holder>Richard Purdie</holder>
             <holder>Chris Larson</holder>
             <holder>and Phil Blundell</holder>

bitbake/doc/bitbake.1

@@ -105,7 +105,7 @@ Show debug logging for the specified logging domains
 profile the command and print a report
 .TP
 .B \-uUI, \-\-ui=UI
-User interface to use. Currently, knotty, taskexp or ncurses can be specified as UI.
+User interface to use. Currently, hob, depexp, goggle or ncurses can be specified as UI.
 .TP
 .B \-tSERVERTYPE, \-\-servertype=SERVERTYPE
 Choose which server to use, none, process or xmlrpc.

bitbake/doc/poky.ent

@@ -17,6 +17,13 @@
 <!ENTITY OE_DOCS_URL "http://docs.openembedded.org">
 <!ENTITY OH_HOME_URL "http://o-hand.com">
 <!ENTITY BITBAKE_HOME_URL "http://developer.berlios.de/projects/bitbake/">
+<!ENTITY ECLIPSE_MAIN_URL "http://www.eclipse.org/downloads">
+<!ENTITY ECLIPSE_DL_URL "http://download.eclipse.org">
+<!ENTITY ECLIPSE_DL_PLUGIN_URL "&YOCTO_DL_URL;/releases/eclipse-plugin/&DISTRO;">
+<!ENTITY ECLIPSE_UPDATES_URL "&ECLIPSE_DL_URL;/tm/updates/3.3">
+<!ENTITY ECLIPSE_INDIGO_URL "&ECLIPSE_DL_URL;/releases/indigo">
+<!ENTITY ECLIPSE_JUNO_URL "&ECLIPSE_DL_URL;/releases/juno">
+<!ENTITY ECLIPSE_INDIGO_CDT_URL "&ECLIPSE_DL_URL;tools/cdt/releases/indigo">
 <!ENTITY YOCTO_DOCS_URL "&YOCTO_HOME_URL;/docs">
 <!ENTITY YOCTO_SOURCES_URL "&YOCTO_HOME_URL;/sources/">
 <!ENTITY YOCTO_AB_PORT_URL "&YOCTO_AB_URL;:8010">
@@ -24,6 +31,7 @@
 <!ENTITY YOCTO_POKY_URL "&YOCTO_DL_URL;/releases/poky/">
 <!ENTITY YOCTO_RELEASE_DL_URL "&YOCTO_DL_URL;/releases/yocto/yocto-&DISTRO;">
 <!ENTITY YOCTO_TOOLCHAIN_DL_URL "&YOCTO_RELEASE_DL_URL;/toolchain/">
+<!ENTITY YOCTO_ECLIPSE_DL_URL "&YOCTO_RELEASE_DL_URL;/eclipse-plugin/indigo;">
 <!ENTITY YOCTO_ADTINSTALLER_DL_URL "&YOCTO_RELEASE_DL_URL;/adt_installer">
 <!ENTITY YOCTO_POKY_DL_URL "&YOCTO_RELEASE_DL_URL;/&YOCTO_POKY;.tar.bz2">
 <!ENTITY YOCTO_MACHINES_DL_URL "&YOCTO_RELEASE_DL_URL;/machines">

bitbake/lib/bb/COW.py

@@ -3,7 +3,7 @@
 #
 # This is a copy on write dictionary and set which abuses classes to try and be nice and fast.
 #
-# Copyright (C) 2006 Tim Ansell
+# Copyright (C) 2006 Tim Amsell
 #
 # This program is free software; you can redistribute it and/or modify
 # it under the terms of the GNU General Public License version 2 as
@@ -23,17 +23,19 @@
 # Assign a file to __warn__ to get warnings about slow operations.
 #
 
-
+from __future__ import print_function
 import copy
 import types
 ImmutableTypes = (
+    types.NoneType,
     bool,
     complex,
     float,
     int,
+    long,
     tuple,
     frozenset,
-    str
+    basestring
 )
 
 MUTABLE = "__mutable__"
@@ -59,7 +61,7 @@ class COWDictMeta(COWMeta):
     __call__ = cow
 
     def __setitem__(cls, key, value):
-        if value is not None and not isinstance(value, ImmutableTypes):
+        if not isinstance(value, ImmutableTypes):
             if not isinstance(value, COWMeta):
                 cls.__hasmutable__ = True
             key += MUTABLE
@@ -114,7 +116,7 @@ class COWDictMeta(COWMeta):
         cls.__setitem__(key, cls.__marker__)
 
     def __revertitem__(cls, key):
-        if key not in cls.__dict__:
+        if not cls.__dict__.has_key(key):
             key += MUTABLE
         delattr(cls, key)
 
@@ -150,7 +152,7 @@ class COWDictMeta(COWMeta):
                 yield value
             if type == "items":
                 yield (key, value)
-        return
+        raise StopIteration()
 
     def iterkeys(cls):
         return cls.iter("keys")
@@ -181,7 +183,7 @@ class COWSetMeta(COWDictMeta):
         COWDictMeta.__delitem__(cls, repr(hash(value)))
 
     def __in__(cls, value):
-        return repr(hash(value)) in COWDictMeta
+        return COWDictMeta.has_key(repr(hash(value)))
 
     def iterkeys(cls):
         raise TypeError("sets don't have keys")
@@ -190,10 +192,12 @@ class COWSetMeta(COWDictMeta):
         raise TypeError("sets don't have 'items'")
 
 # These are the actual classes you use!
-class COWDictBase(object, metaclass = COWDictMeta):
+class COWDictBase(object):
+    __metaclass__ = COWDictMeta
     __count__ = 0
 
-class COWSetBase(object, metaclass = COWSetMeta):
+class COWSetBase(object):
+    __metaclass__ = COWSetMeta
     __count__ = 0
 
 if __name__ == "__main__":
@@ -283,7 +287,7 @@ if __name__ == "__main__":
     except KeyError:
         print("Yay! deleted key raises error")
 
-    if 'b' in b:
+    if b.has_key('b'):
         print("Boo!")
     else:
         print("Yay - has_key with delete works!")

bitbake/lib/bb/__init__.py

@@ -21,11 +21,11 @@
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
-__version__ = "1.42.0"
+__version__ = "1.24.0"
 
 import sys
-if sys.version_info < (3, 4, 0):
-    raise RuntimeError("Sorry, python 3.4.0 or later is required for this version of bitbake")
+if sys.version_info < (2, 7, 3):
+    raise RuntimeError("Sorry, python 2.7.3 or later is required for this version of bitbake")
 
 
 class BBHandledException(Exception):
@@ -63,10 +63,6 @@ class BBLogger(Logger):
     def verbose(self, msg, *args, **kwargs):
         return self.log(logging.INFO - 1, msg, *args, **kwargs)
 
-    def verbnote(self, msg, *args, **kwargs):
-        return self.log(logging.INFO + 2, msg, *args, **kwargs)
-
-
 logging.raiseExceptions = False
 logging.setLoggerClass(BBLogger)
 
@@ -74,8 +70,6 @@ logger = logging.getLogger("BitBake")
 logger.addHandler(NullHandler())
 logger.setLevel(logging.DEBUG - 2)
 
-mainlogger = logging.getLogger("BitBake.Main")
-
 # This has to be imported after the setLoggerClass, as the import of bb.msg
 # can result in construction of the various loggers.
 import bb.msg
@@ -85,38 +79,26 @@ sys.modules['bb.fetch'] = sys.modules['bb.fetch2']
 
 # Messaging convenience functions
 def plain(*args):
-    mainlogger.plain(''.join(args))
+    logger.plain(''.join(args))
 
 def debug(lvl, *args):
-    if isinstance(lvl, str):
-        mainlogger.warning("Passed invalid debug level '%s' to bb.debug", lvl)
+    if isinstance(lvl, basestring):
+        logger.warn("Passed invalid debug level '%s' to bb.debug", lvl)
         args = (lvl,) + args
         lvl = 1
-    mainlogger.debug(lvl, ''.join(args))
+    logger.debug(lvl, ''.join(args))
 
 def note(*args):
-    mainlogger.info(''.join(args))
+    logger.info(''.join(args))
 
-#
-# A higher prioity note which will show on the console but isn't a warning
-#
-# Something is happening the user should be aware of but they probably did
-# something to make it happen
-#
-def verbnote(*args):
-    mainlogger.verbnote(''.join(args))
-
-#
-# Warnings - things the user likely needs to pay attention to and fix
-#
 def warn(*args):
-    mainlogger.warning(''.join(args))
+    logger.warn(''.join(args))
 
-def error(*args, **kwargs):
-    mainlogger.error(''.join(args), extra=kwargs)
+def error(*args):
+    logger.error(''.join(args))
 
-def fatal(*args, **kwargs):
-    mainlogger.critical(''.join(args), extra=kwargs)
+def fatal(*args):
+    logger.critical(''.join(args))
     raise BBHandledException()
 
 def deprecated(func, name=None, advice=""):

bitbake/lib/bb/build.py

@@ -31,41 +31,23 @@ import logging
 import shlex
 import glob
 import time
-import stat
 import bb
 import bb.msg
 import bb.process
-import bb.progress
-from bb import data, event, utils
+from contextlib import nested
+from bb import event, utils
 
 bblogger = logging.getLogger('BitBake')
 logger = logging.getLogger('BitBake.Build')
 
-__mtime_cache = {}
-
-def cached_mtime_noerror(f):
-    if f not in __mtime_cache:
-        try:
-            __mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
-        except OSError:
-            return 0
-    return __mtime_cache[f]
-
-def reset_cache():
-    global __mtime_cache
-    __mtime_cache = {}
+NULL = open(os.devnull, 'r+')
 
 # When we execute a Python function, we'd like certain things
 # in all namespaces, hence we add them to __builtins__.
 # If we do not do this and use the exec globals, they will
 # not be available to subfunctions.
-if hasattr(__builtins__, '__setitem__'):
-    builtins = __builtins__
-else:
-    builtins = __builtins__.__dict__
-
-builtins['bb'] = bb
-builtins['os'] = os
+__builtins__['bb'] = bb
+__builtins__['os'] = os
 
 class FuncFailed(Exception):
     def __init__(self, name = None, logfile = None):
@@ -89,14 +71,13 @@ class TaskBase(event.Event):
 
     def __init__(self, t, logfile, d):
         self._task = t
-        self._package = d.getVar("PF")
-        self._mc = d.getVar("BB_CURRENT_MC")
-        self.taskfile = d.getVar("FILE")
+        self._package = d.getVar("PF", True)
+        self.taskfile = d.getVar("FILE", True)
         self.taskname = self._task
         self.logfile = logfile
         self.time = time.time()
         event.Event.__init__(self)
-        self._message = "recipe %s: task %s: %s" % (d.getVar("PF"), t, self.getDisplayName())
+        self._message = "recipe %s: task %s: %s" % (d.getVar("PF", True), t, self.getDisplayName())
 
     def getTask(self):
         return self._task
@@ -137,25 +118,6 @@ class TaskInvalid(TaskBase):
         super(TaskInvalid, self).__init__(task, None, metadata)
         self._message = "No such task '%s'" % task
 
-class TaskProgress(event.Event):
-    """
-    Task made some progress that could be reported to the user, usually in
-    the form of a progress bar or similar.
-    NOTE: this class does not inherit from TaskBase since it doesn't need
-    to - it's fired within the task context itself, so we don't have any of
-    the context information that you do in the case of the other events.
-    The event PID can be used to determine which task it came from.
-    The progress value is normally 0-100, but can also be negative
-    indicating that progress has been made but we aren't able to determine
-    how much.
-    The rate is optional, this is simply an extra string to display to the
-    user if specified.
-    """
-    def __init__(self, progress, rate=None):
-        self.progress = progress
-        self.rate = rate
-        event.Event.__init__(self)
-
 
 class LogTee(object):
     def __init__(self, logger, outfile):
@@ -179,27 +141,23 @@ class LogTee(object):
     def flush(self):
         self.outfile.flush()
 
-#
-# pythonexception allows the python exceptions generated to be raised
-# as the real exceptions (not FuncFailed) and without a backtrace at the 
-# origin of the failure.
-#
-def exec_func(func, d, dirs = None, pythonexception=False):
+def exec_func(func, d, dirs = None):
     """Execute a BB 'function'"""
 
-    try:
-        oldcwd = os.getcwd()
-    except:
-        oldcwd = None
+    body = d.getVar(func)
+    if not body:
+        if body is None:
+            logger.warn("Function %s doesn't exist", func)
+        return
 
     flags = d.getVarFlags(func)
-    cleandirs = flags.get('cleandirs') if flags else None
+    cleandirs = flags.get('cleandirs')
     if cleandirs:
         for cdir in d.expand(cleandirs).split():
             bb.utils.remove(cdir, True)
             bb.utils.mkdirhier(cdir)
 
-    if flags and dirs is None:
+    if dirs is None:
         dirs = flags.get('dirs')
         if dirs:
             dirs = d.expand(dirs).split()
@@ -209,13 +167,8 @@ def exec_func(func, d, dirs = None, pythonexception=False):
             bb.utils.mkdirhier(adir)
         adir = dirs[-1]
     else:
-        adir = None
-
-    body = d.getVar(func, False)
-    if not body:
-        if body is None:
-            logger.warning("Function %s doesn't exist", func)
-        return
+        adir = d.getVar('B', True)
+        bb.utils.mkdirhier(adir)
 
     ispython = flags.get('python')
 
@@ -225,17 +178,17 @@ def exec_func(func, d, dirs = None, pythonexception=False):
     else:
         lockfiles = None
 
-    tempdir = d.getVar('T')
+    tempdir = d.getVar('T', True)
 
     # or func allows items to be executed outside of the normal
     # task set, such as buildhistory
-    task = d.getVar('BB_RUNTASK') or func
+    task = d.getVar('BB_RUNTASK', True) or func
     if task == func:
         taskfunc = task
     else:
         taskfunc = "%s.%s" % (task, func)
 
-    runfmt = d.getVar('BB_RUNFMT') or "run.{func}.{pid}"
+    runfmt = d.getVar('BB_RUNFMT', True) or "run.{func}.{pid}"
     runfn = runfmt.format(taskfunc=taskfunc, task=task, func=func, pid=os.getpid())
     runfile = os.path.join(tempdir, runfn)
     bb.utils.mkdirhier(os.path.dirname(runfile))
@@ -256,30 +209,22 @@ def exec_func(func, d, dirs = None, pythonexception=False):
 
     with bb.utils.fileslocked(lockfiles):
         if ispython:
-            exec_func_python(func, d, runfile, cwd=adir, pythonexception=pythonexception)
+            exec_func_python(func, d, runfile, cwd=adir)
         else:
             exec_func_shell(func, d, runfile, cwd=adir)
 
-    try:
-        curcwd = os.getcwd()
-    except:
-        curcwd = None
-
-    if oldcwd and curcwd != oldcwd:
-        try:
-            bb.warn("Task %s changed cwd to %s" % (func, curcwd))
-            os.chdir(oldcwd)
-        except:
-            pass
-
 _functionfmt = """
+def {function}(d):
+{body}
+
 {function}(d)
 """
 logformatter = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
-def exec_func_python(func, d, runfile, cwd=None, pythonexception=False):
+def exec_func_python(func, d, runfile, cwd=None):
     """Execute a python BB 'function'"""
 
-    code = _functionfmt.format(function=func)
+    bbfile = d.getVar('FILE', True)
+    code = _functionfmt.format(function=func, body=d.getVar(func, True))
     bb.utils.mkdirhier(os.path.dirname(runfile))
     with open(runfile, 'w') as script:
         bb.data.emit_func_python(func, script, d)
@@ -287,27 +232,18 @@ def exec_func_python(func, d, runfile, cwd=None, pythonexception=False):
     if cwd:
         try:
             olddir = os.getcwd()
-        except OSError as e:
-            bb.warn("%s: Cannot get cwd: %s" % (func, e))
+        except OSError:
             olddir = None
         os.chdir(cwd)
 
     bb.debug(2, "Executing python function %s" % func)
 
     try:
-        text = "def %s(d):\n%s" % (func, d.getVar(func, False))
-        fn = d.getVarFlag(func, "filename", False)
-        lineno = int(d.getVarFlag(func, "lineno", False))
-        bb.methodpool.insert_method(func, text, fn, lineno - 1)
-
-        comp = utils.better_compile(code, func, "exec_python_func() autogenerated")
-        utils.better_exec(comp, {"d": d}, code, "exec_python_func() autogenerated", pythonexception=pythonexception)
+        comp = utils.better_compile(code, func, bbfile)
+        utils.better_exec(comp, {"d": d}, code, bbfile)
     except (bb.parse.SkipRecipe, bb.build.FuncFailed):
         raise
-    except Exception as e:
-        if pythonexception:
-            raise
-        logger.error(str(e))
+    except:
         raise FuncFailed(func, None)
     finally:
         bb.debug(2, "Python function %s finished" % func)
@@ -315,8 +251,8 @@ def exec_func_python(func, d, runfile, cwd=None, pythonexception=False):
         if cwd and olddir:
             try:
                 os.chdir(olddir)
-            except OSError as e:
-                bb.warn("%s: Cannot restore cwd %s: %s" % (func, olddir, e))
+            except OSError:
+                pass
 
 def shell_trap_code():
     return '''#!/bin/sh\n
@@ -326,8 +262,9 @@ bb_exit_handler() {
     case $ret in
     0)  ;;
     *)  case $BASH_VERSION in
-        "") echo "WARNING: exit code $ret from a shell command.";;
-        *)  echo "WARNING: ${BASH_SOURCE[0]}:${BASH_LINENO[0]} exit $ret from '$BASH_COMMAND'";;
+        "")   echo "WARNING: exit code $ret from a shell command.";;
+        *)    echo "WARNING: ${BASH_SOURCE[0]}:${BASH_LINENO[0]} exit $ret from
+  \"$BASH_COMMAND\"";;
         esac
         exit $ret
     esac
@@ -361,14 +298,14 @@ def exec_func_shell(func, d, runfile, cwd=None):
 # cleanup
 ret=$?
 trap '' 0
-exit $ret
+exit $?
 ''')
 
-    os.chmod(runfile, 0o775)
+    os.chmod(runfile, 0775)
 
     cmd = runfile
-    if d.getVarFlag(func, 'fakeroot', False):
-        fakerootcmd = d.getVar('FAKEROOT')
+    if d.getVarFlag(func, 'fakeroot'):
+        fakerootcmd = d.getVar('FAKEROOT', True)
         if fakerootcmd:
             cmd = [fakerootcmd, runfile]
 
@@ -377,75 +314,14 @@ exit $ret
     else:
         logfile = sys.stdout
 
-    progress = d.getVarFlag(func, 'progress')
-    if progress:
-        if progress == 'percent':
-            # Use default regex
-            logfile = bb.progress.BasicProgressHandler(d, outfile=logfile)
-        elif progress.startswith('percent:'):
-            # Use specified regex
-            logfile = bb.progress.BasicProgressHandler(d, regex=progress.split(':', 1)[1], outfile=logfile)
-        elif progress.startswith('outof:'):
-            # Use specified regex
-            logfile = bb.progress.OutOfProgressHandler(d, regex=progress.split(':', 1)[1], outfile=logfile)
-        else:
-            bb.warn('%s: invalid task progress varflag value "%s", ignoring' % (func, progress))
+    bb.debug(2, "Executing shell function %s" % func)
 
-    fifobuffer = bytearray()
-    def readfifo(data):
-        nonlocal fifobuffer
-        fifobuffer.extend(data)
-        while fifobuffer:
-            message, token, nextmsg = fifobuffer.partition(b"\00")
-            if token:
-                splitval = message.split(b' ', 1)
-                cmd = splitval[0].decode("utf-8")
-                if len(splitval) > 1:
-                    value = splitval[1].decode("utf-8")
-                else:
-                    value = ''
-                if cmd == 'bbplain':
-                    bb.plain(value)
-                elif cmd == 'bbnote':
-                    bb.note(value)
-                elif cmd == 'bbwarn':
-                    bb.warn(value)
-                elif cmd == 'bberror':
-                    bb.error(value)
-                elif cmd == 'bbfatal':
-                    # The caller will call exit themselves, so bb.error() is
-                    # what we want here rather than bb.fatal()
-                    bb.error(value)
-                elif cmd == 'bbfatal_log':
-                    bb.error(value, forcelog=True)
-                elif cmd == 'bbdebug':
-                    splitval = value.split(' ', 1)
-                    level = int(splitval[0])
-                    value = splitval[1]
-                    bb.debug(level, value)
-                else:
-                    bb.warn("Unrecognised command '%s' on FIFO" % cmd)
-                fifobuffer = nextmsg
-            else:
-                break
-
-    tempdir = d.getVar('T')
-    fifopath = os.path.join(tempdir, 'fifo.%s' % os.getpid())
-    if os.path.exists(fifopath):
-        os.unlink(fifopath)
-    os.mkfifo(fifopath)
-    with open(fifopath, 'r+b', buffering=0) as fifo:
-        try:
-            bb.debug(2, "Executing shell function %s" % func)
-
-            try:
-                with open(os.devnull, 'r+') as stdin:
-                    bb.process.run(cmd, shell=False, stdin=stdin, log=logfile, extrafiles=[(fifo,readfifo)])
-            except bb.process.CmdError:
-                logfn = d.getVar('BB_LOGFILE')
-                raise FuncFailed(func, logfn)
-        finally:
-            os.unlink(fifopath)
+    try:
+        with open(os.devnull, 'r+') as stdin:
+            bb.process.run(cmd, shell=False, stdin=stdin, log=logfile)
+    except bb.process.CmdError:
+        logfn = d.getVar('BB_LOGFILE', True)
+        raise FuncFailed(func, logfn)
 
     bb.debug(2, "Shell function %s finished" % func)
 
@@ -465,7 +341,7 @@ def _exec_task(fn, task, d, quieterr):
     Execution of a task involves a bit more setup than executing a function,
     running it with its own local metadata, and with some useful variables set.
     """
-    if not d.getVarFlag(task, 'task', False):
+    if not d.getVarFlag(task, 'task'):
         event.fire(TaskInvalid(task, d), d)
         logger.error("No such task: %s" % task)
         return 1
@@ -473,29 +349,22 @@ def _exec_task(fn, task, d, quieterr):
     logger.debug(1, "Executing task %s", task)
 
     localdata = _task_data(fn, task, d)
-    tempdir = localdata.getVar('T')
+    tempdir = localdata.getVar('T', True)
     if not tempdir:
         bb.fatal("T variable not set, unable to build")
 
     # Change nice level if we're asked to
-    nice = localdata.getVar("BB_TASK_NICE_LEVEL")
+    nice = localdata.getVar("BB_TASK_NICE_LEVEL", True)
     if nice:
         curnice = os.nice(0)
         nice = int(nice) - curnice
         newnice = os.nice(nice)
         logger.debug(1, "Renice to %s " % newnice)
-    ionice = localdata.getVar("BB_TASK_IONICE_LEVEL")
-    if ionice:
-        try:
-            cls, prio = ionice.split(".", 1)
-            bb.utils.ioprio_set(os.getpid(), int(cls), int(prio))
-        except:
-            bb.warn("Invalid ionice level %s" % ionice)
 
     bb.utils.mkdirhier(tempdir)
 
     # Determine the logfile to generate
-    logfmt = localdata.getVar('BB_LOGFMT') or 'log.{task}.{pid}'
+    logfmt = localdata.getVar('BB_LOGFMT', True) or 'log.{task}.{pid}'
     logbase = logfmt.format(task=task, pid=os.getpid())
 
     # Document the order of the tasks...
@@ -526,12 +395,10 @@ def _exec_task(fn, task, d, quieterr):
             self.triggered = False
             logging.Handler.__init__(self, logging.ERROR)
         def emit(self, record):
-            if getattr(record, 'forcelog', False):
-                self.triggered = False
-            else:
-                self.triggered = True
+            self.triggered = True
 
     # Handle logfiles
+    si = open('/dev/null', 'r')
     try:
         bb.utils.mkdirhier(os.path.dirname(logfn))
         logfile = open(logfn, 'w')
@@ -545,8 +412,7 @@ def _exec_task(fn, task, d, quieterr):
     ose = [os.dup(sys.stderr.fileno()), sys.stderr.fileno()]
 
     # Replace those fds with our own
-    with open('/dev/null', 'r') as si:
-        os.dup2(si.fileno(), osi[1])
+    os.dup2(si.fileno(), osi[1])
     os.dup2(logfile.fileno(), oso[1])
     os.dup2(logfile.fileno(), ose[1])
 
@@ -562,36 +428,24 @@ def _exec_task(fn, task, d, quieterr):
 
     localdata.setVar('BB_LOGFILE', logfn)
     localdata.setVar('BB_RUNTASK', task)
-    localdata.setVar('BB_TASK_LOGGER', bblogger)
 
     flags = localdata.getVarFlags(task)
 
+    event.fire(TaskStarted(task, logfn, flags, localdata), localdata)
     try:
-        try:
-            event.fire(TaskStarted(task, logfn, flags, localdata), localdata)
-        except (bb.BBHandledException, SystemExit):
-            return 1
-        except FuncFailed as exc:
+        for func in (prefuncs or '').split():
+            exec_func(func, localdata)
+        exec_func(task, localdata)
+        for func in (postfuncs or '').split():
+            exec_func(func, localdata)
+    except FuncFailed as exc:
+        if quieterr:
+            event.fire(TaskFailedSilent(task, logfn, localdata), localdata)
+        else:
+            errprinted = errchk.triggered
             logger.error(str(exc))
-            return 1
-
-        try:
-            for func in (prefuncs or '').split():
-                exec_func(func, localdata)
-            exec_func(task, localdata)
-            for func in (postfuncs or '').split():
-                exec_func(func, localdata)
-        except FuncFailed as exc:
-            if quieterr:
-                event.fire(TaskFailedSilent(task, logfn, localdata), localdata)
-            else:
-                errprinted = errchk.triggered
-                logger.error(str(exc))
-                event.fire(TaskFailed(task, logfn, localdata, errprinted), localdata)
-            return 1
-        except bb.BBHandledException:
-            event.fire(TaskFailed(task, logfn, localdata, True), localdata)
-            return 1
+            event.fire(TaskFailed(task, logfn, localdata, errprinted), localdata)
+        return 1
     finally:
         sys.stdout.flush()
         sys.stderr.flush()
@@ -607,6 +461,7 @@ def _exec_task(fn, task, d, quieterr):
         os.close(osi[0])
         os.close(oso[0])
         os.close(ose[0])
+        si.close()
 
         logfile.close()
         if os.path.exists(logfn) and os.path.getsize(logfn) == 0:
@@ -615,7 +470,7 @@ def _exec_task(fn, task, d, quieterr):
             bb.utils.remove(loglink)
     event.fire(TaskSucceeded(task, logfn, localdata), localdata)
 
-    if not localdata.getVarFlag(task, 'nostamp', False) and not localdata.getVarFlag(task, 'selfstamp', False):
+    if not localdata.getVarFlag(task, 'nostamp') and not localdata.getVarFlag(task, 'selfstamp'):
         make_stamp(task, localdata)
 
     return 0
@@ -623,11 +478,11 @@ def _exec_task(fn, task, d, quieterr):
 def exec_task(fn, task, d, profile = False):
     try:
         quieterr = False
-        if d.getVarFlag(task, "quieterrors", False) is not None:
+        if d.getVarFlag(task, "quieterrors") is not None:
             quieterr = True
 
         if profile:
-            profname = "profile-%s.log" % (d.getVar("PN") + "-" + task)
+            profname = "profile-%s.log" % (d.getVar("PN", True) + "-" + task)
             try:
                 import cProfile as profile
             except:
@@ -650,7 +505,7 @@ def exec_task(fn, task, d, profile = False):
             event.fire(failedevent, d)
         return 1
 
-def stamp_internal(taskname, d, file_name, baseonly=False, noextra=False):
+def stamp_internal(taskname, d, file_name, baseonly=False):
     """
     Internal stamp helper function
     Makes sure the stamp directory exists
@@ -664,17 +519,15 @@ def stamp_internal(taskname, d, file_name, baseonly=False, noextra=False):
         taskflagname = taskname.replace("_setscene", "")
 
     if file_name:
-        stamp = d.stamp[file_name]
+        stamp = d.stamp_base[file_name].get(taskflagname) or d.stamp[file_name]
         extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
     else:
-        stamp = d.getVar('STAMP')
-        file_name = d.getVar('BB_FILENAME')
-        extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info') or ""
+        stamp = d.getVarFlag(taskflagname, 'stamp-base', True) or d.getVar('STAMP', True)
+        file_name = d.getVar('BB_FILENAME', True)
+        extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
 
     if baseonly:
         return stamp
-    if noextra:
-        extrainfo = ""
 
     if not stamp:
         return
@@ -682,7 +535,7 @@ def stamp_internal(taskname, d, file_name, baseonly=False, noextra=False):
     stamp = bb.parse.siggen.stampfile(stamp, file_name, taskname, extrainfo)
 
     stampdir = os.path.dirname(stamp)
-    if cached_mtime_noerror(stampdir) == 0:
+    if bb.parse.cached_mtime_noerror(stampdir) == 0:
         bb.utils.mkdirhier(stampdir)
 
     return stamp
@@ -700,12 +553,12 @@ def stamp_cleanmask_internal(taskname, d, file_name):
         taskflagname = taskname.replace("_setscene", "")
 
     if file_name:
-        stamp = d.stampclean[file_name]
+        stamp = d.stamp_base_clean[file_name].get(taskflagname) or d.stampclean[file_name]
         extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
     else:
-        stamp = d.getVar('STAMPCLEAN')
-        file_name = d.getVar('BB_FILENAME')
-        extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info') or ""
+        stamp = d.getVarFlag(taskflagname, 'stamp-base-clean', True) or d.getVar('STAMPCLEAN', True)
+        file_name = d.getVar('BB_FILENAME', True)
+        extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info', True) or ""
 
     if not stamp:
         return []
@@ -723,7 +576,7 @@ def make_stamp(task, d, file_name = None):
     for mask in cleanmask:
         for name in glob.glob(mask):
             # Preserve sigdata files in the stamps directory
-            if "sigdata" in name or "sigbasedata" in name:
+            if "sigdata" in name:
                 continue
             # Preserve taint files in the stamps directory
             if name.endswith('.taint'):
@@ -741,7 +594,7 @@ def make_stamp(task, d, file_name = None):
     # as it completes
     if not task.endswith("_setscene") and task != "do_setscene" and not file_name:
         stampbase = stamp_internal(task, d, None, True)
-        file_name = d.getVar('BB_FILENAME')
+        file_name = d.getVar('BB_FILENAME', True)
         bb.parse.siggen.dump_sigtask(file_name, task, stampbase, True)
 
 def del_stamp(task, d, file_name = None):
@@ -763,22 +616,22 @@ def write_taint(task, d, file_name = None):
     if file_name:
         taintfn = d.stamp[file_name] + '.' + task + '.taint'
     else:
-        taintfn = d.getVar('STAMP') + '.' + task + '.taint'
+        taintfn = d.getVar('STAMP', True) + '.' + task + '.taint'
     bb.utils.mkdirhier(os.path.dirname(taintfn))
     # The specific content of the taint file is not really important,
     # we just need it to be random, so a random UUID is used
     with open(taintfn, 'w') as taintf:
         taintf.write(str(uuid.uuid4()))
 
-def stampfile(taskname, d, file_name = None, noextra=False):
+def stampfile(taskname, d, file_name = None):
     """
     Return the stamp for a given task
     (d can be a data dict or dataCache)
     """
-    return stamp_internal(taskname, d, file_name, noextra=noextra)
+    return stamp_internal(taskname, d, file_name)
 
-def add_tasks(tasklist, d):
-    task_deps = d.getVar('_task_deps', False)
+def add_tasks(tasklist, deltasklist, d):
+    task_deps = d.getVar('_task_deps')
     if not task_deps:
         task_deps = {}
     if not 'tasks' in task_deps:
@@ -789,6 +642,9 @@ def add_tasks(tasklist, d):
     for task in tasklist:
         task = d.expand(task)
 
+        if task in deltasklist:
+            continue
+
         d.setVarFlag(task, 'task', 1)
 
         if not task in task_deps['tasks']:
@@ -801,7 +657,6 @@ def add_tasks(tasklist, d):
             if name in flags:
                 deptask = d.expand(flags[name])
                 task_deps[name][task] = deptask
-        getTask('mcdepends')
         getTask('depends')
         getTask('rdepends')
         getTask('deptask')
@@ -826,12 +681,12 @@ def addtask(task, before, after, d):
         task = "do_" + task
 
     d.setVarFlag(task, "task", 1)
-    bbtasks = d.getVar('__BBTASKS', False) or []
-    if task not in bbtasks:
+    bbtasks = d.getVar('__BBTASKS') or []
+    if not task in bbtasks:
         bbtasks.append(task)
     d.setVar('__BBTASKS', bbtasks)
 
-    existing = d.getVarFlag(task, "deps", False) or []
+    existing = d.getVarFlag(task, "deps") or []
     if after is not None:
         # set up deps for function
         for entry in after.split():
@@ -841,7 +696,7 @@ def addtask(task, before, after, d):
     if before is not None:
         # set up things that depend on this func
         for entry in before.split():
-            existing = d.getVarFlag(entry, "deps", False) or []
+            existing = d.getVarFlag(entry, "deps") or []
             if task not in existing:
                 d.setVarFlag(entry, "deps", [task] + existing)
 
@@ -849,64 +704,8 @@ def deltask(task, d):
     if task[:3] != "do_":
         task = "do_" + task
 
-    bbtasks = d.getVar('__BBTASKS', False) or []
-    if task in bbtasks:
-        bbtasks.remove(task)
-        d.delVarFlag(task, 'task')
-        d.setVar('__BBTASKS', bbtasks)
+    bbtasks = d.getVar('__BBDELTASKS') or []
+    if not task in bbtasks:
+        bbtasks.append(task)
+    d.setVar('__BBDELTASKS', bbtasks)
 
-    d.delVarFlag(task, 'deps')
-    for bbtask in d.getVar('__BBTASKS', False) or []:
-        deps = d.getVarFlag(bbtask, 'deps', False) or []
-        if task in deps:
-            deps.remove(task)
-            d.setVarFlag(bbtask, 'deps', deps)
-
-def preceedtask(task, with_recrdeptasks, d):
-    """
-    Returns a set of tasks in the current recipe which were specified as
-    precondition by the task itself ("after") or which listed themselves
-    as precondition ("before"). Preceeding tasks specified via the
-    "recrdeptask" are included in the result only if requested. Beware
-    that this may lead to the task itself being listed.
-    """
-    preceed = set()
-
-    # Ignore tasks which don't exist
-    tasks = d.getVar('__BBTASKS', False)
-    if task not in tasks:
-        return preceed
-
-    preceed.update(d.getVarFlag(task, 'deps') or [])
-    if with_recrdeptasks:
-        recrdeptask = d.getVarFlag(task, 'recrdeptask')
-        if recrdeptask:
-            preceed.update(recrdeptask.split())
-    return preceed
-
-def tasksbetween(task_start, task_end, d):
-    """
-    Return the list of tasks between two tasks in the current recipe,
-    where task_start is to start at and task_end is the task to end at
-    (and task_end has a dependency chain back to task_start).
-    """
-    outtasks = []
-    tasks = list(filter(lambda k: d.getVarFlag(k, "task"), d.keys()))
-    def follow_chain(task, endtask, chain=None):
-        if not chain:
-            chain = []
-        chain.append(task)
-        for othertask in tasks:
-            if othertask == task:
-                continue
-            if task == endtask:
-                for ctask in chain:
-                    if ctask not in outtasks:
-                        outtasks.append(ctask)
-            else:
-                deps = d.getVarFlag(othertask, 'deps', False)
-                if task in deps:
-                    follow_chain(othertask, endtask, chain)
-        chain.pop()
-    follow_chain(task_start, task_end)
-    return outtasks

bitbake/lib/bb/cache.py

@@ -28,16 +28,22 @@
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
+
 import os
-import sys
 import logging
-import pickle
 from collections import defaultdict
 import bb.utils
 
 logger = logging.getLogger("BitBake.Cache")
 
-__cache_version__ = "152"
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    logger.info("Importing cPickle failed. "
+                "Falling back to a very slow implementation.")
+
+__cache_version__ = "148"
 
 def getCacheFile(path, filename, data_hash):
     return os.path.join(path, filename + "." + data_hash)
@@ -71,33 +77,33 @@ class RecipeInfoCommon(object):
 
     @classmethod
     def flaglist(cls, flag, varlist, metadata, squash=False):
-        out_dict = dict((var, metadata.getVarFlag(var, flag))
+        out_dict = dict((var, metadata.getVarFlag(var, flag, True))
                     for var in varlist)
         if squash:
-            return dict((k,v) for (k,v) in out_dict.items() if v)
+            return dict((k,v) for (k,v) in out_dict.iteritems() if v)
         else:
             return out_dict
 
     @classmethod
-    def getvar(cls, var, metadata, expand = True):
-        return metadata.getVar(var, expand) or ''
+    def getvar(cls, var, metadata):
+        return metadata.getVar(var, True) or ''
 
 
 class CoreRecipeInfo(RecipeInfoCommon):
     __slots__ = ()
 
-    cachefile = "bb_cache.dat"
+    cachefile = "bb_cache.dat"   
 
-    def __init__(self, filename, metadata):
+    def __init__(self, filename, metadata):      
         self.file_depends = metadata.getVar('__depends', False)
         self.timestamp = bb.parse.cached_mtime(filename)
         self.variants = self.listvar('__VARIANTS', metadata) + ['']
         self.appends = self.listvar('__BBAPPEND', metadata)
-        self.nocache = self.getvar('BB_DONT_CACHE', metadata)
+        self.nocache = self.getvar('__BB_DONT_CACHE', metadata)
 
         self.skipreason = self.getvar('__SKIPPED', metadata)
         if self.skipreason:
-            self.pn = self.getvar('PN', metadata) or bb.parse.vars_from_file(filename,metadata)[0]
+            self.pn = self.getvar('PN', metadata) or bb.parse.BBHandler.vars_from_file(filename,metadata)[0]
             self.skipped = True
             self.provides  = self.depvar('PROVIDES', metadata)
             self.rprovides = self.depvar('RPROVIDES', metadata)
@@ -107,7 +113,7 @@ class CoreRecipeInfo(RecipeInfoCommon):
 
         self.pn = self.getvar('PN', metadata)
         self.packages = self.listvar('PACKAGES', metadata)
-        if not self.packages:
+        if not self.pn in self.packages:
             self.packages.append(self.pn)
 
         self.basetaskhashes = self.taskvar('BB_BASEHASH', self.tasks, metadata)
@@ -122,7 +128,9 @@ class CoreRecipeInfo(RecipeInfoCommon):
         self.defaultpref = self.intvar('DEFAULT_PREFERENCE', metadata)
         self.not_world = self.getvar('EXCLUDE_FROM_WORLD', metadata)
         self.stamp = self.getvar('STAMP', metadata)
-        self.stampclean = self.getvar('STAMPCLEAN', metadata)
+        self.stampclean = self.getvar('STAMPCLEAN', metadata)        
+        self.stamp_base = self.flaglist('stamp-base', self.tasks, metadata)
+        self.stamp_base_clean = self.flaglist('stamp-base-clean', self.tasks, metadata)
         self.stamp_extrainfo = self.flaglist('stamp-extra-info', self.tasks, metadata)
         self.file_checksums = self.flaglist('file-checksums', self.tasks, metadata, True)
         self.packages_dynamic = self.listvar('PACKAGES_DYNAMIC', metadata)
@@ -134,11 +142,10 @@ class CoreRecipeInfo(RecipeInfoCommon):
         self.rprovides_pkg    = self.pkgvar('RPROVIDES', self.packages, metadata)
         self.rdepends_pkg     = self.pkgvar('RDEPENDS', self.packages, metadata)
         self.rrecommends_pkg  = self.pkgvar('RRECOMMENDS', self.packages, metadata)
-        self.inherits         = self.getvar('__inherit_cache', metadata, expand=False)
+        self.inherits         = self.getvar('__inherit_cache', metadata)
         self.fakerootenv      = self.getvar('FAKEROOTENV', metadata)
         self.fakerootdirs     = self.getvar('FAKEROOTDIRS', metadata)
         self.fakerootnoenv    = self.getvar('FAKEROOTNOENV', metadata)
-        self.extradepsfunc    = self.getvar('calculate_extra_depends', metadata)
 
     @classmethod
     def init_cacheData(cls, cachedata):
@@ -151,6 +158,8 @@ class CoreRecipeInfo(RecipeInfoCommon):
 
         cachedata.stamp = {}
         cachedata.stampclean = {}
+        cachedata.stamp_base = {}
+        cachedata.stamp_base_clean = {}
         cachedata.stamp_extrainfo = {}
         cachedata.file_checksums = {}
         cachedata.fn_provides = {}
@@ -174,7 +183,6 @@ class CoreRecipeInfo(RecipeInfoCommon):
         cachedata.fakerootenv = {}
         cachedata.fakerootnoenv = {}
         cachedata.fakerootdirs = {}
-        cachedata.extradepsfunc = {}
 
     def add_cacheData(self, cachedata, fn):
         cachedata.task_deps[fn] = self.task_deps
@@ -184,6 +192,8 @@ class CoreRecipeInfo(RecipeInfoCommon):
         cachedata.pkg_dp[fn] = self.defaultpref
         cachedata.stamp[fn] = self.stamp
         cachedata.stampclean[fn] = self.stampclean
+        cachedata.stamp_base[fn] = self.stamp_base
+        cachedata.stamp_base_clean[fn] = self.stamp_base_clean
         cachedata.stamp_extrainfo[fn] = self.stamp_extrainfo
         cachedata.file_checksums[fn] = self.file_checksums
 
@@ -210,14 +220,13 @@ class CoreRecipeInfo(RecipeInfoCommon):
             rprovides += self.rprovides_pkg[package]
 
         for rprovide in rprovides:
-            if fn not in cachedata.rproviders[rprovide]:
-                cachedata.rproviders[rprovide].append(fn)
+            cachedata.rproviders[rprovide].append(fn)
 
         for package in self.packages_dynamic:
             cachedata.packages_dynamic[package].append(fn)
 
         # Build hash of runtime depends and recommends
-        for package in self.packages:
+        for package in self.packages + [self.pn]:
             cachedata.rundeps[fn][package] = list(self.rdepends) + self.rdepends_pkg[package]
             cachedata.runrecs[fn][package] = list(self.rrecommends) + self.rrecommends_pkg[package]
 
@@ -234,7 +243,7 @@ class CoreRecipeInfo(RecipeInfoCommon):
         cachedata.universe_target.append(self.pn)
 
         cachedata.hashfn[fn] = self.hashfilename
-        for task, taskhash in self.basetaskhashes.items():
+        for task, taskhash in self.basetaskhashes.iteritems():
             identifier = '%s.%s' % (fn, task)
             cachedata.basetaskhash[identifier] = taskhash
 
@@ -242,146 +251,24 @@ class CoreRecipeInfo(RecipeInfoCommon):
         cachedata.fakerootenv[fn] = self.fakerootenv
         cachedata.fakerootnoenv[fn] = self.fakerootnoenv
         cachedata.fakerootdirs[fn] = self.fakerootdirs
-        cachedata.extradepsfunc[fn] = self.extradepsfunc
-
-def virtualfn2realfn(virtualfn):
-    """
-    Convert a virtual file name to a real one + the associated subclass keyword
-    """
-    mc = ""
-    if virtualfn.startswith('multiconfig:'):
-        elems = virtualfn.split(':')
-        mc = elems[1]
-        virtualfn = ":".join(elems[2:])
-
-    fn = virtualfn
-    cls = ""
-    if virtualfn.startswith('virtual:'):
-        elems = virtualfn.split(':')
-        cls = ":".join(elems[1:-1])
-        fn = elems[-1]
-
-    return (fn, cls, mc)
-
-def realfn2virtual(realfn, cls, mc):
-    """
-    Convert a real filename + the associated subclass keyword to a virtual filename
-    """
-    if cls:
-        realfn = "virtual:" + cls + ":" + realfn
-    if mc:
-        realfn = "multiconfig:" + mc + ":" + realfn
-    return realfn
-
-def variant2virtual(realfn, variant):
-    """
-    Convert a real filename + the associated subclass keyword to a virtual filename
-    """
-    if variant == "":
-        return realfn
-    if variant.startswith("multiconfig:"):
-        elems = variant.split(":")
-        if elems[2]:
-            return "multiconfig:" + elems[1] + ":virtual:" + ":".join(elems[2:]) + ":" + realfn
-        return "multiconfig:" + elems[1] + ":" + realfn
-    return "virtual:" + variant + ":" + realfn
-
-def parse_recipe(bb_data, bbfile, appends, mc=''):
-    """
-    Parse a recipe
-    """
-
-    chdir_back = False
-
-    bb_data.setVar("__BBMULTICONFIG", mc)
-
-    # expand tmpdir to include this topdir
-    bb_data.setVar('TMPDIR', bb_data.getVar('TMPDIR') or "")
-    bbfile_loc = os.path.abspath(os.path.dirname(bbfile))
-    oldpath = os.path.abspath(os.getcwd())
-    bb.parse.cached_mtime_noerror(bbfile_loc)
-
-    # The ConfHandler first looks if there is a TOPDIR and if not
-    # then it would call getcwd().
-    # Previously, we chdir()ed to bbfile_loc, called the handler
-    # and finally chdir()ed back, a couple of thousand times. We now
-    # just fill in TOPDIR to point to bbfile_loc if there is no TOPDIR yet.
-    if not bb_data.getVar('TOPDIR', False):
-        chdir_back = True
-        bb_data.setVar('TOPDIR', bbfile_loc)
-    try:
-        if appends:
-            bb_data.setVar('__BBAPPEND', " ".join(appends))
-        bb_data = bb.parse.handle(bbfile, bb_data)
-        if chdir_back:
-            os.chdir(oldpath)
-        return bb_data
-    except:
-        if chdir_back:
-            os.chdir(oldpath)
-        raise
 
 
 
-class NoCache(object):
-
-    def __init__(self, databuilder):
-        self.databuilder = databuilder
-        self.data = databuilder.data
-
-    def loadDataFull(self, virtualfn, appends):
-        """
-        Return a complete set of data for fn.
-        To do this, we need to parse the file.
-        """
-        logger.debug(1, "Parsing %s (full)" % virtualfn)
-        (fn, virtual, mc) = virtualfn2realfn(virtualfn)
-        bb_data = self.load_bbfile(virtualfn, appends, virtonly=True)
-        return bb_data[virtual]
-
-    def load_bbfile(self, bbfile, appends, virtonly = False):
-        """
-        Load and parse one .bb build file
-        Return the data and whether parsing resulted in the file being skipped
-        """
-
-        if virtonly:
-            (bbfile, virtual, mc) = virtualfn2realfn(bbfile)
-            bb_data = self.databuilder.mcdata[mc].createCopy()
-            bb_data.setVar("__ONLYFINALISE", virtual or "default")
-            datastores = parse_recipe(bb_data, bbfile, appends, mc)
-            return datastores
-
-        bb_data = self.data.createCopy()
-        datastores = parse_recipe(bb_data, bbfile, appends)
-
-        for mc in self.databuilder.mcdata:
-            if not mc:
-                continue
-            bb_data = self.databuilder.mcdata[mc].createCopy()
-            newstores = parse_recipe(bb_data, bbfile, appends, mc)
-            for ns in newstores:
-                datastores["multiconfig:%s:%s" % (mc, ns)] = newstores[ns]
-
-        return datastores
-
-class Cache(NoCache):
+class Cache(object):
     """
     BitBake Cache implementation
     """
 
-    def __init__(self, databuilder, data_hash, caches_array):
-        super().__init__(databuilder)
-        data = databuilder.data
-
+    def __init__(self, data, data_hash, caches_array):
         # Pass caches_array information into Cache Constructor
-        # It will be used later for deciding whether we
-        # need extra cache file dump/load support
+        # It will be used later for deciding whether we 
+        # need extra cache file dump/load support 
         self.caches_array = caches_array
-        self.cachedir = data.getVar("CACHE")
+        self.cachedir = data.getVar("CACHE", True)
         self.clean = set()
         self.checked = set()
         self.depends_cache = {}
+        self.data = None
         self.data_fn = None
         self.cacheclean = True
         self.data_hash = data_hash
@@ -395,87 +282,78 @@ class Cache(NoCache):
         self.has_cache = True
         self.cachefile = getCacheFile(self.cachedir, "bb_cache.dat", self.data_hash)
 
-        logger.debug(1, "Cache dir: %s", self.cachedir)
+        logger.debug(1, "Using cache in '%s'", self.cachedir)
         bb.utils.mkdirhier(self.cachedir)
 
         cache_ok = True
         if self.caches_array:
             for cache_class in self.caches_array:
-                cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
-                cache_ok = cache_ok and os.path.exists(cachefile)
-                cache_class.init_cacheData(self)
+                if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                    cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
+                    cache_ok = cache_ok and os.path.exists(cachefile)
+                    cache_class.init_cacheData(self)
         if cache_ok:
             self.load_cachefile()
         elif os.path.isfile(self.cachefile):
             logger.info("Out of date cache found, rebuilding...")
-        else:
-            logger.debug(1, "Cache file %s not found, building..." % self.cachefile)
 
     def load_cachefile(self):
+        # Firstly, using core cache file information for
+        # valid checking
+        with open(self.cachefile, "rb") as cachefile:
+            pickled = pickle.Unpickler(cachefile)
+            try:
+                cache_ver = pickled.load()
+                bitbake_ver = pickled.load()
+            except Exception:
+                logger.info('Invalid cache, rebuilding...')
+                return
+
+            if cache_ver != __cache_version__:
+                logger.info('Cache version mismatch, rebuilding...')
+                return
+            elif bitbake_ver != bb.__version__:
+                logger.info('Bitbake version mismatch, rebuilding...')
+                return
+
+
         cachesize = 0
         previous_progress = 0
         previous_percent = 0
 
         # Calculate the correct cachesize of all those cache files
         for cache_class in self.caches_array:
-            cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
-            with open(cachefile, "rb") as cachefile:
-                cachesize += os.fstat(cachefile.fileno()).st_size
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
+                with open(cachefile, "rb") as cachefile:
+                    cachesize += os.fstat(cachefile.fileno()).st_size
 
         bb.event.fire(bb.event.CacheLoadStarted(cachesize), self.data)
-
+        
         for cache_class in self.caches_array:
-            cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
-            logger.debug(1, 'Loading cache file: %s' % cachefile)
-            with open(cachefile, "rb") as cachefile:
-                pickled = pickle.Unpickler(cachefile)
-                # Check cache version information
-                try:
-                    cache_ver = pickled.load()
-                    bitbake_ver = pickled.load()
-                except Exception:
-                    logger.info('Invalid cache, rebuilding...')
-                    return
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
+                with open(cachefile, "rb") as cachefile:
+                    pickled = pickle.Unpickler(cachefile)                    
+                    while cachefile:
+                        try:
+                            key = pickled.load()
+                            value = pickled.load()
+                        except Exception:
+                            break
+                        if self.depends_cache.has_key(key):
+                            self.depends_cache[key].append(value)
+                        else:
+                            self.depends_cache[key] = [value]
+                        # only fire events on even percentage boundaries
+                        current_progress = cachefile.tell() + previous_progress
+                        current_percent = 100 * current_progress / cachesize
+                        if current_percent > previous_percent:
+                            previous_percent = current_percent
+                            bb.event.fire(bb.event.CacheLoadProgress(current_progress, cachesize),
+                                          self.data)
 
-                if cache_ver != __cache_version__:
-                    logger.info('Cache version mismatch, rebuilding...')
-                    return
-                elif bitbake_ver != bb.__version__:
-                    logger.info('Bitbake version mismatch, rebuilding...')
-                    return
-
-                # Load the rest of the cache file
-                current_progress = 0
-                while cachefile:
-                    try:
-                        key = pickled.load()
-                        value = pickled.load()
-                    except Exception:
-                        break
-                    if not isinstance(key, str):
-                        bb.warn("%s from extras cache is not a string?" % key)
-                        break
-                    if not isinstance(value, RecipeInfoCommon):
-                        bb.warn("%s from extras cache is not a RecipeInfoCommon class?" % value)
-                        break
-
-                    if key in self.depends_cache:
-                        self.depends_cache[key].append(value)
-                    else:
-                        self.depends_cache[key] = [value]
-                    # only fire events on even percentage boundaries
-                    current_progress = cachefile.tell() + previous_progress
-                    if current_progress > cachesize:
-                        # we might have calculated incorrect total size because a file
-                        # might've been written out just after we checked its size
-                        cachesize = current_progress
-                    current_percent = 100 * current_progress / cachesize
-                    if current_percent > previous_percent:
-                        previous_percent = current_percent
-                        bb.event.fire(bb.event.CacheLoadProgress(current_progress, cachesize),
-                                      self.data)
-
-                previous_progress += current_progress
+                    previous_progress += current_progress
 
         # Note: depends cache number is corresponding to the parsing file numbers.
         # The same file has several caches, still regarded as one item in the cache
@@ -483,33 +361,69 @@ class Cache(NoCache):
                                                   len(self.depends_cache)),
                       self.data)
 
-    def parse(self, filename, appends):
+    
+    @staticmethod
+    def virtualfn2realfn(virtualfn):
+        """
+        Convert a virtual file name to a real one + the associated subclass keyword
+        """
+
+        fn = virtualfn
+        cls = ""
+        if virtualfn.startswith('virtual:'):
+            elems = virtualfn.split(':')
+            cls = ":".join(elems[1:-1])
+            fn = elems[-1]
+        return (fn, cls)
+
+    @staticmethod
+    def realfn2virtual(realfn, cls):
+        """
+        Convert a real filename + the associated subclass keyword to a virtual filename
+        """
+        if cls == "":
+            return realfn
+        return "virtual:" + cls + ":" + realfn
+
+    @classmethod
+    def loadDataFull(cls, virtualfn, appends, cfgData):
+        """
+        Return a complete set of data for fn.
+        To do this, we need to parse the file.
+        """
+
+        (fn, virtual) = cls.virtualfn2realfn(virtualfn)
+
+        logger.debug(1, "Parsing %s (full)", fn)
+
+        cfgData.setVar("__ONLYFINALISE", virtual or "default")
+        bb_data = cls.load_bbfile(fn, appends, cfgData)
+        return bb_data[virtual]
+
+    @classmethod
+    def parse(cls, filename, appends, configdata, caches_array):
         """Parse the specified filename, returning the recipe information"""
-        logger.debug(1, "Parsing %s", filename)
         infos = []
-        datastores = self.load_bbfile(filename, appends)
+        datastores = cls.load_bbfile(filename, appends, configdata)
         depends = []
-        variants = []
-        # Process the "real" fn last so we can store variants list
-        for variant, data in sorted(datastores.items(),
+        for variant, data in sorted(datastores.iteritems(),
                                     key=lambda i: i[0],
                                     reverse=True):
-            virtualfn = variant2virtual(filename, variant)
-            variants.append(variant)
+            virtualfn = cls.realfn2virtual(filename, variant)
             depends = depends + (data.getVar("__depends", False) or [])
             if depends and not variant:
                 data.setVar("__depends", depends)
-            if virtualfn == filename:
-                data.setVar("__VARIANTS", " ".join(variants))
+
             info_array = []
-            for cache_class in self.caches_array:
-                info = cache_class(filename, data)
-                info_array.append(info)
+            for cache_class in caches_array:
+                if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                    info = cache_class(filename, data)
+                    info_array.append(info)
             infos.append((virtualfn, info_array))
 
         return infos
 
-    def load(self, filename, appends):
+    def load(self, filename, appends, configdata):
         """Obtain the recipe information for the specified filename,
         using cached values if available, otherwise parsing.
 
@@ -523,20 +437,21 @@ class Cache(NoCache):
             # info_array item is a list of [CoreRecipeInfo, XXXRecipeInfo]
             info_array = self.depends_cache[filename]
             for variant in info_array[0].variants:
-                virtualfn = variant2virtual(filename, variant)
+                virtualfn = self.realfn2virtual(filename, variant)
                 infos.append((virtualfn, self.depends_cache[virtualfn]))
         else:
+            logger.debug(1, "Parsing %s", filename)
             return self.parse(filename, appends, configdata, self.caches_array)
 
         return cached, infos
 
-    def loadData(self, fn, appends, cacheData):
+    def loadData(self, fn, appends, cfgData, cacheData):
         """Load the recipe info for the specified filename,
         parsing and adding to the cache if necessary, and adding
         the recipe information to the supplied CacheData instance."""
         skipped, virtuals = 0, 0
 
-        cached, infos = self.load(fn, appends)
+        cached, infos = self.load(fn, appends, cfgData)
         for virtualfn, info_array in infos:
             if info_array[0].skipped:
                 logger.debug(1, "Skipping %s: %s", virtualfn, info_array[0].skipreason)
@@ -613,20 +528,7 @@ class Cache(NoCache):
 
         if hasattr(info_array[0], 'file_checksums'):
             for _, fl in info_array[0].file_checksums.items():
-                fl = fl.strip()
-                while fl:
-                    # A .split() would be simpler but means spaces or colons in filenames would break
-                    a = fl.find(":True")
-                    b = fl.find(":False")
-                    if ((a < 0) and b) or ((b > 0) and (b < a)):
-                        f = fl[:b+6]
-                        fl = fl[b+7:]
-                    elif ((b < 0) and a) or ((a > 0) and (a < b)):
-                        f = fl[:a+5]
-                        fl = fl[a+6:]
-                    else:
-                        break
-                    fl = fl.strip()
+                for f in fl.split():
                     if "*" in f:
                         continue
                     f, exist = f.split(":")
@@ -644,19 +546,16 @@ class Cache(NoCache):
 
         invalid = False
         for cls in info_array[0].variants:
-            virtualfn = variant2virtual(fn, cls)
+            virtualfn = self.realfn2virtual(fn, cls)
             self.clean.add(virtualfn)
             if virtualfn not in self.depends_cache:
                 logger.debug(2, "Cache: %s is not cached", virtualfn)
                 invalid = True
-            elif len(self.depends_cache[virtualfn]) != len(self.caches_array):
-                logger.debug(2, "Cache: Extra caches missing for %s?" % virtualfn)
-                invalid = True
 
         # If any one of the variants is not present, mark as invalid for all
         if invalid:
             for cls in info_array[0].variants:
-                virtualfn = variant2virtual(fn, cls)
+                virtualfn = self.realfn2virtual(fn, cls)
                 if virtualfn in self.clean:
                     logger.debug(2, "Cache: Removing %s from cache", virtualfn)
                     self.clean.remove(virtualfn)
@@ -693,19 +592,30 @@ class Cache(NoCache):
             logger.debug(2, "Cache is clean, not saving.")
             return
 
+        file_dict = {}
+        pickler_dict = {}
         for cache_class in self.caches_array:
-            cache_class_name = cache_class.__name__
-            cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
-            with open(cachefile, "wb") as f:
-                p = pickle.Pickler(f, pickle.HIGHEST_PROTOCOL)
-                p.dump(__cache_version__)
-                p.dump(bb.__version__)
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                cache_class_name = cache_class.__name__
+                cachefile = getCacheFile(self.cachedir, cache_class.cachefile, self.data_hash)
+                file_dict[cache_class_name] = open(cachefile, "wb")
+                pickler_dict[cache_class_name] =  pickle.Pickler(file_dict[cache_class_name], pickle.HIGHEST_PROTOCOL)
+                   
+        pickler_dict['CoreRecipeInfo'].dump(__cache_version__)
+        pickler_dict['CoreRecipeInfo'].dump(bb.__version__)
 
-                for key, info_array in self.depends_cache.items():
-                    for info in info_array:
-                        if isinstance(info, RecipeInfoCommon) and info.__class__.__name__ == cache_class_name:
-                            p.dump(key)
-                            p.dump(info)
+        try:
+            for key, info_array in self.depends_cache.iteritems():
+                for info in info_array:
+                    if isinstance(info, RecipeInfoCommon):
+                        cache_class_name = info.__class__.__name__
+                        pickler_dict[cache_class_name].dump(key)
+                        pickler_dict[cache_class_name].dump(info)
+        finally:
+            for cache_class in self.caches_array:
+                if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                    cache_class_name = cache_class.__name__
+                    file_dict[cache_class_name].close()
 
         del self.depends_cache
 
@@ -733,13 +643,50 @@ class Cache(NoCache):
         Save data we need into the cache
         """
 
-        realfn = virtualfn2realfn(file_name)[0]
+        realfn = self.virtualfn2realfn(file_name)[0]
 
         info_array = []
         for cache_class in self.caches_array:
-            info_array.append(cache_class(realfn, data))
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                info_array.append(cache_class(realfn, data))
         self.add_info(file_name, info_array, cacheData, parsed)
 
+    @staticmethod
+    def load_bbfile(bbfile, appends, config):
+        """
+        Load and parse one .bb build file
+        Return the data and whether parsing resulted in the file being skipped
+        """
+        chdir_back = False
+
+        from bb import data, parse
+
+        # expand tmpdir to include this topdir
+        data.setVar('TMPDIR', data.getVar('TMPDIR', config, 1) or "", config)
+        bbfile_loc = os.path.abspath(os.path.dirname(bbfile))
+        oldpath = os.path.abspath(os.getcwd())
+        parse.cached_mtime_noerror(bbfile_loc)
+        bb_data = data.init_db(config)
+        # The ConfHandler first looks if there is a TOPDIR and if not
+        # then it would call getcwd().
+        # Previously, we chdir()ed to bbfile_loc, called the handler
+        # and finally chdir()ed back, a couple of thousand times. We now
+        # just fill in TOPDIR to point to bbfile_loc if there is no TOPDIR yet.
+        if not data.getVar('TOPDIR', bb_data):
+            chdir_back = True
+            data.setVar('TOPDIR', bbfile_loc, bb_data)
+        try:
+            if appends:
+                data.setVar('__BBAPPEND', " ".join(appends), bb_data)
+            bb_data = parse.handle(bbfile, bb_data)
+            if chdir_back:
+                os.chdir(oldpath)
+            return bb_data
+        except:
+            if chdir_back:
+                os.chdir(oldpath)
+            raise
+
 
 def init(cooker):
     """
@@ -769,9 +716,8 @@ class CacheData(object):
     def __init__(self, caches_array):
         self.caches_array = caches_array
         for cache_class in self.caches_array:
-            if not issubclass(cache_class, RecipeInfoCommon):
-                bb.error("Extra cache data class %s should subclass RecipeInfoCommon class" % cache_class)
-            cache_class.init_cacheData(self)
+            if type(cache_class) is type and issubclass(cache_class, RecipeInfoCommon):
+                cache_class.init_cacheData(self)        
 
         # Direct cache variables
         self.task_queues = {}
@@ -798,14 +744,13 @@ class MultiProcessCache(object):
         self.cachedata = self.create_cachedata()
         self.cachedata_extras = self.create_cachedata()
 
-    def init_cache(self, d, cache_file_name=None):
-        cachedir = (d.getVar("PERSISTENT_DIR") or
-                    d.getVar("CACHE"))
+    def init_cache(self, d):
+        cachedir = (d.getVar("PERSISTENT_DIR", True) or
+                    d.getVar("CACHE", True))
         if cachedir in [None, '']:
             return
         bb.utils.mkdirhier(cachedir)
-        self.cachefile = os.path.join(cachedir,
-                                      cache_file_name or self.__class__.cache_file_name)
+        self.cachefile = os.path.join(cachedir, self.__class__.cache_file_name)
         logger.debug(1, "Using cache in '%s'", self.cachefile)
 
         glf = bb.utils.lockfile(self.cachefile + ".lock")
@@ -829,7 +774,7 @@ class MultiProcessCache(object):
         data = [{}]
         return data
 
-    def save_extras(self):
+    def save_extras(self, d):
         if not self.cachefile:
             return
 
@@ -859,7 +804,7 @@ class MultiProcessCache(object):
                 if h not in dest[j]:
                     dest[j][h] = source[j][h]
 
-    def save_merge(self):
+    def save_merge(self, d):
         if not self.cachefile:
             return
 
@@ -889,3 +834,4 @@ class MultiProcessCache(object):
             p.dump([data, self.__class__.CACHE_VERSION])
 
         bb.utils.unlockfile(glf)
+

bitbake/lib/bb/checksum.py

@@ -15,17 +15,22 @@
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
-import glob
-import operator
 import os
 import stat
-import pickle
 import bb.utils
 import logging
 from bb.cache import MultiProcessCache
 
 logger = logging.getLogger("BitBake.Cache")
 
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    logger.info("Importing cPickle failed. "
+                "Falling back to a very slow implementation.")
+
+
 # mtime cache (non-persistent)
 # based upon the assumption that files do not change during bitbake run
 class FileMtimeCache(object):
@@ -83,54 +88,3 @@ class FileChecksumCache(MultiProcessCache):
                     dest[0][h] = source[0][h]
             else:
                 dest[0][h] = source[0][h]
-
-    def get_checksums(self, filelist, pn):
-        """Get checksums for a list of files"""
-
-        def checksum_file(f):
-            try:
-                checksum = self.get_checksum(f)
-            except OSError as e:
-                bb.warn("Unable to get checksum for %s SRC_URI entry %s: %s" % (pn, os.path.basename(f), e))
-                return None
-            return checksum
-
-        def checksum_dir(pth):
-            # Handle directories recursively
-            if pth == "/":
-                bb.fatal("Refusing to checksum /")
-            dirchecksums = []
-            for root, dirs, files in os.walk(pth):
-                for name in files:
-                    fullpth = os.path.join(root, name)
-                    checksum = checksum_file(fullpth)
-                    if checksum:
-                        dirchecksums.append((fullpth, checksum))
-            return dirchecksums
-
-        checksums = []
-        for pth in filelist.split():
-            exist = pth.split(":")[1]
-            if exist == "False":
-                continue
-            pth = pth.split(":")[0]
-            if '*' in pth:
-                # Handle globs
-                for f in glob.glob(pth):
-                    if os.path.isdir(f):
-                        if not os.path.islink(f):
-                            checksums.extend(checksum_dir(f))
-                    else:
-                        checksum = checksum_file(f)
-                        if checksum:
-                            checksums.append((f, checksum))
-            elif os.path.isdir(pth):
-                if not os.path.islink(pth):
-                    checksums.extend(checksum_dir(pth))
-            else:
-                checksum = checksum_file(pth)
-                if checksum:
-                    checksums.append((pth, checksum))
-
-        checksums.sort(key=operator.itemgetter(1))
-        return checksums

bitbake/lib/bb/codeparser.py

@@ -1,39 +1,21 @@
-"""
-BitBake code parser
-
-Parses actual code (i.e. python and shell) for functions and in-line
-expressions. Used mainly to determine dependencies on other functions
-and variables within the BitBake metadata. Also provides a cache for
-this information in order to speed up processing.
-
-(Not to be confused with the code that parses the metadata itself,
-see lib/bb/parse/ for that).
-
-NOTE: if you change how the parsers gather information you will almost
-certainly need to increment CodeParserCache.CACHE_VERSION below so that
-any existing codeparser cache gets invalidated. Additionally you'll need
-to increment __cache_version__ in cache.py in order to ensure that old
-recipe caches don't trigger "Taskhash mismatch" errors.
-
-"""
-
 import ast
-import sys
 import codegen
 import logging
-import pickle
-import bb.pysh as pysh
 import os.path
 import bb.utils, bb.data
-import hashlib
 from itertools import chain
-from bb.pysh import pyshyacc, pyshlex, sherrors
+from pysh import pyshyacc, pyshlex, sherrors
 from bb.cache import MultiProcessCache
 
+
 logger = logging.getLogger('BitBake.CodeParser')
 
-def bbhash(s):
-    return hashlib.sha256(s.encode("utf-8")).hexdigest()
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    logger.info('Importing cPickle failed.  Falling back to a very slow implementation.')
+
 
 def check_indent(codestr):
     """If the code is indented, add a top level piece of code to 'remove' the indentation"""
@@ -46,10 +28,6 @@ def check_indent(codestr):
         return codestr
 
     if codestr[i-1] == "\t" or codestr[i-1] == " ":
-        if codestr[0] == "\n":
-            # Since we're adding a line, we need to remove one line of any empty padding
-            # to ensure line numbers are correct
-            codestr = codestr[1:]
         return "if 1:\n" + codestr
 
     return codestr
@@ -86,12 +64,11 @@ class SetCache(object):
         
         new = []
         for i in items:
-            new.append(sys.intern(i))
+            new.append(intern(i))
         s = frozenset(new)
-        h = hash(s)
-        if h in self.setcache:
-            return self.setcache[h]
-        self.setcache[h] = s
+        if hash(s) in self.setcache:
+            return self.setcache[hash(s)]
+        self.setcache[hash(s)] = s
         return s
 
 codecache = SetCache()
@@ -115,9 +92,6 @@ class pythonCacheLine(object):
         for c in sorted(self.contains.keys()):
             l = l + (c, hash(self.contains[c]))
         return hash(l)
-    def __repr__(self):
-        return " ".join([str(self.refs), str(self.execs), str(self.contains)]) 
-
 
 class shellCacheLine(object):
     def __init__(self, execs):
@@ -131,16 +105,10 @@ class shellCacheLine(object):
         self.__init__(execs)
     def __hash__(self):
         return hash(self.execs)
-    def __repr__(self):
-        return str(self.execs)
 
 class CodeParserCache(MultiProcessCache):
     cache_file_name = "bb_codeparser.dat"
-    # NOTE: you must increment this if you change how the parsers gather information,
-    # so that an existing cache gets invalidated. Additionally you'll need
-    # to increment __cache_version__ in cache.py in order to ensure that old
-    # recipe caches don't trigger "Taskhash mismatch" errors.
-    CACHE_VERSION = 11
+    CACHE_VERSION = 7
 
     def __init__(self):
         MultiProcessCache.__init__(self)
@@ -171,10 +139,6 @@ class CodeParserCache(MultiProcessCache):
         return cacheline
 
     def init_cache(self, d):
-        # Check if we already have the caches
-        if self.pythoncache:
-            return
-
         MultiProcessCache.init_cache(self, d)
 
         # cachedata gets re-assigned in the parent
@@ -190,11 +154,11 @@ codeparsercache = CodeParserCache()
 def parser_cache_init(d):
     codeparsercache.init_cache(d)
 
-def parser_cache_save():
-    codeparsercache.save_extras()
+def parser_cache_save(d):
+    codeparsercache.save_extras(d)
 
-def parser_cache_savemerge():
-    codeparsercache.save_merge()
+def parser_cache_savemerge(d):
+    codeparsercache.save_merge(d)
 
 Logger = logging.getLoggerClass()
 class BufferedLogger(Logger):
@@ -209,15 +173,12 @@ class BufferedLogger(Logger):
 
     def flush(self):
         for record in self.buffer:
-            if self.target.isEnabledFor(record.levelno):
-                self.target.handle(record)
+            self.target.handle(record)
         self.buffer = []
 
 class PythonParser():
-    getvars = (".getVar", ".appendVar", ".prependVar", "oe.utils.conditional")
-    getvarflags = (".getVarFlag", ".appendVarFlag", ".prependVarFlag")
-    containsfuncs = ("bb.utils.contains", "base_contains")
-    containsanyfuncs = ("bb.utils.contains_any",  "bb.utils.filter")
+    getvars = (".getVar", ".appendVar", ".prependVar")
+    containsfuncs = ("bb.utils.contains", "base_contains", "oe.utils.contains", "bb.utils.contains_any")
     execfuncs = ("bb.build.exec_func", "bb.build.exec_task")
 
     def warn(self, func, arg):
@@ -236,37 +197,17 @@ class PythonParser():
 
     def visit_Call(self, node):
         name = self.called_node_name(node.func)
-        if name and (name.endswith(self.getvars) or name.endswith(self.getvarflags) or name in self.containsfuncs or name in self.containsanyfuncs):
+        if name and name.endswith(self.getvars) or name in self.containsfuncs:
             if isinstance(node.args[0], ast.Str):
                 varname = node.args[0].s
                 if name in self.containsfuncs and isinstance(node.args[1], ast.Str):
                     if varname not in self.contains:
                         self.contains[varname] = set()
                     self.contains[varname].add(node.args[1].s)
-                elif name in self.containsanyfuncs and isinstance(node.args[1], ast.Str):
-                    if varname not in self.contains:
-                        self.contains[varname] = set()
-                    self.contains[varname].update(node.args[1].s.split())
-                elif name.endswith(self.getvarflags):
-                    if isinstance(node.args[1], ast.Str):
-                        self.references.add('%s[%s]' % (varname, node.args[1].s))
-                    else:
-                        self.warn(node.func, node.args[1])
-                else:
-                    self.references.add(varname)
+                else:                      
+                    self.references.add(node.args[0].s)
             else:
                 self.warn(node.func, node.args[0])
-        elif name and name.endswith(".expand"):
-            if isinstance(node.args[0], ast.Str):
-                value = node.args[0].s
-                d = bb.data.init()
-                parser = d.expandWithRefs(value, self.name)
-                self.references |= parser.references
-                self.execs |= parser.execs
-                for varname in parser.contains:
-                    if varname not in self.contains:
-                        self.contains[varname] = set()
-                    self.contains[varname] |= parser.contains[varname]
         elif name in self.execfuncs:
             if isinstance(node.args[0], ast.Str):
                 self.var_execs.add(node.args[0].s)
@@ -289,7 +230,6 @@ class PythonParser():
                 break
 
     def __init__(self, name, log):
-        self.name = name
         self.var_execs = set()
         self.contains = {}
         self.execs = set()
@@ -299,11 +239,8 @@ class PythonParser():
         self.unhandled_message = "in call of %s, argument '%s' is not a string literal"
         self.unhandled_message = "while parsing %s, %s" % (name, self.unhandled_message)
 
-    def parse_python(self, node, lineno=0, filename="<string>"):
-        if not node or not node.strip():
-            return
-
-        h = bbhash(str(node))
+    def parse_python(self, node):
+        h = hash(str(node))
 
         if h in codeparsercache.pythoncache:
             self.references = set(codeparsercache.pythoncache[h].refs)
@@ -321,9 +258,7 @@ class PythonParser():
                 self.contains[i] = set(codeparsercache.pythoncacheextras[h].contains[i])
             return
 
-        # We can't add to the linenumbers for compile, we can pad to the correct number of blank lines though
-        node = "\n" * int(lineno) + node
-        code = compile(check_indent(str(node)), filename, "exec",
+        code = compile(check_indent(str(node)), "<string>", "exec",
                        ast.PyCF_ONLY_AST)
 
         for n in ast.walk(code):
@@ -348,7 +283,7 @@ class ShellParser():
         commands it executes.
         """
 
-        h = bbhash(str(value))
+        h = hash(str(value))
 
         if h in codeparsercache.shellcache:
             self.execs = set(codeparsercache.shellcache[h].execs)
@@ -368,11 +303,11 @@ class ShellParser():
     def _parse_shell(self, value):
         try:
             tokens, _ = pyshyacc.parse(value, eof=True, debug=False)
-        except Exception:
-            bb.error('Error during parse shell code, the last 5 lines are:\n%s' % '\n'.join(value.split('\n')[-5:]))
-            raise
+        except pyshlex.NeedMore:
+            raise sherrors.ShellSyntaxError("Unexpected EOF")
 
-        self.process_tokens(tokens)
+        for token in tokens:
+            self.process_tokens(token)
 
     def process_tokens(self, tokens):
         """Process a supplied portion of the syntax tree as returned by
@@ -418,24 +353,18 @@ class ShellParser():
             "case_clause": case_clause,
         }
 
-        def process_token_list(tokens):
-            for token in tokens:
-                if isinstance(token, list):
-                    process_token_list(token)
-                    continue
-                name, value = token
-                try:
-                    more_tokens, words = token_handlers[name](value)
-                except KeyError:
-                    raise NotImplementedError("Unsupported token type " + name)
+        for token in tokens:
+            name, value = token
+            try:
+                more_tokens, words = token_handlers[name](value)
+            except KeyError:
+                raise NotImplementedError("Unsupported token type " + name)
 
-                if more_tokens:
-                    self.process_tokens(more_tokens)
+            if more_tokens:
+                self.process_tokens(more_tokens)
 
-                if words:
-                    self.process_words(words)
-
-        process_token_list(tokens)
+            if words:
+                self.process_words(words)
 
     def process_words(self, words):
         """Process a set of 'words' in pyshyacc parlance, which includes

bitbake/lib/bb/command.py

@@ -28,15 +28,8 @@ and must not trigger events, directly or indirectly.
 Commands are queued in a CommandQueue
 """
 
-from collections import OrderedDict, defaultdict
-
 import bb.event
 import bb.cooker
-import bb.remotedata
-
-class DataStoreConnectionHandle(object):
-    def __init__(self, dsindex=0):
-        self.dsindex = dsindex
 
 class CommandCompleted(bb.event.Event):
     pass
@@ -50,8 +43,6 @@ class CommandFailed(CommandExit):
     def __init__(self, message):
         self.error = message
         CommandExit.__init__(self, 1)
-    def __str__(self):
-        return "Command execution failed: %s" % self.error
 
 class CommandError(Exception):
     pass
@@ -64,7 +55,6 @@ class Command:
         self.cooker = cooker
         self.cmds_sync = CommandsSync()
         self.cmds_async = CommandsAsync()
-        self.remotedatastores = bb.remotedata.RemoteDatastores(cooker)
 
         # FIXME Add lock for this
         self.currentAsyncCommand = None
@@ -78,13 +68,10 @@ class Command:
                 if not hasattr(command_method, 'readonly') or False == getattr(command_method, 'readonly'):
                     return None, "Not able to execute not readonly commands in readonly mode"
             try:
-                self.cooker.process_inotify_updates()
-                if getattr(command_method, 'needconfig', True):
-                    self.cooker.updateCacheSync()
                 result = command_method(self, commandline)
             except CommandError as exc:
                 return None, exc.args[0]
-            except (Exception, SystemExit):
+            except Exception:
                 import traceback
                 return None, traceback.format_exc()
             else:
@@ -99,7 +86,6 @@ class Command:
 
     def runAsyncCommand(self):
         try:
-            self.cooker.process_inotify_updates()
             if self.cooker.state in (bb.cooker.state.error, bb.cooker.state.shutdown, bb.cooker.state.forceshutdown):
                 # updateCache will trigger a shutdown of the parser
                 # and then raise BBHandledException triggering an exit
@@ -122,7 +108,7 @@ class Command:
             return False
         except SystemExit as exc:
             arg = exc.args[0]
-            if isinstance(arg, str):
+            if isinstance(arg, basestring):
                 self.finishAsyncCommand(arg)
             else:
                 self.finishAsyncCommand("Exited with %s" % arg)
@@ -137,23 +123,14 @@ class Command:
 
     def finishAsyncCommand(self, msg=None, code=None):
         if msg or msg == "":
-            bb.event.fire(CommandFailed(msg), self.cooker.data)
+            bb.event.fire(CommandFailed(msg), self.cooker.event_data)
         elif code:
-            bb.event.fire(CommandExit(code), self.cooker.data)
+            bb.event.fire(CommandExit(code), self.cooker.event_data)
         else:
-            bb.event.fire(CommandCompleted(), self.cooker.data)
+            bb.event.fire(CommandCompleted(), self.cooker.event_data)
         self.currentAsyncCommand = None
         self.cooker.finishcommand()
 
-    def reset(self):
-        self.remotedatastores = bb.remotedata.RemoteDatastores(self.cooker)
-
-def split_mc_pn(pn):
-    if pn.startswith("multiconfig:"):
-        _, mc, pn = pn.split(":", 2)
-        return (mc, pn)
-    return ('', pn)
-
 class CommandsSync:
     """
     A class of synchronous commands
@@ -200,19 +177,8 @@ class CommandsSync:
         """
         varname = params[0]
         value = str(params[1])
-        command.cooker.extraconfigdata[varname] = value
         command.cooker.data.setVar(varname, value)
 
-    def getSetVariable(self, command, params):
-        """
-        Read the value of a variable from data and set it into the datastore
-        which effectively expands and locks the value.
-        """
-        varname = params[0]
-        result = self.getVariable(command, params)
-        command.cooker.data.setVar(varname, result)
-        return result
-
     def setConfig(self, command, params):
         """
         Set the value of variable in configuration
@@ -238,17 +204,54 @@ class CommandsSync:
         postfiles = params[1].split()
         command.cooker.configuration.prefile = prefiles
         command.cooker.configuration.postfile = postfiles
-    setPrePostConfFiles.needconfig = False
+
+    def getCpuCount(self, command, params):
+        """
+        Get the CPU count on the bitbake server
+        """
+        return bb.utils.cpu_count()
+    getCpuCount.readonly = True
 
     def matchFile(self, command, params):
         fMatch = params[0]
         return command.cooker.matchFile(fMatch)
-    matchFile.needconfig = False
 
-    def getUIHandlerNum(self, command, params):
-        return bb.event.get_uihandler()
-    getUIHandlerNum.needconfig = False
-    getUIHandlerNum.readonly = True
+    def generateNewImage(self, command, params):
+        image = params[0]
+        base_image = params[1]
+        package_queue = params[2]
+        timestamp = params[3]
+        description = params[4]
+        return command.cooker.generateNewImage(image, base_image,
+                        package_queue, timestamp, description)
+
+    def ensureDir(self, command, params):
+        directory = params[0]
+        bb.utils.mkdirhier(directory)
+
+    def setVarFile(self, command, params):
+        """
+        Save a variable in a file; used for saving in a configuration file
+        """
+        var = params[0]
+        val = params[1]
+        default_file = params[2]
+        op = params[3]
+        command.cooker.modifyConfigurationVar(var, val, default_file, op)
+
+    def removeVarFile(self, command, params):
+        """
+        Remove a variable declaration from a file
+        """
+        var = params[0]
+        command.cooker.removeConfigurationVar(var)
+
+    def createConfigFile(self, command, params):
+        """
+        Create an extra configuration file
+        """
+        name = params[0]
+        command.cooker.createConfigFile(name)
 
     def setEventMask(self, command, params):
         handlerNum = params[0]
@@ -256,8 +259,6 @@ class CommandsSync:
         debug_domains = params[2]
         mask = params[3]
         return bb.event.set_UIHmask(handlerNum, llevel, debug_domains, mask)
-    setEventMask.needconfig = False
-    setEventMask.readonly = True
 
     def setFeatures(self, command, params):
         """
@@ -265,314 +266,14 @@ class CommandsSync:
         """
         features = params[0]
         command.cooker.setFeatures(features)
-    setFeatures.needconfig = False
+
     # although we change the internal state of the cooker, this is transparent since
     # we always take and leave the cooker in state.initial
     setFeatures.readonly = True
 
     def updateConfig(self, command, params):
         options = params[0]
-        environment = params[1]
-        cmdline = params[2]
-        command.cooker.updateConfigOpts(options, environment, cmdline)
-    updateConfig.needconfig = False
-
-    def parseConfiguration(self, command, params):
-        """Instruct bitbake to parse its configuration
-        NOTE: it is only necessary to call this if you aren't calling any normal action
-        (otherwise parsing is taken care of automatically)
-        """
-        command.cooker.parseConfiguration()
-    parseConfiguration.needconfig = False
-
-    def getLayerPriorities(self, command, params):
-        command.cooker.parseConfiguration()
-        ret = []
-        # regex objects cannot be marshalled by xmlrpc
-        for collection, pattern, regex, pri in command.cooker.bbfile_config_priorities:
-            ret.append((collection, pattern, regex.pattern, pri))
-        return ret
-    getLayerPriorities.readonly = True
-
-    def getRecipes(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return list(command.cooker.recipecaches[mc].pkg_pn.items())
-    getRecipes.readonly = True
-
-    def getRecipeDepends(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return list(command.cooker.recipecaches[mc].deps.items())
-    getRecipeDepends.readonly = True
-
-    def getRecipeVersions(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return command.cooker.recipecaches[mc].pkg_pepvpr
-    getRecipeVersions.readonly = True
-
-    def getRecipeProvides(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return command.cooker.recipecaches[mc].fn_provides
-    getRecipeProvides.readonly = True
-
-    def getRecipePackages(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return command.cooker.recipecaches[mc].packages
-    getRecipePackages.readonly = True
-
-    def getRecipePackagesDynamic(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return command.cooker.recipecaches[mc].packages_dynamic
-    getRecipePackagesDynamic.readonly = True
-
-    def getRProviders(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return command.cooker.recipecaches[mc].rproviders
-    getRProviders.readonly = True
-
-    def getRuntimeDepends(self, command, params):
-        ret = []
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        rundeps = command.cooker.recipecaches[mc].rundeps
-        for key, value in rundeps.items():
-            if isinstance(value, defaultdict):
-                value = dict(value)
-            ret.append((key, value))
-        return ret
-    getRuntimeDepends.readonly = True
-
-    def getRuntimeRecommends(self, command, params):
-        ret = []
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        runrecs = command.cooker.recipecaches[mc].runrecs
-        for key, value in runrecs.items():
-            if isinstance(value, defaultdict):
-                value = dict(value)
-            ret.append((key, value))
-        return ret
-    getRuntimeRecommends.readonly = True
-
-    def getRecipeInherits(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return command.cooker.recipecaches[mc].inherits
-    getRecipeInherits.readonly = True
-
-    def getBbFilePriority(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return command.cooker.recipecaches[mc].bbfile_priority
-    getBbFilePriority.readonly = True
-
-    def getDefaultPreference(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return command.cooker.recipecaches[mc].pkg_dp
-    getDefaultPreference.readonly = True
-
-    def getSkippedRecipes(self, command, params):
-        # Return list sorted by reverse priority order
-        import bb.cache
-        skipdict = OrderedDict(sorted(command.cooker.skiplist.items(),
-                                      key=lambda x: (-command.cooker.collection.calc_bbfile_priority(bb.cache.virtualfn2realfn(x[0])[0]), x[0])))
-        return list(skipdict.items())
-    getSkippedRecipes.readonly = True
-
-    def getOverlayedRecipes(self, command, params):
-        return list(command.cooker.collection.overlayed.items())
-    getOverlayedRecipes.readonly = True
-
-    def getFileAppends(self, command, params):
-        fn = params[0]
-        return command.cooker.collection.get_file_appends(fn)
-    getFileAppends.readonly = True
-
-    def getAllAppends(self, command, params):
-        return command.cooker.collection.bbappends
-    getAllAppends.readonly = True
-
-    def findProviders(self, command, params):
-        return command.cooker.findProviders()
-    findProviders.readonly = True
-
-    def findBestProvider(self, command, params):
-        (mc, pn) = split_mc_pn(params[0])
-        return command.cooker.findBestProvider(pn, mc)
-    findBestProvider.readonly = True
-
-    def allProviders(self, command, params):
-        try:
-            mc = params[0]
-        except IndexError:
-            mc = ''
-        return list(bb.providers.allProviders(command.cooker.recipecaches[mc]).items())
-    allProviders.readonly = True
-
-    def getRuntimeProviders(self, command, params):
-        rprovide = params[0]
-        try:
-            mc = params[1]
-        except IndexError:
-            mc = ''
-        all_p = bb.providers.getRuntimeProviders(command.cooker.recipecaches[mc], rprovide)
-        if all_p:
-            best = bb.providers.filterProvidersRunTime(all_p, rprovide,
-                            command.cooker.data,
-                            command.cooker.recipecaches[mc])[0][0]
-        else:
-            best = None
-        return all_p, best
-    getRuntimeProviders.readonly = True
-
-    def dataStoreConnectorFindVar(self, command, params):
-        dsindex = params[0]
-        name = params[1]
-        datastore = command.remotedatastores[dsindex]
-        value, overridedata = datastore._findVar(name)
-
-        if value:
-            content = value.get('_content', None)
-            if isinstance(content, bb.data_smart.DataSmart):
-                # Value is a datastore (e.g. BB_ORIGENV) - need to handle this carefully
-                idx = command.remotedatastores.check_store(content, True)
-                return {'_content': DataStoreConnectionHandle(idx),
-                        '_connector_origtype': 'DataStoreConnectionHandle',
-                        '_connector_overrides': overridedata}
-            elif isinstance(content, set):
-                return {'_content': list(content),
-                        '_connector_origtype': 'set',
-                        '_connector_overrides': overridedata}
-            else:
-                value['_connector_overrides'] = overridedata
-        else:
-            value = {}
-            value['_connector_overrides'] = overridedata
-        return value
-    dataStoreConnectorFindVar.readonly = True
-
-    def dataStoreConnectorGetKeys(self, command, params):
-        dsindex = params[0]
-        datastore = command.remotedatastores[dsindex]
-        return list(datastore.keys())
-    dataStoreConnectorGetKeys.readonly = True
-
-    def dataStoreConnectorGetVarHistory(self, command, params):
-        dsindex = params[0]
-        name = params[1]
-        datastore = command.remotedatastores[dsindex]
-        return datastore.varhistory.variable(name)
-    dataStoreConnectorGetVarHistory.readonly = True
-
-    def dataStoreConnectorExpandPythonRef(self, command, params):
-        config_data_dict = params[0]
-        varname = params[1]
-        expr = params[2]
-
-        config_data = command.remotedatastores.receive_datastore(config_data_dict)
-
-        varparse = bb.data_smart.VariableParse(varname, config_data)
-        return varparse.python_sub(expr)
-
-    def dataStoreConnectorRelease(self, command, params):
-        dsindex = params[0]
-        if dsindex <= 0:
-            raise CommandError('dataStoreConnectorRelease: invalid index %d' % dsindex)
-        command.remotedatastores.release(dsindex)
-
-    def dataStoreConnectorSetVarFlag(self, command, params):
-        dsindex = params[0]
-        name = params[1]
-        flag = params[2]
-        value = params[3]
-        datastore = command.remotedatastores[dsindex]
-        datastore.setVarFlag(name, flag, value)
-
-    def dataStoreConnectorDelVar(self, command, params):
-        dsindex = params[0]
-        name = params[1]
-        datastore = command.remotedatastores[dsindex]
-        if len(params) > 2:
-            flag = params[2]
-            datastore.delVarFlag(name, flag)
-        else:
-            datastore.delVar(name)
-
-    def dataStoreConnectorRenameVar(self, command, params):
-        dsindex = params[0]
-        name = params[1]
-        newname = params[2]
-        datastore = command.remotedatastores[dsindex]
-        datastore.renameVar(name, newname)
-
-    def parseRecipeFile(self, command, params):
-        """
-        Parse the specified recipe file (with or without bbappends)
-        and return a datastore object representing the environment
-        for the recipe.
-        """
-        fn = params[0]
-        appends = params[1]
-        appendlist = params[2]
-        if len(params) > 3:
-            config_data_dict = params[3]
-            config_data = command.remotedatastores.receive_datastore(config_data_dict)
-        else:
-            config_data = None
-
-        if appends:
-            if appendlist is not None:
-                appendfiles = appendlist
-            else:
-                appendfiles = command.cooker.collection.get_file_appends(fn)
-        else:
-            appendfiles = []
-        # We are calling bb.cache locally here rather than on the server,
-        # but that's OK because it doesn't actually need anything from
-        # the server barring the global datastore (which we have a remote
-        # version of)
-        if config_data:
-            # We have to use a different function here if we're passing in a datastore
-            # NOTE: we took a copy above, so we don't do it here again
-            envdata = bb.cache.parse_recipe(config_data, fn, appendfiles)['']
-        else:
-            # Use the standard path
-            parser = bb.cache.NoCache(command.cooker.databuilder)
-            envdata = parser.loadDataFull(fn, appendfiles)
-        idx = command.remotedatastores.store(envdata)
-        return DataStoreConnectionHandle(idx)
-    parseRecipeFile.readonly = True
+        command.cooker.updateConfigOpts(options)
 
 class CommandsAsync:
     """
@@ -587,15 +288,8 @@ class CommandsAsync:
         """
         bfile = params[0]
         task = params[1]
-        if len(params) > 2:
-            internal = params[2]
-        else:
-            internal = False
 
-        if internal:
-            command.cooker.buildFileInternal(bfile, task, fireevents=False, quietlog=True)
-        else:
-            command.cooker.buildFile(bfile, task)
+        command.cooker.buildFile(bfile, task)
     buildFile.needcache = False
 
     def buildTargets(self, command, params):
@@ -645,6 +339,17 @@ class CommandsAsync:
         command.finishAsyncCommand()
     generateTargetsTree.needcache = True
 
+    def findCoreBaseFiles(self, command, params):
+        """
+        Find certain files in COREBASE directory. i.e. Layers
+        """
+        subdir = params[0]
+        filename = params[1]
+
+        command.cooker.findCoreBaseFiles(subdir, filename)
+        command.finishAsyncCommand()
+    findCoreBaseFiles.needcache = False
+
     def findConfigFiles(self, command, params):
         """
         Find config files which provide appropriate values
@@ -744,22 +449,3 @@ class CommandsAsync:
         command.finishAsyncCommand()
     resetCooker.needcache = False
 
-    def clientComplete(self, command, params):
-        """
-        Do the right thing when the controlling client exits
-        """
-        command.cooker.clientComplete()
-        command.finishAsyncCommand()
-    clientComplete.needcache = False
-
-    def findSigInfo(self, command, params):
-        """
-        Find signature info files via the signature generator
-        """
-        pn = params[0]
-        taskname = params[1]
-        sigs = params[2]
-        res = bb.siggen.find_siginfo(pn, taskname, sigs, command.cooker.data)
-        bb.event.fire(bb.event.FindSigInfoResult(res), command.cooker.data)
-        command.finishAsyncCommand()
-    findSigInfo.needcache = False

bitbake/lib/bb/cookerdata.py

@@ -22,11 +22,9 @@
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
-import logging
-import os
-import re
-import sys
+import os, sys
 from functools import wraps
+import logging
 import bb
 from bb import data
 import bb.parse
@@ -35,16 +33,20 @@ logger      = logging.getLogger("BitBake")
 parselog    = logging.getLogger("BitBake.Parsing")
 
 class ConfigParameters(object):
-    def __init__(self, argv=sys.argv):
-        self.options, targets = self.parseCommandLine(argv)
+    def __init__(self):
+        self.options, targets = self.parseCommandLine()
         self.environment = self.parseEnvironment()
 
         self.options.pkgs_to_build = targets or []
 
+        self.options.tracking = False
+        if hasattr(self.options, "show_environment") and self.options.show_environment:
+            self.options.tracking = True
+
         for key, val in self.options.__dict__.items():
             setattr(self, key, val)
 
-    def parseCommandLine(self, argv=sys.argv):
+    def parseCommandLine(self):
         raise Exception("Caller must implement commandline option parsing")
 
     def parseEnvironment(self):
@@ -61,23 +63,22 @@ class ConfigParameters(object):
             raise Exception("Unable to set configuration option 'cmd' on the server: %s" % error)
 
         if not self.options.pkgs_to_build:
-            bbpkgs, error = server.runCommand(["getVariable", "BBTARGETS"])
+            bbpkgs, error = server.runCommand(["getVariable", "BBPKGS"])
             if error:
-                raise Exception("Unable to get the value of BBTARGETS from the server: %s" % error)
+                raise Exception("Unable to get the value of BBPKGS from the server: %s" % error)
             if bbpkgs:
                 self.options.pkgs_to_build.extend(bbpkgs.split())
 
-    def updateToServer(self, server, environment):
+    def updateToServer(self, server):
         options = {}
-        for o in ["abort", "force", "invalidate_stamp",
-                  "verbose", "debug", "dry_run", "dump_signatures",
-                  "debug_domains", "extra_assume_provided", "profile",
-                  "prefile", "postfile", "server_timeout"]:
+        for o in ["abort", "tryaltconfigs", "force", "invalidate_stamp", 
+                  "verbose", "debug", "dry_run", "dump_signatures", 
+                  "debug_domains", "extra_assume_provided", "profile"]:
             options[o] = getattr(self.options, o)
 
-        ret, error = server.runCommand(["updateConfig", options, environment, sys.argv])
+        ret, error = server.runCommand(["updateConfig", options])
         if error:
-            raise Exception("Unable to update the server configuration with local parameters: %s" % error)
+                raise Exception("Unable to update the server configuration with local parameters: %s" % error)
 
     def parseActions(self):
         # Parse any commandline into actions
@@ -133,18 +134,11 @@ class CookerConfiguration(object):
         self.force = False
         self.profile = False
         self.nosetscene = False
-        self.setsceneonly = False
         self.invalidate_stamp = False
         self.dump_signatures = []
         self.dry_run = False
         self.tracking = False
-        self.xmlrpcinterface = []
-        self.server_timeout = None
-        self.writeeventlog = False
-        self.server_only = False
-        self.limited_deps = False
-        self.runall = []
-        self.runonly = []
+        self.interface = []
 
         self.env = {}
 
@@ -153,6 +147,7 @@ class CookerConfiguration(object):
             if key in parameters.options.__dict__:
                 setattr(self, key, parameters.options.__dict__[key])
         self.env = parameters.environment.copy()
+        self.tracking = parameters.tracking
 
     def setServerRegIdleCallback(self, srcb):
         self.server_register_idlecallback = srcb
@@ -168,7 +163,7 @@ class CookerConfiguration(object):
 
     def __setstate__(self,state):
         for k in state:
-            setattr(self, k, state[k])
+            setattr(self, k, state[k]) 
 
 
 def catch_parse_error(func):
@@ -177,26 +172,11 @@ def catch_parse_error(func):
     def wrapped(fn, *args):
         try:
             return func(fn, *args)
-        except IOError as exc:
+        except (IOError, bb.parse.ParseError, bb.data_smart.ExpansionError) as exc:
             import traceback
-            parselog.critical(traceback.format_exc())
+            parselog.critical( traceback.format_exc())
             parselog.critical("Unable to parse %s: %s" % (fn, exc))
             sys.exit(1)
-        except bb.data_smart.ExpansionError as exc:
-            import traceback
-
-            bbdir = os.path.dirname(__file__) + os.sep
-            exc_class, exc, tb = sys.exc_info()
-            for tb in iter(lambda: tb.tb_next, None):
-                # Skip frames in bitbake itself, we only want the metadata
-                fn, _, _, _ = traceback.extract_tb(tb, 1)[0]
-                if not fn.startswith(bbdir):
-                    break
-            parselog.critical("Unable to parse %s" % fn, exc_info=(exc_class, exc, tb))
-            sys.exit(1)
-        except bb.parse.ParseError as exc:
-            parselog.critical(str(exc))
-            sys.exit(1)
     return wrapped
 
 @catch_parse_error
@@ -210,7 +190,7 @@ def _inherit(bbclass, data):
 
 def findConfigFile(configfile, data):
     search = []
-    bbpath = data.getVar("BBPATH")
+    bbpath = data.getVar("BBPATH", True)
     if bbpath:
         for i in bbpath.split(":"):
             search.append(os.path.join(i, "conf", configfile))
@@ -225,27 +205,6 @@ def findConfigFile(configfile, data):
 
     return None
 
-#
-# We search for a conf/bblayers.conf under an entry in BBPATH or in cwd working 
-# up to /. If that fails, we search for a conf/bitbake.conf in BBPATH.
-#
-
-def findTopdir():
-    d = bb.data.init()
-    bbpath = None
-    if 'BBPATH' in os.environ:
-        bbpath = os.environ['BBPATH']
-        d.setVar('BBPATH', bbpath)
-
-    layerconf = findConfigFile("bblayers.conf", d)
-    if layerconf:
-        return os.path.dirname(os.path.dirname(layerconf))
-    if bbpath:
-        bitbakeconf = bb.utils.which(bbpath, "conf/bitbake.conf")
-        if bitbakeconf:
-            return os.path.dirname(os.path.dirname(bitbakeconf))
-    return None
-
 class CookerDataBuilder(object):
 
     def __init__(self, cookercfg, worker = False):
@@ -256,9 +215,9 @@ class CookerDataBuilder(object):
 
         bb.utils.set_context(bb.utils.clean_context())
         bb.event.set_class_handlers(bb.event.clean_class_handlers())
-        self.basedata = bb.data.init()
+        self.data = bb.data.init()
         if self.tracking:
-            self.basedata.enableTracking()
+            self.data.enableTracking()
 
         # Keep a datastore of the initial environment variables and their
         # values from when BitBake was launched to enable child processes
@@ -269,51 +228,16 @@ class CookerDataBuilder(object):
             self.savedenv.setVar(k, cookercfg.env[k])
 
         filtered_keys = bb.utils.approved_variables()
-        bb.data.inheritFromOS(self.basedata, self.savedenv, filtered_keys)
-        self.basedata.setVar("BB_ORIGENV", self.savedenv)
-
+        bb.data.inheritFromOS(self.data, self.savedenv, filtered_keys)
+        self.data.setVar("BB_ORIGENV", self.savedenv)
+        
         if worker:
-            self.basedata.setVar("BB_WORKERCONTEXT", "1")
-
-        self.data = self.basedata
-        self.mcdata = {}
+            self.data.setVar("BB_WORKERCONTEXT", "1")
 
     def parseBaseConfiguration(self):
         try:
-            bb.parse.init_parser(self.basedata)
-            self.data = self.parseConfigurationFiles(self.prefiles, self.postfiles)
-
-            if self.data.getVar("BB_WORKERCONTEXT", False) is None:
-                bb.fetch.fetcher_init(self.data)
-            bb.codeparser.parser_cache_init(self.data)
-
-            bb.event.fire(bb.event.ConfigParsed(), self.data)
-
-            reparse_cnt = 0
-            while self.data.getVar("BB_INVALIDCONF", False) is True:
-                if reparse_cnt > 20:
-                    logger.error("Configuration has been re-parsed over 20 times, "
-                                 "breaking out of the loop...")
-                    raise Exception("Too deep config re-parse loop. Check locations where "
-                                    "BB_INVALIDCONF is being set (ConfigParsed event handlers)")
-                self.data.setVar("BB_INVALIDCONF", False)
-                self.data = self.parseConfigurationFiles(self.prefiles, self.postfiles)
-                reparse_cnt += 1
-                bb.event.fire(bb.event.ConfigParsed(), self.data)
-
-            bb.parse.init_parser(self.data)
-            self.data_hash = self.data.get_hash()
-            self.mcdata[''] = self.data
-
-            multiconfig = (self.data.getVar("BBMULTICONFIG") or "").split()
-            for config in multiconfig:
-                mcdata = self.parseConfigurationFiles(self.prefiles, self.postfiles, config)
-                bb.event.fire(bb.event.ConfigParsed(), mcdata)
-                self.mcdata[config] = mcdata
-            if multiconfig:
-                bb.event.fire(bb.event.MultiConfigParsed(self.mcdata), self.data)
-
-        except (SyntaxError, bb.BBHandledException):
+            self.parseConfigurationFiles(self.prefiles, self.postfiles)
+        except SyntaxError:
             raise bb.BBHandledException
         except bb.data_smart.ExpansionError as e:
             logger.error(str(e))
@@ -322,24 +246,12 @@ class CookerDataBuilder(object):
             logger.exception("Error parsing configuration files")
             raise bb.BBHandledException
 
-        # Create a copy so we can reset at a later date when UIs disconnect
-        self.origdata = self.data
-        self.data = bb.data.createCopy(self.origdata)
-        self.mcdata[''] = self.data
-
-    def reset(self):
-        # We may not have run parseBaseConfiguration() yet
-        if not hasattr(self, 'origdata'):
-            return
-        self.data = bb.data.createCopy(self.origdata)
-        self.mcdata[''] = self.data
-
     def _findLayerConf(self, data):
         return findConfigFile("bblayers.conf", data)
 
-    def parseConfigurationFiles(self, prefiles, postfiles, mc = "default"):
-        data = bb.data.createCopy(self.basedata)
-        data.setVar("BB_CURRENT_MC", mc)
+    def parseConfigurationFiles(self, prefiles, postfiles):
+        data = self.data
+        bb.parse.init_parser(data)
 
         # Parse files for loading *before* bitbake.conf and any includes
         for f in prefiles:
@@ -353,57 +265,18 @@ class CookerDataBuilder(object):
             data.setVar("TOPDIR", os.path.dirname(os.path.dirname(layerconf)))
             data = parse_config_file(layerconf, data)
 
-            layers = (data.getVar('BBLAYERS') or "").split()
+            layers = (data.getVar('BBLAYERS', True) or "").split()
 
             data = bb.data.createCopy(data)
-            approved = bb.utils.approved_variables()
             for layer in layers:
-                if not os.path.isdir(layer):
-                    parselog.critical("Layer directory '%s' does not exist! "
-                                      "Please check BBLAYERS in %s" % (layer, layerconf))
-                    sys.exit(1)
                 parselog.debug(2, "Adding layer %s", layer)
-                if 'HOME' in approved and '~' in layer:
-                    layer = os.path.expanduser(layer)
-                if layer.endswith('/'):
-                    layer = layer.rstrip('/')
                 data.setVar('LAYERDIR', layer)
-                data.setVar('LAYERDIR_RE', re.escape(layer))
                 data = parse_config_file(os.path.join(layer, "conf", "layer.conf"), data)
                 data.expandVarref('LAYERDIR')
-                data.expandVarref('LAYERDIR_RE')
 
-            data.delVar('LAYERDIR_RE')
             data.delVar('LAYERDIR')
 
-            bbfiles_dynamic = (data.getVar('BBFILES_DYNAMIC') or "").split()
-            collections = (data.getVar('BBFILE_COLLECTIONS') or "").split()
-            invalid = []
-            for entry in bbfiles_dynamic:
-                parts = entry.split(":", 1)
-                if len(parts) != 2:
-                    invalid.append(entry)
-                    continue
-                l, f = parts
-                if l in collections:
-                    data.appendVar("BBFILES", " " + f)
-            if invalid:
-                bb.fatal("BBFILES_DYNAMIC entries must be of the form <collection name>:<filename pattern>, not:\n    %s" % "\n    ".join(invalid))
-
-            layerseries = set((data.getVar("LAYERSERIES_CORENAMES") or "").split())
-            collections_tmp = collections[:]
-            for c in collections:
-                collections_tmp.remove(c)
-                if c in collections_tmp:
-                    bb.fatal("Found duplicated BBFILE_COLLECTIONS '%s', check bblayers.conf or layer.conf to fix it." % c)
-                compat = set((data.getVar("LAYERSERIES_COMPAT_%s" % c) or "").split())
-                if compat and not (compat & layerseries):
-                    bb.fatal("Layer %s is not compatible with the core layer which only supports these series: %s (layer is compatible with %s)"
-                              % (c, " ".join(layerseries), " ".join(compat)))
-                elif not compat and not data.getVar("BB_WORKERCONTEXT"):
-                    bb.warn("Layer %s should set LAYERSERIES_COMPAT_%s in its conf/layer.conf file to list the core layer names it is compatible with." % (c, c))
-
-        if not data.getVar("BBPATH"):
+        if not data.getVar("BBPATH", True):
             msg = "The BBPATH variable is not set"
             if not layerconf:
                 msg += (" and bitbake did not find a conf/bblayers.conf file in"
@@ -418,21 +291,29 @@ class CookerDataBuilder(object):
             data = parse_config_file(p, data)
 
         # Handle any INHERITs and inherit the base class
-        bbclasses  = ["base"] + (data.getVar('INHERIT') or "").split()
+        bbclasses  = ["base"] + (data.getVar('INHERIT', True) or "").split()
         for bbclass in bbclasses:
             data = _inherit(bbclass, data)
 
         # Nomally we only register event handlers at the end of parsing .bb files
         # We register any handlers we've found so far here...
-        for var in data.getVar('__BBHANDLERS', False) or []:
-            handlerfn = data.getVarFlag(var, "filename", False)
-            if not handlerfn:
-                parselog.critical("Undefined event handler function '%s'" % var)
-                sys.exit(1)
-            handlerln = int(data.getVarFlag(var, "lineno", False))
-            bb.event.register(var, data.getVar(var, False),  (data.getVarFlag(var, "eventmask") or "").split(), handlerfn, handlerln)
+        for var in data.getVar('__BBHANDLERS') or []:
+            bb.event.register(var, data.getVar(var),  (data.getVarFlag(var, "eventmask", True) or "").split())
 
+        if data.getVar("BB_WORKERCONTEXT", False) is None:
+            bb.fetch.fetcher_init(data)
+        bb.codeparser.parser_cache_init(data)
+        bb.event.fire(bb.event.ConfigParsed(), data)
+
+        if data.getVar("BB_INVALIDCONF") is True:
+            data.setVar("BB_INVALIDCONF", False)
+            self.parseConfigurationFiles(self.prefiles, self.postfiles)
+            return
+
+        bb.parse.init_parser(data)
         data.setVar('BBINCLUDED',bb.parse.get_file_depends(data))
+        self.data = data
+        self.data_hash = data.get_hash()
+
 
-        return data
 

bitbake/lib/bb/daemonize.py

@@ -1,14 +1,48 @@
 """
 Python Daemonizing helper
 
-Originally based on code Copyright (C) 2005 Chad J. Schroeder but now heavily modified
-to allow a function to be daemonized and return for bitbake use by Richard Purdie
+Configurable daemon behaviors:
+
+    1.) The current working directory set to the "/" directory.
+    2.) The current file creation mode mask set to 0.
+    3.) Close all open files (1024). 
+    4.) Redirect standard I/O streams to "/dev/null".
+
+A failed call to fork() now raises an exception.
+
+References:
+    1) Advanced Programming in the Unix Environment: W. Richard Stevens
+	http://www.apuebook.com/apue3e.html
+    2) The Linux Programming Interface: Michael Kerrisk
+	http://man7.org/tlpi/index.html
+    3) Unix Programming Frequently Asked Questions:
+	http://www.faqs.org/faqs/unix-faq/programmer/faq/
+
+Modified to allow a function to be daemonized and return for 
+bitbake use by Richard Purdie
 """
 
-import os
-import sys
-import io
-import traceback
+__author__ = "Chad J. Schroeder"
+__copyright__ = "Copyright (C) 2005 Chad J. Schroeder"
+__version__ = "0.2"
+
+# Standard Python modules.
+import os                    # Miscellaneous OS interfaces.
+import sys                   # System-specific parameters and functions.
+
+# Default daemon parameters.
+# File mode creation mask of the daemon.
+# For BitBake's children, we do want to inherit the parent umask.
+UMASK = None
+
+# Default maximum for the number of available file descriptors.
+MAXFD = 1024
+
+# The standard I/O file descriptors are redirected to /dev/null by default.
+if (hasattr(os, "devnull")):
+    REDIRECT_TO = os.devnull
+else:
+    REDIRECT_TO = "/dev/null"
 
 def createDaemon(function, logfile):
     """
@@ -16,10 +50,6 @@ def createDaemon(function, logfile):
     background as a daemon, returning control to the caller.
     """
 
-    # Ensure stdout/stderror are flushed before forking to avoid duplicate output
-    sys.stdout.flush()
-    sys.stderr.flush()
-
     try:
         # Fork a child process so the parent can exit.  This returns control to
         # the command-line or shell.  It also guarantees that the child will not
@@ -35,6 +65,36 @@ def createDaemon(function, logfile):
         # leader of the new process group, we call os.setsid().  The process is
         # also guaranteed not to have a controlling terminal.
         os.setsid()
+
+        # Is ignoring SIGHUP necessary?
+        #
+        # It's often suggested that the SIGHUP signal should be ignored before
+        # the second fork to avoid premature termination of the process.  The
+        # reason is that when the first child terminates, all processes, e.g.
+        # the second child, in the orphaned group will be sent a SIGHUP.
+        #
+        # "However, as part of the session management system, there are exactly
+        # two cases where SIGHUP is sent on the death of a process:
+        #
+        #    1) When the process that dies is the session leader of a session that
+        #        is attached to a terminal device, SIGHUP is sent to all processes
+        #        in the foreground process group of that terminal device.
+        #    2) When the death of a process causes a process group to become
+        #        orphaned, and one or more processes in the orphaned group are
+        #        stopped, then SIGHUP and SIGCONT are sent to all members of the
+        #        orphaned group." [2]
+        #
+        # The first case can be ignored since the child is guaranteed not to have
+        # a controlling terminal.  The second case isn't so easy to dismiss.
+        # The process group is orphaned when the first child terminates and
+        # POSIX.1 requires that every STOPPED process in an orphaned process
+        # group be sent a SIGHUP signal followed by a SIGCONT signal.  Since the
+        # second child is not STOPPED though, we can safely forego ignoring the
+        # SIGHUP signal.  In any case, there are no ill-effects if it is ignored.
+        #
+        # import signal              # Set handlers for asynchronous events.
+        # signal.signal(signal.SIGHUP, signal.SIG_IGN)
+
         try:
             # Fork a second child and exit immediately to prevent zombies.  This
             # causes the second child process to be orphaned, making the init
@@ -48,46 +108,86 @@ def createDaemon(function, logfile):
         except OSError as e:
             raise Exception("%s [%d]" % (e.strerror, e.errno))
 
-        if (pid != 0):
+        if (pid == 0):  # The second child.
+            # We probably don't want the file mode creation mask inherited from
+            # the parent, so we give the child complete control over permissions.
+            if UMASK is not None:
+                os.umask(UMASK)
+        else:
             # Parent (the first child) of the second child.
-            # exit() or _exit()?
-            # _exit is like exit(), but it doesn't call any functions registered
-            # with atexit (and on_exit) or any registered signal handlers.  It also
-            # closes any open file descriptors, but doesn't flush any buffered output.
-            # Using exit() may cause all any temporary files to be unexpectedly
-            # removed.  It's therefore recommended that child branches of a fork()
-            # and the parent branch(es) of a daemon use _exit().
             os._exit(0)
     else:
-        os.waitpid(pid, 0)
+        # exit() or _exit()?
+        # _exit is like exit(), but it doesn't call any functions registered
+        # with atexit (and on_exit) or any registered signal handlers.  It also
+        # closes any open file descriptors.  Using exit() may cause all stdio
+        # streams to be flushed twice and any temporary files may be unexpectedly
+        # removed.  It's therefore recommended that child branches of a fork()
+        # and the parent branch(es) of a daemon use _exit().
         return
 
-    # The second child.
+    # Close all open file descriptors.  This prevents the child from keeping
+    # open any file descriptors inherited from the parent.  There is a variety
+    # of methods to accomplish this task.  Three are listed below.
+    #
+    # Try the system configuration variable, SC_OPEN_MAX, to obtain the maximum
+    # number of open file descriptors to close.  If it doesn't exist, use
+    # the default value (configurable).
+    #
+    # try:
+    #     maxfd = os.sysconf("SC_OPEN_MAX")
+    # except (AttributeError, ValueError):
+    #     maxfd = MAXFD
+    #
+    # OR
+    #
+    # if (os.sysconf_names.has_key("SC_OPEN_MAX")):
+    #     maxfd = os.sysconf("SC_OPEN_MAX")
+    # else:
+    #     maxfd = MAXFD
+    #
+    # OR
+    #
+    # Use the getrlimit method to retrieve the maximum file descriptor number
+    # that can be opened by this process.  If there is no limit on the
+    # resource, use the default value.
+    #
+    import resource             # Resource usage information.
+    maxfd = resource.getrlimit(resource.RLIMIT_NOFILE)[1]
+    if (maxfd == resource.RLIM_INFINITY):
+        maxfd = MAXFD
+  
+    # Iterate through and close all file descriptors.
+#    for fd in range(0, maxfd):
+#        try:
+#            os.close(fd)
+#        except OSError:        # ERROR, fd wasn't open to begin with (ignored)
+#            pass
 
-    # Replace standard fds with our own
-    with open('/dev/null', 'r') as si:
-        os.dup2(si.fileno(), sys.stdin.fileno())
+    # Redirect the standard I/O file descriptors to the specified file.  Since
+    # the daemon has no controlling terminal, most daemons redirect stdin,
+    # stdout, and stderr to /dev/null.  This is done to prevent side-effects
+    # from reads and writes to the standard I/O file descriptors.
 
-    try:
-        so = open(logfile, 'a+')
-        os.dup2(so.fileno(), sys.stdout.fileno())
-        os.dup2(so.fileno(), sys.stderr.fileno())
-    except io.UnsupportedOperation:
-        sys.stdout = open(logfile, 'a+')
+    # This call to open is guaranteed to return the lowest file descriptor,
+    # which will be 0 (stdin), since it was closed above.
+#    os.open(REDIRECT_TO, os.O_RDWR)    # standard input (0)
 
-    # Have stdout and stderr be the same so log output matches chronologically
-    # and there aren't two seperate buffers
-    sys.stderr = sys.stdout
+    # Duplicate standard input to standard output and standard error.
+#    os.dup2(0, 1)                      # standard output (1)
+#    os.dup2(0, 2)                      # standard error (2)
 
-    try:
-        function()
-    except Exception as e:
-        traceback.print_exc()
-    finally:
-        bb.event.print_ui_queue()
-        # os._exit() doesn't flush open files like os.exit() does. Manually flush
-        # stdout and stderr so that any logging output will be seen, particularly
-        # exception tracebacks.
-        sys.stdout.flush()
-        sys.stderr.flush()
-        os._exit(0)
+
+    si = file('/dev/null', 'r')
+    so = file(logfile, 'w')
+    se = so
+
+
+    # Replace those fds with our own
+    os.dup2(si.fileno(), sys.stdin.fileno())
+    os.dup2(so.fileno(), sys.stdout.fileno())
+    os.dup2(se.fileno(), sys.stderr.fileno())
+
+    function()
+
+    os._exit(0)

bitbake/lib/bb/data.py

@@ -38,7 +38,6 @@ the speed is more critical here.
 # Based on functions from the base bb module, Copyright 2003 Holger Schurig
 
 import sys, os, re
-import hashlib
 if sys.argv[0][-5:] == "pydoc":
     path = os.path.dirname(os.path.dirname(sys.argv[1]))
 else:
@@ -79,6 +78,59 @@ def initVar(var, d):
     """Non-destructive var init for data structure"""
     d.initVar(var)
 
+
+def setVar(var, value, d):
+    """Set a variable to a given value"""
+    d.setVar(var, value)
+
+
+def getVar(var, d, exp = 0):
+    """Gets the value of a variable"""
+    return d.getVar(var, exp)
+
+
+def renameVar(key, newkey, d):
+    """Renames a variable from key to newkey"""
+    d.renameVar(key, newkey)
+
+def delVar(var, d):
+    """Removes a variable from the data set"""
+    d.delVar(var)
+
+def appendVar(var, value, d):
+    """Append additional value to a variable"""
+    d.appendVar(var, value)
+
+def setVarFlag(var, flag, flagvalue, d):
+    """Set a flag for a given variable to a given value"""
+    d.setVarFlag(var, flag, flagvalue)
+
+def getVarFlag(var, flag, d):
+    """Gets given flag from given var"""
+    return d.getVarFlag(var, flag)
+
+def delVarFlag(var, flag, d):
+    """Removes a given flag from the variable's flags"""
+    d.delVarFlag(var, flag)
+
+def setVarFlags(var, flags, d):
+    """Set the flags for a given variable
+
+    Note:
+        setVarFlags will not clear previous
+        flags. Think of this method as
+        addVarFlags
+    """
+    d.setVarFlags(var, flags)
+
+def getVarFlags(var, d):
+    """Gets a variable's flags"""
+    return d.getVarFlags(var)
+
+def delVarFlags(var, d):
+    """Removes a variable's flags"""
+    d.delVarFlags(var)
+
 def keys(d):
     """Return a list of keys in d"""
     return d.keys()
@@ -107,12 +159,13 @@ def expandKeys(alterdata, readdata = None):
 
     # These two for loops are split for performance to maximise the
     # usefulness of the expand cache
-    for key in sorted(todolist):
+
+    for key in todolist:
         ekey = todolist[key]
-        newval = alterdata.getVar(ekey, False)
-        if newval is not None:
-            val = alterdata.getVar(key, False)
-            if val is not None:
+        newval = alterdata.getVar(ekey, 0)
+        if newval:
+            val = alterdata.getVar(key, 0)
+            if val is not None and newval is not None:
                 bb.warn("Variable key %s (%s) replaces original key %s (%s)." % (key, val, ekey, newval))
         alterdata.renameVar(key, ekey)
 
@@ -122,7 +175,7 @@ def inheritFromOS(d, savedenv, permitted):
     for s in savedenv.keys():
         if s in permitted:
             try:
-                d.setVar(s, savedenv.getVar(s), op = 'from env')
+                d.setVar(s, getVar(s, savedenv, True), op = 'from env')
                 if s in exportlist:
                     d.setVarFlag(s, "export", True, op = 'auto env export')
             except TypeError:
@@ -130,39 +183,39 @@ def inheritFromOS(d, savedenv, permitted):
 
 def emit_var(var, o=sys.__stdout__, d = init(), all=False):
     """Emit a variable to be sourced by a shell."""
-    func = d.getVarFlag(var, "func", False)
-    if d.getVarFlag(var, 'python', False) and func:
-        return False
+    if getVarFlag(var, "python", d):
+        return 0
 
-    export = d.getVarFlag(var, "export", False)
-    unexport = d.getVarFlag(var, "unexport", False)
+    export = getVarFlag(var, "export", d)
+    unexport = getVarFlag(var, "unexport", d)
+    func = getVarFlag(var, "func", d)
     if not all and not export and not unexport and not func:
-        return False
+        return 0
 
     try:
         if all:
-            oval = d.getVar(var, False)
-        val = d.getVar(var)
+            oval = getVar(var, d, 0)
+        val = getVar(var, d, 1)
     except (KeyboardInterrupt, bb.build.FuncFailed):
         raise
     except Exception as exc:
         o.write('# expansion of %s threw %s: %s\n' % (var, exc.__class__.__name__, str(exc)))
-        return False
+        return 0
 
     if all:
-        d.varhistory.emit(var, oval, val, o, d)
+        d.varhistory.emit(var, oval, val, o)
 
     if (var.find("-") != -1 or var.find(".") != -1 or var.find('{') != -1 or var.find('}') != -1 or var.find('+') != -1) and not all:
-        return False
+        return 0
 
-    varExpanded = d.expand(var)
+    varExpanded = expand(var, d)
 
     if unexport:
         o.write('unset %s\n' % varExpanded)
-        return False
+        return 0
 
     if val is None:
-        return False
+        return 0
 
     val = str(val)
 
@@ -171,11 +224,10 @@ def emit_var(var, o=sys.__stdout__, d = init(), all=False):
         val = val[3:] # Strip off "() "
         o.write("%s() %s\n" % (varExpanded, val))
         o.write("export -f %s\n" % (varExpanded))
-        return True
+        return 1
 
     if func:
         # NOTE: should probably check for unbalanced {} within the var
-        val = val.rstrip('\n')
         o.write("%s() {\n%s\n}\n" % (varExpanded, val))
         return 1
 
@@ -188,31 +240,29 @@ def emit_var(var, o=sys.__stdout__, d = init(), all=False):
     alter = re.sub('\n', ' \\\n', alter)
     alter = re.sub('\\$', '\\\\$', alter)
     o.write('%s="%s"\n' % (varExpanded, alter))
-    return False
+    return 0
 
 def emit_env(o=sys.__stdout__, d = init(), all=False):
     """Emits all items in the data store in a format such that it can be sourced by a shell."""
 
-    isfunc = lambda key: bool(d.getVarFlag(key, "func", False))
+    isfunc = lambda key: bool(d.getVarFlag(key, "func"))
     keys = sorted((key for key in d.keys() if not key.startswith("__")), key=isfunc)
     grouped = groupby(keys, isfunc)
     for isfunc, keys in grouped:
-        for key in sorted(keys):
+        for key in keys:
             emit_var(key, o, d, all and not isfunc) and o.write('\n')
 
 def exported_keys(d):
     return (key for key in d.keys() if not key.startswith('__') and
-                                      d.getVarFlag(key, 'export', False) and
-                                      not d.getVarFlag(key, 'unexport', False))
+                                      d.getVarFlag(key, 'export') and
+                                      not d.getVarFlag(key, 'unexport'))
 
 def exported_vars(d):
-    k = list(exported_keys(d))
-    for key in k:
+    for key in exported_keys(d):
         try:
-            value = d.getVar(key)
-        except Exception as err:
-            bb.warn("%s: Unable to export ${%s}: %s" % (d.getVar("FILE"), key, err))
-            continue
+            value = d.getVar(key, True)
+        except Exception:
+            pass
 
         if value is not None:
             yield key, str(value)
@@ -220,24 +270,23 @@ def exported_vars(d):
 def emit_func(func, o=sys.__stdout__, d = init()):
     """Emits all items in the data store in a format such that it can be sourced by a shell."""
 
-    keys = (key for key in d.keys() if not key.startswith("__") and not d.getVarFlag(key, "func", False))
-    for key in sorted(keys):
-        emit_var(key, o, d, False)
+    keys = (key for key in d.keys() if not key.startswith("__") and not d.getVarFlag(key, "func"))
+    for key in keys:
+        emit_var(key, o, d, False) and o.write('\n')
 
-    o.write('\n')
     emit_var(func, o, d, False) and o.write('\n')
-    newdeps = bb.codeparser.ShellParser(func, logger).parse_shell(d.getVar(func))
-    newdeps |= set((d.getVarFlag(func, "vardeps") or "").split())
+    newdeps = bb.codeparser.ShellParser(func, logger).parse_shell(d.getVar(func, True))
+    newdeps |= set((d.getVarFlag(func, "vardeps", True) or "").split())
     seen = set()
     while newdeps:
         deps = newdeps
         seen |= deps
         newdeps = set()
         for dep in deps:
-            if d.getVarFlag(dep, "func", False) and not d.getVarFlag(dep, "python", False):
+            if d.getVarFlag(dep, "func") and not d.getVarFlag(dep, "python"):
                emit_var(dep, o, d, False) and o.write('\n')
-               newdeps |=  bb.codeparser.ShellParser(dep, logger).parse_shell(d.getVar(dep))
-               newdeps |= set((d.getVarFlag(dep, "vardeps") or "").split())
+               newdeps |=  bb.codeparser.ShellParser(dep, logger).parse_shell(d.getVar(dep, True))
+               newdeps |= set((d.getVarFlag(dep, "vardeps", True) or "").split())
         newdeps -= seen
 
 _functionfmt = """
@@ -248,7 +297,7 @@ def emit_func_python(func, o=sys.__stdout__, d = init()):
     """Emits all items in the data store in a format such that it can be sourced by a shell."""
 
     def write_func(func, o, call = False):
-        body = d.getVar(func, False)
+        body = d.getVar(func, True)
         if not body.startswith("def"):
             body = _functionfmt.format(function=func, body=body)
 
@@ -258,21 +307,21 @@ def emit_func_python(func, o=sys.__stdout__, d = init()):
 
     write_func(func, o, True)
     pp = bb.codeparser.PythonParser(func, logger)
-    pp.parse_python(d.getVar(func, False))
+    pp.parse_python(d.getVar(func, True))
     newdeps = pp.execs
-    newdeps |= set((d.getVarFlag(func, "vardeps") or "").split())
+    newdeps |= set((d.getVarFlag(func, "vardeps", True) or "").split())
     seen = set()
     while newdeps:
         deps = newdeps
         seen |= deps
         newdeps = set()
         for dep in deps:
-            if d.getVarFlag(dep, "func", False) and d.getVarFlag(dep, "python", False):
+            if d.getVarFlag(dep, "func") and d.getVarFlag(dep, "python"):
                write_func(dep, o)
                pp = bb.codeparser.PythonParser(dep, logger)
-               pp.parse_python(d.getVar(dep, False))
+               pp.parse_python(d.getVar(dep, True))
                newdeps |= pp.execs
-               newdeps |= set((d.getVarFlag(dep, "vardeps") or "").split())
+               newdeps |= set((d.getVarFlag(dep, "vardeps", True) or "").split())
         newdeps -= seen
 
 def update_data(d):
@@ -284,73 +333,60 @@ def build_dependencies(key, keys, shelldeps, varflagsexcl, d):
     try:
         if key[-1] == ']':
             vf = key[:-1].split('[')
-            value, parser = d.getVarFlag(vf[0], vf[1], False, retparser=True)
+            value = d.getVarFlag(vf[0], vf[1], False)
+            parser = d.expandWithRefs(value, key)
             deps |= parser.references
             deps = deps | (keys & parser.execs)
             return deps, value
-        varflags = d.getVarFlags(key, ["vardeps", "vardepvalue", "vardepsexclude", "exports", "postfuncs", "prefuncs", "lineno", "filename"]) or {}
+        varflags = d.getVarFlags(key, ["vardeps", "vardepvalue", "vardepsexclude", "vardepvalueexclude", "postfuncs", "prefuncs"]) or {}
         vardeps = varflags.get("vardeps")
+        value = d.getVar(key, False)
 
         def handle_contains(value, contains, d):
             newvalue = ""
             for k in sorted(contains):
-                l = (d.getVar(k) or "").split()
-                for item in sorted(contains[k]):
-                    for word in item.split():
-                        if not word in l:
-                            newvalue += "\n%s{%s} = Unset" % (k, item)
-                            break
+                l = (d.getVar(k, True) or "").split()
+                for word in sorted(contains[k]):
+                    if word in l:
+                        newvalue += "\n%s{%s} = Set" %  (k, word)
                     else:
-                        newvalue += "\n%s{%s} = Set" % (k, item)
+                        newvalue += "\n%s{%s} = Unset" %  (k, word)
             if not newvalue:
                 return value
             if not value:
                 return newvalue
             return value + newvalue
 
-        def handle_remove(value, deps, removes, d):
-            for r in sorted(removes):
-                r2 = d.expandWithRefs(r, None)
-                value += "\n_remove of %s" % r
-                deps |= r2.references
-                deps = deps | (keys & r2.execs)
-            return value
-
         if "vardepvalue" in varflags:
-            value = varflags.get("vardepvalue")
+           value = varflags.get("vardepvalue")
         elif varflags.get("func"):
             if varflags.get("python"):
-                value = d.getVarFlag(key, "_content", False)
+                parsedvar = d.expandWithRefs(value, key)
                 parser = bb.codeparser.PythonParser(key, logger)
-                parser.parse_python(value, filename=varflags.get("filename"), lineno=varflags.get("lineno"))
+                if parsedvar.value and "\t" in parsedvar.value:
+                    logger.warn("Variable %s contains tabs, please remove these (%s)" % (key, d.getVar("FILE", True)))
+                parser.parse_python(parsedvar.value)
                 deps = deps | parser.references
-                deps = deps | (keys & parser.execs)
                 value = handle_contains(value, parser.contains, d)
             else:
-                value, parsedvar = d.getVarFlag(key, "_content", False, retparser=True)
+                parsedvar = d.expandWithRefs(value, key)
                 parser = bb.codeparser.ShellParser(key, logger)
                 parser.parse_shell(parsedvar.value)
                 deps = deps | shelldeps
-                deps = deps | parsedvar.references
-                deps = deps | (keys & parser.execs) | (keys & parsedvar.execs)
-                value = handle_contains(value, parsedvar.contains, d)
-                if hasattr(parsedvar, "removes"):
-                    value = handle_remove(value, deps, parsedvar.removes, d)
             if vardeps is None:
                 parser.log.flush()
             if "prefuncs" in varflags:
                 deps = deps | set(varflags["prefuncs"].split())
             if "postfuncs" in varflags:
                 deps = deps | set(varflags["postfuncs"].split())
-            if "exports" in varflags:
-                deps = deps | set(varflags["exports"].split())
+            deps = deps | parsedvar.references
+            deps = deps | (keys & parser.execs) | (keys & parsedvar.execs)
+            value = handle_contains(value, parsedvar.contains, d)
         else:
-            value, parser = d.getVarFlag(key, "_content", False, retparser=True)
+            parser = d.expandWithRefs(value, key)
             deps |= parser.references
             deps = deps | (keys & parser.execs)
             value = handle_contains(value, parser.contains, d)
-            if hasattr(parser, "removes"):
-                value = handle_remove(value, deps, parser.removes, d)
 
         if "vardepvalueexclude" in varflags:
             exclude = varflags.get("vardepvalueexclude")
@@ -369,11 +405,8 @@ def build_dependencies(key, keys, shelldeps, varflagsexcl, d):
 
         deps |= set((vardeps or "").split())
         deps -= set(varflags.get("vardepsexclude", "").split())
-    except bb.parse.SkipRecipe:
-        raise
     except Exception as e:
-        bb.warn("Exception during build_dependencies for %s" % key)
-        raise
+        raise bb.data_smart.ExpansionError(key, None, e)
     return deps, value
     #bb.note("Variable %s references %s and calls %s" % (key, str(deps), str(execs)))
     #d.setVarFlag(key, "vardeps", deps)
@@ -381,13 +414,13 @@ def build_dependencies(key, keys, shelldeps, varflagsexcl, d):
 def generate_dependencies(d):
 
     keys = set(key for key in d if not key.startswith("__"))
-    shelldeps = set(key for key in d.getVar("__exportlist", False) if d.getVarFlag(key, "export", False) and not d.getVarFlag(key, "unexport", False))
-    varflagsexcl = d.getVar('BB_SIGNATURE_EXCLUDE_FLAGS')
+    shelldeps = set(key for key in d.getVar("__exportlist", False) if d.getVarFlag(key, "export") and not d.getVarFlag(key, "unexport"))
+    varflagsexcl = d.getVar('BB_SIGNATURE_EXCLUDE_FLAGS', True)
 
     deps = {}
     values = {}
 
-    tasklist = d.getVar('__BBTASKS', False) or []
+    tasklist = d.getVar('__BBTASKS') or []
     for task in tasklist:
         deps[task], values[task] = build_dependencies(task, keys, shelldeps, varflagsexcl, d)
         newdeps = deps[task]
@@ -404,45 +437,8 @@ def generate_dependencies(d):
         #print "For %s: %s" % (task, str(deps[task]))
     return tasklist, deps, values
 
-def generate_dependency_hash(tasklist, gendeps, lookupcache, whitelist, fn):
-    taskdeps = {}
-    basehash = {}
-
-    for task in tasklist:
-        data = lookupcache[task]
-
-        if data is None:
-            bb.error("Task %s from %s seems to be empty?!" % (task, fn))
-            data = ''
-
-        gendeps[task] -= whitelist
-        newdeps = gendeps[task]
-        seen = set()
-        while newdeps:
-            nextdeps = newdeps
-            seen |= nextdeps
-            newdeps = set()
-            for dep in nextdeps:
-                if dep in whitelist:
-                    continue
-                gendeps[dep] -= whitelist
-                newdeps |= gendeps[dep]
-            newdeps -= seen
-
-        alldeps = sorted(seen)
-        for dep in alldeps:
-            data = data + dep
-            var = lookupcache[dep]
-            if var is not None:
-                data = data + str(var)
-        k = fn + "." + task
-        basehash[k] = hashlib.sha256(data.encode("utf-8")).hexdigest()
-        taskdeps[task] = alldeps
-
-    return taskdeps, basehash
-
 def inherits_class(klass, d):
-    val = d.getVar('__inherit_cache', False) or []
+    val = getVar('__inherit_cache', d) or []
     needle = os.path.join('classes', '%s.bbclass' % klass)
     for v in val:
         if v.endswith(needle):

bitbake/lib/bb/data_smart.py

@@ -39,11 +39,9 @@ from bb.COW  import COWDictBase
 logger = logging.getLogger("BitBake.Data")
 
 __setvar_keyword__ = ["_append", "_prepend", "_remove"]
-__setvar_regexp__ = re.compile(r'(?P<base>.*?)(?P<keyword>_append|_prepend|_remove)(_(?P<add>[^A-Z]*))?$')
-__expand_var_regexp__ = re.compile(r"\${[a-zA-Z0-9\-_+./~]+?}")
+__setvar_regexp__ = re.compile('(?P<base>.*?)(?P<keyword>_append|_prepend|_remove)(_(?P<add>.*))?$')
+__expand_var_regexp__ = re.compile(r"\${[^{}@\n\t ]+}")
 __expand_python_regexp__ = re.compile(r"\${@.+?}")
-__whitespace_split__ = re.compile(r'(\s)')
-__override_regexp__ = re.compile(r'[a-z0-9]+')
 
 def infer_caller_details(loginfo, parent = False, varval = True):
     """Save the caller the trouble of specifying everything."""
@@ -56,36 +54,27 @@ def infer_caller_details(loginfo, parent = False, varval = True):
         return
     # Infer caller's likely values for variable (var) and value (value), 
     # to reduce clutter in the rest of the code.
-    above = None
-    def set_above():
+    if varval and ('variable' not in loginfo or 'detail' not in loginfo):
         try:
             raise Exception
         except Exception:
             tb = sys.exc_info()[2]
             if parent:
-                return tb.tb_frame.f_back.f_back.f_back
+                above = tb.tb_frame.f_back.f_back
             else:
-                return tb.tb_frame.f_back.f_back
-
-    if varval and ('variable' not in loginfo or 'detail' not in loginfo):
-        if not above:
-            above = set_above()
-        lcls = above.f_locals.items()
+                above = tb.tb_frame.f_back
+            lcls = above.f_locals.items()
         for k, v in lcls:
             if k == 'value' and 'detail' not in loginfo:
                 loginfo['detail'] = v
             if k == 'var' and 'variable' not in loginfo:
                 loginfo['variable'] = v
     # Infer file/line/function from traceback
-    # Don't use traceback.extract_stack() since it fills the line contents which
-    # we don't need and that hits stat syscalls
     if 'file' not in loginfo:
-        if not above:
-            above = set_above()
-        f = above.f_back
-        line = f.f_lineno
-        file = f.f_code.co_filename
-        func = f.f_code.co_name
+        depth = 3    
+        if parent:
+            depth = 4
+        file, line, func, text = traceback.extract_stack(limit = depth)[0]
         loginfo['file'] = file
         loginfo['line'] = line
         if func not in loginfo:
@@ -106,7 +95,11 @@ class VariableParse:
             if self.varname and key:
                 if self.varname == key:
                     raise Exception("variable %s references itself!" % self.varname)
-            var = self.d.getVarFlag(key, "_content")
+            if key in self.d.expand_cache:
+                varparse = self.d.expand_cache[key]
+                var = varparse.value
+            else:
+                var = self.d.getVarFlag(key, "_content", True)
             self.references.add(key)
             if var is not None:
                 return var
@@ -114,25 +107,13 @@ class VariableParse:
                 return match.group()
 
     def python_sub(self, match):
-            if isinstance(match, str):
-                code = match
-            else:
-                code = match.group()[3:-1]
-
-            if "_remote_data" in self.d:
-                connector = self.d["_remote_data"]
-                return connector.expandPythonRef(self.varname, code, self.d)
-
-            if self.varname:
-                varname = 'Var <%s>' % self.varname
-            else:
-                varname = '<expansion>'
-            codeobj = compile(code.strip(), varname, "eval")
+            code = match.group()[3:-1]
+            codeobj = compile(code.strip(), self.varname or "<expansion>", "eval")
 
             parser = bb.codeparser.PythonParser(self.varname, logger)
             parser.parse_python(code)
             if self.varname:
-                vardeps = self.d.getVarFlag(self.varname, "vardeps")
+                vardeps = self.d.getVarFlag(self.varname, "vardeps", True)
                 if vardeps is None:
                     parser.log.flush()
             else:
@@ -145,7 +126,7 @@ class VariableParse:
                     self.contains[k] = parser.contains[k].copy()
                 else:
                     self.contains[k].update(parser.contains[k])
-            value = utils.better_eval(codeobj, DataContext(self.d), {'d' : self.d})
+            value = utils.better_eval(codeobj, DataContext(self.d))
             return str(value)
 
 
@@ -156,8 +137,8 @@ class DataContext(dict):
         self['d'] = metadata
 
     def __missing__(self, key):
-        value = self.metadata.getVar(key)
-        if value is None or self.metadata.getVarFlag(key, 'func', False):
+        value = self.metadata.getVar(key, True)
+        if value is None or self.metadata.getVarFlag(key, 'func'):
             raise KeyError(key)
         else:
             return value
@@ -232,19 +213,6 @@ class VariableHistory(object):
         new.variables = self.variables.copy()
         return new
 
-    def __getstate__(self):
-        vardict = {}
-        for k, v in self.variables.iteritems():
-            vardict[k] = v
-        return {'dataroot': self.dataroot,
-                'variables': vardict}
-
-    def __setstate__(self, state):
-        self.dataroot = state['dataroot']
-        self.variables = COWDictBase.copy()
-        for k, v in state['variables'].items():
-            self.variables[k] = v
-
     def record(self, *kwonly, **loginfo):
         if not self.dataroot._tracking:
             return
@@ -263,47 +231,16 @@ class VariableHistory(object):
 
         if var not in self.variables:
             self.variables[var] = []
-        if not isinstance(self.variables[var], list):
-            return
-        if 'nodups' in loginfo and loginfo in self.variables[var]:
-            return
         self.variables[var].append(loginfo.copy())
 
-    def rename_variable_hist(self, oldvar, newvar):
-        if not self.dataroot._tracking:
-            return
-        if oldvar not in self.variables:
-            return
-        if newvar not in self.variables:
-            self.variables[newvar] = []
-        for i in self.variables[oldvar]:
-            self.variables[newvar].append(i.copy())
-
     def variable(self, var):
-        remote_connector = self.dataroot.getVar('_remote_data', False)
-        if remote_connector:
-            varhistory = remote_connector.getVarHistory(var)
-        else:
-            varhistory = []
-
         if var in self.variables:
-            varhistory.extend(self.variables[var])
-        return varhistory
+            return self.variables[var]
+        else:
+            return []
 
-    def emit(self, var, oval, val, o, d):
+    def emit(self, var, oval, val, o):
         history = self.variable(var)
-
-        # Append override history
-        if var in d.overridedata:
-            for (r, override) in d.overridedata[var]:
-                for event in self.variable(r):
-                    loginfo = event.copy()
-                    if 'flag' in loginfo and not loginfo['flag'].startswith("_"):
-                        continue
-                    loginfo['variable'] = var
-                    loginfo['op'] = 'override[%s]:%s' % (override, loginfo['op'])
-                    history.append(loginfo)
-
         commentVal = re.sub('\n', '\n#', str(oval))
         if history:
             if len(history) == 1:
@@ -350,31 +287,6 @@ class VariableHistory(object):
                 lines.append(line)
         return lines
 
-    def get_variable_items_files(self, var, d):
-        """
-        Use variable history to map items added to a list variable and
-        the files in which they were added.
-        """
-        history = self.variable(var)
-        finalitems = (d.getVar(var) or '').split()
-        filemap = {}
-        isset = False
-        for event in history:
-            if 'flag' in event:
-                continue
-            if event['op'] == '_remove':
-                continue
-            if isset and event['op'] == 'set?':
-                continue
-            isset = True
-            items = d.expand(event['detail']).split()
-            for item in items:
-                # This is a little crude but is belt-and-braces to avoid us
-                # having to handle every possible operation type specifically
-                if item in finalitems and not item in filemap:
-                    filemap[item] = event['file']
-        return filemap
-
     def del_var_history(self, var, f=None, line=None):
         """If file f and line are not given, the entire history of var is deleted"""
         if var in self.variables:
@@ -384,23 +296,18 @@ class VariableHistory(object):
                 self.variables[var] = []
 
 class DataSmart(MutableMapping):
-    def __init__(self):
+    def __init__(self, special = COWDictBase.copy(), seen = COWDictBase.copy() ):
         self.dict = {}
 
         self.inchistory = IncludeHistory()
         self.varhistory = VariableHistory(self)
         self._tracking = False
 
-        self.expand_cache = {}
-
         # cookie monster tribute
-        # Need to be careful about writes to overridedata as
-        # its only a shallow copy, could influence other data store
-        # copies!
-        self.overridedata = {}
-        self.overrides = None
-        self.overridevars = set(["OVERRIDES", "FILE"])
-        self.inoverride = False
+        self._special_values = special
+        self._seen_overrides = seen
+
+        self.expand_cache = {}
 
     def enableTracking(self):
         self._tracking = True
@@ -410,21 +317,19 @@ class DataSmart(MutableMapping):
 
     def expandWithRefs(self, s, varname):
 
-        if not isinstance(s, str): # sanity check
+        if not isinstance(s, basestring): # sanity check
             return VariableParse(varname, self, s)
 
+        if varname and varname in self.expand_cache:
+            return self.expand_cache[varname]
+
         varparse = VariableParse(varname, self)
 
         while s.find('${') != -1:
             olds = s
             try:
                 s = __expand_var_regexp__.sub(varparse.var_sub, s)
-                try:
-                    s = __expand_python_regexp__.sub(varparse.python_sub, s)
-                except SyntaxError as e:
-                    # Likely unmatched brackets, just don't expand the expression
-                    if e.msg != "EOL while scanning string literal":
-                        raise
+                s = __expand_python_regexp__.sub(varparse.python_sub, s)
                 if s == olds:
                     break
             except ExpansionError:
@@ -432,44 +337,109 @@ class DataSmart(MutableMapping):
             except bb.parse.SkipRecipe:
                 raise
             except Exception as exc:
-                tb = sys.exc_info()[2]
-                raise ExpansionError(varname, s, exc).with_traceback(tb) from exc
+                raise ExpansionError(varname, s, exc)
 
         varparse.value = s
 
+        if varname:
+            self.expand_cache[varname] = varparse
+
         return varparse
 
     def expand(self, s, varname = None):
         return self.expandWithRefs(s, varname).value
 
+
     def finalize(self, parent = False):
-        return
-
-    def internal_finalize(self, parent = False):
         """Performs final steps upon the datastore, including application of overrides"""
-        self.overrides = None
 
-    def need_overrides(self):
-        if self.overrides is not None:
-            return
-        if self.inoverride:
-            return
-        for count in range(5):
-            self.inoverride = True
-            # Can end up here recursively so setup dummy values
-            self.overrides = []
-            self.overridesset = set()
-            self.overrides = (self.getVar("OVERRIDES") or "").split(":") or []
-            self.overridesset = set(self.overrides)
-            self.inoverride = False
-            self.expand_cache = {}
-            newoverrides = (self.getVar("OVERRIDES") or "").split(":") or []
-            if newoverrides == self.overrides:
-                break
-            self.overrides = newoverrides
-            self.overridesset = set(self.overrides)
-        else:
-            bb.fatal("Overrides could not be expanded into a stable state after 5 iterations, overrides must be being referenced by other overridden variables in some recursive fashion. Please provide your configuration to bitbake-devel so we can laugh, er, I mean try and understand how to make it work.")
+        overrides = (self.getVar("OVERRIDES", True) or "").split(":") or []
+        finalize_caller = {
+            'op': 'finalize',
+        }
+        infer_caller_details(finalize_caller, parent = parent, varval = False)
+
+        #
+        # Well let us see what breaks here. We used to iterate
+        # over each variable and apply the override and then
+        # do the line expanding.
+        # If we have bad luck - which we will have - the keys
+        # where in some order that is so important for this
+        # method which we don't have anymore.
+        # Anyway we will fix that and write test cases this
+        # time.
+
+        #
+        # First we apply all overrides
+        # Then we will handle _append and _prepend and store the _remove
+        # information for later.
+        #
+
+        # We only want to report finalization once per variable overridden.
+        finalizes_reported = {}
+
+        for o in overrides:
+            # calculate '_'+override
+            l = len(o) + 1
+
+            # see if one should even try
+            if o not in self._seen_overrides:
+                continue
+
+            vars = self._seen_overrides[o].copy()
+            for var in vars:
+                name = var[:-l]
+                try:
+                    # Report only once, even if multiple changes.
+                    if name not in finalizes_reported:
+                        finalizes_reported[name] = True
+                        finalize_caller['variable'] = name
+                        finalize_caller['detail'] = 'was: ' + str(self.getVar(name, False))
+                        self.varhistory.record(**finalize_caller)
+                    # Copy history of the override over.
+                    for event in self.varhistory.variable(var):
+                        loginfo = event.copy()
+                        loginfo['variable'] = name
+                        loginfo['op'] = 'override[%s]:%s' % (o, loginfo['op'])
+                        self.varhistory.record(**loginfo)
+                    self.setVar(name, self.getVar(var, False), op = 'finalize', file = 'override[%s]' % o, line = '')
+                    self.delVar(var)
+                except Exception:
+                    logger.info("Untracked delVar")
+
+        # now on to the appends and prepends, and stashing the removes
+        for op in __setvar_keyword__:
+            if op in self._special_values:
+                appends = self._special_values[op] or []
+                for append in appends:
+                    keep = []
+                    for (a, o) in self.getVarFlag(append, op) or []:
+                        match = True
+                        if o:
+                            for o2 in o.split("_"):
+                                if not o2 in overrides:
+                                    match = False
+                        if not match:
+                            keep.append((a ,o))
+                            continue
+
+                        if op == "_append":
+                            sval = self.getVar(append, False) or ""
+                            sval += a
+                            self.setVar(append, sval)
+                        elif op == "_prepend":
+                            sval = a + (self.getVar(append, False) or "")
+                            self.setVar(append, sval)
+                        elif op == "_remove":
+                            removes = self.getVarFlag(append, "_removeactive", False) or []
+                            removes.extend(a.split())
+                            self.setVarFlag(append, "_removeactive", removes, ignore=True)
+
+                    # We save overrides that may be applied at some later stage
+                    if keep:
+                        self.setVarFlag(append, op, keep, ignore=True)
+                    else:
+                        self.delVarFlag(append, op, ignore=True)
 
     def initVar(self, var):
         self.expand_cache = {}
@@ -480,22 +450,17 @@ class DataSmart(MutableMapping):
         dest = self.dict
         while dest:
             if var in dest:
-                return dest[var], self.overridedata.get(var, None)
-
-            if "_remote_data" in dest:
-                connector = dest["_remote_data"]["_content"]
-                return connector.getVar(var)
+                return dest[var]
 
             if "_data" not in dest:
                 break
             dest = dest["_data"]
-        return None, self.overridedata.get(var, None)
 
     def _makeShadowCopy(self, var):
         if var in self.dict:
             return
 
-        local_var, _ = self._findVar(var)
+        local_var = self._findVar(var)
 
         if local_var:
             self.dict[var] = copy.copy(local_var)
@@ -505,26 +470,15 @@ class DataSmart(MutableMapping):
 
     def setVar(self, var, value, **loginfo):
         #print("var=" + str(var) + "  val=" + str(value))
-        self.expand_cache = {}
-        parsing=False
-        if 'parsing' in loginfo:
-            parsing=True
-
-        if '_remote_data' in self.dict:
-            connector = self.dict["_remote_data"]["_content"]
-            res = connector.setVar(var, value)
-            if not res:
-                return
-
         if 'op' not in loginfo:
             loginfo['op'] = "set"
-
+        self.expand_cache = {}
         match  = __setvar_regexp__.match(var)
         if match and match.group("keyword") in __setvar_keyword__:
             base = match.group('base')
             keyword = match.group("keyword")
             override = match.group('add')
-            l = self.getVarFlag(base, keyword, False) or []
+            l = self.getVarFlag(base, keyword) or []
             l.append([value, override])
             self.setVarFlag(base, keyword, l, ignore=True)
             # And cause that to be recorded:
@@ -537,120 +491,65 @@ class DataSmart(MutableMapping):
             self.varhistory.record(**loginfo)
             # todo make sure keyword is not __doc__ or __module__
             # pay the cookie monster
+            try:
+                self._special_values[keyword].add(base)
+            except KeyError:
+                self._special_values[keyword] = set()
+                self._special_values[keyword].add(base)
 
-            # more cookies for the cookie monster
-            if '_' in var:
-                self._setvar_update_overrides(base, **loginfo)
-
-            if base in self.overridevars:
-                self._setvar_update_overridevars(var, value)
             return
 
         if not var in self.dict:
             self._makeShadowCopy(var)
 
-        if not parsing:
-            if "_append" in self.dict[var]:
-                del self.dict[var]["_append"]
-            if "_prepend" in self.dict[var]:
-                del self.dict[var]["_prepend"]
-            if "_remove" in self.dict[var]:
-                del self.dict[var]["_remove"]
-            if var in self.overridedata:
-                active = []
-                self.need_overrides()
-                for (r, o) in self.overridedata[var]:
-                    if o in self.overridesset:
-                        active.append(r)
-                    elif "_" in o:
-                        if set(o.split("_")).issubset(self.overridesset):
-                            active.append(r)
-                for a in active:
-                    self.delVar(a)
-                del self.overridedata[var]
-
         # more cookies for the cookie monster
         if '_' in var:
-            self._setvar_update_overrides(var, **loginfo)
+            self._setvar_update_overrides(var)
 
         # setting var
         self.dict[var]["_content"] = value
         self.varhistory.record(**loginfo)
 
-        if var in self.overridevars:
-            self._setvar_update_overridevars(var, value)
-
-    def _setvar_update_overridevars(self, var, value):
-        vardata = self.expandWithRefs(value, var)
-        new = vardata.references
-        new.update(vardata.contains.keys())
-        while not new.issubset(self.overridevars):
-            nextnew = set()
-            self.overridevars.update(new)
-            for i in new:
-                vardata = self.expandWithRefs(self.getVar(i), i)
-                nextnew.update(vardata.references)
-                nextnew.update(vardata.contains.keys())
-            new = nextnew
-        self.internal_finalize(True)
-
-    def _setvar_update_overrides(self, var, **loginfo):
+    def _setvar_update_overrides(self, var):
         # aka pay the cookie monster
         override = var[var.rfind('_')+1:]
         shortvar = var[:var.rfind('_')]
-        while override and __override_regexp__.match(override):
-            if shortvar not in self.overridedata:
-                self.overridedata[shortvar] = []
-            if [var, override] not in self.overridedata[shortvar]:
-                # Force CoW by recreating the list first
-                self.overridedata[shortvar] = list(self.overridedata[shortvar])
-                self.overridedata[shortvar].append([var, override])
+        while override:
+            if override not in self._seen_overrides:
+                self._seen_overrides[override] = set()
+            self._seen_overrides[override].add( var )
             override = None
             if "_" in shortvar:
                 override = var[shortvar.rfind('_')+1:]
                 shortvar = var[:shortvar.rfind('_')]
-                if len(shortvar) == 0:
-                    override = None
 
-    def getVar(self, var, expand=True, noweakdefault=False, parsing=False):
-        return self.getVarFlag(var, "_content", expand, noweakdefault, parsing)
+    def getVar(self, var, expand=False, noweakdefault=False):
+        return self.getVarFlag(var, "_content", expand, noweakdefault)
 
     def renameVar(self, key, newkey, **loginfo):
         """
         Rename the variable key to newkey
         """
-        if '_remote_data' in self.dict:
-            connector = self.dict["_remote_data"]["_content"]
-            res = connector.renameVar(key, newkey)
-            if not res:
-                return
-
-        val = self.getVar(key, 0, parsing=True)
+        val = self.getVar(key, 0)
         if val is not None:
-            self.varhistory.rename_variable_hist(key, newkey)
             loginfo['variable'] = newkey
             loginfo['op'] = 'rename from %s' % key
             loginfo['detail'] = val
             self.varhistory.record(**loginfo)
-            self.setVar(newkey, val, ignore=True, parsing=True)
+            self.setVar(newkey, val, ignore=True)
 
         for i in (__setvar_keyword__):
-            src = self.getVarFlag(key, i, False)
+            src = self.getVarFlag(key, i)
             if src is None:
                 continue
 
-            dest = self.getVarFlag(newkey, i, False) or []
+            dest = self.getVarFlag(newkey, i) or []
             dest.extend(src)
             self.setVarFlag(newkey, i, dest, ignore=True)
 
-        if key in self.overridedata:
-            self.overridedata[newkey] = []
-            for (v, o) in self.overridedata[key]:
-                self.overridedata[newkey].append([v.replace(key, newkey), o])
-                self.renameVar(v, v.replace(key, newkey))
-
-        if '_' in newkey and val is None:
-            self._setvar_update_overrides(newkey, **loginfo)
+            if i in self._special_values and key in self._special_values[i]:
+                self._special_values[i].remove(key)
+                self._special_values[i].add(newkey)
 
         loginfo['variable'] = key
         loginfo['op'] = 'rename (to)'
@@ -661,53 +560,27 @@ class DataSmart(MutableMapping):
     def appendVar(self, var, value, **loginfo):
         loginfo['op'] = 'append'
         self.varhistory.record(**loginfo)
-        self.setVar(var + "_append", value, ignore=True, parsing=True)
+        newvalue = (self.getVar(var, False) or "") + value
+        self.setVar(var, newvalue, ignore=True)
 
     def prependVar(self, var, value, **loginfo):
         loginfo['op'] = 'prepend'
         self.varhistory.record(**loginfo)
-        self.setVar(var + "_prepend", value, ignore=True, parsing=True)
+        newvalue = value + (self.getVar(var, False) or "")
+        self.setVar(var, newvalue, ignore=True)
 
     def delVar(self, var, **loginfo):
-        self.expand_cache = {}
-        if '_remote_data' in self.dict:
-            connector = self.dict["_remote_data"]["_content"]
-            res = connector.delVar(var)
-            if not res:
-                return
-
         loginfo['detail'] = ""
         loginfo['op'] = 'del'
         self.varhistory.record(**loginfo)
+        self.expand_cache = {}
         self.dict[var] = {}
-        if var in self.overridedata:
-            del self.overridedata[var]
         if '_' in var:
             override = var[var.rfind('_')+1:]
-            shortvar = var[:var.rfind('_')]
-            while override and override.islower():
-                try:
-                    if shortvar in self.overridedata:
-                        # Force CoW by recreating the list first
-                        self.overridedata[shortvar] = list(self.overridedata[shortvar])
-                        self.overridedata[shortvar].remove([var, override])
-                except ValueError as e:
-                    pass
-                override = None
-                if "_" in shortvar:
-                    override = var[shortvar.rfind('_')+1:]
-                    shortvar = var[:shortvar.rfind('_')]
-                    if len(shortvar) == 0:
-                         override = None
+            if override and override in self._seen_overrides and var in self._seen_overrides[override]:
+                self._seen_overrides[override].remove(var)
 
     def setVarFlag(self, var, flag, value, **loginfo):
-        self.expand_cache = {}
-        if '_remote_data' in self.dict:
-            connector = self.dict["_remote_data"]["_content"]
-            res = connector.setVarFlag(var, flag, value)
-            if not res:
-                return
-
         if 'op' not in loginfo:
             loginfo['op'] = "set"
         loginfo['flag'] = flag
@@ -716,10 +589,8 @@ class DataSmart(MutableMapping):
             self._makeShadowCopy(var)
         self.dict[var][flag] = value
 
-        if flag == "_defaultval" and '_' in var:
-            self._setvar_update_overrides(var, **loginfo)
-        if flag == "_defaultval" and var in self.overridevars:
-            self._setvar_update_overridevars(var, value)
+        if flag == "defaultval" and '_' in var:
+            self._setvar_update_overrides(var)
 
         if flag == "unexport" or flag == "export":
             if not "__exportlist" in self.dict:
@@ -728,142 +599,36 @@ class DataSmart(MutableMapping):
                 self.dict["__exportlist"]["_content"] = set()
             self.dict["__exportlist"]["_content"].add(var)
 
-    def getVarFlag(self, var, flag, expand=True, noweakdefault=False, parsing=False, retparser=False):
-        if flag == "_content":
-            cachename = var
-        else:
-            if not flag:
-                bb.warn("Calling getVarFlag with flag unset is invalid")
-                return None
-            cachename = var + "[" + flag + "]"
-
-        if expand and cachename in self.expand_cache:
-            return self.expand_cache[cachename].value
-
-        local_var, overridedata = self._findVar(var)
+    def getVarFlag(self, var, flag, expand=False, noweakdefault=False):
+        local_var = self._findVar(var)
         value = None
-        removes = set()
-        if flag == "_content" and overridedata is not None and not parsing:
-            match = False
-            active = {}
-            self.need_overrides()
-            for (r, o) in overridedata:
-                # What about double overrides both with "_" in the name?
-                if o in self.overridesset:
-                    active[o] = r
-                elif "_" in o:
-                    if set(o.split("_")).issubset(self.overridesset):
-                        active[o] = r
-
-            mod = True
-            while mod:
-                mod = False
-                for o in self.overrides:
-                    for a in active.copy():
-                        if a.endswith("_" + o):
-                            t = active[a]
-                            del active[a]
-                            active[a.replace("_" + o, "")] = t
-                            mod = True
-                        elif a == o:
-                            match = active[a]
-                            del active[a]
-            if match:
-                value, subparser = self.getVarFlag(match, "_content", False, retparser=True)
-                if hasattr(subparser, "removes"):
-                    # We have to carry the removes from the overridden variable to apply at the
-                    # end of processing
-                    removes = subparser.removes
-
-        if local_var is not None and value is None:
+        if local_var is not None:
             if flag in local_var:
                 value = copy.copy(local_var[flag])
-            elif flag == "_content" and "_defaultval" in local_var and not noweakdefault:
-                value = copy.copy(local_var["_defaultval"])
-
-
-        if flag == "_content" and local_var is not None and "_append" in local_var and not parsing:
-            if not value:
-                value = ""
-            self.need_overrides()
-            for (r, o) in local_var["_append"]:
-                match = True
-                if o:
-                    for o2 in o.split("_"):
-                        if not o2 in self.overrides:
-                            match = False                            
-                if match:
-                    value = value + r
-
-        if flag == "_content" and local_var is not None and "_prepend" in local_var and not parsing:
-            if not value:
-                value = ""
-            self.need_overrides()
-            for (r, o) in local_var["_prepend"]:
-
-                match = True
-                if o:
-                    for o2 in o.split("_"):
-                        if not o2 in self.overrides:
-                            match = False                            
-                if match:
-                    value = r + value
-
-        parser = None
-        if expand or retparser:
-            parser = self.expandWithRefs(value, cachename)
-        if expand:
-            value = parser.value
-
-        if value and flag == "_content" and local_var is not None and "_remove" in local_var and not parsing:
-            self.need_overrides()
-            for (r, o) in local_var["_remove"]:
-                match = True
-                if o:
-                    for o2 in o.split("_"):
-                        if not o2 in self.overrides:
-                            match = False                            
-                if match:
-                    removes.add(r)
-
-        if value and flag == "_content" and not parsing:
-            if removes and parser:
-                expanded_removes = {}
-                for r in removes:
-                    expanded_removes[r] = self.expand(r).split()
-
-                parser.removes = set()
-                val = ""
-                for v in __whitespace_split__.split(parser.value):
-                    skip = False
-                    for r in removes:
-                        if v in expanded_removes[r]:
-                            parser.removes.add(r)
-                            skip = True
-                    if skip:
-                        continue
-                    val = val + v
-                parser.value = val
-                if expand:
-                    value = parser.value
-
-        if parser:
-            self.expand_cache[cachename] = parser
-
-        if retparser:
-            return value, parser
-
+            elif flag == "_content" and "defaultval" in local_var and not noweakdefault:
+                value = copy.copy(local_var["defaultval"])
+        if expand and value:
+            # Only getvar (flag == _content) hits the expand cache
+            cachename = None
+            if flag == "_content":
+                cachename = var
+            else:
+                cachename = var + "[" + flag + "]"
+            value = self.expand(value, cachename)
+        if value and flag == "_content" and local_var is not None and "_removeactive" in local_var:
+            removes = [self.expand(r).split()  for r in local_var["_removeactive"]]
+            removes = reduce(lambda a, b: a+b, removes, [])
+            filtered = filter(lambda v: v not in removes,
+                              value.split())
+            value = " ".join(filtered)
+            if expand:
+                 # We need to ensure the expand cache has the correct value
+                 # flag == "_content" here
+                self.expand_cache[var].value = value
         return value
 
     def delVarFlag(self, var, flag, **loginfo):
-        self.expand_cache = {}
-        if '_remote_data' in self.dict:
-            connector = self.dict["_remote_data"]["_content"]
-            res = connector.delVarFlag(var, flag)
-            if not res:
-                return
-
-        local_var, _ = self._findVar(var)
+        local_var = self._findVar(var)
         if not local_var:
             return
         if not var in self.dict:
@@ -892,7 +657,6 @@ class DataSmart(MutableMapping):
         self.setVarFlag(var, flag, newvalue, ignore=True)
 
     def setVarFlags(self, var, flags, **loginfo):
-        self.expand_cache = {}
         infer_caller_details(loginfo)
         if not var in self.dict:
             self._makeShadowCopy(var)
@@ -906,7 +670,7 @@ class DataSmart(MutableMapping):
             self.dict[var][i] = flags[i]
 
     def getVarFlags(self, var, expand = False, internalflags=False):
-        local_var, _ = self._findVar(var)
+        local_var = self._findVar(var)
         flags = {}
 
         if local_var:
@@ -922,7 +686,6 @@ class DataSmart(MutableMapping):
 
 
     def delVarFlags(self, var, **loginfo):
-        self.expand_cache = {}
         if not var in self.dict:
             self._makeShadowCopy(var)
 
@@ -940,25 +703,20 @@ class DataSmart(MutableMapping):
             else:
                 del self.dict[var]
 
+
     def createCopy(self):
         """
         Create a copy of self by setting _data to self
         """
         # we really want this to be a DataSmart...
-        data = DataSmart()
+        data = DataSmart(seen=self._seen_overrides.copy(), special=self._special_values.copy())
         data.dict["_data"] = self.dict
         data.varhistory = self.varhistory.copy()
-        data.varhistory.dataroot = data
+        data.varhistory.datasmart = data
         data.inchistory = self.inchistory.copy()
 
         data._tracking = self._tracking
 
-        data.overrides = None
-        data.overridevars = copy.copy(self.overridevars)
-        # Should really be a deepcopy but has heavy overhead.
-        # Instead, we're careful with writes.
-        data.overridedata = copy.copy(self.overridedata)
-
         return data
 
     def expandVarref(self, variable, parents=False):
@@ -979,55 +737,29 @@ class DataSmart(MutableMapping):
 
     def localkeys(self):
         for key in self.dict:
-            if key not in ['_data', '_remote_data']:
+            if key != '_data':
                 yield key
 
     def __iter__(self):
-        deleted = set()
-        overrides = set()
         def keylist(d):        
             klist = set()
             for key in d:
-                if key in ["_data", "_remote_data"]:
-                    continue
-                if key in deleted:
-                    continue
-                if key in overrides:
+                if key == "_data":
                     continue
                 if not d[key]:
-                    deleted.add(key)
                     continue
                 klist.add(key)
 
             if "_data" in d:
                 klist |= keylist(d["_data"])
 
-            if "_remote_data" in d:
-                connector = d["_remote_data"]["_content"]
-                for key in connector.getKeys():
-                    if key in deleted:
-                        continue
-                    klist.add(key)
-
             return klist
 
-        self.need_overrides()
-        for var in self.overridedata:
-            for (r, o) in self.overridedata[var]:
-                if o in self.overridesset:
-                    overrides.add(var)
-                elif "_" in o:
-                    if set(o.split("_")).issubset(self.overridesset):
-                        overrides.add(var)
-
         for k in keylist(self.dict):
              yield k
 
-        for k in overrides:
-             yield k
-
     def __len__(self):
-        return len(frozenset(iter(self)))
+        return len(frozenset(self))
 
     def __getitem__(self, item):
         value = self.getVar(item, False)
@@ -1046,8 +778,9 @@ class DataSmart(MutableMapping):
         data = {}
         d = self.createCopy()
         bb.data.expandKeys(d)
+        bb.data.update_data(d)
 
-        config_whitelist = set((d.getVar("BB_HASHCONFIG_WHITELIST") or "").split())
+        config_whitelist = set((d.getVar("BB_HASHCONFIG_WHITELIST", True) or "").split())
         keys = set(key for key in iter(d) if not key.startswith("__"))
         for key in keys:
             if key in config_whitelist:
@@ -1066,12 +799,13 @@ class DataSmart(MutableMapping):
 
         for key in ["__BBTASKS", "__BBANONFUNCS", "__BBHANDLERS"]:
             bb_list = d.getVar(key, False) or []
+            bb_list.sort()
             data.update({key:str(bb_list)})
 
             if key == "__BBANONFUNCS":
                 for i in bb_list:
-                    value = d.getVar(i, False) or ""
+                    value = d.getVar(i, True) or ""
                     data.update({i:value})
 
         data_str = str([(k, data[k]) for k in sorted(data.keys())])
-        return hashlib.sha256(data_str.encode("utf-8")).hexdigest()
+        return hashlib.md5(data_str).hexdigest()

bitbake/lib/bb/event.py

@@ -24,13 +24,13 @@ BitBake build tools.
 
 import os, sys
 import warnings
-import pickle
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
 import logging
 import atexit
 import traceback
-import ast
-import threading
-
 import bb.utils
 import bb.compat
 import bb.exceptions
@@ -48,16 +48,6 @@ class Event(object):
     def __init__(self):
         self.pid = worker_pid
 
-
-class HeartbeatEvent(Event):
-    """Triggered at regular time intervals of 10 seconds. Other events can fire much more often
-       (runQueueTaskStarted when there are many short tasks) or not at all for long periods
-       of time (again runQueueTaskStarted, when there is just one long-running task), so this
-       event is more suitable for doing some task-independent work occassionally."""
-    def __init__(self, time):
-        Event.__init__(self)
-        self.time = time
-
 Registered        = 10
 AlreadyRegistered = 14
 
@@ -78,30 +68,9 @@ _ui_logfilters = {}
 _ui_handler_seq = 0
 _event_handler_map = {}
 _catchall_handlers = {}
-_eventfilter = None
-_uiready = False
-_thread_lock = threading.Lock()
-_thread_lock_enabled = False
-
-if hasattr(__builtins__, '__setitem__'):
-    builtins = __builtins__
-else:
-    builtins = __builtins__.__dict__
-
-def enable_threadlock():
-    global _thread_lock_enabled
-    _thread_lock_enabled = True
-
-def disable_threadlock():
-    global _thread_lock_enabled
-    _thread_lock_enabled = False
 
 def execute_handler(name, handler, event, d):
     event.data = d
-    addedd = False
-    if 'd' not in builtins:
-        builtins['d'] = d
-        addedd = True
     try:
         ret = handler(event)
     except (bb.parse.SkipRecipe, bb.BBHandledException):
@@ -117,8 +86,6 @@ def execute_handler(name, handler, event, d):
         raise
     finally:
         del event.data
-        if addedd:
-            del builtins['d']
 
 def fire_class_handlers(event, d):
     if isinstance(event, logging.LogRecord):
@@ -126,11 +93,8 @@ def fire_class_handlers(event, d):
 
     eid = str(event.__class__)[8:-2]
     evt_hmap = _event_handler_map.get(eid, {})
-    for name, handler in list(_handlers.items()):
+    for name, handler in _handlers.iteritems():
         if name in _catchall_handlers or name in evt_hmap:
-            if _eventfilter:
-                if not _eventfilter(name, handler, event, d):
-                    continue
             execute_handler(name, handler, event, d)
 
 ui_queue = []
@@ -139,60 +103,33 @@ def print_ui_queue():
     """If we're exiting before a UI has been spawned, display any queued
     LogRecords to the console."""
     logger = logging.getLogger("BitBake")
-    if not _uiready:
+    if not _ui_handlers:
         from bb.msg import BBLogFormatter
-        # Flush any existing buffered content
-        sys.stdout.flush()
-        sys.stderr.flush()
-        stdout = logging.StreamHandler(sys.stdout)
-        stderr = logging.StreamHandler(sys.stderr)
-        formatter = BBLogFormatter("%(levelname)s: %(message)s")
-        stdout.setFormatter(formatter)
-        stderr.setFormatter(formatter)
+        console = logging.StreamHandler(sys.stdout)
+        console.setFormatter(BBLogFormatter("%(levelname)s: %(message)s"))
+        logger.handlers = [console]
 
         # First check to see if we have any proper messages
         msgprint = False
-        msgerrs = False
-
-        # Should we print to stderr?
-        for event in ui_queue[:]:
-            if isinstance(event, logging.LogRecord) and event.levelno >= logging.WARNING:
-                msgerrs = True
-                break
-
-        if msgerrs:
-            logger.addHandler(stderr)
-        else:
-            logger.addHandler(stdout)
-
-        for event in ui_queue[:]:
+        for event in ui_queue:
             if isinstance(event, logging.LogRecord):
                 if event.levelno > logging.DEBUG:
                     logger.handle(event)
                     msgprint = True
+        if msgprint:
+            return
 
         # Nope, so just print all of the messages we have (including debug messages)
-        if not msgprint:
-            for event in ui_queue[:]:
-                if isinstance(event, logging.LogRecord):
-                    logger.handle(event)
-        if msgerrs:
-            logger.removeHandler(stderr)
-        else:
-            logger.removeHandler(stdout)
+        for event in ui_queue:
+            if isinstance(event, logging.LogRecord):
+                logger.handle(event)
 
 def fire_ui_handlers(event, d):
-    global _thread_lock
-    global _thread_lock_enabled
-
-    if not _uiready:
+    if not _ui_handlers:
         # No UI handlers registered yet, queue up the messages
         ui_queue.append(event)
         return
 
-    if _thread_lock_enabled:
-        _thread_lock.acquire()
-
     errors = []
     for h in _ui_handlers:
         #print "Sending event %s" % event
@@ -211,9 +148,6 @@ def fire_ui_handlers(event, d):
     for h in errors:
         del _ui_handlers[h]
 
-    if _thread_lock_enabled:
-        _thread_lock.release()
-
 def fire(event, d):
     """Fire off an Event"""
 
@@ -226,19 +160,13 @@ def fire(event, d):
     if worker_fire:
         worker_fire(event, d)
     else:
-        # If messages have been queued up, clear the queue
-        global _uiready, ui_queue
-        if _uiready and ui_queue:
-            for queue_event in ui_queue:
-                fire_ui_handlers(queue_event, d)
-            ui_queue = []
         fire_ui_handlers(event, d)
 
 def fire_from_worker(event, d):
     fire_ui_handlers(event, d)
 
 noop = lambda _: None
-def register(name, handler, mask=None, filename=None, lineno=None):
+def register(name, handler, mask=[]):
     """Register an Event handler"""
 
     # already registered
@@ -247,18 +175,10 @@ def register(name, handler, mask=None, filename=None, lineno=None):
 
     if handler is not None:
         # handle string containing python code
-        if isinstance(handler, str):
+        if isinstance(handler, basestring):
             tmp = "def %s(e):\n%s" % (name, handler)
             try:
-                code = bb.methodpool.compile_cache(tmp)
-                if not code:
-                    if filename is None:
-                        filename = "%s(e)" % name
-                    code = compile(tmp, filename, "exec", ast.PyCF_ONLY_AST)
-                    if lineno is not None:
-                        ast.increment_lineno(code, lineno-1)
-                    code = compile(code, filename, "exec")
-                    bb.methodpool.compile_cache_add(tmp, code)
+                code = compile(tmp, "%s(e)" % name, "exec")
             except SyntaxError:
                 logger.error("Unable to register event handler '%s':\n%s", name,
                              ''.join(traceback.format_exc(limit=0)))
@@ -284,46 +204,19 @@ def register(name, handler, mask=None, filename=None, lineno=None):
 def remove(name, handler):
     """Remove an Event handler"""
     _handlers.pop(name)
-    if name in _catchall_handlers:
-        _catchall_handlers.pop(name)
-    for event in _event_handler_map.keys():
-        if name in _event_handler_map[event]:
-            _event_handler_map[event].pop(name)
 
-def get_handlers():
-    return _handlers
-
-def set_handlers(handlers):
-    global _handlers
-    _handlers = handlers
-
-def set_eventfilter(func):
-    global _eventfilter
-    _eventfilter = func
-
-def register_UIHhandler(handler, mainui=False):
+def register_UIHhandler(handler):
     bb.event._ui_handler_seq = bb.event._ui_handler_seq + 1
     _ui_handlers[_ui_handler_seq] = handler
     level, debug_domains = bb.msg.constructLogOptions()
     _ui_logfilters[_ui_handler_seq] = UIEventFilter(level, debug_domains)
-    if mainui:
-        global _uiready
-        _uiready = _ui_handler_seq
     return _ui_handler_seq
 
-def unregister_UIHhandler(handlerNum, mainui=False):
-    if mainui:
-        global _uiready
-        _uiready = False
+def unregister_UIHhandler(handlerNum):
     if handlerNum in _ui_handlers:
         del _ui_handlers[handlerNum]
     return
 
-def get_uihandler():
-    if _uiready is False:
-        return None
-    return _uiready
-
 # Class to allow filtering of events and specific filtering of LogRecords *before* we put them over the IPC
 class UIEventFilter(object):
     def __init__(self, level, debug_domains):
@@ -386,30 +279,13 @@ class OperationProgress(Event):
 class ConfigParsed(Event):
     """Configuration Parsing Complete"""
 
-class MultiConfigParsed(Event):
-    """Multi-Config Parsing Complete"""
-    def __init__(self, mcdata):
-        self.mcdata = mcdata
-        Event.__init__(self)
-
 class RecipeEvent(Event):
     def __init__(self, fn):
         self.fn = fn
         Event.__init__(self)
 
 class RecipePreFinalise(RecipeEvent):
-    """ Recipe Parsing Complete but not yet finalised"""
-
-class RecipeTaskPreProcess(RecipeEvent):
-    """
-    Recipe Tasks about to be finalised
-    The list of tasks should be final at this point and handlers
-    are only able to change interdependencies
-    """
-    def __init__(self, fn, tasklist):
-        self.fn = fn
-        self.tasklist = tasklist
-        Event.__init__(self)
+    """ Recipe Parsing Complete but not yet finialised"""
 
 class RecipeParsed(RecipeEvent):
     """ Recipe Parsing Complete """
@@ -432,7 +308,7 @@ class StampUpdate(Event):
     targets = property(getTargets)
 
 class BuildBase(Event):
-    """Base class for bitbake build events"""
+    """Base class for bbmake run events"""
 
     def __init__(self, n, p, failures = 0):
         self._name = n
@@ -452,6 +328,12 @@ class BuildBase(Event):
     def setName(self, name):
         self._name = name
 
+    def getCfg(self):
+        return self.data
+
+    def setCfg(self, cfg):
+        self.data = cfg
+
     def getFailures(self):
         """
         Return the number of failed packages
@@ -460,27 +342,25 @@ class BuildBase(Event):
 
     pkgs = property(getPkgs, setPkgs, None, "pkgs property")
     name = property(getName, setName, None, "name property")
+    cfg = property(getCfg, setCfg, None, "cfg property")
+
+
+
 
-class BuildInit(BuildBase):
-    """buildFile or buildTargets was invoked"""
-    def __init__(self, p=[]):
-        name = None
-        BuildBase.__init__(self, name, p)
 
 class BuildStarted(BuildBase, OperationStarted):
-    """Event when builds start"""
+    """bbmake build run started"""
     def __init__(self, n, p, failures = 0):
         OperationStarted.__init__(self, "Building Started")
         BuildBase.__init__(self, n, p, failures)
 
 class BuildCompleted(BuildBase, OperationCompleted):
-    """Event when builds have completed"""
-    def __init__(self, total, n, p, failures=0, interrupted=0):
+    """bbmake build run completed"""
+    def __init__(self, total, n, p, failures = 0):
         if not failures:
             OperationCompleted.__init__(self, total, "Building Succeeded")
         else:
             OperationCompleted.__init__(self, total, "Building Failed")
-        self._interrupted = interrupted
         BuildBase.__init__(self, n, p, failures)
 
 class DiskFull(Event):
@@ -492,27 +372,10 @@ class DiskFull(Event):
         self._free = freespace
         self._mountpoint = mountpoint
 
-class DiskUsageSample:
-    def __init__(self, available_bytes, free_bytes, total_bytes):
-        # Number of bytes available to non-root processes.
-        self.available_bytes = available_bytes
-        # Number of bytes available to root processes.
-        self.free_bytes = free_bytes
-        # Total capacity of the volume.
-        self.total_bytes = total_bytes
-
-class MonitorDiskEvent(Event):
-    """If BB_DISKMON_DIRS is set, then this event gets triggered each time disk space is checked.
-       Provides information about devices that are getting monitored."""
-    def __init__(self, disk_usage):
-        Event.__init__(self)
-        # hash of device root path -> DiskUsageSample
-        self.disk_usage = disk_usage
-
 class NoProvider(Event):
     """No Provider for an Event"""
 
-    def __init__(self, item, runtime=False, dependees=None, reasons=None, close_matches=None):
+    def __init__(self, item, runtime=False, dependees=None, reasons=[], close_matches=[]):
         Event.__init__(self)
         self._item = item
         self._runtime = runtime
@@ -526,28 +389,6 @@ class NoProvider(Event):
     def isRuntime(self):
         return self._runtime
 
-    def __str__(self):
-        msg = ''
-        if self._runtime:
-            r = "R"
-        else:
-            r = ""
-
-        extra = ''
-        if not self._reasons:
-            if self._close_matches:
-                extra = ". Close matches:\n  %s" % '\n  '.join(self._close_matches)
-
-        if self._dependees:
-            msg = "Nothing %sPROVIDES '%s' (but %s %sDEPENDS on or otherwise requires it)%s" % (r, self._item, ", ".join(self._dependees), r, extra)
-        else:
-            msg = "Nothing %sPROVIDES '%s'%s" % (r, self._item, extra)
-        if self._reasons:
-            for reason in self._reasons:
-                msg += '\n' + reason
-        return msg
-
-
 class MultipleProviders(Event):
     """Multiple Providers"""
 
@@ -575,16 +416,6 @@ class MultipleProviders(Event):
         """
         return self._candidates
 
-    def __str__(self):
-        msg = "Multiple providers are available for %s%s (%s)" % (self._is_runtime and "runtime " or "",
-                            self._item,
-                            ", ".join(self._candidates))
-        rtime = ""
-        if self._is_runtime:
-            rtime = "R"
-        msg += "\nConsider defining a PREFERRED_%sPROVIDER entry to match %s" % (rtime, self._item)
-        return msg
-
 class ParseStarted(OperationStarted):
     """Recipe parsing for the runqueue has begun"""
     def __init__(self, total):
@@ -658,16 +489,6 @@ class TargetsTreeGenerated(Event):
         Event.__init__(self)
         self._model = model
 
-class ReachableStamps(Event):
-    """
-    An event listing all stamps reachable after parsing
-    which the metadata may use to clean up stale data
-    """
-
-    def __init__(self, stamps):
-        Event.__init__(self)
-        self.stamps = stamps
-
 class FilesMatchingFound(Event):
     """
     Event when a list of files matching the supplied pattern has
@@ -678,6 +499,14 @@ class FilesMatchingFound(Event):
         self._pattern = pattern
         self._matches = matches
 
+class CoreBaseFilesFound(Event):
+    """
+    Event when a list of appropriate config files has been generated
+    """
+    def __init__(self, paths):
+        Event.__init__(self)
+        self._paths = paths
+
 class ConfigFilesFound(Event):
     """
     Event when a list of appropriate config files has been generated
@@ -737,10 +566,7 @@ class LogHandler(logging.Handler):
             etype, value, tb = record.exc_info
             if hasattr(tb, 'tb_next'):
                 tb = list(bb.exceptions.extract_traceback(tb, context=3))
-            # Need to turn the value into something the logging system can pickle
             record.bb_exc_info = (etype, value, tb)
-            record.bb_exc_formatted = bb.exceptions.format_exception(etype, value, tb, limit=5)
-            value = str(value)
             record.exc_info = None
         fire(record, None)
 
@@ -748,6 +574,19 @@ class LogHandler(logging.Handler):
         record.taskpid = worker_pid
         return True
 
+class RequestPackageInfo(Event):
+    """
+    Event to request package information
+    """
+
+class PackageInfo(Event):
+    """
+    Package information for GUI
+    """
+    def __init__(self, pkginfolist):
+        Event.__init__(self)
+        self._pkginfolist = pkginfolist
+
 class MetadataEvent(Event):
     """
     Generic event that target for OE-Core classes
@@ -758,33 +597,6 @@ class MetadataEvent(Event):
         self.type = eventtype
         self._localdata = eventdata
 
-class ProcessStarted(Event):
-    """
-    Generic process started event (usually part of the initial startup)
-    where further progress events will be delivered
-    """
-    def __init__(self, processname, total):
-        Event.__init__(self)
-        self.processname = processname
-        self.total = total
-
-class ProcessProgress(Event):
-    """
-    Generic process progress event (usually part of the initial startup)
-    """
-    def __init__(self, processname, progress):
-        Event.__init__(self)
-        self.processname = processname
-        self.progress = progress
-
-class ProcessFinished(Event):
-    """
-    Generic process finished event (usually part of the initial startup)
-    """
-    def __init__(self, processname):
-        Event.__init__(self)
-        self.processname = processname
-
 class SanityCheck(Event):
     """
     Event to run sanity checks, either raise errors or generate events as return status.
@@ -825,10 +637,3 @@ class NetworkTestFailed(Event):
     Event to indicate network test has failed
     """
 
-class FindSigInfoResult(Event):
-    """
-    Event to return results from findSigInfo command
-    """
-    def __init__(self, result):
-        Event.__init__(self)
-        self.result = result

bitbake/lib/bb/exceptions.py

@@ -1,4 +1,4 @@
-
+from __future__ import absolute_import
 import inspect
 import traceback
 import bb.namedtuple_with_abc
@@ -86,6 +86,6 @@ def format_exception(etype, value, tb, context=1, limit=None, formatter=None):
 
 def to_string(exc):
     if isinstance(exc, SystemExit):
-        if not isinstance(exc.code, str):
+        if not isinstance(exc.code, basestring):
             return 'Exited with "%d"' % exc.code
     return str(exc)

bitbake/lib/bb/fetch2/bzr.py

@@ -27,6 +27,7 @@ import os
 import sys
 import logging
 import bb
+from bb import data
 from bb.fetch2 import FetchMethod
 from bb.fetch2 import FetchError
 from bb.fetch2 import runfetchcmd
@@ -41,16 +42,15 @@ class Bzr(FetchMethod):
         init bzr specific variable within url data
         """
         # Create paths to bzr checkouts
-        bzrdir = d.getVar("BZRDIR") or (d.getVar("DL_DIR") + "/bzr")
         relpath = self._strip_leading_slashes(ud.path)
-        ud.pkgdir = os.path.join(bzrdir, ud.host, relpath)
+        ud.pkgdir = os.path.join(data.expand('${BZRDIR}', d), ud.host, relpath)
 
-        ud.setup_revisions(d)
+        ud.setup_revisons(d)
 
         if not ud.revision:
             ud.revision = self.latest_revision(ud, d)
 
-        ud.localfile = d.expand('bzr_%s_%s_%s.tar.gz' % (ud.host, ud.path.replace('/', '.'), ud.revision))
+        ud.localfile = data.expand('bzr_%s_%s_%s.tar.gz' % (ud.host, ud.path.replace('/', '.'), ud.revision), d)
 
     def _buildbzrcommand(self, ud, d, command):
         """
@@ -58,7 +58,7 @@ class Bzr(FetchMethod):
         command is "fetch", "update", "revno"
         """
 
-        basecmd = d.getVar("FETCHCMD_bzr") or "/usr/bin/env bzr"
+        basecmd = data.expand('${FETCHCMD_bzr}', d)
 
         proto =  ud.parm.get('protocol', 'http')
 
@@ -88,25 +88,28 @@ class Bzr(FetchMethod):
             bzrcmd = self._buildbzrcommand(ud, d, "update")
             logger.debug(1, "BZR Update %s", ud.url)
             bb.fetch2.check_network_access(d, bzrcmd, ud.url)
-            runfetchcmd(bzrcmd, d, workdir=os.path.join(ud.pkgdir, os.path.basename(ud.path)))
+            os.chdir(os.path.join (ud.pkgdir, os.path.basename(ud.path)))
+            runfetchcmd(bzrcmd, d)
         else:
             bb.utils.remove(os.path.join(ud.pkgdir, os.path.basename(ud.pkgdir)), True)
             bzrcmd = self._buildbzrcommand(ud, d, "fetch")
             bb.fetch2.check_network_access(d, bzrcmd, ud.url)
             logger.debug(1, "BZR Checkout %s", ud.url)
             bb.utils.mkdirhier(ud.pkgdir)
+            os.chdir(ud.pkgdir)
             logger.debug(1, "Running %s", bzrcmd)
-            runfetchcmd(bzrcmd, d, workdir=ud.pkgdir)
+            runfetchcmd(bzrcmd, d)
+
+        os.chdir(ud.pkgdir)
 
         scmdata = ud.parm.get("scmdata", "")
         if scmdata == "keep":
             tar_flags = ""
         else:
-            tar_flags = "--exclude='.bzr' --exclude='.bzrtags'"
+            tar_flags = "--exclude '.bzr' --exclude '.bzrtags'"
 
         # tar them up to a defined filename
-        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(ud.pkgdir)),
-                    d, cleanup=[ud.localpath], workdir=ud.pkgdir)
+        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(ud.pkgdir)), d, cleanup = [ud.localpath])
 
     def supports_srcrev(self):
         return True

bitbake/lib/bb/fetch2/clearcase.py

@@ -9,7 +9,7 @@ Usage in the recipe:
 
     SRC_URI = "ccrc://cc.example.org/ccrc;vob=/example_vob;module=/example_module"
     SRCREV = "EXAMPLE_CLEARCASE_TAG"
-    PV = "${@d.getVar("SRCREV", False).replace("/", "+")}"
+    PV = "${@d.getVar("SRCREV").replace("/", "+")}"
 
 The fetcher uses the rcleartool or cleartool remote client, depending on which one is available.
 
@@ -65,10 +65,12 @@ import os
 import sys
 import shutil
 import bb
+from   bb import data
 from   bb.fetch2 import FetchMethod
 from   bb.fetch2 import FetchError
 from   bb.fetch2 import runfetchcmd
 from   bb.fetch2 import logger
+from   distutils import spawn
 
 class ClearCase(FetchMethod):
     """Class to fetch urls via 'clearcase'"""
@@ -106,13 +108,13 @@ class ClearCase(FetchMethod):
         else:
             ud.module = ""
 
-        ud.basecmd = d.getVar("FETCHCMD_ccrc") or "/usr/bin/env cleartool || rcleartool"
+        ud.basecmd = d.getVar("FETCHCMD_ccrc", True) or spawn.find_executable("cleartool") or spawn.find_executable("rcleartool")
 
-        if d.getVar("SRCREV") == "INVALID":
+        if data.getVar("SRCREV", d, True) == "INVALID":
           raise FetchError("Set a valid SRCREV for the clearcase fetcher in your recipe, e.g. SRCREV = \"/main/LATEST\" or any other label of your choice.")
 
-        ud.label = d.getVar("SRCREV", False)
-        ud.customspec = d.getVar("CCASE_CUSTOM_CONFIG_SPEC")
+        ud.label = d.getVar("SRCREV")
+        ud.customspec = d.getVar("CCASE_CUSTOM_CONFIG_SPEC", True)
 
         ud.server     = "%s://%s%s" % (ud.proto, ud.host, ud.path)
 
@@ -122,7 +124,7 @@ class ClearCase(FetchMethod):
 
         ud.viewname         = "%s-view%s" % (ud.identifier, d.getVar("DATETIME", d, True))
         ud.csname           = "%s-config-spec" % (ud.identifier)
-        ud.ccasedir         = os.path.join(d.getVar("DL_DIR"), ud.type)
+        ud.ccasedir         = os.path.join(data.getVar("DL_DIR", d, True), ud.type)
         ud.viewdir          = os.path.join(ud.ccasedir, ud.viewname)
         ud.configspecfile   = os.path.join(ud.ccasedir, ud.csname)
         ud.localfile        = "%s.tar.gz" % (ud.identifier)
@@ -142,7 +144,7 @@ class ClearCase(FetchMethod):
         self.debug("configspecfile  = %s" % ud.configspecfile)
         self.debug("localfile       = %s" % ud.localfile)
 
-        ud.localfile = os.path.join(d.getVar("DL_DIR"), ud.localfile)
+        ud.localfile = os.path.join(data.getVar("DL_DIR", d, True), ud.localfile)
 
     def _build_ccase_command(self, ud, command):
         """
@@ -200,10 +202,11 @@ class ClearCase(FetchMethod):
 
     def _remove_view(self, ud, d):
         if os.path.exists(ud.viewdir):
+            os.chdir(ud.ccasedir)
             cmd = self._build_ccase_command(ud, 'rmview');
             logger.info("cleaning up [VOB=%s label=%s view=%s]", ud.vob, ud.label, ud.viewname)
             bb.fetch2.check_network_access(d, cmd, ud.url)
-            output = runfetchcmd(cmd, d, workdir=ud.ccasedir)
+            output = runfetchcmd(cmd, d)
             logger.info("rmview output: %s", output)
 
     def need_update(self, ud, d):
@@ -238,10 +241,11 @@ class ClearCase(FetchMethod):
                 raise e
 
         # Set configspec: Setting the configspec effectively fetches the files as defined in the configspec
+        os.chdir(ud.viewdir)
         cmd = self._build_ccase_command(ud, 'setcs');
         logger.info("fetching data [VOB=%s label=%s view=%s]", ud.vob, ud.label, ud.viewname)
         bb.fetch2.check_network_access(d, cmd, ud.url)
-        output = runfetchcmd(cmd, d, workdir=ud.viewdir)
+        output = runfetchcmd(cmd, d)
         logger.info("%s", output)
 
         # Copy the configspec to the viewdir so we have it in our source tarball later

bitbake/lib/bb/fetch2/cvs.py

@@ -63,7 +63,7 @@ class Cvs(FetchMethod):
         if 'fullpath' in ud.parm:
             fullpath = '_fullpath'
 
-        ud.localfile = d.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath))
+        ud.localfile = bb.data.expand('%s_%s_%s_%s%s%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.tag, ud.date, norecurse, fullpath), d)
 
     def need_update(self, ud, d):
         if (ud.date == "now"):
@@ -87,10 +87,10 @@ class Cvs(FetchMethod):
             cvsroot = ud.path
         else:
             cvsroot = ":" + method
-            cvsproxyhost = d.getVar('CVS_PROXY_HOST')
+            cvsproxyhost = d.getVar('CVS_PROXY_HOST', True)
             if cvsproxyhost:
                 cvsroot += ";proxy=" + cvsproxyhost
-            cvsproxyport = d.getVar('CVS_PROXY_PORT')
+            cvsproxyport = d.getVar('CVS_PROXY_PORT', True)
             if cvsproxyport:
                 cvsroot += ";proxyport=" + cvsproxyport
             cvsroot += ":" + ud.user
@@ -110,7 +110,7 @@ class Cvs(FetchMethod):
         if ud.tag:
             options.append("-r %s" % ud.tag)
 
-        cvsbasecmd = d.getVar("FETCHCMD_cvs") or "/usr/bin/env cvs"
+        cvsbasecmd = d.getVar("FETCHCMD_cvs", True)
         cvscmd = cvsbasecmd + " '-d" + cvsroot + "' co " + " ".join(options) + " " + ud.module
         cvsupdatecmd = cvsbasecmd + " '-d" + cvsroot + "' update -d -P " + " ".join(options)
 
@@ -120,27 +120,25 @@ class Cvs(FetchMethod):
 
         # create module directory
         logger.debug(2, "Fetch: checking for module directory")
-        pkg = d.getVar('PN')
-        cvsdir = d.getVar("CVSDIR") or (d.getVar("DL_DIR") + "/cvs")
-        pkgdir = os.path.join(cvsdir, pkg)
+        pkg = d.getVar('PN', True)
+        pkgdir = os.path.join(d.getVar('CVSDIR', True), pkg)
         moddir = os.path.join(pkgdir, localdir)
-        workdir = None
         if os.access(os.path.join(moddir, 'CVS'), os.R_OK):
             logger.info("Update " + ud.url)
             bb.fetch2.check_network_access(d, cvsupdatecmd, ud.url)
             # update sources there
-            workdir = moddir
+            os.chdir(moddir)
             cmd = cvsupdatecmd
         else:
             logger.info("Fetch " + ud.url)
             # check out sources there
             bb.utils.mkdirhier(pkgdir)
-            workdir = pkgdir
+            os.chdir(pkgdir)
             logger.debug(1, "Running %s", cvscmd)
             bb.fetch2.check_network_access(d, cvscmd, ud.url)
             cmd = cvscmd
 
-        runfetchcmd(cmd, d, cleanup=[moddir], workdir=workdir)
+        runfetchcmd(cmd, d, cleanup = [moddir])
 
         if not os.access(moddir, os.R_OK):
             raise FetchError("Directory %s was not readable despite sucessful fetch?!" % moddir, ud.url)
@@ -149,24 +147,24 @@ class Cvs(FetchMethod):
         if scmdata == "keep":
             tar_flags = ""
         else:
-            tar_flags = "--exclude='CVS'"
+            tar_flags = "--exclude 'CVS'"
 
         # tar them up to a defined filename
-        workdir = None
         if 'fullpath' in ud.parm:
-            workdir = pkgdir
+            os.chdir(pkgdir)
             cmd = "tar %s -czf %s %s" % (tar_flags, ud.localpath, localdir)
         else:
-            workdir = os.path.dirname(os.path.realpath(moddir))
+            os.chdir(moddir)
+            os.chdir('..')
             cmd = "tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.basename(moddir))
 
-        runfetchcmd(cmd, d, cleanup=[ud.localpath], workdir=workdir)
+        runfetchcmd(cmd, d, cleanup = [ud.localpath])
 
     def clean(self, ud, d):
         """ Clean CVS Files and tarballs """
 
-        pkg = d.getVar('PN')
-        pkgdir = os.path.join(d.getVar("CVSDIR"), pkg)
+        pkg = d.getVar('PN', True)
+        pkgdir = os.path.join(d.getVar("CVSDIR", True), pkg)
 
         bb.utils.remove(pkgdir, True)
         bb.utils.remove(ud.localpath)

bitbake/lib/bb/fetch2/git.py

@@ -49,10 +49,6 @@ Supported SRC_URI options are:
    referring to commit which is valid in tag instead of branch.
    The default is "0", set nobranch=1 if needed.
 
-- usehead
-   For local git:// urls to use the current branch HEAD as the revision for use with
-   AUTOREV. Implies nobranch.
-
 """
 
 #Copyright (C) 2005 Richard Purdie
@@ -70,64 +66,14 @@ Supported SRC_URI options are:
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
-import collections
-import errno
-import fnmatch
 import os
-import re
-import subprocess
-import tempfile
 import bb
-import bb.progress
+from   bb    import data
 from   bb.fetch2 import FetchMethod
 from   bb.fetch2 import runfetchcmd
 from   bb.fetch2 import logger
 
-
-class GitProgressHandler(bb.progress.LineFilterProgressHandler):
-    """Extract progress information from git output"""
-    def __init__(self, d):
-        self._buffer = ''
-        self._count = 0
-        super(GitProgressHandler, self).__init__(d)
-        # Send an initial progress event so the bar gets shown
-        self._fire_progress(-1)
-
-    def write(self, string):
-        self._buffer += string
-        stages = ['Counting objects', 'Compressing objects', 'Receiving objects', 'Resolving deltas']
-        stage_weights = [0.2, 0.05, 0.5, 0.25]
-        stagenum = 0
-        for i, stage in reversed(list(enumerate(stages))):
-            if stage in self._buffer:
-                stagenum = i
-                self._buffer = ''
-                break
-        self._status = stages[stagenum]
-        percs = re.findall(r'(\d+)%', string)
-        if percs:
-            progress = int(round((int(percs[-1]) * stage_weights[stagenum]) + (sum(stage_weights[:stagenum]) * 100)))
-            rates = re.findall(r'([\d.]+ [a-zA-Z]*/s+)', string)
-            if rates:
-                rate = rates[-1]
-            else:
-                rate = None
-            self.update(progress, rate)
-        else:
-            if stagenum == 0:
-                percs = re.findall(r': (\d+)', string)
-                if percs:
-                    count = int(percs[-1])
-                    if count > self._count:
-                        self._count = count
-                        self._fire_progress(-count)
-        super(GitProgressHandler, self).write(string)
-
-
 class Git(FetchMethod):
-    bitbake_dir = os.path.abspath(os.path.join(os.path.dirname(os.path.join(os.path.abspath(__file__))), '..', '..', '..'))
-    make_shallow_path = os.path.join(bitbake_dir, 'bin', 'git-make-shallow')
-
     """Class to fetch a module or modules from git repositories"""
     def init(self, d):
         pass
@@ -162,13 +108,6 @@ class Git(FetchMethod):
 
         ud.nobranch = ud.parm.get("nobranch","0") == "1"
 
-        # usehead implies nobranch
-        ud.usehead = ud.parm.get("usehead","0") == "1"
-        if ud.usehead:
-            if ud.proto != "file":
-                 raise bb.fetch2.ParameterError("The usehead option is only for use with local ('protocol=file') git repositories", ud.url)
-            ud.nobranch = 1
-
         # bareclone implies nocheckout
         ud.bareclone = ud.parm.get("bareclone","0") == "1"
         if ud.bareclone:
@@ -178,68 +117,17 @@ class Git(FetchMethod):
         branches = ud.parm.get("branch", "master").split(',')
         if len(branches) != len(ud.names):
             raise bb.fetch2.ParameterError("The number of name and branch parameters is not balanced", ud.url)
-
-        ud.cloneflags = "-s -n"
-        if ud.bareclone:
-            ud.cloneflags += " --mirror"
-
-        ud.shallow = d.getVar("BB_GIT_SHALLOW") == "1"
-        ud.shallow_extra_refs = (d.getVar("BB_GIT_SHALLOW_EXTRA_REFS") or "").split()
-
-        depth_default = d.getVar("BB_GIT_SHALLOW_DEPTH")
-        if depth_default is not None:
-            try:
-                depth_default = int(depth_default or 0)
-            except ValueError:
-                raise bb.fetch2.FetchError("Invalid depth for BB_GIT_SHALLOW_DEPTH: %s" % depth_default)
-            else:
-                if depth_default < 0:
-                    raise bb.fetch2.FetchError("Invalid depth for BB_GIT_SHALLOW_DEPTH: %s" % depth_default)
-        else:
-            depth_default = 1
-        ud.shallow_depths = collections.defaultdict(lambda: depth_default)
-
-        revs_default = d.getVar("BB_GIT_SHALLOW_REVS")
-        ud.shallow_revs = []
         ud.branches = {}
-        for pos, name in enumerate(ud.names):
-            branch = branches[pos]
+        for name in ud.names:
+            branch = branches[ud.names.index(name)]
             ud.branches[name] = branch
             ud.unresolvedrev[name] = branch
 
-            shallow_depth = d.getVar("BB_GIT_SHALLOW_DEPTH_%s" % name)
-            if shallow_depth is not None:
-                try:
-                    shallow_depth = int(shallow_depth or 0)
-                except ValueError:
-                    raise bb.fetch2.FetchError("Invalid depth for BB_GIT_SHALLOW_DEPTH_%s: %s" % (name, shallow_depth))
-                else:
-                    if shallow_depth < 0:
-                        raise bb.fetch2.FetchError("Invalid depth for BB_GIT_SHALLOW_DEPTH_%s: %s" % (name, shallow_depth))
-                    ud.shallow_depths[name] = shallow_depth
+        ud.basecmd = data.getVar("FETCHCMD_git", d, True) or "git -c core.fsyncobjectfiles=0"
 
-            revs = d.getVar("BB_GIT_SHALLOW_REVS_%s" % name)
-            if revs is not None:
-                ud.shallow_revs.extend(revs.split())
-            elif revs_default is not None:
-                ud.shallow_revs.extend(revs_default.split())
+        ud.write_tarballs = ((data.getVar("BB_GENERATE_MIRROR_TARBALLS", d, True) or "0") != "0") or ud.rebaseable
 
-        if (ud.shallow and
-                not ud.shallow_revs and
-                all(ud.shallow_depths[n] == 0 for n in ud.names)):
-            # Shallow disabled for this URL
-            ud.shallow = False
-
-        if ud.usehead:
-            ud.unresolvedrev['default'] = 'HEAD'
-
-        ud.basecmd = d.getVar("FETCHCMD_git") or "git -c core.fsyncobjectfiles=0"
-
-        write_tarballs = d.getVar("BB_GENERATE_MIRROR_TARBALLS") or "0"
-        ud.write_tarballs = write_tarballs != "0" or ud.rebaseable
-        ud.write_shallow_tarballs = (d.getVar("BB_GENERATE_SHALLOW_TARBALLS") or write_tarballs) != "0"
-
-        ud.setup_revisions(d)
+        ud.setup_revisons(d)
 
         for name in ud.names:
             # Ensure anything that doesn't look like a sha256 checksum/revision is translated into one
@@ -248,10 +136,7 @@ class Git(FetchMethod):
                     ud.unresolvedrev[name] = ud.revisions[name]
                 ud.revisions[name] = self.latest_revision(ud, d, name)
 
-        gitsrcname = '%s%s' % (ud.host.replace(':', '.'), ud.path.replace('/', '.').replace('*', '.'))
-        if gitsrcname.startswith('.'):
-            gitsrcname = gitsrcname[1:]
-
+        gitsrcname = '%s%s' % (ud.host.replace(':','.'), ud.path.replace('/', '.').replace('*', '.'))
         # for rebaseable git repo, it is necessary to keep mirror tar ball
         # per revision, so that even the revision disappears from the
         # upstream repo in the future, the mirror will remain intact and still
@@ -259,66 +144,31 @@ class Git(FetchMethod):
         if ud.rebaseable:
             for name in ud.names:
                 gitsrcname = gitsrcname + '_' + ud.revisions[name]
-
-        dl_dir = d.getVar("DL_DIR")
-        gitdir = d.getVar("GITDIR") or (dl_dir + "/git2")
+        ud.mirrortarball = 'git2_%s.tar.gz' % (gitsrcname)
+        ud.fullmirror = os.path.join(d.getVar("DL_DIR", True), ud.mirrortarball)
+        gitdir = d.getVar("GITDIR", True) or (d.getVar("DL_DIR", True) + "/git2/")
         ud.clonedir = os.path.join(gitdir, gitsrcname)
+
         ud.localfile = ud.clonedir
 
-        mirrortarball = 'git2_%s.tar.gz' % gitsrcname
-        ud.fullmirror = os.path.join(dl_dir, mirrortarball)
-        ud.mirrortarballs = [mirrortarball]
-        if ud.shallow:
-            tarballname = gitsrcname
-            if ud.bareclone:
-                tarballname = "%s_bare" % tarballname
-
-            if ud.shallow_revs:
-                tarballname = "%s_%s" % (tarballname, "_".join(sorted(ud.shallow_revs)))
-
-            for name, revision in sorted(ud.revisions.items()):
-                tarballname = "%s_%s" % (tarballname, ud.revisions[name][:7])
-                depth = ud.shallow_depths[name]
-                if depth:
-                    tarballname = "%s-%s" % (tarballname, depth)
-
-            shallow_refs = []
-            if not ud.nobranch:
-                shallow_refs.extend(ud.branches.values())
-            if ud.shallow_extra_refs:
-                shallow_refs.extend(r.replace('refs/heads/', '').replace('*', 'ALL') for r in ud.shallow_extra_refs)
-            if shallow_refs:
-                tarballname = "%s_%s" % (tarballname, "_".join(sorted(shallow_refs)).replace('/', '.'))
-
-            fetcher = self.__class__.__name__.lower()
-            ud.shallowtarball = '%sshallow_%s.tar.gz' % (fetcher, tarballname)
-            ud.fullshallow = os.path.join(dl_dir, ud.shallowtarball)
-            ud.mirrortarballs.insert(0, ud.shallowtarball)
-
     def localpath(self, ud, d):
         return ud.clonedir
 
     def need_update(self, ud, d):
-        return self.clonedir_need_update(ud, d) or self.shallow_tarball_need_update(ud) or self.tarball_need_update(ud)
-
-    def clonedir_need_update(self, ud, d):
         if not os.path.exists(ud.clonedir):
             return True
+        os.chdir(ud.clonedir)
         for name in ud.names:
-            if not self._contains_ref(ud, d, name, ud.clonedir):
+            if not self._contains_ref(ud, d, name):
                 return True
+        if ud.write_tarballs and not os.path.exists(ud.fullmirror):
+            return True
         return False
 
-    def shallow_tarball_need_update(self, ud):
-        return ud.shallow and ud.write_shallow_tarballs and not os.path.exists(ud.fullshallow)
-
-    def tarball_need_update(self, ud):
-        return ud.write_tarballs and not os.path.exists(ud.fullmirror)
-
     def try_premirror(self, ud, d):
         # If we don't do this, updating an existing checkout with only premirrors
         # is not possible
-        if bb.utils.to_boolean(d.getVar("BB_FETCH_PREMIRRORONLY")):
+        if d.getVar("BB_FETCH_PREMIRRORONLY", True) is not None:
             return True
         if os.path.exists(ud.clonedir):
             return False
@@ -327,145 +177,74 @@ class Git(FetchMethod):
     def download(self, ud, d):
         """Fetch url"""
 
-        # A current clone is preferred to either tarball, a shallow tarball is
-        # preferred to an out of date clone, and a missing clone will use
-        # either tarball.
-        if ud.shallow and os.path.exists(ud.fullshallow) and self.need_update(ud, d):
-            ud.localpath = ud.fullshallow
-            return
-        elif os.path.exists(ud.fullmirror) and not os.path.exists(ud.clonedir):
-            bb.utils.mkdirhier(ud.clonedir)
-            runfetchcmd("tar -xzf %s" % ud.fullmirror, d, workdir=ud.clonedir)
+        if ud.user:
+            username = ud.user + '@'
+        else:
+            username = ""
 
-        repourl = self._get_repo_url(ud)
+        ud.repochanged = not os.path.exists(ud.fullmirror)
+
+        # If the checkout doesn't exist and the mirror tarball does, extract it
+        if not os.path.exists(ud.clonedir) and os.path.exists(ud.fullmirror):
+            bb.utils.mkdirhier(ud.clonedir)
+            os.chdir(ud.clonedir)
+            runfetchcmd("tar -xzf %s" % (ud.fullmirror), d)
+
+        repourl = "%s://%s%s%s" % (ud.proto, username, ud.host, ud.path)
 
         # If the repo still doesn't exist, fallback to cloning it
         if not os.path.exists(ud.clonedir):
             # We do this since git will use a "-l" option automatically for local urls where possible
             if repourl.startswith("file://"):
                 repourl = repourl[7:]
-            clone_cmd = "LANG=C %s clone --bare --mirror %s %s --progress" % (ud.basecmd, repourl, ud.clonedir)
+            clone_cmd = "%s clone --bare --mirror %s %s" % (ud.basecmd, repourl, ud.clonedir)
             if ud.proto.lower() != 'file':
-                bb.fetch2.check_network_access(d, clone_cmd, ud.url)
-            progresshandler = GitProgressHandler(d)
-            runfetchcmd(clone_cmd, d, log=progresshandler)
+                bb.fetch2.check_network_access(d, clone_cmd)
+            runfetchcmd(clone_cmd, d)
 
+        os.chdir(ud.clonedir)
         # Update the checkout if needed
         needupdate = False
         for name in ud.names:
-            if not self._contains_ref(ud, d, name, ud.clonedir):
+            if not self._contains_ref(ud, d, name):
                 needupdate = True
-                break
-
         if needupdate:
-            output = runfetchcmd("%s remote" % ud.basecmd, d, quiet=True, workdir=ud.clonedir)
-            if "origin" in output:
-              runfetchcmd("%s remote rm origin" % ud.basecmd, d, workdir=ud.clonedir)
+            try: 
+                runfetchcmd("%s remote rm origin" % ud.basecmd, d) 
+            except bb.fetch2.FetchError:
+                logger.debug(1, "No Origin")
 
-            runfetchcmd("%s remote add --mirror=fetch origin %s" % (ud.basecmd, repourl), d, workdir=ud.clonedir)
-            fetch_cmd = "LANG=C %s fetch -f --prune --progress %s refs/*:refs/*" % (ud.basecmd, repourl)
+            runfetchcmd("%s remote add --mirror=fetch origin %s" % (ud.basecmd, repourl), d)
+            fetch_cmd = "%s fetch -f --prune %s refs/*:refs/*" % (ud.basecmd, repourl)
             if ud.proto.lower() != 'file':
                 bb.fetch2.check_network_access(d, fetch_cmd, ud.url)
-            progresshandler = GitProgressHandler(d)
-            runfetchcmd(fetch_cmd, d, log=progresshandler, workdir=ud.clonedir)
-            runfetchcmd("%s prune-packed" % ud.basecmd, d, workdir=ud.clonedir)
-            runfetchcmd("%s pack-refs --all" % ud.basecmd, d, workdir=ud.clonedir)
-            runfetchcmd("%s pack-redundant --all | xargs -r rm" % ud.basecmd, d, workdir=ud.clonedir)
-            try:
-                os.unlink(ud.fullmirror)
-            except OSError as exc:
-                if exc.errno != errno.ENOENT:
-                    raise
-
+            runfetchcmd(fetch_cmd, d)
+            runfetchcmd("%s prune-packed" % ud.basecmd, d)
+            runfetchcmd("%s pack-redundant --all | xargs -r rm" % ud.basecmd, d)
+            ud.repochanged = True
+        os.chdir(ud.clonedir)
         for name in ud.names:
-            if not self._contains_ref(ud, d, name, ud.clonedir):
+            if not self._contains_ref(ud, d, name):
                 raise bb.fetch2.FetchError("Unable to find revision %s in branch %s even from upstream" % (ud.revisions[name], ud.branches[name]))
 
     def build_mirror_data(self, ud, d):
-        if ud.shallow and ud.write_shallow_tarballs:
-            if not os.path.exists(ud.fullshallow):
-                if os.path.islink(ud.fullshallow):
-                    os.unlink(ud.fullshallow)
-                tempdir = tempfile.mkdtemp(dir=d.getVar('DL_DIR'))
-                shallowclone = os.path.join(tempdir, 'git')
-                try:
-                    self.clone_shallow_local(ud, shallowclone, d)
-
-                    logger.info("Creating tarball of git repository")
-                    runfetchcmd("tar -czf %s ." % ud.fullshallow, d, workdir=shallowclone)
-                    runfetchcmd("touch %s.done" % ud.fullshallow, d)
-                finally:
-                    bb.utils.remove(tempdir, recurse=True)
-        elif ud.write_tarballs and not os.path.exists(ud.fullmirror):
+        # Generate a mirror tarball if needed
+        if ud.write_tarballs and (ud.repochanged or not os.path.exists(ud.fullmirror)):
+            # it's possible that this symlink points to read-only filesystem with PREMIRROR
             if os.path.islink(ud.fullmirror):
                 os.unlink(ud.fullmirror)
 
+            os.chdir(ud.clonedir)
             logger.info("Creating tarball of git repository")
-            runfetchcmd("tar -czf %s ." % ud.fullmirror, d, workdir=ud.clonedir)
-            runfetchcmd("touch %s.done" % ud.fullmirror, d)
-
-    def clone_shallow_local(self, ud, dest, d):
-        """Clone the repo and make it shallow.
-
-        The upstream url of the new clone isn't set at this time, as it'll be
-        set correctly when unpacked."""
-        runfetchcmd("%s clone %s %s %s" % (ud.basecmd, ud.cloneflags, ud.clonedir, dest), d)
-
-        to_parse, shallow_branches = [], []
-        for name in ud.names:
-            revision = ud.revisions[name]
-            depth = ud.shallow_depths[name]
-            if depth:
-                to_parse.append('%s~%d^{}' % (revision, depth - 1))
-
-            # For nobranch, we need a ref, otherwise the commits will be
-            # removed, and for non-nobranch, we truncate the branch to our
-            # srcrev, to avoid keeping unnecessary history beyond that.
-            branch = ud.branches[name]
-            if ud.nobranch:
-                ref = "refs/shallow/%s" % name
-            elif ud.bareclone:
-                ref = "refs/heads/%s" % branch
-            else:
-                ref = "refs/remotes/origin/%s" % branch
-
-            shallow_branches.append(ref)
-            runfetchcmd("%s update-ref %s %s" % (ud.basecmd, ref, revision), d, workdir=dest)
-
-        # Map srcrev+depths to revisions
-        parsed_depths = runfetchcmd("%s rev-parse %s" % (ud.basecmd, " ".join(to_parse)), d, workdir=dest)
-
-        # Resolve specified revisions
-        parsed_revs = runfetchcmd("%s rev-parse %s" % (ud.basecmd, " ".join('"%s^{}"' % r for r in ud.shallow_revs)), d, workdir=dest)
-        shallow_revisions = parsed_depths.splitlines() + parsed_revs.splitlines()
-
-        # Apply extra ref wildcards
-        all_refs = runfetchcmd('%s for-each-ref "--format=%%(refname)"' % ud.basecmd,
-                               d, workdir=dest).splitlines()
-        for r in ud.shallow_extra_refs:
-            if not ud.bareclone:
-                r = r.replace('refs/heads/', 'refs/remotes/origin/')
-
-            if '*' in r:
-                matches = filter(lambda a: fnmatch.fnmatchcase(a, r), all_refs)
-                shallow_branches.extend(matches)
-            else:
-                shallow_branches.append(r)
-
-        # Make the repository shallow
-        shallow_cmd = [self.make_shallow_path, '-s']
-        for b in shallow_branches:
-            shallow_cmd.append('-r')
-            shallow_cmd.append(b)
-        shallow_cmd.extend(shallow_revisions)
-        runfetchcmd(subprocess.list2cmdline(shallow_cmd), d, workdir=dest)
+            runfetchcmd("tar -czf %s %s" % (ud.fullmirror, os.path.join(".") ), d)
+            runfetchcmd("touch %s.done" % (ud.fullmirror), d)
 
     def unpack(self, ud, destdir, d):
         """ unpack the downloaded src to destdir"""
 
         subdir = ud.parm.get("subpath", "")
         if subdir != "":
-            readpathspec = ":%s" % subdir
+            readpathspec = ":%s" % (subdir)
             def_destsuffix = "%s/" % os.path.basename(subdir.rstrip('/'))
         else:
             readpathspec = ""
@@ -476,68 +255,47 @@ class Git(FetchMethod):
         if os.path.exists(destdir):
             bb.utils.prunedir(destdir)
 
-        source_found = False
-        source_error = []
+        cloneflags = "-s -n"
+        if ud.bareclone:
+            cloneflags += " --mirror"
 
-        if not source_found:
-            clonedir_is_up_to_date = not self.clonedir_need_update(ud, d)
-            if clonedir_is_up_to_date:
-                runfetchcmd("%s clone %s %s/ %s" % (ud.basecmd, ud.cloneflags, ud.clonedir, destdir), d)
-                source_found = True
-            else:
-                source_error.append("clone directory not available or not up to date: " + ud.clonedir)
+        # Versions of git prior to 1.7.9.2 have issues where foo.git and foo get confused
+        # and you end up with some horrible union of the two when you attempt to clone it
+        # The least invasive workaround seems to be a symlink to the real directory to
+        # fool git into ignoring any .git version that may also be present.
+        #
+        # The issue is fixed in more recent versions of git so we can drop this hack in future
+        # when that version becomes common enough.
+        clonedir = ud.clonedir
+        if not ud.path.endswith(".git"):
+            indirectiondir = destdir[:-1] + ".indirectionsymlink"
+            if os.path.exists(indirectiondir):
+                os.remove(indirectiondir)
+            bb.utils.mkdirhier(os.path.dirname(indirectiondir))
+            os.symlink(ud.clonedir, indirectiondir)
+            clonedir = indirectiondir
 
-        if not source_found:
-            if ud.shallow:
-                if os.path.exists(ud.fullshallow):
-                    bb.utils.mkdirhier(destdir)
-                    runfetchcmd("tar -xzf %s" % ud.fullshallow, d, workdir=destdir)
-                    source_found = True
-                else:
-                    source_error.append("shallow clone not available: " + ud.fullshallow)
-            else:
-                source_error.append("shallow clone not enabled")
-
-        if not source_found:
-            raise bb.fetch2.UnpackError("No up to date source found: " + "; ".join(source_error), ud.url)
-
-        repourl = self._get_repo_url(ud)
-        runfetchcmd("%s remote set-url origin %s" % (ud.basecmd, repourl), d, workdir=destdir)
+        runfetchcmd("%s clone %s %s/ %s" % (ud.basecmd, cloneflags, clonedir, destdir), d)
         if not ud.nocheckout:
+            os.chdir(destdir)
             if subdir != "":
-                runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.revisions[ud.names[0]], readpathspec), d,
-                            workdir=destdir)
-                runfetchcmd("%s checkout-index -q -f -a" % ud.basecmd, d, workdir=destdir)
-            elif not ud.nobranch:
-                branchname =  ud.branches[ud.names[0]]
-                runfetchcmd("%s checkout -B %s %s" % (ud.basecmd, branchname, \
-                            ud.revisions[ud.names[0]]), d, workdir=destdir)
-                runfetchcmd("%s branch %s --set-upstream-to origin/%s" % (ud.basecmd, branchname, \
-                            branchname), d, workdir=destdir)
+                runfetchcmd("%s read-tree %s%s" % (ud.basecmd, ud.revisions[ud.names[0]], readpathspec), d)
+                runfetchcmd("%s checkout-index -q -f -a" % ud.basecmd, d)
             else:
-                runfetchcmd("%s checkout %s" % (ud.basecmd, ud.revisions[ud.names[0]]), d, workdir=destdir)
-
+                runfetchcmd("%s checkout %s" % (ud.basecmd, ud.revisions[ud.names[0]]), d)
         return True
 
     def clean(self, ud, d):
         """ clean the git directory """
 
-        to_remove = [ud.localpath, ud.fullmirror, ud.fullmirror + ".done"]
-        # The localpath is a symlink to clonedir when it is cloned from a
-        # mirror, so remove both of them.
-        if os.path.islink(ud.localpath):
-            clonedir = os.path.realpath(ud.localpath)
-            to_remove.append(clonedir)
-
-        for r in to_remove:
-            if os.path.exists(r):
-                bb.note('Removing %s' % r)
-                bb.utils.remove(r, True)
+        bb.utils.remove(ud.localpath, True)
+        bb.utils.remove(ud.fullmirror)
+        bb.utils.remove(ud.fullmirror + ".done")
 
     def supports_srcrev(self):
         return True
 
-    def _contains_ref(self, ud, d, name, wd):
+    def _contains_ref(self, ud, d, name):
         cmd = ""
         if ud.nobranch:
             cmd = "%s log --pretty=oneline -n 1 %s -- 2> /dev/null | wc -l" % (
@@ -546,23 +304,13 @@ class Git(FetchMethod):
             cmd =  "%s branch --contains %s --list %s 2> /dev/null | wc -l" % (
                 ud.basecmd, ud.revisions[name], ud.branches[name])
         try:
-            output = runfetchcmd(cmd, d, quiet=True, workdir=wd)
+            output = runfetchcmd(cmd, d, quiet=True)
         except bb.fetch2.FetchError:
             return False
         if len(output.split()) > 1:
             raise bb.fetch2.FetchError("The command '%s' gave output with more then 1 line unexpectedly, output: '%s'" % (cmd, output))
         return output.split()[0] != "0"
 
-    def _get_repo_url(self, ud):
-        """
-        Return the repository URL
-        """
-        if ud.user:
-            username = ud.user + '@'
-        else:
-            username = ""
-        return "%s://%s%s%s" % (ud.proto, username, ud.host, ud.path)
-
     def _revision_key(self, ud, d, name):
         """
         Return a unique key for the url
@@ -573,123 +321,38 @@ class Git(FetchMethod):
         """
         Run git ls-remote with the specified search string
         """
-        # Prevent recursion e.g. in OE if SRCPV is in PV, PV is in WORKDIR,
-        # and WORKDIR is in PATH (as a result of RSS), our call to
-        # runfetchcmd() exports PATH so this function will get called again (!)
-        # In this scenario the return call of the function isn't actually
-        # important - WORKDIR isn't needed in PATH to call git ls-remote
-        # anyway.
-        if d.getVar('_BB_GIT_IN_LSREMOTE', False):
-            return ''
-        d.setVar('_BB_GIT_IN_LSREMOTE', '1')
-        try:
-            repourl = self._get_repo_url(ud)
-            cmd = "%s ls-remote %s %s" % \
-                (ud.basecmd, repourl, search)
-            if ud.proto.lower() != 'file':
-                bb.fetch2.check_network_access(d, cmd, repourl)
-            output = runfetchcmd(cmd, d, True)
-            if not output:
-                raise bb.fetch2.FetchError("The command %s gave empty output unexpectedly" % cmd, ud.url)
-        finally:
-            d.delVar('_BB_GIT_IN_LSREMOTE')
+        if ud.user:
+            username = ud.user + '@'
+        else:
+            username = ""
+
+        cmd = "%s ls-remote %s://%s%s%s %s" % \
+              (ud.basecmd, ud.proto, username, ud.host, ud.path, search)
+        if ud.proto.lower() != 'file':
+            bb.fetch2.check_network_access(d, cmd)
+        output = runfetchcmd(cmd, d, True)
+        if not output:
+            raise bb.fetch2.FetchError("The command %s gave empty output unexpectedly" % cmd, ud.url)
         return output
 
     def _latest_revision(self, ud, d, name):
         """
         Compute the HEAD revision for the url
         """
-        output = self._lsremote(ud, d, "")
-        # Tags of the form ^{} may not work, need to fallback to other form
-        if ud.unresolvedrev[name][:5] == "refs/" or ud.usehead:
-            head = ud.unresolvedrev[name]
-            tag = ud.unresolvedrev[name]
+        if ud.unresolvedrev[name][:5] == "refs/":
+            search = "%s %s^{}" % (ud.unresolvedrev[name], ud.unresolvedrev[name])
         else:
-            head = "refs/heads/%s" % ud.unresolvedrev[name]
-            tag = "refs/tags/%s" % ud.unresolvedrev[name]
-        for s in [head, tag + "^{}", tag]:
-            for l in output.strip().split('\n'):
-                sha1, ref = l.split()
-                if s == ref:
-                    return sha1
-        raise bb.fetch2.FetchError("Unable to resolve '%s' in upstream git repository in git ls-remote output for %s" % \
-            (ud.unresolvedrev[name], ud.host+ud.path))
-
-    def latest_versionstring(self, ud, d):
-        """
-        Compute the latest release name like "x.y.x" in "x.y.x+gitHASH"
-        by searching through the tags output of ls-remote, comparing
-        versions and returning the highest match.
-        """
-        pupver = ('', '')
-
-        tagregex = re.compile(d.getVar('UPSTREAM_CHECK_GITTAGREGEX') or r"(?P<pver>([0-9][\.|_]?)+)")
-        try:
-            output = self._lsremote(ud, d, "refs/tags/*")
-        except (bb.fetch2.FetchError, bb.fetch2.NetworkAccess) as e:
-            bb.note("Could not list remote: %s" % str(e))
-            return pupver
-
-        verstring = ""
-        revision = ""
-        for line in output.split("\n"):
-            if not line:
-                break
-
-            tag_head = line.split("/")[-1]
-            # Ignore non-released branches
-            m = re.search(r"(alpha|beta|rc|final)+", tag_head)
-            if m:
-                continue
-
-            # search for version in the line
-            tag = tagregex.search(tag_head)
-            if tag == None:
-                continue
-
-            tag = tag.group('pver')
-            tag = tag.replace("_", ".")
-
-            if verstring and bb.utils.vercmp(("0", tag, ""), ("0", verstring, "")) < 0:
-                continue
-
-            verstring = tag
-            revision = line.split()[0]
-            pupver = (verstring, revision)
-
-        return pupver
+            search = "refs/heads/%s refs/tags/%s^{}" % (ud.unresolvedrev[name], ud.unresolvedrev[name])
+        output = self._lsremote(ud, d, search)
+        return output.split()[0]
 
     def _build_revision(self, ud, d, name):
         return ud.revisions[name]
 
-    def gitpkgv_revision(self, ud, d, name):
-        """
-        Return a sortable revision number by counting commits in the history
-        Based on gitpkgv.bblass in meta-openembedded
-        """
-        rev = self._build_revision(ud, d, name)
-        localpath = ud.localpath
-        rev_file = os.path.join(localpath, "oe-gitpkgv_" + rev)
-        if not os.path.exists(localpath):
-            commits = None
-        else:
-            if not os.path.exists(rev_file) or not os.path.getsize(rev_file):
-                from pipes import quote
-                commits = bb.fetch2.runfetchcmd(
-                        "git rev-list %s -- | wc -l" % quote(rev),
-                        d, quiet=True).strip().lstrip('0')
-                if commits:
-                    open(rev_file, "w").write("%d\n" % int(commits))
-            else:
-                commits = open(rev_file, "r").readline(128).strip()
-        if commits:
-            return False, "%s+%s" % (commits, rev[:7])
-        else:
-            return True, str(rev)
-
-    def checkstatus(self, fetch, ud, d):
+    def checkstatus(self, ud, d):
+        fetchcmd = "%s ls-remote %s" % (ud.basecmd, ud.url)
         try:
-            self._lsremote(ud, d, "")
+            runfetchcmd(fetchcmd, d, quiet=True)
             return True
-        except bb.fetch2.FetchError:
+        except FetchError:
             return False

bitbake/lib/bb/fetch2/gitannex.py

@@ -22,6 +22,7 @@ BitBake 'Fetch' git annex implementation
 
 import os
 import bb
+from   bb import data
 from   bb.fetch2.git import Git
 from   bb.fetch2 import runfetchcmd
 from   bb.fetch2 import logger
@@ -33,59 +34,43 @@ class GitANNEX(Git):
         """
         return ud.type in ['gitannex']
 
-    def urldata_init(self, ud, d):
-        super(GitANNEX, self).urldata_init(ud, d)
-        if ud.shallow:
-            ud.shallow_extra_refs += ['refs/heads/git-annex', 'refs/heads/synced/*']
-
-    def uses_annex(self, ud, d, wd):
+    def uses_annex(self, ud, d):
         for name in ud.names:
             try:
-                runfetchcmd("%s rev-list git-annex" % (ud.basecmd), d, quiet=True, workdir=wd)
+                runfetchcmd("%s rev-list git-annex" % (ud.basecmd), d, quiet=True)
                 return True
             except bb.fetch.FetchError:
                 pass
 
         return False
 
-    def update_annex(self, ud, d, wd):
+    def update_annex(self, ud, d):
         try:
-            runfetchcmd("%s annex get --all" % (ud.basecmd), d, quiet=True, workdir=wd)
+            runfetchcmd("%s annex get --all" % (ud.basecmd), d, quiet=True)
         except bb.fetch.FetchError:
             return False
-        runfetchcmd("chmod u+w -R %s/annex" % (ud.clonedir), d, quiet=True, workdir=wd)
+        runfetchcmd("chmod u+w -R %s/annex" % (ud.clonedir), d, quiet=True)
 
         return True
 
     def download(self, ud, d):
         Git.download(self, ud, d)
 
-        if not ud.shallow or ud.localpath != ud.fullshallow:
-            if self.uses_annex(ud, d, ud.clonedir):
-                self.update_annex(ud, d, ud.clonedir)
-
-    def clone_shallow_local(self, ud, dest, d):
-        super(GitANNEX, self).clone_shallow_local(ud, dest, d)
-
-        try:
-            runfetchcmd("%s annex init" % ud.basecmd, d, workdir=dest)
-        except bb.fetch.FetchError:
-            pass
-
-        if self.uses_annex(ud, d, dest):
-            runfetchcmd("%s annex get" % ud.basecmd, d, workdir=dest)
-            runfetchcmd("chmod u+w -R %s/.git/annex" % (dest), d, quiet=True, workdir=dest)
+        os.chdir(ud.clonedir)
+        annex = self.uses_annex(ud, d)
+        if annex:
+            self.update_annex(ud, d)
 
     def unpack(self, ud, destdir, d):
         Git.unpack(self, ud, destdir, d)
 
+        os.chdir(ud.destdir)
         try:
-            runfetchcmd("%s annex init" % (ud.basecmd), d, workdir=ud.destdir)
+            runfetchcmd("%s annex sync" % (ud.basecmd), d)
         except bb.fetch.FetchError:
             pass
 
-        annex = self.uses_annex(ud, d, ud.destdir)
+        annex = self.uses_annex(ud, d)
         if annex:
-            runfetchcmd("%s annex get" % (ud.basecmd), d, workdir=ud.destdir)
-            runfetchcmd("chmod u+w -R %s/.git/annex" % (ud.destdir), d, quiet=True, workdir=ud.destdir)
-
+            runfetchcmd("%s annex get" % (ud.basecmd), d)
+            runfetchcmd("chmod u+w -R %s/.git/annex" % (ud.destdir), d, quiet=True)

bitbake/lib/bb/fetch2/gitsm.py

@@ -31,12 +31,10 @@ NOTE: Switching a SRC_URI from "git://" to "gitsm://" requires a clean of your r
 
 import os
 import bb
-import copy
+from   bb    import data
 from   bb.fetch2.git import Git
 from   bb.fetch2 import runfetchcmd
 from   bb.fetch2 import logger
-from   bb.fetch2 import Fetch
-from   bb.fetch2 import BBFetchException
 
 class GitSM(Git):
     def supports(self, ud, d):
@@ -45,181 +43,94 @@ class GitSM(Git):
         """
         return ud.type in ['gitsm']
 
-    def process_submodules(self, ud, workdir, function, d):
-        """
-        Iterate over all of the submodules in this repository and execute
-        the 'function' for each of them.
-        """
-
-        submodules = []
-        paths = {}
-        revision = {}
-        uris = {}
-        subrevision = {}
-
-        def parse_gitmodules(gitmodules):
-            modules = {}
-            module = ""
-            for line in gitmodules.splitlines():
-                if line.startswith('[submodule'):
-                    module = line.split('"')[1]
-                    modules[module] = {}
-                elif module and line.strip().startswith('path'):
-                    path = line.split('=')[1].strip()
-                    modules[module]['path'] = path
-                elif module and line.strip().startswith('url'):
-                    url = line.split('=')[1].strip()
-                    modules[module]['url'] = url
-            return modules
-
-        # Collect the defined submodules, and their attributes
+    def uses_submodules(self, ud, d):
         for name in ud.names:
             try:
-                gitmodules = runfetchcmd("%s show %s:.gitmodules" % (ud.basecmd, ud.revisions[name]), d, quiet=True, workdir=workdir)
-            except:
-                # No submodules to update
-                continue
-
-            for m, md in parse_gitmodules(gitmodules).items():
-                try:
-                    module_hash = runfetchcmd("%s ls-tree -z -d %s %s" % (ud.basecmd, ud.revisions[name], md['path']), d, quiet=True, workdir=workdir)
-                except:
-                    # If the command fails, we don't have a valid file to check.  If it doesn't
-                    # fail -- it still might be a failure, see next check...
-                    module_hash = ""
-
-                if not module_hash:
-                    logger.debug(1, "submodule %s is defined, but is not initialized in the repository. Skipping", m)
-                    continue
-
-                submodules.append(m)
-                paths[m] = md['path']
-                revision[m] = ud.revisions[name]
-                uris[m] = md['url']
-                subrevision[m] = module_hash.split()[2]
-
-                # Convert relative to absolute uri based on parent uri
-                if uris[m].startswith('..'):
-                    newud = copy.copy(ud)
-                    newud.path = os.path.realpath(os.path.join(newud.path, uris[m]))
-                    uris[m] = Git._get_repo_url(self, newud)
-
-        for module in submodules:
-            # Translate the module url into a SRC_URI
-
-            if "://" in uris[module]:
-                # Properly formated URL already
-                proto = uris[module].split(':', 1)[0]
-                url = uris[module].replace('%s:' % proto, 'gitsm:', 1)
-            else:
-                if ":" in uris[module]:
-                    # Most likely an SSH style reference
-                    proto = "ssh"
-                    if ":/" in uris[module]:
-                        # Absolute reference, easy to convert..
-                        url = "gitsm://" + uris[module].replace(':/', '/', 1)
-                    else:
-                        # Relative reference, no way to know if this is right!
-                        logger.warning("Submodule included by %s refers to relative ssh reference %s.  References may fail if not absolute." % (ud.url, uris[module]))
-                        url = "gitsm://" + uris[module].replace(':', '/', 1)
-                else:
-                    # This has to be a file reference
-                    proto = "file"
-                    url = "gitsm://" + uris[module]
-
-            url += ';protocol=%s' % proto
-            url += ";name=%s" % module
-            url += ";subpath=%s" % paths[module]
-
-            ld = d.createCopy()
-            # Not necessary to set SRC_URI, since we're passing the URI to
-            # Fetch.
-            #ld.setVar('SRC_URI', url)
-            ld.setVar('SRCREV_%s' % module, subrevision[module])
-
-            # Workaround for issues with SRCPV/SRCREV_FORMAT errors
-            # error refer to 'multiple' repositories.  Only the repository
-            # in the original SRC_URI actually matters...
-            ld.setVar('SRCPV', d.getVar('SRCPV'))
-            ld.setVar('SRCREV_FORMAT', module)
-
-            function(ud, url, module, paths[module], ld)
-
-        return submodules != []
-
-    def need_update(self, ud, d):
-        if Git.need_update(self, ud, d):
-            return True
-
-        try:
-            # Check for the nugget dropped by the download operation
-            known_srcrevs = runfetchcmd("%s config --get-all bitbake.srcrev" % \
-                            (ud.basecmd), d, workdir=ud.clonedir)
-
-            if ud.revisions[ud.names[0]] not in known_srcrevs.split():
+                runfetchcmd("%s show %s:.gitmodules" % (ud.basecmd, ud.revisions[name]), d, quiet=True)
                 return True
-        except bb.fetch2.FetchError:
-            # No srcrev nuggets, so this is new and needs to be updated
-            return True
-
+            except bb.fetch.FetchError:
+                pass
         return False
 
+    def _set_relative_paths(self, repopath):
+        """
+        Fix submodule paths to be relative instead of absolute,
+        so that when we move the repo it doesn't break
+        (In Git 1.7.10+ this is done automatically)
+        """
+        submodules = []
+        with open(os.path.join(repopath, '.gitmodules'), 'r') as f:
+            for line in f.readlines():
+                if line.startswith('[submodule'):
+                    submodules.append(line.split('"')[1])
+
+        for module in submodules:
+            repo_conf = os.path.join(repopath, module, '.git')
+            if os.path.exists(repo_conf):
+                with open(repo_conf, 'r') as f:
+                    lines = f.readlines()
+                newpath = ''
+                for i, line in enumerate(lines):
+                    if line.startswith('gitdir:'):
+                        oldpath = line.split(': ')[-1].rstrip()
+                        if oldpath.startswith('/'):
+                            newpath = '../' * (module.count('/') + 1) + '.git/modules/' + module
+                            lines[i] = 'gitdir: %s\n' % newpath
+                            break
+                if newpath:
+                    with open(repo_conf, 'w') as f:
+                        for line in lines:
+                            f.write(line)
+
+            repo_conf2 = os.path.join(repopath, '.git', 'modules', module, 'config')
+            if os.path.exists(repo_conf2):
+                with open(repo_conf2, 'r') as f:
+                    lines = f.readlines()
+                newpath = ''
+                for i, line in enumerate(lines):
+                    if line.lstrip().startswith('worktree = '):
+                        oldpath = line.split(' = ')[-1].rstrip()
+                        if oldpath.startswith('/'):
+                            newpath = '../' * (module.count('/') + 3) + module
+                            lines[i] = '\tworktree = %s\n' % newpath
+                            break
+                if newpath:
+                    with open(repo_conf2, 'w') as f:
+                        for line in lines:
+                            f.write(line)
+
+    def update_submodules(self, ud, d):
+        # We have to convert bare -> full repo, do the submodule bit, then convert back
+        tmpclonedir = ud.clonedir + ".tmp"
+        gitdir = tmpclonedir + os.sep + ".git"
+        bb.utils.remove(tmpclonedir, True)
+        os.mkdir(tmpclonedir)
+        os.rename(ud.clonedir, gitdir)
+        runfetchcmd("sed " + gitdir + "/config -i -e 's/bare.*=.*true/bare = false/'", d)
+        os.chdir(tmpclonedir)
+        runfetchcmd(ud.basecmd + " reset --hard", d)
+        runfetchcmd(ud.basecmd + " submodule init", d)
+        runfetchcmd(ud.basecmd + " submodule update", d)
+        self._set_relative_paths(tmpclonedir)
+        runfetchcmd("sed " + gitdir + "/config -i -e 's/bare.*=.*false/bare = true/'", d)
+        os.rename(gitdir, ud.clonedir,)
+        bb.utils.remove(tmpclonedir, True)
+
     def download(self, ud, d):
-        def download_submodule(ud, url, module, modpath, d):
-            url += ";bareclone=1;nobranch=1"
-
-            # Is the following still needed?
-            #url += ";nocheckout=1"
-
-            try:
-                newfetch = Fetch([url], d, cache=False)
-                newfetch.download()
-                # Drop a nugget to add each of the srcrevs we've fetched (used by need_update)
-                runfetchcmd("%s config --add bitbake.srcrev %s" % \
-                            (ud.basecmd, ud.revisions[ud.names[0]]), d, workdir=ud.clonedir)
-            except Exception as e:
-                logger.error('gitsm: submodule download failed: %s %s' % (type(e).__name__, str(e)))
-                raise
-
         Git.download(self, ud, d)
-        self.process_submodules(ud, ud.clonedir, download_submodule, d)
+
+        os.chdir(ud.clonedir)
+        submodules = self.uses_submodules(ud, d)
+        if submodules:
+            self.update_submodules(ud, d)
 
     def unpack(self, ud, destdir, d):
-        def unpack_submodules(ud, url, module, modpath, d):
-            url += ";bareclone=1;nobranch=1"
-
-            # Figure out where we clone over the bare submodules...
-            if ud.bareclone:
-                repo_conf = ud.destdir
-            else:
-                repo_conf = os.path.join(ud.destdir, '.git')
-
-            try:
-                newfetch = Fetch([url], d, cache=False)
-                newfetch.unpack(root=os.path.dirname(os.path.join(repo_conf, 'modules', modpath)))
-            except Exception as e:
-                logger.error('gitsm: submodule unpack failed: %s %s' % (type(e).__name__, str(e)))
-                raise
-
-            local_path = newfetch.localpath(url)
-
-            # Correct the submodule references to the local download version...
-            runfetchcmd("%(basecmd)s config submodule.%(module)s.url %(url)s" % {'basecmd': ud.basecmd, 'module': module, 'url' : local_path}, d, workdir=ud.destdir)
-
-            if ud.shallow:
-                runfetchcmd("%(basecmd)s config submodule.%(module)s.shallow true" % {'basecmd': ud.basecmd, 'module': module}, d, workdir=ud.destdir)
-
-            # Ensure the submodule repository is NOT set to bare, since we're checking it out...
-            try:
-                runfetchcmd("%s config core.bare false" % (ud.basecmd), d, quiet=True, workdir=os.path.join(repo_conf, 'modules', modpath))
-            except:
-                logger.error("Unable to set git config core.bare to false for %s" % os.path.join(repo_conf, 'modules', modpath))
-                raise
-
         Git.unpack(self, ud, destdir, d)
+        
+        os.chdir(ud.destdir)
+        submodules = self.uses_submodules(ud, d)
+        if submodules:
+            runfetchcmd("cp -r " + ud.clonedir + "/modules " + ud.destdir + "/.git/", d)
+            runfetchcmd(ud.basecmd + " submodule init", d)
+            runfetchcmd(ud.basecmd + " submodule update", d)
 
-        ret = self.process_submodules(ud, ud.destdir, unpack_submodules, d)
-
-        if not ud.bareclone and ret:
-            # Run submodule update, this sets up the directories -- without touching the config
-            runfetchcmd("%s submodule update --recursive --no-fetch" % (ud.basecmd), d, quiet=True, workdir=ud.destdir)

bitbake/lib/bb/fetch2/hg.py

@@ -28,7 +28,7 @@ import os
 import sys
 import logging
 import bb
-import errno
+from bb import data
 from bb.fetch2 import FetchMethod
 from bb.fetch2 import FetchError
 from bb.fetch2 import MissingParameterError
@@ -43,13 +43,6 @@ class Hg(FetchMethod):
         """
         return ud.type in ['hg']
 
-    def supports_checksum(self, urldata):
-        """
-        Don't require checksums for local archives created from
-        repository checkouts.
-        """ 
-        return False
-
     def urldata_init(self, ud, d):
         """
         init hg specific variable within url data
@@ -59,34 +52,19 @@ class Hg(FetchMethod):
 
         ud.module = ud.parm["module"]
 
-        if 'protocol' in ud.parm:
-            ud.proto = ud.parm['protocol']
-        elif not ud.host:
-            ud.proto = 'file'
-        else:
-            ud.proto = "hg"
+        # Create paths to mercurial checkouts
+        relpath = self._strip_leading_slashes(ud.path)
+        ud.pkgdir = os.path.join(data.expand('${HGDIR}', d), ud.host, relpath)
+        ud.moddir = os.path.join(ud.pkgdir, ud.module)
 
-        ud.setup_revisions(d)
+        ud.setup_revisons(d)
 
         if 'rev' in ud.parm:
             ud.revision = ud.parm['rev']
         elif not ud.revision:
             ud.revision = self.latest_revision(ud, d)
 
-        # Create paths to mercurial checkouts
-        hgsrcname = '%s_%s_%s' % (ud.module.replace('/', '.'), \
-                            ud.host, ud.path.replace('/', '.'))
-        mirrortarball = 'hg_%s.tar.gz' % hgsrcname
-        ud.fullmirror = os.path.join(d.getVar("DL_DIR"), mirrortarball)
-        ud.mirrortarballs = [mirrortarball]
-
-        hgdir = d.getVar("HGDIR") or (d.getVar("DL_DIR") + "/hg")
-        ud.pkgdir = os.path.join(hgdir, hgsrcname)
-        ud.moddir = os.path.join(ud.pkgdir, ud.module)
-        ud.localfile = ud.moddir
-        ud.basecmd = d.getVar("FETCHCMD_hg") or "/usr/bin/env hg"
-
-        ud.write_tarballs = d.getVar("BB_GENERATE_MIRROR_TARBALLS")
+        ud.localfile = data.expand('%s_%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision), d)
 
     def need_update(self, ud, d):
         revTag = ud.parm.get('rev', 'tip')
@@ -96,21 +74,14 @@ class Hg(FetchMethod):
             return True
         return False
 
-    def try_premirror(self, ud, d):
-        # If we don't do this, updating an existing checkout with only premirrors
-        # is not possible
-        if bb.utils.to_boolean(d.getVar("BB_FETCH_PREMIRRORONLY")):
-            return True
-        if os.path.exists(ud.moddir):
-            return False
-        return True
-
     def _buildhgcommand(self, ud, d, command):
         """
         Build up an hg commandline based on ud
         command is "fetch", "update", "info"
         """
 
+        basecmd = data.expand('${FETCHCMD_hg}', d)
+
         proto = ud.parm.get('protocol', 'http')
 
         host = ud.host
@@ -127,7 +98,7 @@ class Hg(FetchMethod):
                 hgroot = ud.user + "@" + host + ud.path
 
         if command == "info":
-            return "%s identify -i %s://%s/%s" % (ud.basecmd, proto, hgroot, ud.module)
+            return "%s identify -i %s://%s/%s" % (basecmd, proto, hgroot, ud.module)
 
         options = [];
 
@@ -140,22 +111,22 @@ class Hg(FetchMethod):
 
         if command == "fetch":
             if ud.user and ud.pswd:
-                cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" clone %s %s://%s/%s %s" % (ud.basecmd, ud.user, ud.pswd, proto, " ".join(options), proto, hgroot, ud.module, ud.module)
+                cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" clone %s %s://%s/%s %s" % (basecmd, ud.user, ud.pswd, proto, " ".join(options), proto, hgroot, ud.module, ud.module)
             else:
-                cmd = "%s clone %s %s://%s/%s %s" % (ud.basecmd, " ".join(options), proto, hgroot, ud.module, ud.module)
+                cmd = "%s clone %s %s://%s/%s %s" % (basecmd, " ".join(options), proto, hgroot, ud.module, ud.module)	      
         elif command == "pull":
             # do not pass options list; limiting pull to rev causes the local
             # repo not to contain it and immediately following "update" command
             # will crash
             if ud.user and ud.pswd:
-                cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" pull" % (ud.basecmd, ud.user, ud.pswd, proto)
+                cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" pull" % (basecmd, ud.user, ud.pswd, proto)
             else:
-                cmd = "%s pull" % (ud.basecmd)
+                cmd = "%s pull" % (basecmd)
         elif command == "update":
             if ud.user and ud.pswd:
-                cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" update -C %s" % (ud.basecmd, ud.user, ud.pswd, proto, " ".join(options))
+                cmd = "%s --config auth.default.prefix=* --config auth.default.username=%s --config auth.default.password=%s --config \"auth.default.schemes=%s\" update -C %s" % (basecmd, ud.user, ud.pswd, proto, " ".join(options))
             else:
-                cmd = "%s update -C %s" % (ud.basecmd, " ".join(options))
+                cmd = "%s update -C %s" % (basecmd, " ".join(options))
         else:
             raise FetchError("Invalid hg command %s" % command, ud.url)
 
@@ -166,53 +137,40 @@ class Hg(FetchMethod):
 
         logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
 
-        # If the checkout doesn't exist and the mirror tarball does, extract it
-        if not os.path.exists(ud.pkgdir) and os.path.exists(ud.fullmirror):
-            bb.utils.mkdirhier(ud.pkgdir)
-            runfetchcmd("tar -xzf %s" % (ud.fullmirror), d, workdir=ud.pkgdir)
-
         if os.access(os.path.join(ud.moddir, '.hg'), os.R_OK):
-            # Found the source, check whether need pull
-            updatecmd = self._buildhgcommand(ud, d, "update")
+            updatecmd = self._buildhgcommand(ud, d, "pull")
+            logger.info("Update " + ud.url)
+            # update sources there
+            os.chdir(ud.moddir)
             logger.debug(1, "Running %s", updatecmd)
-            try:
-                runfetchcmd(updatecmd, d, workdir=ud.moddir)
-            except bb.fetch2.FetchError:
-                # Runnning pull in the repo
-                pullcmd = self._buildhgcommand(ud, d, "pull")
-                logger.info("Pulling " + ud.url)
-                # update sources there
-                logger.debug(1, "Running %s", pullcmd)
-                bb.fetch2.check_network_access(d, pullcmd, ud.url)
-                runfetchcmd(pullcmd, d, workdir=ud.moddir)
-                try:
-                    os.unlink(ud.fullmirror)
-                except OSError as exc:
-                    if exc.errno != errno.ENOENT:
-                        raise
+            bb.fetch2.check_network_access(d, updatecmd, ud.url)
+            runfetchcmd(updatecmd, d)
 
-        # No source found, clone it.
-        if not os.path.exists(ud.moddir):
+        else:
             fetchcmd = self._buildhgcommand(ud, d, "fetch")
             logger.info("Fetch " + ud.url)
             # check out sources there
             bb.utils.mkdirhier(ud.pkgdir)
+            os.chdir(ud.pkgdir)
             logger.debug(1, "Running %s", fetchcmd)
             bb.fetch2.check_network_access(d, fetchcmd, ud.url)
-            runfetchcmd(fetchcmd, d, workdir=ud.pkgdir)
+            runfetchcmd(fetchcmd, d)
 
         # Even when we clone (fetch), we still need to update as hg's clone
         # won't checkout the specified revision if its on a branch
         updatecmd = self._buildhgcommand(ud, d, "update")
+        os.chdir(ud.moddir)
         logger.debug(1, "Running %s", updatecmd)
-        runfetchcmd(updatecmd, d, workdir=ud.moddir)
+        runfetchcmd(updatecmd, d)
 
-    def clean(self, ud, d):
-        """ Clean the hg dir """
+        scmdata = ud.parm.get("scmdata", "")
+        if scmdata == "keep":
+            tar_flags = ""
+        else:
+            tar_flags = "--exclude '.hg' --exclude '.hgrags'"
 
-        bb.utils.remove(ud.localpath, True)
-        bb.utils.remove(ud.fullmirror)
-        bb.utils.remove(ud.fullmirror + ".done")
+        os.chdir(ud.pkgdir)
+        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d, cleanup = [ud.localpath])
 
     def supports_srcrev(self):
         return True
@@ -221,7 +179,7 @@ class Hg(FetchMethod):
         """
         Compute tip revision for the url
         """
-        bb.fetch2.check_network_access(d, self._buildhgcommand(ud, d, "info"), ud.url)
+        bb.fetch2.check_network_access(d, self._buildhgcommand(ud, d, "info"))
         output = runfetchcmd(self._buildhgcommand(ud, d, "info"), d)
         return output.strip()
 
@@ -233,38 +191,3 @@ class Hg(FetchMethod):
         Return a unique key for the url
         """
         return "hg:" + ud.moddir
-
-    def build_mirror_data(self, ud, d):
-        # Generate a mirror tarball if needed
-        if ud.write_tarballs == "1" and not os.path.exists(ud.fullmirror):
-            # it's possible that this symlink points to read-only filesystem with PREMIRROR
-            if os.path.islink(ud.fullmirror):
-                os.unlink(ud.fullmirror)
-
-            logger.info("Creating tarball of hg repository")
-            runfetchcmd("tar -czf %s %s" % (ud.fullmirror, ud.module), d, workdir=ud.pkgdir)
-            runfetchcmd("touch %s.done" % (ud.fullmirror), d, workdir=ud.pkgdir)
-
-    def localpath(self, ud, d):
-        return ud.pkgdir
-
-    def unpack(self, ud, destdir, d):
-        """
-        Make a local clone or export for the url
-        """
-
-        revflag = "-r %s" % ud.revision
-        subdir = ud.parm.get("destsuffix", ud.module)
-        codir = "%s/%s" % (destdir, subdir)
-
-        scmdata = ud.parm.get("scmdata", "")
-        if scmdata != "nokeep":
-            if not os.access(os.path.join(codir, '.hg'), os.R_OK):
-                logger.debug(2, "Unpack: creating new hg repository in '" + codir + "'")
-                runfetchcmd("%s init %s" % (ud.basecmd, codir), d)
-            logger.debug(2, "Unpack: updating source in '" + codir + "'")
-            runfetchcmd("%s pull %s" % (ud.basecmd, ud.moddir), d, workdir=codir)
-            runfetchcmd("%s up -C %s" % (ud.basecmd, revflag), d, workdir=codir)
-        else:
-            logger.debug(2, "Unpack: extracting source to '" + codir + "'")
-            runfetchcmd("%s archive -t files %s %s" % (ud.basecmd, revflag, codir), d, workdir=ud.moddir)

bitbake/lib/bb/fetch2/local.py

@@ -26,9 +26,10 @@ BitBake build tools.
 # Based on functions from the base bb module, Copyright 2003 Holger Schurig
 
 import os
-import urllib.request, urllib.parse, urllib.error
+import urllib
 import bb
 import bb.utils
+from   bb import data
 from   bb.fetch2 import FetchMethod, FetchError
 from   bb.fetch2 import logger
 
@@ -41,10 +42,9 @@ class Local(FetchMethod):
 
     def urldata_init(self, ud, d):
         # We don't set localfile as for this fetcher the file is already local!
-        ud.decodedurl = urllib.parse.unquote(ud.url.split("://")[1].split(";")[0])
+        ud.decodedurl = urllib.unquote(ud.url.split("://")[1].split(";")[0])
         ud.basename = os.path.basename(ud.decodedurl)
         ud.basepath = ud.decodedurl
-        ud.needdonestamp = False
         return
 
     def localpath(self, urldata, d):
@@ -62,11 +62,17 @@ class Local(FetchMethod):
         newpath = path
         if path[0] == "/":
             return [path]
-        filespath = d.getVar('FILESPATH')
+        filespath = data.getVar('FILESPATH', d, True)
         if filespath:
             logger.debug(2, "Searching for %s in paths:\n    %s" % (path, "\n    ".join(filespath.split(":"))))
             newpath, hist = bb.utils.which(filespath, path, history=True)
             searched.extend(hist)
+        if not newpath:
+            filesdir = data.getVar('FILESDIR', d, True)
+            if filesdir:
+                logger.debug(2, "Searching for %s in path: %s" % (path, filesdir))
+                newpath = os.path.join(filesdir, path)
+                searched.append(newpath)
         if (not newpath or not os.path.exists(newpath)) and path.find("*") != -1:
             # For expressions using '*', best we can do is take the first directory in FILESPATH that exists
             newpath, hist = bb.utils.which(filespath, ".", history=True)
@@ -74,7 +80,7 @@ class Local(FetchMethod):
             logger.debug(2, "Searching for %s in path: %s" % (path, newpath))
             return searched
         if not os.path.exists(newpath):
-            dldirfile = os.path.join(d.getVar("DL_DIR"), path)
+            dldirfile = os.path.join(d.getVar("DL_DIR", True), path)
             logger.debug(2, "Defaulting to %s for %s" % (dldirfile, path))
             bb.utils.mkdirhier(os.path.dirname(dldirfile))
             searched.append(dldirfile)
@@ -93,17 +99,20 @@ class Local(FetchMethod):
         # no need to fetch local files, we'll deal with them in place.
         if self.supports_checksum(urldata) and not os.path.exists(urldata.localpath):
             locations = []
-            filespath = d.getVar('FILESPATH')
+            filespath = data.getVar('FILESPATH', d, True)
             if filespath:
                 locations = filespath.split(":")
-            locations.append(d.getVar("DL_DIR"))
+            filesdir = data.getVar('FILESDIR', d, True)
+            if filesdir:
+                locations.append(filesdir)
+            locations.append(d.getVar("DL_DIR", True))
 
             msg = "Unable to find file " + urldata.url + " anywhere. The paths that were searched were:\n    " + "\n    ".join(locations)
             raise FetchError(msg)
 
         return True
 
-    def checkstatus(self, fetch, urldata, d):
+    def checkstatus(self, urldata, d):
         """
         Check the status of the url
         """

bitbake/lib/bb/fetch2/npm.py

@@ -1,308 +0,0 @@
-# ex:ts=4:sw=4:sts=4:et
-# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
-"""
-BitBake 'Fetch' NPM implementation
-
-The NPM fetcher is used to retrieve files from the npmjs repository
-
-Usage in the recipe:
-
-    SRC_URI = "npm://registry.npmjs.org/;name=${PN};version=${PV}"
-    Suported SRC_URI options are:
-
-    - name
-    - version
-
-    npm://registry.npmjs.org/${PN}/-/${PN}-${PV}.tgz  would become npm://registry.npmjs.org;name=${PN};version=${PV}
-    The fetcher all triggers off the existence of ud.localpath. If that exists and has the ".done" stamp, its assumed the fetch is good/done
-
-"""
-
-import os
-import sys
-import urllib.request, urllib.parse, urllib.error
-import json
-import subprocess
-import signal
-import bb
-from   bb.fetch2 import FetchMethod
-from   bb.fetch2 import FetchError
-from   bb.fetch2 import ChecksumError
-from   bb.fetch2 import runfetchcmd
-from   bb.fetch2 import logger
-from   bb.fetch2 import UnpackError
-from   bb.fetch2 import ParameterError
-
-def subprocess_setup():
-    # Python installs a SIGPIPE handler by default. This is usually not what
-    # non-Python subprocesses expect.
-    # SIGPIPE errors are known issues with gzip/bash
-    signal.signal(signal.SIGPIPE, signal.SIG_DFL)
-
-class Npm(FetchMethod):
-
-    """Class to fetch urls via 'npm'"""
-    def init(self, d):
-        pass
-
-    def supports(self, ud, d):
-        """
-        Check to see if a given url can be fetched with npm
-        """
-        return ud.type in ['npm']
-
-    def debug(self, msg):
-        logger.debug(1, "NpmFetch: %s", msg)
-
-    def clean(self, ud, d):
-        logger.debug(2, "Calling cleanup %s" % ud.pkgname)
-        bb.utils.remove(ud.localpath, False)
-        bb.utils.remove(ud.pkgdatadir, True)
-        bb.utils.remove(ud.fullmirror, False)
-
-    def urldata_init(self, ud, d):
-        """
-        init NPM specific variable within url data
-        """
-        if 'downloadfilename' in ud.parm:
-            ud.basename = ud.parm['downloadfilename']
-        else:
-            ud.basename = os.path.basename(ud.path)
-
-        # can't call it ud.name otherwise fetcher base class will start doing sha1stuff
-        # TODO: find a way to get an sha1/sha256 manifest of pkg & all deps
-        ud.pkgname = ud.parm.get("name", None)
-        if not ud.pkgname:
-            raise ParameterError("NPM fetcher requires a name parameter", ud.url)
-        ud.version = ud.parm.get("version", None)
-        if not ud.version:
-            raise ParameterError("NPM fetcher requires a version parameter", ud.url)
-        ud.bbnpmmanifest = "%s-%s.deps.json" % (ud.pkgname, ud.version)
-        ud.bbnpmmanifest = ud.bbnpmmanifest.replace('/', '-')
-        ud.registry = "http://%s" % (ud.url.replace('npm://', '', 1).split(';'))[0]
-        prefixdir = "npm/%s" % ud.pkgname
-        ud.pkgdatadir = d.expand("${DL_DIR}/%s" % prefixdir)
-        if not os.path.exists(ud.pkgdatadir):
-            bb.utils.mkdirhier(ud.pkgdatadir)
-        ud.localpath = d.expand("${DL_DIR}/npm/%s" % ud.bbnpmmanifest)
-
-        self.basecmd = d.getVar("FETCHCMD_wget") or "/usr/bin/env wget -O -t 2 -T 30 -nv --passive-ftp --no-check-certificate "
-        ud.prefixdir = prefixdir
-
-        ud.write_tarballs = ((d.getVar("BB_GENERATE_MIRROR_TARBALLS") or "0") != "0")
-        mirrortarball = 'npm_%s-%s.tar.xz' % (ud.pkgname, ud.version)
-        mirrortarball = mirrortarball.replace('/', '-')
-        ud.fullmirror = os.path.join(d.getVar("DL_DIR"), mirrortarball)
-        ud.mirrortarballs = [mirrortarball]
-
-    def need_update(self, ud, d):
-        if os.path.exists(ud.localpath):
-            return False
-        return True
-
-    def _runwget(self, ud, d, command, quiet):
-        logger.debug(2, "Fetching %s using command '%s'" % (ud.url, command))
-        bb.fetch2.check_network_access(d, command, ud.url)
-        dldir = d.getVar("DL_DIR")
-        runfetchcmd(command, d, quiet, workdir=dldir)
-
-    def _unpackdep(self, ud, pkg, data, destdir, dldir, d):
-        file = data[pkg]['tgz']
-        logger.debug(2, "file to extract is %s" % file)
-        if file.endswith('.tgz') or file.endswith('.tar.gz') or file.endswith('.tar.Z'):
-            cmd = 'tar xz --strip 1 --no-same-owner --warning=no-unknown-keyword -f %s/%s' % (dldir, file)
-        else:
-            bb.fatal("NPM package %s downloaded not a tarball!" % file)
-
-        # Change to subdir before executing command
-        if not os.path.exists(destdir):
-            os.makedirs(destdir)
-        path = d.getVar('PATH')
-        if path:
-            cmd = "PATH=\"%s\" %s" % (path, cmd)
-        bb.note("Unpacking %s to %s/" % (file, destdir))
-        ret = subprocess.call(cmd, preexec_fn=subprocess_setup, shell=True, cwd=destdir)
-
-        if ret != 0:
-            raise UnpackError("Unpack command %s failed with return value %s" % (cmd, ret), ud.url)
-
-        if 'deps' not in data[pkg]:
-            return
-        for dep in data[pkg]['deps']:
-            self._unpackdep(ud, dep, data[pkg]['deps'], "%s/node_modules/%s" % (destdir, dep), dldir, d)
-
-
-    def unpack(self, ud, destdir, d):
-        dldir = d.getVar("DL_DIR")
-        with open("%s/npm/%s" % (dldir, ud.bbnpmmanifest)) as datafile:
-            workobj = json.load(datafile)
-        dldir = "%s/%s" % (os.path.dirname(ud.localpath), ud.pkgname)
-
-        if 'subdir' in ud.parm:
-            unpackdir = '%s/%s' % (destdir, ud.parm.get('subdir'))
-        else:
-            unpackdir = '%s/npmpkg' % destdir
-
-        self._unpackdep(ud, ud.pkgname, workobj, unpackdir, dldir, d)
-
-    def _parse_view(self, output):
-        '''
-        Parse the output of npm view --json; the last JSON result
-        is assumed to be the one that we're interested in.
-        '''
-        pdata = None
-        outdeps = {}
-        datalines = []
-        bracelevel = 0
-        for line in output.splitlines():
-            if bracelevel:
-                datalines.append(line)
-            elif '{' in line:
-                datalines = []
-                datalines.append(line)
-            bracelevel = bracelevel + line.count('{') - line.count('}')
-        if datalines:
-            pdata = json.loads('\n'.join(datalines))
-        return pdata
-
-    def _getdependencies(self, pkg, data, version, d, ud, optional=False, fetchedlist=None):
-        if fetchedlist is None:
-            fetchedlist = []
-        pkgfullname = pkg
-        if version != '*' and not '/' in version:
-            pkgfullname += "@'%s'" % version
-        logger.debug(2, "Calling getdeps on %s" % pkg)
-        fetchcmd = "npm view %s --json --registry %s" % (pkgfullname, ud.registry)
-        output = runfetchcmd(fetchcmd, d, True)
-        pdata = self._parse_view(output)
-        if not pdata:
-            raise FetchError("The command '%s' returned no output" % fetchcmd)
-        if optional:
-            pkg_os = pdata.get('os', None)
-            if pkg_os:
-                if not isinstance(pkg_os, list):
-                    pkg_os = [pkg_os]
-                blacklist = False
-                for item in pkg_os:
-                    if item.startswith('!'):
-                        blacklist = True
-                        break
-                if (not blacklist and 'linux' not in pkg_os) or '!linux' in pkg_os:
-                    logger.debug(2, "Skipping %s since it's incompatible with Linux" % pkg)
-                    return
-        #logger.debug(2, "Output URL is %s - %s - %s" % (ud.basepath, ud.basename, ud.localfile))
-        outputurl = pdata['dist']['tarball']
-        data[pkg] = {}
-        data[pkg]['tgz'] = os.path.basename(outputurl)
-        if outputurl in fetchedlist:
-            return
-
-        self._runwget(ud, d, "%s --directory-prefix=%s %s" % (self.basecmd, ud.prefixdir, outputurl), False)
-        fetchedlist.append(outputurl)
-
-        dependencies = pdata.get('dependencies', {})
-        optionalDependencies = pdata.get('optionalDependencies', {})
-        dependencies.update(optionalDependencies)
-        depsfound = {}
-        optdepsfound = {}
-        data[pkg]['deps'] = {}
-        for dep in dependencies:
-            if dep in optionalDependencies:
-                optdepsfound[dep] = dependencies[dep]
-            else:
-                depsfound[dep] = dependencies[dep]
-        for dep, version in optdepsfound.items():
-            self._getdependencies(dep, data[pkg]['deps'], version, d, ud, optional=True, fetchedlist=fetchedlist)
-        for dep, version in depsfound.items():
-            self._getdependencies(dep, data[pkg]['deps'], version, d, ud, fetchedlist=fetchedlist)
-
-    def _getshrinkeddependencies(self, pkg, data, version, d, ud, lockdown, manifest, toplevel=True):
-        logger.debug(2, "NPM shrinkwrap file is %s" % data)
-        if toplevel:
-            name = data.get('name', None)
-            if name and name != pkg:
-                for obj in data.get('dependencies', []):
-                    if obj == pkg:
-                        self._getshrinkeddependencies(obj, data['dependencies'][obj], data['dependencies'][obj]['version'], d, ud, lockdown, manifest, False)
-                        return
-        outputurl = "invalid"
-        if ('resolved' not in data) or (not data['resolved'].startswith('http://') and not data['resolved'].startswith('https://')):
-            # will be the case for ${PN}
-            fetchcmd = "npm view %s@%s dist.tarball --registry %s" % (pkg, version, ud.registry)
-            logger.debug(2, "Found this matching URL: %s" % str(fetchcmd))
-            outputurl = runfetchcmd(fetchcmd, d, True)
-        else:
-            outputurl = data['resolved']
-        self._runwget(ud, d, "%s --directory-prefix=%s %s" % (self.basecmd, ud.prefixdir, outputurl), False)
-        manifest[pkg] = {}
-        manifest[pkg]['tgz'] = os.path.basename(outputurl).rstrip()
-        manifest[pkg]['deps'] = {}
-
-        if pkg in lockdown:
-            sha1_expected = lockdown[pkg][version]
-            sha1_data = bb.utils.sha1_file("npm/%s/%s" % (ud.pkgname, manifest[pkg]['tgz']))
-            if sha1_expected != sha1_data:
-                msg = "\nFile: '%s' has %s checksum %s when %s was expected" % (manifest[pkg]['tgz'], 'sha1', sha1_data, sha1_expected)
-                raise ChecksumError('Checksum mismatch!%s' % msg)
-        else:
-            logger.debug(2, "No lockdown data for %s@%s" % (pkg, version))
-
-        if 'dependencies' in data:
-            for obj in data['dependencies']:
-                logger.debug(2, "Found dep is %s" % str(obj))
-                self._getshrinkeddependencies(obj, data['dependencies'][obj], data['dependencies'][obj]['version'], d, ud, lockdown, manifest[pkg]['deps'], False)
-
-    def download(self, ud, d):
-        """Fetch url"""
-        jsondepobj = {}
-        shrinkobj = {}
-        lockdown = {}
-
-        if not os.listdir(ud.pkgdatadir) and os.path.exists(ud.fullmirror):
-            dest = d.getVar("DL_DIR")
-            bb.utils.mkdirhier(dest)
-            runfetchcmd("tar -xJf %s" % (ud.fullmirror), d, workdir=dest)
-            return
-
-        if ud.parm.get("noverify", None) != '1':
-            shwrf = d.getVar('NPM_SHRINKWRAP')
-            logger.debug(2, "NPM shrinkwrap file is %s" % shwrf)
-            if shwrf:
-                try:
-                    with open(shwrf) as datafile:
-                        shrinkobj = json.load(datafile)
-                except Exception as e:
-                    raise FetchError('Error loading NPM_SHRINKWRAP file "%s" for %s: %s' % (shwrf, ud.pkgname, str(e)))
-            elif not ud.ignore_checksums:
-                logger.warning('Missing shrinkwrap file in NPM_SHRINKWRAP for %s, this will lead to unreliable builds!' % ud.pkgname)
-            lckdf = d.getVar('NPM_LOCKDOWN')
-            logger.debug(2, "NPM lockdown file is %s" % lckdf)
-            if lckdf:
-                try:
-                    with open(lckdf) as datafile:
-                        lockdown = json.load(datafile)
-                except Exception as e:
-                    raise FetchError('Error loading NPM_LOCKDOWN file "%s" for %s: %s' % (lckdf, ud.pkgname, str(e)))
-            elif not ud.ignore_checksums:
-                logger.warning('Missing lockdown file in NPM_LOCKDOWN for %s, this will lead to unreproducible builds!' % ud.pkgname)
-
-        if ('name' not in shrinkobj):
-            self._getdependencies(ud.pkgname, jsondepobj, ud.version, d, ud)
-        else:
-            self._getshrinkeddependencies(ud.pkgname, shrinkobj, ud.version, d, ud, lockdown, jsondepobj)
-
-        with open(ud.localpath, 'w') as outfile:
-            json.dump(jsondepobj, outfile)
-
-    def build_mirror_data(self, ud, d):
-        # Generate a mirror tarball if needed
-        if ud.write_tarballs and not os.path.exists(ud.fullmirror):
-            # it's possible that this symlink points to read-only filesystem with PREMIRROR
-            if os.path.islink(ud.fullmirror):
-                os.unlink(ud.fullmirror)
-
-            dldir = d.getVar("DL_DIR")
-            logger.info("Creating tarball of npm data")
-            runfetchcmd("tar -cJf %s npm/%s npm/%s" % (ud.fullmirror, ud.bbnpmmanifest, ud.pkgname), d,
-                        workdir=dldir)
-            runfetchcmd("touch %s.done" % (ud.fullmirror), d, workdir=dldir)

bitbake/lib/bb/fetch2/osc.py

@@ -10,6 +10,7 @@ import  os
 import  sys
 import logging
 import  bb
+from    bb       import data
 from    bb.fetch2 import FetchMethod
 from    bb.fetch2 import FetchError
 from    bb.fetch2 import MissingParameterError
@@ -32,22 +33,21 @@ class Osc(FetchMethod):
         ud.module = ud.parm["module"]
 
         # Create paths to osc checkouts
-        oscdir = d.getVar("OSCDIR") or (d.getVar("DL_DIR") + "/osc")
         relpath = self._strip_leading_slashes(ud.path)
-        ud.pkgdir = os.path.join(oscdir, ud.host)
+        ud.pkgdir = os.path.join(data.expand('${OSCDIR}', d), ud.host)
         ud.moddir = os.path.join(ud.pkgdir, relpath, ud.module)
 
         if 'rev' in ud.parm:
             ud.revision = ud.parm['rev']
         else:
-            pv = d.getVar("PV", False)
+            pv = data.getVar("PV", d, 0)
             rev = bb.fetch2.srcrev_internal_helper(ud, d)
             if rev and rev != True:
                 ud.revision = rev
             else:
                 ud.revision = ""
 
-        ud.localfile = d.expand('%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.path.replace('/', '.'), ud.revision))
+        ud.localfile = data.expand('%s_%s_%s.tar.gz' % (ud.module.replace('/', '.'), ud.path.replace('/', '.'), ud.revision), d)
 
     def _buildosccommand(self, ud, d, command):
         """
@@ -55,7 +55,7 @@ class Osc(FetchMethod):
         command is "fetch", "update", "info"
         """
 
-        basecmd = d.getVar("FETCHCMD_osc") or "/usr/bin/env osc"
+        basecmd = data.expand('${FETCHCMD_osc}', d)
 
         proto = ud.parm.get('protocol', 'ocs')
 
@@ -84,25 +84,27 @@ class Osc(FetchMethod):
 
         logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
 
-        if os.access(os.path.join(d.getVar('OSCDIR'), ud.path, ud.module), os.R_OK):
+        if os.access(os.path.join(data.expand('${OSCDIR}', d), ud.path, ud.module), os.R_OK):
             oscupdatecmd = self._buildosccommand(ud, d, "update")
             logger.info("Update "+ ud.url)
             # update sources there
+            os.chdir(ud.moddir)
             logger.debug(1, "Running %s", oscupdatecmd)
             bb.fetch2.check_network_access(d, oscupdatecmd, ud.url)
-            runfetchcmd(oscupdatecmd, d, workdir=ud.moddir)
+            runfetchcmd(oscupdatecmd, d)
         else:
             oscfetchcmd = self._buildosccommand(ud, d, "fetch")
             logger.info("Fetch " + ud.url)
             # check out sources there
             bb.utils.mkdirhier(ud.pkgdir)
+            os.chdir(ud.pkgdir)
             logger.debug(1, "Running %s", oscfetchcmd)
             bb.fetch2.check_network_access(d, oscfetchcmd, ud.url)
-            runfetchcmd(oscfetchcmd, d, workdir=ud.pkgdir)
+            runfetchcmd(oscfetchcmd, d)
 
+        os.chdir(os.path.join(ud.pkgdir + ud.path))
         # tar them up to a defined filename
-        runfetchcmd("tar -czf %s %s" % (ud.localpath, ud.module), d,
-                    cleanup=[ud.localpath], workdir=os.path.join(ud.pkgdir + ud.path))
+        runfetchcmd("tar -czf %s %s" % (ud.localpath, ud.module), d, cleanup = [ud.localpath])
 
     def supports_srcrev(self):
         return False
@@ -112,7 +114,7 @@ class Osc(FetchMethod):
         Generate a .oscrc to be used for this run.
         """
 
-        config_path = os.path.join(d.getVar('OSCDIR'), "oscrc")
+        config_path = os.path.join(data.expand('${OSCDIR}', d), "oscrc")
         if (os.path.exists(config_path)):
             os.remove(config_path)
 
@@ -121,8 +123,8 @@ class Osc(FetchMethod):
         f.write("apisrv = %s\n" % ud.host)
         f.write("scheme = http\n")
         f.write("su-wrapper = su -c\n")
-        f.write("build-root = %s\n" % d.getVar('WORKDIR'))
-        f.write("urllist = %s\n" % d.getVar("OSCURLLIST"))
+        f.write("build-root = %s\n" % data.expand('${WORKDIR}', d))
+        f.write("urllist = http://moblin-obs.jf.intel.com:8888/build/%(project)s/%(repository)s/%(buildarch)s/:full/%(name)s.rpm\n")
         f.write("extra-pkgs = gzip\n")
         f.write("\n")
         f.write("[%s]\n" % ud.host)

bitbake/lib/bb/fetch2/perforce.py

@@ -1,12 +1,14 @@
 # ex:ts=4:sw=4:sts=4:et
 # -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
 """
-BitBake 'Fetch' implementation for perforce
+BitBake 'Fetch' implementations
+
+Classes for obtaining upstream sources for the
+BitBake build tools.
 
 """
 
 # Copyright (C) 2003, 2004  Chris Larson
-# Copyright (C) 2016 Kodak Alaris, Inc.
 #
 # This program is free software; you can redistribute it and/or modify
 # it under the terms of the GNU General Public License version 2 as
@@ -23,183 +25,163 @@ BitBake 'Fetch' implementation for perforce
 #
 # Based on functions from the base bb module, Copyright 2003 Holger Schurig
 
+from future_builtins import zip
 import os
+import subprocess
 import logging
 import bb
+from   bb import data
 from   bb.fetch2 import FetchMethod
 from   bb.fetch2 import FetchError
 from   bb.fetch2 import logger
 from   bb.fetch2 import runfetchcmd
 
 class Perforce(FetchMethod):
-    """ Class to fetch from perforce repositories """
     def supports(self, ud, d):
-        """ Check to see if a given url can be fetched with perforce. """
         return ud.type in ['p4']
 
-    def urldata_init(self, ud, d):
-        """
-        Initialize perforce specific variables within url data.  If P4CONFIG is
-        provided by the env, use it.  If P4PORT is specified by the recipe, use
-        its values, which may override the settings in P4CONFIG.
-        """
-        ud.basecmd = d.getVar("FETCHCMD_p4") or "/usr/bin/env p4"
-
-        ud.dldir = d.getVar("P4DIR") or (d.getVar("DL_DIR") + "/p4")
-
-        path = ud.url.split('://')[1]
-        path = path.split(';')[0]
-        delim = path.find('@');
+    def doparse(url, d):
+        parm = {}
+        path = url.split("://")[1]
+        delim = path.find("@");
         if delim != -1:
-            (ud.user, ud.pswd) = path.split('@')[0].split(':')
-            ud.path = path.split('@')[1]
+            (user, pswd, host, port) = path.split('@')[0].split(":")
+            path = path.split('@')[1]
         else:
-            ud.path = path
+            (host, port) = d.getVar('P4PORT').split(':')
+            user = ""
+            pswd = ""
 
-        ud.usingp4config = False
-        p4port = d.getVar('P4PORT')
+        if path.find(";") != -1:
+            keys=[]
+            values=[]
+            plist = path.split(';')
+            for item in plist:
+                if item.count('='):
+                    (key, value) = item.split('=')
+                    keys.append(key)
+                    values.append(value)
 
-        if p4port:
-            logger.debug(1, 'Using recipe provided P4PORT: %s' % p4port)
-            ud.host = p4port
-        else:
-            logger.debug(1, 'Trying to use P4CONFIG to automatically set P4PORT...')
-            ud.usingp4config = True
-            p4cmd = '%s info | grep "Server address"' % ud.basecmd
-            bb.fetch2.check_network_access(d, p4cmd, ud.url)
-            ud.host = runfetchcmd(p4cmd, d, True)
-            ud.host = ud.host.split(': ')[1].strip()
-            logger.debug(1, 'Determined P4PORT to be: %s' % ud.host)
-            if not ud.host:
-                raise FetchError('Could not determine P4PORT from P4CONFIG')
-	
-        if ud.path.find('/...') >= 0:
-            ud.pathisdir = True
-        else:
-            ud.pathisdir = False
+            parm = dict(zip(keys, values))
+        path = "//" + path.split(';')[0]
+        host += ":%s" % (port)
+        parm["cset"] = Perforce.getcset(d, path, host, user, pswd, parm)
 
-        cleanedpath = ud.path.replace('/...', '').replace('/', '.')
-        cleanedhost = ud.host.replace(':', '.')
-        ud.pkgdir = os.path.join(ud.dldir, cleanedhost, cleanedpath)
+        return host, path, user, pswd, parm
+    doparse = staticmethod(doparse)
 
-        ud.setup_revisions(d)
-
-        ud.localfile = d.expand('%s_%s_%s.tar.gz' % (cleanedhost, cleanedpath, ud.revision))
-
-    def _buildp4command(self, ud, d, command, depot_filename=None):
-        """
-        Build a p4 commandline.  Valid commands are "changes", "print", and
-        "files".  depot_filename is the full path to the file in the depot
-        including the trailing '#rev' value.
-        """
+    def getcset(d, depot, host, user, pswd, parm):
         p4opt = ""
+        if "cset" in parm:
+            return parm["cset"];
+        if user:
+            p4opt += " -u %s" % (user)
+        if pswd:
+            p4opt += " -P %s" % (pswd)
+        if host:
+            p4opt += " -p %s" % (host)
 
-        if ud.user:
-            p4opt += ' -u "%s"' % (ud.user)
+        p4date = d.getVar("P4DATE", True)
+        if "revision" in parm:
+            depot += "#%s" % (parm["revision"])
+        elif "label" in parm:
+            depot += "@%s" % (parm["label"])
+        elif p4date:
+            depot += "@%s" % (p4date)
 
-        if ud.pswd:
-            p4opt += ' -P "%s"' % (ud.pswd)
+        p4cmd = d.getVar('FETCHCMD_p4', True) or "p4"
+        logger.debug(1, "Running %s%s changes -m 1 %s", p4cmd, p4opt, depot)
+        p4file, errors = bb.process.run("%s%s changes -m 1 %s" % (p4cmd, p4opt, depot))
+        cset = p4file.strip()
+        logger.debug(1, "READ %s", cset)
+        if not cset:
+            return -1
 
-        if ud.host and not ud.usingp4config:
-            p4opt += ' -p %s' % (ud.host)
+        return cset.split(' ')[1]
+    getcset = staticmethod(getcset)
 
-        if hasattr(ud, 'revision') and ud.revision:
-            pathnrev = '%s@%s' % (ud.path, ud.revision)
+    def urldata_init(self, ud, d):
+        (host, path, user, pswd, parm) = Perforce.doparse(ud.url, d)
+
+        base_path = path.replace('/...', '')
+        base_path = self._strip_leading_slashes(base_path)
+        
+        if "label" in parm:
+            version = parm["label"]
         else:
-            pathnrev = '%s' % (ud.path)
+            version = Perforce.getcset(d, path, host, user, pswd, parm)
 
-        if depot_filename:
-            if ud.pathisdir: # Remove leading path to obtain filename
-                filename = depot_filename[len(ud.path)-1:]
-            else:
-                filename = depot_filename[depot_filename.rfind('/'):]
-            filename = filename[:filename.find('#')] # Remove trailing '#rev'
-
-        if command == 'changes':
-            p4cmd = '%s%s changes -m 1 //%s' % (ud.basecmd, p4opt, pathnrev)
-        elif command == 'print':
-            if depot_filename != None:
-                p4cmd = '%s%s print -o "p4/%s" "%s"' % (ud.basecmd, p4opt, filename, depot_filename)
-            else:
-                raise FetchError('No depot file name provided to p4 %s' % command, ud.url)
-        elif command == 'files':
-            p4cmd = '%s%s files //%s' % (ud.basecmd, p4opt, pathnrev)
-        else:
-            raise FetchError('Invalid p4 command %s' % command, ud.url)
-
-        return p4cmd
-
-    def _p4listfiles(self, ud, d):
-        """
-        Return a list of the file names which are present in the depot using the
-        'p4 files' command, including trailing '#rev' file revision indicator
-        """
-        p4cmd = self._buildp4command(ud, d, 'files')
-        bb.fetch2.check_network_access(d, p4cmd, ud.url)
-        p4fileslist = runfetchcmd(p4cmd, d, True)
-        p4fileslist = [f.rstrip() for f in p4fileslist.splitlines()]
-
-        if not p4fileslist:
-            raise FetchError('Unable to fetch listing of p4 files from %s@%s' % (ud.host, ud.path))
-
-        count = 0
-        filelist = []
-
-        for filename in p4fileslist:
-            item = filename.split(' - ')
-            lastaction = item[1].split()
-            logger.debug(1, 'File: %s Last Action: %s' % (item[0], lastaction[0]))
-            if lastaction[0] == 'delete':
-                continue
-            filelist.append(item[0])
-
-        return filelist
+        ud.localfile = data.expand('%s+%s+%s.tar.gz' % (host, base_path.replace('/', '.'), version), d)
 
     def download(self, ud, d):
-        """ Get the list of files, fetch each one """
-        filelist = self._p4listfiles(ud, d)
-        if not filelist:
-            raise FetchError('No files found in depot %s@%s' % (ud.host, ud.path))
+        """
+        Fetch urls
+        """
 
-        bb.utils.remove(ud.pkgdir, True)
-        bb.utils.mkdirhier(ud.pkgdir)
+        (host, depot, user, pswd, parm) = Perforce.doparse(ud.url, d)
 
-        for afile in filelist:
-            p4fetchcmd = self._buildp4command(ud, d, 'print', afile)
-            bb.fetch2.check_network_access(d, p4fetchcmd, ud.url)
-            runfetchcmd(p4fetchcmd, d, workdir=ud.pkgdir)
+        if depot.find('/...') != -1:
+            path = depot[:depot.find('/...')]
+        else:
+            path = depot
 
-        runfetchcmd('tar -czf %s p4' % (ud.localpath), d, cleanup=[ud.localpath], workdir=ud.pkgdir)
+        module = parm.get('module', os.path.basename(path))
 
-    def clean(self, ud, d):
-        """ Cleanup p4 specific files and dirs"""
-        bb.utils.remove(ud.localpath)
-        bb.utils.remove(ud.pkgdir, True)
+        # Get the p4 command
+        p4opt = ""
+        if user:
+            p4opt += " -u %s" % (user)
 
-    def supports_srcrev(self):
-        return True
+        if pswd:
+            p4opt += " -P %s" % (pswd)
 
-    def _revision_key(self, ud, d, name):
-        """ Return a unique key for the url """
-        return 'p4:%s' % ud.pkgdir
+        if host:
+            p4opt += " -p %s" % (host)
 
-    def _latest_revision(self, ud, d, name):
-        """ Return the latest upstream scm revision number """
-        p4cmd = self._buildp4command(ud, d, "changes")
-        bb.fetch2.check_network_access(d, p4cmd, ud.url)
-        tip = runfetchcmd(p4cmd, d, True)
+        p4cmd = d.getVar('FETCHCMD_p4', True) or "p4"
 
-        if not tip:
-            raise FetchError('Could not determine the latest perforce changelist')
+        # create temp directory
+        logger.debug(2, "Fetch: creating temporary directory")
+        bb.utils.mkdirhier(d.expand('${WORKDIR}'))
+        mktemp = d.getVar("FETCHCMD_p4mktemp", True) or d.expand("mktemp -d -q '${WORKDIR}/oep4.XXXXXX'")
+        tmpfile, errors = bb.process.run(mktemp)
+        tmpfile = tmpfile.strip()
+        if not tmpfile:
+            raise FetchError("Fetch: unable to create temporary directory.. make sure 'mktemp' is in the PATH.", ud.url)
 
-        tipcset = tip.split(' ')[1]
-        logger.debug(1, 'p4 tip found to be changelist %s' % tipcset)
-        return tipcset
+        if "label" in parm:
+            depot = "%s@%s" % (depot, parm["label"])
+        else:
+            cset = Perforce.getcset(d, depot, host, user, pswd, parm)
+            depot = "%s@%s" % (depot, cset)
 
-    def sortable_revision(self, ud, d, name):
-        """ Return a sortable revision number """
-        return False, self._build_revision(ud, d)
+        os.chdir(tmpfile)
+        logger.info("Fetch " + ud.url)
+        logger.info("%s%s files %s", p4cmd, p4opt, depot)
+        p4file, errors = bb.process.run("%s%s files %s" % (p4cmd, p4opt, depot))
+        p4file = [f.rstrip() for f in p4file.splitlines()]
 
-    def _build_revision(self, ud, d):
-        return ud.revision
+        if not p4file:
+            raise FetchError("Fetch: unable to get the P4 files from %s" % depot, ud.url)
 
+        count = 0
+
+        for file in p4file:
+            list = file.split()
+
+            if list[2] == "delete":
+                continue
+
+            dest = list[0][len(path)+1:]
+            where = dest.find("#")
+
+            subprocess.call("%s%s print -o %s/%s %s" % (p4cmd, p4opt, module, dest[:where], list[0]), shell=True)
+            count = count + 1
+
+        if count == 0:
+            logger.error()
+            raise FetchError("Fetch: No files gathered from the P4 fetch", ud.url)
+
+        runfetchcmd("tar -czf %s %s" % (ud.localpath, module), d, cleanup = [ud.localpath])
+        # cleanup
+        bb.utils.prunedir(tmpfile)

bitbake/lib/bb/fetch2/repo.py

@@ -25,9 +25,9 @@ BitBake "Fetch" repo (git) implementation
 
 import os
 import bb
+from   bb    import data
 from   bb.fetch2 import FetchMethod
 from   bb.fetch2 import runfetchcmd
-from   bb.fetch2 import logger
 
 class Repo(FetchMethod):
     """Class to fetch a module or modules from repo (git) repositories"""
@@ -45,25 +45,23 @@ class Repo(FetchMethod):
         "master".
         """
 
-        ud.basecmd = d.getVar("FETCHCMD_repo") or "/usr/bin/env repo"
-
         ud.proto = ud.parm.get('protocol', 'git')
         ud.branch = ud.parm.get('branch', 'master')
         ud.manifest = ud.parm.get('manifest', 'default.xml')
         if not ud.manifest.endswith('.xml'):
             ud.manifest += '.xml'
 
-        ud.localfile = d.expand("repo_%s%s_%s_%s.tar.gz" % (ud.host, ud.path.replace("/", "."), ud.manifest, ud.branch))
+        ud.localfile = data.expand("repo_%s%s_%s_%s.tar.gz" % (ud.host, ud.path.replace("/", "."), ud.manifest, ud.branch), d)
 
     def download(self, ud, d):
         """Fetch url"""
 
-        if os.access(os.path.join(d.getVar("DL_DIR"), ud.localfile), os.R_OK):
+        if os.access(os.path.join(data.getVar("DL_DIR", d, True), ud.localfile), os.R_OK):
             logger.debug(1, "%s already exists (or was stashed). Skipping repo init / sync.", ud.localpath)
             return
 
-        repodir = d.getVar("REPODIR") or (d.getVar("DL_DIR") + "/repo")
         gitsrcname = "%s%s" % (ud.host, ud.path.replace("/", "."))
+        repodir = data.getVar("REPODIR", d, True) or os.path.join(data.getVar("DL_DIR", d, True), "repo")
         codir = os.path.join(repodir, gitsrcname, ud.manifest)
 
         if ud.user:
@@ -71,23 +69,24 @@ class Repo(FetchMethod):
         else:
             username = ""
 
-        repodir = os.path.join(codir, "repo")
-        bb.utils.mkdirhier(repodir)
-        if not os.path.exists(os.path.join(repodir, ".repo")):
-            bb.fetch2.check_network_access(d, "%s init -m %s -b %s -u %s://%s%s%s" % (ud.basecmd, ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), ud.url)
-            runfetchcmd("%s init -m %s -b %s -u %s://%s%s%s" % (ud.basecmd, ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), d, workdir=repodir)
+        bb.utils.mkdirhier(os.path.join(codir, "repo"))
+        os.chdir(os.path.join(codir, "repo"))
+        if not os.path.exists(os.path.join(codir, "repo", ".repo")):
+            bb.fetch2.check_network_access(d, "repo init -m %s -b %s -u %s://%s%s%s" % (ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), ud.url)
+            runfetchcmd("repo init -m %s -b %s -u %s://%s%s%s" % (ud.manifest, ud.branch, ud.proto, username, ud.host, ud.path), d)
 
-        bb.fetch2.check_network_access(d, "%s sync %s" % (ud.basecmd, ud.url), ud.url)
-        runfetchcmd("%s sync" % ud.basecmd, d, workdir=repodir)
+        bb.fetch2.check_network_access(d, "repo sync %s" % ud.url, ud.url)
+        runfetchcmd("repo sync", d)
+        os.chdir(codir)
 
         scmdata = ud.parm.get("scmdata", "")
         if scmdata == "keep":
             tar_flags = ""
         else:
-            tar_flags = "--exclude='.repo' --exclude='.git'"
+            tar_flags = "--exclude '.repo' --exclude '.git'"
 
         # Create a cache
-        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.join(".", "*") ), d, workdir=codir)
+        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, os.path.join(".", "*") ), d)
 
     def supports_srcrev(self):
         return False

bitbake/lib/bb/fetch2/s3.py

@@ -1,98 +0,0 @@
-# ex:ts=4:sw=4:sts=4:et
-# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
-"""
-BitBake 'Fetch' implementation for Amazon AWS S3.
-
-Class for fetching files from Amazon S3 using the AWS Command Line Interface.
-The aws tool must be correctly installed and configured prior to use.
-
-"""
-
-# Copyright (C) 2017, Andre McCurdy <armccurdy@gmail.com>
-#
-# Based in part on bb.fetch2.wget:
-#    Copyright (C) 2003, 2004  Chris Larson
-#
-# This program is free software; you can redistribute it and/or modify
-# it under the terms of the GNU General Public License version 2 as
-# published by the Free Software Foundation.
-#
-# This program is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-# GNU General Public License for more details.
-#
-# You should have received a copy of the GNU General Public License along
-# with this program; if not, write to the Free Software Foundation, Inc.,
-# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-#
-# Based on functions from the base bb module, Copyright 2003 Holger Schurig
-
-import os
-import bb
-import urllib.request, urllib.parse, urllib.error
-from bb.fetch2 import FetchMethod
-from bb.fetch2 import FetchError
-from bb.fetch2 import runfetchcmd
-
-class S3(FetchMethod):
-    """Class to fetch urls via 'aws s3'"""
-
-    def supports(self, ud, d):
-        """
-        Check to see if a given url can be fetched with s3.
-        """
-        return ud.type in ['s3']
-
-    def recommends_checksum(self, urldata):
-        return True
-
-    def urldata_init(self, ud, d):
-        if 'downloadfilename' in ud.parm:
-            ud.basename = ud.parm['downloadfilename']
-        else:
-            ud.basename = os.path.basename(ud.path)
-
-        ud.localfile = d.expand(urllib.parse.unquote(ud.basename))
-
-        ud.basecmd = d.getVar("FETCHCMD_s3") or "/usr/bin/env aws s3"
-
-    def download(self, ud, d):
-        """
-        Fetch urls
-        Assumes localpath was called first
-        """
-
-        cmd = '%s cp s3://%s%s %s' % (ud.basecmd, ud.host, ud.path, ud.localpath)
-        bb.fetch2.check_network_access(d, cmd, ud.url)
-        runfetchcmd(cmd, d)
-
-        # Additional sanity checks copied from the wget class (although there
-        # are no known issues which mean these are required, treat the aws cli
-        # tool with a little healthy suspicion).
-
-        if not os.path.exists(ud.localpath):
-            raise FetchError("The aws cp command returned success for s3://%s%s but %s doesn't exist?!" % (ud.host, ud.path, ud.localpath))
-
-        if os.path.getsize(ud.localpath) == 0:
-            os.remove(ud.localpath)
-            raise FetchError("The aws cp command for s3://%s%s resulted in a zero size file?! Deleting and failing since this isn't right." % (ud.host, ud.path))
-
-        return True
-
-    def checkstatus(self, fetch, ud, d):
-        """
-        Check the status of a URL
-        """
-
-        cmd = '%s ls s3://%s%s' % (ud.basecmd, ud.host, ud.path)
-        bb.fetch2.check_network_access(d, cmd, ud.url)
-        output = runfetchcmd(cmd, d)
-
-        # "aws s3 ls s3://mybucket/foo" will exit with success even if the file
-        # is not found, so check output of the command to confirm success.
-
-        if not output:
-            raise FetchError("The aws ls command for s3://%s%s gave empty output" % (ud.host, ud.path))
-
-        return True

bitbake/lib/bb/fetch2/sftp.py

@@ -61,11 +61,14 @@ SRC_URI = "sftp://user@host.example.com/dir/path.file.txt"
 
 import os
 import bb
-import urllib.request, urllib.parse, urllib.error
+import urllib
+import commands
+from bb import data
 from bb.fetch2 import URI
 from bb.fetch2 import FetchMethod
 from bb.fetch2 import runfetchcmd
 
+
 class SFTP(FetchMethod):
     """Class to fetch urls via 'sftp'"""
 
@@ -90,19 +93,19 @@ class SFTP(FetchMethod):
         else:
             ud.basename = os.path.basename(ud.path)
 
-        ud.localfile = d.expand(urllib.parse.unquote(ud.basename))
+        ud.localfile = data.expand(urllib.unquote(ud.basename), d)
 
     def download(self, ud, d):
         """Fetch urls"""
 
         urlo = URI(ud.url)
-        basecmd = 'sftp -oBatchMode=yes'
+        basecmd = 'sftp -oPasswordAuthentication=no'
         port = ''
         if urlo.port:
             port = '-P %d' % urlo.port
             urlo.port = None
 
-        dldir = d.getVar('DL_DIR')
+        dldir = data.getVar('DL_DIR', d, True)
         lpath = os.path.join(dldir, ud.localfile)
 
         user = ''
@@ -118,7 +121,8 @@ class SFTP(FetchMethod):
 
         remote = '%s%s:%s' % (user, urlo.hostname, path)
 
-        cmd = '%s %s %s %s' % (basecmd, port, remote, lpath)
+        cmd = '%s %s %s %s' % (basecmd, port, commands.mkarg(remote),
+                               commands.mkarg(lpath))
 
         bb.fetch2.check_network_access(d, cmd, ud.url)
         runfetchcmd(cmd, d)

bitbake/lib/bb/fetch2/ssh.py

@@ -43,6 +43,7 @@ IETF secsh internet draft:
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
 import re, os
+from   bb import data
 from   bb.fetch2 import FetchMethod
 from   bb.fetch2 import FetchError
 from   bb.fetch2 import logger
@@ -86,11 +87,10 @@ class SSH(FetchMethod):
         m = __pattern__.match(urldata.url)
         path = m.group('path')
         host = m.group('host')
-        urldata.localpath = os.path.join(d.getVar('DL_DIR'),
-                os.path.basename(os.path.normpath(path)))
+        urldata.localpath = os.path.join(d.getVar('DL_DIR', True), os.path.basename(path))
 
     def download(self, urldata, d):
-        dldir = d.getVar('DL_DIR')
+        dldir = d.getVar('DL_DIR', True)
 
         m = __pattern__.match(urldata.url)
         path = m.group('path')
@@ -113,10 +113,12 @@ class SSH(FetchMethod):
             fr = host
         fr += ':%s' % path
 
+
+        import commands
         cmd = 'scp -B -r %s %s %s/' % (
             portarg,
-            fr,
-            dldir
+            commands.mkarg(fr),
+            commands.mkarg(dldir)
         )
 
         bb.fetch2.check_network_access(d, cmd, urldata.url)

bitbake/lib/bb/fetch2/svn.py

@@ -28,6 +28,7 @@ import sys
 import logging
 import bb
 import re
+from   bb import data
 from   bb.fetch2 import FetchMethod
 from   bb.fetch2 import FetchError
 from   bb.fetch2 import MissingParameterError
@@ -49,30 +50,21 @@ class Svn(FetchMethod):
         if not "module" in ud.parm:
             raise MissingParameterError('module', ud.url)
 
-        ud.basecmd = d.getVar("FETCHCMD_svn") or "/usr/bin/env svn --non-interactive --trust-server-cert"
+        ud.basecmd = d.getVar('FETCHCMD_svn', True)
 
         ud.module = ud.parm["module"]
 
-        if not "path_spec" in ud.parm:
-            ud.path_spec = ud.module
-        else:
-            ud.path_spec = ud.parm["path_spec"]
-
         # Create paths to svn checkouts
-        svndir = d.getVar("SVNDIR") or (d.getVar("DL_DIR") + "/svn")
         relpath = self._strip_leading_slashes(ud.path)
-        ud.pkgdir = os.path.join(svndir, ud.host, relpath)
+        ud.pkgdir = os.path.join(data.expand('${SVNDIR}', d), ud.host, relpath)
         ud.moddir = os.path.join(ud.pkgdir, ud.module)
-        # Protects the repository from concurrent updates, e.g. from two
-        # recipes fetching different revisions at the same time
-        ud.svnlock = os.path.join(ud.pkgdir, "svn.lock")
 
-        ud.setup_revisions(d)
+        ud.setup_revisons(d)
 
         if 'rev' in ud.parm:
             ud.revision = ud.parm['rev']
 
-        ud.localfile = d.expand('%s_%s_%s_%s_.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision))
+        ud.localfile = data.expand('%s_%s_%s_%s_.tar.gz' % (ud.module.replace('/', '.'), ud.host, ud.path.replace('/', '.'), ud.revision), d)
 
     def _buildsvncommand(self, ud, d, command):
         """
@@ -82,9 +74,9 @@ class Svn(FetchMethod):
 
         proto = ud.parm.get('protocol', 'svn')
 
-        svn_ssh = None
-        if proto == "svn+ssh" and "ssh" in ud.parm:
-            svn_ssh = ud.parm["ssh"]
+        svn_rsh = None
+        if proto == "svn+ssh" and "rsh" in ud.parm:
+            svn_rsh = ud.parm["rsh"]
 
         svnroot = ud.host + ud.path
 
@@ -110,14 +102,14 @@ class Svn(FetchMethod):
 
             if command == "fetch":
                 transportuser = ud.parm.get("transportuser", "")
-                svncmd = "%s co %s %s://%s%s/%s%s %s" % (ud.basecmd, " ".join(options), proto, transportuser, svnroot, ud.module, suffix, ud.path_spec)
+                svncmd = "%s co %s %s://%s%s/%s%s %s" % (ud.basecmd, " ".join(options), proto, transportuser, svnroot, ud.module, suffix, ud.module)
             elif command == "update":
                 svncmd = "%s update %s" % (ud.basecmd, " ".join(options))
             else:
                 raise FetchError("Invalid svn command %s" % command, ud.url)
 
-        if svn_ssh:
-            svncmd = "SVN_SSH=\"%s\" %s" % (svn_ssh, svncmd)
+        if svn_rsh:
+            svncmd = "svn_RSH=\"%s\" %s" % (svn_rsh, svncmd)
 
         return svncmd
 
@@ -126,40 +118,38 @@ class Svn(FetchMethod):
 
         logger.debug(2, "Fetch: checking for module directory '" + ud.moddir + "'")
 
-        lf = bb.utils.lockfile(ud.svnlock)
+        if os.access(os.path.join(ud.moddir, '.svn'), os.R_OK):
+            svnupdatecmd = self._buildsvncommand(ud, d, "update")
+            logger.info("Update " + ud.url)
+            # update sources there
+            os.chdir(ud.moddir)
+            # We need to attempt to run svn upgrade first in case its an older working format
+            try:
+                runfetchcmd(ud.basecmd + " upgrade", d)
+            except FetchError:
+                pass
+            logger.debug(1, "Running %s", svnupdatecmd)
+            bb.fetch2.check_network_access(d, svnupdatecmd, ud.url)
+            runfetchcmd(svnupdatecmd, d)
+        else:
+            svnfetchcmd = self._buildsvncommand(ud, d, "fetch")
+            logger.info("Fetch " + ud.url)
+            # check out sources there
+            bb.utils.mkdirhier(ud.pkgdir)
+            os.chdir(ud.pkgdir)
+            logger.debug(1, "Running %s", svnfetchcmd)
+            bb.fetch2.check_network_access(d, svnfetchcmd, ud.url)
+            runfetchcmd(svnfetchcmd, d)
 
-        try:
-            if os.access(os.path.join(ud.moddir, '.svn'), os.R_OK):
-                svnupdatecmd = self._buildsvncommand(ud, d, "update")
-                logger.info("Update " + ud.url)
-                # We need to attempt to run svn upgrade first in case its an older working format
-                try:
-                    runfetchcmd(ud.basecmd + " upgrade", d, workdir=ud.moddir)
-                except FetchError:
-                    pass
-                logger.debug(1, "Running %s", svnupdatecmd)
-                bb.fetch2.check_network_access(d, svnupdatecmd, ud.url)
-                runfetchcmd(svnupdatecmd, d, workdir=ud.moddir)
-            else:
-                svnfetchcmd = self._buildsvncommand(ud, d, "fetch")
-                logger.info("Fetch " + ud.url)
-                # check out sources there
-                bb.utils.mkdirhier(ud.pkgdir)
-                logger.debug(1, "Running %s", svnfetchcmd)
-                bb.fetch2.check_network_access(d, svnfetchcmd, ud.url)
-                runfetchcmd(svnfetchcmd, d, workdir=ud.pkgdir)
+        scmdata = ud.parm.get("scmdata", "")
+        if scmdata == "keep":
+            tar_flags = ""
+        else:
+            tar_flags = "--exclude '.svn'"
 
-            scmdata = ud.parm.get("scmdata", "")
-            if scmdata == "keep":
-                tar_flags = ""
-            else:
-                tar_flags = "--exclude='.svn'"
-
-            # tar them up to a defined filename
-            runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.path_spec), d,
-                        cleanup=[ud.localpath], workdir=ud.pkgdir)
-        finally:
-            bb.utils.unlockfile(lf)
+        os.chdir(ud.pkgdir)
+        # tar them up to a defined filename
+        runfetchcmd("tar %s -czf %s %s" % (tar_flags, ud.localpath, ud.module), d, cleanup = [ud.localpath])
 
     def clean(self, ud, d):
         """ Clean SVN specific files and dirs """
@@ -181,7 +171,7 @@ class Svn(FetchMethod):
         """
         Return the latest upstream revision number
         """
-        bb.fetch2.check_network_access(d, self._buildsvncommand(ud, d, "log1"), ud.url)
+        bb.fetch2.check_network_access(d, self._buildsvncommand(ud, d, "log1"))
 
         output = runfetchcmd("LANG=C LC_ALL=C " + self._buildsvncommand(ud, d, "log1"), d, True)
 

bitbake/lib/bb/fetch2/wget.py

@@ -25,46 +25,15 @@ BitBake build tools.
 #
 # Based on functions from the base bb module, Copyright 2003 Holger Schurig
 
-import re
-import tempfile
-import subprocess
 import os
 import logging
-import errno
 import bb
-import bb.progress
-import socket
-import http.client
-import urllib.request, urllib.parse, urllib.error
+import urllib
+from   bb import data
 from   bb.fetch2 import FetchMethod
 from   bb.fetch2 import FetchError
 from   bb.fetch2 import logger
 from   bb.fetch2 import runfetchcmd
-from   bb.fetch2 import FetchConnectionCache
-from   bb.utils import export_proxies
-from   bs4 import BeautifulSoup
-from   bs4 import SoupStrainer
-
-class WgetProgressHandler(bb.progress.LineFilterProgressHandler):
-    """
-    Extract progress information from wget output.
-    Note: relies on --progress=dot (with -v or without -q/-nv) being
-    specified on the wget command line.
-    """
-    def __init__(self, d):
-        super(WgetProgressHandler, self).__init__(d)
-        # Send an initial progress event so the bar gets shown
-        self._fire_progress(0)
-
-    def writeline(self, line):
-        percs = re.findall(r'(\d+)%\s+([\d.]+[A-Z])', line)
-        if percs:
-            progress = int(percs[-1][0])
-            rate = percs[-1][1] + '/s'
-            self.update(progress, rate)
-            return False
-        return True
-
 
 class Wget(FetchMethod):
     """Class to fetch urls via 'wget'"""
@@ -87,19 +56,15 @@ class Wget(FetchMethod):
         else:
             ud.basename = os.path.basename(ud.path)
 
-        ud.localfile = d.expand(urllib.parse.unquote(ud.basename))
-        if not ud.localfile:
-            ud.localfile = d.expand(urllib.parse.unquote(ud.host + ud.path).replace("/", "."))
+        ud.localfile = data.expand(urllib.unquote(ud.basename), d)
 
-        self.basecmd = d.getVar("FETCHCMD_wget") or "/usr/bin/env wget -t 2 -T 30 --passive-ftp --no-check-certificate"
+        self.basecmd = d.getVar("FETCHCMD_wget", True) or "/usr/bin/env wget -t 2 -T 30 -nv --passive-ftp --no-check-certificate"
 
-    def _runwget(self, ud, d, command, quiet, workdir=None):
-
-        progresshandler = WgetProgressHandler(d)
+    def _runwget(self, ud, d, command, quiet):
 
         logger.debug(2, "Fetching %s using command '%s'" % (ud.url, command))
-        bb.fetch2.check_network_access(d, command, ud.url)
-        runfetchcmd(command + ' --progress=dot -v', d, quiet, log=progresshandler, workdir=workdir)
+        bb.fetch2.check_network_access(d, command)
+        runfetchcmd(command, d, quiet)
 
     def download(self, ud, d):
         """Fetch urls"""
@@ -107,13 +72,10 @@ class Wget(FetchMethod):
         fetchcmd = self.basecmd
 
         if 'downloadfilename' in ud.parm:
-            dldir = d.getVar("DL_DIR")
+            dldir = d.getVar("DL_DIR", True)
             bb.utils.mkdirhier(os.path.dirname(dldir + os.sep + ud.localfile))
             fetchcmd += " -O " + dldir + os.sep + ud.localfile
 
-        if ud.user and ud.pswd:
-            fetchcmd += " --user=%s --password=%s --auth-no-challenge" % (ud.user, ud.pswd)
-
         uri = ud.url.split(";")[0]
         if os.path.exists(ud.localpath):
             # file exists, but we didnt complete it.. trying again..
@@ -134,486 +96,11 @@ class Wget(FetchMethod):
 
         return True
 
-    def checkstatus(self, fetch, ud, d, try_again=True):
-        class HTTPConnectionCache(http.client.HTTPConnection):
-            if fetch.connection_cache:
-                def connect(self):
-                    """Connect to the host and port specified in __init__."""
+    def checkstatus(self, ud, d):
 
-                    sock = fetch.connection_cache.get_connection(self.host, self.port)
-                    if sock:
-                        self.sock = sock
-                    else:
-                        self.sock = socket.create_connection((self.host, self.port),
-                                    self.timeout, self.source_address)
-                        fetch.connection_cache.add_connection(self.host, self.port, self.sock)
+        uri = ud.url.split(";")[0]
+        fetchcmd = self.basecmd + " --spider '%s'" % uri
 
-                    if self._tunnel_host:
-                        self._tunnel()
+        self._runwget(ud, d, fetchcmd, True)
 
-        class CacheHTTPHandler(urllib.request.HTTPHandler):
-            def http_open(self, req):
-                return self.do_open(HTTPConnectionCache, req)
-
-            def do_open(self, http_class, req):
-                """Return an addinfourl object for the request, using http_class.
-
-                http_class must implement the HTTPConnection API from httplib.
-                The addinfourl return value is a file-like object.  It also
-                has methods and attributes including:
-                    - info(): return a mimetools.Message object for the headers
-                    - geturl(): return the original request URL
-                    - code: HTTP status code
-                """
-                host = req.host
-                if not host:
-                    raise urllib.error.URLError('no host given')
-
-                h = http_class(host, timeout=req.timeout) # will parse host:port
-                h.set_debuglevel(self._debuglevel)
-
-                headers = dict(req.unredirected_hdrs)
-                headers.update(dict((k, v) for k, v in list(req.headers.items())
-                            if k not in headers))
-
-                # We want to make an HTTP/1.1 request, but the addinfourl
-                # class isn't prepared to deal with a persistent connection.
-                # It will try to read all remaining data from the socket,
-                # which will block while the server waits for the next request.
-                # So make sure the connection gets closed after the (only)
-                # request.
-
-                # Don't close connection when connection_cache is enabled,
-                if fetch.connection_cache is None:
-                    headers["Connection"] = "close"
-                else:
-                    headers["Connection"] = "Keep-Alive" # Works for HTTP/1.0
-
-                headers = dict(
-                    (name.title(), val) for name, val in list(headers.items()))
-
-                if req._tunnel_host:
-                    tunnel_headers = {}
-                    proxy_auth_hdr = "Proxy-Authorization"
-                    if proxy_auth_hdr in headers:
-                        tunnel_headers[proxy_auth_hdr] = headers[proxy_auth_hdr]
-                        # Proxy-Authorization should not be sent to origin
-                        # server.
-                        del headers[proxy_auth_hdr]
-                    h.set_tunnel(req._tunnel_host, headers=tunnel_headers)
-
-                try:
-                    h.request(req.get_method(), req.selector, req.data, headers)
-                except socket.error as err: # XXX what error?
-                    # Don't close connection when cache is enabled.
-                    # Instead, try to detect connections that are no longer
-                    # usable (for example, closed unexpectedly) and remove
-                    # them from the cache.
-                    if fetch.connection_cache is None:
-                        h.close()
-                    elif isinstance(err, OSError) and err.errno == errno.EBADF:
-                        # This happens when the server closes the connection despite the Keep-Alive.
-                        # Apparently urllib then uses the file descriptor, expecting it to be
-                        # connected, when in reality the connection is already gone.
-                        # We let the request fail and expect it to be
-                        # tried once more ("try_again" in check_status()),
-                        # with the dead connection removed from the cache.
-                        # If it still fails, we give up, which can happend for bad
-                        # HTTP proxy settings.
-                        fetch.connection_cache.remove_connection(h.host, h.port)
-                    raise urllib.error.URLError(err)
-                else:
-                    try:
-                        r = h.getresponse(buffering=True)
-                    except TypeError: # buffering kw not supported
-                        r = h.getresponse()
-
-                # Pick apart the HTTPResponse object to get the addinfourl
-                # object initialized properly.
-
-                # Wrap the HTTPResponse object in socket's file object adapter
-                # for Windows.  That adapter calls recv(), so delegate recv()
-                # to read().  This weird wrapping allows the returned object to
-                # have readline() and readlines() methods.
-
-                # XXX It might be better to extract the read buffering code
-                # out of socket._fileobject() and into a base class.
-                r.recv = r.read
-
-                # no data, just have to read
-                r.read()
-                class fp_dummy(object):
-                    def read(self):
-                        return ""
-                    def readline(self):
-                        return ""
-                    def close(self):
-                        pass
-                    closed = False
-
-                resp = urllib.response.addinfourl(fp_dummy(), r.msg, req.get_full_url())
-                resp.code = r.status
-                resp.msg = r.reason
-
-                # Close connection when server request it.
-                if fetch.connection_cache is not None:
-                    if 'Connection' in r.msg and r.msg['Connection'] == 'close':
-                        fetch.connection_cache.remove_connection(h.host, h.port)
-
-                return resp
-
-        class HTTPMethodFallback(urllib.request.BaseHandler):
-            """
-            Fallback to GET if HEAD is not allowed (405 HTTP error)
-            """
-            def http_error_405(self, req, fp, code, msg, headers):
-                fp.read()
-                fp.close()
-
-                newheaders = dict((k, v) for k, v in list(req.headers.items())
-                                  if k.lower() not in ("content-length", "content-type"))
-                return self.parent.open(urllib.request.Request(req.get_full_url(),
-                                                        headers=newheaders,
-                                                        origin_req_host=req.origin_req_host,
-                                                        unverifiable=True))
-
-
-            # Some servers (e.g. GitHub archives, hosted on Amazon S3) return 403
-            # Forbidden when they actually mean 405 Method Not Allowed.
-            http_error_403 = http_error_405
-
-
-        class FixedHTTPRedirectHandler(urllib.request.HTTPRedirectHandler):
-            """
-            urllib2.HTTPRedirectHandler resets the method to GET on redirect,
-            when we want to follow redirects using the original method.
-            """
-            def redirect_request(self, req, fp, code, msg, headers, newurl):
-                newreq = urllib.request.HTTPRedirectHandler.redirect_request(self, req, fp, code, msg, headers, newurl)
-                newreq.get_method = req.get_method
-                return newreq
-        exported_proxies = export_proxies(d)
-
-        handlers = [FixedHTTPRedirectHandler, HTTPMethodFallback]
-        if exported_proxies:
-            handlers.append(urllib.request.ProxyHandler())
-        handlers.append(CacheHTTPHandler())
-        # Since Python 2.7.9 ssl cert validation is enabled by default
-        # see PEP-0476, this causes verification errors on some https servers
-        # so disable by default.
-        import ssl
-        if hasattr(ssl, '_create_unverified_context'):
-            handlers.append(urllib.request.HTTPSHandler(context=ssl._create_unverified_context()))
-        opener = urllib.request.build_opener(*handlers)
-
-        try:
-            uri = ud.url.split(";")[0]
-            r = urllib.request.Request(uri)
-            r.get_method = lambda: "HEAD"
-            # Some servers (FusionForge, as used on Alioth) require that the
-            # optional Accept header is set.
-            r.add_header("Accept", "*/*")
-            def add_basic_auth(login_str, request):
-                '''Adds Basic auth to http request, pass in login:password as string'''
-                import base64
-                encodeuser = base64.b64encode(login_str.encode('utf-8')).decode("utf-8")
-                authheader = "Basic %s" % encodeuser
-                r.add_header("Authorization", authheader)
-
-            if ud.user and ud.pswd:
-                add_basic_auth(ud.user + ':' + ud.pswd, r)
-
-            try:
-                import netrc
-                n = netrc.netrc()
-                login, unused, password = n.authenticators(urllib.parse.urlparse(uri).hostname)
-                add_basic_auth("%s:%s" % (login, password), r)
-            except (TypeError, ImportError, IOError, netrc.NetrcParseError):
-                pass
-
-            with opener.open(r) as response:
-                pass
-        except urllib.error.URLError as e:
-            if try_again:
-                logger.debug(2, "checkstatus: trying again")
-                return self.checkstatus(fetch, ud, d, False)
-            else:
-                # debug for now to avoid spamming the logs in e.g. remote sstate searches
-                logger.debug(2, "checkstatus() urlopen failed: %s" % e)
-                return False
         return True
-
-    def _parse_path(self, regex, s):
-        """
-        Find and group name, version and archive type in the given string s
-        """
-
-        m = regex.search(s)
-        if m:
-            pname = ''
-            pver = ''
-            ptype = ''
-
-            mdict = m.groupdict()
-            if 'name' in mdict.keys():
-                pname = mdict['name']
-            if 'pver' in mdict.keys():
-                pver = mdict['pver']
-            if 'type' in mdict.keys():
-                ptype = mdict['type']
-
-            bb.debug(3, "_parse_path: %s, %s, %s" % (pname, pver, ptype))
-
-            return (pname, pver, ptype)
-
-        return None
-
-    def _modelate_version(self, version):
-        if version[0] in ['.', '-']:
-            if version[1].isdigit():
-                version = version[1] + version[0] + version[2:len(version)]
-            else:
-                version = version[1:len(version)]
-
-        version = re.sub('-', '.', version)
-        version = re.sub('_', '.', version)
-        version = re.sub('(rc)+', '.1000.', version)
-        version = re.sub('(beta)+', '.100.', version)
-        version = re.sub('(alpha)+', '.10.', version)
-        if version[0] == 'v':
-            version = version[1:len(version)]
-        return version
-
-    def _vercmp(self, old, new):
-        """
-        Check whether 'new' is newer than 'old' version. We use existing vercmp() for the
-        purpose. PE is cleared in comparison as it's not for build, and PR is cleared too
-        for simplicity as it's somehow difficult to get from various upstream format
-        """
-
-        (oldpn, oldpv, oldsuffix) = old
-        (newpn, newpv, newsuffix) = new
-
-        # Check for a new suffix type that we have never heard of before
-        if newsuffix:
-            m = self.suffix_regex_comp.search(newsuffix)
-            if not m:
-                bb.warn("%s has a possible unknown suffix: %s" % (newpn, newsuffix))
-                return False
-
-        # Not our package so ignore it
-        if oldpn != newpn:
-            return False
-
-        oldpv = self._modelate_version(oldpv)
-        newpv = self._modelate_version(newpv)
-
-        return bb.utils.vercmp(("0", oldpv, ""), ("0", newpv, ""))
-
-    def _fetch_index(self, uri, ud, d):
-        """
-        Run fetch checkstatus to get directory information
-        """
-        f = tempfile.NamedTemporaryFile()
-        with tempfile.TemporaryDirectory(prefix="wget-index-") as workdir, tempfile.NamedTemporaryFile(dir=workdir, prefix="wget-listing-") as f:
-            agent = "Mozilla/5.0 (X11; U; Linux i686; en-US; rv:1.9.2.12) Gecko/20101027 Ubuntu/9.10 (karmic) Firefox/3.6.12"
-            fetchcmd = self.basecmd
-            fetchcmd += " -O " + f.name + " --user-agent='" + agent + "' '" + uri + "'"
-            try:
-                self._runwget(ud, d, fetchcmd, True, workdir=workdir)
-                fetchresult = f.read()
-            except bb.fetch2.BBFetchException:
-                fetchresult = ""
-
-        return fetchresult
-
-    def _check_latest_version(self, url, package, package_regex, current_version, ud, d):
-        """
-        Return the latest version of a package inside a given directory path
-        If error or no version, return ""
-        """
-        valid = 0
-        version = ['', '', '']
-
-        bb.debug(3, "VersionURL: %s" % (url))
-        soup = BeautifulSoup(self._fetch_index(url, ud, d), "html.parser", parse_only=SoupStrainer("a"))
-        if not soup:
-            bb.debug(3, "*** %s NO SOUP" % (url))
-            return ""
-
-        for line in soup.find_all('a', href=True):
-            bb.debug(3, "line['href'] = '%s'" % (line['href']))
-            bb.debug(3, "line = '%s'" % (str(line)))
-
-            newver = self._parse_path(package_regex, line['href'])
-            if not newver:
-                newver = self._parse_path(package_regex, str(line))
-
-            if newver:
-                bb.debug(3, "Upstream version found: %s" % newver[1])
-                if valid == 0:
-                    version = newver
-                    valid = 1
-                elif self._vercmp(version, newver) < 0:
-                    version = newver
-                
-        pupver = re.sub('_', '.', version[1])
-
-        bb.debug(3, "*** %s -> UpstreamVersion = %s (CurrentVersion = %s)" %
-                (package, pupver or "N/A", current_version[1]))
-
-        if valid:
-            return pupver
-
-        return ""
-
-    def _check_latest_version_by_dir(self, dirver, package, package_regex, current_version, ud, d):
-        """
-        Scan every directory in order to get upstream version.
-        """
-        version_dir = ['', '', '']
-        version = ['', '', '']
-
-        dirver_regex = re.compile(r"(?P<pfx>\D*)(?P<ver>(\d+[\.\-_])+(\d+))")
-        s = dirver_regex.search(dirver)
-        if s:
-            version_dir[1] = s.group('ver')
-        else:
-            version_dir[1] = dirver
-
-        dirs_uri = bb.fetch.encodeurl([ud.type, ud.host,
-                ud.path.split(dirver)[0], ud.user, ud.pswd, {}])
-        bb.debug(3, "DirURL: %s, %s" % (dirs_uri, package))
-
-        soup = BeautifulSoup(self._fetch_index(dirs_uri, ud, d), "html.parser", parse_only=SoupStrainer("a"))
-        if not soup:
-            return version[1]
-
-        for line in soup.find_all('a', href=True):
-            s = dirver_regex.search(line['href'].strip("/"))
-            if s:
-                sver = s.group('ver')
-
-                # When prefix is part of the version directory it need to
-                # ensure that only version directory is used so remove previous
-                # directories if exists.
-                #
-                # Example: pfx = '/dir1/dir2/v' and version = '2.5' the expected
-                # result is v2.5.
-                spfx = s.group('pfx').split('/')[-1]
-
-                version_dir_new = ['', sver, '']
-                if self._vercmp(version_dir, version_dir_new) <= 0:
-                    dirver_new = spfx + sver
-                    path = ud.path.replace(dirver, dirver_new, True) \
-                        .split(package)[0]
-                    uri = bb.fetch.encodeurl([ud.type, ud.host, path,
-                        ud.user, ud.pswd, {}])
-
-                    pupver = self._check_latest_version(uri,
-                            package, package_regex, current_version, ud, d)
-                    if pupver:
-                        version[1] = pupver
-
-                    version_dir = version_dir_new
-
-        return version[1]
-
-    def _init_regexes(self, package, ud, d):
-        """
-        Match as many patterns as possible such as:
-                gnome-common-2.20.0.tar.gz (most common format)
-                gtk+-2.90.1.tar.gz
-                xf86-input-synaptics-12.6.9.tar.gz
-                dri2proto-2.3.tar.gz
-                blktool_4.orig.tar.gz
-                libid3tag-0.15.1b.tar.gz
-                unzip552.tar.gz
-                icu4c-3_6-src.tgz
-                genext2fs_1.3.orig.tar.gz
-                gst-fluendo-mp3
-        """
-        # match most patterns which uses "-" as separator to version digits
-        pn_prefix1 = r"[a-zA-Z][a-zA-Z0-9]*([-_][a-zA-Z]\w+)*\+?[-_]"
-        # a loose pattern such as for unzip552.tar.gz
-        pn_prefix2 = r"[a-zA-Z]+"
-        # a loose pattern such as for 80325-quicky-0.4.tar.gz
-        pn_prefix3 = r"[0-9]+[-]?[a-zA-Z]+"
-        # Save the Package Name (pn) Regex for use later
-        pn_regex = r"(%s|%s|%s)" % (pn_prefix1, pn_prefix2, pn_prefix3)
-
-        # match version
-        pver_regex = r"(([A-Z]*\d+[a-zA-Z]*[\.\-_]*)+)"
-
-        # match arch
-        parch_regex = "-source|_all_"
-
-        # src.rpm extension was added only for rpm package. Can be removed if the rpm
-        # packaged will always be considered as having to be manually upgraded
-        psuffix_regex = r"(tar\.gz|tgz|tar\.bz2|zip|xz|tar\.lz|rpm|bz2|orig\.tar\.gz|tar\.xz|src\.tar\.gz|src\.tgz|svnr\d+\.tar\.bz2|stable\.tar\.gz|src\.rpm)"
-
-        # match name, version and archive type of a package
-        package_regex_comp = re.compile(r"(?P<name>%s?\.?v?)(?P<pver>%s)(?P<arch>%s)?[\.-](?P<type>%s$)"
-                                                    % (pn_regex, pver_regex, parch_regex, psuffix_regex))
-        self.suffix_regex_comp = re.compile(psuffix_regex)
-
-        # compile regex, can be specific by package or generic regex
-        pn_regex = d.getVar('UPSTREAM_CHECK_REGEX')
-        if pn_regex:
-            package_custom_regex_comp = re.compile(pn_regex)
-        else:
-            version = self._parse_path(package_regex_comp, package)
-            if version:
-                package_custom_regex_comp = re.compile(
-                    r"(?P<name>%s)(?P<pver>%s)(?P<arch>%s)?[\.-](?P<type>%s)" %
-                    (re.escape(version[0]), pver_regex, parch_regex, psuffix_regex))
-            else:
-                package_custom_regex_comp = None
-
-        return package_custom_regex_comp
-
-    def latest_versionstring(self, ud, d):
-        """
-        Manipulate the URL and try to obtain the latest package version
-
-        sanity check to ensure same name and type.
-        """
-        package = ud.path.split("/")[-1]
-        current_version = ['', d.getVar('PV'), '']
-
-        """possible to have no version in pkg name, such as spectrum-fw"""
-        if not re.search(r"\d+", package):
-            current_version[1] = re.sub('_', '.', current_version[1])
-            current_version[1] = re.sub('-', '.', current_version[1])
-            return (current_version[1], '')
-
-        package_regex = self._init_regexes(package, ud, d)
-        if package_regex is None:
-            bb.warn("latest_versionstring: package %s don't match pattern" % (package))
-            return ('', '')
-        bb.debug(3, "latest_versionstring, regex: %s" % (package_regex.pattern))
-
-        uri = ""
-        regex_uri = d.getVar("UPSTREAM_CHECK_URI")
-        if not regex_uri:
-            path = ud.path.split(package)[0]
-
-            # search for version matches on folders inside the path, like:
-            # "5.7" in http://download.gnome.org/sources/${PN}/5.7/${PN}-${PV}.tar.gz
-            dirver_regex = re.compile(r"(?P<dirver>[^/]*(\d+\.)*\d+([-_]r\d+)*)/")
-            m = dirver_regex.search(path)
-            if m:
-                pn = d.getVar('PN')
-                dirver = m.group('dirver')
-
-                dirver_pn_regex = re.compile(r"%s\d?" % (re.escape(pn)))
-                if not dirver_pn_regex.search(dirver):
-                    return (self._check_latest_version_by_dir(dirver,
-                        package, package_regex, current_version, ud, d), '')
-
-            uri = bb.fetch.encodeurl([ud.type, ud.host, path, ud.user, ud.pswd, {}])
-        else:
-            uri = regex_uri
-
-        return (self._check_latest_version(uri, package, package_regex,
-                current_version, ud, d), '')

bitbake/lib/bb/main.py

@@ -1,510 +0,0 @@
-#!/usr/bin/env python
-# ex:ts=4:sw=4:sts=4:et
-# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
-#
-# Copyright (C) 2003, 2004  Chris Larson
-# Copyright (C) 2003, 2004  Phil Blundell
-# Copyright (C) 2003 - 2005 Michael 'Mickey' Lauer
-# Copyright (C) 2005        Holger Hans Peter Freyther
-# Copyright (C) 2005        ROAD GmbH
-# Copyright (C) 2006        Richard Purdie
-#
-# This program is free software; you can redistribute it and/or modify
-# it under the terms of the GNU General Public License version 2 as
-# published by the Free Software Foundation.
-#
-# This program is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-# GNU General Public License for more details.
-#
-# You should have received a copy of the GNU General Public License along
-# with this program; if not, write to the Free Software Foundation, Inc.,
-# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
-import os
-import sys
-import logging
-import optparse
-import warnings
-import fcntl
-import time
-import traceback
-
-import bb
-from bb import event
-import bb.msg
-from bb import cooker
-from bb import ui
-from bb import server
-from bb import cookerdata
-
-import bb.server.process
-import bb.server.xmlrpcclient
-
-logger = logging.getLogger("BitBake")
-
-class BBMainException(Exception):
-    pass
-
-class BBMainFatal(bb.BBHandledException):
-    pass
-
-def present_options(optionlist):
-    if len(optionlist) > 1:
-        return ' or '.join([', '.join(optionlist[:-1]), optionlist[-1]])
-    else:
-        return optionlist[0]
-
-class BitbakeHelpFormatter(optparse.IndentedHelpFormatter):
-    def format_option(self, option):
-        # We need to do this here rather than in the text we supply to
-        # add_option() because we don't want to call list_extension_modules()
-        # on every execution (since it imports all of the modules)
-        # Note also that we modify option.help rather than the returned text
-        # - this is so that we don't have to re-format the text ourselves
-        if option.dest == 'ui':
-            valid_uis = list_extension_modules(bb.ui, 'main')
-            option.help = option.help.replace('@CHOICES@', present_options(valid_uis))
-
-        return optparse.IndentedHelpFormatter.format_option(self, option)
-
-def list_extension_modules(pkg, checkattr):
-    """
-    Lists extension modules in a specific Python package
-    (e.g. UIs, servers). NOTE: Calling this function will import all of the
-    submodules of the specified module in order to check for the specified
-    attribute; this can have unusual side-effects. As a result, this should
-    only be called when displaying help text or error messages.
-    Parameters:
-        pkg: previously imported Python package to list
-        checkattr: attribute to look for in module to determine if it's valid
-            as the type of extension you are looking for
-    """
-    import pkgutil
-    pkgdir = os.path.dirname(pkg.__file__)
-
-    modules = []
-    for _, modulename, _ in pkgutil.iter_modules([pkgdir]):
-        if os.path.isdir(os.path.join(pkgdir, modulename)):
-            # ignore directories
-            continue
-        try:
-            module = __import__(pkg.__name__, fromlist=[modulename])
-        except:
-            # If we can't import it, it's not valid
-            continue
-        module_if = getattr(module, modulename)
-        if getattr(module_if, 'hidden_extension', False):
-            continue
-        if not checkattr or hasattr(module_if, checkattr):
-            modules.append(modulename)
-    return modules
-
-def import_extension_module(pkg, modulename, checkattr):
-    try:
-        # Dynamically load the UI based on the ui name. Although we
-        # suggest a fixed set this allows you to have flexibility in which
-        # ones are available.
-        module = __import__(pkg.__name__, fromlist=[modulename])
-        return getattr(module, modulename)
-    except AttributeError:
-        modules = present_options(list_extension_modules(pkg, checkattr))
-        raise BBMainException('FATAL: Unable to import extension module "%s" from %s. '
-                              'Valid extension modules: %s' % (modulename, pkg.__name__, modules))
-
-# Display bitbake/OE warnings via the BitBake.Warnings logger, ignoring others"""
-warnlog = logging.getLogger("BitBake.Warnings")
-_warnings_showwarning = warnings.showwarning
-def _showwarning(message, category, filename, lineno, file=None, line=None):
-    if file is not None:
-        if _warnings_showwarning is not None:
-            _warnings_showwarning(message, category, filename, lineno, file, line)
-    else:
-        s = warnings.formatwarning(message, category, filename, lineno)
-        warnlog.warning(s)
-
-warnings.showwarning = _showwarning
-warnings.filterwarnings("ignore")
-warnings.filterwarnings("default", module="(<string>$|(oe|bb)\.)")
-warnings.filterwarnings("ignore", category=PendingDeprecationWarning)
-warnings.filterwarnings("ignore", category=ImportWarning)
-warnings.filterwarnings("ignore", category=DeprecationWarning, module="<string>$")
-warnings.filterwarnings("ignore", message="With-statements now directly support multiple context managers")
-
-class BitBakeConfigParameters(cookerdata.ConfigParameters):
-
-    def parseCommandLine(self, argv=sys.argv):
-        parser = optparse.OptionParser(
-            formatter=BitbakeHelpFormatter(),
-            version="BitBake Build Tool Core version %s" % bb.__version__,
-            usage="""%prog [options] [recipename/target recipe:do_task ...]
-
-    Executes the specified task (default is 'build') for a given set of target recipes (.bb files).
-    It is assumed there is a conf/bblayers.conf available in cwd or in BBPATH which
-    will provide the layer, BBFILES and other configuration information.""")
-
-        parser.add_option("-b", "--buildfile", action="store", dest="buildfile", default=None,
-                          help="Execute tasks from a specific .bb recipe directly. WARNING: Does "
-                               "not handle any dependencies from other recipes.")
-
-        parser.add_option("-k", "--continue", action="store_false", dest="abort", default=True,
-                          help="Continue as much as possible after an error. While the target that "
-                               "failed and anything depending on it cannot be built, as much as "
-                               "possible will be built before stopping.")
-
-        parser.add_option("-f", "--force", action="store_true", dest="force", default=False,
-                          help="Force the specified targets/task to run (invalidating any "
-                               "existing stamp file).")
-
-        parser.add_option("-c", "--cmd", action="store", dest="cmd",
-                          help="Specify the task to execute. The exact options available "
-                               "depend on the metadata. Some examples might be 'compile'"
-                               " or 'populate_sysroot' or 'listtasks' may give a list of "
-                               "the tasks available.")
-
-        parser.add_option("-C", "--clear-stamp", action="store", dest="invalidate_stamp",
-                          help="Invalidate the stamp for the specified task such as 'compile' "
-                               "and then run the default task for the specified target(s).")
-
-        parser.add_option("-r", "--read", action="append", dest="prefile", default=[],
-                          help="Read the specified file before bitbake.conf.")
-
-        parser.add_option("-R", "--postread", action="append", dest="postfile", default=[],
-                          help="Read the specified file after bitbake.conf.")
-
-        parser.add_option("-v", "--verbose", action="store_true", dest="verbose", default=False,
-                          help="Enable tracing of shell tasks (with 'set -x'). "
-                               "Also print bb.note(...) messages to stdout (in "
-                               "addition to writing them to ${T}/log.do_<task>).")
-
-        parser.add_option("-D", "--debug", action="count", dest="debug", default=0,
-                          help="Increase the debug level. You can specify this "
-                               "more than once. -D sets the debug level to 1, "
-                               "where only bb.debug(1, ...) messages are printed "
-                               "to stdout; -DD sets the debug level to 2, where "
-                               "both bb.debug(1, ...) and bb.debug(2, ...) "
-                               "messages are printed; etc. Without -D, no debug "
-                               "messages are printed. Note that -D only affects "
-                               "output to stdout. All debug messages are written "
-                               "to ${T}/log.do_taskname, regardless of the debug "
-                               "level.")
-
-        parser.add_option("-q", "--quiet", action="count", dest="quiet", default=0,
-                          help="Output less log message data to the terminal. You can specify this more than once.")
-
-        parser.add_option("-n", "--dry-run", action="store_true", dest="dry_run", default=False,
-                          help="Don't execute, just go through the motions.")
-
-        parser.add_option("-S", "--dump-signatures", action="append", dest="dump_signatures",
-                          default=[], metavar="SIGNATURE_HANDLER",
-                          help="Dump out the signature construction information, with no task "
-                               "execution. The SIGNATURE_HANDLER parameter is passed to the "
-                               "handler. Two common values are none and printdiff but the handler "
-                               "may define more/less. none means only dump the signature, printdiff"
-                               " means compare the dumped signature with the cached one.")
-
-        parser.add_option("-p", "--parse-only", action="store_true",
-                          dest="parse_only", default=False,
-                          help="Quit after parsing the BB recipes.")
-
-        parser.add_option("-s", "--show-versions", action="store_true",
-                          dest="show_versions", default=False,
-                          help="Show current and preferred versions of all recipes.")
-
-        parser.add_option("-e", "--environment", action="store_true",
-                          dest="show_environment", default=False,
-                          help="Show the global or per-recipe environment complete with information"
-                               " about where variables were set/changed.")
-
-        parser.add_option("-g", "--graphviz", action="store_true", dest="dot_graph", default=False,
-                          help="Save dependency tree information for the specified "
-                               "targets in the dot syntax.")
-
-        parser.add_option("-I", "--ignore-deps", action="append",
-                          dest="extra_assume_provided", default=[],
-                          help="Assume these dependencies don't exist and are already provided "
-                               "(equivalent to ASSUME_PROVIDED). Useful to make dependency "
-                               "graphs more appealing")
-
-        parser.add_option("-l", "--log-domains", action="append", dest="debug_domains", default=[],
-                          help="Show debug logging for the specified logging domains")
-
-        parser.add_option("-P", "--profile", action="store_true", dest="profile", default=False,
-                          help="Profile the command and save reports.")
-
-        # @CHOICES@ is substituted out by BitbakeHelpFormatter above
-        parser.add_option("-u", "--ui", action="store", dest="ui",
-                          default=os.environ.get('BITBAKE_UI', 'knotty'),
-                          help="The user interface to use (@CHOICES@ - default %default).")
-
-        parser.add_option("", "--token", action="store", dest="xmlrpctoken",
-                          default=os.environ.get("BBTOKEN"),
-                          help="Specify the connection token to be used when connecting "
-                               "to a remote server.")
-
-        parser.add_option("", "--revisions-changed", action="store_true",
-                          dest="revisions_changed", default=False,
-                          help="Set the exit code depending on whether upstream floating "
-                               "revisions have changed or not.")
-
-        parser.add_option("", "--server-only", action="store_true",
-                          dest="server_only", default=False,
-                          help="Run bitbake without a UI, only starting a server "
-                               "(cooker) process.")
-
-        parser.add_option("-B", "--bind", action="store", dest="bind", default=False,
-                          help="The name/address for the bitbake xmlrpc server to bind to.")
-
-        parser.add_option("-T", "--idle-timeout", type=float, dest="server_timeout",
-                          default=os.getenv("BB_SERVER_TIMEOUT"),
-                          help="Set timeout to unload bitbake server due to inactivity, "
-                                "set to -1 means no unload, "
-                                "default: Environment variable BB_SERVER_TIMEOUT.")
-
-        parser.add_option("", "--no-setscene", action="store_true",
-                          dest="nosetscene", default=False,
-                          help="Do not run any setscene tasks. sstate will be ignored and "
-                               "everything needed, built.")
-
-        parser.add_option("", "--setscene-only", action="store_true",
-                          dest="setsceneonly", default=False,
-                          help="Only run setscene tasks, don't run any real tasks.")
-
-        parser.add_option("", "--remote-server", action="store", dest="remote_server",
-                          default=os.environ.get("BBSERVER"),
-                          help="Connect to the specified server.")
-
-        parser.add_option("-m", "--kill-server", action="store_true",
-                          dest="kill_server", default=False,
-                          help="Terminate any running bitbake server.")
-
-        parser.add_option("", "--observe-only", action="store_true",
-                          dest="observe_only", default=False,
-                          help="Connect to a server as an observing-only client.")
-
-        parser.add_option("", "--status-only", action="store_true",
-                          dest="status_only", default=False,
-                          help="Check the status of the remote bitbake server.")
-
-        parser.add_option("-w", "--write-log", action="store", dest="writeeventlog",
-                          default=os.environ.get("BBEVENTLOG"),
-                          help="Writes the event log of the build to a bitbake event json file. "
-                               "Use '' (empty string) to assign the name automatically.")
-
-        parser.add_option("", "--runall", action="append", dest="runall",
-                          help="Run the specified task for any recipe in the taskgraph of the specified target (even if it wouldn't otherwise have run).")
-
-        parser.add_option("", "--runonly", action="append", dest="runonly",
-                          help="Run only the specified task within the taskgraph of the specified targets (and any task dependencies those tasks may have).")
-
-
-        options, targets = parser.parse_args(argv)
-
-        if options.quiet and options.verbose:
-            parser.error("options --quiet and --verbose are mutually exclusive")
-
-        if options.quiet and options.debug:
-            parser.error("options --quiet and --debug are mutually exclusive")
-
-        # use configuration files from environment variables
-        if "BBPRECONF" in os.environ:
-            options.prefile.append(os.environ["BBPRECONF"])
-
-        if "BBPOSTCONF" in os.environ:
-            options.postfile.append(os.environ["BBPOSTCONF"])
-
-        # fill in proper log name if not supplied
-        if options.writeeventlog is not None and len(options.writeeventlog) == 0:
-            from datetime import datetime
-            eventlog = "bitbake_eventlog_%s.json" % datetime.now().strftime("%Y%m%d%H%M%S")
-            options.writeeventlog = eventlog
-
-        if options.bind:
-            try:
-                #Checking that the port is a number and is a ':' delimited value
-                (host, port) = options.bind.split(':')
-                port = int(port)
-            except (ValueError,IndexError):
-                raise BBMainException("FATAL: Malformed host:port bind parameter")
-            options.xmlrpcinterface = (host, port)
-        else:
-            options.xmlrpcinterface = (None, 0)
-
-        return options, targets[1:]
-
-
-def bitbake_main(configParams, configuration):
-
-    # Python multiprocessing requires /dev/shm on Linux
-    if sys.platform.startswith('linux') and not os.access('/dev/shm', os.W_OK | os.X_OK):
-        raise BBMainException("FATAL: /dev/shm does not exist or is not writable")
-
-    # Unbuffer stdout to avoid log truncation in the event
-    # of an unorderly exit as well as to provide timely
-    # updates to log files for use with tail
-    try:
-        if sys.stdout.name == '<stdout>':
-            # Reopen with O_SYNC (unbuffered)
-            fl = fcntl.fcntl(sys.stdout.fileno(), fcntl.F_GETFL)
-            fl |= os.O_SYNC
-            fcntl.fcntl(sys.stdout.fileno(), fcntl.F_SETFL, fl)
-    except:
-        pass
-
-    configuration.setConfigParameters(configParams)
-
-    if configParams.server_only and configParams.remote_server:
-            raise BBMainException("FATAL: The '--server-only' option conflicts with %s.\n" %
-                                  ("the BBSERVER environment variable" if "BBSERVER" in os.environ \
-                                   else "the '--remote-server' option"))
-
-    if configParams.observe_only and not (configParams.remote_server or configParams.bind):
-        raise BBMainException("FATAL: '--observe-only' can only be used by UI clients "
-                              "connecting to a server.\n")
-
-    if "BBDEBUG" in os.environ:
-        level = int(os.environ["BBDEBUG"])
-        if level > configuration.debug:
-            configuration.debug = level
-
-    bb.msg.init_msgconfig(configParams.verbose, configuration.debug,
-                          configuration.debug_domains)
-
-    server_connection, ui_module = setup_bitbake(configParams, configuration)
-    # No server connection
-    if server_connection is None:
-        if configParams.status_only:
-            return 1
-        if configParams.kill_server:
-            return 0
-
-    if not configParams.server_only:
-        if configParams.status_only:
-            server_connection.terminate()
-            return 0
-
-        try:
-            for event in bb.event.ui_queue:
-                server_connection.events.queue_event(event)
-            bb.event.ui_queue = []
-
-            return ui_module.main(server_connection.connection, server_connection.events,
-                                  configParams)
-        finally:
-            server_connection.terminate()
-    else:
-        return 0
-
-    return 1
-
-def setup_bitbake(configParams, configuration, extrafeatures=None):
-    # Ensure logging messages get sent to the UI as events
-    handler = bb.event.LogHandler()
-    if not configParams.status_only:
-        # In status only mode there are no logs and no UI
-        logger.addHandler(handler)
-
-    if configParams.server_only:
-        featureset = []
-        ui_module = None
-    else:
-        ui_module = import_extension_module(bb.ui, configParams.ui, 'main')
-        # Collect the feature set for the UI
-        featureset = getattr(ui_module, "featureSet", [])
-
-    if extrafeatures:
-        for feature in extrafeatures:
-            if not feature in featureset:
-                featureset.append(feature)
-
-    server_connection = None
-
-    # Clear away any spurious environment variables while we stoke up the cooker
-    # (done after import_extension_module() above since for example import gi triggers env var usage)
-    cleanedvars = bb.utils.clean_environment()
-
-    if configParams.remote_server:
-        # Connect to a remote XMLRPC server
-        server_connection = bb.server.xmlrpcclient.connectXMLRPC(configParams.remote_server, featureset,
-                                                                 configParams.observe_only, configParams.xmlrpctoken)
-    else:
-        retries = 8
-        while retries:
-            try:
-                topdir, lock = lockBitbake()
-                sockname = topdir + "/bitbake.sock"
-                if lock:
-                    if configParams.status_only or configParams.kill_server:
-                        logger.info("bitbake server is not running.")
-                        lock.close()
-                        return None, None
-                    # we start a server with a given configuration
-                    logger.info("Starting bitbake server...")
-                    # Clear the event queue since we already displayed messages
-                    bb.event.ui_queue = []
-                    server = bb.server.process.BitBakeServer(lock, sockname, configuration, featureset)
-
-                else:
-                    logger.info("Reconnecting to bitbake server...")
-                    if not os.path.exists(sockname):
-                        logger.info("Previous bitbake instance shutting down?, waiting to retry...")
-                        i = 0
-                        lock = None
-                        # Wait for 5s or until we can get the lock
-                        while not lock and i < 50:
-                            time.sleep(0.1)
-                            _, lock = lockBitbake()
-                            i += 1
-                        if lock:
-                            bb.utils.unlockfile(lock)
-                        raise bb.server.process.ProcessTimeout("Bitbake still shutting down as socket exists but no lock?")
-                if not configParams.server_only:
-                    try:
-                        server_connection = bb.server.process.connectProcessServer(sockname, featureset)
-                    except EOFError:
-                        # The server may have been shutting down but not closed the socket yet. If that happened,
-                        # ignore it.
-                        pass
-
-                if server_connection or configParams.server_only:
-                    break
-            except BBMainFatal:
-                raise
-            except (Exception, bb.server.process.ProcessTimeout) as e:
-                if not retries:
-                    raise
-                retries -= 1
-                tryno = 8 - retries
-                if isinstance(e, (bb.server.process.ProcessTimeout, BrokenPipeError)):
-                    logger.info("Retrying server connection (#%d)..." % tryno)
-                else:
-                    logger.info("Retrying server connection (#%d)... (%s)" % (tryno, traceback.format_exc()))
-            if not retries:
-                bb.fatal("Unable to connect to bitbake server, or start one")
-            if retries < 5:
-                time.sleep(5)
-
-    if configParams.kill_server:
-        server_connection.connection.terminateServer()
-        server_connection.terminate()
-        bb.event.ui_queue = []
-        logger.info("Terminated bitbake server.")
-        return None, None
-
-    # Restore the environment in case the UI needs it
-    for k in cleanedvars:
-        os.environ[k] = cleanedvars[k]
-
-    logger.removeHandler(handler)
-
-    return server_connection, ui_module
-
-def lockBitbake():
-    topdir = bb.cookerdata.findTopdir()
-    if not topdir:
-        bb.error("Unable to find conf/bblayers.conf or conf/bitbake.conf. BBAPTH is unset and/or not in a build directory?")
-        raise BBMainFatal
-    lockfile = topdir + "/bitbake.lock"
-    return topdir, bb.utils.lockfile(lockfile, False, False)
-

bitbake/lib/bb/methodpool.py

@@ -19,22 +19,11 @@
 
 from bb.utils import better_compile, better_exec
 
-def insert_method(modulename, code, fn, lineno):
+def insert_method(modulename, code, fn):
     """
     Add code of a module should be added. The methods
     will be simply added, no checking will be done
     """
-    comp = better_compile(code, modulename, fn, lineno=lineno)
+    comp = better_compile(code, modulename, fn )
     better_exec(comp, None, code, fn)
 
-compilecache = {}
-
-def compile_cache(code):
-    h = hash(code)
-    if h in compilecache:
-        return compilecache[h]
-    return None
-
-def compile_cache_add(code, compileobj):
-    h = hash(code)
-    compilecache[h] = compileobj

bitbake/lib/bb/monitordisk.py

@@ -28,16 +28,16 @@ def convertGMK(unit):
 
     """ Convert the space unit G, M, K, the unit is case-insensitive """
 
-    unitG = re.match(r'([1-9][0-9]*)[gG]\s?$', unit)
+    unitG = re.match('([1-9][0-9]*)[gG]\s?$', unit)
     if unitG:
         return int(unitG.group(1)) * (1024 ** 3)
-    unitM = re.match(r'([1-9][0-9]*)[mM]\s?$', unit)
+    unitM = re.match('([1-9][0-9]*)[mM]\s?$', unit)
     if unitM:
         return int(unitM.group(1)) * (1024 ** 2)
-    unitK = re.match(r'([1-9][0-9]*)[kK]\s?$', unit)
+    unitK = re.match('([1-9][0-9]*)[kK]\s?$', unit)
     if unitK:
         return int(unitK.group(1)) * 1024
-    unitN = re.match(r'([1-9][0-9]*)\s?$', unit)
+    unitN = re.match('([1-9][0-9]*)\s?$', unit)
     if unitN:
         return int(unitN.group(1))
     else:
@@ -83,7 +83,7 @@ def getDiskData(BBDirs, configuration):
     for pathSpaceInode in BBDirs.split():
         # The input format is: "dir,space,inode", dir is a must, space
         # and inode are optional
-        pathSpaceInodeRe = re.match(r'([^,]*),([^,]*),([^,]*),?(.*)', pathSpaceInode)
+        pathSpaceInodeRe = re.match('([^,]*),([^,]*),([^,]*),?(.*)', pathSpaceInode)
         if not pathSpaceInodeRe:
             printErr("Invalid value in BB_DISKMON_DIRS: %s" % pathSpaceInode)
             return None
@@ -129,7 +129,7 @@ def getDiskData(BBDirs, configuration):
             bb.utils.mkdirhier(path)
         dev = getMountedDev(path)
         # Use path/action as the key
-        devDict[(path, action)] = [dev, minSpace, minInode]
+        devDict[os.path.join(path, action)] = [dev, minSpace, minInode]
 
     return devDict
 
@@ -141,13 +141,13 @@ def getInterval(configuration):
     spaceDefault = 50 * 1024 * 1024
     inodeDefault = 5 * 1024
 
-    interval = configuration.getVar("BB_DISKMON_WARNINTERVAL")
+    interval = configuration.getVar("BB_DISKMON_WARNINTERVAL", True)
     if not interval:
         return spaceDefault, inodeDefault
     else:
         # The disk space or inode interval is optional, but it should
         # have a correct value once it is specified
-        intervalRe = re.match(r'([^,]*),?\s*(.*)', interval)
+        intervalRe = re.match('([^,]*),?\s*(.*)', interval)
         if intervalRe:
             intervalSpace = intervalRe.group(1)
             if intervalSpace:
@@ -179,7 +179,7 @@ class diskMonitor:
         self.enableMonitor = False
         self.configuration = configuration
 
-        BBDirs = configuration.getVar("BB_DISKMON_DIRS") or None
+        BBDirs = configuration.getVar("BB_DISKMON_DIRS", True) or None
         if BBDirs:
             self.devDict = getDiskData(BBDirs, configuration)
             if self.devDict:
@@ -205,25 +205,22 @@ class diskMonitor:
         """ Take action for the monitor """
 
         if self.enableMonitor:
-            diskUsage = {}
-            for k, attributes in self.devDict.items():
-                path, action = k
-                dev, minSpace, minInode = attributes
+            for k in self.devDict:
+                path = os.path.dirname(k)
+                action = os.path.basename(k)
+                dev = self.devDict[k][0]
+                minSpace = self.devDict[k][1]
+                minInode = self.devDict[k][2]
 
                 st = os.statvfs(path)
 
-                # The available free space, integer number
+                # The free space, float point number
                 freeSpace = st.f_bavail * st.f_frsize
 
-                # Send all relevant information in the event.
-                freeSpaceRoot = st.f_bfree * st.f_frsize
-                totalSpace = st.f_blocks * st.f_frsize
-                diskUsage[dev] = bb.event.DiskUsageSample(freeSpace, freeSpaceRoot, totalSpace)
-
                 if minSpace and freeSpace < minSpace:
                     # Always show warning, the self.checked would always be False if the action is WARN
                     if self.preFreeS[k] == 0 or self.preFreeS[k] - freeSpace > self.spaceInterval and not self.checked[k]:
-                        logger.warning("The free space of %s (%s) is running low (%.3fGB left)" % \
+                        logger.warn("The free space of %s (%s) is running low (%.3fGB left)" % \
                                 (path, dev, freeSpace / 1024 / 1024 / 1024.0))
                         self.preFreeS[k] = freeSpace
 
@@ -238,7 +235,7 @@ class diskMonitor:
                         rq.finish_runqueue(True)
                         bb.event.fire(bb.event.DiskFull(dev, 'disk', freeSpace, path), self.configuration)
 
-                # The free inodes, integer number
+                # The free inodes, float point number
                 freeInode = st.f_favail
 
                 if minInode and freeInode < minInode:
@@ -249,7 +246,7 @@ class diskMonitor:
                         continue
                     # Always show warning, the self.checked would always be False if the action is WARN
                     if self.preFreeI[k] == 0 or self.preFreeI[k] - freeInode > self.inodeInterval and not self.checked[k]:
-                        logger.warning("The free inode of %s (%s) is running low (%.3fK left)" % \
+                        logger.warn("The free inode of %s (%s) is running low (%.3fK left)" % \
                                 (path, dev, freeInode / 1024.0))
                         self.preFreeI[k] = freeInode
 
@@ -263,6 +260,4 @@ class diskMonitor:
                         self.checked[k] = True
                         rq.finish_runqueue(True)
                         bb.event.fire(bb.event.DiskFull(dev, 'inode', freeInode, path), self.configuration)
-
-            bb.event.fire(bb.event.MonitorDiskEvent(diskUsage), self.configuration)
         return

bitbake/lib/bb/msg.py

@@ -40,7 +40,6 @@ class BBLogFormatter(logging.Formatter):
     VERBOSE = logging.INFO - 1
     NOTE = logging.INFO
     PLAIN = logging.INFO + 1
-    VERBNOTE = logging.INFO + 2
     ERROR = logging.ERROR
     WARNING = logging.WARNING
     CRITICAL = logging.CRITICAL
@@ -52,14 +51,13 @@ class BBLogFormatter(logging.Formatter):
         VERBOSE: 'NOTE',
         NOTE    : 'NOTE',
         PLAIN  : '',
-        VERBNOTE: 'NOTE',
         WARNING : 'WARNING',
         ERROR   : 'ERROR',
         CRITICAL: 'ERROR',
     }
 
     color_enabled = False
-    BASECOLOR, BLACK, RED, GREEN, YELLOW, BLUE, MAGENTA, CYAN, WHITE = list(range(29,38))
+    BASECOLOR, BLACK, RED, GREEN, YELLOW, BLUE, MAGENTA, CYAN, WHITE = range(29,38)
 
     COLORS = {
         DEBUG3  : CYAN,
@@ -68,7 +66,6 @@ class BBLogFormatter(logging.Formatter):
         VERBOSE : BASECOLOR,
         NOTE    : BASECOLOR,
         PLAIN   : BASECOLOR,
-        VERBNOTE: BASECOLOR,
         WARNING : YELLOW,
         ERROR   : RED,
         CRITICAL: RED,
@@ -93,9 +90,8 @@ class BBLogFormatter(logging.Formatter):
             if self.color_enabled:
                 record = self.colorize(record)
             msg = logging.Formatter.format(self, record)
-        if hasattr(record, 'bb_exc_formatted'):
-            msg += '\n' + ''.join(record.bb_exc_formatted)
-        elif hasattr(record, 'bb_exc_info'):
+
+        if hasattr(record, 'bb_exc_info'):
             etype, value, tb = record.bb_exc_info
             formatted = bb.exceptions.format_exception(etype, value, tb, limit=5)
             msg += '\n' + ''.join(formatted)
@@ -154,7 +150,7 @@ loggerDefaultVerbose = False
 loggerVerboseLogs = False
 loggerDefaultDomains = []
 
-def init_msgconfig(verbose, debug, debug_domains=None):
+def init_msgconfig(verbose, debug, debug_domains = []):
     """
     Set default verbosity and debug levels config the logger
     """
@@ -162,10 +158,7 @@ def init_msgconfig(verbose, debug, debug_domains=None):
     bb.msg.loggerDefaultVerbose = verbose
     if verbose:
         bb.msg.loggerVerboseLogs = True
-    if debug_domains:
-        bb.msg.loggerDefaultDomains = debug_domains
-    else:
-        bb.msg.loggerDefaultDomains = []
+    bb.msg.loggerDefaultDomains = debug_domains
 
 def constructLogOptions():
     debug = loggerDefaultDebugLevel
@@ -185,12 +178,9 @@ def constructLogOptions():
         debug_domains["BitBake.%s" % domainarg] = logging.DEBUG - dlevel + 1
     return level, debug_domains
 
-def addDefaultlogFilter(handler, cls = BBLogFilter, forcelevel=None):
+def addDefaultlogFilter(handler, cls = BBLogFilter):
     level, debug_domains = constructLogOptions()
 
-    if forcelevel is not None:
-        level = forcelevel
-
     cls(handler, level, debug_domains)
 
 #
@@ -204,25 +194,3 @@ def fatal(msgdomain, msg):
         logger = logging.getLogger("BitBake")
     logger.critical(msg)
     sys.exit(1)
-
-def logger_create(name, output=sys.stderr, level=logging.INFO, preserve_handlers=False, color='auto'):
-    """Standalone logger creation function"""
-    logger = logging.getLogger(name)
-    console = logging.StreamHandler(output)
-    format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
-    if color == 'always' or (color == 'auto' and output.isatty()):
-        format.enable_color()
-    console.setFormatter(format)
-    if preserve_handlers:
-        logger.addHandler(console)
-    else:
-        logger.handlers = [console]
-    logger.setLevel(level)
-    return logger
-
-def has_console_handler(logger):
-    for handler in logger.handlers:
-        if isinstance(handler, logging.StreamHandler):
-            if handler.stream in [sys.stderr, sys.stdout]:
-                return True
-    return False

bitbake/lib/bb/parse/__init__.py

@@ -26,10 +26,9 @@ File parsers for the BitBake build tools.
 
 handlers = []
 
-import errno
-import logging
 import os
 import stat
+import logging
 import bb
 import bb.utils
 import bb.siggen
@@ -71,12 +70,7 @@ def cached_mtime_noerror(f):
     return __mtime_cache[f]
 
 def update_mtime(f):
-    try:
-        __mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
-    except OSError:
-        if f in __mtime_cache:
-            del __mtime_cache[f]
-        return 0
+    __mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
     return __mtime_cache[f]
 
 def update_cache(f):
@@ -84,14 +78,10 @@ def update_cache(f):
         logger.debug(1, "Updating mtime cache for %s" % f)
         update_mtime(f)
 
-def clear_cache():
-    global __mtime_cache
-    __mtime_cache = {}
-
 def mark_dependency(d, f):
     if f.startswith('./'):
         f = "%s/%s" % (os.getcwd(), f[2:])
-    deps = (d.getVar('__depends', False) or [])
+    deps = (d.getVar('__depends') or [])
     s = (f, cached_mtime_noerror(f))
     if s not in deps:
         deps.append(s)
@@ -99,7 +89,7 @@ def mark_dependency(d, f):
 
 def check_dependency(d, f):
     s = (f, cached_mtime_noerror(f))
-    deps = (d.getVar('__depends', False) or [])
+    deps = (d.getVar('__depends') or [])
     return s in deps
    
 def supports(fn, data):
@@ -127,18 +117,17 @@ def init_parser(d):
 
 def resolve_file(fn, d):
     if not os.path.isabs(fn):
-        bbpath = d.getVar("BBPATH")
+        bbpath = d.getVar("BBPATH", True)
         newfn, attempts = bb.utils.which(bbpath, fn, history=True)
         for af in attempts:
             mark_dependency(d, af)
         if not newfn:
-            raise IOError(errno.ENOENT, "file %s not found in %s" % (fn, bbpath))
+            raise IOError("file %s not found in %s" % (fn, bbpath))
         fn = newfn
-    else:
-        mark_dependency(d, fn)
 
+    mark_dependency(d, fn)
     if not os.path.isfile(fn):
-        raise IOError(errno.ENOENT, "file %s not found" % fn)
+        raise IOError("file %s not found" % fn)
 
     return fn
 
@@ -166,8 +155,8 @@ def vars_from_file(mypkg, d):
 def get_file_depends(d):
     '''Return the dependent files'''
     dep_files = []
-    depends = d.getVar('__base_depends', False) or []
-    depends = depends + (d.getVar('__depends', False) or [])
+    depends = d.getVar('__base_depends', True) or []
+    depends = depends + (d.getVar('__depends', True) or [])
     for (fn, _) in depends:
         dep_files.append(os.path.abspath(fn))
     return " ".join(dep_files)

bitbake/lib/bb/parse/ast.py

@@ -21,7 +21,8 @@
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
-
+from __future__ import absolute_import
+from future_builtins import filter
 import re
 import string
 import logging
@@ -30,6 +31,8 @@ import itertools
 from bb import methodpool
 from bb.parse import logger
 
+_bbversions_re = re.compile(r"\[(?P<from>[0-9]+)-(?P<to>[0-9]+)\]")
+
 class StatementGroup(list):
     def eval(self, data):
         for statement in self:
@@ -67,33 +70,6 @@ class ExportNode(AstNode):
     def eval(self, data):
         data.setVarFlag(self.var, "export", 1, op = 'exported')
 
-class UnsetNode(AstNode):
-    def __init__(self, filename, lineno, var):
-        AstNode.__init__(self, filename, lineno)
-        self.var = var
-
-    def eval(self, data):
-        loginfo = {
-            'variable': self.var,
-            'file': self.filename,
-            'line': self.lineno,
-        }
-        data.delVar(self.var,**loginfo)
-
-class UnsetFlagNode(AstNode):
-    def __init__(self, filename, lineno, var, flag):
-        AstNode.__init__(self, filename, lineno)
-        self.var = var
-        self.flag = flag
-
-    def eval(self, data):
-        loginfo = {
-            'variable': self.var,
-            'file': self.filename,
-            'line': self.lineno,
-        }
-        data.delVarFlag(self.var, self.flag, **loginfo)
-
 class DataNode(AstNode):
     """
     Various data related updates. For the sake of sanity
@@ -107,9 +83,9 @@ class DataNode(AstNode):
 
     def getFunc(self, key, data):
         if 'flag' in self.groupd and self.groupd['flag'] != None:
-            return data.getVarFlag(key, self.groupd['flag'], expand=False, noweakdefault=True)
+            return data.getVarFlag(key, self.groupd['flag'], noweakdefault=True)
         else:
-            return data.getVar(key, False, noweakdefault=True, parsing=True)
+            return data.getVar(key, noweakdefault=True)
 
     def eval(self, data):
         groupd = self.groupd
@@ -130,6 +106,7 @@ class DataNode(AstNode):
                 val = groupd["value"]
         elif "colon" in groupd and groupd["colon"] != None:
             e = data.createCopy()
+            bb.data.update_data(e)
             op = "immediate"
             val = e.expand(groupd["value"], key + "[:=]")
         elif "append" in groupd and groupd["append"] != None:
@@ -151,7 +128,7 @@ class DataNode(AstNode):
         if 'flag' in groupd and groupd['flag'] != None:
             flag = groupd['flag']
         elif groupd["lazyques"]:
-            flag = "_defaultval"
+            flag = "defaultval"
 
         loginfo['op'] = op
         loginfo['detail'] = groupd["value"]
@@ -159,42 +136,29 @@ class DataNode(AstNode):
         if flag:
             data.setVarFlag(key, flag, val, **loginfo)
         else:
-            data.setVar(key, val, parsing=True, **loginfo)
+            data.setVar(key, val, **loginfo)
 
 class MethodNode(AstNode):
-    tr_tbl = str.maketrans('/.+-@%&', '_______')
+    tr_tbl = string.maketrans('/.+-@%', '______')
 
-    def __init__(self, filename, lineno, func_name, body, python, fakeroot):
+    def __init__(self, filename, lineno, func_name, body):
         AstNode.__init__(self, filename, lineno)
         self.func_name = func_name
         self.body = body
-        self.python = python
-        self.fakeroot = fakeroot
 
     def eval(self, data):
         text = '\n'.join(self.body)
-        funcname = self.func_name
         if self.func_name == "__anonymous":
             funcname = ("__anon_%s_%s" % (self.lineno, self.filename.translate(MethodNode.tr_tbl)))
-            self.python = True
             text = "def %s(d):\n" % (funcname) + text
-            bb.methodpool.insert_method(funcname, text, self.filename, self.lineno - len(self.body) - 1)
-            anonfuncs = data.getVar('__BBANONFUNCS', False) or []
+            bb.methodpool.insert_method(funcname, text, self.filename)
+            anonfuncs = data.getVar('__BBANONFUNCS') or []
             anonfuncs.append(funcname)
             data.setVar('__BBANONFUNCS', anonfuncs)
-        if data.getVar(funcname, False):
-            # clean up old version of this piece of metadata, as its
-            # flags could cause problems
-            data.delVarFlag(funcname, 'python')
-            data.delVarFlag(funcname, 'fakeroot')
-        if self.python:
-            data.setVarFlag(funcname, "python", "1")
-        if self.fakeroot:
-            data.setVarFlag(funcname, "fakeroot", "1")
-        data.setVarFlag(funcname, "func", 1)
-        data.setVar(funcname, text, parsing=True)
-        data.setVarFlag(funcname, 'filename', self.filename)
-        data.setVarFlag(funcname, 'lineno', str(self.lineno - len(self.body)))
+            data.setVar(funcname, text)
+        else:
+            data.setVarFlag(self.func_name, "func", 1)
+            data.setVar(self.func_name, text)
 
 class PythonMethodNode(AstNode):
     def __init__(self, filename, lineno, function, modulename, body):
@@ -208,12 +172,31 @@ class PythonMethodNode(AstNode):
         # 'this' file. This means we will not parse methods from
         # bb classes twice
         text = '\n'.join(self.body)
-        bb.methodpool.insert_method(self.modulename, text, self.filename, self.lineno - len(self.body) - 1)
+        bb.methodpool.insert_method(self.modulename, text, self.filename)
         data.setVarFlag(self.function, "func", 1)
         data.setVarFlag(self.function, "python", 1)
-        data.setVar(self.function, text, parsing=True)
-        data.setVarFlag(self.function, 'filename', self.filename)
-        data.setVarFlag(self.function, 'lineno', str(self.lineno - len(self.body) - 1))
+        data.setVar(self.function, text)
+
+class MethodFlagsNode(AstNode):
+    def __init__(self, filename, lineno, key, m):
+        AstNode.__init__(self, filename, lineno)
+        self.key = key
+        self.m = m
+
+    def eval(self, data):
+        if data.getVar(self.key):
+            # clean up old version of this piece of metadata, as its
+            # flags could cause problems
+            data.setVarFlag(self.key, 'python', None)
+            data.setVarFlag(self.key, 'fakeroot', None)
+        if self.m.group("py") is not None:
+            data.setVarFlag(self.key, "python", "1")
+        else:
+            data.delVarFlag(self.key, "python")
+        if self.m.group("fr") is not None:
+            data.setVarFlag(self.key, "fakeroot", "1")
+        else:
+            data.delVarFlag(self.key, "fakeroot")
 
 class ExportFuncsNode(AstNode):
     def __init__(self, filename, lineno, fns, classname):
@@ -226,28 +209,26 @@ class ExportFuncsNode(AstNode):
         for func in self.n:
             calledfunc = self.classname + "_" + func
 
-            if data.getVar(func, False) and not data.getVarFlag(func, 'export_func', False):
+            if data.getVar(func) and not data.getVarFlag(func, 'export_func'):
                 continue
 
-            if data.getVar(func, False):
+            if data.getVar(func):
                 data.setVarFlag(func, 'python', None)
                 data.setVarFlag(func, 'func', None)
 
             for flag in [ "func", "python" ]:
-                if data.getVarFlag(calledfunc, flag, False):
-                    data.setVarFlag(func, flag, data.getVarFlag(calledfunc, flag, False))
+                if data.getVarFlag(calledfunc, flag):
+                    data.setVarFlag(func, flag, data.getVarFlag(calledfunc, flag))
             for flag in [ "dirs" ]:
-                if data.getVarFlag(func, flag, False):
-                    data.setVarFlag(calledfunc, flag, data.getVarFlag(func, flag, False))
-            data.setVarFlag(func, "filename", "autogenerated")
-            data.setVarFlag(func, "lineno", 1)
+                if data.getVarFlag(func, flag):
+                    data.setVarFlag(calledfunc, flag, data.getVarFlag(func, flag))
 
-            if data.getVarFlag(calledfunc, "python", False):
-                data.setVar(func, "    bb.build.exec_func('" + calledfunc + "', d)\n", parsing=True)
+            if data.getVarFlag(calledfunc, "python"):
+                data.setVar(func, "    bb.build.exec_func('" + calledfunc + "', d)\n")
             else:
                 if "-" in self.classname:
                    bb.fatal("The classname %s contains a dash character and is calling an sh function %s using EXPORT_FUNCTIONS. Since a dash is illegal in sh function names, this cannot work, please rename the class or don't use EXPORT_FUNCTIONS." % (self.classname, calledfunc))
-                data.setVar(func, "    " + calledfunc + "\n", parsing=True)
+                data.setVar(func, "    " + calledfunc + "\n")
             data.setVarFlag(func, 'export_func', '1')
 
 class AddTaskNode(AstNode):
@@ -274,7 +255,7 @@ class BBHandlerNode(AstNode):
         self.hs = fns.split()
 
     def eval(self, data):
-        bbhands = data.getVar('__BBHANDLERS', False) or []
+        bbhands = data.getVar('__BBHANDLERS') or []
         for h in self.hs:
             bbhands.append(h)
             data.setVarFlag(h, "handler", 1)
@@ -294,21 +275,18 @@ def handleInclude(statements, filename, lineno, m, force):
 def handleExport(statements, filename, lineno, m):
     statements.append(ExportNode(filename, lineno, m.group(1)))
 
-def handleUnset(statements, filename, lineno, m):
-    statements.append(UnsetNode(filename, lineno, m.group(1)))
-
-def handleUnsetFlag(statements, filename, lineno, m):
-    statements.append(UnsetFlagNode(filename, lineno, m.group(1), m.group(2)))
-
 def handleData(statements, filename, lineno, groupd):
     statements.append(DataNode(filename, lineno, groupd))
 
-def handleMethod(statements, filename, lineno, func_name, body, python, fakeroot):
-    statements.append(MethodNode(filename, lineno, func_name, body, python, fakeroot))
+def handleMethod(statements, filename, lineno, func_name, body):
+    statements.append(MethodNode(filename, lineno, func_name, body))
 
 def handlePythonMethod(statements, filename, lineno, funcname, modulename, body):
     statements.append(PythonMethodNode(filename, lineno, funcname, modulename, body))
 
+def handleMethodFlags(statements, filename, lineno, key, m):
+    statements.append(MethodFlagsNode(filename, lineno, key, m))
+
 def handleExportFuncs(statements, filename, lineno, m, classname):
     statements.append(ExportFuncsNode(filename, lineno, m.group(1), classname))
 
@@ -335,39 +313,31 @@ def handleInherit(statements, filename, lineno, m):
     classes = m.group(1)
     statements.append(InheritNode(filename, lineno, classes))
 
-def runAnonFuncs(d):
+def finalize(fn, d, variant = None):
+    all_handlers = {}
+    for var in d.getVar('__BBHANDLERS') or []:
+        # try to add the handler
+        bb.event.register(var, d.getVar(var), (d.getVarFlag(var, "eventmask", True) or "").split())
+
+    bb.event.fire(bb.event.RecipePreFinalise(fn), d)
+
+    bb.data.expandKeys(d)
+    bb.data.update_data(d)
     code = []
-    for funcname in d.getVar("__BBANONFUNCS", False) or []:
+    for funcname in d.getVar("__BBANONFUNCS") or []:
         code.append("%s(d)" % funcname)
     bb.utils.better_exec("\n".join(code), {"d": d})
+    bb.data.update_data(d)
 
-def finalize(fn, d, variant = None):
-    saved_handlers = bb.event.get_handlers().copy()
-    try:
-        for var in d.getVar('__BBHANDLERS', False) or []:
-            # try to add the handler
-            handlerfn = d.getVarFlag(var, "filename", False)
-            if not handlerfn:
-                bb.fatal("Undefined event handler function '%s'" % var)
-            handlerln = int(d.getVarFlag(var, "lineno", False))
-            bb.event.register(var, d.getVar(var, False), (d.getVarFlag(var, "eventmask") or "").split(), handlerfn, handlerln)
+    tasklist = d.getVar('__BBTASKS') or []
+    deltasklist = d.getVar('__BBDELTASKS') or []
+    bb.build.add_tasks(tasklist, deltasklist, d)
 
-        bb.event.fire(bb.event.RecipePreFinalise(fn), d)
+    bb.parse.siggen.finalise(fn, d, variant)
 
-        bb.data.expandKeys(d)
-        runAnonFuncs(d)
+    d.setVar('BBINCLUDED', bb.parse.get_file_depends(d))
 
-        tasklist = d.getVar('__BBTASKS', False) or []
-        bb.event.fire(bb.event.RecipeTaskPreProcess(fn, list(tasklist)), d)
-        bb.build.add_tasks(tasklist, d)
-
-        bb.parse.siggen.finalise(fn, d, variant)
-
-        d.setVar('BBINCLUDED', bb.parse.get_file_depends(d))
-
-        bb.event.fire(bb.event.RecipeParsed(fn), d)
-    finally:
-        bb.event.set_handlers(saved_handlers)
+    bb.event.fire(bb.event.RecipeParsed(fn), d)
 
 def _create_variants(datastores, names, function, onlyfinalise):
     def create_variant(name, orig_d, arg = None):
@@ -377,16 +347,37 @@ def _create_variants(datastores, names, function, onlyfinalise):
         function(arg or name, new_d)
         datastores[name] = new_d
 
-    for variant in list(datastores.keys()):
+    for variant, variant_d in datastores.items():
         for name in names:
             if not variant:
                 # Based on main recipe
-                create_variant(name, datastores[""])
+                create_variant(name, variant_d)
             else:
-                create_variant("%s-%s" % (variant, name), datastores[variant], name)
+                create_variant("%s-%s" % (variant, name), variant_d, name)
+
+def _expand_versions(versions):
+    def expand_one(version, start, end):
+        for i in xrange(start, end + 1):
+            ver = _bbversions_re.sub(str(i), version, 1)
+            yield ver
+
+    versions = iter(versions)
+    while True:
+        try:
+            version = next(versions)
+        except StopIteration:
+            break
+
+        range_ver = _bbversions_re.search(version)
+        if not range_ver:
+            yield version
+        else:
+            newversions = expand_one(version, int(range_ver.group("from")),
+                                     int(range_ver.group("to")))
+            versions = itertools.chain(newversions, versions)
 
 def multi_finalize(fn, d):
-    appends = (d.getVar("__BBAPPEND") or "").split()
+    appends = (d.getVar("__BBAPPEND", True) or "").split()
     for append in appends:
         logger.debug(1, "Appending .bbappend file %s to %s", append, fn)
         bb.parse.BBHandler.handle(append, d, True)
@@ -401,7 +392,51 @@ def multi_finalize(fn, d):
         d.setVar("__SKIPPED", e.args[0])
     datastores = {"": safe_d}
 
-    extended = d.getVar("BBCLASSEXTEND") or ""
+    versions = (d.getVar("BBVERSIONS", True) or "").split()
+    if versions:
+        pv = orig_pv = d.getVar("PV", True)
+        baseversions = {}
+
+        def verfunc(ver, d, pv_d = None):
+            if pv_d is None:
+                pv_d = d
+
+            overrides = d.getVar("OVERRIDES", True).split(":")
+            pv_d.setVar("PV", ver)
+            overrides.append(ver)
+            bpv = baseversions.get(ver) or orig_pv
+            pv_d.setVar("BPV", bpv)
+            overrides.append(bpv)
+            d.setVar("OVERRIDES", ":".join(overrides))
+
+        versions = list(_expand_versions(versions))
+        for pos, version in enumerate(list(versions)):
+            try:
+                pv, bpv = version.split(":", 2)
+            except ValueError:
+                pass
+            else:
+                versions[pos] = pv
+                baseversions[pv] = bpv
+
+        if pv in versions and not baseversions.get(pv):
+            versions.remove(pv)
+        else:
+            pv = versions.pop()
+
+            # This is necessary because our existing main datastore
+            # has already been finalized with the old PV, we need one
+            # that's been finalized with the new PV.
+            d = bb.data.createCopy(safe_d)
+            verfunc(pv, d, safe_d)
+            try:
+                finalize(fn, d)
+            except bb.parse.SkipRecipe as e:
+                d.setVar("__SKIPPED", e.args[0])
+
+        _create_variants(datastores, versions, verfunc, onlyfinalise)
+
+    extended = d.getVar("BBCLASSEXTEND", True) or ""
     if extended:
         # the following is to support bbextends with arguments, for e.g. multilib
         # an example is as follows:
@@ -419,7 +454,7 @@ def multi_finalize(fn, d):
             else:
                 extendedmap[ext] = ext
 
-        pn = d.getVar("PN")
+        pn = d.getVar("PN", True)
         def extendfunc(name, d):
             if name != extendedmap[name]:
                 d.setVar("BBEXTENDCURR", extendedmap[name])
@@ -431,13 +466,17 @@ def multi_finalize(fn, d):
         safe_d.setVar("BBCLASSEXTEND", extended)
         _create_variants(datastores, extendedmap.keys(), extendfunc, onlyfinalise)
 
-    for variant in datastores.keys():
+    for variant, variant_d in datastores.iteritems():
         if variant:
             try:
                 if not onlyfinalise or variant in onlyfinalise:
-                    finalize(fn, datastores[variant], variant)
+                    finalize(fn, variant_d, variant)
             except bb.parse.SkipRecipe as e:
-                datastores[variant].setVar("__SKIPPED", e.args[0])
+                variant_d.setVar("__SKIPPED", e.args[0])
+
+    if len(datastores) > 1:
+        variants = filter(None, datastores.iterkeys())
+        safe_d.setVar("__VARIANTS", " ".join(variants))
 
     datastores[""] = d
     return datastores

bitbake/lib/bb/parse/parse_py/BBHandler.py

@@ -25,49 +25,59 @@
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
-
+from __future__ import absolute_import
 import re, bb, os
 import logging
 import bb.build, bb.utils
 from bb import data
 
 from . import ConfHandler
-from .. import resolve_file, ast, logger, ParseError
+from .. import resolve_file, ast, logger
 from .ConfHandler import include, init
 
 # For compatibility
 bb.deprecate_import(__name__, "bb.parse", ["vars_from_file"])
 
-__func_start_regexp__    = re.compile(r"(((?P<py>python)|(?P<fr>fakeroot))\s*)*(?P<func>[\w\.\-\+\{\}\$]+)?\s*\(\s*\)\s*{$" )
-__inherit_regexp__       = re.compile(r"inherit\s+(.+)" )
-__export_func_regexp__   = re.compile(r"EXPORT_FUNCTIONS\s+(.+)" )
-__addtask_regexp__       = re.compile(r"addtask\s+(?P<func>\w+)\s*((before\s*(?P<before>((.*(?=after))|(.*))))|(after\s*(?P<after>((.*(?=before))|(.*)))))*")
-__deltask_regexp__       = re.compile(r"deltask\s+(?P<func>\w+)")
-__addhandler_regexp__    = re.compile(r"addhandler\s+(.+)" )
-__def_regexp__           = re.compile(r"def\s+(\w+).*:" )
-__python_func_regexp__   = re.compile(r"(\s+.*)|(^$)|(^#)" )
-__python_tab_regexp__    = re.compile(r" *\t")
+__func_start_regexp__    = re.compile( r"(((?P<py>python)|(?P<fr>fakeroot))\s*)*(?P<func>[\w\.\-\+\{\}\$]+)?\s*\(\s*\)\s*{$" )
+__inherit_regexp__       = re.compile( r"inherit\s+(.+)" )
+__export_func_regexp__   = re.compile( r"EXPORT_FUNCTIONS\s+(.+)" )
+__addtask_regexp__       = re.compile("addtask\s+(?P<func>\w+)\s*((before\s*(?P<before>((.*(?=after))|(.*))))|(after\s*(?P<after>((.*(?=before))|(.*)))))*")
+__deltask_regexp__       = re.compile("deltask\s+(?P<func>\w+)")
+__addhandler_regexp__    = re.compile( r"addhandler\s+(.+)" )
+__def_regexp__           = re.compile( r"def\s+(\w+).*:" )
+__python_func_regexp__   = re.compile( r"(\s+.*)|(^$)" )
 
-__infunc__ = []
+
+__infunc__ = ""
 __inpython__ = False
 __body__   = []
 __classname__ = ""
 
 cached_statements = {}
 
+# We need to indicate EOF to the feeder. This code is so messy that
+# factoring it out to a close_parse_file method is out of question.
+# We will use the IN_PYTHON_EOF as an indicator to just close the method
+#
+# The two parts using it are tightly integrated anyway
+IN_PYTHON_EOF = -9999999999999
+
+
+
 def supports(fn, d):
     """Return True if fn has a supported extension"""
     return os.path.splitext(fn)[-1] in [".bb", ".bbclass", ".inc"]
 
 def inherit(files, fn, lineno, d):
-    __inherit_cache = d.getVar('__inherit_cache', False) or []
+    __inherit_cache = d.getVar('__inherit_cache') or []
     files = d.expand(files).split()
     for file in files:
         if not os.path.isabs(file) and not file.endswith(".bbclass"):
             file = os.path.join('classes', '%s.bbclass' % file)
 
         if not os.path.isabs(file):
-            bbpath = d.getVar("BBPATH")
+            dname = os.path.dirname(fn)
+            bbpath = "%s:%s" % (dname, d.getVar("BBPATH", True))
             abs_fn, attempts = bb.utils.which(bbpath, file, history=True)
             for af in attempts:
                 if af != abs_fn:
@@ -80,7 +90,7 @@ def inherit(files, fn, lineno, d):
             __inherit_cache.append( file )
             d.setVar('__inherit_cache', __inherit_cache)
             include(fn, file, lineno, d, "inherit")
-            __inherit_cache = d.getVar('__inherit_cache', False) or []
+            __inherit_cache = d.getVar('__inherit_cache') or []
 
 def get_statements(filename, absolute_filename, base_name):
     global cached_statements
@@ -88,20 +98,20 @@ def get_statements(filename, absolute_filename, base_name):
     try:
         return cached_statements[absolute_filename]
     except KeyError:
-        with open(absolute_filename, 'r') as f:
-            statements = ast.StatementGroup()
-
-            lineno = 0
-            while True:
-                lineno = lineno + 1
-                s = f.readline()
-                if not s: break
-                s = s.rstrip()
-                feeder(lineno, s, filename, base_name, statements)
+        file = open(absolute_filename, 'r')
+        statements = ast.StatementGroup()
 
+        lineno = 0
+        while True:
+            lineno = lineno + 1
+            s = file.readline()
+            if not s: break
+            s = s.rstrip()
+            feeder(lineno, s, filename, base_name, statements)
+        file.close()
         if __inpython__:
             # add a blank line to close out any python definition
-            feeder(lineno, "", filename, base_name, statements, eof=True)
+            feeder(IN_PYTHON_EOF, "", filename, base_name, statements)
 
         if filename.endswith(".bbclass") or filename.endswith(".inc"):
             cached_statements[absolute_filename] = statements
@@ -110,7 +120,7 @@ def get_statements(filename, absolute_filename, base_name):
 def handle(fn, d, include):
     global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __infunc__, __body__, __residue__, __classname__
     __body__ = []
-    __infunc__ = []
+    __infunc__ = ""
     __classname__ = ""
     __residue__ = []
 
@@ -120,62 +130,50 @@ def handle(fn, d, include):
 
     if ext == ".bbclass":
         __classname__ = root
-        __inherit_cache = d.getVar('__inherit_cache', False) or []
+        __inherit_cache = d.getVar('__inherit_cache') or []
         if not fn in __inherit_cache:
             __inherit_cache.append(fn)
             d.setVar('__inherit_cache', __inherit_cache)
 
     if include != 0:
-        oldfile = d.getVar('FILE', False)
+        oldfile = d.getVar('FILE')
     else:
         oldfile = None
 
     abs_fn = resolve_file(fn, d)
 
+    if include:
+        bb.parse.mark_dependency(d, abs_fn)
+
     # actual loading
     statements = get_statements(fn, abs_fn, base_name)
 
     # DONE WITH PARSING... time to evaluate
-    if ext != ".bbclass" and abs_fn != oldfile:
+    if ext != ".bbclass":
         d.setVar('FILE', abs_fn)
 
     try:
         statements.eval(d)
     except bb.parse.SkipRecipe:
-        d.setVar("__SKIPPED", True)
+        bb.data.setVar("__SKIPPED", True, d)
         if include == 0:
             return { "" : d }
 
-    if __infunc__:
-        raise ParseError("Shell function %s is never closed" % __infunc__[0], __infunc__[1], __infunc__[2])
-    if __residue__:
-        raise ParseError("Leftover unparsed (incomplete?) data %s from %s" % __residue__, fn)
-
     if ext != ".bbclass" and include == 0:
         return ast.multi_finalize(fn, d)
 
-    if ext != ".bbclass" and oldfile and abs_fn != oldfile:
+    if oldfile:
         d.setVar("FILE", oldfile)
 
     return d
 
-def feeder(lineno, s, fn, root, statements, eof=False):
+def feeder(lineno, s, fn, root, statements):
     global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __def_regexp__, __python_func_regexp__, __inpython__, __infunc__, __body__, bb, __residue__, __classname__
-
-    # Check tabs in python functions:
-    # - def py_funcname(): covered by __inpython__
-    # - python(): covered by '__anonymous' == __infunc__[0]
-    # - python funcname(): covered by __infunc__[3]
-    if __inpython__ or (__infunc__ and ('__anonymous' == __infunc__[0] or __infunc__[3])):
-        tab = __python_tab_regexp__.match(s)
-        if tab:
-            bb.warn('python should use 4 spaces indentation, but found tabs in %s, line %s' % (root, lineno))
-
     if __infunc__:
         if s == '}':
             __body__.append('')
-            ast.handleMethod(statements, fn, lineno, __infunc__[0], __body__, __infunc__[3], __infunc__[4])
-            __infunc__ = []
+            ast.handleMethod(statements, fn, lineno, __infunc__, __body__)
+            __infunc__ = ""
             __body__ = []
         else:
             __body__.append(s)
@@ -183,7 +181,7 @@ def feeder(lineno, s, fn, root, statements, eof=False):
 
     if __inpython__:
         m = __python_func_regexp__.match(s)
-        if m and not eof:
+        if m and lineno != IN_PYTHON_EOF:
             __body__.append(s)
             return
         else:
@@ -192,7 +190,7 @@ def feeder(lineno, s, fn, root, statements, eof=False):
             __body__ = []
             __inpython__ = False
 
-            if eof:
+            if lineno == IN_PYTHON_EOF:
                 return
 
     if s and s[0] == '#':
@@ -219,7 +217,8 @@ def feeder(lineno, s, fn, root, statements, eof=False):
 
     m = __func_start_regexp__.match(s)
     if m:
-        __infunc__ = [m.group("func") or "__anonymous", fn, lineno, m.group("py") is not None, m.group("fr") is not None]
+        __infunc__ = m.group("func") or "__anonymous"
+        ast.handleMethodFlags(statements, fn, lineno, __infunc__, m)
         return
 
     m = __def_regexp__.match(s)

bitbake/lib/bb/parse/parse_py/ConfHandler.py

@@ -24,16 +24,15 @@
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
-import errno
-import re
-import os
+import re, os
+import logging
 import bb.utils
-from bb.parse import ParseError, resolve_file, ast, logger, handle
+from bb.parse import ParseError, resolve_file, ast, logger
 
 __config_regexp__  = re.compile( r"""
     ^
-    (?P<exp>export\s+)?
-    (?P<var>[a-zA-Z0-9\-_+.${}/~]+?)
+    (?P<exp>export\s*)?
+    (?P<var>[a-zA-Z0-9\-~_+.${}/]+?)
     (\[(?P<flag>[a-zA-Z0-9\-_+.]+)\])?
 
     \s* (
@@ -56,12 +55,10 @@ __config_regexp__  = re.compile( r"""
     """, re.X)
 __include_regexp__ = re.compile( r"include\s+(.+)" )
 __require_regexp__ = re.compile( r"require\s+(.+)" )
-__export_regexp__ = re.compile( r"export\s+([a-zA-Z0-9\-_+.${}/~]+)$" )
-__unset_regexp__ = re.compile( r"unset\s+([a-zA-Z0-9\-_+.${}/~]+)$" )
-__unset_flag_regexp__ = re.compile( r"unset\s+([a-zA-Z0-9\-_+.${}/~]+)\[([a-zA-Z0-9\-_+.]+)\]$" )
+__export_regexp__ = re.compile( r"export\s+([a-zA-Z0-9\-_+.${}/]+)$" )
 
 def init(data):
-    topdir = data.getVar('TOPDIR', False)
+    topdir = data.getVar('TOPDIR')
     if not topdir:
         data.setVar('TOPDIR', os.getcwd())
 
@@ -69,51 +66,40 @@ def init(data):
 def supports(fn, d):
     return fn[-5:] == ".conf"
 
-def include(parentfn, fns, lineno, data, error_out):
+def include(oldfn, fn, lineno, data, error_out):
     """
     error_out: A string indicating the verb (e.g. "include", "inherit") to be
     used in a ParseError that will be raised if the file to be included could
     not be included. Specify False to avoid raising an error in this case.
     """
-    fns = data.expand(fns)
-    parentfn = data.expand(parentfn)
-
-    # "include" or "require" accept zero to n space-separated file names to include.
-    for fn in fns.split():
-        include_single_file(parentfn, fn, lineno, data, error_out)
-
-def include_single_file(parentfn, fn, lineno, data, error_out):
-    """
-    Helper function for include() which does not expand or split its parameters.
-    """
-    if parentfn == fn: # prevent infinite recursion
+    if oldfn == fn: # prevent infinite recursion
         return None
 
+    import bb
+    fn = data.expand(fn)
+    oldfn = data.expand(oldfn)
+
     if not os.path.isabs(fn):
-        dname = os.path.dirname(parentfn)
-        bbpath = "%s:%s" % (dname, data.getVar("BBPATH"))
+        dname = os.path.dirname(oldfn)
+        bbpath = "%s:%s" % (dname, data.getVar("BBPATH", True))
         abs_fn, attempts = bb.utils.which(bbpath, fn, history=True)
         if abs_fn and bb.parse.check_dependency(data, abs_fn):
-            logger.warning("Duplicate inclusion for %s in %s" % (abs_fn, data.getVar('FILE')))
+            bb.warn("Duplicate inclusion for %s in %s" % (abs_fn, data.getVar('FILE', True)))
         for af in attempts:
             bb.parse.mark_dependency(data, af)
         if abs_fn:
             fn = abs_fn
     elif bb.parse.check_dependency(data, fn):
-        logger.warning("Duplicate inclusion for %s in %s" % (fn, data.getVar('FILE')))
+        bb.warn("Duplicate inclusion for %s in %s" % (fn, data.getVar('FILE', True)))
 
+    from bb.parse import handle
     try:
-        bb.parse.handle(fn, data, True)
-    except (IOError, OSError) as exc:
-        if exc.errno == errno.ENOENT:
-            if error_out:
-                raise ParseError("Could not %s file %s" % (error_out, fn), parentfn, lineno)
-            logger.debug(2, "CONF file '%s' not found", fn)
-        else:
-            if error_out:
-                raise ParseError("Could not %s file %s: %s" % (error_out, fn, exc.strerror), parentfn, lineno)
-            else:
-                raise ParseError("Error parsing %s: %s" % (fn, exc.strerror), parentfn, lineno)
+        ret = handle(fn, data, True)
+    except (IOError, OSError):
+        if error_out:
+            raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
+        logger.debug(2, "CONF file '%s' not found", fn)
+        bb.parse.mark_dependency(data, fn)
 
 # We have an issue where a UI might want to enforce particular settings such as
 # an empty DISTRO variable. If configuration files do something like assigning
@@ -129,11 +115,14 @@ def handle(fn, data, include):
     if include == 0:
         oldfile = None
     else:
-        oldfile = data.getVar('FILE', False)
+        oldfile = data.getVar('FILE')
 
     abs_fn = resolve_file(fn, data)
     f = open(abs_fn, 'r')
 
+    if include:
+        bb.parse.mark_dependency(data, abs_fn)
+
     statements = ast.StatementGroup()
     lineno = 0
     while True:
@@ -147,7 +136,7 @@ def handle(fn, data, include):
             continue
         s = s.rstrip()
         while s[-1] == '\\':
-            s2 = f.readline().rstrip()
+            s2 = f.readline().strip()
             lineno = lineno + 1
             if (not s2 or s2 and s2[0] != "#") and s[0] == "#" :
                 bb.fatal("There is a confusing multiline, partially commented expression on line %s of file %s (%s).\nPlease clarify whether this is all a comment or should be parsed." % (lineno, fn, s))
@@ -192,16 +181,6 @@ def feeder(lineno, s, fn, statements):
         ast.handleExport(statements, fn, lineno, m)
         return
 
-    m = __unset_regexp__.match(s)
-    if m:
-        ast.handleUnset(statements, fn, lineno, m)
-        return
-
-    m = __unset_flag_regexp__.match(s)
-    if m:
-        ast.handleUnsetFlag(statements, fn, lineno, m)
-        return
-
     raise ParseError("unparsed line: '%s'" % s, fn, lineno);
 
 # Add us to the handlers list

bitbake/lib/bb/persist_data.py

@@ -28,8 +28,11 @@ import sys
 import warnings
 from bb.compat import total_ordering
 from collections import Mapping
-import sqlite3
-import contextlib
+
+try:
+    import sqlite3
+except ImportError:
+    from pysqlite2 import dbapi2 as sqlite3
 
 sqlversion = sqlite3.sqlite_version_info
 if sqlversion[0] < 3 or (sqlversion[0] == 3 and sqlversion[1] < 3):
@@ -37,181 +40,84 @@ if sqlversion[0] < 3 or (sqlversion[0] == 3 and sqlversion[1] < 3):
 
 
 logger = logging.getLogger("BitBake.PersistData")
+if hasattr(sqlite3, 'enable_shared_cache'):
+    try:
+        sqlite3.enable_shared_cache(True)
+    except sqlite3.OperationalError:
+        pass
+
 
 @total_ordering
 class SQLTable(collections.MutableMapping):
-    class _Decorators(object):
-        @staticmethod
-        def retry(*, reconnect=True):
-            """
-            Decorator that restarts a function if a database locked sqlite
-            exception occurs. If reconnect is True, the database connection
-            will be closed and reopened each time a failure occurs
-            """
-            def retry_wrapper(f):
-                def wrap_func(self, *args, **kwargs):
-                    # Reconnect if necessary
-                    if self.connection is None and reconnect:
-                        self.reconnect()
-
-                    count = 0
-                    while True:
-                        try:
-                            return f(self, *args, **kwargs)
-                        except sqlite3.OperationalError as exc:
-                            if count < 500 and ('is locked' in str(exc) or 'locking protocol' in str(exc)):
-                                count = count + 1
-                                if reconnect:
-                                    self.reconnect()
-                                continue
-                            raise
-                return wrap_func
-            return retry_wrapper
-
-        @staticmethod
-        def transaction(f):
-            """
-            Decorator that starts a database transaction and creates a database
-            cursor for performing queries. If no exception is thrown, the
-            database results are commited. If an exception occurs, the database
-            is rolled back. In all cases, the cursor is closed after the
-            function ends.
-
-            Note that the cursor is passed as an extra argument to the function
-            after `self` and before any of the normal arguments
-            """
-            def wrap_func(self, *args, **kwargs):
-                # Context manager will COMMIT the database on success,
-                # or ROLLBACK on an exception
-                with self.connection:
-                    # Automatically close the cursor when done
-                    with contextlib.closing(self.connection.cursor()) as cursor:
-                        return f(self, cursor, *args, **kwargs)
-            return wrap_func
-
     """Object representing a table/domain in the database"""
     def __init__(self, cachefile, table):
         self.cachefile = cachefile
         self.table = table
+        self.cursor = connect(self.cachefile)
 
-        self.connection = None
-        self._execute_single("CREATE TABLE IF NOT EXISTS %s(key TEXT PRIMARY KEY NOT NULL, value TEXT);" % table)
+        self._execute("CREATE TABLE IF NOT EXISTS %s(key TEXT, value TEXT);"
+                      % table)
 
-    @_Decorators.retry(reconnect=False)
-    @_Decorators.transaction
-    def _setup_database(self, cursor):
-        cursor.execute("pragma synchronous = off;")
-        # Enable WAL and keep the autocheckpoint length small (the default is
-        # usually 1000). Persistent caches are usually read-mostly, so keeping
-        # this short will keep readers running quickly
-        cursor.execute("pragma journal_mode = WAL;")
-        cursor.execute("pragma wal_autocheckpoint = 100;")
-
-    def reconnect(self):
-        if self.connection is not None:
-            self.connection.close()
-        self.connection = sqlite3.connect(self.cachefile, timeout=5)
-        self.connection.text_factory = str
-        self._setup_database()
-
-    @_Decorators.retry()
-    @_Decorators.transaction
-    def _execute_single(self, cursor, *query):
-        """
-        Executes a single query and discards the results. This correctly closes
-        the database cursor when finished
-        """
-        cursor.execute(*query)
-
-    @_Decorators.retry()
-    def _row_iter(self, f, *query):
-        """
-        Helper function that returns a row iterator. Each time __next__ is
-        called on the iterator, the provided function is evaluated to determine
-        the return value
-        """
-        class CursorIter(object):
-            def __init__(self, cursor):
-                self.cursor = cursor
-
-            def __iter__(self):
-                return self
-
-            def __next__(self):
-                row = self.cursor.fetchone()
-                if row is None:
+    def _execute(self, *query):
+        """Execute a query, waiting to acquire a lock if necessary"""
+        count = 0
+        while True:
+            try:
+                return self.cursor.execute(*query)
+            except sqlite3.OperationalError as exc:
+                if 'database is locked' in str(exc) and count < 500:
+                    count = count + 1
                     self.cursor.close()
-                    raise StopIteration
-                return f(row)
-
-            def __enter__(self):
-                return self
-
-            def __exit__(self, typ, value, traceback):
-                self.cursor.close()
-                return False
-
-        cursor = self.connection.cursor()
-        try:
-            cursor.execute(*query)
-            return CursorIter(cursor)
-        except:
-            cursor.close()
+                    self.cursor = connect(self.cachefile)
+                    continue
+                raise
 
     def __enter__(self):
-        self.connection.__enter__()
+        self.cursor.__enter__()
         return self
 
     def __exit__(self, *excinfo):
-        self.connection.__exit__(*excinfo)
+        self.cursor.__exit__(*excinfo)
 
-    @_Decorators.retry()
-    @_Decorators.transaction
-    def __getitem__(self, cursor, key):
-        cursor.execute("SELECT * from %s where key=?;" % self.table, [key])
-        row = cursor.fetchone()
-        if row is not None:
+    def __getitem__(self, key):
+        data = self._execute("SELECT * from %s where key=?;" %
+                             self.table, [key])
+        for row in data:
             return row[1]
         raise KeyError(key)
 
-    @_Decorators.retry()
-    @_Decorators.transaction
-    def __delitem__(self, cursor, key):
+    def __delitem__(self, key):
         if key not in self:
             raise KeyError(key)
-        cursor.execute("DELETE from %s where key=?;" % self.table, [key])
+        self._execute("DELETE from %s where key=?;" % self.table, [key])
 
-    @_Decorators.retry()
-    @_Decorators.transaction
-    def __setitem__(self, cursor, key, value):
-        if not isinstance(key, str):
+    def __setitem__(self, key, value):
+        if not isinstance(key, basestring):
             raise TypeError('Only string keys are supported')
-        elif not isinstance(value, str):
+        elif not isinstance(value, basestring):
             raise TypeError('Only string values are supported')
 
-        cursor.execute("SELECT * from %s where key=?;" % self.table, [key])
-        row = cursor.fetchone()
-        if row is not None:
-            cursor.execute("UPDATE %s SET value=? WHERE key=?;" % self.table, [value, key])
+        data = self._execute("SELECT * from %s where key=?;" %
+                                   self.table, [key])
+        exists = len(list(data))
+        if exists:
+            self._execute("UPDATE %s SET value=? WHERE key=?;" % self.table,
+                          [value, key])
         else:
-            cursor.execute("INSERT into %s(key, value) values (?, ?);" % self.table, [key, value])
+            self._execute("INSERT into %s(key, value) values (?, ?);" %
+                          self.table, [key, value])
 
-    @_Decorators.retry()
-    @_Decorators.transaction
-    def __contains__(self, cursor, key):
-        cursor.execute('SELECT * from %s where key=?;' % self.table, [key])
-        return cursor.fetchone() is not None
+    def __contains__(self, key):
+        return key in set(self)
 
-    @_Decorators.retry()
-    @_Decorators.transaction
-    def __len__(self, cursor):
-        cursor.execute("SELECT COUNT(key) FROM %s;" % self.table)
-        row = cursor.fetchone()
-        if row is not None:
+    def __len__(self):
+        data = self._execute("SELECT COUNT(key) FROM %s;" % self.table)
+        for row in data:
             return row[0]
 
     def __iter__(self):
-        return self._row_iter(lambda row: row[0], "SELECT key from %s;" % self.table)
+        data = self._execute("SELECT key FROM %s;" % self.table)
+        return (row[0] for row in data)
 
     def __lt__(self, other):
         if not isinstance(other, Mapping):
@@ -220,27 +126,25 @@ class SQLTable(collections.MutableMapping):
         return len(self) < len(other)
 
     def get_by_pattern(self, pattern):
-        return self._row_iter(lambda row: row[1], "SELECT * FROM %s WHERE key LIKE ?;" %
-                              self.table, [pattern])
+        data = self._execute("SELECT * FROM %s WHERE key LIKE ?;" %
+                             self.table, [pattern])
+        return [row[1] for row in data]
 
     def values(self):
         return list(self.itervalues())
 
     def itervalues(self):
-        return self._row_iter(lambda row: row[0], "SELECT value FROM %s;" %
-                              self.table)
+        data = self._execute("SELECT value FROM %s;" % self.table)
+        return (row[0] for row in data)
 
     def items(self):
         return list(self.iteritems())
 
     def iteritems(self):
-        return self._row_iter(lambda row: (row[0], row[1]), "SELECT * FROM %s;" %
-                              self.table)
+        return self._execute("SELECT * FROM %s;" % self.table)
 
-    @_Decorators.retry()
-    @_Decorators.transaction
-    def clear(self, cursor):
-        cursor.execute("DELETE FROM %s;" % self.table)
+    def clear(self):
+        self._execute("DELETE FROM %s;" % self.table)
 
     def has_key(self, key):
         return key in self
@@ -274,7 +178,7 @@ class PersistData(object):
         """
         Return a list of key + value pairs for a domain
         """
-        return list(self.data[domain].items())
+        return self.data[domain].items()
 
     def getValue(self, domain, key):
         """
@@ -294,11 +198,16 @@ class PersistData(object):
         """
         del self.data[domain][key]
 
+def connect(database):
+    connection = sqlite3.connect(database, timeout=5, isolation_level=None)
+    connection.execute("pragma synchronous = off;")
+    return connection
+
 def persist(domain, d):
     """Convenience factory for SQLTable objects based upon metadata"""
     import bb.utils
-    cachedir = (d.getVar("PERSISTENT_DIR") or
-                d.getVar("CACHE"))
+    cachedir = (d.getVar("PERSISTENT_DIR", True) or
+                d.getVar("CACHE", True))
     if not cachedir:
         logger.critical("Please set the 'PERSISTENT_DIR' or 'CACHE' variable")
         sys.exit(1)

bitbake/lib/bb/process.py

@@ -17,7 +17,7 @@ class CmdError(RuntimeError):
         self.msg = msg
 
     def __str__(self):
-        if not isinstance(self.command, str):
+        if not isinstance(self.command, basestring):
             cmd = subprocess.list2cmdline(self.command)
         else:
             cmd = self.command
@@ -64,7 +64,7 @@ class Popen(subprocess.Popen):
         options.update(kwargs)
         subprocess.Popen.__init__(self, *args, **options)
 
-def _logged_communicate(pipe, log, input, extrafiles):
+def _logged_communicate(pipe, log, input):
     if pipe.stdin:
         if input is not None:
             pipe.stdin.write(input)
@@ -79,82 +79,40 @@ def _logged_communicate(pipe, log, input, extrafiles):
     if pipe.stderr is not None:
         bb.utils.nonblockingfd(pipe.stderr.fileno())
         rin.append(pipe.stderr)
-    for fobj, _ in extrafiles:
-        bb.utils.nonblockingfd(fobj.fileno())
-        rin.append(fobj)
-
-    def readextras(selected):
-        for fobj, func in extrafiles:
-            if fobj in selected:
-                try:
-                    data = fobj.read()
-                except IOError as err:
-                    if err.errno == errno.EAGAIN or err.errno == errno.EWOULDBLOCK:
-                        data = None
-                if data is not None:
-                    func(data)
-
-    def read_all_pipes(log, rin, outdata, errdata):
-        rlist = rin
-        stdoutbuf = b""
-        stderrbuf = b""
-
-        try:
-            r,w,e = select.select (rlist, [], [], 1)
-        except OSError as e:
-            if e.errno != errno.EINTR:
-                raise
-
-        readextras(r)
-
-        if pipe.stdout in r:
-            data = stdoutbuf + pipe.stdout.read()
-            if data is not None and len(data) > 0:
-                try:
-                    data = data.decode("utf-8")
-                    outdata.append(data)
-                    log.write(data)
-                    log.flush()
-                    stdoutbuf = b""
-                except UnicodeDecodeError:
-                    stdoutbuf = data
-
-        if pipe.stderr in r:
-            data = stderrbuf + pipe.stderr.read()
-            if data is not None and len(data) > 0:
-                try:
-                    data = data.decode("utf-8")
-                    errdata.append(data)
-                    log.write(data)
-                    log.flush()
-                    stderrbuf = b""
-                except UnicodeDecodeError:
-                    stderrbuf = data
 
     try:
-        # Read all pipes while the process is open
         while pipe.poll() is None:
-            read_all_pipes(log, rin, outdata, errdata)
+            rlist = rin
+            try:
+                r,w,e = select.select (rlist, [], [], 1)
+            except OSError as e:
+                if e.errno != errno.EINTR:
+                    raise
 
-        # Pocess closed, drain all pipes...
-        read_all_pipes(log, rin, outdata, errdata)
-    finally:
+            if pipe.stdout in r:
+                data = pipe.stdout.read()
+                if data is not None:
+                    outdata.append(data)
+                    log.write(data)
+
+            if pipe.stderr in r:
+                data = pipe.stderr.read()
+                if data is not None:
+                    errdata.append(data)
+                    log.write(data)
+    finally:    
         log.flush()
-
     if pipe.stdout is not None:
         pipe.stdout.close()
     if pipe.stderr is not None:
         pipe.stderr.close()
     return ''.join(outdata), ''.join(errdata)
 
-def run(cmd, input=None, log=None, extrafiles=None, **options):
+def run(cmd, input=None, log=None, **options):
     """Convenience function to run a command and return its output, raising an
     exception when the command fails"""
 
-    if not extrafiles:
-        extrafiles = []
-
-    if isinstance(cmd, str) and not "shell" in options:
+    if isinstance(cmd, basestring) and not "shell" in options:
         options["shell"] = True
 
     try:
@@ -166,13 +124,9 @@ def run(cmd, input=None, log=None, extrafiles=None, **options):
             raise CmdError(cmd, exc)
 
     if log:
-        stdout, stderr = _logged_communicate(pipe, log, input, extrafiles)
+        stdout, stderr = _logged_communicate(pipe, log, input)
     else:
         stdout, stderr = pipe.communicate(input)
-        if not stdout is None:
-            stdout = stdout.decode("utf-8")
-        if not stderr is None:
-            stderr = stderr.decode("utf-8")
 
     if pipe.returncode != 0:
         raise ExecutionError(cmd, pipe.returncode, stdout, stderr)

bitbake/lib/bb/progress.py

@@ -1,276 +0,0 @@
-"""
-BitBake progress handling code
-"""
-
-# Copyright (C) 2016 Intel Corporation
-#
-# This program is free software; you can redistribute it and/or modify
-# it under the terms of the GNU General Public License version 2 as
-# published by the Free Software Foundation.
-#
-# This program is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-# GNU General Public License for more details.
-#
-# You should have received a copy of the GNU General Public License along
-# with this program; if not, write to the Free Software Foundation, Inc.,
-# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
-import sys
-import re
-import time
-import inspect
-import bb.event
-import bb.build
-
-class ProgressHandler(object):
-    """
-    Base class that can pretend to be a file object well enough to be
-    used to build objects to intercept console output and determine the
-    progress of some operation.
-    """
-    def __init__(self, d, outfile=None):
-        self._progress = 0
-        self._data = d
-        self._lastevent = 0
-        if outfile:
-            self._outfile = outfile
-        else:
-            self._outfile = sys.stdout
-
-    def _fire_progress(self, taskprogress, rate=None):
-        """Internal function to fire the progress event"""
-        bb.event.fire(bb.build.TaskProgress(taskprogress, rate), self._data)
-
-    def write(self, string):
-        self._outfile.write(string)
-
-    def flush(self):
-        self._outfile.flush()
-
-    def update(self, progress, rate=None):
-        ts = time.time()
-        if progress > 100:
-            progress = 100
-        if progress != self._progress or self._lastevent + 1 < ts:
-            self._fire_progress(progress, rate)
-            self._lastevent = ts
-            self._progress = progress
-
-class LineFilterProgressHandler(ProgressHandler):
-    """
-    A ProgressHandler variant that provides the ability to filter out
-    the lines if they contain progress information. Additionally, it
-    filters out anything before the last line feed on a line. This can
-    be used to keep the logs clean of output that we've only enabled for
-    getting progress, assuming that that can be done on a per-line
-    basis.
-    """
-    def __init__(self, d, outfile=None):
-        self._linebuffer = ''
-        super(LineFilterProgressHandler, self).__init__(d, outfile)
-
-    def write(self, string):
-        self._linebuffer += string
-        while True:
-            breakpos = self._linebuffer.find('\n') + 1
-            if breakpos == 0:
-                break
-            line = self._linebuffer[:breakpos]
-            self._linebuffer = self._linebuffer[breakpos:]
-            # Drop any line feeds and anything that precedes them
-            lbreakpos = line.rfind('\r') + 1
-            if lbreakpos:
-                line = line[lbreakpos:]
-            if self.writeline(line):
-                super(LineFilterProgressHandler, self).write(line)
-
-    def writeline(self, line):
-        return True
-
-class BasicProgressHandler(ProgressHandler):
-    def __init__(self, d, regex=r'(\d+)%', outfile=None):
-        super(BasicProgressHandler, self).__init__(d, outfile)
-        self._regex = re.compile(regex)
-        # Send an initial progress event so the bar gets shown
-        self._fire_progress(0)
-
-    def write(self, string):
-        percs = self._regex.findall(string)
-        if percs:
-            progress = int(percs[-1])
-            self.update(progress)
-        super(BasicProgressHandler, self).write(string)
-
-class OutOfProgressHandler(ProgressHandler):
-    def __init__(self, d, regex, outfile=None):
-        super(OutOfProgressHandler, self).__init__(d, outfile)
-        self._regex = re.compile(regex)
-        # Send an initial progress event so the bar gets shown
-        self._fire_progress(0)
-
-    def write(self, string):
-        nums = self._regex.findall(string)
-        if nums:
-            progress = (float(nums[-1][0]) / float(nums[-1][1])) * 100
-            self.update(progress)
-        super(OutOfProgressHandler, self).write(string)
-
-class MultiStageProgressReporter(object):
-    """
-    Class which allows reporting progress without the caller
-    having to know where they are in the overall sequence. Useful
-    for tasks made up of python code spread across multiple
-    classes / functions - the progress reporter object can
-    be passed around or stored at the object level and calls
-    to next_stage() and update() made whereever needed.
-    """
-    def __init__(self, d, stage_weights, debug=False):
-        """
-        Initialise the progress reporter.
-
-        Parameters:
-        * d: the datastore (needed for firing the events)
-        * stage_weights: a list of weight values, one for each stage.
-          The value is scaled internally so you only need to specify
-          values relative to other values in the list, so if there
-          are two stages and the first takes 2s and the second takes
-          10s you would specify [2, 10] (or [1, 5], it doesn't matter).
-        * debug: specify True (and ensure you call finish() at the end)
-          in order to show a printout of the calculated stage weights
-          based on timing each stage. Use this to determine what the
-          weights should be when you're not sure.
-        """
-        self._data = d
-        total = sum(stage_weights)
-        self._stage_weights = [float(x)/total for x in stage_weights]
-        self._stage = -1
-        self._base_progress = 0
-        # Send an initial progress event so the bar gets shown
-        self._fire_progress(0)
-        self._debug = debug
-        self._finished = False
-        if self._debug:
-            self._last_time = time.time()
-            self._stage_times = []
-            self._stage_total = None
-            self._callers = []
-
-    def _fire_progress(self, taskprogress):
-        bb.event.fire(bb.build.TaskProgress(taskprogress), self._data)
-
-    def next_stage(self, stage_total=None):
-        """
-        Move to the next stage.
-        Parameters:
-        * stage_total: optional total for progress within the stage,
-          see update() for details
-        NOTE: you need to call this before the first stage.
-        """
-        self._stage += 1
-        self._stage_total = stage_total
-        if self._stage == 0:
-            # First stage
-            if self._debug:
-                self._last_time = time.time()
-        else:
-            if self._stage < len(self._stage_weights):
-                self._base_progress = sum(self._stage_weights[:self._stage]) * 100
-                if self._debug:
-                    currtime = time.time()
-                    self._stage_times.append(currtime - self._last_time)
-                    self._last_time = currtime
-                    self._callers.append(inspect.getouterframes(inspect.currentframe())[1])
-            elif not self._debug:
-                bb.warn('ProgressReporter: current stage beyond declared number of stages')
-                self._base_progress = 100
-            self._fire_progress(self._base_progress)
-
-    def update(self, stage_progress):
-        """
-        Update progress within the current stage.
-        Parameters:
-        * stage_progress: progress value within the stage. If stage_total
-          was specified when next_stage() was last called, then this
-          value is considered to be out of stage_total, otherwise it should
-          be a percentage value from 0 to 100.
-        """
-        if self._stage_total:
-            stage_progress = (float(stage_progress) / self._stage_total) * 100
-        if self._stage < 0:
-            bb.warn('ProgressReporter: update called before first call to next_stage()')
-        elif self._stage < len(self._stage_weights):
-            progress = self._base_progress + (stage_progress * self._stage_weights[self._stage])
-        else:
-            progress = self._base_progress
-        if progress > 100:
-            progress = 100
-        self._fire_progress(progress)
-
-    def finish(self):
-        if self._finished:
-            return
-        self._finished = True
-        if self._debug:
-            import math
-            self._stage_times.append(time.time() - self._last_time)
-            mintime = max(min(self._stage_times), 0.01)
-            self._callers.append(None)
-            stage_weights = [int(math.ceil(x / mintime)) for x in self._stage_times]
-            bb.warn('Stage weights: %s' % stage_weights)
-            out = []
-            for stage_weight, caller in zip(stage_weights, self._callers):
-                if caller:
-                    out.append('Up to %s:%d: %d' % (caller[1], caller[2], stage_weight))
-                else:
-                    out.append('Up to finish: %d' % stage_weight)
-            bb.warn('Stage times:\n  %s' % '\n  '.join(out))
-
-class MultiStageProcessProgressReporter(MultiStageProgressReporter):
-    """
-    Version of MultiStageProgressReporter intended for use with
-    standalone processes (such as preparing the runqueue)
-    """
-    def __init__(self, d, processname, stage_weights, debug=False):
-        self._processname = processname
-        self._started = False
-        MultiStageProgressReporter.__init__(self, d, stage_weights, debug)
-
-    def start(self):
-        if not self._started:
-            bb.event.fire(bb.event.ProcessStarted(self._processname, 100), self._data)
-            self._started = True
-
-    def _fire_progress(self, taskprogress):
-        if taskprogress == 0:
-            self.start()
-            return
-        bb.event.fire(bb.event.ProcessProgress(self._processname, taskprogress), self._data)
-
-    def finish(self):
-        MultiStageProgressReporter.finish(self)
-        bb.event.fire(bb.event.ProcessFinished(self._processname), self._data)
-
-class DummyMultiStageProcessProgressReporter(MultiStageProgressReporter):
-    """
-    MultiStageProcessProgressReporter that takes the calls and does nothing
-    with them (to avoid a bunch of "if progress_reporter:" checks)
-    """
-    def __init__(self):
-        MultiStageProcessProgressReporter.__init__(self, "", None, [])
-
-    def _fire_progress(self, taskprogress, rate=None):
-        pass
-
-    def start(self):
-        pass
-
-    def next_stage(self, stage_total=None):
-        pass
-
-    def update(self, stage_progress):
-        pass
-
-    def finish(self):
-        pass

bitbake/lib/bb/providers.py

@@ -48,6 +48,7 @@ def findProviders(cfgData, dataCache, pkg_pn = None):
 
     # Need to ensure data store is expanded
     localdata = data.createCopy(cfgData)
+    bb.data.update_data(localdata)
     bb.data.expandKeys(localdata)
 
     preferred_versions = {}
@@ -120,16 +121,13 @@ def findPreferredProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
     preferred_file = None
     preferred_ver = None
 
-    # pn can contain '_', e.g. gcc-cross-x86_64 and an override cannot
-    # hence we do this manually rather than use OVERRIDES
-    preferred_v = cfgData.getVar("PREFERRED_VERSION_pn-%s" % pn)
-    if not preferred_v:
-        preferred_v = cfgData.getVar("PREFERRED_VERSION_%s" % pn)
-    if not preferred_v:
-        preferred_v = cfgData.getVar("PREFERRED_VERSION")
+    localdata = data.createCopy(cfgData)
+    localdata.setVar('OVERRIDES', "%s:pn-%s:%s" % (data.getVar('OVERRIDES', localdata), pn, pn))
+    bb.data.update_data(localdata)
 
+    preferred_v = localdata.getVar('PREFERRED_VERSION', True)
     if preferred_v:
-        m = re.match(r'(\d+:)*(.*)(_.*)*', preferred_v)
+        m = re.match('(\d+:)*(.*)(_.*)*', preferred_v)
         if m:
             if m.group(1):
                 preferred_e = m.group(1)[:-1]
@@ -225,7 +223,7 @@ def findBestProvider(pn, cfgData, dataCache, pkg_pn = None, item = None):
 def _filterProviders(providers, item, cfgData, dataCache):
     """
     Take a list of providers and filter/reorder according to the
-    environment variables
+    environment variables and previous build results
     """
     eligible = []
     preferred_versions = {}
@@ -244,17 +242,17 @@ def _filterProviders(providers, item, cfgData, dataCache):
             pkg_pn[pn] = []
         pkg_pn[pn].append(p)
 
-    logger.debug(1, "providers for %s are: %s", item, list(sorted(pkg_pn.keys())))
+    logger.debug(1, "providers for %s are: %s", item, pkg_pn.keys())
 
     # First add PREFERRED_VERSIONS
-    for pn in sorted(pkg_pn):
+    for pn in pkg_pn:
         sortpkg_pn[pn] = sortPriorities(pn, dataCache, pkg_pn)
         preferred_versions[pn] = findPreferredProvider(pn, cfgData, dataCache, sortpkg_pn[pn], item)
         if preferred_versions[pn][1]:
             eligible.append(preferred_versions[pn][1])
 
     # Now add latest versions
-    for pn in sorted(sortpkg_pn):
+    for pn in sortpkg_pn:
         if pn in preferred_versions and preferred_versions[pn][1]:
             continue
         preferred_versions[pn] = findLatestProvider(pn, cfgData, dataCache, sortpkg_pn[pn][0])
@@ -282,13 +280,13 @@ def _filterProviders(providers, item, cfgData, dataCache):
 def filterProviders(providers, item, cfgData, dataCache):
     """
     Take a list of providers and filter/reorder according to the
-    environment variables
+    environment variables and previous build results
     Takes a "normal" target item
     """
 
     eligible = _filterProviders(providers, item, cfgData, dataCache)
 
-    prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % item)
+    prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % item, True)
     if prefervar:
         dataCache.preferred[item] = prefervar
 
@@ -310,56 +308,38 @@ def filterProviders(providers, item, cfgData, dataCache):
 def filterProvidersRunTime(providers, item, cfgData, dataCache):
     """
     Take a list of providers and filter/reorder according to the
-    environment variables
+    environment variables and previous build results
     Takes a "runtime" target item
     """
 
     eligible = _filterProviders(providers, item, cfgData, dataCache)
 
-    # First try and match any PREFERRED_RPROVIDER entry
-    prefervar = cfgData.getVar('PREFERRED_RPROVIDER_%s' % item)
-    foundUnique = False
-    if prefervar:
-        for p in eligible:
-            pn = dataCache.pkg_fn[p]
-            if prefervar == pn:
-                logger.verbose("selecting %s to satisfy %s due to PREFERRED_RPROVIDER", pn, item)
-                eligible.remove(p)
-                eligible = [p] + eligible
-                foundUnique = True
-                numberPreferred = 1
+    # Should use dataCache.preferred here?
+    preferred = []
+    preferred_vars = []
+    pns = {}
+    for p in eligible:
+        pns[dataCache.pkg_fn[p]] = p
+    for p in eligible:
+        pn = dataCache.pkg_fn[p]
+        provides = dataCache.pn_provides[pn]
+        for provide in provides:
+            prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % provide, True)
+            #logger.debug(1, "checking PREFERRED_PROVIDER_%s (value %s) against %s", provide, prefervar, pns.keys())
+            if prefervar in pns and pns[prefervar] not in preferred:
+                var = "PREFERRED_PROVIDER_%s = %s" % (provide, prefervar)
+                logger.verbose("selecting %s to satisfy runtime %s due to %s", prefervar, item, var)
+                preferred_vars.append(var)
+                pref = pns[prefervar]
+                eligible.remove(pref)
+                eligible = [pref] + eligible
+                preferred.append(pref)
                 break
 
-    # If we didn't find an RPROVIDER entry, try and infer the provider from PREFERRED_PROVIDER entries
-    # by looking through the provides of each eligible recipe and seeing if a PREFERRED_PROVIDER was set.
-    # This is most useful for virtual/ entries rather than having a RPROVIDER per entry.
-    if not foundUnique:
-        # Should use dataCache.preferred here?
-        preferred = []
-        preferred_vars = []
-        pns = {}
-        for p in eligible:
-            pns[dataCache.pkg_fn[p]] = p
-        for p in eligible:
-            pn = dataCache.pkg_fn[p]
-            provides = dataCache.pn_provides[pn]
-            for provide in provides:
-                prefervar = cfgData.getVar('PREFERRED_PROVIDER_%s' % provide)
-                #logger.debug(1, "checking PREFERRED_PROVIDER_%s (value %s) against %s", provide, prefervar, pns.keys())
-                if prefervar in pns and pns[prefervar] not in preferred:
-                    var = "PREFERRED_PROVIDER_%s = %s" % (provide, prefervar)
-                    logger.verbose("selecting %s to satisfy runtime %s due to %s", prefervar, item, var)
-                    preferred_vars.append(var)
-                    pref = pns[prefervar]
-                    eligible.remove(pref)
-                    eligible = [pref] + eligible
-                    preferred.append(pref)
-                    break
-
-        numberPreferred = len(preferred)
+    numberPreferred = len(preferred)
 
     if numberPreferred > 1:
-        logger.error("Trying to resolve runtime dependency %s resulted in conflicting PREFERRED_PROVIDER entries being found.\nThe providers found were: %s\nThe PREFERRED_PROVIDER entries resulting in this conflict were: %s. You could set PREFERRED_RPROVIDER_%s" % (item, preferred, preferred_vars, item))
+        logger.error("Trying to resolve runtime dependency %s resulted in conflicting PREFERRED_PROVIDER entries being found.\nThe providers found were: %s\nThe PREFERRED_PROVIDER entries resulting in this conflict were: %s", item, preferred, preferred_vars)
 
     logger.debug(1, "sorted runtime providers for %s are: %s", item, eligible)
 
@@ -384,7 +364,7 @@ def getRuntimeProviders(dataCache, rdepend):
 
     # Only search dynamic packages if we can't find anything in other variables
     for pattern in dataCache.packages_dynamic:
-        pattern = pattern.replace(r'+', r"\+")
+        pattern = pattern.replace('+', "\+")
         if pattern in regexp_cache:
             regexp = regexp_cache[pattern]
         else:
@@ -399,32 +379,3 @@ def getRuntimeProviders(dataCache, rdepend):
             logger.debug(1, "Assuming %s is a dynamic package, but it may not exist" % rdepend)
 
     return rproviders
-
-
-def buildWorldTargetList(dataCache, task=None):
-    """
-    Build package list for "bitbake world"
-    """
-    if dataCache.world_target:
-        return
-
-    logger.debug(1, "collating packages for \"world\"")
-    for f in dataCache.possible_world:
-        terminal = True
-        pn = dataCache.pkg_fn[f]
-        if task and task not in dataCache.task_deps[f]['tasks']:
-            logger.debug(2, "World build skipping %s as task %s doesn't exist", f, task)
-            terminal = False
-
-        for p in dataCache.pn_provides[pn]:
-            if p.startswith('virtual/'):
-                logger.debug(2, "World build skipping %s due to %s provider starting with virtual/", f, p)
-                terminal = False
-                break
-            for pf in dataCache.providers[p]:
-                if dataCache.pkg_fn[pf] != pn:
-                    logger.debug(2, "World build skipping %s due to both us and %s providing %s", f, pf, p)
-                    terminal = False
-                    break
-        if terminal:
-            dataCache.world_target.add(pn)

bitbake/lib/bb/pysh/builtin.py

@@ -0,0 +1,710 @@
+# builtin.py - builtins and utilities definitions for pysh.
+#
+# Copyright 2007 Patrick Mezard
+#
+# This software may be used and distributed according to the terms
+# of the GNU General Public License, incorporated herein by reference.
+
+"""Builtin and internal utilities implementations.
+
+- Beware not to use python interpreter environment as if it were the shell
+environment. For instance, commands working directory must be explicitely handled
+through env['PWD'] instead of relying on python working directory.
+"""
+import errno
+import optparse
+import os
+import re
+import subprocess
+import sys
+import time
+
+def has_subprocess_bug():
+    return getattr(subprocess, 'list2cmdline') and \
+       (    subprocess.list2cmdline(['']) == '' or \
+            subprocess.list2cmdline(['foo|bar']) == 'foo|bar')
+            
+# Detect python bug 1634343: "subprocess swallows empty arguments under win32"
+# <http://sourceforge.net/tracker/index.php?func=detail&aid=1634343&group_id=5470&atid=105470>
+# Also detect: "[ 1710802 ] subprocess must escape redirection characters under win32"
+# <http://sourceforge.net/tracker/index.php?func=detail&aid=1710802&group_id=5470&atid=105470>
+if has_subprocess_bug():
+    import subprocess_fix
+    subprocess.list2cmdline = subprocess_fix.list2cmdline
+
+from sherrors import *
+
+class NonExitingParser(optparse.OptionParser):
+    """OptionParser default behaviour upon error is to print the error message and
+    exit. Raise a utility error instead.
+    """
+    def error(self, msg):
+        raise UtilityError(msg)
+
+#-------------------------------------------------------------------------------  
+# set special builtin
+#-------------------------------------------------------------------------------  
+OPT_SET = NonExitingParser(usage="set - set or unset options and positional parameters")
+OPT_SET.add_option( '-f', action='store_true', dest='has_f', default=False,
+    help='The shell shall disable pathname expansion.')
+OPT_SET.add_option('-e', action='store_true', dest='has_e', default=False,
+    help="""When this option is on, if a simple command fails for any of the \
+    reasons listed in Consequences of Shell Errors or returns an exit status \
+    value >0, and is not part of the compound list following a while, until, \
+    or if keyword, and is not a part of an AND or OR list, and is not a \
+    pipeline preceded by the ! reserved word, then the shell shall immediately \
+    exit.""")
+OPT_SET.add_option('-x', action='store_true', dest='has_x', default=False,
+    help="""The shell shall write to standard error a trace for each command \
+    after it expands the command and before it executes it. It is unspecified \
+    whether the command that turns tracing off is traced.""")
+
+def builtin_set(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    option, args = OPT_SET.parse_args(args)
+    env = interp.get_env()
+    
+    if option.has_f:
+        env.set_opt('-f')
+    if option.has_e:
+        env.set_opt('-e')
+    if option.has_x:
+        env.set_opt('-x')
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# shift special builtin
+#-------------------------------------------------------------------------------  
+def builtin_shift(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    params = interp.get_env().get_positional_args()
+    if args:
+        try:
+            n = int(args[0])
+            if n > len(params):
+                raise ValueError()
+        except ValueError:
+            return 1
+    else:
+        n = 1
+        
+    params[:n] = []
+    interp.get_env().set_positional_args(params)
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# export special builtin
+#-------------------------------------------------------------------------------  
+OPT_EXPORT = NonExitingParser(usage="set - set or unset options and positional parameters")
+OPT_EXPORT.add_option('-p', action='store_true', dest='has_p', default=False)
+
+def builtin_export(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    option, args = OPT_EXPORT.parse_args(args)
+    if option.has_p:
+        raise NotImplementedError()
+    
+    for arg in args:
+        try:
+            name, value = arg.split('=', 1)
+        except ValueError:
+            name, value = arg, None
+        env = interp.get_env().export(name, value)
+    
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# return special builtin
+#-------------------------------------------------------------------------------  
+def builtin_return(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    res = 0
+    if args:
+        try:
+            res = int(args[0])
+        except ValueError:
+            res = 0
+        if not 0<=res<=255:
+            res = 0
+            
+    # BUG: should be last executed command exit code        
+    raise ReturnSignal(res)
+
+#-------------------------------------------------------------------------------  
+# trap special builtin
+#-------------------------------------------------------------------------------  
+def builtin_trap(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    if len(args) < 2:
+        stderr.write('trap: usage: trap [[arg] signal_spec ...]\n')
+        return 2
+
+    action = args[0]
+    for sig in args[1:]:
+        try:
+            env.traps[sig] = action
+        except Exception as e:
+            stderr.write('trap: %s\n' % str(e))
+    return 0
+
+#-------------------------------------------------------------------------------  
+# unset special builtin
+#-------------------------------------------------------------------------------
+OPT_UNSET = NonExitingParser("unset - unset values and attributes of variables and functions")
+OPT_UNSET.add_option( '-f', action='store_true', dest='has_f', default=False)
+OPT_UNSET.add_option( '-v', action='store_true', dest='has_v', default=False)
+
+def builtin_unset(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    option, args = OPT_UNSET.parse_args(args)
+    
+    status = 0
+    env = interp.get_env()
+    for arg in args:    
+        try:
+            if option.has_f:
+                env.remove_function(arg)
+            else:
+                del env[arg]
+        except KeyError:
+            pass
+        except VarAssignmentError:
+            status = 1
+            
+    return status
+
+#-------------------------------------------------------------------------------  
+# wait special builtin
+#-------------------------------------------------------------------------------  
+def builtin_wait(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    return interp.wait([int(arg) for arg in args])
+
+#-------------------------------------------------------------------------------  
+# cat utility
+#-------------------------------------------------------------------------------
+def utility_cat(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    if not args:
+        args = ['-']
+
+    status = 0
+    for arg in args:
+        if arg == '-':
+            data = stdin.read()
+        else:
+            path = os.path.join(env['PWD'], arg)
+            try:
+                f = file(path, 'rb')
+                try:
+                    data = f.read()
+                finally:
+                    f.close()
+            except IOError as e:
+                if e.errno != errno.ENOENT:
+                    raise
+                status = 1
+                continue
+        stdout.write(data)
+        stdout.flush()
+    return status
+    
+#-------------------------------------------------------------------------------  
+# cd utility
+#-------------------------------------------------------------------------------  
+OPT_CD = NonExitingParser("cd - change the working directory")
+
+def utility_cd(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    option, args = OPT_CD.parse_args(args)
+    env = interp.get_env()
+    
+    directory = None
+    printdir = False
+    if not args:
+        home = env.get('HOME')
+        if home:
+            # Unspecified, do nothing
+            return 0
+        else:
+            directory = home
+    elif len(args)==1:
+        directory = args[0]
+        if directory=='-':
+            if 'OLDPWD' not in env:
+                raise UtilityError("OLDPWD not set")
+            printdir = True
+            directory = env['OLDPWD']
+    else:
+        raise UtilityError("too many arguments")
+            
+    curpath = None
+    # Absolute directories will be handled correctly by the os.path.join call.
+    if not directory.startswith('.') and not directory.startswith('..'):
+        cdpaths = env.get('CDPATH', '.').split(';')
+        for cdpath in cdpaths:
+            p = os.path.join(cdpath, directory)
+            if os.path.isdir(p):
+                curpath = p
+                break
+    
+    if curpath is None:
+        curpath = directory
+    curpath = os.path.join(env['PWD'], directory)
+
+    env['OLDPWD'] = env['PWD']
+    env['PWD'] = curpath
+    if printdir:
+        stdout.write('%s\n' % curpath)
+    return 0
+
+#-------------------------------------------------------------------------------  
+# colon utility
+#-------------------------------------------------------------------------------  
+def utility_colon(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# echo utility
+#-------------------------------------------------------------------------------  
+def utility_echo(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    # Echo only takes arguments, no options. Use printf if you need fancy stuff.
+    output = ' '.join(args) + '\n'
+    stdout.write(output)
+    stdout.flush()
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# egrep utility
+#-------------------------------------------------------------------------------
+# egrep is usually a shell script.
+# Unfortunately, pysh does not support shell scripts *with arguments* right now,
+# so the redirection is implemented here, assuming grep is available.
+def utility_egrep(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    return run_command('grep', ['-E'] + args, interp, env, stdin, stdout, 
+        stderr, debugflags)
+    
+#-------------------------------------------------------------------------------  
+# env utility
+#-------------------------------------------------------------------------------  
+def utility_env(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    
+    if args and args[0]=='-i':
+        raise NotImplementedError('env: -i option is not implemented')
+    
+    i = 0
+    for arg in args:
+        if '=' not in arg:
+            break
+        # Update the current environment
+        name, value = arg.split('=', 1)
+        env[name] = value
+        i += 1
+        
+    if args[i:]:
+        # Find then execute the specified interpreter
+        utility = env.find_in_path(args[i])
+        if not utility:
+            return 127
+        args[i:i+1] = utility
+        name = args[i]
+        args = args[i+1:]
+        try:
+            return run_command(name, args, interp, env, stdin, stdout, stderr, 
+                debugflags)
+        except UtilityError:
+            stderr.write('env: failed to execute %s' % ' '.join([name]+args))
+            return 126            
+    else:
+        for pair in env.get_variables().iteritems():
+            stdout.write('%s=%s\n' % pair)
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# exit utility
+#-------------------------------------------------------------------------------
+def utility_exit(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    res = None
+    if args:
+        try:
+            res = int(args[0])
+        except ValueError:
+            res = None
+        if not 0<=res<=255:
+            res = None
+            
+    if res is None:
+        # BUG: should be last executed command exit code
+        res = 0
+        
+    raise ExitSignal(res)
+
+#-------------------------------------------------------------------------------  
+# fgrep utility
+#-------------------------------------------------------------------------------
+# see egrep
+def utility_fgrep(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    return run_command('grep', ['-F'] + args, interp, env, stdin, stdout, 
+        stderr, debugflags)
+
+#-------------------------------------------------------------------------------  
+# gunzip utility
+#-------------------------------------------------------------------------------
+# see egrep
+def utility_gunzip(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    return run_command('gzip', ['-d'] + args, interp, env, stdin, stdout, 
+        stderr, debugflags)
+    
+#-------------------------------------------------------------------------------  
+# kill utility
+#-------------------------------------------------------------------------------
+def utility_kill(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    for arg in args:
+        pid = int(arg)
+        status = subprocess.call(['pskill', '/T', str(pid)],
+                                shell=True,
+                                stdout=subprocess.PIPE,
+                                stderr=subprocess.PIPE)
+        # pskill is asynchronous, hence the stupid polling loop
+        while 1:
+            p = subprocess.Popen(['pslist', str(pid)],
+                                shell=True,
+                                stdout=subprocess.PIPE,
+                                stderr=subprocess.STDOUT)
+            output = p.communicate()[0]
+            if ('process %d was not' % pid) in output:
+                break
+            time.sleep(1)
+    return status
+    
+#-------------------------------------------------------------------------------  
+# mkdir utility
+#-------------------------------------------------------------------------------
+OPT_MKDIR = NonExitingParser("mkdir - make directories.")
+OPT_MKDIR.add_option('-p', action='store_true', dest='has_p', default=False)
+
+def utility_mkdir(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    # TODO: implement umask
+    # TODO: implement proper utility error report
+    option, args = OPT_MKDIR.parse_args(args)
+    for arg in args:
+        path = os.path.join(env['PWD'], arg)
+        if option.has_p:
+            try:
+                os.makedirs(path)
+            except IOError as e:
+                if e.errno != errno.EEXIST:
+                    raise
+        else:               
+            os.mkdir(path)
+    return 0
+
+#-------------------------------------------------------------------------------  
+# netstat utility
+#-------------------------------------------------------------------------------
+def utility_netstat(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    # Do you really expect me to implement netstat ?
+    # This empty form is enough for Mercurial tests since it's
+    # supposed to generate nothing upon success. Faking this test
+    # is not a big deal either.
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# pwd utility
+#-------------------------------------------------------------------------------  
+OPT_PWD = NonExitingParser("pwd - return working directory name")
+OPT_PWD.add_option('-L', action='store_true', dest='has_L', default=True,
+    help="""If the PWD environment variable contains an absolute pathname of \
+    the current directory that does not contain the filenames dot or dot-dot, \
+    pwd shall write this pathname to standard output. Otherwise, the -L option \
+    shall behave as the -P option.""")
+OPT_PWD.add_option('-P', action='store_true', dest='has_L', default=False,
+    help="""The absolute pathname written shall not contain filenames that, in \
+    the context of the pathname, refer to files of type symbolic link.""")
+
+def utility_pwd(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    option, args = OPT_PWD.parse_args(args)        
+    stdout.write('%s\n' % env['PWD'])
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# printf utility
+#-------------------------------------------------------------------------------
+RE_UNESCAPE = re.compile(r'(\\x[a-zA-Z0-9]{2}|\\[0-7]{1,3}|\\.)')
+
+def utility_printf(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    def replace(m):
+        assert m.group()
+        g = m.group()[1:]
+        if g.startswith('x'):
+            return chr(int(g[1:], 16))
+        if len(g) <= 3 and len([c for c in g if c in '01234567']) == len(g):
+            # Yay, an octal number
+            return chr(int(g, 8))
+        return {
+            'a': '\a',
+            'b': '\b',
+            'f': '\f',
+            'n': '\n',
+            'r': '\r',
+            't': '\t',
+            'v': '\v',
+            '\\': '\\',
+        }.get(g)
+        
+    # Convert escape sequences
+    format = re.sub(RE_UNESCAPE, replace, args[0])
+    stdout.write(format % tuple(args[1:]))
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# true utility
+#-------------------------------------------------------------------------------
+def utility_true(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    return 0
+
+#-------------------------------------------------------------------------------  
+# sed utility
+#-------------------------------------------------------------------------------
+RE_SED = re.compile(r'^s(.).*\1[a-zA-Z]*$')
+
+# cygwin sed fails with some expressions when they do not end with a single space.
+# see unit tests for details. Interestingly, the same expressions works perfectly
+# in cygwin shell.
+def utility_sed(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    # Scan pattern arguments and append a space if necessary
+    for i in xrange(len(args)):
+        if not RE_SED.search(args[i]):
+            continue
+        args[i] = args[i] + ' '
+
+    return run_command(name, args, interp, env, stdin, stdout, 
+        stderr, debugflags)
+
+#-------------------------------------------------------------------------------  
+# sleep utility
+#-------------------------------------------------------------------------------
+def utility_sleep(name, args, interp, env, stdin, stdout, stderr, debugflags):
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+    time.sleep(int(args[0]))
+    return 0
+    
+#-------------------------------------------------------------------------------  
+# sort utility
+#-------------------------------------------------------------------------------
+OPT_SORT = NonExitingParser("sort - sort, merge, or sequence check text files")
+
+def utility_sort(name, args, interp, env, stdin, stdout, stderr, debugflags):
+
+    def sort(path):
+        if path == '-':
+            lines = stdin.readlines()
+        else:
+            try:
+                f = file(path)
+                try:
+                    lines = f.readlines()
+                finally:
+                    f.close()
+            except IOError as e:
+                stderr.write(str(e) + '\n')
+                return 1
+        
+        if lines and lines[-1][-1]!='\n':
+            lines[-1] = lines[-1] + '\n'
+        return lines
+    
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+        
+    option, args = OPT_SORT.parse_args(args)
+    alllines = []
+    
+    if len(args)<=0:
+        args += ['-']
+        
+    # Load all files lines
+    curdir = os.getcwd()
+    try:
+        os.chdir(env['PWD'])
+        for path in args:
+            alllines += sort(path)
+    finally:
+        os.chdir(curdir)
+            
+    alllines.sort()
+    for line in alllines:
+        stdout.write(line)
+    return 0
+    
+#-------------------------------------------------------------------------------
+# hg utility
+#-------------------------------------------------------------------------------
+
+hgcommands = [
+    'add',
+    'addremove',
+    'commit', 'ci',
+    'debugrename',
+    'debugwalk',
+    'falabala', # Dummy command used in a mercurial test
+    'incoming',
+    'locate',
+    'pull',
+    'push',
+    'qinit',
+    'remove', 'rm',
+    'rename', 'mv',
+    'revert',    
+    'showconfig',
+    'status', 'st',
+    'strip',
+    ]
+
+def rewriteslashes(name, args):
+    # Several hg commands output file paths, rewrite the separators
+    if len(args) > 1 and name.lower().endswith('python') \
+       and args[0].endswith('hg'):
+        for cmd in hgcommands:
+            if cmd in args[1:]:
+                return True
+            
+    # svn output contains many paths with OS specific separators.
+    # Normalize these to unix paths.
+    base = os.path.basename(name)
+    if base.startswith('svn'):
+        return True
+    
+    return False
+
+def rewritehg(output):
+    if not output:
+        return output
+    # Rewrite os specific messages
+    output = output.replace(': The system cannot find the file specified',
+                            ': No such file or directory')
+    output = re.sub(': Access is denied.*$', ': Permission denied', output)
+    output = output.replace(': No connection could be made because the target machine actively refused it',
+                            ': Connection refused')
+    return output
+                            
+
+def run_command(name, args, interp, env, stdin, stdout,
+                stderr, debugflags):
+    # Execute the command
+    if 'debug-utility' in debugflags:
+        print interp.log(' '.join([name, str(args), interp['PWD']]) + '\n')
+
+    hgbin = interp.options().hgbinary
+    ishg = hgbin and ('hg' in name or args and 'hg' in args[0])
+    unixoutput = 'cygwin' in name or ishg
+    
+    exec_env = env.get_variables()        
+    try:
+        # BUG: comparing file descriptor is clearly not a reliable way to tell
+        # whether they point on the same underlying object. But in pysh limited
+        # scope this is usually right, we do not expect complicated redirections
+        # besides usual 2>&1.
+        # Still there is one case we have but cannot deal with is when stdout
+        # and stderr are redirected *by pysh caller*. This the reason for the
+        # --redirect pysh() option.
+        # Now, we want to know they are the same because we sometimes need to 
+        # transform the command output, mostly remove CR-LF to ensure that
+        # command output is unix-like. Cygwin utilies are a special case because
+        # they explicitely set their output streams to binary mode, so we have
+        # nothing to do. For all others commands, we have to guess whether they
+        # are sending text data, in which case the transformation must be done.
+        # Again, the NUL character test is unreliable but should be enough for
+        # hg tests.
+        redirected = stdout.fileno()==stderr.fileno()
+        if not redirected:
+            p = subprocess.Popen([name] + args, cwd=env['PWD'], env=exec_env, 
+                    stdin=stdin, stdout=subprocess.PIPE, stderr=subprocess.PIPE)
+        else:
+            p = subprocess.Popen([name] + args, cwd=env['PWD'], env=exec_env, 
+                    stdin=stdin, stdout=subprocess.PIPE, stderr=subprocess.STDOUT)
+        out, err = p.communicate()
+    except WindowsError as e:
+        raise UtilityError(str(e))
+
+    if not unixoutput:
+        def encode(s):
+            if '\0' in s:
+                return s
+            return s.replace('\r\n', '\n')
+    else:
+        encode = lambda s: s
+
+    if rewriteslashes(name, args):
+        encode1_ = encode
+        def encode(s):
+            s = encode1_(s)
+            s = s.replace('\\\\', '\\')
+            s = s.replace('\\', '/')
+            return s
+
+    if ishg:
+        encode2_ = encode
+        def encode(s):
+            return rewritehg(encode2_(s))
+    
+    stdout.write(encode(out))
+    if not redirected:
+        stderr.write(encode(err))
+    return p.returncode
+            

bitbake/lib/bb/pysh/lsprof.py

@@ -0,0 +1,116 @@
+#! /usr/bin/env python
+
+import sys
+from _lsprof import Profiler, profiler_entry
+
+__all__ = ['profile', 'Stats']
+
+def profile(f, *args, **kwds):
+    """XXX docstring"""
+    p = Profiler()
+    p.enable(subcalls=True, builtins=True)
+    try:
+        f(*args, **kwds)
+    finally:
+        p.disable()
+    return Stats(p.getstats())
+
+
+class Stats(object):
+    """XXX docstring"""
+
+    def __init__(self, data):
+        self.data = data
+
+    def sort(self, crit="inlinetime"):
+        """XXX docstring"""
+        if crit not in profiler_entry.__dict__:
+            raise ValueError("Can't sort by %s" % crit)
+        self.data.sort(lambda b, a: cmp(getattr(a, crit),
+                                        getattr(b, crit)))
+        for e in self.data:
+            if e.calls:
+                e.calls.sort(lambda b, a: cmp(getattr(a, crit),
+                                              getattr(b, crit)))
+
+    def pprint(self, top=None, file=None, limit=None, climit=None):
+        """XXX docstring"""
+        if file is None:
+            file = sys.stdout
+        d = self.data
+        if top is not None:
+            d = d[:top]
+        cols = "% 12s %12s %11.4f %11.4f   %s\n"
+        hcols = "% 12s %12s %12s %12s %s\n"
+        cols2 = "+%12s %12s %11.4f %11.4f +  %s\n"
+        file.write(hcols % ("CallCount", "Recursive", "Total(ms)",
+                            "Inline(ms)", "module:lineno(function)"))
+        count = 0
+        for e in d:
+            file.write(cols % (e.callcount, e.reccallcount, e.totaltime,
+                               e.inlinetime, label(e.code)))
+            count += 1
+            if limit is not None and count == limit:
+                return
+            ccount = 0
+            if e.calls:
+                for se in e.calls:
+                    file.write(cols % ("+%s" % se.callcount, se.reccallcount,
+                                       se.totaltime, se.inlinetime,
+                                       "+%s" % label(se.code)))
+                    count += 1
+                    ccount += 1
+                    if limit is not None and count == limit:
+                        return
+                    if climit is not None and ccount == climit:
+                        break
+
+    def freeze(self):
+        """Replace all references to code objects with string
+        descriptions; this makes it possible to pickle the instance."""
+
+        # this code is probably rather ickier than it needs to be!
+        for i in range(len(self.data)):
+            e = self.data[i]
+            if not isinstance(e.code, str):
+                self.data[i] = type(e)((label(e.code),) + e[1:])
+            if e.calls:
+                for j in range(len(e.calls)):
+                    se = e.calls[j]
+                    if not isinstance(se.code, str):
+                        e.calls[j] = type(se)((label(se.code),) + se[1:])
+
+_fn2mod = {}
+
+def label(code):
+    if isinstance(code, str):
+        return code
+    try:
+        mname = _fn2mod[code.co_filename]
+    except KeyError:
+        for k, v in sys.modules.items():
+            if v is None:
+                continue
+            if not hasattr(v, '__file__'):
+                continue
+            if not isinstance(v.__file__, str):
+                continue
+            if v.__file__.startswith(code.co_filename):
+                mname = _fn2mod[code.co_filename] = k
+                break
+        else:
+            mname = _fn2mod[code.co_filename] = '<%s>'%code.co_filename
+
+    return '%s:%d(%s)' % (mname, code.co_firstlineno, code.co_name)
+
+
+if __name__ == '__main__':
+    import os
+    sys.argv = sys.argv[1:]
+    if not sys.argv:
+        print >> sys.stderr, "usage: lsprof.py <script> <arguments...>"
+        sys.exit(2)
+    sys.path.insert(0, os.path.abspath(os.path.dirname(sys.argv[0])))
+    stats = profile(execfile, sys.argv[0], globals(), locals())
+    stats.sort()
+    stats.pprint()

bitbake/lib/bb/pysh/pysh.py

@@ -0,0 +1,167 @@
+# pysh.py - command processing for pysh.
+#
+# Copyright 2007 Patrick Mezard
+#
+# This software may be used and distributed according to the terms
+# of the GNU General Public License, incorporated herein by reference.
+
+import optparse
+import os
+import sys
+
+import interp
+
+SH_OPT = optparse.OptionParser(prog='pysh', usage="%prog [OPTIONS]", version='0.1')
+SH_OPT.add_option('-c', action='store_true', dest='command_string', default=None, 
+    help='A string that shall be interpreted by the shell as one or more commands')
+SH_OPT.add_option('--redirect-to', dest='redirect_to', default=None, 
+    help='Redirect script commands stdout and stderr to the specified file')
+# See utility_command in builtin.py about the reason for this flag.
+SH_OPT.add_option('--redirected', dest='redirected', action='store_true', default=False, 
+    help='Tell the interpreter that stdout and stderr are actually the same objects, which is really stdout')
+SH_OPT.add_option('--debug-parsing', action='store_true', dest='debug_parsing', default=False, 
+    help='Trace PLY execution')
+SH_OPT.add_option('--debug-tree', action='store_true', dest='debug_tree', default=False, 
+    help='Display the generated syntax tree.')
+SH_OPT.add_option('--debug-cmd', action='store_true', dest='debug_cmd', default=False, 
+    help='Trace command execution before parameters expansion and exit status.')
+SH_OPT.add_option('--debug-utility', action='store_true', dest='debug_utility', default=False, 
+    help='Trace utility calls, after parameters expansions')
+SH_OPT.add_option('--ast', action='store_true', dest='ast', default=False,
+    help='Encoded commands to execute in a subprocess')
+SH_OPT.add_option('--profile', action='store_true', default=False,
+    help='Profile pysh run')
+    
+    
+def split_args(args):
+    # Separate shell arguments from command ones
+    # Just stop at the first argument not starting with a dash. I know, this is completely broken,
+    # it ignores files starting with a dash or may take option values for command file. This is not
+    # supposed to happen for now
+    command_index = len(args)
+    for i,arg in enumerate(args):
+        if not arg.startswith('-'):
+            command_index = i
+            break
+            
+    return args[:command_index], args[command_index:]
+
+
+def fixenv(env):
+    path = env.get('PATH')
+    if path is not None:
+        parts = path.split(os.pathsep)
+        # Remove Windows utilities from PATH, they are useless at best and
+        # some of them (find) may be confused with other utilities.
+        parts = [p for p in parts if 'system32' not in p.lower()]
+        env['PATH'] = os.pathsep.join(parts)
+    if env.get('HOME') is None:
+        # Several utilities, including cvsps, cannot work without
+        # a defined HOME directory.
+        env['HOME'] = os.path.expanduser('~')
+    return env
+
+def _sh(cwd, shargs, cmdargs, options, debugflags=None, env=None):
+    if os.environ.get('PYSH_TEXT') != '1':
+        import msvcrt
+        for fp in (sys.stdin, sys.stdout, sys.stderr):
+            msvcrt.setmode(fp.fileno(), os.O_BINARY)
+
+    hgbin = os.environ.get('PYSH_HGTEXT') != '1'
+    
+    if debugflags is None:
+        debugflags = []
+        if options.debug_parsing:    debugflags.append('debug-parsing')
+        if options.debug_utility:    debugflags.append('debug-utility')
+        if options.debug_cmd:        debugflags.append('debug-cmd')
+        if options.debug_tree:       debugflags.append('debug-tree')
+    
+    if env is None:
+        env = fixenv(dict(os.environ))
+    if cwd is None:
+        cwd = os.getcwd()
+
+    if not cmdargs:
+        # Nothing to do
+        return 0
+
+    ast = None
+    command_file = None
+    if options.command_string:
+        input = cmdargs[0]
+        if not options.ast:
+            input += '\n'
+        else:
+            args, input = interp.decodeargs(input), None
+            env, ast = args
+            cwd = env.get('PWD', cwd)
+    else:
+        command_file = cmdargs[0]
+        arguments = cmdargs[1:]
+
+        prefix = interp.resolve_shebang(command_file, ignoreshell=True)
+        if prefix:
+            input = ' '.join(prefix + [command_file] + arguments)
+        else:
+            # Read commands from file
+            f = file(command_file)
+            try:
+                # Trailing newline to help the parser
+                input = f.read() + '\n'
+            finally:
+                f.close()
+    
+    redirect = None
+    try:
+        if options.redirected:
+            stdout = sys.stdout
+            stderr = stdout
+        elif options.redirect_to:
+            redirect = open(options.redirect_to, 'wb')
+            stdout = redirect
+            stderr = redirect
+        else:
+            stdout = sys.stdout
+            stderr = sys.stderr
+            
+        # TODO: set arguments to environment variables
+        opts = interp.Options()
+        opts.hgbinary = hgbin
+        ip = interp.Interpreter(cwd, debugflags, stdout=stdout, stderr=stderr,
+                                opts=opts)
+        try:
+            # Export given environment in shell object
+            for k,v in env.iteritems():
+                ip.get_env().export(k,v)
+            return ip.execute_script(input, ast, scriptpath=command_file)
+        finally:
+            ip.close()
+    finally:
+        if redirect is not None:
+            redirect.close()
+
+def sh(cwd=None, args=None, debugflags=None, env=None):
+    if args is None:
+        args = sys.argv[1:]
+    shargs, cmdargs = split_args(args)
+    options, shargs = SH_OPT.parse_args(shargs)
+
+    if options.profile:
+        import lsprof
+        p = lsprof.Profiler()
+        p.enable(subcalls=True)
+        try:
+            return _sh(cwd, shargs, cmdargs, options, debugflags, env)
+        finally:
+            p.disable()
+            stats = lsprof.Stats(p.getstats())
+            stats.sort()
+            stats.pprint(top=10, file=sys.stderr, climit=5)
+    else:
+        return _sh(cwd, shargs, cmdargs, options, debugflags, env)
+            
+def main():
+    sys.exit(sh())
+
+if __name__=='__main__':
+    main()

bitbake/lib/bb/pysh/pyshlex.py

@@ -13,9 +13,14 @@
 # PLY in pull mode. It was designed to work incrementally and it would not be
 # that hard to enable pull mode.
 import re
+try:
+    s = set()
+    del s
+except NameError:
+    from Set import Set as set
 
 from ply import lex
-from bb.pysh.sherrors import *
+from sherrors import *
 
 class NeedMore(Exception):
     pass

bitbake/lib/bb/pysh/pyshyacc.py

@@ -10,11 +10,11 @@
 import os.path
 import sys
 
-import bb.pysh.pyshlex as pyshlex
+import pyshlex
 tokens = pyshlex.tokens
 
 from ply import yacc
-import bb.pysh.sherrors as sherrors
+import sherrors
     
 class IORedirect:
     def __init__(self, op, filename, io_number=None):
@@ -636,16 +636,13 @@ def p_empty(p):
 def p_error(p):
     msg = []
     w = msg.append
-    if p:
-        w('%r\n' % p)
-        w('followed by:\n')
-        for i in range(5):
-            n = yacc.token()
-            if not n:
-                break
-            w('  %r\n' % n)
-    else:
-        w('Unexpected EOF')
+    w('%r\n' % p)
+    w('followed by:\n')
+    for i in range(5):
+        n = yacc.token()
+        if not n:
+            break
+        w('  %r\n' % n)
     raise sherrors.ShellSyntaxError(''.join(msg))
 
 # Build the parser

bitbake/lib/bb/pysh/sherrors.py

@@ -13,3 +13,29 @@ class ShellError(Exception):
 
 class ShellSyntaxError(ShellError):
     pass
+    
+class UtilityError(ShellError):
+    """Raised upon utility syntax error (option or operand error)."""
+    pass
+   
+class ExpansionError(ShellError):
+    pass
+     
+class CommandNotFound(ShellError):
+    """Specified command was not found."""
+    pass
+    
+class RedirectionError(ShellError):
+    pass
+    
+class VarAssignmentError(ShellError):
+    """Variable assignment error."""
+    pass
+    
+class ExitSignal(ShellError):
+    """Exit signal."""
+    pass
+    
+class ReturnSignal(ShellError):
+    """Exit signal."""
+    pass

bitbake/lib/bb/pysh/subprocess_fix.py

@@ -0,0 +1,77 @@
+# subprocess - Subprocesses with accessible I/O streams
+#
+# For more information about this module, see PEP 324.
+#
+# This module should remain compatible with Python 2.2, see PEP 291.
+#
+# Copyright (c) 2003-2005 by Peter Astrand <astrand@lysator.liu.se>
+#
+# Licensed to PSF under a Contributor Agreement.
+# See http://www.python.org/2.4/license for licensing details.
+
+def list2cmdline(seq):
+    """
+    Translate a sequence of arguments into a command line
+    string, using the same rules as the MS C runtime:
+
+    1) Arguments are delimited by white space, which is either a
+       space or a tab.
+
+    2) A string surrounded by double quotation marks is
+       interpreted as a single argument, regardless of white space
+       contained within.  A quoted string can be embedded in an
+       argument.
+
+    3) A double quotation mark preceded by a backslash is
+       interpreted as a literal double quotation mark.
+
+    4) Backslashes are interpreted literally, unless they
+       immediately precede a double quotation mark.
+
+    5) If backslashes immediately precede a double quotation mark,
+       every pair of backslashes is interpreted as a literal
+       backslash.  If the number of backslashes is odd, the last
+       backslash escapes the next double quotation mark as
+       described in rule 3.
+    """
+
+    # See
+    # http://msdn.microsoft.com/library/en-us/vccelng/htm/progs_12.asp
+    result = []
+    needquote = False
+    for arg in seq:
+        bs_buf = []
+
+        # Add a space to separate this argument from the others
+        if result:
+            result.append(' ')
+
+        needquote = (" " in arg) or ("\t" in arg) or ("|" in arg) or arg == ""
+        if needquote:
+            result.append('"')
+
+        for c in arg:
+            if c == '\\':
+                # Don't know if we need to double yet.
+                bs_buf.append(c)
+            elif c == '"':
+                # Double backspaces.
+                result.append('\\' * len(bs_buf)*2)
+                bs_buf = []
+                result.append('\\"')
+            else:
+                # Normal char
+                if bs_buf:
+                    result.extend(bs_buf)
+                    bs_buf = []
+                result.append(c)
+
+        # Add remaining backspaces, if any.
+        if bs_buf:
+            result.extend(bs_buf)
+
+        if needquote:
+            result.extend(bs_buf)
+            result.append('"')
+            
+    return ''.join(result)

bitbake/lib/bb/remotedata.py

@@ -1,116 +0,0 @@
-"""
-BitBake 'remotedata' module
-
-Provides support for using a datastore from the bitbake client
-"""
-
-# Copyright (C) 2016  Intel Corporation
-#
-# This program is free software; you can redistribute it and/or modify
-# it under the terms of the GNU General Public License version 2 as
-# published by the Free Software Foundation.
-#
-# This program is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-# GNU General Public License for more details.
-#
-# You should have received a copy of the GNU General Public License along
-# with this program; if not, write to the Free Software Foundation, Inc.,
-# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
-import bb.data
-
-class RemoteDatastores:
-    """Used on the server side to manage references to server-side datastores"""
-    def __init__(self, cooker):
-        self.cooker = cooker
-        self.datastores = {}
-        self.locked = []
-        self.nextindex = 1
-
-    def __len__(self):
-        return len(self.datastores)
-
-    def __getitem__(self, key):
-        if key is None:
-            return self.cooker.data
-        else:
-            return self.datastores[key]
-
-    def items(self):
-        return self.datastores.items()
-
-    def store(self, d, locked=False):
-        """
-        Put a datastore into the collection. If locked=True then the datastore
-        is understood to be managed externally and cannot be released by calling
-        release().
-        """
-        idx = self.nextindex
-        self.datastores[idx] = d
-        if locked:
-            self.locked.append(idx)
-        self.nextindex += 1
-        return idx
-
-    def check_store(self, d, locked=False):
-        """
-        Put a datastore into the collection if it's not already in there;
-        in either case return the index
-        """
-        for key, val in self.datastores.items():
-            if val is d:
-                idx = key
-                break
-        else:
-            idx = self.store(d, locked)
-        return idx
-
-    def release(self, idx):
-        """Discard a datastore in the collection"""
-        if idx in self.locked:
-            raise Exception('Tried to release locked datastore %d' % idx)
-        del self.datastores[idx]
-
-    def receive_datastore(self, remote_data):
-        """Receive a datastore object sent from the client (as prepared by transmit_datastore())"""
-        dct = dict(remote_data)
-        d = bb.data_smart.DataSmart()
-        d.dict = dct
-        while True:
-            if '_remote_data' in dct:
-                dsindex = dct['_remote_data']['_content']
-                del dct['_remote_data']
-                if dsindex is None:
-                    dct['_data'] = self.cooker.data.dict
-                else:
-                    dct['_data'] = self.datastores[dsindex].dict
-                break
-            elif '_data' in dct:
-                idct = dict(dct['_data'])
-                dct['_data'] = idct
-                dct = idct
-            else:
-                break
-        return d
-
-    @staticmethod
-    def transmit_datastore(d):
-        """Prepare a datastore object for sending over IPC from the client end"""
-        # FIXME content might be a dict, need to turn that into a list as well
-        def copy_dicts(dct):
-            if '_remote_data' in dct:
-                dsindex = dct['_remote_data']['_content'].dsindex
-                newdct = dct.copy()
-                newdct['_remote_data'] = {'_content': dsindex}
-                return list(newdct.items())
-            elif '_data' in dct:
-                newdct = dct.copy()
-                newdata = copy_dicts(dct['_data'])
-                if newdata:
-                    newdct['_data'] = newdata
-                return list(newdct.items())
-            return None
-        main_dict = copy_dicts(d.dict)
-        return main_dict

bitbake/lib/bb/server/__init__.py

@@ -18,4 +18,79 @@
 # with this program; if not, write to the Free Software Foundation, Inc.,
 # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
 
+""" Base code for Bitbake server process
 
+Have a common base for that all Bitbake server classes ensures a consistent
+approach to the interface, and minimize risks associated with code duplication.
+
+"""
+
+"""  BaseImplServer() the base class for all XXServer() implementations.
+
+    These classes contain the actual code that runs the server side, i.e.
+    listens for the commands and executes them. Although these implementations
+    contain all the data of the original bitbake command, i.e the cooker instance,
+    they may well run on a different process or even machine.
+
+"""
+
+class BaseImplServer():
+    def __init__(self):
+        self._idlefuns = {}
+
+    def addcooker(self, cooker):
+        self.cooker = cooker
+
+    def register_idle_function(self, function, data):
+        """Register a function to be called while the server is idle"""
+        assert hasattr(function, '__call__')
+        self._idlefuns[function] = data
+
+
+
+""" BitBakeBaseServerConnection class is the common ancestor to all
+    BitBakeServerConnection classes.
+
+    These classes control the remote server. The only command currently
+    implemented is the terminate() command.
+
+"""
+
+class BitBakeBaseServerConnection():
+    def __init__(self, serverImpl):
+        pass
+
+    def terminate(self):
+        pass
+
+
+""" BitBakeBaseServer class is the common ancestor to all Bitbake servers
+
+    Derive this class in order to implement a BitBakeServer which is the
+    controlling stub for the actual server implementation
+
+"""
+class BitBakeBaseServer(object):
+    def initServer(self):
+        self.serverImpl = None  # we ensure a runtime crash if not overloaded
+        self.connection = None
+        return
+
+    def addcooker(self, cooker):
+        self.cooker = cooker
+        self.serverImpl.addcooker(cooker)
+
+    def getServerIdleCB(self):
+        return self.serverImpl.register_idle_function
+
+    def saveConnectionDetails(self):
+        return
+
+    def detach(self):
+        return
+
+    def establishConnection(self, featureset):
+        raise   "Must redefine the %s.establishConnection()" % self.__class__.__name__
+
+    def endSession(self):
+        self.connection.terminate()

bitbake/lib/bb/server/process.py

@@ -22,268 +22,112 @@
 
 import bb
 import bb.event
+import itertools
 import logging
 import multiprocessing
-import threading
-import array
 import os
+import signal
 import sys
 import time
 import select
-import socket
-import subprocess
-import errno
-import re
-import datetime
-import bb.server.xmlrpcserver
-from bb import daemonize
-from multiprocessing import queues
+from Queue import Empty
+from multiprocessing import Event, Process, util, Queue, Pipe, queues, Manager
+
+from . import BitBakeBaseServer, BitBakeBaseServerConnection, BaseImplServer
 
 logger = logging.getLogger('BitBake')
 
-class ProcessTimeout(SystemExit):
-    pass
+class ServerCommunicator():
+    def __init__(self, connection, event_handle, server):
+        self.connection = connection
+        self.event_handle = event_handle
+        self.server = server
 
-class ProcessServer(multiprocessing.Process):
+    def runCommand(self, command):
+        # @todo try/except
+        self.connection.send(command)
+
+        if not self.server.is_alive():
+            raise SystemExit
+
+        while True:
+            # don't let the user ctrl-c while we're waiting for a response
+            try:
+                if self.connection.poll(20):
+                    return self.connection.recv()
+                else:
+                    bb.fatal("Timeout while attempting to communicate with bitbake server")
+            except KeyboardInterrupt:
+                pass
+
+    def getEventHandle(self):
+        return self.event_handle.value
+
+class EventAdapter():
+    """
+    Adapter to wrap our event queue since the caller (bb.event) expects to
+    call a send() method, but our actual queue only has put()
+    """
+    def __init__(self, queue):
+        self.queue = queue
+
+    def send(self, event):
+        try:
+            self.queue.put(event)
+        except Exception as err:
+            print("EventAdapter puked: %s" % str(err))
+
+
+class ProcessServer(Process, BaseImplServer):
     profile_filename = "profile.log"
     profile_processed_filename = "profile.log.processed"
 
-    def __init__(self, lock, sock, sockname):
-        multiprocessing.Process.__init__(self)
-        self.command_channel = False
-        self.command_channel_reply = False
+    def __init__(self, command_channel, event_queue, featurelist):
+        BaseImplServer.__init__(self)
+        Process.__init__(self)
+        self.command_channel = command_channel
+        self.event_queue = event_queue
+        self.event = EventAdapter(event_queue)
+        self.featurelist = featurelist
         self.quit = False
-        self.heartbeat_seconds = 1 # default, BB_HEARTBEAT_EVENT will be checked once we have a datastore.
-        self.next_heartbeat = time.time()
 
-        self.event_handle = None
-        self.haveui = False
-        self.lastui = False
-        self.xmlrpc = False
-
-        self._idlefuns = {}
-
-        self.bitbake_lock = lock
-        self.sock = sock
-        self.sockname = sockname
-
-    def register_idle_function(self, function, data):
-        """Register a function to be called while the server is idle"""
-        assert hasattr(function, '__call__')
-        self._idlefuns[function] = data
+        self.quitin, self.quitout = Pipe()
+        self.event_handle = multiprocessing.Value("i")
 
     def run(self):
+        for event in bb.event.ui_queue:
+            self.event_queue.put(event)
+        self.event_handle.value = bb.event.register_UIHhandler(self)
 
-        if self.xmlrpcinterface[0]:
-            self.xmlrpc = bb.server.xmlrpcserver.BitBakeXMLRPCServer(self.xmlrpcinterface, self.cooker, self)
-
-            print("Bitbake XMLRPC server address: %s, server port: %s" % (self.xmlrpc.host, self.xmlrpc.port))
-
-        heartbeat_event = self.cooker.data.getVar('BB_HEARTBEAT_EVENT')
-        if heartbeat_event:
-            try:
-                self.heartbeat_seconds = float(heartbeat_event)
-            except:
-                bb.warn('Ignoring invalid BB_HEARTBEAT_EVENT=%s, must be a float specifying seconds.' % heartbeat_event)
-
-        self.timeout = self.server_timeout or self.cooker.data.getVar('BB_SERVER_TIMEOUT')
-        try:
-            if self.timeout:
-                self.timeout = float(self.timeout)
-        except:
-            bb.warn('Ignoring invalid BB_SERVER_TIMEOUT=%s, must be a float specifying seconds.' % self.timeout)
-
-
-        try:
-            self.bitbake_lock.seek(0)
-            self.bitbake_lock.truncate()
-            if self.xmlrpc:
-                self.bitbake_lock.write("%s %s:%s\n" % (os.getpid(), self.xmlrpc.host, self.xmlrpc.port))
-            else:
-                self.bitbake_lock.write("%s\n" % (os.getpid()))
-            self.bitbake_lock.flush()
-        except Exception as e:
-            print("Error writing to lock file: %s" % str(e))
-            pass
-
-        if self.cooker.configuration.profile:
-            try:
-                import cProfile as profile
-            except:
-                import profile
-            prof = profile.Profile()
-
-            ret = profile.Profile.runcall(prof, self.main)
-
-            prof.dump_stats("profile.log")
-            bb.utils.process_profilelog("profile.log")
-            print("Raw profiling information saved to profile.log and processed statistics to profile.log.processed")
-
-        else:
-            ret = self.main()
-
-        return ret
+        bb.cooker.server_main(self.cooker, self.main)
 
     def main(self):
-        self.cooker.pre_serve()
-
-        bb.utils.set_process_name("Cooker")
-
-        ready = []
-        newconnections = []
-
-        self.controllersock = False
-        fds = [self.sock]
-        if self.xmlrpc:
-            fds.append(self.xmlrpc)
-        print("Entering server connection loop")
-
-        def disconnect_client(self, fds):
-            print("Disconnecting Client")
-            if self.controllersock:
-                fds.remove(self.controllersock)
-                self.controllersock.close()
-                self.controllersock = False
-            if self.haveui:
-                fds.remove(self.command_channel)
-                bb.event.unregister_UIHhandler(self.event_handle, True)
-                self.command_channel_reply.writer.close()
-                self.event_writer.writer.close()
-                self.command_channel.close()
-                self.command_channel = False
-                del self.event_writer
-                self.lastui = time.time()
-                self.cooker.clientComplete()
-                self.haveui = False
-            ready = select.select(fds,[],[],0)[0]
-            if newconnections:
-                print("Starting new client")
-                conn = newconnections.pop(-1)
-                fds.append(conn)
-                self.controllersock = conn
-            elif self.timeout is None and not ready:
-                print("No timeout, exiting.")
-                self.quit = True
-
+        # Ignore SIGINT within the server, as all SIGINT handling is done by
+        # the UI and communicated to us
+        self.quitin.close()
+        signal.signal(signal.SIGINT, signal.SIG_IGN)
         while not self.quit:
-            if self.sock in ready:
-                while select.select([self.sock],[],[],0)[0]:
-                    controllersock, address = self.sock.accept()
-                    if self.controllersock:
-                        print("Queuing %s (%s)" % (str(ready), str(newconnections)))
-                        newconnections.append(controllersock)
-                    else:
-                        print("Accepting %s (%s)" % (str(ready), str(newconnections)))
-                        self.controllersock = controllersock
-                        fds.append(controllersock)
-            if self.controllersock in ready:
-                try:
-                    print("Processing Client")
-                    ui_fds = recvfds(self.controllersock, 3)
-                    print("Connecting Client")
-
-                    # Where to write events to
-                    writer = ConnectionWriter(ui_fds[0])
-                    self.event_handle = bb.event.register_UIHhandler(writer, True)
-                    self.event_writer = writer
-
-                    # Where to read commands from
-                    reader = ConnectionReader(ui_fds[1])
-                    fds.append(reader)
-                    self.command_channel = reader
-
-                    # Where to send command return values to
-                    writer = ConnectionWriter(ui_fds[2])
-                    self.command_channel_reply = writer
-
-                    self.haveui = True
-
-                except (EOFError, OSError):
-                    disconnect_client(self, fds)
-
-            if not self.timeout == -1.0 and not self.haveui and self.lastui and self.timeout and \
-                    (self.lastui + self.timeout) < time.time():
-                print("Server timeout, exiting.")
-                self.quit = True
-
-            if self.command_channel in ready:
-                try:
-                    command = self.command_channel.get()
-                except EOFError:
-                    # Client connection shutting down
-                    ready = []
-                    disconnect_client(self, fds)
-                    continue
-                if command[0] == "terminateServer":
+            try:
+                if self.command_channel.poll():
+                    command = self.command_channel.recv()
+                    self.runCommand(command)
+                if self.quitout.poll():
+                    self.quitout.recv()
                     self.quit = True
-                    continue
-                try:
-                    print("Running command %s" % command)
-                    self.command_channel_reply.send(self.cooker.command.runCommand(command))
-                except Exception as e:
-                   logger.exception('Exception in server main event loop running command %s (%s)' % (command, str(e)))
 
-            if self.xmlrpc in ready:
-                self.xmlrpc.handle_requests()
+                self.idle_commands(.1, [self.event_queue._reader, self.command_channel, self.quitout])
+            except Exception:
+                logger.exception('Running command %s', command)
 
-            ready = self.idle_commands(.1, fds)
+        self.event_queue.close()
+        bb.event.unregister_UIHhandler(self.event_handle.value)
+        self.command_channel.close()
+        self.cooker.shutdown(True)
 
-        print("Exiting")
-        # Remove the socket file so we don't get any more connections to avoid races
-        os.unlink(self.sockname)
-        self.sock.close()
-
-        try: 
-            self.cooker.shutdown(True)
-            self.cooker.notifier.stop()
-            self.cooker.confignotifier.stop()
-        except:
-            pass
-
-        self.cooker.post_serve()
-
-        # Finally release the lockfile but warn about other processes holding it open
-        lock = self.bitbake_lock
-        lockfile = lock.name
-        lock.close()
-        lock = None
-
-        while not lock:
-            with bb.utils.timeout(3):
-                lock = bb.utils.lockfile(lockfile, shared=False, retry=False, block=True)
-                if lock:
-                    # We hold the lock so we can remove the file (hide stale pid data)
-                    bb.utils.remove(lockfile)
-                    bb.utils.unlockfile(lock)
-                    return
-
-                if not lock:
-                    # Some systems may not have lsof available
-                    procs = None
-                    try:
-                        procs = subprocess.check_output(["lsof", '-w', lockfile], stderr=subprocess.STDOUT)
-                    except OSError as e:
-                        if e.errno != errno.ENOENT:
-                            raise
-                    if procs is None:
-                        # Fall back to fuser if lsof is unavailable
-                        try:
-                            procs = subprocess.check_output(["fuser", '-v', lockfile], stderr=subprocess.STDOUT)
-                        except OSError as e:
-                            if e.errno != errno.ENOENT:
-                                raise
-
-                    msg = "Delaying shutdown due to active processes which appear to be holding bitbake.lock"
-                    if procs:
-                        msg += ":\n%s" % str(procs)
-                    print(msg)
-
-    def idle_commands(self, delay, fds=None):
+    def idle_commands(self, delay, fds = []):
         nextsleep = delay
-        if not fds:
-            fds = []
 
-        for function, data in list(self._idlefuns.items()):
+        for function, data in self._idlefuns.items():
             try:
                 retval = function(self, data, False)
                 if retval is False:
@@ -291,7 +135,7 @@ class ProcessServer(multiprocessing.Process):
                     nextsleep = None
                 elif retval is True:
                     nextsleep = None
-                elif isinstance(retval, float) and nextsleep:
+                elif isinstance(retval, float):
                     if (retval < nextsleep):
                         nextsleep = retval
                 elif nextsleep is None:
@@ -300,367 +144,109 @@ class ProcessServer(multiprocessing.Process):
                     fds = fds + retval
             except SystemExit:
                 raise
-            except Exception as exc:
-                if not isinstance(exc, bb.BBHandledException):
-                    logger.exception('Running idle function')
+            except Exception:
+                logger.exception('Running idle function')
                 del self._idlefuns[function]
                 self.quit = True
 
-        # Create new heartbeat event?
-        now = time.time()
-        if now >= self.next_heartbeat:
-            # We might have missed heartbeats. Just trigger once in
-            # that case and continue after the usual delay.
-            self.next_heartbeat += self.heartbeat_seconds
-            if self.next_heartbeat <= now:
-                self.next_heartbeat = now + self.heartbeat_seconds
-            heartbeat = bb.event.HeartbeatEvent(now)
-            bb.event.fire(heartbeat, self.cooker.data)
-        if nextsleep and now + nextsleep > self.next_heartbeat:
-            # Shorten timeout so that we we wake up in time for
-            # the heartbeat.
-            nextsleep = self.next_heartbeat - now
-
         if nextsleep is not None:
-            if self.xmlrpc:
-                nextsleep = self.xmlrpc.get_timeout(nextsleep)
-            try:
-                return select.select(fds,[],[],nextsleep)[0]
-            except InterruptedError:
-                # Ignore EINTR
-                return []
-        else:
-            return select.select(fds,[],[],0)[0]
-
-
-class ServerCommunicator():
-    def __init__(self, connection, recv):
-        self.connection = connection
-        self.recv = recv
+            select.select(fds,[],[],nextsleep)
 
     def runCommand(self, command):
-        self.connection.send(command)
-        if not self.recv.poll(30):
-            raise ProcessTimeout("Timeout while waiting for a reply from the bitbake server")
-        return self.recv.get()
+        """
+        Run a cooker command on the server
+        """
+        self.command_channel.send(self.cooker.command.runCommand(command))
 
-    def updateFeatureSet(self, featureset):
-        _, error = self.runCommand(["setFeatures", featureset])
+    def stop(self):
+        self.quitin.send("quit")
+        self.quitin.close()
+
+class BitBakeProcessServerConnection(BitBakeBaseServerConnection):
+    def __init__(self, serverImpl, ui_channel, event_queue):
+        self.procserver = serverImpl
+        self.ui_channel = ui_channel
+        self.event_queue = event_queue
+        self.connection = ServerCommunicator(self.ui_channel, self.procserver.event_handle, self.procserver)
+        self.events = self.event_queue
+
+    def sigterm_terminate(self):
+        bb.error("UI received SIGTERM")
+        self.terminate()
+
+    def terminate(self):
+        def flushevents():
+            while True:
+                try:
+                    event = self.event_queue.get(block=False)
+                except (Empty, IOError):
+                    break
+                if isinstance(event, logging.LogRecord):
+                    logger.handle(event)
+
+        signal.signal(signal.SIGINT, signal.SIG_IGN)
+        self.procserver.stop()
+
+        while self.procserver.is_alive():
+            flushevents()
+            self.procserver.join(0.1)
+
+        self.ui_channel.close()
+        self.event_queue.close()
+        self.event_queue.setexit()
+
+# Wrap Queue to provide API which isn't server implementation specific
+class ProcessEventQueue(multiprocessing.queues.Queue):
+    def __init__(self, maxsize):
+        multiprocessing.queues.Queue.__init__(self, maxsize)
+        self.exit = False
+
+    def setexit(self):
+        self.exit = True
+
+    def waitEvent(self, timeout):
+        if self.exit:
+            sys.exit(1)
+        try:
+            if not self.server.is_alive():
+                self.setexit()
+                return None
+            return self.get(True, timeout)
+        except Empty:
+            return None
+
+    def getEvent(self):
+        try:
+            if not self.server.is_alive():
+                self.setexit()
+                return None
+            return self.get(False)
+        except Empty:
+            return None
+
+
+class BitBakeServer(BitBakeBaseServer):
+    def initServer(self):
+        # establish communication channels.  We use bidirectional pipes for
+        # ui <--> server command/response pairs
+        # and a queue for server -> ui event notifications
+        #
+        self.ui_channel, self.server_channel = Pipe()
+        self.event_queue = ProcessEventQueue(0)
+        self.serverImpl = ProcessServer(self.server_channel, self.event_queue, None)
+        self.event_queue.server = self.serverImpl
+
+    def detach(self):
+        self.serverImpl.start()
+        return
+
+    def establishConnection(self, featureset):
+
+        self.connection = BitBakeProcessServerConnection(self.serverImpl, self.ui_channel, self.event_queue)
+
+        _, error = self.connection.connection.runCommand(["setFeatures", featureset])
         if error:
             logger.error("Unable to set the cooker to the correct featureset: %s" % error)
             raise BaseException(error)
-
-    def getEventHandle(self):
-        handle, error = self.runCommand(["getUIHandlerNum"])
-        if error:
-            logger.error("Unable to get UI Handler Number: %s" % error)
-            raise BaseException(error)
-
-        return handle
-
-    def terminateServer(self):
-        self.connection.send(['terminateServer'])
-        return
-
-class BitBakeProcessServerConnection(object):
-    def __init__(self, ui_channel, recv, eq, sock):
-        self.connection = ServerCommunicator(ui_channel, recv)
-        self.events = eq
-        # Save sock so it doesn't get gc'd for the life of our connection
-        self.socket_connection = sock
-
-    def terminate(self):
-        self.socket_connection.close()
-        self.connection.connection.close()
-        self.connection.recv.close()
-        return
-
-class BitBakeServer(object):
-    start_log_format = '--- Starting bitbake server pid %s at %s ---'
-    start_log_datetime_format = '%Y-%m-%d %H:%M:%S.%f'
-
-    def __init__(self, lock, sockname, configuration, featureset):
-
-        self.configuration = configuration
-        self.featureset = featureset
-        self.sockname = sockname
-        self.bitbake_lock = lock
-        self.readypipe, self.readypipein = os.pipe()
-
-        # Create server control socket
-        if os.path.exists(sockname):
-            os.unlink(sockname)
-
-        # Place the log in the builddirectory alongside the lock file
-        logfile = os.path.join(os.path.dirname(self.bitbake_lock.name), "bitbake-cookerdaemon.log")
-
-        self.sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM)
-        # AF_UNIX has path length issues so chdir here to workaround
-        cwd = os.getcwd()
-        try:
-            os.chdir(os.path.dirname(sockname))
-            self.sock.bind(os.path.basename(sockname))
-        finally:
-            os.chdir(cwd)
-        self.sock.listen(1)
-
-        os.set_inheritable(self.sock.fileno(), True)
-        startdatetime = datetime.datetime.now()
-        bb.daemonize.createDaemon(self._startServer, logfile)
-        self.sock.close()
-        self.bitbake_lock.close()
-        os.close(self.readypipein)
-
-        ready = ConnectionReader(self.readypipe)
-        r = ready.poll(5)
-        if not r:
-            bb.note("Bitbake server didn't start within 5 seconds, waiting for 90")
-            r = ready.poll(90)
-        if r:
-            try:
-                r = ready.get()
-            except EOFError:
-                # Trap the child exitting/closing the pipe and error out
-                r = None
-        if not r or r[0] != "r":
-            ready.close()
-            bb.error("Unable to start bitbake server (%s)" % str(r))
-            if os.path.exists(logfile):
-                logstart_re = re.compile(self.start_log_format % ('([0-9]+)', '([0-9-]+ [0-9:.]+)'))
-                started = False
-                lines = []
-                lastlines = []
-                with open(logfile, "r") as f:
-                    for line in f:
-                        if started:
-                            lines.append(line)
-                        else:
-                            lastlines.append(line)
-                            res = logstart_re.match(line.rstrip())
-                            if res:
-                                ldatetime = datetime.datetime.strptime(res.group(2), self.start_log_datetime_format)
-                                if ldatetime >= startdatetime:
-                                    started = True
-                                    lines.append(line)
-                        if len(lastlines) > 60:
-                            lastlines = lastlines[-60:]
-                if lines:
-                    if len(lines) > 60:
-                        bb.error("Last 60 lines of server log for this session (%s):\n%s" % (logfile, "".join(lines[-60:])))
-                    else:
-                        bb.error("Server log for this session (%s):\n%s" % (logfile, "".join(lines)))
-                elif lastlines:
-                        bb.error("Server didn't start, last 60 loglines (%s):\n%s" % (logfile, "".join(lastlines)))
-            else:
-                bb.error("%s doesn't exist" % logfile)
-
-            raise SystemExit(1)
-
-        ready.close()
-
-    def _startServer(self):
-        print(self.start_log_format % (os.getpid(), datetime.datetime.now().strftime(self.start_log_datetime_format)))
-        sys.stdout.flush()
-
-        server = ProcessServer(self.bitbake_lock, self.sock, self.sockname)
-        self.configuration.setServerRegIdleCallback(server.register_idle_function)
-        os.close(self.readypipe)
-        writer = ConnectionWriter(self.readypipein)
-        self.cooker = bb.cooker.BBCooker(self.configuration, self.featureset)
-        writer.send("r")
-        writer.close()
-        server.cooker = self.cooker
-        server.server_timeout = self.configuration.server_timeout
-        server.xmlrpcinterface = self.configuration.xmlrpcinterface
-        print("Started bitbake server pid %d" % os.getpid())
-        sys.stdout.flush()
-
-        server.start()
-
-def connectProcessServer(sockname, featureset):
-    # Connect to socket
-    sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM)
-    # AF_UNIX has path length issues so chdir here to workaround
-    cwd = os.getcwd()
-
-    readfd = writefd = readfd1 = writefd1 = readfd2 = writefd2 = None
-    eq = command_chan_recv = command_chan = None
-
-    sock.settimeout(10)
-
-    try:
-        try:
-            os.chdir(os.path.dirname(sockname))
-            finished = False
-            while not finished:
-                try:
-                    sock.connect(os.path.basename(sockname))
-                    finished = True
-                except IOError as e:
-                    if e.errno == errno.EWOULDBLOCK:
-                        pass
-                    raise
-        finally:
-            os.chdir(cwd)
-
-        # Send an fd for the remote to write events to
-        readfd, writefd = os.pipe()
-        eq = BBUIEventQueue(readfd)
-        # Send an fd for the remote to recieve commands from
-        readfd1, writefd1 = os.pipe()
-        command_chan = ConnectionWriter(writefd1)
-        # Send an fd for the remote to write commands results to
-        readfd2, writefd2 = os.pipe()
-        command_chan_recv = ConnectionReader(readfd2)
-
-        sendfds(sock, [writefd, readfd1, writefd2])
-
-        server_connection = BitBakeProcessServerConnection(command_chan, command_chan_recv, eq, sock)
-
-        # Close the ends of the pipes we won't use
-        for i in [writefd, readfd1, writefd2]:
-            os.close(i)
-
-        server_connection.connection.updateFeatureSet(featureset)
-
-    except (Exception, SystemExit) as e:
-        if command_chan_recv:
-            command_chan_recv.close()
-        if command_chan:
-            command_chan.close()
-        for i in [writefd, readfd1, writefd2]:
-            try:
-                if i:
-                    os.close(i)
-            except OSError:
-                pass
-        sock.close()
-        raise
-
-    return server_connection
-
-def sendfds(sock, fds):
-        '''Send an array of fds over an AF_UNIX socket.'''
-        fds = array.array('i', fds)
-        msg = bytes([len(fds) % 256])
-        sock.sendmsg([msg], [(socket.SOL_SOCKET, socket.SCM_RIGHTS, fds)])
-
-def recvfds(sock, size):
-        '''Receive an array of fds over an AF_UNIX socket.'''
-        a = array.array('i')
-        bytes_size = a.itemsize * size
-        msg, ancdata, flags, addr = sock.recvmsg(1, socket.CMSG_LEN(bytes_size))
-        if not msg and not ancdata:
-            raise EOFError
-        try:
-            if len(ancdata) != 1:
-                raise RuntimeError('received %d items of ancdata' %
-                                   len(ancdata))
-            cmsg_level, cmsg_type, cmsg_data = ancdata[0]
-            if (cmsg_level == socket.SOL_SOCKET and
-                cmsg_type == socket.SCM_RIGHTS):
-                if len(cmsg_data) % a.itemsize != 0:
-                    raise ValueError
-                a.frombytes(cmsg_data)
-                assert len(a) % 256 == msg[0]
-                return list(a)
-        except (ValueError, IndexError):
-            pass
-        raise RuntimeError('Invalid data received')
-
-class BBUIEventQueue:
-    def __init__(self, readfd):
-
-        self.eventQueue = []
-        self.eventQueueLock = threading.Lock()
-        self.eventQueueNotify = threading.Event()
-
-        self.reader = ConnectionReader(readfd)
-
-        self.t = threading.Thread()
-        self.t.setDaemon(True)
-        self.t.run = self.startCallbackHandler
-        self.t.start()
-
-    def getEvent(self):
-        self.eventQueueLock.acquire()
-
-        if len(self.eventQueue) == 0:
-            self.eventQueueLock.release()
-            return None
-
-        item = self.eventQueue.pop(0)
-
-        if len(self.eventQueue) == 0:
-            self.eventQueueNotify.clear()
-
-        self.eventQueueLock.release()
-        return item
-
-    def waitEvent(self, delay):
-        self.eventQueueNotify.wait(delay)
-        return self.getEvent()
-
-    def queue_event(self, event):
-        self.eventQueueLock.acquire()
-        self.eventQueue.append(event)
-        self.eventQueueNotify.set()
-        self.eventQueueLock.release()
-
-    def send_event(self, event):
-        self.queue_event(pickle.loads(event))
-
-    def startCallbackHandler(self):
-        bb.utils.set_process_name("UIEventQueue")
-        while True:
-            try:
-                self.reader.wait()
-                event = self.reader.get()
-                self.queue_event(event)
-            except EOFError:
-                # Easiest way to exit is to close the file descriptor to cause an exit
-                break
-        self.reader.close()
-
-class ConnectionReader(object):
-
-    def __init__(self, fd):
-        self.reader = multiprocessing.connection.Connection(fd, writable=False)
-        self.rlock = multiprocessing.Lock()
-
-    def wait(self, timeout=None):
-        return multiprocessing.connection.wait([self.reader], timeout)
-
-    def poll(self, timeout=None):
-        return self.reader.poll(timeout)
-
-    def get(self):
-        with self.rlock:
-            res = self.reader.recv_bytes()
-        return multiprocessing.reduction.ForkingPickler.loads(res)
-
-    def fileno(self):
-        return self.reader.fileno()
-
-    def close(self):
-        return self.reader.close()
-
-
-class ConnectionWriter(object):
-
-    def __init__(self, fd):
-        self.writer = multiprocessing.connection.Connection(fd, readable=False)
-        self.wlock = multiprocessing.Lock()
-        # Why bb.event needs this I have no idea
-        self.event = self
-
-    def send(self, obj):
-        obj = multiprocessing.reduction.ForkingPickler.dumps(obj)
-        with self.wlock:
-            self.writer.send_bytes(obj)
-
-    def fileno(self):
-        return self.writer.fileno()
-
-    def close(self):
-        return self.writer.close()
+        signal.signal(signal.SIGTERM, lambda i, s: self.connection.sigterm_terminate())
+        return self.connection

bitbake/lib/bb/server/xmlrpc.py

@@ -0,0 +1,383 @@
+#
+# BitBake XMLRPC Server
+#
+# Copyright (C) 2006 - 2007  Michael 'Mickey' Lauer
+# Copyright (C) 2006 - 2008  Richard Purdie
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+"""
+    This module implements an xmlrpc server for BitBake.
+
+    Use this by deriving a class from BitBakeXMLRPCServer and then adding
+    methods which you want to "export" via XMLRPC. If the methods have the
+    prefix xmlrpc_, then registering those function will happen automatically,
+    if not, you need to call register_function.
+
+    Use register_idle_function() to add a function which the xmlrpc server
+    calls from within server_forever when no requests are pending. Make sure
+    that those functions are non-blocking or else you will introduce latency
+    in the server's main loop.
+"""
+
+import bb
+import xmlrpclib, sys
+from bb import daemonize
+from bb.ui import uievent
+import hashlib, time
+import socket
+import os, signal
+import threading
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+
+DEBUG = False
+
+from SimpleXMLRPCServer import SimpleXMLRPCServer, SimpleXMLRPCRequestHandler
+import inspect, select, httplib
+
+from . import BitBakeBaseServer, BitBakeBaseServerConnection, BaseImplServer
+
+class BBTransport(xmlrpclib.Transport):
+    def __init__(self, timeout):
+        self.timeout = timeout
+        self.connection_token = None
+        xmlrpclib.Transport.__init__(self)
+
+    # Modified from default to pass timeout to HTTPConnection
+    def make_connection(self, host):
+        #return an existing connection if possible.  This allows
+        #HTTP/1.1 keep-alive.
+        if self._connection and host == self._connection[0]:
+            return self._connection[1]
+
+        # create a HTTP connection object from a host descriptor
+        chost, self._extra_headers, x509 = self.get_host_info(host)
+        #store the host argument along with the connection object
+        self._connection = host, httplib.HTTPConnection(chost, timeout=self.timeout)
+        return self._connection[1]
+
+    def set_connection_token(self, token):
+        self.connection_token = token
+
+    def send_content(self, h, body):
+        if self.connection_token:
+            h.putheader("Bitbake-token", self.connection_token)
+        xmlrpclib.Transport.send_content(self, h, body)
+
+def _create_server(host, port, timeout = 60):
+    t = BBTransport(timeout)
+    s = xmlrpclib.ServerProxy("http://%s:%d/" % (host, port), transport=t, allow_none=True)
+    return s, t
+
+class BitBakeServerCommands():
+
+    def __init__(self, server):
+        self.server = server
+        self.has_client = False
+
+    def registerEventHandler(self, host, port):
+        """
+        Register a remote UI Event Handler
+        """
+        s, t = _create_server(host, port)
+
+        # we don't allow connections if the cooker is running
+        if (self.cooker.state in [bb.cooker.state.parsing, bb.cooker.state.running]):
+            return None
+
+        self.event_handle = bb.event.register_UIHhandler(s)
+        return self.event_handle
+
+    def unregisterEventHandler(self, handlerNum):
+        """
+        Unregister a remote UI Event Handler
+        """
+        return bb.event.unregister_UIHhandler(handlerNum)
+
+    def runCommand(self, command):
+        """
+        Run a cooker command on the server
+        """
+        return self.cooker.command.runCommand(command, self.server.readonly)
+
+    def getEventHandle(self):
+        return self.event_handle
+
+    def terminateServer(self):
+        """
+        Trigger the server to quit
+        """
+        self.server.quit = True
+        print("Server (cooker) exiting")
+        return
+
+    def addClient(self):
+        if self.has_client:
+            return None
+        token = hashlib.md5(str(time.time())).hexdigest()
+        self.server.set_connection_token(token)
+        self.has_client = True
+        return token
+
+    def removeClient(self):
+        if self.has_client:
+            self.server.set_connection_token(None)
+            self.has_client = False
+            if self.server.single_use:
+                self.server.quit = True
+
+# This request handler checks if the request has a "Bitbake-token" header
+# field (this comes from the client side) and compares it with its internal
+# "Bitbake-token" field (this comes from the server). If the two are not
+# equal, it is assumed that a client is trying to connect to the server
+# while another client is connected to the server. In this case, a 503 error
+# ("service unavailable") is returned to the client.
+class BitBakeXMLRPCRequestHandler(SimpleXMLRPCRequestHandler):
+    def __init__(self, request, client_address, server):
+        self.server = server
+        SimpleXMLRPCRequestHandler.__init__(self, request, client_address, server)
+
+    def do_POST(self):
+        try:
+            remote_token = self.headers["Bitbake-token"]
+        except:
+            remote_token = None
+        if remote_token != self.server.connection_token and remote_token != "observer":
+            self.report_503()
+        else:
+            if remote_token == "observer":
+                self.server.readonly = True
+            else:
+                self.server.readonly = False
+            SimpleXMLRPCRequestHandler.do_POST(self)
+
+    def report_503(self):
+        self.send_response(503)
+        response = 'No more client allowed'
+        self.send_header("Content-type", "text/plain")
+        self.send_header("Content-length", str(len(response)))
+        self.end_headers()
+        self.wfile.write(response)
+
+
+class XMLRPCProxyServer(BaseImplServer):
+    """ not a real working server, but a stub for a proxy server connection
+
+    """
+    def __init__(self, host, port):
+        self.host = host
+        self.port = port
+
+class XMLRPCServer(SimpleXMLRPCServer, BaseImplServer):
+    # remove this when you're done with debugging
+    # allow_reuse_address = True
+
+    def __init__(self, interface):
+        """
+        Constructor
+        """
+        BaseImplServer.__init__(self)
+        if (interface[1] == 0):     # anonymous port, not getting reused
+            self.single_use = True
+        # Use auto port configuration
+        if (interface[1] == -1):
+            interface = (interface[0], 0)
+        SimpleXMLRPCServer.__init__(self, interface,
+                                    requestHandler=BitBakeXMLRPCRequestHandler,
+                                    logRequests=False, allow_none=True)
+        self.host, self.port = self.socket.getsockname()
+        self.connection_token = None
+        #self.register_introspection_functions()
+        self.commands = BitBakeServerCommands(self)
+        self.autoregister_all_functions(self.commands, "")
+        self.interface = interface
+        self.single_use = False
+
+    def addcooker(self, cooker):
+        BaseImplServer.addcooker(self, cooker)
+        self.commands.cooker = cooker
+
+    def autoregister_all_functions(self, context, prefix):
+        """
+        Convenience method for registering all functions in the scope
+        of this class that start with a common prefix
+        """
+        methodlist = inspect.getmembers(context, inspect.ismethod)
+        for name, method in methodlist:
+            if name.startswith(prefix):
+                self.register_function(method, name[len(prefix):])
+
+
+    def serve_forever(self):
+        # Start the actual XMLRPC server
+        bb.cooker.server_main(self.cooker, self._serve_forever)
+
+    def _serve_forever(self):
+        """
+        Serve Requests. Overloaded to honor a quit command
+        """
+        self.quit = False
+        while not self.quit:
+            fds = [self]
+            nextsleep = 0.1
+            for function, data in self._idlefuns.items():
+                try:
+                    retval = function(self, data, False)
+                    if retval is False:
+                        del self._idlefuns[function]
+                    elif retval is True:
+                        nextsleep = 0
+                    elif isinstance(retval, float):
+                        if (retval < nextsleep):
+                            nextsleep = retval
+                    else:
+                        fds = fds + retval
+                except SystemExit:
+                    raise
+                except:
+                    import traceback
+                    traceback.print_exc()
+                    pass
+
+            socktimeout = self.socket.gettimeout() or nextsleep
+            socktimeout = min(socktimeout, nextsleep)
+            # Mirror what BaseServer handle_request would do
+            try:
+                fd_sets = select.select(fds, [], [], socktimeout)
+                if fd_sets[0] and self in fd_sets[0]:
+                    self._handle_request_noblock()
+            except IOError:
+                # we ignore interrupted calls
+                pass
+
+        # Tell idle functions we're exiting
+        for function, data in self._idlefuns.items():
+            try:
+                retval = function(self, data, True)
+            except:
+                pass
+        self.server_close()
+        return
+
+    def set_connection_token(self, token):
+        self.connection_token = token
+
+class BitBakeXMLRPCServerConnection(BitBakeBaseServerConnection):
+    def __init__(self, serverImpl, clientinfo=("localhost", 0), observer_only = False, featureset = []):
+        self.connection, self.transport = _create_server(serverImpl.host, serverImpl.port)
+        self.clientinfo = clientinfo
+        self.serverImpl = serverImpl
+        self.observer_only = observer_only
+        self.featureset = featureset
+
+    def connect(self, token = None):
+        if token is None:
+            if self.observer_only:
+                token = "observer"
+            else:
+                token = self.connection.addClient()
+
+        if token is None:
+            return None
+
+        self.transport.set_connection_token(token)
+
+        self.events = uievent.BBUIEventQueue(self.connection, self.clientinfo)
+        for event in bb.event.ui_queue:
+            self.events.queue_event(event)
+
+        _, error = self.connection.runCommand(["setFeatures", self.featureset])
+        if error:
+            # no need to log it here, the error shall be sent to the client
+            raise BaseException(error)
+
+        return self
+
+    def removeClient(self):
+        if not self.observer_only:
+            self.connection.removeClient()
+
+    def terminate(self):
+        # Don't wait for server indefinitely
+        import socket
+        socket.setdefaulttimeout(2)
+        try:
+            self.events.system_quit()
+        except:
+            pass
+        try:
+            self.connection.removeClient()
+        except:
+            pass
+
+class BitBakeServer(BitBakeBaseServer):
+    def initServer(self, interface = ("localhost", 0)):
+        self.interface = interface
+        self.serverImpl = XMLRPCServer(interface)
+
+    def detach(self):
+        daemonize.createDaemon(self.serverImpl.serve_forever, "bitbake-cookerdaemon.log")
+        del self.cooker
+
+    def establishConnection(self, featureset):
+        self.connection = BitBakeXMLRPCServerConnection(self.serverImpl, self.interface, False, featureset)
+        return self.connection.connect()
+
+    def set_connection_token(self, token):
+        self.connection.transport.set_connection_token(token)
+
+class BitBakeXMLRPCClient(BitBakeBaseServer):
+
+    def __init__(self, observer_only = False, token = None):
+        self.token = token
+
+        self.observer_only = observer_only
+        # if we need extra caches, just tell the server to load them all
+        pass
+
+    def saveConnectionDetails(self, remote):
+        self.remote = remote
+
+    def establishConnection(self, featureset):
+        # The format of "remote" must be "server:port"
+        try:
+            [host, port] = self.remote.split(":")
+            port = int(port)
+        except Exception as e:
+            bb.warn("Failed to read remote definition (%s)" % str(e))
+            raise e
+
+        # We need our IP for the server connection. We get the IP
+        # by trying to connect with the server
+        try:
+            s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)
+            s.connect((host, port))
+            ip = s.getsockname()[0]
+            s.close()
+        except Exception as e:
+            bb.warn("Could not create socket for %s:%s (%s)" % (host, port, str(e)))
+            raise e
+        try:
+            self.serverImpl = XMLRPCProxyServer(host, port)
+            self.connection = BitBakeXMLRPCServerConnection(self.serverImpl, (ip, 0), self.observer_only, featureset)
+            return self.connection.connect(self.token)
+        except Exception as e:
+            bb.warn("Could not connect to server at %s:%s (%s)" % (host, port, str(e)))
+            raise e
+
+    def endSession(self):
+        self.connection.removeClient()

bitbake/lib/bb/server/xmlrpcclient.py

@@ -1,154 +0,0 @@
-#
-# BitBake XMLRPC Client Interface
-#
-# Copyright (C) 2006 - 2007  Michael 'Mickey' Lauer
-# Copyright (C) 2006 - 2008  Richard Purdie
-#
-# This program is free software; you can redistribute it and/or modify
-# it under the terms of the GNU General Public License version 2 as
-# published by the Free Software Foundation.
-#
-# This program is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-# GNU General Public License for more details.
-#
-# You should have received a copy of the GNU General Public License along
-# with this program; if not, write to the Free Software Foundation, Inc.,
-# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
-import os
-import sys
-
-import socket
-import http.client
-import xmlrpc.client
-
-import bb
-from bb.ui import uievent
-
-class BBTransport(xmlrpc.client.Transport):
-    def __init__(self, timeout):
-        self.timeout = timeout
-        self.connection_token = None
-        xmlrpc.client.Transport.__init__(self)
-
-    # Modified from default to pass timeout to HTTPConnection
-    def make_connection(self, host):
-        #return an existing connection if possible.  This allows
-        #HTTP/1.1 keep-alive.
-        if self._connection and host == self._connection[0]:
-            return self._connection[1]
-
-        # create a HTTP connection object from a host descriptor
-        chost, self._extra_headers, x509 = self.get_host_info(host)
-        #store the host argument along with the connection object
-        self._connection = host, http.client.HTTPConnection(chost, timeout=self.timeout)
-        return self._connection[1]
-
-    def set_connection_token(self, token):
-        self.connection_token = token
-
-    def send_content(self, h, body):
-        if self.connection_token:
-            h.putheader("Bitbake-token", self.connection_token)
-        xmlrpc.client.Transport.send_content(self, h, body)
-
-def _create_server(host, port, timeout = 60):
-    t = BBTransport(timeout)
-    s = xmlrpc.client.ServerProxy("http://%s:%d/" % (host, port), transport=t, allow_none=True, use_builtin_types=True)
-    return s, t
-
-def check_connection(remote, timeout):
-    try:
-        host, port = remote.split(":")
-        port = int(port)
-    except Exception as e:
-        bb.warn("Failed to read remote definition (%s)" % str(e))
-        raise e
-
-    server, _transport = _create_server(host, port, timeout)
-    try:
-        ret, err =  server.runCommand(['getVariable', 'TOPDIR'])
-        if err or not ret:
-            return False
-    except ConnectionError:
-        return False
-    return True
-
-class BitBakeXMLRPCServerConnection(object):
-    def __init__(self, host, port, clientinfo=("localhost", 0), observer_only = False, featureset = None):
-        self.connection, self.transport = _create_server(host, port)
-        self.clientinfo = clientinfo
-        self.observer_only = observer_only
-        if featureset:
-            self.featureset = featureset
-        else:
-            self.featureset = []
-
-        self.events = uievent.BBUIEventQueue(self.connection, self.clientinfo)
-
-        _, error = self.connection.runCommand(["setFeatures", self.featureset])
-        if error:
-            # disconnect the client, we can't make the setFeature work
-            self.connection.removeClient()
-            # no need to log it here, the error shall be sent to the client
-            raise BaseException(error)
-
-    def connect(self, token = None):
-        if token is None:
-            if self.observer_only:
-                token = "observer"
-            else:
-                token = self.connection.addClient()
-
-        if token is None:
-            return None
-
-        self.transport.set_connection_token(token)
-        return self
-
-    def removeClient(self):
-        if not self.observer_only:
-            self.connection.removeClient()
-
-    def terminate(self):
-        # Don't wait for server indefinitely
-        socket.setdefaulttimeout(2)
-        try:
-            self.events.system_quit()
-        except:
-            pass
-        try:
-            self.connection.removeClient()
-        except:
-            pass
-
-def connectXMLRPC(remote, featureset, observer_only = False, token = None):
-    # The format of "remote" must be "server:port"
-    try:
-        [host, port] = remote.split(":")
-        port = int(port)
-    except Exception as e:
-        bb.warn("Failed to parse remote definition %s (%s)" % (remote, str(e)))
-        raise e
-
-    # We need our IP for the server connection. We get the IP
-    # by trying to connect with the server
-    try:
-        s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)
-        s.connect((host, port))
-        ip = s.getsockname()[0]
-        s.close()
-    except Exception as e:
-        bb.warn("Could not create socket for %s:%s (%s)" % (host, port, str(e)))
-        raise e
-    try:
-        connection = BitBakeXMLRPCServerConnection(host, port, (ip, 0), observer_only, featureset)
-        return connection.connect(token)
-    except Exception as e:
-        bb.warn("Could not connect to server at %s:%s (%s)" % (host, port, str(e)))
-        raise e
-
-
-

bitbake/lib/bb/server/xmlrpcserver.py

@@ -1,158 +0,0 @@
-#
-# BitBake XMLRPC Server Interface
-#
-# Copyright (C) 2006 - 2007  Michael 'Mickey' Lauer
-# Copyright (C) 2006 - 2008  Richard Purdie
-#
-# This program is free software; you can redistribute it and/or modify
-# it under the terms of the GNU General Public License version 2 as
-# published by the Free Software Foundation.
-#
-# This program is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-# GNU General Public License for more details.
-#
-# You should have received a copy of the GNU General Public License along
-# with this program; if not, write to the Free Software Foundation, Inc.,
-# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
-
-import os
-import sys
-
-import hashlib
-import time
-import inspect
-from xmlrpc.server import SimpleXMLRPCServer, SimpleXMLRPCRequestHandler
-
-import bb
-
-# This request handler checks if the request has a "Bitbake-token" header
-# field (this comes from the client side) and compares it with its internal
-# "Bitbake-token" field (this comes from the server). If the two are not
-# equal, it is assumed that a client is trying to connect to the server
-# while another client is connected to the server. In this case, a 503 error
-# ("service unavailable") is returned to the client.
-class BitBakeXMLRPCRequestHandler(SimpleXMLRPCRequestHandler):
-    def __init__(self, request, client_address, server):
-        self.server = server
-        SimpleXMLRPCRequestHandler.__init__(self, request, client_address, server)
-
-    def do_POST(self):
-        try:
-            remote_token = self.headers["Bitbake-token"]
-        except:
-            remote_token = None
-        if 0 and remote_token != self.server.connection_token and remote_token != "observer":
-            self.report_503()
-        else:
-            if remote_token == "observer":
-                self.server.readonly = True
-            else:
-                self.server.readonly = False
-            SimpleXMLRPCRequestHandler.do_POST(self)
-
-    def report_503(self):
-        self.send_response(503)
-        response = 'No more client allowed'
-        self.send_header("Content-type", "text/plain")
-        self.send_header("Content-length", str(len(response)))
-        self.end_headers()
-        self.wfile.write(bytes(response, 'utf-8'))
-
-class BitBakeXMLRPCServer(SimpleXMLRPCServer):
-    # remove this when you're done with debugging
-    # allow_reuse_address = True
-
-    def __init__(self, interface, cooker, parent):
-        # Use auto port configuration
-        if (interface[1] == -1):
-            interface = (interface[0], 0)
-        SimpleXMLRPCServer.__init__(self, interface,
-                                    requestHandler=BitBakeXMLRPCRequestHandler,
-                                    logRequests=False, allow_none=True)
-        self.host, self.port = self.socket.getsockname()
-        self.interface = interface
-
-        self.connection_token = None
-        self.commands = BitBakeXMLRPCServerCommands(self)
-        self.register_functions(self.commands, "")
-
-        self.cooker = cooker
-        self.parent = parent
-
-
-    def register_functions(self, context, prefix):
-        """
-        Convenience method for registering all functions in the scope
-        of this class that start with a common prefix
-        """
-        methodlist = inspect.getmembers(context, inspect.ismethod)
-        for name, method in methodlist:
-            if name.startswith(prefix):
-                self.register_function(method, name[len(prefix):])
-
-    def get_timeout(self, delay):
-        socktimeout = self.socket.gettimeout() or delay
-        return min(socktimeout, delay)
-
-    def handle_requests(self):
-        self._handle_request_noblock()
-
-class BitBakeXMLRPCServerCommands():
-
-    def __init__(self, server):
-        self.server = server
-        self.has_client = False
-
-    def registerEventHandler(self, host, port):
-        """
-        Register a remote UI Event Handler
-        """
-        s, t = bb.server.xmlrpcclient._create_server(host, port)
-
-        # we don't allow connections if the cooker is running
-        if (self.server.cooker.state in [bb.cooker.state.parsing, bb.cooker.state.running]):
-            return None, "Cooker is busy: %s" % bb.cooker.state.get_name(self.server.cooker.state)
-
-        self.event_handle = bb.event.register_UIHhandler(s, True)
-        return self.event_handle, 'OK'
-
-    def unregisterEventHandler(self, handlerNum):
-        """
-        Unregister a remote UI Event Handler
-        """
-        ret = bb.event.unregister_UIHhandler(handlerNum, True)
-        self.event_handle = None
-        return ret
-
-    def runCommand(self, command):
-        """
-        Run a cooker command on the server
-        """
-        return self.server.cooker.command.runCommand(command, self.server.readonly)
-
-    def getEventHandle(self):
-        return self.event_handle
-
-    def terminateServer(self):
-        """
-        Trigger the server to quit
-        """
-        self.server.parent.quit = True
-        print("XMLRPC Server triggering exit")
-        return
-
-    def addClient(self):
-        if self.server.parent.haveui:
-            return None
-        token = hashlib.md5(str(time.time()).encode("utf-8")).hexdigest()
-        self.server.connection_token = token
-        self.server.parent.haveui = True
-        return token
-
-    def removeClient(self):
-        if self.server.parent.haveui:
-            self.server.connection_token = None
-            self.server.parent.haveui = False
-

bitbake/lib/bb/shell.py

@@ -0,0 +1,820 @@
+# ex:ts=4:sw=4:sts=4:et
+# -*- tab-width: 4; c-basic-offset: 4; indent-tabs-mode: nil -*-
+##########################################################################
+#
+# Copyright (C) 2005-2006 Michael 'Mickey' Lauer <mickey@Vanille.de>
+# Copyright (C) 2005-2006 Vanille Media
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License version 2 as
+# published by the Free Software Foundation.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with this program; if not, write to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+#
+##########################################################################
+#
+# Thanks to:
+# * Holger Freyther <zecke@handhelds.org>
+# * Justin Patrin <papercrane@reversefold.com>
+#
+##########################################################################
+
+"""
+BitBake Shell
+
+IDEAS:
+    * list defined tasks per package
+    * list classes
+    * toggle force
+    * command to reparse just one (or more) bbfile(s)
+    * automatic check if reparsing is necessary (inotify?)
+    * frontend for bb file manipulation
+    * more shell-like features:
+        - output control, i.e. pipe output into grep, sort, etc.
+        - job control, i.e. bring running commands into background and foreground
+    * start parsing in background right after startup
+    * ncurses interface
+
+PROBLEMS:
+    * force doesn't always work
+    * readline completion for commands with more than one parameters
+
+"""
+
+##########################################################################
+# Import and setup global variables
+##########################################################################
+
+from __future__ import print_function
+from functools import reduce
+try:
+    set
+except NameError:
+    from sets import Set as set
+import sys, os, readline, socket, httplib, urllib, commands, popen2, shlex, Queue, fnmatch
+from bb import data, parse, build, cache, taskdata, runqueue, providers as Providers
+
+__version__ = "0.5.3.1"
+__credits__ = """BitBake Shell Version %s (C) 2005 Michael 'Mickey' Lauer <mickey@Vanille.de>
+Type 'help' for more information, press CTRL-D to exit.""" % __version__
+
+cmds = {}
+leave_mainloop = False
+last_exception = None
+cooker = None
+parsed = False
+debug = os.environ.get( "BBSHELL_DEBUG", "" )
+
+##########################################################################
+# Class BitBakeShellCommands
+##########################################################################
+
+class BitBakeShellCommands:
+    """This class contains the valid commands for the shell"""
+
+    def __init__( self, shell ):
+        """Register all the commands"""
+        self._shell = shell
+        for attr in BitBakeShellCommands.__dict__:
+            if not attr.startswith( "_" ):
+                if attr.endswith( "_" ):
+                    command = attr[:-1].lower()
+                else:
+                    command = attr[:].lower()
+                method = getattr( BitBakeShellCommands, attr )
+                debugOut( "registering command '%s'" % command )
+                # scan number of arguments
+                usage = getattr( method, "usage", "" )
+                if usage != "<...>":
+                    numArgs = len( usage.split() )
+                else:
+                    numArgs = -1
+                shell.registerCommand( command, method, numArgs, "%s %s" % ( command, usage ), method.__doc__ )
+
+    def _checkParsed( self ):
+        if not parsed:
+            print("SHELL: This command needs to parse bbfiles...")
+            self.parse( None )
+
+    def _findProvider( self, item ):
+        self._checkParsed()
+        # Need to use taskData for this information
+        preferred = data.getVar( "PREFERRED_PROVIDER_%s" % item, cooker.configuration.data, 1 )
+        if not preferred: preferred = item
+        try:
+            lv, lf, pv, pf = Providers.findBestProvider(preferred, cooker.configuration.data, cooker.status)
+        except KeyError:
+            if item in cooker.status.providers:
+                pf = cooker.status.providers[item][0]
+            else:
+                pf = None
+        return pf
+
+    def alias( self, params ):
+        """Register a new name for a command"""
+        new, old = params
+        if not old in cmds:
+            print("ERROR: Command '%s' not known" % old)
+        else:
+            cmds[new] = cmds[old]
+            print("OK")
+    alias.usage = "<alias> <command>"
+
+    def buffer( self, params ):
+        """Dump specified output buffer"""
+        index = params[0]
+        print(self._shell.myout.buffer( int( index ) ))
+    buffer.usage = "<index>"
+
+    def buffers( self, params ):
+        """Show the available output buffers"""
+        commands = self._shell.myout.bufferedCommands()
+        if not commands:
+            print("SHELL: No buffered commands available yet. Start doing something.")
+        else:
+            print("="*35, "Available Output Buffers", "="*27)
+            for index, cmd in enumerate( commands ):
+                print("| %s %s" % ( str( index ).ljust( 3 ), cmd ))
+            print("="*88)
+
+    def build( self, params, cmd = "build" ):
+        """Build a providee"""
+        global last_exception
+        globexpr = params[0]
+        self._checkParsed()
+        names = globfilter( cooker.status.pkg_pn, globexpr )
+        if len( names ) == 0: names = [ globexpr ]
+        print("SHELL: Building %s" % ' '.join( names ))
+
+        td = taskdata.TaskData(cooker.configuration.abort)
+        localdata = data.createCopy(cooker.configuration.data)
+        data.update_data(localdata)
+        data.expandKeys(localdata)
+
+        try:
+            tasks = []
+            for name in names:
+                td.add_provider(localdata, cooker.status, name)
+                providers = td.get_provider(name)
+
+                if len(providers) == 0:
+                    raise Providers.NoProvider
+
+                tasks.append([name, "do_%s" % cmd])
+
+            td.add_unresolved(localdata, cooker.status)
+
+            rq = runqueue.RunQueue(cooker, localdata, cooker.status, td, tasks)
+            rq.prepare_runqueue()
+            rq.execute_runqueue()
+
+        except Providers.NoProvider:
+            print("ERROR: No Provider")
+            last_exception = Providers.NoProvider
+
+        except runqueue.TaskFailure as fnids:
+            last_exception = runqueue.TaskFailure
+
+        except build.FuncFailed as e:
+            print("ERROR: Couldn't build '%s'" % names)
+            last_exception = e
+
+
+    build.usage = "<providee>"
+
+    def clean( self, params ):
+        """Clean a providee"""
+        self.build( params, "clean" )
+    clean.usage = "<providee>"
+
+    def compile( self, params ):
+        """Execute 'compile' on a providee"""
+        self.build( params, "compile" )
+    compile.usage = "<providee>"
+
+    def configure( self, params ):
+        """Execute 'configure' on a providee"""
+        self.build( params, "configure" )
+    configure.usage = "<providee>"
+
+    def install( self, params ):
+        """Execute 'install' on a providee"""
+        self.build( params, "install" )
+    install.usage = "<providee>"
+
+    def edit( self, params ):
+        """Call $EDITOR on a providee"""
+        name = params[0]
+        bbfile = self._findProvider( name )
+        if bbfile is not None:
+            os.system( "%s %s" % ( os.environ.get( "EDITOR", "vi" ), bbfile ) )
+        else:
+            print("ERROR: Nothing provides '%s'" % name)
+    edit.usage = "<providee>"
+
+    def environment( self, params ):
+        """Dump out the outer BitBake environment"""
+        cooker.showEnvironment()
+
+    def exit_( self, params ):
+        """Leave the BitBake Shell"""
+        debugOut( "setting leave_mainloop to true" )
+        global leave_mainloop
+        leave_mainloop = True
+
+    def fetch( self, params ):
+        """Fetch a providee"""
+        self.build( params, "fetch" )
+    fetch.usage = "<providee>"
+
+    def fileBuild( self, params, cmd = "build" ):
+        """Parse and build a .bb file"""
+        global last_exception
+        name = params[0]
+        bf = completeFilePath( name )
+        print("SHELL: Calling '%s' on '%s'" % ( cmd, bf ))
+
+        try:
+            cooker.buildFile(bf, cmd)
+        except parse.ParseError:
+            print("ERROR: Unable to open or parse '%s'" % bf)
+        except build.FuncFailed as e:
+            print("ERROR: Couldn't build '%s'" % name)
+            last_exception = e
+
+    fileBuild.usage = "<bbfile>"
+
+    def fileClean( self, params ):
+        """Clean a .bb file"""
+        self.fileBuild( params, "clean" )
+    fileClean.usage = "<bbfile>"
+
+    def fileEdit( self, params ):
+        """Call $EDITOR on a .bb file"""
+        name = params[0]
+        os.system( "%s %s" % ( os.environ.get( "EDITOR", "vi" ), completeFilePath( name ) ) )
+    fileEdit.usage = "<bbfile>"
+
+    def fileRebuild( self, params ):
+        """Rebuild (clean & build) a .bb file"""
+        self.fileBuild( params, "rebuild" )
+    fileRebuild.usage = "<bbfile>"
+
+    def fileReparse( self, params ):
+        """(re)Parse a bb file"""
+        bbfile = params[0]
+        print("SHELL: Parsing '%s'" % bbfile)
+        parse.update_mtime( bbfile )
+        cooker.parser.reparse(bbfile)
+        if False: #fromCache:
+            print("SHELL: File has not been updated, not reparsing")
+        else:
+            print("SHELL: Parsed")
+    fileReparse.usage = "<bbfile>"
+
+    def abort( self, params ):
+        """Toggle abort task execution flag (see bitbake -k)"""
+        cooker.configuration.abort = not cooker.configuration.abort
+        print("SHELL: Abort Flag is now '%s'" % repr( cooker.configuration.abort ))
+
+    def force( self, params ):
+        """Toggle force task execution flag (see bitbake -f)"""
+        cooker.configuration.force = not cooker.configuration.force
+        print("SHELL: Force Flag is now '%s'" % repr( cooker.configuration.force ))
+
+    def help( self, params ):
+        """Show a comprehensive list of commands and their purpose"""
+        print("="*30, "Available Commands", "="*30)
+        for cmd in sorted(cmds):
+            function, numparams, usage, helptext = cmds[cmd]
+            print("| %s | %s" % (usage.ljust(30), helptext))
+        print("="*78)
+
+    def lastError( self, params ):
+        """Show the reason or log that was produced by the last BitBake event exception"""
+        if last_exception is None:
+            print("SHELL: No Errors yet (Phew)...")
+        else:
+            reason, event = last_exception.args
+            print("SHELL: Reason for the last error: '%s'" % reason)
+            if ':' in reason:
+                msg, filename = reason.split( ':' )
+                filename = filename.strip()
+                print("SHELL: Dumping log file for last error:")
+                try:
+                    print(open( filename ).read())
+                except IOError:
+                    print("ERROR: Couldn't open '%s'" % filename)
+
+    def match( self, params ):
+        """Dump all files or providers matching a glob expression"""
+        what, globexpr = params
+        if what == "files":
+            self._checkParsed()
+            for key in globfilter( cooker.status.pkg_fn, globexpr ): print(key)
+        elif what == "providers":
+            self._checkParsed()
+            for key in globfilter( cooker.status.pkg_pn, globexpr ): print(key)
+        else:
+            print("Usage: match %s" % self.print_.usage)
+    match.usage = "<files|providers> <glob>"
+
+    def new( self, params ):
+        """Create a new .bb file and open the editor"""
+        dirname, filename = params
+        packages = '/'.join( data.getVar( "BBFILES", cooker.configuration.data, 1 ).split('/')[:-2] )
+        fulldirname = "%s/%s" % ( packages, dirname )
+
+        if not os.path.exists( fulldirname ):
+            print("SHELL: Creating '%s'" % fulldirname)
+            os.mkdir( fulldirname )
+        if os.path.exists( fulldirname ) and os.path.isdir( fulldirname ):
+            if os.path.exists( "%s/%s" % ( fulldirname, filename ) ):
+                print("SHELL: ERROR: %s/%s already exists" % ( fulldirname, filename ))
+                return False
+            print("SHELL: Creating '%s/%s'" % ( fulldirname, filename ))
+            newpackage = open( "%s/%s" % ( fulldirname, filename ), "w" )
+            print("""DESCRIPTION = ""
+SECTION = ""
+AUTHOR = ""
+HOMEPAGE = ""
+MAINTAINER = ""
+LICENSE = "GPL"
+PR = "r0"
+
+SRC_URI = ""
+
+#inherit base
+
+#do_configure() {
+#
+#}
+
+#do_compile() {
+#
+#}
+
+#do_stage() {
+#
+#}
+
+#do_install() {
+#
+#}
+""", file=newpackage)
+            newpackage.close()
+            os.system( "%s %s/%s" % ( os.environ.get( "EDITOR" ), fulldirname, filename ) )
+    new.usage = "<directory> <filename>"
+
+    def package( self, params ):
+        """Execute 'package' on a providee"""
+        self.build( params, "package" )
+    package.usage = "<providee>"
+
+    def pasteBin( self, params ):
+        """Send a command + output buffer to the pastebin at http://rafb.net/paste"""
+        index = params[0]
+        contents = self._shell.myout.buffer( int( index ) )
+        sendToPastebin( "output of " + params[0], contents )
+    pasteBin.usage = "<index>"
+
+    def pasteLog( self, params ):
+        """Send the last event exception error log (if there is one) to http://rafb.net/paste"""
+        if last_exception is None:
+            print("SHELL: No Errors yet (Phew)...")
+        else:
+            reason, event = last_exception.args
+            print("SHELL: Reason for the last error: '%s'" % reason)
+            if ':' in reason:
+                msg, filename = reason.split( ':' )
+                filename = filename.strip()
+                print("SHELL: Pasting log file to pastebin...")
+
+                file = open( filename ).read()
+                sendToPastebin( "contents of " + filename, file )
+
+    def patch( self, params ):
+        """Execute 'patch' command on a providee"""
+        self.build( params, "patch" )
+    patch.usage = "<providee>"
+
+    def parse( self, params ):
+        """(Re-)parse .bb files and calculate the dependency graph"""
+        cooker.status = cache.CacheData(cooker.caches_array)
+        ignore = data.getVar("ASSUME_PROVIDED", cooker.configuration.data, 1) or ""
+        cooker.status.ignored_dependencies = set( ignore.split() )
+        cooker.handleCollections( data.getVar("BBFILE_COLLECTIONS", cooker.configuration.data, 1) )
+
+        (filelist, masked) = cooker.collect_bbfiles()
+        cooker.parse_bbfiles(filelist, masked, cooker.myProgressCallback)
+        cooker.buildDepgraph()
+        global parsed
+        parsed = True
+        print()
+
+    def reparse( self, params ):
+        """(re)Parse a providee's bb file"""
+        bbfile = self._findProvider( params[0] )
+        if bbfile is not None:
+            print("SHELL: Found bbfile '%s' for '%s'" % ( bbfile, params[0] ))
+            self.fileReparse( [ bbfile ] )
+        else:
+            print("ERROR: Nothing provides '%s'" % params[0])
+    reparse.usage = "<providee>"
+
+    def getvar( self, params ):
+        """Dump the contents of an outer BitBake environment variable"""
+        var = params[0]
+        value = data.getVar( var, cooker.configuration.data, 1 )
+        print(value)
+    getvar.usage = "<variable>"
+
+    def peek( self, params ):
+        """Dump contents of variable defined in providee's metadata"""
+        name, var = params
+        bbfile = self._findProvider( name )
+        if bbfile is not None:
+            the_data = cache.Cache.loadDataFull(bbfile, cooker.configuration.data)
+            value = the_data.getVar( var, 1 )
+            print(value)
+        else:
+            print("ERROR: Nothing provides '%s'" % name)
+    peek.usage = "<providee> <variable>"
+
+    def poke( self, params ):
+        """Set contents of variable defined in providee's metadata"""
+        name, var, value = params
+        bbfile = self._findProvider( name )
+        if bbfile is not None:
+            print("ERROR: Sorry, this functionality is currently broken")
+            #d = cooker.pkgdata[bbfile]
+            #data.setVar( var, value, d )
+
+            # mark the change semi persistant
+            #cooker.pkgdata.setDirty(bbfile, d)
+            #print "OK"
+        else:
+            print("ERROR: Nothing provides '%s'" % name)
+    poke.usage = "<providee> <variable> <value>"
+
+    def print_( self, params ):
+        """Dump all files or providers"""
+        what = params[0]
+        if what == "files":
+            self._checkParsed()
+            for key in cooker.status.pkg_fn: print(key)
+        elif what == "providers":
+            self._checkParsed()
+            for key in cooker.status.providers: print(key)
+        else:
+            print("Usage: print %s" % self.print_.usage)
+    print_.usage = "<files|providers>"
+
+    def python( self, params ):
+        """Enter the expert mode - an interactive BitBake Python Interpreter"""
+        sys.ps1 = "EXPERT BB>>> "
+        sys.ps2 = "EXPERT BB... "
+        import code
+        interpreter = code.InteractiveConsole( dict( globals() ) )
+        interpreter.interact( "SHELL: Expert Mode - BitBake Python %s\nType 'help' for more information, press CTRL-D to switch back to BBSHELL." % sys.version )
+
+    def showdata( self, params ):
+        """Execute 'showdata' on a providee"""
+        cooker.showEnvironment(None, params)
+    showdata.usage = "<providee>"
+
+    def setVar( self, params ):
+        """Set an outer BitBake environment variable"""
+        var, value = params
+        data.setVar( var, value, cooker.configuration.data )
+        print("OK")
+    setVar.usage = "<variable> <value>"
+
+    def rebuild( self, params ):
+        """Clean and rebuild a .bb file or a providee"""
+        self.build( params, "clean" )
+        self.build( params, "build" )
+    rebuild.usage = "<providee>"
+
+    def shell( self, params ):
+        """Execute a shell command and dump the output"""
+        if params != "":
+            print(commands.getoutput( " ".join( params ) ))
+    shell.usage = "<...>"
+
+    def stage( self, params ):
+        """Execute 'stage' on a providee"""
+        self.build( params, "populate_staging" )
+    stage.usage = "<providee>"
+
+    def status( self, params ):
+        """<just for testing>"""
+        print("-" * 78)
+        print("building list = '%s'" % cooker.building_list)
+        print("build path = '%s'" % cooker.build_path)
+        print("consider_msgs_cache = '%s'" % cooker.consider_msgs_cache)
+        print("build stats = '%s'" % cooker.stats)
+        if last_exception is not None: print("last_exception = '%s'" % repr( last_exception.args ))
+        print("memory output contents = '%s'" % self._shell.myout._buffer)
+
+    def test( self, params ):
+        """<just for testing>"""
+        print("testCommand called with '%s'" % params)
+
+    def unpack( self, params ):
+        """Execute 'unpack' on a providee"""
+        self.build( params, "unpack" )
+    unpack.usage = "<providee>"
+
+    def which( self, params ):
+        """Computes the providers for a given providee"""
+        # Need to use taskData for this information
+        item = params[0]
+
+        self._checkParsed()
+
+        preferred = data.getVar( "PREFERRED_PROVIDER_%s" % item, cooker.configuration.data, 1 )
+        if not preferred: preferred = item
+
+        try:
+            lv, lf, pv, pf = Providers.findBestProvider(preferred, cooker.configuration.data, cooker.status)
+        except KeyError:
+            lv, lf, pv, pf = (None,)*4
+
+        try:
+            providers = cooker.status.providers[item]
+        except KeyError:
+            print("SHELL: ERROR: Nothing provides", preferred)
+        else:
+            for provider in providers:
+                if provider == pf: provider = " (***) %s" % provider
+                else:              provider = "       %s" % provider
+                print(provider)
+    which.usage = "<providee>"
+
+##########################################################################
+# Common helper functions
+##########################################################################
+
+def completeFilePath( bbfile ):
+    """Get the complete bbfile path"""
+    if not cooker.status: return bbfile
+    if not cooker.status.pkg_fn: return bbfile
+    for key in cooker.status.pkg_fn:
+        if key.endswith( bbfile ):
+            return key
+    return bbfile
+
+def sendToPastebin( desc, content ):
+    """Send content to http://oe.pastebin.com"""
+    mydata = {}
+    mydata["lang"] = "Plain Text"
+    mydata["desc"] = desc
+    mydata["cvt_tabs"] = "No"
+    mydata["nick"] = "%s@%s" % ( os.environ.get( "USER", "unknown" ), socket.gethostname() or "unknown" )
+    mydata["text"] = content
+    params = urllib.urlencode( mydata )
+    headers = {"Content-type": "application/x-www-form-urlencoded", "Accept": "text/plain"}
+
+    host = "rafb.net"
+    conn = httplib.HTTPConnection( "%s:80" % host )
+    conn.request("POST", "/paste/paste.php", params, headers )
+
+    response = conn.getresponse()
+    conn.close()
+
+    if response.status == 302:
+        location = response.getheader( "location" ) or "unknown"
+        print("SHELL: Pasted to http://%s%s" % ( host, location ))
+    else:
+        print("ERROR: %s %s" % ( response.status, response.reason ))
+
+def completer( text, state ):
+    """Return a possible readline completion"""
+    debugOut( "completer called with text='%s', state='%d'" % ( text, state ) )
+
+    if state == 0:
+        line = readline.get_line_buffer()
+        if " " in line:
+            line = line.split()
+            # we are in second (or more) argument
+            if line[0] in cmds and hasattr( cmds[line[0]][0], "usage" ): # known command and usage
+                u = getattr( cmds[line[0]][0], "usage" ).split()[0]
+                if u == "<variable>":
+                    allmatches = cooker.configuration.data.keys()
+                elif u == "<bbfile>":
+                    if cooker.status.pkg_fn is None: allmatches = [ "(No Matches Available. Parsed yet?)" ]
+                    else: allmatches = [ x.split("/")[-1] for x in cooker.status.pkg_fn ]
+                elif u == "<providee>":
+                    if cooker.status.pkg_fn is None: allmatches = [ "(No Matches Available. Parsed yet?)" ]
+                    else: allmatches = cooker.status.providers.iterkeys()
+                else: allmatches = [ "(No tab completion available for this command)" ]
+            else: allmatches = [ "(No tab completion available for this command)" ]
+        else:
+            # we are in first argument
+            allmatches = cmds.iterkeys()
+
+        completer.matches = [ x for x in allmatches if x[:len(text)] == text ]
+        #print "completer.matches = '%s'" % completer.matches
+    if len( completer.matches ) > state:
+        return completer.matches[state]
+    else:
+        return None
+
+def debugOut( text ):
+    if debug:
+        sys.stderr.write( "( %s )\n" % text )
+
+def columnize( alist, width = 80 ):
+    """
+    A word-wrap function that preserves existing line breaks
+    and most spaces in the text. Expects that existing line
+    breaks are posix newlines (\n).
+    """
+    return reduce(lambda line, word, width=width: '%s%s%s' %
+                  (line,
+                   ' \n'[(len(line[line.rfind('\n')+1:])
+                         + len(word.split('\n', 1)[0]
+                              ) >= width)],
+                   word),
+                  alist
+                 )
+
+def globfilter( names, pattern ):
+    return fnmatch.filter( names, pattern )
+
+##########################################################################
+# Class MemoryOutput
+##########################################################################
+
+class MemoryOutput:
+    """File-like output class buffering the output of the last 10 commands"""
+    def __init__( self, delegate ):
+        self.delegate = delegate
+        self._buffer = []
+        self.text = []
+        self._command = None
+
+    def startCommand( self, command ):
+        self._command = command
+        self.text = []
+    def endCommand( self ):
+        if self._command is not None:
+            if len( self._buffer ) == 10: del self._buffer[0]
+            self._buffer.append( ( self._command, self.text ) )
+    def removeLast( self ):
+        if self._buffer:
+            del self._buffer[ len( self._buffer ) - 1 ]
+        self.text = []
+        self._command = None
+    def lastBuffer( self ):
+        if self._buffer:
+            return self._buffer[ len( self._buffer ) -1 ][1]
+    def bufferedCommands( self ):
+        return [ cmd for cmd, output in self._buffer ]
+    def buffer( self, i ):
+        if i < len( self._buffer ):
+            return "BB>> %s\n%s" % ( self._buffer[i][0], "".join( self._buffer[i][1] ) )
+        else: return "ERROR: Invalid buffer number. Buffer needs to be in (0, %d)" % ( len( self._buffer ) - 1 )
+    def write( self, text ):
+        if self._command is not None and text != "BB>> ": self.text.append( text )
+        if self.delegate is not None: self.delegate.write( text )
+    def flush( self ):
+        return self.delegate.flush()
+    def fileno( self ):
+        return self.delegate.fileno()
+    def isatty( self ):
+        return self.delegate.isatty()
+
+##########################################################################
+# Class BitBakeShell
+##########################################################################
+
+class BitBakeShell:
+
+    def __init__( self ):
+        """Register commands and set up readline"""
+        self.commandQ = Queue.Queue()
+        self.commands = BitBakeShellCommands( self )
+        self.myout = MemoryOutput( sys.stdout )
+        self.historyfilename = os.path.expanduser( "~/.bbsh_history" )
+        self.startupfilename = os.path.expanduser( "~/.bbsh_startup" )
+
+        readline.set_completer( completer )
+        readline.set_completer_delims( " " )
+        readline.parse_and_bind("tab: complete")
+
+        try:
+            readline.read_history_file( self.historyfilename )
+        except IOError:
+            pass  # It doesn't exist yet.
+
+        print(__credits__)
+
+    def cleanup( self ):
+        """Write readline history and clean up resources"""
+        debugOut( "writing command history" )
+        try:
+            readline.write_history_file( self.historyfilename )
+        except:
+            print("SHELL: Unable to save command history")
+
+    def registerCommand( self, command, function, numparams = 0, usage = "", helptext = "" ):
+        """Register a command"""
+        if usage == "": usage = command
+        if helptext == "": helptext = function.__doc__ or "<not yet documented>"
+        cmds[command] = ( function, numparams, usage, helptext )
+
+    def processCommand( self, command, params ):
+        """Process a command. Check number of params and print a usage string, if appropriate"""
+        debugOut( "processing command '%s'..." % command )
+        try:
+            function, numparams, usage, helptext = cmds[command]
+        except KeyError:
+            print("SHELL: ERROR: '%s' command is not a valid command." % command)
+            self.myout.removeLast()
+        else:
+            if (numparams != -1) and (not len( params ) == numparams):
+                print("Usage: '%s'" % usage)
+                return
+
+            result = function( self.commands, params )
+            debugOut( "result was '%s'" % result )
+
+    def processStartupFile( self ):
+        """Read and execute all commands found in $HOME/.bbsh_startup"""
+        if os.path.exists( self.startupfilename ):
+            startupfile = open( self.startupfilename, "r" )
+            for cmdline in startupfile:
+                debugOut( "processing startup line '%s'" % cmdline )
+                if not cmdline:
+                    continue
+                if "|" in cmdline:
+                    print("ERROR: '|' in startup file is not allowed. Ignoring line")
+                    continue
+                self.commandQ.put( cmdline.strip() )
+
+    def main( self ):
+        """The main command loop"""
+        while not leave_mainloop:
+            try:
+                if self.commandQ.empty():
+                    sys.stdout = self.myout.delegate
+                    cmdline = raw_input( "BB>> " )
+                    sys.stdout = self.myout
+                else:
+                    cmdline = self.commandQ.get()
+                if cmdline:
+                    allCommands = cmdline.split( ';' )
+                    for command in allCommands:
+                        pipecmd = None
+                        #
+                        # special case for expert mode
+                        if command == 'python':
+                            sys.stdout = self.myout.delegate
+                            self.processCommand( command, "" )
+                            sys.stdout = self.myout
+                        else:
+                            self.myout.startCommand( command )
+                            if '|' in command: # disable output
+                                command, pipecmd = command.split( '|' )
+                                delegate = self.myout.delegate
+                                self.myout.delegate = None
+                            tokens = shlex.split( command, True )
+                            self.processCommand( tokens[0], tokens[1:] or "" )
+                            self.myout.endCommand()
+                            if pipecmd is not None: # restore output
+                                self.myout.delegate = delegate
+
+                                pipe = popen2.Popen4( pipecmd )
+                                pipe.tochild.write( "\n".join( self.myout.lastBuffer() ) )
+                                pipe.tochild.close()
+                                sys.stdout.write( pipe.fromchild.read() )
+                        #
+            except EOFError:
+                print()
+                return
+            except KeyboardInterrupt:
+                print()
+
+##########################################################################
+# Start function - called from the BitBake command line utility
+##########################################################################
+
+def start( aCooker ):
+    global cooker
+    cooker = aCooker
+    bbshell = BitBakeShell()
+    bbshell.processStartupFile()
+    bbshell.main()
+    bbshell.cleanup()
+
+if __name__ == "__main__":
+    print("SHELL: Sorry, this program should only be called by BitBake.")

bitbake/lib/bb/siggen.py

@@ -3,19 +3,21 @@ import logging
 import os
 import re
 import tempfile
-import pickle
 import bb.data
-import difflib
-import simplediff
-from bb.checksum import FileChecksumCache
 
 logger = logging.getLogger('BitBake.SigGen')
 
+try:
+    import cPickle as pickle
+except ImportError:
+    import pickle
+    logger.info('Importing cPickle failed.  Falling back to a very slow implementation.')
+
 def init(d):
-    siggens = [obj for obj in globals().values()
+    siggens = [obj for obj in globals().itervalues()
                       if type(obj) is type and issubclass(obj, SignatureGenerator)]
 
-    desired = d.getVar("BB_SIGNATURE_HANDLER") or "noop"
+    desired = d.getVar("BB_SIGNATURE_HANDLER", True) or "noop"
     for sg in siggens:
         if desired == sg.name:
             return sg(d)
@@ -32,23 +34,17 @@ class SignatureGenerator(object):
     name = "noop"
 
     def __init__(self, data):
-        self.basehash = {}
         self.taskhash = {}
         self.runtaskdeps = {}
         self.file_checksum_values = {}
-        self.taints = {}
 
     def finalise(self, fn, d, varient):
         return
 
-    def get_unihash(self, task):
-        return self.taskhash[task]
-
     def get_taskhash(self, fn, task, deps, dataCache):
         return "0"
 
-    def writeout_file_checksum_cache(self):
-        """Write/update the file checksum cache onto disk"""
+    def set_taskdata(self, hashes, deps, checksum):
         return
 
     def stampfile(self, stampbase, file_name, taskname, extrainfo):
@@ -67,13 +63,10 @@ class SignatureGenerator(object):
         return
 
     def get_taskdata(self):
-        return (self.runtaskdeps, self.taskhash, self.file_checksum_values, self.taints, self.basehash)
+       return (self.runtaskdeps, self.taskhash, self.file_checksum_values)
 
     def set_taskdata(self, data):
-        self.runtaskdeps, self.taskhash, self.file_checksum_values, self.taints, self.basehash = data
-
-    def reset(self, data):
-        self.__init__(data)
+        self.runtaskdeps, self.taskhash, self.file_checksum_values = data
 
 
 class SignatureGeneratorBasic(SignatureGenerator):
@@ -87,22 +80,15 @@ class SignatureGeneratorBasic(SignatureGenerator):
         self.taskdeps = {}
         self.runtaskdeps = {}
         self.file_checksum_values = {}
-        self.taints = {}
         self.gendeps = {}
         self.lookupcache = {}
-        self.pkgnameextract = re.compile(r"(?P<fn>.*)\..*")
-        self.basewhitelist = set((data.getVar("BB_HASHBASE_WHITELIST") or "").split())
+        self.pkgnameextract = re.compile("(?P<fn>.*)\..*")
+        self.basewhitelist = set((data.getVar("BB_HASHBASE_WHITELIST", True) or "").split())
         self.taskwhitelist = None
         self.init_rundepcheck(data)
-        checksum_cache_file = data.getVar("BB_HASH_CHECKSUM_CACHE_FILE")
-        if checksum_cache_file:
-            self.checksum_cache = FileChecksumCache()
-            self.checksum_cache.init_cache(data, checksum_cache_file)
-        else:
-            self.checksum_cache = None
 
     def init_rundepcheck(self, data):
-        self.taskwhitelist = data.getVar("BB_HASHTASK_WHITELIST") or None
+        self.taskwhitelist = data.getVar("BB_HASHTASK_WHITELIST", True) or None
         if self.taskwhitelist:
             self.twl = re.compile(self.taskwhitelist)
         else:
@@ -110,16 +96,40 @@ class SignatureGeneratorBasic(SignatureGenerator):
 
     def _build_data(self, fn, d):
 
-        ignore_mismatch = ((d.getVar("BB_HASH_IGNORE_MISMATCH") or '') == '1')
         tasklist, gendeps, lookupcache = bb.data.generate_dependencies(d)
 
-        taskdeps, basehash = bb.data.generate_dependency_hash(tasklist, gendeps, lookupcache, self.basewhitelist, fn)
+        taskdeps = {}
+        basehash = {}
 
         for task in tasklist:
-            k = fn + "." + task
-            if not ignore_mismatch and k in self.basehash and self.basehash[k] != basehash[k]:
-                bb.error("When reparsing %s, the basehash value changed from %s to %s. The metadata is not deterministic and this needs to be fixed." % (k, self.basehash[k], basehash[k]))
-            self.basehash[k] = basehash[k]
+            data = lookupcache[task]
+
+            if data is None:
+                bb.error("Task %s from %s seems to be empty?!" % (task, fn))
+                data = ''
+
+            gendeps[task] -= self.basewhitelist
+            newdeps = gendeps[task]
+            seen = set()
+            while newdeps:
+                nextdeps = newdeps
+                seen |= nextdeps
+                newdeps = set()
+                for dep in nextdeps:
+                    if dep in self.basewhitelist:
+                        continue
+                    gendeps[dep] -= self.basewhitelist
+                    newdeps |= gendeps[dep]
+                newdeps -= seen
+
+            alldeps = sorted(seen)
+            for dep in alldeps:
+                data = data + dep
+                var = lookupcache[dep]
+                if var is not None:
+                    data = data + str(var)
+            self.basehash[fn + "." + task] = hashlib.md5(data).hexdigest()
+            taskdeps[task] = alldeps
 
         self.taskdeps[fn] = taskdeps
         self.gendeps[fn] = gendeps
@@ -129,21 +139,18 @@ class SignatureGeneratorBasic(SignatureGenerator):
 
     def finalise(self, fn, d, variant):
 
-        mc = d.getVar("__BBMULTICONFIG", False) or ""
-        if variant or mc:
-            fn = bb.cache.realfn2virtual(fn, variant, mc)
+        if variant:
+            fn = "virtual:" + variant + ":" + fn
 
         try:
             taskdeps = self._build_data(fn, d)
-        except bb.parse.SkipRecipe:
-            raise
         except:
-            bb.warn("Error during finalise of %s" % fn)
+            bb.note("Error during finalise of %s" % fn)
             raise
 
         #Slow but can be useful for debugging mismatched basehashes
         #for task in self.taskdeps[fn]:
-        #    self.dump_sigtask(fn, task, d.getVar("STAMP"), False)
+        #    self.dump_sigtask(fn, task, d.getVar("STAMP", True), False)
 
         for task in taskdeps:
             d.setVar("BB_BASEHASH_task-%s" % task, self.basehash[fn + "." + task])
@@ -167,78 +174,41 @@ class SignatureGeneratorBasic(SignatureGenerator):
         return taint
 
     def get_taskhash(self, fn, task, deps, dataCache):
-
-        mc = ''
-        if fn.startswith('multiconfig:'):
-            mc = fn.split(':')[1]
         k = fn + "." + task
-
         data = dataCache.basetaskhash[k]
-        self.basehash[k] = data
         self.runtaskdeps[k] = []
-        self.file_checksum_values[k] = []
+        self.file_checksum_values[k] = {}
         recipename = dataCache.pkg_fn[fn]
         for dep in sorted(deps, key=clean_basepath):
-            pkgname = self.pkgnameextract.search(dep).group('fn')
-            if mc:
-                depmc = pkgname.split(':')[1]
-                if mc != depmc:
-                    continue
-            if dep.startswith("multiconfig:") and not mc:
-                continue
-            depname = dataCache.pkg_fn[pkgname]
+            depname = dataCache.pkg_fn[self.pkgnameextract.search(dep).group('fn')]
             if not self.rundep_check(fn, recipename, task, dep, depname, dataCache):
                 continue
             if dep not in self.taskhash:
-                bb.fatal("%s is not in taskhash, caller isn't calling in dependency order?" % dep)
-            data = data + self.get_unihash(dep)
+                bb.fatal("%s is not in taskhash, caller isn't calling in dependency order?", dep)
+            data = data + self.taskhash[dep]
             self.runtaskdeps[k].append(dep)
 
         if task in dataCache.file_checksums[fn]:
-            if self.checksum_cache:
-                checksums = self.checksum_cache.get_checksums(dataCache.file_checksums[fn][task], recipename)
-            else:
-                checksums = bb.fetch2.get_file_checksums(dataCache.file_checksums[fn][task], recipename)
+            checksums = bb.fetch2.get_file_checksums(dataCache.file_checksums[fn][task], recipename)
             for (f,cs) in checksums:
-                self.file_checksum_values[k].append((f,cs))
+                self.file_checksum_values[k][f] = cs
                 if cs:
                     data = data + cs
 
-        taskdep = dataCache.task_deps[fn]
-        if 'nostamp' in taskdep and task in taskdep['nostamp']:
-            # Nostamp tasks need an implicit taint so that they force any dependent tasks to run
-            import uuid
-            taint = str(uuid.uuid4())
-            data = data + taint
-            self.taints[k] = "nostamp:" + taint
-
         taint = self.read_taint(fn, task, dataCache.stamp[fn])
         if taint:
             data = data + taint
-            self.taints[k] = taint
-            logger.warning("%s is tainted from a forced run" % k)
+            logger.warn("%s is tainted from a forced run" % k)
 
-        h = hashlib.sha256(data.encode("utf-8")).hexdigest()
+        h = hashlib.md5(data).hexdigest()
         self.taskhash[k] = h
         #d.setVar("BB_TASKHASH_task-%s" % task, taskhash[task])
         return h
 
-    def writeout_file_checksum_cache(self):
-        """Write/update the file checksum cache onto disk"""
-        if self.checksum_cache:
-            self.checksum_cache.save_extras()
-            self.checksum_cache.save_merge()
-        else:
-            bb.fetch2.fetcher_parse_save()
-            bb.fetch2.fetcher_parse_done()
-
     def dump_sigtask(self, fn, task, stampbase, runtime):
-
         k = fn + "." + task
-        referencestamp = stampbase
-        if isinstance(runtime, str) and runtime.startswith("customfile"):
+        if runtime == "customfile":
             sigfile = stampbase
-            referencestamp = runtime[11:]
         elif runtime and k in self.taskhash:
             sigfile = stampbase + "." + task + ".sigdata" + "." + self.taskhash[k]
         else:
@@ -247,7 +217,6 @@ class SignatureGeneratorBasic(SignatureGenerator):
         bb.utils.mkdirhier(os.path.dirname(sigfile))
 
         data = {}
-        data['task'] = task
         data['basewhitelist'] = self.basewhitelist
         data['taskwhitelist'] = self.taskwhitelist
         data['taskdeps'] = self.taskdeps[fn][task]
@@ -263,35 +232,21 @@ class SignatureGeneratorBasic(SignatureGenerator):
 
         if runtime and k in self.taskhash:
             data['runtaskdeps'] = self.runtaskdeps[k]
-            data['file_checksum_values'] = [(os.path.basename(f), cs) for f,cs in self.file_checksum_values[k]]
+            data['file_checksum_values'] = [(os.path.basename(f), cs) for f,cs in self.file_checksum_values[k].items()]
             data['runtaskhashes'] = {}
             for dep in data['runtaskdeps']:
-                data['runtaskhashes'][dep] = self.get_unihash(dep)
-            data['taskhash'] = self.taskhash[k]
+                data['runtaskhashes'][dep] = self.taskhash[dep]
 
-        taint = self.read_taint(fn, task, referencestamp)
+        taint = self.read_taint(fn, task, stampbase)
         if taint:
             data['taint'] = taint
 
-        if runtime and k in self.taints:
-            if 'nostamp:' in self.taints[k]:
-                data['taint'] = self.taints[k]
-
-        computed_basehash = calc_basehash(data)
-        if computed_basehash != self.basehash[k]:
-            bb.error("Basehash mismatch %s versus %s for %s" % (computed_basehash, self.basehash[k], k))
-        if runtime and k in self.taskhash:
-            computed_taskhash = calc_taskhash(data)
-            if computed_taskhash != self.taskhash[k]:
-                bb.error("Taskhash mismatch %s versus %s for %s" % (computed_taskhash, self.taskhash[k], k))
-                sigfile = sigfile.replace(self.taskhash[k], computed_taskhash)
-
         fd, tmpfile = tempfile.mkstemp(dir=os.path.dirname(sigfile), prefix="sigtask.")
         try:
             with os.fdopen(fd, "wb") as stream:
                 p = pickle.dump(data, stream, -1)
                 stream.flush()
-            os.chmod(tmpfile, 0o664)
+            os.chmod(tmpfile, 0664)
             os.rename(tmpfile, sigfile)
         except (OSError, IOError) as err:
             try:
@@ -300,29 +255,20 @@ class SignatureGeneratorBasic(SignatureGenerator):
                 pass
             raise err
 
-    def dump_sigfn(self, fn, dataCaches, options):
-        if fn in self.taskdeps:
+    def dump_sigs(self, dataCache, options):
+        for fn in self.taskdeps:
             for task in self.taskdeps[fn]:
-                tid = fn + ":" + task
-                (mc, _, _) = bb.runqueue.split_tid(tid)
                 k = fn + "." + task
                 if k not in self.taskhash:
                     continue
-                if dataCaches[mc].basetaskhash[k] != self.basehash[k]:
+                if dataCache.basetaskhash[k] != self.basehash[k]:
                     bb.error("Bitbake's cached basehash does not match the one we just generated (%s)!" % k)
-                    bb.error("The mismatched hashes were %s and %s" % (dataCaches[mc].basetaskhash[k], self.basehash[k]))
-                self.dump_sigtask(fn, task, dataCaches[mc].stamp[fn], True)
+                    bb.error("The mismatched hashes were %s and %s" % (dataCache.basetaskhash[k], self.basehash[k]))
+                self.dump_sigtask(fn, task, dataCache.stamp[fn], True)
 
 class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
     name = "basichash"
 
-    def get_stampfile_hash(self, task):
-        if task in self.taskhash:
-            return self.taskhash[task]
-
-        # If task is not in basehash, then error
-        return self.basehash[task]
-
     def stampfile(self, stampbase, fn, taskname, extrainfo, clean=False):
         if taskname != "do_setscene" and taskname.endswith("_setscene"):
             k = fn + "." + taskname[:-9]
@@ -330,85 +276,30 @@ class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
             k = fn + "." + taskname
         if clean:
             h = "*"
+        elif k in self.taskhash:
+            h = self.taskhash[k]
         else:
-            h = self.get_stampfile_hash(k)
-
+            # If k is not in basehash, then error
+            h = self.basehash[k]
         return ("%s.%s.%s.%s" % (stampbase, taskname, h, extrainfo)).rstrip('.')
 
     def stampcleanmask(self, stampbase, fn, taskname, extrainfo):
         return self.stampfile(stampbase, fn, taskname, extrainfo, clean=True)
-
+        
     def invalidate_task(self, task, d, fn):
         bb.note("Tainting hash to force rebuild of task %s, %s" % (fn, task))
         bb.build.write_taint(task, d, fn)
 
 def dump_this_task(outfile, d):
     import bb.parse
-    fn = d.getVar("BB_FILENAME")
-    task = "do_" + d.getVar("BB_CURRENTTASK")
-    referencestamp = bb.build.stamp_internal(task, d, None, True)
-    bb.parse.siggen.dump_sigtask(fn, task, outfile, "customfile:" + referencestamp)
-
-def init_colors(enable_color):
-    """Initialise colour dict for passing to compare_sigfiles()"""
-    # First set up the colours
-    colors = {'color_title':   '\033[1m',
-              'color_default': '\033[0m',
-              'color_add':     '\033[0;32m',
-              'color_remove':  '\033[0;31m',
-             }
-    # Leave all keys present but clear the values
-    if not enable_color:
-        for k in colors.keys():
-            colors[k] = ''
-    return colors
-
-def worddiff_str(oldstr, newstr, colors=None):
-    if not colors:
-        colors = init_colors(False)
-    diff = simplediff.diff(oldstr.split(' '), newstr.split(' '))
-    ret = []
-    for change, value in diff:
-        value = ' '.join(value)
-        if change == '=':
-            ret.append(value)
-        elif change == '+':
-            item = '{color_add}{{+{value}+}}{color_default}'.format(value=value, **colors)
-            ret.append(item)
-        elif change == '-':
-            item = '{color_remove}[-{value}-]{color_default}'.format(value=value, **colors)
-            ret.append(item)
-    whitespace_note = ''
-    if oldstr != newstr and ' '.join(oldstr.split()) == ' '.join(newstr.split()):
-        whitespace_note = ' (whitespace changed)'
-    return '"%s"%s' % (' '.join(ret), whitespace_note)
-
-def list_inline_diff(oldlist, newlist, colors=None):
-    if not colors:
-        colors = init_colors(False)
-    diff = simplediff.diff(oldlist, newlist)
-    ret = []
-    for change, value in diff:
-        value = ' '.join(value)
-        if change == '=':
-            ret.append("'%s'" % value)
-        elif change == '+':
-            item = '{color_add}+{value}{color_default}'.format(value=value, **colors)
-            ret.append(item)
-        elif change == '-':
-            item = '{color_remove}-{value}{color_default}'.format(value=value, **colors)
-            ret.append(item)
-    return '[%s]' % (', '.join(ret))
+    fn = d.getVar("BB_FILENAME", True)
+    task = "do_" + d.getVar("BB_CURRENTTASK", True)
+    bb.parse.siggen.dump_sigtask(fn, task, outfile, "customfile")
 
 def clean_basepath(a):
-    mc = None
-    if a.startswith("multiconfig:"):
-        _, mc, a = a.split(":", 2)
-    b = a.rsplit("/", 2)[1] + '/' + a.rsplit("/", 2)[2]
+    b = a.rsplit("/", 2)[1] + a.rsplit("/", 2)[2]
     if a.startswith("virtual:"):
         b = b + ":" + a.rsplit(":", 1)[0]
-    if mc:
-        b = b + ":multiconfig:" + mc
     return b
 
 def clean_basepaths(a):
@@ -417,38 +308,13 @@ def clean_basepaths(a):
         b[clean_basepath(x)] = a[x]
     return b
 
-def clean_basepaths_list(a):
-    b = []
-    for x in a:
-        b.append(clean_basepath(x))
-    return b
-
-def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
+def compare_sigfiles(a, b, recursecb = None):
     output = []
 
-    colors = init_colors(color)
-    def color_format(formatstr, **values):
-        """
-        Return colour formatted string.
-        NOTE: call with the format string, not an already formatted string
-        containing values (otherwise you could have trouble with { and }
-        characters)
-        """
-        if not formatstr.endswith('{color_default}'):
-            formatstr += '{color_default}'
-        # In newer python 3 versions you can pass both of these directly,
-        # but we only require 3.4 at the moment
-        formatparams = {}
-        formatparams.update(colors)
-        formatparams.update(values)
-        return formatstr.format(**formatparams)
-
-    with open(a, 'rb') as f:
-        p1 = pickle.Unpickler(f)
-        a_data = p1.load()
-    with open(b, 'rb') as f:
-        p2 = pickle.Unpickler(f)
-        b_data = p2.load()
+    p1 = pickle.Unpickler(open(a, "rb"))
+    a_data = p1.load()
+    p2 = pickle.Unpickler(open(b, "rb"))
+    b_data = p2.load()
 
     def dict_diff(a, b, whitelist=set()):
         sa = set(a.keys())
@@ -496,100 +362,50 @@ def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
         return changed, added, removed
 
     if 'basewhitelist' in a_data and a_data['basewhitelist'] != b_data['basewhitelist']:
-        output.append(color_format("{color_title}basewhitelist changed{color_default} from '%s' to '%s'") % (a_data['basewhitelist'], b_data['basewhitelist']))
+        output.append("basewhitelist changed from '%s' to '%s'" % (a_data['basewhitelist'], b_data['basewhitelist']))
         if a_data['basewhitelist'] and b_data['basewhitelist']:
             output.append("changed items: %s" % a_data['basewhitelist'].symmetric_difference(b_data['basewhitelist']))
 
     if 'taskwhitelist' in a_data and a_data['taskwhitelist'] != b_data['taskwhitelist']:
-        output.append(color_format("{color_title}taskwhitelist changed{color_default} from '%s' to '%s'") % (a_data['taskwhitelist'], b_data['taskwhitelist']))
+        output.append("taskwhitelist changed from '%s' to '%s'" % (a_data['taskwhitelist'], b_data['taskwhitelist']))
         if a_data['taskwhitelist'] and b_data['taskwhitelist']:
             output.append("changed items: %s" % a_data['taskwhitelist'].symmetric_difference(b_data['taskwhitelist']))
 
     if a_data['taskdeps'] != b_data['taskdeps']:
-        output.append(color_format("{color_title}Task dependencies changed{color_default} from:\n%s\nto:\n%s") % (sorted(a_data['taskdeps']), sorted(b_data['taskdeps'])))
+        output.append("Task dependencies changed from:\n%s\nto:\n%s" % (sorted(a_data['taskdeps']), sorted(b_data['taskdeps'])))
 
-    if a_data['basehash'] != b_data['basehash'] and not collapsed:
-        output.append(color_format("{color_title}basehash changed{color_default} from %s to %s") % (a_data['basehash'], b_data['basehash']))
+    if a_data['basehash'] != b_data['basehash']:
+        output.append("basehash changed from %s to %s" % (a_data['basehash'], b_data['basehash']))
 
     changed, added, removed = dict_diff(a_data['gendeps'], b_data['gendeps'], a_data['basewhitelist'] & b_data['basewhitelist'])
     if changed:
         for dep in changed:
-            output.append(color_format("{color_title}List of dependencies for variable %s changed from '{color_default}%s{color_title}' to '{color_default}%s{color_title}'") % (dep, a_data['gendeps'][dep], b_data['gendeps'][dep]))
+            output.append("List of dependencies for variable %s changed from '%s' to '%s'" % (dep, a_data['gendeps'][dep], b_data['gendeps'][dep]))
             if a_data['gendeps'][dep] and b_data['gendeps'][dep]:
                 output.append("changed items: %s" % a_data['gendeps'][dep].symmetric_difference(b_data['gendeps'][dep]))
     if added:
         for dep in added:
-            output.append(color_format("{color_title}Dependency on variable %s was added") % (dep))
+            output.append("Dependency on variable %s was added" % (dep))
     if removed:
         for dep in removed:
-            output.append(color_format("{color_title}Dependency on Variable %s was removed") % (dep))
+            output.append("Dependency on Variable %s was removed" % (dep))
 
 
     changed, added, removed = dict_diff(a_data['varvals'], b_data['varvals'])
     if changed:
         for dep in changed:
-            oldval = a_data['varvals'][dep]
-            newval = b_data['varvals'][dep]
-            if newval and oldval and ('\n' in oldval or '\n' in newval):
-                diff = difflib.unified_diff(oldval.splitlines(), newval.splitlines(), lineterm='')
-                # Cut off the first two lines, since we aren't interested in
-                # the old/new filename (they are blank anyway in this case)
-                difflines = list(diff)[2:]
-                if color:
-                    # Add colour to diff output
-                    for i, line in enumerate(difflines):
-                        if line.startswith('+'):
-                            line = color_format('{color_add}{line}', line=line)
-                            difflines[i] = line
-                        elif line.startswith('-'):
-                            line = color_format('{color_remove}{line}', line=line)
-                            difflines[i] = line
-                output.append(color_format("{color_title}Variable {var} value changed:{color_default}\n{diff}", var=dep, diff='\n'.join(difflines)))
-            elif newval and oldval and (' ' in oldval or ' ' in newval):
-                output.append(color_format("{color_title}Variable {var} value changed:{color_default}\n{diff}", var=dep, diff=worddiff_str(oldval, newval, colors)))
-            else:
-                output.append(color_format("{color_title}Variable {var} value changed from '{color_default}{oldval}{color_title}' to '{color_default}{newval}{color_title}'{color_default}", var=dep, oldval=oldval, newval=newval))
-
-    if not 'file_checksum_values' in a_data:
-         a_data['file_checksum_values'] = {}
-    if not 'file_checksum_values' in b_data:
-         b_data['file_checksum_values'] = {}
+            output.append("Variable %s value changed from '%s' to '%s'" % (dep, a_data['varvals'][dep], b_data['varvals'][dep]))
 
     changed, added, removed = file_checksums_diff(a_data['file_checksum_values'], b_data['file_checksum_values'])
     if changed:
         for f, old, new in changed:
-            output.append(color_format("{color_title}Checksum for file %s changed{color_default} from %s to %s") % (f, old, new))
+            output.append("Checksum for file %s changed from %s to %s" % (f, old, new))
     if added:
         for f in added:
-            output.append(color_format("{color_title}Dependency on checksum of file %s was added") % (f))
+            output.append("Dependency on checksum of file %s was added" % (f))
     if removed:
         for f in removed:
-            output.append(color_format("{color_title}Dependency on checksum of file %s was removed") % (f))
-
-    if not 'runtaskdeps' in a_data:
-         a_data['runtaskdeps'] = {}
-    if not 'runtaskdeps' in b_data:
-         b_data['runtaskdeps'] = {}
-
-    if not collapsed:
-        if len(a_data['runtaskdeps']) != len(b_data['runtaskdeps']):
-            changed = ["Number of task dependencies changed"]
-        else:
-            changed = []
-            for idx, task in enumerate(a_data['runtaskdeps']):
-                a = a_data['runtaskdeps'][idx]
-                b = b_data['runtaskdeps'][idx]
-                if a_data['runtaskhashes'][a] != b_data['runtaskhashes'][b] and not collapsed:
-                    changed.append("%s with hash %s\n changed to\n%s with hash %s" % (clean_basepath(a), a_data['runtaskhashes'][a], clean_basepath(b), b_data['runtaskhashes'][b]))
-
-        if changed:
-            clean_a = clean_basepaths_list(a_data['runtaskdeps'])
-            clean_b = clean_basepaths_list(b_data['runtaskdeps'])
-            if clean_a != clean_b:
-                output.append(color_format("{color_title}runtaskdeps changed:{color_default}\n%s") % list_inline_diff(clean_a, clean_b, colors))
-            else:
-                output.append(color_format("{color_title}runtaskdeps changed:"))
-            output.append("\n".join(changed))
+            output.append("Dependency on checksum of file %s was removed" % (f))
 
 
     if 'runtaskhashes' in a_data and 'runtaskhashes' in b_data:
@@ -605,7 +421,7 @@ def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
                             #output.append("Dependency on task %s was replaced by %s with same hash" % (dep, bdep))
                             bdep_found = True
                 if not bdep_found:
-                    output.append(color_format("{color_title}Dependency on task %s was added{color_default} with hash %s") % (clean_basepath(dep), b[dep]))
+                    output.append("Dependency on task %s was added with hash %s" % (clean_basepath(dep), b[dep]))
         if removed:
             for dep in removed:
                 adep_found = False
@@ -615,70 +431,30 @@ def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
                             #output.append("Dependency on task %s was replaced by %s with same hash" % (adep, dep))
                             adep_found = True
                 if not adep_found:
-                    output.append(color_format("{color_title}Dependency on task %s was removed{color_default} with hash %s") % (clean_basepath(dep), a[dep]))
+                    output.append("Dependency on task %s was removed with hash %s" % (clean_basepath(dep), a[dep]))
         if changed:
             for dep in changed:
-                if not collapsed:
-                    output.append(color_format("{color_title}Hash for dependent task %s changed{color_default} from %s to %s") % (clean_basepath(dep), a[dep], b[dep]))
+                output.append("Hash for dependent task %s changed from %s to %s" % (clean_basepath(dep), a[dep], b[dep]))
                 if callable(recursecb):
+                    # If a dependent hash changed, might as well print the line above and then defer to the changes in 
+                    # that hash since in all likelyhood, they're the same changes this task also saw.
                     recout = recursecb(dep, a[dep], b[dep])
                     if recout:
-                        if collapsed:
-                            output.extend(recout)
-                        else:
-                            # If a dependent hash changed, might as well print the line above and then defer to the changes in
-                            # that hash since in all likelyhood, they're the same changes this task also saw.
-                            output = [output[-1]] + recout
+                        output = [output[-1]] + recout
 
     a_taint = a_data.get('taint', None)
     b_taint = b_data.get('taint', None)
     if a_taint != b_taint:
-        output.append(color_format("{color_title}Taint (by forced/invalidated task) changed{color_default} from %s to %s") % (a_taint, b_taint))
+        output.append("Taint (by forced/invalidated task) changed from %s to %s" % (a_taint, b_taint))
 
     return output
 
 
-def calc_basehash(sigdata):
-    task = sigdata['task']
-    basedata = sigdata['varvals'][task]
-
-    if basedata is None:
-        basedata = ''
-
-    alldeps = sigdata['taskdeps']
-    for dep in alldeps:
-        basedata = basedata + dep
-        val = sigdata['varvals'][dep]
-        if val is not None:
-            basedata = basedata + str(val)
-
-    return hashlib.sha256(basedata.encode("utf-8")).hexdigest()
-
-def calc_taskhash(sigdata):
-    data = sigdata['basehash']
-
-    for dep in sigdata['runtaskdeps']:
-        data = data + sigdata['runtaskhashes'][dep]
-
-    for c in sigdata['file_checksum_values']:
-        if c[1]:
-            data = data + c[1]
-
-    if 'taint' in sigdata:
-        if 'nostamp:' in sigdata['taint']:
-            data = data + sigdata['taint'][8:]
-        else:
-            data = data + sigdata['taint']
-
-    return hashlib.sha256(data.encode("utf-8")).hexdigest()
-
-
 def dump_sigfile(a):
     output = []
 
-    with open(a, 'rb') as f:
-        p1 = pickle.Unpickler(f)
-        a_data = p1.load()
+    p1 = pickle.Unpickler(open(a, "rb"))
+    a_data = p1.load()
 
     output.append("basewhitelist: %s" % (a_data['basewhitelist']))
 
@@ -707,13 +483,4 @@ def dump_sigfile(a):
     if 'taint' in a_data:
         output.append("Tainted (by forced/invalidated task): %s" % a_data['taint'])
 
-    if 'task' in a_data:
-        computed_basehash = calc_basehash(a_data)
-        output.append("Computed base hash is %s and from file %s" % (computed_basehash, a_data['basehash']))
-    else:
-        output.append("Unable to compute base hash")
-
-    computed_taskhash = calc_taskhash(a_data)
-    output.append("Computed task hash is %s" % computed_taskhash)
-
     return output